mirror of
https://github.com/SideStore/SideStore.git
synced 2026-04-05 18:25:41 +02:00
Compare commits
62 Commits
0.5.1
...
connect-de
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
94ee08c718 | ||
|
|
fd7dc94975 | ||
|
|
b78707808d | ||
|
|
d41518581a | ||
|
|
4abbfe6142 | ||
|
|
dae813d80c | ||
|
|
af89b178ad | ||
|
|
8c269207fd | ||
|
|
42ecd38517 | ||
|
|
9f7d4dee49 | ||
|
|
458b8e491e | ||
|
|
495e621e69 | ||
|
|
c986512b5f | ||
|
|
d277754ae5 | ||
|
|
2ef2e2f26b | ||
|
|
23a53034fa | ||
|
|
ce57d72a78 | ||
|
|
502b89d890 | ||
|
|
5f0015fad0 | ||
|
|
c81236957b | ||
|
|
970ab38b27 | ||
|
|
8a5c31b81d | ||
|
|
8508fe79b5 | ||
|
|
3859e98801 | ||
|
|
a759c7be9e | ||
|
|
12fc6cf6e2 | ||
|
|
580db6530e | ||
|
|
9c67c237ee | ||
|
|
357d85a72e | ||
|
|
88ad828ce0 | ||
|
|
a95625a34a | ||
|
|
95e00d81f5 | ||
|
|
c2e386a5c5 | ||
|
|
a76aade4ff | ||
|
|
65c9986103 | ||
|
|
9e2b9b6639 | ||
|
|
cf373634d7 | ||
|
|
b3d5d976b4 | ||
|
|
c3c31995ce | ||
|
|
7e92e17429 | ||
|
|
88ab8fa8d7 | ||
|
|
ebe78932bf | ||
|
|
2e613e6d15 | ||
|
|
35ee92db12 | ||
|
|
04d9f760ad | ||
|
|
4f52743be8 | ||
|
|
32cae7a5b2 | ||
|
|
c2c0e3b790 | ||
|
|
6d36a30787 | ||
|
|
48a86ec6de | ||
|
|
5cff914ff3 | ||
|
|
70ea725ce3 | ||
|
|
78f12e45f9 | ||
|
|
e5061acc20 | ||
|
|
2d7bc51d30 | ||
|
|
9128b67ee8 | ||
|
|
551c004476 | ||
|
|
ed6a8d1379 | ||
|
|
766fb89e0b | ||
|
|
c5b8cb4459 | ||
|
|
0deae92829 | ||
|
|
cc5d2f1813 |
2
.github/CODEOWNERS
vendored
2
.github/CODEOWNERS
vendored
@@ -1 +1 @@
|
||||
* @JoeMatt @lonkelle
|
||||
* @JoeMatt @lonkelle @nythepegasus @Spidy123222 @SternXD
|
||||
|
||||
3
.github/ISSUE_TEMPLATE/bug_report.yml
vendored
3
.github/ISSUE_TEMPLATE/bug_report.yml
vendored
@@ -2,8 +2,7 @@ name: Bug Report
|
||||
description: Report a bug
|
||||
title: "[BUG] "
|
||||
labels: ["bug"]
|
||||
assignees:
|
||||
- naturecodevoid
|
||||
assignees: []
|
||||
body:
|
||||
- type: markdown
|
||||
attributes:
|
||||
|
||||
3
.github/ISSUE_TEMPLATE/feature_request.yml
vendored
3
.github/ISSUE_TEMPLATE/feature_request.yml
vendored
@@ -2,8 +2,7 @@ name: Feature Request
|
||||
description: Suggest a feature
|
||||
title: "[FEATURE REQUEST] "
|
||||
labels: ["enhancement"]
|
||||
assignees:
|
||||
- naturecodevoid
|
||||
assignees: []
|
||||
body:
|
||||
- type: markdown
|
||||
attributes:
|
||||
|
||||
2
.github/workflows/nightly.yml
vendored
2
.github/workflows/nightly.yml
vendored
@@ -2,7 +2,7 @@ name: Nightly SideStore build
|
||||
on:
|
||||
push:
|
||||
branches:
|
||||
- develop
|
||||
- connect-develop
|
||||
|
||||
jobs:
|
||||
build:
|
||||
|
||||
2
.gitmodules
vendored
2
.gitmodules
vendored
@@ -9,7 +9,7 @@
|
||||
url = https://github.com/libimobiledevice/libusbmuxd.git
|
||||
[submodule "Dependencies/libplist"]
|
||||
path = Dependencies/libplist
|
||||
url = https://github.com/libimobiledevice/libplist.git
|
||||
url = https://github.com/SideStore/libplist.git
|
||||
[submodule "Dependencies/MarkdownAttributedString"]
|
||||
path = Dependencies/MarkdownAttributedString
|
||||
url = https://github.com/chockenberry/MarkdownAttributedString.git
|
||||
|
||||
@@ -5,9 +5,9 @@
|
||||
"color-space" : "srgb",
|
||||
"components" : {
|
||||
"alpha" : "1.000",
|
||||
"blue" : "0.518",
|
||||
"green" : "0.502",
|
||||
"red" : "0.004"
|
||||
"blue" : "175",
|
||||
"green" : "4",
|
||||
"red" : "115"
|
||||
}
|
||||
},
|
||||
"idiom" : "universal"
|
||||
@@ -23,9 +23,9 @@
|
||||
"color-space" : "srgb",
|
||||
"components" : {
|
||||
"alpha" : "1.000",
|
||||
"blue" : "0.404",
|
||||
"green" : "0.322",
|
||||
"red" : "0.008"
|
||||
"blue" : "150",
|
||||
"green" : "3",
|
||||
"red" : "99"
|
||||
}
|
||||
},
|
||||
"idiom" : "universal"
|
||||
|
||||
@@ -8,13 +8,39 @@
|
||||
|
||||
/* Begin PBXBuildFile section */
|
||||
03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E314122A05D4C00370A3C /* Bundle+AltStore.swift */; };
|
||||
0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0E1A1F902AE36A9600364CAD /* bytearray.c */; };
|
||||
0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = 0E764E162ADFF5740043DD4E /* AltBackup.ipa */; };
|
||||
0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166472ADFE0D1003015C1 /* out-limd.c */; };
|
||||
0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166522ADFE0D2003015C1 /* out-default.c */; };
|
||||
0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166552ADFE0D2003015C1 /* out-plutil.c */; };
|
||||
0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166562ADFE0D2003015C1 /* oplist.c */; };
|
||||
0EA166682ADFE122003015C1 /* jsmn.h in Headers */ = {isa = PBXBuildFile; fileRef = 0EA166632ADFE122003015C1 /* jsmn.h */; };
|
||||
0EA166692ADFE140003015C1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166452ADFE0D1003015C1 /* Array.cpp */; };
|
||||
0EA1666A2ADFE140003015C1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166492ADFE0D1003015C1 /* String.cpp */; };
|
||||
0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */; };
|
||||
0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166532ADFE0D2003015C1 /* Integer.cpp */; };
|
||||
0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166432ADFE0D1003015C1 /* Data.cpp */; };
|
||||
0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166512ADFE0D2003015C1 /* ptrarray.c */; };
|
||||
0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664F2ADFE0D1003015C1 /* hashtable.c */; };
|
||||
0EA166702ADFE140003015C1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166502ADFE0D2003015C1 /* Node.cpp */; };
|
||||
0EA166712ADFE140003015C1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166582ADFE0D2003015C1 /* Key.cpp */; };
|
||||
0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166462ADFE0D1003015C1 /* Dictionary.cpp */; };
|
||||
0EA166742ADFE140003015C1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166422ADFE0D1003015C1 /* Date.cpp */; };
|
||||
0EA166752ADFE140003015C1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166542ADFE0D2003015C1 /* Real.cpp */; };
|
||||
0EA166762ADFE140003015C1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664A2ADFE0D1003015C1 /* base64.c */; };
|
||||
0EA166772ADFE140003015C1 /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166412ADFE0D1003015C1 /* jplist.c */; };
|
||||
0EA166782ADFE140003015C1 /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166572ADFE0D2003015C1 /* jsmn.c */; };
|
||||
0EA166792ADFE140003015C1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166442ADFE0D1003015C1 /* bplist.c */; };
|
||||
0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664B2ADFE0D1003015C1 /* Uid.cpp */; };
|
||||
0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1665A2ADFE0D2003015C1 /* Structure.cpp */; };
|
||||
0EA1667D2ADFE140003015C1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166592ADFE0D2003015C1 /* xplist.c */; };
|
||||
0EA1667E2ADFE140003015C1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664C2ADFE0D1003015C1 /* time64.c */; };
|
||||
0EA4B9BC2AE4A414009209CE /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA4B9BB2AE4A3F6009209CE /* plist.c */; };
|
||||
19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */ = {isa = PBXBuildFile; fileRef = BF45872B2298D31600BD7491 /* libimobiledevice.a */; };
|
||||
19104DB52909C06D00C49C7B /* EmotionalDamage.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19104DB42909C06D00C49C7B /* EmotionalDamage.swift */; };
|
||||
19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DB22909C06C00C49C7B /* libEmotionalDamage.a */; };
|
||||
191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FAB290A5D92001A3B7C /* libminimuxer.a */; };
|
||||
191E5FDC290AFA5C001A3B7C /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 191E5FDB290AFA5C001A3B7C /* OpenSSL */; };
|
||||
191E607D290B2EA5001A3B7C /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FD0290A651D001A3B7C /* jsmn.c */; };
|
||||
191E607E290B2EA7001A3B7C /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FCF290A651D001A3B7C /* jplist.c */; };
|
||||
1920B04F2924AC8300744F60 /* Settings.bundle in Resources */ = {isa = PBXBuildFile; fileRef = 1920B04E2924AC8300744F60 /* Settings.bundle */; };
|
||||
19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */; };
|
||||
4879A95F2861046500FC1BBD /* AltSign in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A95E2861046500FC1BBD /* AltSign */; };
|
||||
@@ -25,7 +51,6 @@
|
||||
99F87D1829D8E4C900B40039 /* SwiftBridgeCore.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1629D8E4C900B40039 /* SwiftBridgeCore.swift */; };
|
||||
99F87D1929D8E4C900B40039 /* minimuxer.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1729D8E4C900B40039 /* minimuxer.swift */; };
|
||||
B3146ED2284F581E00BBC3FD /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; };
|
||||
B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; settings = {ATTRIBUTES = (CodeSignOnCopy, RemoveHeadersOnCopy, ); }; };
|
||||
B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F894295F7F9B002B1159 /* libfragmentzip.a */; };
|
||||
B33FFBAA295F8F78002259E6 /* preboard.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBA9295F8F78002259E6 /* preboard.c */; };
|
||||
B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBAB295F8F98002259E6 /* companion_proxy.c */; };
|
||||
@@ -74,7 +99,6 @@
|
||||
BF41B808233433C100C593A3 /* LoadingState.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF41B807233433C100C593A3 /* LoadingState.swift */; };
|
||||
BF42345A25101C35006D1EB2 /* WidgetView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF42345825101C1D006D1EB2 /* WidgetView.swift */; };
|
||||
BF44EEF0246B08BA002A52F2 /* BackupController.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEEF246B08BA002A52F2 /* BackupController.swift */; };
|
||||
BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */; };
|
||||
BF44EEFC246B4550002A52F2 /* RemoveAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */; };
|
||||
BF4587F82298D3AB00BD7491 /* service.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4587C82298D3A800BD7491 /* service.h */; };
|
||||
BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587C92298D3A800BD7491 /* diagnostics_relay.c */; };
|
||||
@@ -254,34 +278,6 @@
|
||||
BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = BFD247782284B9A700981D42 /* LaunchScreen.storyboard */; };
|
||||
BFD2478C2284C4C300981D42 /* AppIconImageView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478B2284C4C300981D42 /* AppIconImageView.swift */; };
|
||||
BFD2478F2284C8F900981D42 /* Button.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478E2284C8F900981D42 /* Button.swift */; };
|
||||
BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */; };
|
||||
BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE622A1A9CA000B7ED1 /* base64.c */; };
|
||||
BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE722A1A9CA000B7ED1 /* hashtable.c */; };
|
||||
BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */; };
|
||||
BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */; };
|
||||
BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEA22A1A9CA000B7ED1 /* bplist.c */; };
|
||||
BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEB22A1A9CA000B7ED1 /* String.cpp */; };
|
||||
BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEC22A1A9CA000B7ED1 /* time64.c */; };
|
||||
BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BED22A1A9CA000B7ED1 /* plist.h */; };
|
||||
BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEE22A1A9CA000B7ED1 /* plist.c */; };
|
||||
BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */; };
|
||||
BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF022A1A9CA000B7ED1 /* Date.cpp */; };
|
||||
BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */; };
|
||||
BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */; };
|
||||
BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF322A1A9CA000B7ED1 /* Real.cpp */; };
|
||||
BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF422A1A9CA000B7ED1 /* strbuf.h */; };
|
||||
BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF522A1A9CA000B7ED1 /* bytearray.c */; };
|
||||
BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF622A1A9CA000B7ED1 /* base64.h */; };
|
||||
BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF722A1A9CA000B7ED1 /* Data.cpp */; };
|
||||
BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF822A1A9CB000B7ED1 /* Array.cpp */; };
|
||||
BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF922A1A9CB000B7ED1 /* Node.cpp */; };
|
||||
BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */; };
|
||||
BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */; };
|
||||
BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */; };
|
||||
BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */; };
|
||||
BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */; };
|
||||
BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFF22A1A9CB000B7ED1 /* time64.h */; };
|
||||
BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C0022A1A9CB000B7ED1 /* xplist.c */; };
|
||||
BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1D22A1A9EC000B7ED1 /* node.c */; };
|
||||
BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1E22A1A9EC000B7ED1 /* node_list.c */; };
|
||||
BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1F22A1A9EC000B7ED1 /* cnary.c */; };
|
||||
@@ -336,6 +332,7 @@
|
||||
D57FE84428C7DB7100216002 /* ErrorLogViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */; };
|
||||
D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = D58916FD28C7C55C00E39C8B /* LoggedError.swift */; };
|
||||
D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D593F1932717749A006E82DE /* PatchAppOperation.swift */; };
|
||||
D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */; };
|
||||
D5CA0C4B280E141900469595 /* ManagedPatron.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4A280E141900469595 /* ManagedPatron.swift */; };
|
||||
D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */; };
|
||||
D5DAE0942804B0B80034D8D4 /* ScreenshotProcessor.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5DAE0932804B0B80034D8D4 /* ScreenshotProcessor.swift */; };
|
||||
@@ -482,7 +479,6 @@
|
||||
dstPath = "";
|
||||
dstSubfolderSpec = 10;
|
||||
files = (
|
||||
B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */,
|
||||
BF1614F2250822F100767AEA /* Roxas.framework in Embed Frameworks */,
|
||||
BF66EE862501AE50007EE018 /* AltStoreCore.framework in Embed Frameworks */,
|
||||
);
|
||||
@@ -503,12 +499,45 @@
|
||||
/* End PBXCopyFilesBuildPhase section */
|
||||
|
||||
/* Begin PBXFileReference section */
|
||||
0E1A1F902AE36A9600364CAD /* bytearray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = src/bytearray.c; sourceTree = "<group>"; };
|
||||
0E764E162ADFF5740043DD4E /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; name = AltBackup.ipa; path = AltStore/Resources/AltBackup.ipa; sourceTree = SOURCE_ROOT; };
|
||||
0EA166412ADFE0D1003015C1 /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA166422ADFE0D1003015C1 /* Date.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166432ADFE0D1003015C1 /* Data.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166442ADFE0D1003015C1 /* bplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA166452ADFE0D1003015C1 /* Array.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166462ADFE0D1003015C1 /* Dictionary.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166472ADFE0D1003015C1 /* out-limd.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-limd.c"; path = "Dependencies/libplist/src/out-limd.c"; sourceTree = SOURCE_ROOT; };
|
||||
0EA166492ADFE0D1003015C1 /* String.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA1664A2ADFE0D1003015C1 /* base64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA1664B2ADFE0D1003015C1 /* Uid.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA1664C2ADFE0D1003015C1 /* time64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA1664F2ADFE0D1003015C1 /* hashtable.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA166502ADFE0D2003015C1 /* Node.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166512ADFE0D2003015C1 /* ptrarray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA166522ADFE0D2003015C1 /* out-default.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-default.c"; path = "Dependencies/libplist/src/out-default.c"; sourceTree = SOURCE_ROOT; };
|
||||
0EA166532ADFE0D2003015C1 /* Integer.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166542ADFE0D2003015C1 /* Real.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166552ADFE0D2003015C1 /* out-plutil.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-plutil.c"; path = "Dependencies/libplist/src/out-plutil.c"; sourceTree = SOURCE_ROOT; };
|
||||
0EA166562ADFE0D2003015C1 /* oplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = oplist.c; path = Dependencies/libplist/src/oplist.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA166572ADFE0D2003015C1 /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA166582ADFE0D2003015C1 /* Key.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166592ADFE0D2003015C1 /* xplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA1665A2ADFE0D2003015C1 /* Structure.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA1665F2ADFE122003015C1 /* time64_limits.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166602ADFE122003015C1 /* time64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166612ADFE122003015C1 /* bytearray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166622ADFE122003015C1 /* ptrarray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166632ADFE122003015C1 /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166642ADFE122003015C1 /* plist.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166652ADFE122003015C1 /* hashtable.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166662ADFE122003015C1 /* base64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166672ADFE122003015C1 /* strbuf.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA4B9BB2AE4A3F6009209CE /* plist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
|
||||
19104DB22909C06C00C49C7B /* libEmotionalDamage.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libEmotionalDamage.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
||||
19104DB42909C06D00C49C7B /* EmotionalDamage.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EmotionalDamage.swift; sourceTree = "<group>"; };
|
||||
191E5FAB290A5D92001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
||||
191E5FCF290A651D001A3B7C /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
|
||||
191E5FD0290A651D001A3B7C /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
|
||||
191E5FD1290A651D001A3B7C /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
|
||||
1920B04E2924AC8300744F60 /* Settings.bundle */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.plug-in"; path = Settings.bundle; sourceTree = "<group>"; };
|
||||
19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SelectTeamViewController.swift; sourceTree = "<group>"; };
|
||||
9961EC2D29BE9F2E00AF2C6F /* minimuxer-helpers.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; name = "minimuxer-helpers.swift"; path = "Dependencies/minimuxer/minimuxer-helpers.swift"; sourceTree = SOURCE_ROOT; };
|
||||
@@ -573,7 +602,6 @@
|
||||
BF41B807233433C100C593A3 /* LoadingState.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoadingState.swift; sourceTree = "<group>"; };
|
||||
BF42345825101C1D006D1EB2 /* WidgetView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = WidgetView.swift; sourceTree = "<group>"; };
|
||||
BF44EEEF246B08BA002A52F2 /* BackupController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = BackupController.swift; sourceTree = "<group>"; };
|
||||
BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; path = AltBackup.ipa; sourceTree = "<group>"; };
|
||||
BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RemoveAppOperation.swift; sourceTree = "<group>"; };
|
||||
BF45872B2298D31600BD7491 /* libimobiledevice.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libimobiledevice.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
||||
BF4587C82298D3A800BD7491 /* service.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = service.h; path = Dependencies/libimobiledevice/src/service.h; sourceTree = SOURCE_ROOT; };
|
||||
@@ -759,34 +787,6 @@
|
||||
BFD2479E2284FBD000981D42 /* UIColor+AltStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "UIColor+AltStore.swift"; sourceTree = "<group>"; };
|
||||
BFD44605241188C300EAB90A /* CodableServerError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = CodableServerError.swift; sourceTree = "<group>"; };
|
||||
BFD52BD222A06EFB000B7ED1 /* ALTConstants.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTConstants.h; sourceTree = "<group>"; };
|
||||
BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BE622A1A9CA000B7ED1 /* base64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BE722A1A9CA000B7ED1 /* hashtable.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BEA22A1A9CA000B7ED1 /* bplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BEB22A1A9CA000B7ED1 /* String.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BEC22A1A9CA000B7ED1 /* time64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BED22A1A9CA000B7ED1 /* plist.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BEE22A1A9CA000B7ED1 /* plist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF022A1A9CA000B7ED1 /* Date.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF322A1A9CA000B7ED1 /* Real.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF422A1A9CA000B7ED1 /* strbuf.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF522A1A9CA000B7ED1 /* bytearray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = Dependencies/libplist/src/bytearray.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF622A1A9CA000B7ED1 /* base64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF722A1A9CA000B7ED1 /* Data.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF822A1A9CB000B7ED1 /* Array.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF922A1A9CB000B7ED1 /* Node.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BFF22A1A9CB000B7ED1 /* time64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52C0022A1A9CB000B7ED1 /* xplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52C1D22A1A9EC000B7ED1 /* node.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node.c; path = Dependencies/libplist/libcnary/node.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52C1E22A1A9EC000B7ED1 /* node_list.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node_list.c; path = Dependencies/libplist/libcnary/node_list.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52C1F22A1A9EC000B7ED1 /* cnary.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = cnary.c; path = Dependencies/libplist/libcnary/cnary.c; sourceTree = SOURCE_ROOT; };
|
||||
@@ -840,6 +840,7 @@
|
||||
D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorLogViewController.swift; sourceTree = "<group>"; };
|
||||
D58916FD28C7C55C00E39C8B /* LoggedError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoggedError.swift; sourceTree = "<group>"; };
|
||||
D593F1932717749A006E82DE /* PatchAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchAppOperation.swift; sourceTree = "<group>"; };
|
||||
D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ClearAppCacheOperation.swift; sourceTree = "<group>"; };
|
||||
D5CA0C4A280E141900469595 /* ManagedPatron.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ManagedPatron.swift; sourceTree = "<group>"; };
|
||||
D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 10.xcdatamodel"; sourceTree = "<group>"; };
|
||||
D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcmappingmodel; path = AltStore9ToAltStore10.xcmappingmodel; sourceTree = "<group>"; };
|
||||
@@ -1192,37 +1193,41 @@
|
||||
BF4588562298DC6D00BD7491 /* libplist */ = {
|
||||
isa = PBXGroup;
|
||||
children = (
|
||||
BFD52BE622A1A9CA000B7ED1 /* base64.c */,
|
||||
BFD52BEA22A1A9CA000B7ED1 /* bplist.c */,
|
||||
BFD52BF522A1A9CA000B7ED1 /* bytearray.c */,
|
||||
BFD52BE722A1A9CA000B7ED1 /* hashtable.c */,
|
||||
191E5FCF290A651D001A3B7C /* jplist.c */,
|
||||
191E5FD0290A651D001A3B7C /* jsmn.c */,
|
||||
BFD52BEE22A1A9CA000B7ED1 /* plist.c */,
|
||||
BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */,
|
||||
BFD52BEC22A1A9CA000B7ED1 /* time64.c */,
|
||||
BFD52C0022A1A9CB000B7ED1 /* xplist.c */,
|
||||
BFD52BF822A1A9CB000B7ED1 /* Array.cpp */,
|
||||
BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */,
|
||||
BFD52BF722A1A9CA000B7ED1 /* Data.cpp */,
|
||||
BFD52BF022A1A9CA000B7ED1 /* Date.cpp */,
|
||||
BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */,
|
||||
BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */,
|
||||
BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */,
|
||||
BFD52BF922A1A9CB000B7ED1 /* Node.cpp */,
|
||||
BFD52BF322A1A9CA000B7ED1 /* Real.cpp */,
|
||||
BFD52BEB22A1A9CA000B7ED1 /* String.cpp */,
|
||||
BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */,
|
||||
BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */,
|
||||
BFD52BF622A1A9CA000B7ED1 /* base64.h */,
|
||||
BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */,
|
||||
BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */,
|
||||
191E5FD1290A651D001A3B7C /* jsmn.h */,
|
||||
BFD52BED22A1A9CA000B7ED1 /* plist.h */,
|
||||
BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */,
|
||||
BFD52BF422A1A9CA000B7ED1 /* strbuf.h */,
|
||||
BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */,
|
||||
BFD52BFF22A1A9CB000B7ED1 /* time64.h */,
|
||||
0EA166462ADFE0D1003015C1 /* Dictionary.cpp */,
|
||||
0E1A1F902AE36A9600364CAD /* bytearray.c */,
|
||||
0EA166442ADFE0D1003015C1 /* bplist.c */,
|
||||
0EA166432ADFE0D1003015C1 /* Data.cpp */,
|
||||
0EA166422ADFE0D1003015C1 /* Date.cpp */,
|
||||
0EA1664F2ADFE0D1003015C1 /* hashtable.c */,
|
||||
0EA166532ADFE0D2003015C1 /* Integer.cpp */,
|
||||
0EA166562ADFE0D2003015C1 /* oplist.c */,
|
||||
0EA166522ADFE0D2003015C1 /* out-default.c */,
|
||||
0EA166472ADFE0D1003015C1 /* out-limd.c */,
|
||||
0EA166552ADFE0D2003015C1 /* out-plutil.c */,
|
||||
0EA166492ADFE0D1003015C1 /* String.cpp */,
|
||||
0EA1665A2ADFE0D2003015C1 /* Structure.cpp */,
|
||||
0EA166452ADFE0D1003015C1 /* Array.cpp */,
|
||||
0EA1664A2ADFE0D1003015C1 /* base64.c */,
|
||||
0EA166572ADFE0D2003015C1 /* jsmn.c */,
|
||||
0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */,
|
||||
0EA4B9BB2AE4A3F6009209CE /* plist.c */,
|
||||
0EA166412ADFE0D1003015C1 /* jplist.c */,
|
||||
0EA166582ADFE0D2003015C1 /* Key.cpp */,
|
||||
0EA166512ADFE0D2003015C1 /* ptrarray.c */,
|
||||
0EA1664C2ADFE0D1003015C1 /* time64.c */,
|
||||
0EA166502ADFE0D2003015C1 /* Node.cpp */,
|
||||
0EA166542ADFE0D2003015C1 /* Real.cpp */,
|
||||
0EA1664B2ADFE0D1003015C1 /* Uid.cpp */,
|
||||
0EA166592ADFE0D2003015C1 /* xplist.c */,
|
||||
0EA166662ADFE122003015C1 /* base64.h */,
|
||||
0EA166652ADFE122003015C1 /* hashtable.h */,
|
||||
0EA166632ADFE122003015C1 /* jsmn.h */,
|
||||
0EA166642ADFE122003015C1 /* plist.h */,
|
||||
0EA166612ADFE122003015C1 /* bytearray.h */,
|
||||
0EA166622ADFE122003015C1 /* ptrarray.h */,
|
||||
0EA166672ADFE122003015C1 /* strbuf.h */,
|
||||
0EA1665F2ADFE122003015C1 /* time64_limits.h */,
|
||||
0EA166602ADFE122003015C1 /* time64.h */,
|
||||
BF4588892298DDEA00BD7491 /* libcnary */,
|
||||
);
|
||||
path = libplist;
|
||||
@@ -1619,7 +1624,7 @@
|
||||
BFD247962284D7C100981D42 /* Resources */ = {
|
||||
isa = PBXGroup;
|
||||
children = (
|
||||
BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */,
|
||||
0E764E162ADFF5740043DD4E /* AltBackup.ipa */,
|
||||
BFD247762284B9A700981D42 /* Assets.xcassets */,
|
||||
BF770E6822BD57DD002A40FE /* Silence.m4a */,
|
||||
);
|
||||
@@ -1694,6 +1699,7 @@
|
||||
D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */,
|
||||
D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */,
|
||||
D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */,
|
||||
D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */,
|
||||
BF7B44062725A4B8005288A4 /* Patch App */,
|
||||
);
|
||||
path = Operations;
|
||||
@@ -1780,32 +1786,26 @@
|
||||
isa = PBXHeadersBuildPhase;
|
||||
buildActionMask = 2147483647;
|
||||
files = (
|
||||
0EA166682ADFE122003015C1 /* jsmn.h in Headers */,
|
||||
BF4588112298D3AB00BD7491 /* misagent.h in Headers */,
|
||||
BF4588042298D3AB00BD7491 /* lockdown.h in Headers */,
|
||||
BF45880B2298D3AB00BD7491 /* mobilesync.h in Headers */,
|
||||
BF4588002298D3AB00BD7491 /* restore.h in Headers */,
|
||||
BF4588152298D3AB00BD7491 /* mobilebackup.h in Headers */,
|
||||
BF4588182298D3AB00BD7491 /* syslog_relay.h in Headers */,
|
||||
BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */,
|
||||
BF45881D2298D3AB00BD7491 /* file_relay.h in Headers */,
|
||||
BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */,
|
||||
BF4587FD2298D3AB00BD7491 /* sbservices.h in Headers */,
|
||||
BF4588362298D3C100BD7491 /* debug.h in Headers */,
|
||||
BF4588202298D3AB00BD7491 /* mobile_image_mounter.h in Headers */,
|
||||
BF4588122298D3AB00BD7491 /* house_arrest.h in Headers */,
|
||||
BF45881F2298D3AB00BD7491 /* device_link_service.h in Headers */,
|
||||
BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */,
|
||||
BF45880E2298D3AB00BD7491 /* debugserver.h in Headers */,
|
||||
BF4588102298D3AB00BD7491 /* heartbeat.h in Headers */,
|
||||
BF4587FA2298D3AB00BD7491 /* diagnostics_relay.h in Headers */,
|
||||
BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */,
|
||||
BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */,
|
||||
BF4588192298D3AB00BD7491 /* webinspector.h in Headers */,
|
||||
BF4588342298D3C100BD7491 /* userpref.h in Headers */,
|
||||
BF45880A2298D3AB00BD7491 /* screenshotr.h in Headers */,
|
||||
BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */,
|
||||
BF4587FE2298D3AB00BD7491 /* mobilebackup2.h in Headers */,
|
||||
BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */,
|
||||
BF45881C2298D3AB00BD7491 /* afc.h in Headers */,
|
||||
BF45881A2298D3AB00BD7491 /* mobileactivation.h in Headers */,
|
||||
BF4588052298D3AB00BD7491 /* idevice.h in Headers */,
|
||||
@@ -1813,7 +1813,6 @@
|
||||
BF4587F82298D3AB00BD7491 /* service.h in Headers */,
|
||||
BF4588252298D3AB00BD7491 /* property_list_service.h in Headers */,
|
||||
BF4588132298D3AB00BD7491 /* notification_proxy.h in Headers */,
|
||||
BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */,
|
||||
);
|
||||
runOnlyForDeploymentPostprocessing = 0;
|
||||
};
|
||||
@@ -2209,7 +2208,6 @@
|
||||
BFE60738231ADF49002B0E8E /* Settings.storyboard in Resources */,
|
||||
D57DF638271E32F000677701 /* PatchApp.storyboard in Resources */,
|
||||
BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */,
|
||||
BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */,
|
||||
BF770E6922BD57DD002A40FE /* Silence.m4a in Resources */,
|
||||
BFD247772284B9A700981D42 /* Assets.xcassets in Resources */,
|
||||
1920B04F2924AC8300744F60 /* Settings.bundle in Resources */,
|
||||
@@ -2217,6 +2215,7 @@
|
||||
BFB6B22423187A3D0022A802 /* NewsCollectionViewCell.xib in Resources */,
|
||||
BFD247752284B9A500981D42 /* Main.storyboard in Resources */,
|
||||
BFDB5B2622EFBBEA00F74113 /* BrowseCollectionViewCell.xib in Resources */,
|
||||
0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */,
|
||||
BFE6073C231AE1E7002B0E8E /* SettingsHeaderFooterView.xib in Resources */,
|
||||
BF29012F2318F6B100D88A45 /* AppBannerView.xib in Resources */,
|
||||
BFE6325A22A83BEB00F30809 /* Authentication.storyboard in Resources */,
|
||||
@@ -2292,69 +2291,73 @@
|
||||
isa = PBXSourcesBuildPhase;
|
||||
buildActionMask = 2147483647;
|
||||
files = (
|
||||
0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */,
|
||||
0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */,
|
||||
0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */,
|
||||
0EA166742ADFE140003015C1 /* Date.cpp in Sources */,
|
||||
0EA166712ADFE140003015C1 /* Key.cpp in Sources */,
|
||||
0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */,
|
||||
0EA1666A2ADFE140003015C1 /* String.cpp in Sources */,
|
||||
0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */,
|
||||
0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */,
|
||||
0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */,
|
||||
0EA166702ADFE140003015C1 /* Node.cpp in Sources */,
|
||||
0EA166752ADFE140003015C1 /* Real.cpp in Sources */,
|
||||
0EA166762ADFE140003015C1 /* base64.c in Sources */,
|
||||
0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */,
|
||||
BF45881B2298D3AB00BD7491 /* house_arrest.c in Sources */,
|
||||
BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */,
|
||||
0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */,
|
||||
BF4588232298D3AB00BD7491 /* mobilesync.c in Sources */,
|
||||
BF4588072298D3AB00BD7491 /* afc.c in Sources */,
|
||||
191E607D290B2EA5001A3B7C /* jsmn.c in Sources */,
|
||||
191E607E290B2EA7001A3B7C /* jplist.c in Sources */,
|
||||
BF4588082298D3AB00BD7491 /* mobile_image_mounter.c in Sources */,
|
||||
BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */,
|
||||
BF4588022298D3AB00BD7491 /* file_relay.c in Sources */,
|
||||
BF45880F2298D3AB00BD7491 /* debugserver.c in Sources */,
|
||||
0EA166792ADFE140003015C1 /* bplist.c in Sources */,
|
||||
0EA166772ADFE140003015C1 /* jplist.c in Sources */,
|
||||
BF4588162298D3AB00BD7491 /* restore.c in Sources */,
|
||||
BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */,
|
||||
BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */,
|
||||
BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */,
|
||||
BF4588092298D3AB00BD7491 /* installation_proxy.c in Sources */,
|
||||
0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */,
|
||||
0EA1667E2ADFE140003015C1 /* time64.c in Sources */,
|
||||
BF4587FF2298D3AB00BD7491 /* heartbeat.c in Sources */,
|
||||
BF4588222298D3AB00BD7491 /* mobileactivation.c in Sources */,
|
||||
BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */,
|
||||
BF4588212298D3AB00BD7491 /* idevice.c in Sources */,
|
||||
B343F885295F7C5D002B1159 /* tlv.c in Sources */,
|
||||
BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */,
|
||||
BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */,
|
||||
B343F87D295F7C5D002B1159 /* cbuf.c in Sources */,
|
||||
BF4588062298D3AB00BD7491 /* webinspector.c in Sources */,
|
||||
BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */,
|
||||
B343F883295F7C5D002B1159 /* thread.c in Sources */,
|
||||
BF45880D2298D3AB00BD7491 /* mobilebackup.c in Sources */,
|
||||
BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */,
|
||||
BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */,
|
||||
BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */,
|
||||
BF45883A2298D3C100BD7491 /* debug.c in Sources */,
|
||||
B343F881295F7C5D002B1159 /* termcolors.c in Sources */,
|
||||
0EA1667D2ADFE140003015C1 /* xplist.c in Sources */,
|
||||
B343F87E295F7C5D002B1159 /* collection.c in Sources */,
|
||||
BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */,
|
||||
B33FFBAA295F8F78002259E6 /* preboard.c in Sources */,
|
||||
B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */,
|
||||
BF4587FB2298D3AB00BD7491 /* notification_proxy.c in Sources */,
|
||||
BF4588352298D3C100BD7491 /* userpref.c in Sources */,
|
||||
BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */,
|
||||
0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */,
|
||||
B343F87C295F7C5D002B1159 /* opack.c in Sources */,
|
||||
BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */,
|
||||
BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */,
|
||||
B343F884295F7C5D002B1159 /* utils.c in Sources */,
|
||||
BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */,
|
||||
B343F87F295F7C5D002B1159 /* glue.c in Sources */,
|
||||
BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */,
|
||||
BF4588242298D3AB00BD7491 /* property_list_service.c in Sources */,
|
||||
BF45881E2298D3AB00BD7491 /* misagent.c in Sources */,
|
||||
0EA166692ADFE140003015C1 /* Array.cpp in Sources */,
|
||||
B343F880295F7C5D002B1159 /* socket.c in Sources */,
|
||||
BF4587FC2298D3AB00BD7491 /* sbservices.c in Sources */,
|
||||
BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */,
|
||||
0EA166782ADFE140003015C1 /* jsmn.c in Sources */,
|
||||
BF4588142298D3AB00BD7491 /* device_link_service.c in Sources */,
|
||||
BF4588172298D3AB00BD7491 /* screenshotr.c in Sources */,
|
||||
BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */,
|
||||
BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */,
|
||||
BF4588432298D40000BD7491 /* libusbmuxd.c in Sources */,
|
||||
0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */,
|
||||
0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */,
|
||||
BF4588032298D3AB00BD7491 /* syslog_relay.c in Sources */,
|
||||
BF4588272298D3AB00BD7491 /* service.c in Sources */,
|
||||
BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */,
|
||||
BF4588262298D3AB00BD7491 /* lockdown.c in Sources */,
|
||||
BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */,
|
||||
BF45880C2298D3AB00BD7491 /* mobilebackup2.c in Sources */,
|
||||
BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */,
|
||||
0EA4B9BC2AE4A414009209CE /* plist.c in Sources */,
|
||||
);
|
||||
runOnlyForDeploymentPostprocessing = 0;
|
||||
};
|
||||
@@ -2504,6 +2507,7 @@
|
||||
BFD6B03322DFF20800B86064 /* MyAppsComponents.swift in Sources */,
|
||||
BF41B808233433C100C593A3 /* LoadingState.swift in Sources */,
|
||||
BFF0B69A2322D7D0007A79E1 /* UIScreen+CompactHeight.swift in Sources */,
|
||||
D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */,
|
||||
D5F2F6A92720B7C20081CCF5 /* PatchViewController.swift in Sources */,
|
||||
B39F16132918D7C5002E9404 /* Consts.swift in Sources */,
|
||||
BF8F69C222E659F700049BA1 /* AppContentViewController.swift in Sources */,
|
||||
@@ -3224,6 +3228,7 @@
|
||||
"$(PROJECT_DIR)/Dependencies/libfragmentzip",
|
||||
"$(PROJECT_DIR)/Dependencies/libcurl",
|
||||
);
|
||||
OTHER_LDFLAGS = "";
|
||||
PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
|
||||
PRODUCT_NAME = "$(TARGET_NAME)";
|
||||
PROVISIONING_PROFILE_SPECIFIER = "";
|
||||
@@ -3258,6 +3263,7 @@
|
||||
"$(PROJECT_DIR)/Dependencies/libfragmentzip",
|
||||
"$(PROJECT_DIR)/Dependencies/libcurl",
|
||||
);
|
||||
OTHER_LDFLAGS = "";
|
||||
PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
|
||||
PRODUCT_NAME = "$(TARGET_NAME)";
|
||||
PROVISIONING_PROFILE_SPECIFIER = "";
|
||||
|
||||
@@ -90,14 +90,21 @@ private extension AppIDsViewController
|
||||
cell.bannerView.button.isUserInteractionEnabled = false
|
||||
|
||||
cell.bannerView.buttonLabel.isHidden = false
|
||||
|
||||
|
||||
let currentDate = Date()
|
||||
|
||||
let numberOfDays = expirationDate.numberOfCalendarDays(since: currentDate)
|
||||
let numberOfDaysText = (numberOfDays == 1) ? NSLocalizedString("1 day", comment: "") : String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
|
||||
cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
|
||||
let formatter = DateComponentsFormatter()
|
||||
formatter.unitsStyle = .full
|
||||
formatter.includesApproximationPhrase = false
|
||||
formatter.includesTimeRemainingPhrase = false
|
||||
formatter.allowedUnits = [.minute, .hour, .day]
|
||||
formatter.maximumUnitCount = 1
|
||||
|
||||
attributedAccessibilityLabel.mutableString.append(String(format: NSLocalizedString("Expires in %@.", comment: ""), numberOfDaysText) + " ")
|
||||
cell.bannerView.button.setTitle((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")).uppercased(), for: .normal)
|
||||
|
||||
// formatter.includesTimeRemainingPhrase = true
|
||||
|
||||
// attributedAccessibilityLabel.mutableString.append((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " ")
|
||||
}
|
||||
else
|
||||
{
|
||||
|
||||
@@ -8,6 +8,7 @@
|
||||
|
||||
import UIKit
|
||||
|
||||
import minimuxer
|
||||
import AltStoreCore
|
||||
import Roxas
|
||||
|
||||
@@ -264,7 +265,13 @@ private extension BrowseViewController
|
||||
previousProgress?.cancel()
|
||||
return
|
||||
}
|
||||
|
||||
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
|
||||
_ = AppManager.shared.install(app, presentingViewController: self) { (result) in
|
||||
DispatchQueue.main.async {
|
||||
switch result
|
||||
|
||||
@@ -81,7 +81,7 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
|
||||
} else {
|
||||
// Show an alert explaining the pairing file
|
||||
// Create new Alert
|
||||
let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/install#pairing-process", preferredStyle: .alert)
|
||||
let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/getting-started/#pairing-file", preferredStyle: .alert)
|
||||
|
||||
// Create OK button with action handler
|
||||
let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
|
||||
@@ -155,7 +155,12 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
|
||||
try! FileManager.default.removeItem(at: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)"))
|
||||
displayError("minimuxer failed to start, please restart SideStore. \((error as? LocalizedError)?.failureReason ?? "UNKNOWN ERROR!!!!!! REPORT TO GITHUB ISSUES!")")
|
||||
}
|
||||
start_auto_mounter(documentsDirectory)
|
||||
if #available(iOS 17, *) {
|
||||
// TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
|
||||
}
|
||||
else {
|
||||
start_auto_mounter(documentsDirectory)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -307,6 +307,16 @@ extension AppManager
|
||||
presentingViewController.present(alertController, animated: true, completion: nil)
|
||||
}
|
||||
}
|
||||
|
||||
func clearAppCache(completion: @escaping (Result<Void, Error>) -> Void)
|
||||
{
|
||||
let clearAppCacheOperation = ClearAppCacheOperation()
|
||||
clearAppCacheOperation.resultHandler = { result in
|
||||
completion(result)
|
||||
}
|
||||
|
||||
self.run([clearAppCacheOperation], context: nil)
|
||||
}
|
||||
}
|
||||
|
||||
extension AppManager
|
||||
@@ -754,6 +764,12 @@ extension AppManager
|
||||
let progress = self.refreshProgress[app.bundleIdentifier]
|
||||
return progress
|
||||
}
|
||||
|
||||
func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
|
||||
{
|
||||
let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
|
||||
return isActivelyManaging
|
||||
}
|
||||
}
|
||||
|
||||
extension AppManager
|
||||
@@ -808,12 +824,6 @@ private extension AppManager
|
||||
}
|
||||
}
|
||||
|
||||
func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
|
||||
{
|
||||
let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
|
||||
return isActivelyManaging
|
||||
}
|
||||
|
||||
@discardableResult
|
||||
private func perform(_ operations: [AppOperation], presentingViewController: UIViewController?, group: RefreshGroup) -> RefreshGroup
|
||||
{
|
||||
@@ -948,7 +958,13 @@ private extension AppManager
|
||||
}
|
||||
else
|
||||
{
|
||||
DispatchQueue.main.schedule {
|
||||
UIApplication.shared.isIdleTimerDisabled = UserDefaults.standard.isIdleTimeoutDisableEnabled
|
||||
}
|
||||
performAppOperations()
|
||||
DispatchQueue.main.schedule {
|
||||
UIApplication.shared.isIdleTimerDisabled = false
|
||||
}
|
||||
}
|
||||
|
||||
return group
|
||||
@@ -1027,6 +1043,32 @@ private extension AppManager
|
||||
verifyOperation.addDependency(downloadOperation)
|
||||
|
||||
|
||||
/* Refresh Anisette Data */
|
||||
let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
|
||||
refreshAnisetteDataOperation.resultHandler = { (result) in
|
||||
switch result
|
||||
{
|
||||
case .failure(let error): context.error = error
|
||||
case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
|
||||
}
|
||||
}
|
||||
refreshAnisetteDataOperation.addDependency(verifyOperation)
|
||||
|
||||
|
||||
/* Fetch Provisioning Profiles */
|
||||
let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
|
||||
fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
|
||||
fetchProvisioningProfilesOperation.resultHandler = { (result) in
|
||||
switch result
|
||||
{
|
||||
case .failure(let error): context.error = error
|
||||
case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
|
||||
}
|
||||
}
|
||||
fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
|
||||
progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
|
||||
|
||||
|
||||
/* Deactivate Apps (if necessary) */
|
||||
let deactivateAppsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
|
||||
do
|
||||
@@ -1042,6 +1084,12 @@ private extension AppManager
|
||||
{
|
||||
throw error
|
||||
}
|
||||
|
||||
guard let profiles = context.provisioningProfiles else { throw OperationError.invalidParameters }
|
||||
if !profiles.contains(where: { $1.isFreeProvisioningProfile == true }) {
|
||||
operation.finish()
|
||||
return
|
||||
}
|
||||
|
||||
guard let app = context.app, let presentingViewController = context.authenticatedContext.presentingViewController else { throw OperationError.invalidParameters }
|
||||
|
||||
@@ -1061,7 +1109,7 @@ private extension AppManager
|
||||
operation.finish()
|
||||
}
|
||||
}
|
||||
deactivateAppsOperation.addDependency(verifyOperation)
|
||||
deactivateAppsOperation.addDependency(fetchProvisioningProfilesOperation)
|
||||
|
||||
|
||||
/* Patch App */
|
||||
@@ -1136,32 +1184,6 @@ private extension AppManager
|
||||
patchAppOperation.addDependency(deactivateAppsOperation)
|
||||
|
||||
|
||||
/* Refresh Anisette Data */
|
||||
let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
|
||||
refreshAnisetteDataOperation.resultHandler = { (result) in
|
||||
switch result
|
||||
{
|
||||
case .failure(let error): context.error = error
|
||||
case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
|
||||
}
|
||||
}
|
||||
refreshAnisetteDataOperation.addDependency(patchAppOperation)
|
||||
|
||||
|
||||
/* Fetch Provisioning Profiles */
|
||||
let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
|
||||
fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
|
||||
fetchProvisioningProfilesOperation.resultHandler = { (result) in
|
||||
switch result
|
||||
{
|
||||
case .failure(let error): context.error = error
|
||||
case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
|
||||
}
|
||||
}
|
||||
fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
|
||||
progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
|
||||
|
||||
|
||||
/* Resign */
|
||||
let resignAppOperation = ResignAppOperation(context: context)
|
||||
resignAppOperation.resultHandler = { (result) in
|
||||
@@ -1171,7 +1193,7 @@ private extension AppManager
|
||||
case .success(let resignedApp): context.resignedApp = resignedApp
|
||||
}
|
||||
}
|
||||
resignAppOperation.addDependency(fetchProvisioningProfilesOperation)
|
||||
resignAppOperation.addDependency(patchAppOperation)
|
||||
progress.addChild(resignAppOperation.progress, withPendingUnitCount: 20)
|
||||
|
||||
|
||||
@@ -1214,7 +1236,7 @@ private extension AppManager
|
||||
progress.addChild(installOperation.progress, withPendingUnitCount: 30)
|
||||
installOperation.addDependency(sendAppOperation)
|
||||
|
||||
let operations = [downloadOperation, verifyOperation, deactivateAppsOperation, patchAppOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, resignAppOperation, sendAppOperation, installOperation]
|
||||
let operations = [downloadOperation, verifyOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, deactivateAppsOperation, patchAppOperation, resignAppOperation, sendAppOperation, installOperation]
|
||||
group.add(operations)
|
||||
self.run(operations, context: group.context)
|
||||
|
||||
|
||||
@@ -15,6 +15,7 @@ import UniformTypeIdentifiers
|
||||
import AltStoreCore
|
||||
import AltSign
|
||||
import Roxas
|
||||
import minimuxer
|
||||
|
||||
import Nuke
|
||||
|
||||
@@ -328,21 +329,25 @@ private extension MyAppsViewController
|
||||
let currentDate = Date()
|
||||
|
||||
let numberOfDays = installedApp.expirationDate.numberOfCalendarDays(since: currentDate)
|
||||
let numberOfDaysText: String
|
||||
|
||||
if numberOfDays == 1
|
||||
{
|
||||
numberOfDaysText = NSLocalizedString("1 day", comment: "")
|
||||
}
|
||||
else
|
||||
{
|
||||
numberOfDaysText = String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
|
||||
}
|
||||
let formatter = DateComponentsFormatter()
|
||||
formatter.unitsStyle = .full
|
||||
formatter.includesApproximationPhrase = false
|
||||
formatter.includesTimeRemainingPhrase = false
|
||||
|
||||
formatter.allowedUnits = [.day, .hour, .minute]
|
||||
|
||||
formatter.maximumUnitCount = 1
|
||||
|
||||
|
||||
|
||||
cell.bannerView.button.setTitle(formatter.string(from: currentDate, to: installedApp.expirationDate)?.uppercased(), for: .normal)
|
||||
|
||||
cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
|
||||
cell.bannerView.button.accessibilityLabel = String(format: NSLocalizedString("Refresh %@", comment: ""), installedApp.name)
|
||||
|
||||
cell.bannerView.accessibilityLabel? += ". " + String(format: NSLocalizedString("Expires in %@", comment: ""), numberOfDaysText)
|
||||
|
||||
formatter.includesTimeRemainingPhrase = true
|
||||
|
||||
cell.bannerView.accessibilityLabel? += ". " + (formatter.string(from: currentDate, to: installedApp.expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " "
|
||||
|
||||
// Make sure refresh button is correct size.
|
||||
cell.layoutIfNeeded()
|
||||
@@ -640,6 +645,12 @@ private extension MyAppsViewController
|
||||
|
||||
@IBAction func refreshAllApps(_ sender: UIBarButtonItem)
|
||||
{
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
|
||||
self.isRefreshingAllApps = true
|
||||
self.collectionView.collectionViewLayout.invalidateLayout()
|
||||
|
||||
@@ -702,6 +713,12 @@ private extension MyAppsViewController
|
||||
|
||||
@IBAction func sideloadApp(_ sender: UIBarButtonItem)
|
||||
{
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
|
||||
let supportedTypes = UTType.types(tag: "ipa", tagClass: .filenameExtension, conformingTo: nil)
|
||||
|
||||
let documentPickerViewController = UIDocumentPickerViewController(forOpeningContentTypes: supportedTypes, asCopy: true)
|
||||
@@ -1006,6 +1023,12 @@ private extension MyAppsViewController
|
||||
|
||||
func refresh(_ installedApp: InstalledApp)
|
||||
{
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
|
||||
let previousProgress = AppManager.shared.refreshProgress(for: installedApp)
|
||||
guard previousProgress == nil else {
|
||||
previousProgress?.cancel()
|
||||
@@ -1027,6 +1050,12 @@ private extension MyAppsViewController
|
||||
|
||||
func activate(_ installedApp: InstalledApp)
|
||||
{
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
|
||||
func finish(_ result: Result<InstalledApp, Error>)
|
||||
{
|
||||
do
|
||||
@@ -1103,6 +1132,11 @@ private extension MyAppsViewController
|
||||
func deactivate(_ installedApp: InstalledApp, completionHandler: ((Result<InstalledApp, Error>) -> Void)? = nil)
|
||||
{
|
||||
guard installedApp.isActive else { return }
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
installedApp.isActive = false
|
||||
|
||||
AppManager.shared.deactivate(installedApp, presentingViewController: self) { (result) in
|
||||
@@ -1164,6 +1198,11 @@ private extension MyAppsViewController
|
||||
|
||||
func backup(_ installedApp: InstalledApp)
|
||||
{
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
let title = NSLocalizedString("Start Backup?", comment: "")
|
||||
let message = NSLocalizedString("This will replace any previous backups. Please leave SideStore open until the backup is complete.", comment: "")
|
||||
|
||||
@@ -1203,6 +1242,11 @@ private extension MyAppsViewController
|
||||
|
||||
func restore(_ installedApp: InstalledApp)
|
||||
{
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
let message = String(format: NSLocalizedString("This will replace all data you currently have in %@.", comment: ""), installedApp.name)
|
||||
let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to restore this backup?", comment: ""), message: message, preferredStyle: .actionSheet)
|
||||
alertController.addAction(.cancel)
|
||||
@@ -1306,6 +1350,16 @@ private extension MyAppsViewController
|
||||
@available(iOS 14, *)
|
||||
func enableJIT(for installedApp: InstalledApp)
|
||||
{
|
||||
if #available(iOS 17, *) {
|
||||
let toastView = ToastView(error: OperationError.tooNewError)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
AppManager.shared.enableJIT(for: installedApp) { result in
|
||||
DispatchQueue.main.async {
|
||||
switch result
|
||||
@@ -1313,7 +1367,7 @@ private extension MyAppsViewController
|
||||
case .success: break
|
||||
case .failure(let error):
|
||||
let toastView = ToastView(error: error)
|
||||
toastView.show(in: self)
|
||||
toastView.show(in: self.navigationController?.view ?? self.view, duration: 5)
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1460,7 +1514,7 @@ extension MyAppsViewController
|
||||
let registeredAppIDs = team.appIDs.count
|
||||
|
||||
let maximumAppIDCount = 10
|
||||
let remainingAppIDs = max(maximumAppIDCount - registeredAppIDs, 0)
|
||||
let remainingAppIDs = maximumAppIDCount - registeredAppIDs
|
||||
|
||||
if remainingAppIDs == 1
|
||||
{
|
||||
@@ -1471,7 +1525,7 @@ extension MyAppsViewController
|
||||
footerView.textLabel.text = String(format: NSLocalizedString("%@ App IDs Remaining", comment: ""), NSNumber(value: remainingAppIDs))
|
||||
}
|
||||
|
||||
footerView.textLabel.isHidden = false
|
||||
footerView.textLabel.isHidden = remainingAppIDs < 0
|
||||
|
||||
case .individual, .organization, .unknown: footerView.textLabel.isHidden = true
|
||||
@unknown default: break
|
||||
|
||||
@@ -12,6 +12,7 @@ import Network
|
||||
|
||||
import AltStoreCore
|
||||
import AltSign
|
||||
import minimuxer
|
||||
|
||||
enum AuthenticationError: LocalizedError
|
||||
{
|
||||
@@ -593,7 +594,7 @@ private extension AuthenticationOperation
|
||||
|
||||
func registerCurrentDevice(for team: ALTTeam, session: ALTAppleAPISession, completionHandler: @escaping (Result<ALTDevice, Error>) -> Void)
|
||||
{
|
||||
guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else {
|
||||
guard let udid = fetch_udid()?.toString() else {
|
||||
return completionHandler(.failure(OperationError.unknownUDID))
|
||||
}
|
||||
|
||||
|
||||
@@ -105,8 +105,13 @@ final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<Inst
|
||||
} catch {
|
||||
self.finish(.failure(error))
|
||||
}
|
||||
start_auto_mounter(documentsDirectory)
|
||||
|
||||
if #available(iOS 17, *) {
|
||||
// TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
|
||||
}
|
||||
else {
|
||||
start_auto_mounter(documentsDirectory)
|
||||
}
|
||||
|
||||
self.managedObjectContext.perform {
|
||||
print("Apps to refresh:", self.installedApps.map(\.bundleIdentifier))
|
||||
|
||||
|
||||
@@ -55,9 +55,8 @@ class BackupAppOperation: ResultOperation<Void>
|
||||
let appName = installedApp.name
|
||||
self.appName = appName
|
||||
|
||||
guard let altstoreApp = InstalledApp.fetchAltStore(in: context) else { throw OperationError.appNotFound }
|
||||
let altstoreOpenURL = altstoreApp.openAppURL
|
||||
|
||||
let altstoreOpenURL = URL(string: "sidestore://")!
|
||||
|
||||
var returnURLComponents = URLComponents(url: altstoreOpenURL, resolvingAgainstBaseURL: false)
|
||||
returnURLComponents?.host = "appBackupResponse"
|
||||
guard let returnURL = returnURLComponents?.url else { throw OperationError.openAppFailed(name: appName) }
|
||||
|
||||
208
AltStore/Operations/ClearAppCacheOperation.swift
Normal file
208
AltStore/Operations/ClearAppCacheOperation.swift
Normal file
@@ -0,0 +1,208 @@
|
||||
//
|
||||
// ClearAppCacheOperation.swift
|
||||
// AltStore
|
||||
//
|
||||
// Created by Riley Testut on 9/27/22.
|
||||
// Copyright © 2022 Riley Testut. All rights reserved.
|
||||
//
|
||||
|
||||
import Foundation
|
||||
import AltStoreCore
|
||||
/*
|
||||
struct BatchError: ALTLocalizedError
|
||||
{
|
||||
|
||||
enum Code: Int, ALTErrorCode
|
||||
{
|
||||
typealias Error = BatchError
|
||||
|
||||
case batchError
|
||||
}
|
||||
|
||||
var code: Code = .batchError
|
||||
var underlyingErrors: [Error]
|
||||
|
||||
var errorTitle: String?
|
||||
var errorFailure: String?
|
||||
|
||||
init(errors: [Error])
|
||||
{
|
||||
self.underlyingErrors = errors
|
||||
}
|
||||
|
||||
var errorFailureReason: String {
|
||||
guard !self.underlyingErrors.isEmpty else { return NSLocalizedString("An unknown error occured.", comment: "") }
|
||||
|
||||
let errorMessages = self.underlyingErrors.map { $0.localizedDescription }
|
||||
|
||||
let message = errorMessages.joined(separator: "\n\n")
|
||||
return message
|
||||
}
|
||||
}
|
||||
*/
|
||||
@objc(ClearAppCacheOperation)
|
||||
class ClearAppCacheOperation: ResultOperation<Void>
|
||||
{
|
||||
private let coordinator = NSFileCoordinator()
|
||||
private let coordinatorQueue = OperationQueue()
|
||||
|
||||
override init()
|
||||
{
|
||||
self.coordinatorQueue.name = "AltStore - ClearAppCacheOperation Queue"
|
||||
}
|
||||
|
||||
override func main()
|
||||
{
|
||||
super.main()
|
||||
|
||||
var allErrors = [Error]()
|
||||
|
||||
self.clearTemporaryDirectory { result in
|
||||
switch result
|
||||
{
|
||||
//case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
|
||||
case .failure(let error): allErrors.append(error)
|
||||
case .success: break
|
||||
}
|
||||
|
||||
self.removeUninstalledAppBackupDirectories { result in
|
||||
switch result
|
||||
{
|
||||
//case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
|
||||
case .failure(let error): allErrors.append(error)
|
||||
case .success: break
|
||||
}
|
||||
|
||||
if allErrors.isEmpty
|
||||
{
|
||||
self.finish(.success(()))
|
||||
}
|
||||
else
|
||||
{
|
||||
self.finish(.failure(OperationError.cacheClearError(errors: allErrors.map({ error in
|
||||
return error.localizedDescription
|
||||
}))))
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
private extension ClearAppCacheOperation
|
||||
{
|
||||
func clearTemporaryDirectory(completion: @escaping (Result<Void, Error>) -> Void)
|
||||
{
|
||||
let intent = NSFileAccessIntent.writingIntent(with: FileManager.default.temporaryDirectory, options: [.forDeleting])
|
||||
self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
|
||||
do
|
||||
{
|
||||
if let error
|
||||
{
|
||||
throw error
|
||||
}
|
||||
|
||||
let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
|
||||
includingPropertiesForKeys: [],
|
||||
options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
|
||||
var errors = [Error]()
|
||||
|
||||
for fileURL in fileURLs
|
||||
{
|
||||
do
|
||||
{
|
||||
print("[ALTLog] Removing item from temporary directory:", fileURL.lastPathComponent)
|
||||
try FileManager.default.removeItem(at: fileURL)
|
||||
}
|
||||
catch
|
||||
{
|
||||
print("[ALTLog] Failed to remove \(fileURL.lastPathComponent) from temporary directory.", error)
|
||||
errors.append(error)
|
||||
}
|
||||
}
|
||||
|
||||
if !errors.isEmpty
|
||||
{
|
||||
completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
|
||||
return error.localizedDescription
|
||||
}))))
|
||||
}
|
||||
else
|
||||
{
|
||||
completion(.success(()))
|
||||
}
|
||||
}
|
||||
catch
|
||||
{
|
||||
completion(.failure(error))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func removeUninstalledAppBackupDirectories(completion: @escaping (Result<Void, Error>) -> Void)
|
||||
{
|
||||
guard let backupsDirectory = FileManager.default.appBackupsDirectory else { return completion(.failure(OperationError.missingAppGroup)) }
|
||||
|
||||
DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
|
||||
let installedAppBundleIDs = Set(InstalledApp.all(in: context).map { $0.bundleIdentifier })
|
||||
|
||||
let intent = NSFileAccessIntent.writingIntent(with: backupsDirectory, options: [.forDeleting])
|
||||
self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
|
||||
do
|
||||
{
|
||||
if let error
|
||||
{
|
||||
throw error
|
||||
}
|
||||
|
||||
var isDirectory: ObjCBool = false
|
||||
guard FileManager.default.fileExists(atPath: intent.url.path, isDirectory: &isDirectory), isDirectory.boolValue else {
|
||||
completion(.success(()))
|
||||
return
|
||||
}
|
||||
|
||||
let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
|
||||
includingPropertiesForKeys: [.isDirectoryKey, .nameKey],
|
||||
options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
|
||||
var errors = [Error]()
|
||||
|
||||
|
||||
for backupDirectory in fileURLs
|
||||
{
|
||||
do
|
||||
{
|
||||
let resourceValues = try backupDirectory.resourceValues(forKeys: [.isDirectoryKey, .nameKey])
|
||||
guard let isDirectory = resourceValues.isDirectory, let bundleID = resourceValues.name else { continue }
|
||||
|
||||
if isDirectory && !installedAppBundleIDs.contains(bundleID) && !AppManager.shared.isActivelyManagingApp(withBundleID: bundleID)
|
||||
{
|
||||
print("[ALTLog] Removing backup directory for uninstalled app:", bundleID)
|
||||
try FileManager.default.removeItem(at: backupDirectory)
|
||||
}
|
||||
}
|
||||
catch
|
||||
{
|
||||
print("[ALTLog] Failed to remove app backup directory:", error)
|
||||
errors.append(error)
|
||||
}
|
||||
}
|
||||
|
||||
if !errors.isEmpty
|
||||
{
|
||||
completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
|
||||
return error.localizedDescription
|
||||
}))))
|
||||
}
|
||||
else
|
||||
{
|
||||
completion(.success(()))
|
||||
}
|
||||
}
|
||||
catch
|
||||
{
|
||||
print("[ALTLog] Failed to remove app backup directory:", error)
|
||||
completion(.failure(error))
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -39,21 +39,14 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
|
||||
let allIdentifiers = [installedApp.resignedBundleIdentifier] + appExtensionProfiles
|
||||
|
||||
for profile in allIdentifiers {
|
||||
var attempts = 5
|
||||
while (attempts > 0){
|
||||
print("Remove Provisioning profile attempts left: \(attempts)")
|
||||
do {
|
||||
try remove_provisioning_profile(profile)
|
||||
self.progress.completedUnitCount += 1
|
||||
installedApp.isActive = false
|
||||
self.finish(.success(installedApp))
|
||||
break
|
||||
} catch {
|
||||
attempts -= 1
|
||||
if (attempts <= 0){
|
||||
self.finish(.failure(error))
|
||||
}
|
||||
}
|
||||
do {
|
||||
try remove_provisioning_profile(profile)
|
||||
self.progress.completedUnitCount += 1
|
||||
installedApp.isActive = false
|
||||
self.finish(.success(installedApp))
|
||||
break
|
||||
} catch {
|
||||
self.finish(.failure(error))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -50,7 +50,7 @@ final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
|
||||
do {
|
||||
try debug_app(installedApp.resignedBundleIdentifier)
|
||||
self.finish(.success(()))
|
||||
break
|
||||
retries = 0
|
||||
} catch {
|
||||
retries -= 1
|
||||
if (retries <= 0){
|
||||
|
||||
@@ -262,10 +262,6 @@ extension FetchProvisioningProfilesOperation
|
||||
{
|
||||
throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
|
||||
}
|
||||
else
|
||||
{
|
||||
throw ALTAppleAPIError(.maximumAppIDLimitReached)
|
||||
}
|
||||
}
|
||||
}
|
||||
//App ID name must be ascii. If the name is not ascii, using bundleID instead
|
||||
|
||||
@@ -41,12 +41,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
|
||||
|
||||
guard
|
||||
let certificate = self.context.certificate,
|
||||
let resignedApp = self.context.resignedApp
|
||||
let resignedApp = self.context.resignedApp,
|
||||
let provisioningProfiles = self.context.provisioningProfiles
|
||||
else { return self.finish(.failure(OperationError.invalidParameters)) }
|
||||
|
||||
let backgroundContext = DatabaseManager.shared.persistentContainer.newBackgroundContext()
|
||||
backgroundContext.perform {
|
||||
|
||||
|
||||
/* App */
|
||||
let installedApp: InstalledApp
|
||||
|
||||
@@ -116,8 +118,7 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
|
||||
// Temporary directory and resigned .ipa no longer needed, so delete them now to ensure AltStore doesn't quit before we get the chance to.
|
||||
self.cleanUp()
|
||||
|
||||
var activeProfiles: Set<String>?
|
||||
if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit
|
||||
if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit, provisioningProfiles.contains(where: { $1.isFreeProvisioningProfile == true })
|
||||
{
|
||||
// When installing these new profiles, AltServer will remove all non-active profiles to ensure we remain under limit.
|
||||
|
||||
@@ -142,11 +143,10 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
|
||||
installedApp.isActive = false
|
||||
}
|
||||
}
|
||||
|
||||
activeProfiles = Set(activeApps.flatMap { (installedApp) -> [String] in
|
||||
let appExtensionProfiles = installedApp.appExtensions.map { $0.resignedBundleIdentifier }
|
||||
return [installedApp.resignedBundleIdentifier] + appExtensionProfiles
|
||||
})
|
||||
}
|
||||
else
|
||||
{
|
||||
installedApp.isActive = true
|
||||
}
|
||||
|
||||
var installing = true
|
||||
|
||||
@@ -34,10 +34,14 @@ enum OperationError: LocalizedError
|
||||
case openAppFailed(name: String)
|
||||
case missingAppGroup
|
||||
|
||||
case noWiFi
|
||||
case tooNewError
|
||||
case anisetteV1Error(message: String)
|
||||
case provisioningError(result: String, message: String?)
|
||||
case anisetteV3Error(message: String)
|
||||
|
||||
case cacheClearError(errors: [String])
|
||||
|
||||
var failureReason: String? {
|
||||
switch self {
|
||||
case .unknown: return NSLocalizedString("An unknown error occured.", comment: "")
|
||||
@@ -53,9 +57,12 @@ enum OperationError: LocalizedError
|
||||
case .openAppFailed(let name): return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), name)
|
||||
case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be found.", comment: "")
|
||||
case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs.", comment: "")
|
||||
case .noWiFi: return NSLocalizedString("You do not appear to be connected to WiFi!\nSideStore will never be able to install or refresh applications without WiFi.", comment: "")
|
||||
case .tooNewError: return NSLocalizedString("iOS 17 has changed how JIT is enabled therefore SideStore cannot enable it at this time, sorry for any inconvenience.\nWe will let everyone know once we have a solution!", comment: "")
|
||||
case .anisetteV1Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: ""), message)
|
||||
case .provisioningError(let result, let message): return String(format: NSLocalizedString("An error occurred when provisioning: %@%@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), result, message != nil ? (" (" + message! + ")") : "")
|
||||
case .anisetteV3Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), message)
|
||||
case .cacheClearError(let errors): return String(format: NSLocalizedString("An error occurred while clearing cache: %@", comment: ""), errors.joined(separator: "\n"))
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -41,19 +41,11 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
|
||||
guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
|
||||
|
||||
for p in profiles {
|
||||
var attempts = 5
|
||||
while (attempts > 0){
|
||||
print("Install provisioning profile attempts left: \(attempts)")
|
||||
do {
|
||||
let bytes = p.value.data.toRustByteSlice()
|
||||
try install_provisioning_profile(bytes.forRust())
|
||||
break
|
||||
} catch {
|
||||
attempts -= 1
|
||||
if (attempts <= 0) {
|
||||
self.finish(.failure(MinimuxerError.ProfileInstall))
|
||||
}
|
||||
}
|
||||
do {
|
||||
let bytes = p.value.data.toRustByteSlice()
|
||||
try install_provisioning_profile(bytes.forRust())
|
||||
} catch {
|
||||
self.finish(.failure(MinimuxerError.ProfileInstall))
|
||||
}
|
||||
|
||||
DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
|
||||
|
||||
@@ -11,6 +11,7 @@ import Roxas
|
||||
|
||||
import AltStoreCore
|
||||
import AltSign
|
||||
import minimuxer
|
||||
|
||||
@objc(ResignAppOperation)
|
||||
final class ResignAppOperation: ResultOperation<ALTApplication>
|
||||
@@ -181,7 +182,7 @@ private extension ResignAppOperation
|
||||
|
||||
if app.isAltStoreApp
|
||||
{
|
||||
guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else { throw OperationError.unknownUDID }
|
||||
guard let udid = fetch_udid()?.toString() as? String else { throw OperationError.unknownUDID }
|
||||
guard let pairingFileString = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.devicePairingString) as? String else { throw OperationError.unknownUDID }
|
||||
additionalValues[Bundle.Info.devicePairingString] = pairingFileString
|
||||
additionalValues[Bundle.Info.deviceID] = udid
|
||||
@@ -202,7 +203,7 @@ private extension ResignAppOperation
|
||||
// The embedded certificate + certificate identifier are already in app bundle, no need to update them.
|
||||
}
|
||||
}
|
||||
else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String
|
||||
else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = fetch_udid()?.toString() as? String
|
||||
{
|
||||
// There is an ALTDeviceID entry, so assume the app is using AltKit and replace it with the device's UDID.
|
||||
additionalValues[Bundle.Info.deviceID] = udid
|
||||
|
||||
@@ -45,21 +45,13 @@ final class SendAppOperation: ResultOperation<()>
|
||||
print("AFC App `fileURL`: \(fileURL.absoluteString)")
|
||||
|
||||
if let data = NSData(contentsOf: fileURL) {
|
||||
var attempts = 10
|
||||
while (attempts != 0){
|
||||
print("Send app attempts left: \(attempts)")
|
||||
do {
|
||||
let bytes = Data(data).toRustByteSlice()
|
||||
try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
|
||||
self.progress.completedUnitCount += 1
|
||||
self.finish(.success(()))
|
||||
break
|
||||
} catch {
|
||||
attempts -= 1
|
||||
if (attempts <= 0) {
|
||||
self.finish(.failure(MinimuxerError.RwAfc))
|
||||
}
|
||||
}
|
||||
do {
|
||||
let bytes = Data(data).toRustByteSlice()
|
||||
try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
|
||||
self.progress.completedUnitCount += 1
|
||||
self.finish(.success(()))
|
||||
} catch {
|
||||
self.finish(.failure(MinimuxerError.RwAfc))
|
||||
self.progress.completedUnitCount += 1
|
||||
self.finish(.success(()))
|
||||
}
|
||||
|
||||
Binary file not shown.
@@ -21,7 +21,7 @@
|
||||
<color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
|
||||
<rect key="frame" x="0.0" y="1126" width="375" height="25"/>
|
||||
<rect key="frame" x="0.0" y="1245" width="375" height="25"/>
|
||||
<autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
|
||||
<fontDescription key="fontDescription" type="system" pointSize="17"/>
|
||||
<color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
@@ -236,14 +236,50 @@
|
||||
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="NO"/>
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="GYp-O0-pse" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="444" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="GYp-O0-pse" id="vDG-ZV-xRS">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<subviews>
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Disable Idle Timeout" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PCh-Up-aJJ">
|
||||
<rect key="frame" x="30" y="15.5" width="166" height="20.5"/>
|
||||
<fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
|
||||
<color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<nil key="highlightedColor"/>
|
||||
</label>
|
||||
<switch opaque="NO" contentMode="scaleToFill" horizontalHuggingPriority="750" verticalHuggingPriority="750" contentHorizontalAlignment="center" contentVerticalAlignment="center" on="YES" translatesAutoresizingMaskIntoConstraints="NO" id="iQA-wm-5ag">
|
||||
<rect key="frame" x="296" y="10" width="51" height="31"/>
|
||||
<connections>
|
||||
<action selector="toggleNoIdleTimeoutEnabled:" destination="aMk-Xp-UL8" eventType="valueChanged" id="WSl-Jc-g5J"/>
|
||||
</connections>
|
||||
</switch>
|
||||
</subviews>
|
||||
<constraints>
|
||||
<constraint firstAttribute="trailingMargin" secondItem="iQA-wm-5ag" secondAttribute="trailing" id="MJ1-HF-Dln"/>
|
||||
<constraint firstItem="PCh-Up-aJJ" firstAttribute="leading" secondItem="vDG-ZV-xRS" secondAttribute="leadingMargin" id="Ocu-jn-RAQ"/>
|
||||
<constraint firstItem="iQA-wm-5ag" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="c6W-bN-VAb"/>
|
||||
<constraint firstItem="PCh-Up-aJJ" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="mL6-LB-cjn"/>
|
||||
</constraints>
|
||||
</tableViewCellContentView>
|
||||
<color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
|
||||
<userDefinedRuntimeAttributes>
|
||||
<userDefinedRuntimeAttribute type="number" keyPath="style">
|
||||
<integer key="value" value="2"/>
|
||||
</userDefinedRuntimeAttribute>
|
||||
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="495" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="amC-sE-8O0" id="GEO-2e-E4k">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<subviews>
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Add to Siri…" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="c6K-fI-CVr">
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Allow Siri To Refresh Apps…" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="c6K-fI-CVr">
|
||||
<rect key="frame" x="30" y="15.5" width="100.5" height="20.5"/>
|
||||
<fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
|
||||
<color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
@@ -269,7 +305,7 @@
|
||||
<tableViewSection headerTitle="" id="eHy-qI-w5w">
|
||||
<cells>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="30h-59-88f" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="535" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="586" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="30h-59-88f" id="7qD-DW-Jls">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -309,7 +345,7 @@
|
||||
<tableViewSection headerTitle="" id="J90-vn-u2O">
|
||||
<cells>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="i4T-2q-jF3" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="626" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="677" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="i4T-2q-jF3" id="VTQ-H4-aCM">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -353,28 +389,28 @@
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="oHX-oR-nwJ" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="677" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="728" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="oHX-oR-nwJ" id="hN4-i5-igu">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<subviews>
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
|
||||
<rect key="frame" x="30" y="15.5" width="89" height="20.5"/>
|
||||
<fontDescription key="fontDescription" type="system" pointSize="17"/>
|
||||
<color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<nil key="highlightedColor"/>
|
||||
</label>
|
||||
<stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
|
||||
<stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
|
||||
<rect key="frame" x="198" y="15.5" width="147" height="20.5"/>
|
||||
<subviews>
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
|
||||
<rect key="frame" x="0.0" y="0.0" width="115" height="20.5"/>
|
||||
<fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
|
||||
<color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<nil key="highlightedColor"/>
|
||||
</label>
|
||||
<imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
|
||||
<imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
|
||||
<rect key="frame" x="129" y="0.0" width="18" height="20.5"/>
|
||||
</imageView>
|
||||
</subviews>
|
||||
@@ -397,7 +433,7 @@
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="0MT-ht-Sit" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="728" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="779" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="0MT-ht-Sit" id="OZp-WM-5H7">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -441,7 +477,7 @@
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="O5R-Al-lGj" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="779" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="830" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="O5R-Al-lGj" id="CrG-Mr-xQq">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -481,7 +517,7 @@
|
||||
<tableViewSection headerTitle="" id="OMa-EK-hRI">
|
||||
<cells>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="FMZ-as-Ljo" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="870" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="921" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="FMZ-as-Ljo" id="JzL-Of-A3T">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -514,7 +550,7 @@
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="Qca-pU-sJh" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="921" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="972" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="Qca-pU-sJh" id="QtU-8J-VQN">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -550,7 +586,7 @@
|
||||
</connections>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="rE2-P4-OaE" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="972" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="1023" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="rE2-P4-OaE" id="qIT-rz-ZUb">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -582,12 +618,45 @@
|
||||
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
|
||||
</userDefinedRuntimeAttributes>
|
||||
<connections>
|
||||
<segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="SSW-vL-86I"/>
|
||||
<segue destination="g8a-Rf-zWa" kind="show" id="vFC-Id-Ww6"/>
|
||||
</connections>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="eZ3-BT-q4D" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="1023" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="eZ3-BT-q4D" id="17m-VV-hzf">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<subviews>
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Clear Cache" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="IbH-V1-ce3">
|
||||
<rect key="frame" x="30" y="15.5" width="98.5" height="20.5"/>
|
||||
<fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
|
||||
<color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<nil key="highlightedColor"/>
|
||||
</label>
|
||||
<imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="FZe-BJ-fOm">
|
||||
<rect key="frame" x="327" y="16.5" width="18" height="18"/>
|
||||
</imageView>
|
||||
</subviews>
|
||||
<constraints>
|
||||
<constraint firstItem="FZe-BJ-fOm" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="bGv-Np-5aO"/>
|
||||
<constraint firstAttribute="trailingMargin" secondItem="FZe-BJ-fOm" secondAttribute="trailing" id="ccb-JP-Eqi"/>
|
||||
<constraint firstItem="IbH-V1-ce3" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="iQJ-gN-sRF"/>
|
||||
<constraint firstItem="IbH-V1-ce3" firstAttribute="leading" secondItem="17m-VV-hzf" secondAttribute="leadingMargin" id="m1g-Y6-aT5"/>
|
||||
</constraints>
|
||||
</tableViewCellContentView>
|
||||
<color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
|
||||
<userDefinedRuntimeAttributes>
|
||||
<userDefinedRuntimeAttribute type="number" keyPath="style">
|
||||
<integer key="value" value="2"/>
|
||||
</userDefinedRuntimeAttribute>
|
||||
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="1074" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VNn-u4-cN8" id="4bh-qe-l2N">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
@@ -619,7 +688,7 @@
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="e7s-hL-kv9" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="1074" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="1125" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="e7s-hL-kv9" id="yjL-Mu-HTk">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -652,7 +721,7 @@
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="1125" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="1176" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -689,7 +758,6 @@
|
||||
</sections>
|
||||
<connections>
|
||||
<outlet property="dataSource" destination="aMk-Xp-UL8" id="c6c-fR-8C4"/>
|
||||
<outlet property="delegate" destination="aMk-Xp-UL8" id="moP-1B-lRq"/>
|
||||
</connections>
|
||||
</tableView>
|
||||
<navigationItem key="navigationItem" title="Settings" id="Ddg-UQ-KJ8"/>
|
||||
@@ -698,6 +766,7 @@
|
||||
<outlet property="accountNameLabel" destination="CnN-M1-AYK" id="Ldc-Py-Bix"/>
|
||||
<outlet property="accountTypeLabel" destination="434-MW-Den" id="mNB-QE-4Jg"/>
|
||||
<outlet property="backgroundRefreshSwitch" destination="DPu-zD-Als" id="eiG-Hv-Vko"/>
|
||||
<outlet property="noIdleTimeoutSwitch" destination="iQA-wm-5ag" id="jHC-js-q0Y"/>
|
||||
<outlet property="versionLabel" destination="bUR-rp-Nw2" id="85I-5R-hqz"/>
|
||||
</connections>
|
||||
</tableViewController>
|
||||
|
||||
@@ -30,13 +30,14 @@ extension SettingsViewController
|
||||
fileprivate enum AppRefreshRow: Int, CaseIterable
|
||||
{
|
||||
case backgroundRefresh
|
||||
case noIdleTimeout
|
||||
|
||||
@available(iOS 14, *)
|
||||
case addToSiri
|
||||
|
||||
static var allCases: [AppRefreshRow] {
|
||||
guard #available(iOS 14, *) else { return [.backgroundRefresh] }
|
||||
return [.backgroundRefresh, .addToSiri]
|
||||
guard #available(iOS 14, *) else { return [.backgroundRefresh, .noIdleTimeout] }
|
||||
return [.backgroundRefresh, .noIdleTimeout, .addToSiri]
|
||||
}
|
||||
}
|
||||
|
||||
@@ -53,9 +54,11 @@ extension SettingsViewController
|
||||
case sendFeedback
|
||||
case refreshAttempts
|
||||
case errorLog
|
||||
case clearCache
|
||||
case resetPairingFile
|
||||
case resetAdiPb
|
||||
case advancedSettings
|
||||
|
||||
}
|
||||
}
|
||||
|
||||
@@ -73,6 +76,7 @@ final class SettingsViewController: UITableViewController
|
||||
@IBOutlet private var accountTypeLabel: UILabel!
|
||||
|
||||
@IBOutlet private var backgroundRefreshSwitch: UISwitch!
|
||||
@IBOutlet private var noIdleTimeoutSwitch: UISwitch!
|
||||
|
||||
@IBOutlet private var versionLabel: UILabel!
|
||||
|
||||
@@ -148,6 +152,7 @@ private extension SettingsViewController
|
||||
}
|
||||
|
||||
self.backgroundRefreshSwitch.isOn = UserDefaults.standard.isBackgroundRefreshEnabled
|
||||
self.noIdleTimeoutSwitch.isOn = UserDefaults.standard.isIdleTimeoutDisableEnabled
|
||||
|
||||
if self.isViewLoaded
|
||||
{
|
||||
@@ -199,7 +204,7 @@ private extension SettingsViewController
|
||||
}
|
||||
else
|
||||
{
|
||||
settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Enable Background Refresh to automatically refresh apps in the background when connected to Wi-Fi.", comment: "")
|
||||
settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Enable Background Refresh to automatically refresh apps in the background when connected to Wi-Fi. \n\nDisable the Idle Timeout toggle to allow SideStore to not let your device go to sleep during a refresh or install of any apps.", comment: "")
|
||||
}
|
||||
|
||||
case .instructions:
|
||||
@@ -280,6 +285,11 @@ private extension SettingsViewController
|
||||
UserDefaults.standard.isBackgroundRefreshEnabled = sender.isOn
|
||||
}
|
||||
|
||||
@IBAction func toggleNoIdleTimeoutEnabled(_ sender: UISwitch)
|
||||
{
|
||||
UserDefaults.standard.isIdleTimeoutDisableEnabled = sender.isOn
|
||||
}
|
||||
|
||||
@available(iOS 14, *)
|
||||
@IBAction func addRefreshAppsShortcut()
|
||||
{
|
||||
@@ -291,6 +301,39 @@ private extension SettingsViewController
|
||||
self.present(viewController, animated: true, completion: nil)
|
||||
}
|
||||
|
||||
func clearCache()
|
||||
{
|
||||
let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to clear SideStore's cache?", comment: ""),
|
||||
message: NSLocalizedString("This will remove all temporary files as well as backups for uninstalled apps.", comment: ""),
|
||||
preferredStyle: .actionSheet)
|
||||
alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { [weak self] _ in
|
||||
self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
|
||||
})
|
||||
alertController.addAction(UIAlertAction(title: NSLocalizedString("Clear Cache", comment: ""), style: .destructive) { [weak self] _ in
|
||||
AppManager.shared.clearAppCache { result in
|
||||
DispatchQueue.main.async {
|
||||
self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
|
||||
|
||||
switch result
|
||||
{
|
||||
case .success: break
|
||||
case .failure(let error):
|
||||
let alertController = UIAlertController(title: NSLocalizedString("Unable to Clear Cache", comment: ""), message: error.localizedDescription, preferredStyle: .alert)
|
||||
alertController.addAction(.ok)
|
||||
self?.present(alertController, animated: true)
|
||||
}
|
||||
}
|
||||
}
|
||||
})
|
||||
|
||||
if let popoverController = alertController.popoverPresentationController {
|
||||
popoverController.sourceView = self.view
|
||||
popoverController.sourceRect = CGRect(x: self.view.bounds.midX, y: self.view.bounds.midY, width: 0, height: 0)
|
||||
}
|
||||
|
||||
self.present(alertController, animated: true)
|
||||
}
|
||||
|
||||
@IBAction func handleDebugModeGesture(_ gestureRecognizer: UISwipeGestureRecognizer)
|
||||
{
|
||||
self.debugGestureCounter += 1
|
||||
@@ -377,15 +420,26 @@ extension SettingsViewController
|
||||
{
|
||||
let cell = super.tableView(tableView, cellForRowAt: indexPath)
|
||||
|
||||
if #available(iOS 14, *) {}
|
||||
else if let cell = cell as? InsetGroupTableViewCell,
|
||||
indexPath.section == Section.appRefresh.rawValue,
|
||||
indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
|
||||
// if #available(iOS 14, *) {}
|
||||
// else if let cell = cell as? InsetGroupTableViewCell,
|
||||
// indexPath.section == Section.appRefresh.rawValue,
|
||||
// indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
|
||||
// {
|
||||
// // Only one row is visible pre-iOS 14.
|
||||
// cell.style = .single
|
||||
// }
|
||||
|
||||
if AppRefreshRow.AllCases().count == 1
|
||||
{
|
||||
// Only one row is visible pre-iOS 14.
|
||||
cell.style = .single
|
||||
if let cell = cell as? InsetGroupTableViewCell,
|
||||
indexPath.section == Section.appRefresh.rawValue,
|
||||
indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
|
||||
{
|
||||
cell.style = .single
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
return cell
|
||||
}
|
||||
|
||||
@@ -465,11 +519,13 @@ extension SettingsViewController
|
||||
switch row
|
||||
{
|
||||
case .backgroundRefresh: break
|
||||
case .noIdleTimeout: break
|
||||
case .addToSiri:
|
||||
guard #available(iOS 14, *) else { return }
|
||||
self.addRefreshAppsShortcut()
|
||||
}
|
||||
|
||||
|
||||
case .credits:
|
||||
let row = CreditsRow.allCases[indexPath.row]
|
||||
switch row
|
||||
@@ -507,6 +563,9 @@ extension SettingsViewController
|
||||
let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
|
||||
toastView.show(in: self)
|
||||
}
|
||||
|
||||
case .clearCache: self.clearCache()
|
||||
|
||||
case .resetPairingFile:
|
||||
let filename = "ALTPairingFile.mobiledevicepairing"
|
||||
let fm = FileManager.default
|
||||
@@ -559,6 +618,7 @@ extension SettingsViewController
|
||||
ELOG("UIApplication.openSettingsURLString invalid")
|
||||
}
|
||||
case .refreshAttempts, .errorLog: break
|
||||
|
||||
}
|
||||
|
||||
default: break
|
||||
|
||||
@@ -27,6 +27,7 @@ public extension UserDefaults
|
||||
@NSManaged var preferredServerID: String?
|
||||
|
||||
@NSManaged var isBackgroundRefreshEnabled: Bool
|
||||
@NSManaged var isIdleTimeoutDisableEnabled: Bool
|
||||
@NSManaged var isDebugModeEnabled: Bool
|
||||
@NSManaged var presentedLaunchReminderNotification: Bool
|
||||
|
||||
@@ -72,6 +73,7 @@ public extension UserDefaults
|
||||
|
||||
let defaults = [
|
||||
#keyPath(UserDefaults.isBackgroundRefreshEnabled): true,
|
||||
#keyPath(UserDefaults.isIdleTimeoutDisableEnabled): true,
|
||||
#keyPath(UserDefaults.isLegacyDeactivationSupported): isLegacyDeactivationSupported,
|
||||
#keyPath(UserDefaults.activeAppLimitIncludesExtensions): activeAppLimitIncludesExtensions,
|
||||
#keyPath(UserDefaults.localServerSupportsRefreshing): localServerSupportsRefreshing,
|
||||
|
||||
@@ -20,17 +20,17 @@ public extension Source
|
||||
#if STAGING
|
||||
|
||||
#if ALPHA
|
||||
static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
|
||||
static let altStoreSourceURL = URL(string: "https://connect.sidestore.io/")!
|
||||
#else
|
||||
static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
|
||||
static let altStoreSourceURL = URL(string: "https://connect.sidestore.io/")!
|
||||
#endif
|
||||
|
||||
#else
|
||||
|
||||
#if ALPHA
|
||||
static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
|
||||
static let altStoreSourceURL = URL(string: "https://connect.sidestore.io/")!
|
||||
#else
|
||||
static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
|
||||
static let altStoreSourceURL = URL(string: "https://connect.sidestore.io/")!
|
||||
#endif
|
||||
|
||||
#endif
|
||||
|
||||
@@ -4,8 +4,8 @@
|
||||
<dict>
|
||||
<key>ALTAppGroups</key>
|
||||
<array>
|
||||
<string>group.com.SideStore.SideStore</string>
|
||||
<string>group.$(APP_GROUP_IDENTIFIER)</string>
|
||||
<string>group.com.SideStore.SideStore</string>
|
||||
</array>
|
||||
<key>CFBundleDevelopmentRegion</key>
|
||||
<string>$(DEVELOPMENT_LANGUAGE)</string>
|
||||
|
||||
@@ -1,8 +1,8 @@
|
||||
// Configuration settings file format documentation can be found at:
|
||||
// https://help.apple.com/xcode/#/dev745c5c974
|
||||
|
||||
MARKETING_VERSION = 0.5.1
|
||||
CURRENT_PROJECT_VERSION = 5010
|
||||
MARKETING_VERSION = 0.5.5
|
||||
CURRENT_PROJECT_VERSION = 5050
|
||||
|
||||
// Vars to be overwritten by `CodeSigning.xcconfig` if exists
|
||||
DEVELOPMENT_TEAM = S32Z3HMYVQ
|
||||
|
||||
2
Dependencies/Roxas
vendored
2
Dependencies/Roxas
vendored
Submodule Dependencies/Roxas updated: d07c467b6f...c28b400621
2
Dependencies/libimobiledevice
vendored
2
Dependencies/libimobiledevice
vendored
Submodule Dependencies/libimobiledevice updated: 6fc41f57fc...04c023317f
2
Dependencies/libplist
vendored
2
Dependencies/libplist
vendored
Submodule Dependencies/libplist updated: d45396aad9...258d3c24aa
@@ -56,7 +56,7 @@ public extension Bundle
|
||||
public extension Bundle
|
||||
{
|
||||
static var baseAltStoreAppGroupID = "group." + Bundle.Info.appbundleIdentifier
|
||||
|
||||
|
||||
var appGroups: [String] {
|
||||
return self.infoDictionary?[Bundle.Info.appGroups] as? [String] ?? []
|
||||
}
|
||||
|
||||
@@ -24,10 +24,6 @@
|
||||
"identifier": "com.flyinghead.source",
|
||||
"sourceURL": "https://flyinghead.github.io/flycast-builds/altstore.json"
|
||||
},
|
||||
{
|
||||
"identifier": "com.emuplace.altstore",
|
||||
"sourceURL": "https://emuplace.app/altstore.json"
|
||||
},
|
||||
{
|
||||
"identifier": "dev.crystall1ne.repos.PojavLauncher",
|
||||
"sourceURL": "https://alt.crystall1ne.dev"
|
||||
@@ -46,7 +42,7 @@
|
||||
},
|
||||
{
|
||||
"identifier": "com.litritt.litsource",
|
||||
"sourceURL": "https://apps.litritt.com/"
|
||||
"sourceURL": "https://altstore.ignitedemulator.com/"
|
||||
}
|
||||
]
|
||||
}
|
||||
|
||||
Reference in New Issue
Block a user