feat: add Ampersand to Trusted Sources

Signed-off-by: suprstarrd <business@suprstarrd.com>

.github/maintenance/cache.py

@@ -1,63 +0,0 @@
-import requests
-import sys
-import os
-
-# Your GitHub Personal Access Token
-GITHUB_TOKEN = os.getenv("GITHUB_TOKEN")
-
-# Repository details
-REPO_OWNER = "SideStore"
-REPO_NAME = "SideStore"
-
-
-API_URL = f"https://api.github.com/repos/{REPO_OWNER}/{REPO_NAME}/actions/caches"
-
-# Common headers for GitHub API calls
-HEADERS = {
-    "Accept": "application/vnd.github+json",
-    "Authorization": f"Bearer {GITHUB_TOKEN}"
-}
-
-def list_caches():
-    response = requests.get(API_URL, headers=HEADERS)
-    if response.status_code != 200:
-        print(f"Failed to list caches. HTTP {response.status_code}")
-        print("Response:", response.text)
-        sys.exit(1)
-    data = response.json()
-    return data.get("actions_caches", [])
-
-def delete_cache(cache_id):
-    delete_url = f"{API_URL}/{cache_id}"
-    response = requests.delete(delete_url, headers=HEADERS)
-    return response.status_code
-
-def main():
-    caches = list_caches()
-    if not caches:
-        print("No caches found.")
-        return
-
-    print("Found caches:")
-    for cache in caches:
-        print(f"ID: {cache.get('id')}, Key: {cache.get('key')}")
-    
-    print("\nDeleting caches...")
-    for cache in caches:
-        cache_id = cache.get("id")
-        status = delete_cache(cache_id)
-        if status == 204:
-            print(f"Successfully deleted cache with ID: {cache_id}")
-        else:
-            print(f"Failed to delete cache with ID: {cache_id}. HTTP status code: {status}")
-    
-    print("All caches processed.")
-
-if __name__ == "__main__":
-    main()
-
-
-### How to use
-'''
-just export the GITHUB_TOKEN and then run this script via `python3 cache.py' to delete the caches 
-'''

.github/workflows/alpha.yml

@@ -1,28 +1,220 @@
-name: Alpha SideStore build
+name: Alpha SideStore Build
+
 on:
   push:
-    branches:
-      - develop-alpha
+    branches: [staging]
+  workflow_dispatch:
 
-# cancel duplicate run if from same branch
 concurrency:
   group: ${{ github.ref }}
   cancel-in-progress: true
 
 jobs:
-  Reusable-build:
-    uses: ./.github/workflows/reusable-sidestore-build.yml
-    with:
-      # bundle_id: "com.SideStore.SideStore.Alpha"
-      bundle_id: "com.SideStore.SideStore"
-      # bundle_id_suffix: ".Alpha"
-      is_beta: true
-      publish: ${{ vars.PUBLISH_ALPHA_UPDATES == 'true' }} 
-      is_shared_build_num: false
-      release_tag: "alpha"
-      release_name: "Alpha"
-      upstream_tag: "nightly"
-      upstream_name: "Nightly"
-    secrets:
-      CROSS_REPO_PUSH_KEY: ${{ secrets.CROSS_REPO_PUSH_KEY }}
-      BUILD_LOG_ZIP_PASSWORD: ${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
+  build:
+    runs-on: macos-26
+    env:
+      DEPLOY_KEY: ${{ secrets.CROSS_REPO_PUSH_KEY }}
+      GH_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+      RELEASE_NAME: Alpha
+      CHANNEL: alpha
+      UPSTREAM_CHANNEL: "nightly"
+
+    steps:
+      - uses: actions/checkout@v4
+        with:
+          submodules: recursive
+          fetch-depth: 0
+
+      - name: Find Last Successful commit
+        run: |
+          LAST_SUCCESSFUL_COMMIT=$(python3 scripts/ci/workflow.py last-successful-commit \
+            "false" "${{ env.CHANNEL }}" || echo "")
+          echo "LAST_SUCCESSFUL_COMMIT=$LAST_SUCCESSFUL_COMMIT" | tee -a $GITHUB_ENV
+
+      - run: brew install ldid xcbeautify
+
+      # --------------------------------------------------
+      # runtime env setup
+      # --------------------------------------------------
+      - name: Setup Env
+        run: |
+          BUILD_NUM="${{ github.run_number }}"
+          MARKETING_VERSION=$(python3 scripts/ci/workflow.py get-marketing-version)
+          SHORT_COMMIT=$(python3 scripts/ci/workflow.py commit-id)
+
+          NORMALIZED_VERSION=$(python3 scripts/ci/workflow.py compute-normalized \
+              "$MARKETING_VERSION" \
+              "$BUILD_NUM" \
+              "$SHORT_COMMIT")
+
+          python3 scripts/ci/workflow.py set-marketing-version "$NORMALIZED_VERSION"
+
+          echo "BUILD_NUM=$BUILD_NUM" | tee -a $GITHUB_ENV
+          echo "SHORT_COMMIT=$SHORT_COMMIT" | tee -a $GITHUB_ENV
+          echo "MARKETING_VERSION=$NORMALIZED_VERSION" | tee -a $GITHUB_ENV
+
+      - name: Setup Xcode
+        uses: maxim-lobanov/setup-xcode@v1.6.0
+        with:
+          xcode-version: "26.2"
+
+      - name: Restore Cache (exact)
+        id: xcode-cache-exact
+        uses: actions/cache/restore@v3
+        with:
+          path: |
+            ~/Library/Developer/Xcode/DerivedData
+            ~/Library/Caches/org.swift.swiftpm
+          key: xcode-build-cache-${{ github.ref_name }}-${{ github.sha }}
+
+      - name: Restore Cache (last)
+        if: steps.xcode-cache-exact.outputs.cache-hit != 'true'
+        id: xcode-cache-fallback
+        uses: actions/cache/restore@v3
+        with:
+          path: |
+            ~/Library/Developer/Xcode/DerivedData
+            ~/Library/Caches/org.swift.swiftpm
+          key: xcode-build-cache-${{ github.ref_name }}-
+
+      # --------------------------------------------------
+      # build and test
+      # --------------------------------------------------
+      - name: Clean
+        if: contains(github.event.head_commit.message, '[--clean-build]')
+        run: |
+          python3 scripts/ci/workflow.py clean
+          python3 scripts/ci/workflow.py clean-derived-data
+          python3 scripts/ci/workflow.py clean-spm-cache
+
+      - name: Boot simulator (async)
+        if: >
+          vars.ENABLE_TESTS == '1' &&
+          vars.ENABLE_TESTS_RUN == '1'
+        run: |
+          mkdir -p build/logs
+          python3 scripts/ci/workflow.py boot-sim-async "iPhone 17 Pro"
+
+      - name: Build
+        id: build
+        env:
+          BUILD_LOG_ZIP_PASSWORD: ${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
+        run: |
+          python3 scripts/ci/workflow.py build; STATUS=$?
+          python3 scripts/ci/workflow.py encrypt-build
+          echo "encrypted=true" >> $GITHUB_OUTPUT
+          exit $STATUS
+
+      - name: Tests Build
+        id: test-build
+        if: >
+          vars.ENABLE_TESTS == '1' &&
+          vars.ENABLE_TESTS_BUILD == '1'
+        env:
+          BUILD_LOG_ZIP_PASSWORD: ${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
+        run: |
+          python3 scripts/ci/workflow.py tests-build; STATUS=$?
+          python3 scripts/ci/workflow.py encrypt-tests-build
+          exit $STATUS
+
+      - name: Save Cache
+        if: ${{ steps.xcode-cache-fallback.outputs.cache-hit != 'true' }}
+        uses: actions/cache/save@v3
+        with:
+          path: |
+            ~/Library/Developer/Xcode/DerivedData
+            ~/Library/Caches/org.swift.swiftpm
+          key: xcode-build-cache-${{ github.ref_name }}-${{ github.sha }}
+
+      - name: Tests Run
+        id: test-run
+        if: >
+          vars.ENABLE_TESTS == '1' &&
+          vars.ENABLE_TESTS_RUN == '1'
+        env:
+          BUILD_LOG_ZIP_PASSWORD: ${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
+        run: |
+          python3 scripts/ci/workflow.py tests-run "iPhone 17 Pro"; STATUS=$?
+          python3 scripts/ci/workflow.py encrypt-tests-run
+          exit $STATUS
+
+      # --------------------------------------------------
+      # artifacts
+      # --------------------------------------------------
+      - uses: actions/upload-artifact@v4
+        with:
+          name: build-logs-${{ env.MARKETING_VERSION }}.zip
+          path: build-logs.zip
+
+      - uses: actions/upload-artifact@v4
+        if: >
+          vars.ENABLE_TESTS == '1' &&
+          vars.ENABLE_TESTS_BUILD == '1'
+        with:
+          name: tests-build-logs-${{ env.SHORT_COMMIT }}.zip
+          path: tests-build-logs.zip
+
+      - uses: actions/upload-artifact@v4
+        if: >
+          vars.ENABLE_TESTS == '1' &&
+          vars.ENABLE_TESTS_RUN == '1'
+        with:
+          name: tests-run-logs-${{ env.SHORT_COMMIT }}.zip
+          path: tests-run-logs.zip
+
+      - uses: actions/upload-artifact@v4
+        with:
+          name: SideStore-${{ env.MARKETING_VERSION }}.ipa
+          path: SideStore.ipa
+      - uses: actions/upload-artifact@v4
+        with:
+          name: SideStore-${{ env.MARKETING_VERSION }}-dSYMs.zip
+          path: SideStore.dSYMs.zip
+
+      - uses: actions/checkout@v4
+        if: env.DEPLOY_KEY != ''
+        with:
+          repository: "SideStore/apps-v2.json"
+          ref: "main"
+          token: ${{ secrets.CROSS_REPO_PUSH_KEY }}
+          path: "SideStore/apps-v2.json"
+
+      - name: Generate Metadata
+        run: |
+          python3 scripts/ci/workflow.py dump-project-settings
+          PRODUCT_NAME=$(python3 scripts/ci/workflow.py read-product-name)
+          BUNDLE_ID=$(python3 scripts/ci/workflow.py read-bundle-id)
+          IPA_NAME="$PRODUCT_NAME.ipa"
+
+          python3 scripts/ci/workflow.py generate-metadata \
+            "$CHANNEL" \
+            "$SHORT_COMMIT" \
+            "$MARKETING_VERSION" \
+            "$CHANNEL" \
+            "$BUNDLE_ID" \
+            "$IPA_NAME" \
+            "$LAST_SUCCESSFUL_COMMIT"
+
+      - name: Deploy
+        if: env.DEPLOY_KEY != ''
+        run: |
+          SOURCE_JSON="_includes/source.json"
+
+          python3 scripts/ci/workflow.py deploy \
+            SideStore/apps-v2.json \
+            "$SOURCE_JSON" \
+            "$CHANNEL" \
+            "$MARKETING_VERSION"
+      
+
+      # --------------------------------------------------
+      # upload release to GH
+      # --------------------------------------------------
+      - name: Upload Release
+        run: |
+          python3 scripts/ci/workflow.py upload-release \
+            "$RELEASE_NAME" \
+            "$CHANNEL" \
+            "$GITHUB_SHA" \
+            "$GITHUB_REPOSITORY" \
+            "$UPSTREAM_CHANNEL"

.github/workflows/beta.yml

@@ -1,103 +0,0 @@
-name: Beta SideStore build
-on:
-  push:
-    tags:
-      - '[0-9]+.[0-9]+.[0-9]+-beta.[0-9]+' # example: 1.0.0-beta.1
-
-jobs:
-  build:
-    name: Build and upload SideStore Beta
-    strategy:
-      fail-fast: false
-      matrix:
-        include:
-          - os: 'macos-14'
-            version: '15.4'
-
-    runs-on: ${{ matrix.os }}
-    steps:
-      - name: Checkout code
-        uses: actions/checkout@v4
-        with:
-          submodules: recursive
-
-      - name: Install dependencies
-        run: brew install ldid
-
-      - name: Change version to tag
-        run: sed -e '/MARKETING_VERSION = .*/s/= .*/= ${{ github.ref_name }}/' -i '' Build.xcconfig
-
-      - name: Get version
-        id: version
-        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
-
-      - name: Echo version
-        run: echo "${{ steps.version.outputs.version }}"
-
-      - name: Setup Xcode
-        uses: maxim-lobanov/setup-xcode@v1
-        with:
-          xcode-version: ${{ matrix.version }}
-
-      
-      - name: Cache Build
-        uses: irgaly/xcode-cache@v1
-        with:
-          key: xcode-cache-deriveddata-${{ github.sha }}
-          restore-keys: xcode-cache-deriveddata
-
-      - name: Build SideStore
-        run: make build | xcpretty && exit ${PIPESTATUS[0]}
-
-      - name: Fakesign app
-        run: make fakesign
-
-      - name: Convert to IPA
-        run: make ipa
-
-      - name: Get current date
-        id: date
-        run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
-
-      - name: Get current date in AltStore date form
-        id: date_altstore
-        run: echo "date=$(date -u +'%Y-%m-%d')" >> $GITHUB_OUTPUT
-
-      - name: Upload to new beta release
-        uses: softprops/action-gh-release@v1
-        with:
-          token: ${{ secrets.GITHUB_TOKEN }}
-          name: ${{ steps.version.outputs.version }}
-          tag_name: ${{ github.ref_name }}
-          draft: true
-          prerelease: true
-          files: SideStore.ipa
-          body: |
-            <!-- NOTE: to reset SideSource cache, go to `https://apps.sidestore.io/reset-cache/nightly/<sidesource key>`. This is not included in the GitHub Action since it makes draft releases so they can be edited and have a changelog. -->
-            Beta builds are hand-picked builds from development commits that will allow you to try out new features earlier than normal. However, **they might contain bugs and other issues. Use at your own risk!**
-
-            ## Changelog
-            
-            - TODO
-            
-            ## Build Info
-            
-            Built at (UTC): `${{ steps.date.outputs.date }}`
-            Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
-            Commit SHA: `${{ github.sha }}`
-            Version: `${{ steps.version.outputs.version }}`
-
-      - name: Add version to IPA file name
-        run: mv SideStore.ipa SideStore-${{ steps.version.outputs.version }}.ipa
-
-      - name: Upload SideStore.ipa Artifact
-        uses: actions/upload-artifact@v4
-        with:
-          name: SideStore-${{ steps.version.outputs.version }}.ipa
-          path: SideStore-${{ steps.version.outputs.version }}.ipa
-
-      - name: Upload *.dSYM Artifact
-        uses: actions/upload-artifact@v4
-        with:
-          name: SideStore-${{ steps.version.outputs.version }}-dSYM
-          path: ./*.dSYM/

.github/workflows/increase-beta-build-num.sh

@@ -1,34 +0,0 @@
-#!/usr/bin/env bash
-
-# Ensure we are in root directory
-cd "$(dirname "$0")/../.."
-
-DATE=`date -u +'%Y.%m.%d'`
-BUILD_NUM=1
-
-# Use RELEASE_CHANNEL from the environment variable or default to "beta"
-RELEASE_CHANNEL=${RELEASE_CHANNEL:-"beta"}
-
-write() {
-    sed -e "/MARKETING_VERSION = .*/s/$/-$RELEASE_CHANNEL.$DATE.$BUILD_NUM+$(git rev-parse --short HEAD)/" -i '' Build.xcconfig
-    echo "$DATE,$BUILD_NUM" > build_number.txt
-}
-
-if [ ! -f "build_number.txt" ]; then
-    write
-    exit 0
-fi
-
-LAST_DATE=`cat build_number.txt | perl -n -e '/([^,]*),([^ ]*)$/ && print $1'`
-LAST_BUILD_NUM=`cat build_number.txt | perl -n -e '/([^,]*),([^ ]*)$/ && print $2'`
-
-# if [[ "$DATE" != "$LAST_DATE" ]]; then
-#     write
-# else
-#     BUILD_NUM=`expr $LAST_BUILD_NUM + 1`
-#     write
-# fi
-
-# Build number is always incremental
-BUILD_NUM=`expr $LAST_BUILD_NUM + 1`
-write

.github/workflows/nightly.yml

@@ -1,82 +1,260 @@
 name: Nightly SideStore Build
+
 on:
   push:
-    branches:
-      - develop
+    branches: [develop]
   schedule:
-    - cron: '0 0 * * *' # Runs every night at midnight UTC
-  workflow_dispatch: # Allows manual trigger
+    - cron: "0 0 * * *"
+  workflow_dispatch:
 
-# cancel duplicate run if from same branch
 concurrency:
   group: ${{ github.ref }}
   cancel-in-progress: true
 
 jobs:
-  check-changes:
-    if: github.event_name == 'schedule'
-    runs-on: ubuntu-latest
-    outputs:
-      has_changes: ${{ steps.check.outputs.has_changes }}
+  build:
+    runs-on: macos-26
+    env:
+      DEPLOY_KEY: ${{ secrets.CROSS_REPO_PUSH_KEY }}
+      GH_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+      RELEASE_NAME: Nightly
+      CHANNEL: nightly
+      UPSTREAM_CHANNEL: ""
+
     steps:
-      - name: Checkout repository
-        uses: actions/checkout@v4
+      - uses: actions/checkout@v4
         with:
-          fetch-depth: 0 # Ensure full history
+          submodules: recursive
+          fetch-depth: 0
 
-      - name: Get last successful workflow run
-        id: get_last_success
+      - name: Find Last Successful commit
         run: |
-          LAST_SUCCESS=$(gh run list --workflow "Nightly SideStore Build" --json createdAt,conclusion \
-            --jq '[.[] | select(.conclusion=="success")][0].createdAt' || echo "")
-          echo "Last successful run: $LAST_SUCCESS"
-          echo "last_success=$LAST_SUCCESS" >> $GITHUB_ENV
-        env:
-          GH_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+          LAST_SUCCESSFUL_COMMIT=$(python3 scripts/ci/workflow.py last-successful-commit \
+            "false" "${{ env.CHANNEL }}" || echo "")
+          echo "LAST_SUCCESSFUL_COMMIT=$LAST_SUCCESSFUL_COMMIT" | tee -a $GITHUB_ENV
 
-      - name: Check for new commits since last successful build
-        id: check
+      - name: Check for new changes (on schedule)
+        id: check_changes
+        if: github.event_name == 'schedule'
         run: |
-          if [ -n "$LAST_SUCCESS" ]; then
-            NEW_COMMITS=$(git rev-list --count --since="$LAST_SUCCESS" origin/develop)
-            COMMIT_LOG=$(git log --since="$LAST_SUCCESS" --pretty=format:"%h %s" origin/develop)
-          else
-            NEW_COMMITS=1
-            COMMIT_LOG=$(git log -n 10 --pretty=format:"%h %s" origin/develop) # Show last 10 commits if no history
-          fi
-          
-          echo "Has changes: $NEW_COMMITS"
-          echo "New commits since last successful build:"
-          echo "$COMMIT_LOG"
-          
-          if [ "$NEW_COMMITS" -gt 0 ]; then
-            echo "has_changes=true" >> $GITHUB_OUTPUT
-          else
-            echo "has_changes=false" >> $GITHUB_OUTPUT
-          fi
+          NEW_COMMITS=$(python3 scripts/ci/workflow.py count-new-commits "$LAST_SUCCESSFUL_COMMIT")
+          SHOULD_BUILD=$([ "${NEW_COMMITS:-0}" -ge 1 ] && echo true || echo false)
+          echo "should_build=$SHOULD_BUILD" >> $GITHUB_OUTPUT
+          echo "NEW_COMMITS=$NEW_COMMITS" | tee -a $GITHUB_ENV
+
+      - name: Should Skip Building (on schedule)
+        id: build_gate
+        run: |
+          SHOULD_SKIP=$(
+            { [ "${{ github.event_name }}" = "schedule" ] && \
+              [ "${{ steps.check_changes.outputs.should_build }}" != "true" ]; \
+            } && echo true || echo false
+          )
+          echo "should_skip=$SHOULD_SKIP" >> $GITHUB_OUTPUT
+
+      - run: brew install ldid xcbeautify
+        if: steps.build_gate.outputs.should_skip != 'true'
+
+      # --------------------------------------------------
+      # runtime env setup
+      # --------------------------------------------------
+      - name: Setup Env
+        if: steps.build_gate.outputs.should_skip != 'true'
+        run: |
+          BUILD_NUM="${{ github.run_number }}"
+          MARKETING_VERSION=$(python3 scripts/ci/workflow.py get-marketing-version)
+          SHORT_COMMIT=$(python3 scripts/ci/workflow.py commit-id)
+
+          NORMALIZED_VERSION=$(python3 scripts/ci/workflow.py compute-normalized \
+              "$MARKETING_VERSION" \
+              "$BUILD_NUM" \
+              "$SHORT_COMMIT")
+
+          python3 scripts/ci/workflow.py set-marketing-version "$NORMALIZED_VERSION"
+
+          echo "BUILD_NUM=$BUILD_NUM" | tee -a $GITHUB_ENV
+          echo "SHORT_COMMIT=$SHORT_COMMIT" | tee -a $GITHUB_ENV
+          echo "MARKETING_VERSION=$NORMALIZED_VERSION" | tee -a $GITHUB_ENV
+
+      - name: Setup Xcode
+        if: steps.build_gate.outputs.should_skip != 'true'
+        uses: maxim-lobanov/setup-xcode@v1.6.0
+        with:
+          xcode-version: "26.2"
+
+      - name: Restore Cache (exact)
+        if: steps.build_gate.outputs.should_skip != 'true'
+        id: xcode-cache-exact
+        uses: actions/cache/restore@v3
+        with:
+          path: |
+            ~/Library/Developer/Xcode/DerivedData
+            ~/Library/Caches/org.swift.swiftpm
+          key: xcode-build-cache-${{ github.ref_name }}-${{ github.sha }}
+
+      - name: Restore Cache (last)
+        if: >
+          steps.build_gate.outputs.should_skip != 'true' &&
+          steps.xcode-cache-exact.outputs.cache-hit != 'true'
+        id: xcode-cache-fallback
+        uses: actions/cache/restore@v3
+        with:
+          path: |
+            ~/Library/Developer/Xcode/DerivedData
+            ~/Library/Caches/org.swift.swiftpm
+          key: xcode-build-cache-${{ github.ref_name }}-
+
+      # --------------------------------------------------
+      # build and test
+      # --------------------------------------------------
+      - name: Clean
+        if: steps.build_gate.outputs.should_skip != 'true' && contains(github.event.head_commit.message, '[--clean-build]')
+        run: |
+          python3 scripts/ci/workflow.py clean
+          python3 scripts/ci/workflow.py clean-derived-data
+          python3 scripts/ci/workflow.py clean-spm-cache
+
+      - name: Boot simulator (async)
+        if: >
+          steps.build_gate.outputs.should_skip != 'true' &&
+          vars.ENABLE_TESTS == '1' &&
+          vars.ENABLE_TESTS_RUN == '1'
+        run: |
+          mkdir -p build/logs
+          python3 scripts/ci/workflow.py boot-sim-async "iPhone 17 Pro"
+
+      - name: Build
+        if: steps.build_gate.outputs.should_skip != 'true'
+        id: build
         env:
-          GH_TOKEN: ${{ secrets.GITHUB_TOKEN }}
-          LAST_SUCCESS: ${{ env.last_success }}
+          BUILD_LOG_ZIP_PASSWORD: ${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
+        run: |
+          python3 scripts/ci/workflow.py build; STATUS=$?
+          python3 scripts/ci/workflow.py encrypt-build
+          echo "encrypted=true" >> $GITHUB_OUTPUT
+          exit $STATUS
 
-  Reusable-build:
-    if: |
-      always() &&
-      (github.event_name == 'push' || 
-      (github.event_name == 'schedule' && needs.check-changes.result == 'success' && needs.check-changes.outputs.has_changes == 'true'))
-    needs: check-changes
-    uses: ./.github/workflows/reusable-sidestore-build.yml
-    with:
-      # bundle_id: "com.SideStore.SideStore.Nightly"
-      bundle_id: "com.SideStore.SideStore"
-      # bundle_id_suffix: ".Nightly"
-      is_beta: true
-      publish: ${{ vars.PUBLISH_NIGHTLY_UPDATES == 'true' }} 
-      is_shared_build_num: false
-      release_tag: "nightly"
-      release_name: "Nightly"
-      upstream_tag: "0.5.10"
-      upstream_name: "Stable"
-    secrets:
-      CROSS_REPO_PUSH_KEY: ${{ secrets.CROSS_REPO_PUSH_KEY }}
-      BUILD_LOG_ZIP_PASSWORD: ${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
+      - name: Tests Build
+        if: >
+          steps.build_gate.outputs.should_skip != 'true' &&
+          vars.ENABLE_TESTS == '1' &&
+          vars.ENABLE_TESTS_BUILD == '1'
+        id: test-build
+        env:
+          BUILD_LOG_ZIP_PASSWORD: ${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
+        run: |
+          python3 scripts/ci/workflow.py tests-build; STATUS=$?
+          python3 scripts/ci/workflow.py encrypt-tests-build
+          exit $STATUS
 
+      - name: Save Cache
+        if: >
+          steps.build_gate.outputs.should_skip != 'true' &&
+          steps.xcode-cache-fallback.outputs.cache-hit != 'true'
+        uses: actions/cache/save@v3
+        with:
+          path: |
+            ~/Library/Developer/Xcode/DerivedData
+            ~/Library/Caches/org.swift.swiftpm
+          key: xcode-build-cache-${{ github.ref_name }}-${{ github.sha }}
+
+      - name: Tests Run
+        if: >
+          steps.build_gate.outputs.should_skip != 'true' &&
+          vars.ENABLE_TESTS == '1' &&
+          vars.ENABLE_TESTS_RUN == '1'
+        id: test-run
+        env:
+          BUILD_LOG_ZIP_PASSWORD: ${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
+        run: |
+          python3 scripts/ci/workflow.py tests-run "iPhone 17 Pro"; STATUS=$?
+          python3 scripts/ci/workflow.py encrypt-tests-run
+          exit $STATUS
+
+      # --------------------------------------------------
+      # artifacts
+      # --------------------------------------------------
+      - uses: actions/upload-artifact@v4
+        if: steps.build_gate.outputs.should_skip != 'true'
+        with:
+          name: build-logs-${{ env.MARKETING_VERSION }}.zip
+          path: build-logs.zip
+
+      - uses: actions/upload-artifact@v4
+        if: >
+          steps.build_gate.outputs.should_skip != 'true' &&
+          vars.ENABLE_TESTS == '1' &&
+          vars.ENABLE_TESTS_BUILD == '1'
+        with:
+          name: tests-build-logs-${{ env.SHORT_COMMIT }}.zip
+          path: tests-build-logs.zip
+
+      - uses: actions/upload-artifact@v4
+        if: >
+          steps.build_gate.outputs.should_skip != 'true' &&
+          vars.ENABLE_TESTS == '1' &&
+          vars.ENABLE_TESTS_RUN == '1'
+        with:
+          name: tests-run-logs-${{ env.SHORT_COMMIT }}.zip
+          path: tests-run-logs.zip
+
+      - uses: actions/upload-artifact@v4
+        if: steps.build_gate.outputs.should_skip != 'true'
+        with:
+          name: SideStore-${{ env.MARKETING_VERSION }}.ipa
+          path: SideStore.ipa
+      - uses: actions/upload-artifact@v4
+        if: steps.build_gate.outputs.should_skip != 'true'
+        with:
+          name: SideStore-${{ env.MARKETING_VERSION }}-dSYMs.zip
+          path: SideStore.dSYMs.zip
+
+      - uses: actions/checkout@v4
+        if: steps.build_gate.outputs.should_skip != 'true' && env.DEPLOY_KEY != ''
+        with:
+          repository: "SideStore/apps-v2.json"
+          ref: "main"
+          token: ${{ secrets.CROSS_REPO_PUSH_KEY }}
+          path: "SideStore/apps-v2.json"
+
+      - name: Generate Metadata
+        if: steps.build_gate.outputs.should_skip != 'true'
+        run: |
+          python3 scripts/ci/workflow.py dump-project-settings
+          PRODUCT_NAME=$(python3 scripts/ci/workflow.py read-product-name)
+          BUNDLE_ID=$(python3 scripts/ci/workflow.py read-bundle-id)
+          IPA_NAME="$PRODUCT_NAME.ipa"
+
+          python3 scripts/ci/workflow.py generate-metadata \
+            "$CHANNEL" \
+            "$SHORT_COMMIT" \
+            "$MARKETING_VERSION" \
+            "$CHANNEL" \
+            "$BUNDLE_ID" \
+            "$IPA_NAME" \
+            "$LAST_SUCCESSFUL_COMMIT"
+
+      - name: Deploy
+        if: steps.build_gate.outputs.should_skip != 'true' && env.DEPLOY_KEY != ''
+        run: |
+          SOURCE_JSON="_includes/source.json"
+
+          python3 scripts/ci/workflow.py deploy \
+            SideStore/apps-v2.json \
+            "$SOURCE_JSON" \
+            "$CHANNEL" \
+            "$MARKETING_VERSION"
+      
+
+      # --------------------------------------------------
+      # upload release to GH
+      # --------------------------------------------------
+      - name: Upload Release
+        if: steps.build_gate.outputs.should_skip != 'true'
+        run: |
+          python3 scripts/ci/workflow.py upload-release \
+            "$RELEASE_NAME" \
+            "$CHANNEL" \
+            "$GITHUB_SHA" \
+            "$GITHUB_REPOSITORY" \
+            "$UPSTREAM_CHANNEL"

.github/workflows/pr.yml

@@ -1,98 +1,90 @@
 name: Pull Request SideStore build
+
 on:
   pull_request:
     # types: [opened, synchronize, reopened, ready_for_review, converted_to_draft]
     types: [opened, synchronize, reopened, ready_for_review]
 
+concurrency:
+  group: pr-${{ github.event.pull_request.number }}
+  cancel-in-progress: true
+
 jobs:
   build:
     name: Build and upload SideStore
     if: ${{ github.event.pull_request.draft == false }}
-    strategy:
-      fail-fast: false
-      matrix:
-        include:
-          - os: 'macos-14'
-            version: '16.1'
+    runs-on: macos-26
 
-    runs-on: ${{ matrix.os }}
     steps:
-      - name: Checkout code
-        uses: actions/checkout@v4
+      - uses: actions/checkout@v4
         with:
           submodules: recursive
+          fetch-depth: 1    # shallow clone just for PR
 
-      - name: Install dependencies
-        run: brew install ldid
+      - run: brew install ldid xcbeautify
 
-      - name: Install xcbeautify
-        run: brew install xcbeautify
-
-      - name: Add PR suffix to version
-        run: sed -e "/MARKETING_VERSION = .*/s/\$/-pr.${{ github.event.pull_request.number }}+$(git rev-parse --short ${COMMIT:-HEAD})/" -i '' Build.xcconfig
-        env:
-          COMMIT: ${{ github.event.pull_request.head.sha }}
-
-      - name: Get version
-        id: version
-        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
-
-      - name: Echo version
-        run: echo "${{ steps.version.outputs.version }}"
+      - name: Setup Env
+        run: |
+          MARKETING_VERSION=$(python3 scripts/ci/workflow.py get-marketing-version)
+          SHORT_COMMIT=$(git rev-parse --short ${{ github.event.pull_request.head.sha }})
+          NORMALIZED_VERSION="${MARKETING_VERSION}-pr.${{ github.event.pull_request.number }}+${SHORT_COMMIT}"
+          python3 scripts/ci/workflow.py set-marketing-version "$NORMALIZED_VERSION"
+          echo "SHORT_COMMIT=$SHORT_COMMIT" | tee -a $GITHUB_ENV
+          echo "MARKETING_VERSION=$NORMALIZED_VERSION" | tee -a $GITHUB_ENV
 
       - name: Setup Xcode
         uses: maxim-lobanov/setup-xcode@v1.6.0
         with:
-          xcode-version: ${{ matrix.version }}
+          xcode-version: "26.2"
 
-      - name: Cache Build
-        uses: irgaly/xcode-cache@v1
+      - name: Restore Cache (exact)
+        id: xcode-cache-exact
+        uses: actions/cache/restore@v3
         with:
-          key: xcode-cache-deriveddata-${{ github.sha }}
-          restore-keys: xcode-cache-deriveddata-
-          swiftpm-cache-key: xcode-cache-sourcedata-${{ github.sha }}
-          swiftpm-cache-restore-keys: |
-            xcode-cache-sourcedata-
+          path: |
+            ~/Library/Developer/Xcode/DerivedData
+            ~/Library/Caches/org.swift.swiftpm
+          key: xcode-build-cache-${{ github.ref_name }}-${{ github.sha }}
 
-      - name: List Files and derived data
+      - name: Restore Cache (last)
+        if: steps.xcode-cache-exact.outputs.cache-hit != 'true'
+        id: xcode-cache-fallback
+        uses: actions/cache/restore@v3
+        with:
+          path: |
+            ~/Library/Developer/Xcode/DerivedData
+            ~/Library/Caches/org.swift.swiftpm
+          key: xcode-build-cache-${{ github.ref_name }}-
+
+      - name: Build
+        env:
+          BUILD_LOG_ZIP_PASSWORD: ${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
         run: |
-          echo ">>>>>>>>> Workdir <<<<<<<<<<"
-          ls -la .
-          echo ""
-          
-          echo ">>>>>>>>> SideStore <<<<<<<<<<"
-          find SideStore -maxdepth 2 -exec ls -ld {} +  || true  # List contents if directory exists    
-          echo ""
-          
-          echo ">>>>>>>>> Dependencies <<<<<<<<<<"
-          find Dependencies -maxdepth 2 -exec ls -ld {} +  || true  # List contents if directory exists    
-          echo ""
-          
-          echo ">>>>>>>>> Xcode-Derived-Data <<<<<<<<<<"
-          ls -la ~/Library/Developer/Xcode/DerivedData || true  # List contents if directory exists    
-          echo ""
+          python3 scripts/ci/workflow.py build; STATUS=$?
+          python3 scripts/ci/workflow.py encrypt-build
+          mv SideStore.ipa SideStore-${{ env.MARKETING_VERSION }}.ipa
+          exit $STATUS
 
-        
-      - name: Build SideStore
-        run: NSUnbufferedIO=YES make build 2>&1 | xcbeautify --renderer github-actions && exit ${PIPESTATUS[0]}
-
-      - name: Fakesign app
-        run: make fakesign
-
-      - name: Convert to IPA
-        run: make ipa
-
-      - name: Add version to IPA file name
-        run: mv SideStore.ipa SideStore-${{ steps.version.outputs.version }}.ipa
-
-      - name: Upload SideStore.ipa Artifact
-        uses: actions/upload-artifact@v4
+      - name: Save Cache
+        if: ${{ steps.xcode-cache-fallback.outputs.cache-hit != 'true' }}
+        uses: actions/cache/save@v3
         with:
-          name: SideStore-${{ steps.version.outputs.version }}.ipa
-          path: SideStore-${{ steps.version.outputs.version }}.ipa
+          path: |
+            ~/Library/Developer/Xcode/DerivedData
+            ~/Library/Caches/org.swift.swiftpm
+          key: xcode-build-cache-${{ github.ref_name }}-${{ github.sha }}
 
-      - name: Upload *.dSYM Artifact
-        uses: actions/upload-artifact@v4
+      - uses: actions/upload-artifact@v4
         with:
-          name: SideStore-${{ steps.version.outputs.version }}-dSYM
-          path: ./SideStore.xcarchive/dSYMs/*
+          name: build-logs-${{ env.MARKETING_VERSION }}.zip
+          path: build-logs.zip
+
+      - uses: actions/upload-artifact@v4
+        with:
+          name: SideStore-${{ env.MARKETING_VERSION }}.ipa
+          path: SideStore-${{ env.MARKETING_VERSION }}.ipa
+
+      - uses: actions/upload-artifact@v4
+        with:
+          name: SideStore-${{ env.MARKETING_VERSION }}-dSYMs.zip
+          path: SideStore.dSYMs.zip

.github/workflows/reusable-sidestore-build.yml

@@ -1,105 +0,0 @@
-name: Reusable SideStore Build
-
-on:
-  workflow_call:
-    inputs:
-      is_beta:
-        required: false
-        default: false
-        type: boolean
-      publish:
-        required: false
-        default: false
-        type: boolean
-      is_shared_build_num:
-        required: false
-        default: true
-        type: boolean
-      release_name:
-        required: true
-        type: string
-      release_tag:
-        required: true
-        type: string
-      upstream_tag:
-        required: true
-        type: string
-      upstream_name:
-        required: true
-        type: string
-      bundle_id:
-        default: com.SideStore.SideStore
-        required: true
-        type: string
-      bundle_id_suffix:
-        default: ''
-        required: false
-        type: string
-
-    secrets:
-    #   GITHUB_TOKEN:
-    #     required: true
-      CROSS_REPO_PUSH_KEY:
-        required: true
-      BUILD_LOG_ZIP_PASSWORD:
-        required: false
-
-
-# since build cache, test-build cache, test-run cache are involved, out of order exec if serialization is on individual jobs will wreak all sorts of havoc
-# so we serialize on the entire workflow
-concurrency:                  
-  group: serialize-workflow
-    
-jobs:
-  shared:
-    uses: ./.github/workflows/sidestore-shared.yml
-    secrets: inherit
-
-  build:
-    needs: shared
-    uses: ./.github/workflows/sidestore-build.yml
-    with:
-      is_beta: ${{ inputs.is_beta }}
-      is_shared_build_num: ${{ inputs.is_shared_build_num }}
-      release_tag: ${{ inputs.release_tag }}
-      short_commit: ${{ needs.shared.outputs.short-commit }}
-      bundle_id: ${{ inputs.bundle_id }}
-      bundle_id_suffix: ${{ inputs.bundle_id_suffix }}
-    secrets: inherit
-
-  # tests-build:
-  #   if: ${{ vars.ENABLE_TESTS == '1' && vars.ENABLE_TESTS_BUILD == '1' }}
-  #   needs: shared
-  #   uses: ./.github/workflows/sidestore-tests-build.yml
-  #   with:
-  #     release_tag: ${{ inputs.release_tag }}
-  #     short_commit: ${{ needs.shared.outputs.short-commit }}
-  #   secrets: inherit
-
-  # tests-run:
-  #   if: ${{ vars.ENABLE_TESTS == '1' && vars.ENABLE_TESTS_RUN == '1' }}
-  #   needs: [shared, tests-build]
-  #   uses: ./.github/workflows/sidestore-tests-run.yml
-  #   with:
-  #     release_tag: ${{ inputs.release_tag }}
-  #     short_commit: ${{ needs.shared.outputs.short-commit }}
-  #   secrets: inherit
-
-  deploy:
-    # needs: [shared, build, tests-build, tests-run] # Keep tests-run in needs
-    needs: [shared, build] # Keep tests-run in needs
-    if: ${{ always() && (needs.tests-run.result == 'skipped' || needs.tests-run.result == 'success') }}
-    uses: ./.github/workflows/sidestore-deploy.yml
-    with:
-      is_beta: ${{ inputs.is_beta }}
-      publish: ${{ inputs.publish }}
-      release_name: ${{ inputs.release_name }}
-      release_tag: ${{ inputs.release_tag }}
-      upstream_tag: ${{ inputs.upstream_tag }}
-      upstream_name: ${{ inputs.upstream_name }}
-      version: ${{ needs.build.outputs.version }}
-      short_commit: ${{ needs.shared.outputs.short-commit }}
-      release_channel: ${{ needs.build.outputs.release-channel }}
-      marketing_version: ${{ needs.build.outputs.marketing-version }}
-      bundle_id: ${{ inputs.bundle_id }}
-    secrets: inherit

.github/workflows/sidestore-build.yml

@@ -1,358 +0,0 @@
-name: SideStore Build
-
-on:
-  workflow_call:
-    inputs:
-      is_beta:
-        type: boolean
-      is_shared_build_num:
-        type: boolean
-      release_tag:
-        type: string
-      bundle_id:
-        type: string
-      bundle_id_suffix:
-        type: string
-      short_commit:
-        type: string
-    secrets:
-      CROSS_REPO_PUSH_KEY:
-        required: true
-      BUILD_LOG_ZIP_PASSWORD:
-        required: false
-    outputs:
-      version: 
-        value: ${{ jobs.build.outputs.version }}
-      marketing-version: 
-        value: ${{ jobs.build.outputs.marketing-version }}
-      release-channel:
-        value: ${{ jobs.build.outputs.release-channel }}
-          
-jobs:
-  build:
-    name: Build SideStore - ${{ inputs.release_tag }}
-    strategy:
-      fail-fast: false
-      matrix:
-        include:
-          - os: 'macos-26'
-            version: '26.0'
-    runs-on: ${{ matrix.os }}
-    outputs:
-      version: ${{ steps.version.outputs.version }}
-      marketing-version: ${{ steps.marketing-version.outputs.MARKETING_VERSION }}
-      release-channel: ${{ steps.release-channel.outputs.RELEASE_CHANNEL }}
-
-    steps:
-      - name: Set beta status
-        run: echo "IS_BETA=${{ inputs.is_beta }}" >> $GITHUB_ENV
-        shell: bash
-
-      - name: Checkout code
-        uses: actions/checkout@v4
-        with:
-          submodules: recursive
-          fetch-depth: 0
-
-      - name: Install dependencies - ldid & xcbeautify
-        run: |
-          brew install ldid xcbeautify
-
-      - name: Set ref based on is_shared_build_num
-        if: ${{ inputs.is_beta }}
-        id: set_ref
-        run: |
-          if [ "${{ inputs.is_shared_build_num }}" == "true" ]; then
-            echo "ref=main" >> $GITHUB_ENV
-          else
-            echo "ref=${{ inputs.release_tag }}" >> $GITHUB_ENV
-          fi
-        shell: bash
-
-      - name: Checkout SideStore/beta-build-num repo
-        if: ${{ inputs.is_beta }}
-        uses: actions/checkout@v4
-        with:
-          repository: 'SideStore/beta-build-num'
-          ref: ${{ env.ref }}
-          token: ${{ secrets.CROSS_REPO_PUSH_KEY }}
-          path: 'SideStore/beta-build-num'
-
-      - name: Copy build_number.txt to repo root
-        if: ${{ inputs.is_beta }}
-        run: |
-          cp SideStore/beta-build-num/build_number.txt .
-          echo "cat build_number.txt"
-          cat build_number.txt
-        shell: bash
-
-      - name: Echo Build.xcconfig
-        run: |
-          echo "cat Build.xcconfig"
-          cat Build.xcconfig
-        shell: bash
-
-      - name: Set Release Channel info for build number bumper
-        id: release-channel
-        run: |
-          RELEASE_CHANNEL="${{ inputs.release_tag }}"
-          echo "RELEASE_CHANNEL=${RELEASE_CHANNEL}" >> $GITHUB_ENV
-          echo "RELEASE_CHANNEL=${RELEASE_CHANNEL}" >> $GITHUB_OUTPUT
-          echo "RELEASE_CHANNEL=${RELEASE_CHANNEL}"
-        shell: bash
-          
-      - name: Increase build number for beta builds
-        if: ${{ inputs.is_beta }}
-        run: |
-          bash .github/workflows/increase-beta-build-num.sh
-        shell: bash
-
-      - name: Extract MARKETING_VERSION from Build.xcconfig
-        id: version
-        run: |
-          version=$(grep MARKETING_VERSION Build.xcconfig | sed -e 's/MARKETING_VERSION = //g')
-          echo "version=$version" >> $GITHUB_OUTPUT
-          echo "version=$version"
-        shell: bash
-
-      - name: Set MARKETING_VERSION
-        if: ${{ inputs.is_beta }}
-        id: marketing-version
-        run: |
-          # Extract version number (e.g., "0.6.0")
-          version=$(echo "${{ steps.version.outputs.version }}" | sed -E 's/^[^0-9]*([0-9]+\.[0-9]+\.[0-9]+).*/\1/')
-          # Extract date (YYYYMMDD) (e.g., "20250205")
-          date=$(echo "${{ steps.version.outputs.version }}" | sed -E 's/.*\.([0-9]{4})\.([0-9]{2})\.([0-9]{2})\..*/\1\2\3/')
-          # Extract build number (e.g., "2")
-          build_num=$(echo "${{ steps.version.outputs.version }}" | sed -E 's/.*\.([0-9]+)\+.*/\1/')
-
-          # Combine them into the final output
-          MARKETING_VERSION="${version}-${date}.${build_num}+${{ inputs.short_commit }}"
-
-          echo "MARKETING_VERSION=$MARKETING_VERSION" >> $GITHUB_ENV
-          echo "MARKETING_VERSION=$MARKETING_VERSION" >> $GITHUB_OUTPUT
-          echo "MARKETING_VERSION=$MARKETING_VERSION"
-        shell: bash
-
-      - name: Echo Updated Build.xcconfig, build_number.txt
-        if: ${{ inputs.is_beta }}
-        run: |
-          cat Build.xcconfig
-          cat build_number.txt
-        shell: bash
-
-      - name: Setup Xcode
-        uses: maxim-lobanov/setup-xcode@v1.6.0
-        with:
-          xcode-version: ${{ matrix.version }}
-
-      - name: (Build) Restore Xcode & SwiftPM Cache (Exact match)
-        id: xcode-cache-restore
-        uses: actions/cache/restore@v3
-        with:
-          path: |
-            ~/Library/Developer/Xcode/DerivedData
-            ~/Library/Caches/org.swift.swiftpm
-          key: xcode-cache-build-${{ github.ref_name }}-${{ github.sha }}
-
-      - name: (Build) Restore Xcode & SwiftPM Cache (Last Available)
-        id: xcode-cache-restore-recent
-        uses: actions/cache/restore@v3
-        with:
-          path: |
-            ~/Library/Developer/Xcode/DerivedData
-            ~/Library/Caches/org.swift.swiftpm
-          key: xcode-cache-build-${{ github.ref_name }}-
-
-      # - name: (Build) Cache Build
-      #   uses: irgaly/xcode-cache@v1.8.1
-      #   with:
-      #     key: xcode-cache-deriveddata-build-${{ github.ref_name }}-${{ github.sha }}
-      #     restore-keys: xcode-cache-deriveddata-build-${{ github.ref_name }}-
-      #     swiftpm-cache-key: xcode-cache-sourcedata-build-${{ github.ref_name }}-${{ github.sha }}
-      #     swiftpm-cache-restore-keys: |
-      #       xcode-cache-sourcedata-build-${{ github.ref_name }}-
-
-      - name: (Build) Clean previous build artifacts
-        # using 'tee' to intercept stdout and log for detailed build-log
-        run: |
-          make clean
-          mkdir -p build/logs
-        shell: bash
-
-      - name: (Build) List Files and derived data
-        if: always()
-        shell: bash
-        run: |
-          echo ">>>>>>>>> Workdir <<<<<<<<<<"
-          ls -la .
-          echo ""
-
-          echo ">>>>>>>>> SideStore <<<<<<<<<<"
-          find SideStore -maxdepth 2 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> Dependencies <<<<<<<<<<"
-          find Dependencies -maxdepth 2 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> Xcode-Derived-Data <<<<<<<<<<"
-          ls -la ~/Library/Developer/Xcode/DerivedData || true  # List contents if directory exists
-          echo ""
-
-      - name: Set BundleID Suffix for Sidestore build
-        run: |
-          echo "BUNDLE_ID_SUFFIX=${{ inputs.bundle_id_suffix }}" >> $GITHUB_ENV
-        shell: bash
-
-
-      - name: Build SideStore.xcarchive
-        # using 'tee' to intercept stdout and log for detailed build-log
-        run: |
-          NSUnbufferedIO=YES make -B build 2>&1 | tee -a build/logs/build.log | xcbeautify --renderer github-actions && exit ${PIPESTATUS[0]}
-        shell: bash
-
-      - name: Fakesign app
-        run: make fakesign | tee -a build/logs/build.log
-        shell: bash
-
-      - name: Convert to IPA
-        run: make ipa | tee -a build/logs/build.log
-        shell: bash
-
-      - name: (Build) Save Xcode & SwiftPM Cache
-        id: cache-save
-        if: ${{ steps.xcode-cache-restore.outputs.cache-hit != 'true' }}
-        uses: actions/cache/save@v3
-        with:
-          path: |
-            ~/Library/Developer/Xcode/DerivedData
-            ~/Library/Caches/org.swift.swiftpm
-          key: xcode-cache-build-${{ github.ref_name }}-${{ github.sha }}
-        
-      - name: (Build) List Files and Build artifacts
-        run: |
-          echo ">>>>>>>>> Workdir <<<<<<<<<<"
-          ls -la .
-          echo ""
-
-          echo ">>>>>>>>> Build <<<<<<<<<<"
-          find build -maxdepth 3 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> SideStore <<<<<<<<<<"
-          find SideStore -maxdepth 3 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> SideStore.xcarchive <<<<<<<<<<"
-          find SideStore.xcarchive -maxdepth 3 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> Xcode-Derived-Data <<<<<<<<<<"
-          ls -la ~/Library/Developer/Xcode/DerivedData || true  # List contents if directory exists
-          echo ""
-        shell: bash
-
-      - name: Encrypt build-logs for upload
-        id: encrypt-build-log
-        run: |
-          DEFAULT_BUILD_LOG_PASSWORD=12345
-
-          BUILD_LOG_ZIP_PASSWORD=${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
-          BUILD_LOG_ZIP_PASSWORD=${BUILD_LOG_ZIP_PASSWORD:-$DEFAULT_BUILD_LOG_PASSWORD}
-
-          if [ "$BUILD_LOG_ZIP_PASSWORD" == "$DEFAULT_BUILD_LOG_PASSWORD" ]; then
-            echo "Warning: BUILD_LOG_ZIP_PASSWORD is not set. Defaulting to '${DEFAULT_BUILD_LOG_PASSWORD}'."
-          fi
-          
-          pushd build/logs && zip -e -P "$BUILD_LOG_ZIP_PASSWORD" ../../encrypted-build-logs.zip * || popd
-          echo "::set-output name=encrypted::true"
-        shell: bash
-
-      - name: Upload encrypted-build-logs.zip
-        id: attach-encrypted-build-log
-        if: ${{ always() && steps.encrypt-build-log.outputs.encrypted == 'true' }}
-        uses: actions/upload-artifact@v4
-        with:
-          name: encrypted-build-logs-${{ steps.version.outputs.version }}.zip
-          path: encrypted-build-logs.zip
-
-      - name: Upload SideStore.ipa Artifact
-        uses: actions/upload-artifact@v4
-        with:
-          name: SideStore-${{ steps.version.outputs.version }}.ipa
-          path: SideStore.ipa
-
-      - name: Zip dSYMs
-        run: zip -r -9 ./SideStore.dSYMs.zip ./SideStore.xcarchive/dSYMs
-        shell: bash
-
-      - name: Upload *.dSYM Artifact
-        uses: actions/upload-artifact@v4
-        with:
-          name: SideStore-${{ steps.version.outputs.version }}-dSYMs.zip
-          path: SideStore.dSYMs.zip
-
-      - name: Keep rolling the build numbers for each successful build
-        if: ${{ inputs.is_beta }}
-        run: |
-          pushd SideStore/beta-build-num/
-  
-          echo "Configure Git user (committer details)"
-          git config user.name "GitHub Actions"
-          git config user.email "github-actions@github.com"
-          
-          echo "Adding files to commit"
-          git add --verbose build_number.txt
-          git commit -m " - updated for ${{ inputs.release_tag }} - ${{ inputs.short_commit }} deployment" || echo "No changes to commit"
-
-          echo "Pushing to remote repo"
-          git push --verbose
-          popd
-        shell: bash
-
-      - name: Get last successful commit
-        id: get_last_commit
-        run: |
-          # Try to get the last successful workflow run commit
-          LAST_SUCCESS_SHA=$(gh run list --branch "${{ github.ref_name }}" --status success --json headSha --jq '.[0].headSha')
-          echo "LAST_SUCCESS_SHA=$LAST_SUCCESS_SHA" >> $GITHUB_OUTPUT
-          echo "LAST_SUCCESS_SHA=$LAST_SUCCESS_SHA" >> $GITHUB_ENV
-        env:
-          GH_TOKEN: ${{ secrets.GITHUB_TOKEN }}
-        shell: bash
-
-      - name: Create release notes
-        run: |
-          LAST_SUCCESS_SHA=${{ steps.get_last_commit.outputs.LAST_SUCCESS_SHA}}
-          echo "Last successful commit SHA: $LAST_SUCCESS_SHA"
-          
-          FROM_COMMIT=$LAST_SUCCESS_SHA
-          # Check if we got a valid SHA
-          if [ -z "$LAST_SUCCESS_SHA" ] || [ "$LAST_SUCCESS_SHA" = "null" ]; then
-            echo "No successful run found, using initial commit of branch"
-            # Get the first commit of the branch (initial commit)
-            FROM_COMMIT=$(git rev-list --max-parents=0 HEAD)
-          fi
-  
-          python3 update_release_notes.py $FROM_COMMIT ${{ inputs.release_tag }} ${{ github.ref_name }}
-          # cat release-notes.md
-        shell: bash
-
-      - name: Upload release-notes.md
-        uses: actions/upload-artifact@v4
-        with:
-          name: release-notes-${{ inputs.short_commit }}.md
-          path: release-notes.md
-
-      - name: Upload update_release_notes.py
-        uses: actions/upload-artifact@v4
-        with:
-          name: update_release_notes-${{ inputs.short_commit }}.py
-          path: update_release_notes.py
-
-      - name: Upload update_apps.py
-        uses: actions/upload-artifact@v4
-        with:
-          name: update_apps-${{ inputs.short_commit }}.py
-          path: update_apps.py

.github/workflows/sidestore-deploy.yml

@@ -1,281 +0,0 @@
-name: SideStore Deploy
-
-on:
-  workflow_call:
-    inputs:
-      is_beta:
-        type: boolean
-      publish:
-        type: boolean
-      release_name:
-        type: string
-      release_tag:
-        type: string
-      upstream_tag:
-        type: string
-      upstream_name:
-        type: string
-      version:
-        type: string
-      short_commit:
-        type: string
-      marketing_version:
-        type: string
-      release_channel:
-        type: string
-      bundle_id:
-        type: string
-    secrets:
-      CROSS_REPO_PUSH_KEY:
-        required: true
-      # GITHUB_TOKEN:
-        # required: true
-
-jobs:
-  deploy:
-    name: Deploy SideStore - ${{ inputs.release_tag }}
-    runs-on: macos-15
-    steps:
-      - name: Download IPA artifact
-        uses: actions/download-artifact@v4
-        with:
-          name: SideStore-${{ inputs.version }}.ipa
-
-      - name: Download dSYM artifact
-        uses: actions/download-artifact@v4
-        with:
-          name: SideStore-${{ inputs.version }}-dSYMs.zip
-
-      - name: Download encrypted-build-logs artifact
-        uses: actions/download-artifact@v4
-        with:
-          name: encrypted-build-logs-${{ inputs.version }}.zip
-
-      - name: Download encrypted-tests-build-logs artifact
-        if: ${{ vars.ENABLE_TESTS == '1' && vars.ENABLE_TESTS_BUILD == '1' }}
-        uses: actions/download-artifact@v4
-        with:
-          name: encrypted-tests-build-logs-${{ inputs.short_commit }}.zip
-
-      - name: Download encrypted-tests-run-logs artifact
-        if: ${{ vars.ENABLE_TESTS == '1' && vars.ENABLE_TESTS_RUN == '1' }}
-        uses: actions/download-artifact@v4
-        with:
-          name: encrypted-tests-run-logs-${{ inputs.short_commit }}.zip
-
-      - name: Download tests-recording artifact
-        if: ${{ vars.ENABLE_TESTS == '1' && vars.ENABLE_TESTS_RUN == '1' }}
-        uses: actions/download-artifact@v4
-        with:
-          name: tests-recording-${{ inputs.short_commit }}.mp4
-
-      - name: Download test-results artifact
-        if: ${{ vars.ENABLE_TESTS == '1' && vars.ENABLE_TESTS_RUN == '1' }}
-        uses: actions/download-artifact@v4
-        with:
-          name: test-results-${{ inputs.short_commit }}.zip  
-  
-      - name: Download release-notes.md
-        uses: actions/download-artifact@v4
-        with:
-          name: release-notes-${{ inputs.short_commit }}.md
-
-      - name: Download update_release_notes.py
-        uses: actions/download-artifact@v4
-        with:
-          name: update_release_notes-${{ inputs.short_commit }}.py
-
-      - name: Download update_apps.py
-        uses: actions/download-artifact@v4
-        with:
-          name: update_apps-${{ inputs.short_commit }}.py
-
-      - name: Read release notes
-        id: release_notes
-        run: |
-          CONTENT=$(python3 update_release_notes.py --retrieve ${{ inputs.release_tag }})
-          echo "content<<EOF" >> $GITHUB_OUTPUT
-          echo "$CONTENT" >> $GITHUB_OUTPUT
-          echo "EOF" >> $GITHUB_OUTPUT
-        shell: bash
-
-      - name: List files before upload
-        run: |
-          echo ">>>>>>>>> Workdir <<<<<<<<<<"
-          find . -maxdepth 4 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-        shell: bash
-
-      - name: Get current date
-        id: date
-        run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
-        shell: bash
-
-      - name: Get current date in AltStore date form
-        id: date_altstore
-        run: echo "date=$(date -u +'%Y-%m-%d')" >> $GITHUB_OUTPUT
-        shell: bash
-
-
-      - name: List files to upload
-        id: list_uploads
-        run: |
-          echo ">>>>>>>>> Workdir <<<<<<<<<<"
-          find . -maxdepth 4 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          FILES="SideStore.ipa SideStore.dSYMs.zip encrypted-build-logs.zip"
-
-          if [[ "${{ vars.ENABLE_TESTS }}" == "1" && "${{ vars.ENABLE_TESTS_BUILD }}" == "1" ]]; then
-            FILES="$FILES encrypted-tests-build-logs.zip"
-          fi
-
-          if [[ "${{ vars.ENABLE_TESTS }}" == "1" && "${{ vars.ENABLE_TESTS_RUN }}" == "1" ]]; then
-            FILES="$FILES encrypted-tests-run-logs.zip test-results.zip tests-recording.mp4"
-          fi
-
-          echo "Final upload list:"
-          for f in $FILES; do
-            if [[ -f "$f" ]]; then
-              echo "  ✓ $f"
-            else
-              echo "  - $f (missing)"
-            fi
-          done
-
-          echo "files=$FILES" >> $GITHUB_OUTPUT
-
-      - name: Set Upstream Recommendation
-        id: upstream_recommendation
-        run: |
-          UPSTREAM_NAME=$(echo "${{ inputs.upstream_name }}" | tr '[:upper:]' '[:lower:]')
-          if [[ "$UPSTREAM_NAME" != "nightly" ]]; then
-            echo "content<<EOF" >> $GITHUB_OUTPUT
-            echo "If you want to try out new features early but want a lower chance of bugs, you can look at [SideStore ${{ inputs.upstream_name }}](https://github.com/${{ github.repository }}/releases?q=${{ inputs.upstream_tag }})." >> $GITHUB_OUTPUT
-            echo "" >> $GITHUB_OUTPUT
-            echo "EOF" >> $GITHUB_OUTPUT
-          else
-            echo "content=" >> $GITHUB_OUTPUT
-          fi
-        shell: bash
-
-      - name: Upload to releases
-        uses: IsaacShelton/update-existing-release@v1.3.1
-        with:
-          token: ${{ secrets.GITHUB_TOKEN }}
-          release: ${{ inputs.release_name }}
-          tag: ${{ inputs.release_tag }}
-          prerelease: ${{ inputs.is_beta }}
-          files: ${{ steps.list_uploads.outputs.files }}
-          body: |
-            This is an ⚠️ **EXPERIMENTAL** ⚠️ ${{ inputs.release_name }} build for commit [${{ github.sha }}](https://github.com/${{ github.repository }}/commit/${{ github.sha }}).
-
-            ${{ inputs.release_name }} builds are **extremely experimental builds only meant to be used by developers and beta testers. They often contain bugs and experimental features. Use at your own risk!**
-
-            ${{ steps.upstream_recommendation.outputs.content }}
-            ## Build Info
-
-            Built at (UTC): `${{ steps.date.outputs.date }}`
-            Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
-            Commit SHA: `${{ github.sha }}`
-            Version: `${{ inputs.version }}`
-
-            ${{ steps.release_notes.outputs.content }}
-
-      - name: Get formatted date
-        run: |
-          FORMATTED_DATE=$(date -u +"%Y-%m-%dT%H:%M:%SZ")
-          echo "Formatted date: $FORMATTED_DATE"
-          echo "FORMATTED_DATE=$FORMATTED_DATE" >> $GITHUB_ENV
-        shell: bash
-
-      - name: Get size of IPA in bytes (macOS/Linux)
-        run: |
-          if [[ "$(uname)" == "Darwin" ]]; then
-            # macOS
-            IPA_SIZE=$(stat -f %z SideStore.ipa)
-          else
-            # Linux
-            IPA_SIZE=$(stat -c %s SideStore.ipa)
-          fi
-          echo "IPA size in bytes: $IPA_SIZE"
-          echo "IPA_SIZE=$IPA_SIZE" >> $GITHUB_ENV
-        shell: bash
-
-      - name: Compute SHA-256 of IPA
-        run: |
-          SHA256_HASH=$(shasum -a 256 SideStore.ipa | awk '{ print $1 }')
-          echo "SHA-256 Hash: $SHA256_HASH"
-          echo "SHA256_HASH=$SHA256_HASH" >> $GITHUB_ENV
-        shell: bash
-
-      - name: Set Release Info variables
-        run: |
-          echo "IS_BETA=${{ inputs.is_beta }}" >> $GITHUB_ENV
-          echo "BUNDLE_IDENTIFIER=${{ inputs.bundle_id }}" >> $GITHUB_ENV
-          echo "VERSION_IPA=${{ inputs.marketing_version }}" >> $GITHUB_ENV
-          echo "VERSION_DATE=$FORMATTED_DATE" >> $GITHUB_ENV
-          echo "RELEASE_CHANNEL=${{ inputs.release_channel }}" >> $GITHUB_ENV
-          echo "SIZE=$IPA_SIZE" >> $GITHUB_ENV
-          echo "SHA256=$SHA256_HASH" >> $GITHUB_ENV
-          echo "DOWNLOAD_URL=https://github.com/SideStore/SideStore/releases/download/${{ inputs.release_tag }}/SideStore.ipa" >> $GITHUB_ENV
-
-          # Format localized description
-          get_description() {
-            cat <<EOF
-          This is release for:
-            - version: "${{ inputs.version }}"
-            - revision: "${{ inputs.short_commit }}"
-            - timestamp: "${{ steps.date.outputs.date }}"
-
-          Release Notes:
-          ${{ steps.release_notes.outputs.content }}
-          EOF
-          }
-
-          LOCALIZED_DESCRIPTION=$(get_description)
-          echo "$LOCALIZED_DESCRIPTION"
-
-          # multiline strings
-          echo "LOCALIZED_DESCRIPTION<<EOF" >> $GITHUB_ENV
-          echo "$LOCALIZED_DESCRIPTION" >> $GITHUB_ENV
-          echo "EOF" >> $GITHUB_ENV
-        shell: bash
-
-      - name: Check if Publish updates is set
-        id: check_publish
-        run: |
-          echo "Publish updates to source.json = ${{ inputs.publish }}"
-        shell: bash
-
-      - name: Checkout SideStore/apps-v2.json
-        if: ${{ inputs.is_beta && inputs.publish }}
-        uses: actions/checkout@v4
-        with:
-          repository: 'SideStore/apps-v2.json'
-          ref: 'main'   # this branch is shared by all beta builds, so beta build workflows are serialized
-          token: ${{ secrets.CROSS_REPO_PUSH_KEY }}
-          path: 'SideStore/apps-v2.json'
-
-      # for stable builds, let the user manually edit the source.json
-      - name: Publish to SideStore/apps-v2.json
-        if: ${{ inputs.is_beta && inputs.publish }}
-        id: publish-release
-        shell: bash
-        run: |
-          # Copy and execute the update script
-          pushd SideStore/apps-v2.json/
-
-          # Configure Git user (committer details)
-          git config user.name "GitHub Actions"
-          git config user.email "github-actions@github.com"
-
-          # update the source.json
-          python3 ../../update_apps.py "./_includes/source.json"
-
-          # Commit changes and push using SSH
-          git add --verbose ./_includes/source.json
-          git commit -m " - updated for ${{ inputs.short_commit }} deployment" || echo "No changes to commit"
-
-          git push --verbose
-          popd

.github/workflows/sidestore-shared.yml

@@ -1,24 +0,0 @@
-name: SideStore Shared
-
-on:
-  workflow_call:
-    outputs:
-      short-commit: 
-        value: ${{ jobs.shared.outputs.short-commit }}
-
-jobs:
-  shared:
-    name: Shared Steps
-    strategy:
-      fail-fast: false
-    runs-on: 'macos-15'
-    steps:
-      - name: Set short commit hash
-        id: commit-id
-        run: |
-          # SHORT_COMMIT="${{ github.sha }}"
-          SHORT_COMMIT=${GITHUB_SHA:0:7}
-          echo "Short commit hash: $SHORT_COMMIT"
-          echo "SHORT_COMMIT=$SHORT_COMMIT" >> $GITHUB_OUTPUT
-    outputs:
-      short-commit: ${{ steps.commit-id.outputs.SHORT_COMMIT }}

.github/workflows/sidestore-tests-build.yml

@@ -1,165 +0,0 @@
-name: SideStore Tests Build
-
-on:
-  workflow_call:
-    inputs:
-      release_tag:
-        type: string
-      short_commit:
-        type: string
-    secrets:
-      BUILD_LOG_ZIP_PASSWORD:
-        required: false
-
-jobs:
-  tests-build:
-    name: Tests-Build SideStore - ${{ inputs.release_tag }}
-    if: ${{ vars.ENABLE_TESTS == '1' && vars.ENABLE_TESTS_BUILD == '1' }}
-    strategy:
-      fail-fast: false
-      matrix:
-        include:
-          - os: 'macos-26'
-            version: '26.0'
-    runs-on: ${{ matrix.os }}
-
-    steps:
-      - name: Checkout code
-        uses: actions/checkout@v4
-        with:
-          submodules: recursive
-
-      - name: Install dependencies - xcbeautify
-        run: |
-          brew install xcbeautify
-        shell: bash
-
-      - name: Setup Xcode
-        uses: maxim-lobanov/setup-xcode@v1.6.0
-        with:
-          xcode-version: '26.0'
-
-      # - name: (Tests-Build) Cache Build
-      #   uses: irgaly/xcode-cache@v1.8.1
-      #   with:
-      #     key: xcode-cache-deriveddata-test-${{ github.ref_name }}-${{ github.sha }}
-      #     # tests shouldn't restore cache unless it is same build
-      #     # restore-keys: xcode-cache-deriveddata-test-${{ github.ref_name }}-
-      #     swiftpm-cache-key: xcode-cache-sourcedata-test-${{ github.ref_name }}-${{ github.sha }}
-      #     swiftpm-cache-restore-keys: |
-      #       xcode-cache-sourcedata-test-${{ github.ref_name }}-
-      #     delete-used-deriveddata-cache: true
-
-      - name: (Tests-Build) Restore Xcode & SwiftPM Cache (Exact match)
-        id: xcode-cache-restore
-        uses: actions/cache/restore@v3
-        with:
-          path: |
-            ~/Library/Developer/Xcode/DerivedData
-            ~/Library/Caches/org.swift.swiftpm
-          key: xcode-cache-tests-${{ github.ref_name }}-${{ github.sha }}
-
-      - name: (Tests-Build) Restore Xcode & SwiftPM Cache (Last Available)
-        id: xcode-cache-restore-recent
-        uses: actions/cache/restore@v3
-        with:
-          path: |
-            ~/Library/Developer/Xcode/DerivedData
-            ~/Library/Caches/org.swift.swiftpm
-          key: xcode-cache-tests-${{ github.ref_name }}-
-
-      - name: Clean Derived Data (if required)
-        if: ${{ vars.PERFORM_CLEAN_TESTS_BUILD == '1' }}
-        run: |
-          rm -rf ~/Library/Developer/Xcode/DerivedData/
-          make clean
-          xcodebuild clean
-        shell: bash
-
-      - name: (Tests-Build) Clean previous build artifacts
-        run: |
-          make clean
-          mkdir -p build/logs
-        shell: bash
-
-      - name: (Tests-Build) List Files and derived data
-        shell: bash
-        run: |
-          echo ">>>>>>>>> Workdir <<<<<<<<<<"
-          ls -la .
-          echo ""
-
-          echo ">>>>>>>>> SideStore <<<<<<<<<<"
-          find SideStore -maxdepth 2 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> Dependencies <<<<<<<<<<"
-          find Dependencies -maxdepth 2 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> Xcode-Derived-Data <<<<<<<<<<"
-          ls -la ~/Library/Developer/Xcode/DerivedData || true  # List contents if directory exists
-          echo ""
-
-      - name: Build SideStore Tests
-        # using 'tee' to intercept stdout and log for detailed build-log
-        shell: bash
-        run: |
-          NSUnbufferedIO=YES make -B build-tests 2>&1 | tee -a build/logs/tests-build.log | xcbeautify --renderer github-actions && exit ${PIPESTATUS[0]}
-
-      - name: (Tests-Build) Save Xcode & SwiftPM Cache
-        id: cache-save
-        if: ${{ steps.xcode-cache-restore.outputs.cache-hit != 'true' }}
-        uses: actions/cache/save@v3
-        with:
-          path: |
-            ~/Library/Developer/Xcode/DerivedData
-            ~/Library/Caches/org.swift.swiftpm
-          key: xcode-cache-tests-${{ github.ref_name }}-${{ github.sha }}
-        
-      - name: (Tests-Build) List Files and Build artifacts
-        if: always()
-        shell: bash
-        run: |
-          echo ">>>>>>>>> Workdir <<<<<<<<<<"
-          ls -la .
-          echo ""
-
-          echo ">>>>>>>>> Build <<<<<<<<<<"
-          find build -maxdepth 3 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> Xcode-Derived-Data <<<<<<<<<<"
-          find ~/Library/Developer/Xcode/DerivedData -maxdepth 8 -exec ls -ld {} + | grep "Build/Products"  >> tests-build-deriveddata.txt || true
-          echo ""
-
-      - uses: actions/upload-artifact@v4
-        if: always()
-        with: 
-          name: tests-build-deriveddata-${{ inputs.short_commit }}.txt
-          path: tests-build-deriveddata.txt
-
-      - name: Encrypt tests-build-logs for upload
-        id: encrypt-test-log
-        if: always()
-        shell: bash
-        run: |
-          DEFAULT_BUILD_LOG_PASSWORD=12345
-
-          BUILD_LOG_ZIP_PASSWORD=${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
-          BUILD_LOG_ZIP_PASSWORD=${BUILD_LOG_ZIP_PASSWORD:-$DEFAULT_BUILD_LOG_PASSWORD}
-
-          if [ "$BUILD_LOG_ZIP_PASSWORD" == "$DEFAULT_BUILD_LOG_PASSWORD" ]; then
-            echo "Warning: BUILD_LOG_ZIP_PASSWORD is not set. Defaulting to '${DEFAULT_BUILD_LOG_PASSWORD}'."
-          fi
-
-          pushd build/logs && zip -e -P "$BUILD_LOG_ZIP_PASSWORD" ../../encrypted-tests-build-logs.zip * || popd
-          echo "::set-output name=encrypted::true"
-      
-      - name: Upload encrypted-tests-build-logs.zip
-        id: attach-encrypted-test-log
-        if: always() && steps.encrypt-test-log.outputs.encrypted == 'true'
-        uses: actions/upload-artifact@v4
-        with:
-          name: encrypted-tests-build-logs-${{ inputs.short_commit }}.zip
-          path: encrypted-tests-build-logs.zip

.github/workflows/sidestore-tests-run.yml

@@ -1,196 +0,0 @@
-name: SideStore Tests Run
-
-on:
-  workflow_call:
-    inputs:
-      release_tag:
-        type: string
-      short_commit:
-        type: string
-    secrets:
-      BUILD_LOG_ZIP_PASSWORD:
-        required: false
-
-jobs:
-  tests-run:
-    name: Tests-Run SideStore - ${{ inputs.release_tag }}
-    if: ${{ vars.ENABLE_TESTS == '1' && vars.ENABLE_TESTS_RUN == '1' }}
-    strategy:
-      fail-fast: false
-      matrix:
-        include:
-          - os: 'macos-26'
-            version: '26.0'
-    runs-on: ${{ matrix.os }}
-
-    steps:
-      - name: Checkout code
-        uses: actions/checkout@v4
-        with:
-          submodules: recursive
-
-      - name: Boot Simulator async(nohup) for testing
-        run: |
-          mkdir -p build/logs
-          nohup make -B boot-sim-async </dev/null >> build/logs/tests-run.log 2>&1 &
-        shell: bash
-
-      - name: Setup Xcode
-        uses: maxim-lobanov/setup-xcode@v1.6.0
-        with:
-          xcode-version: '26.0'
-
-      # - name: (Tests-Run) Cache Build
-      #   uses: irgaly/xcode-cache@v1.8.1
-      #   with:
-      #     # This comes from 
-      #     key: xcode-cache-deriveddata-test-${{ github.ref_name }}-${{ github.sha }}
-      #     swiftpm-cache-key: xcode-cache-sourcedata-test-${{ github.ref_name }}-${{ github.sha }}
-      
-      - name: (Tests-Build) Restore Xcode & SwiftPM Cache (Exact match) [from tests-build job]
-        id: xcode-cache-restore
-        uses: actions/cache/restore@v3
-        with:
-          path: |
-            ~/Library/Developer/Xcode/DerivedData
-            ~/Library/Caches/org.swift.swiftpm
-          key: xcode-cache-tests-${{ github.ref_name }}-${{ github.sha }}
-
-      - name: (Tests-Run) Clean previous build artifacts
-        run: |
-          make clean
-          mkdir -p build/logs
-        shell: bash
-
-      - name: (Tests-Run) List Files and derived data
-        shell: bash
-        run: |
-          echo ">>>>>>>>> Workdir <<<<<<<<<<"
-          ls -la .
-          echo ""
-
-          echo ">>>>>>>>> SideStore <<<<<<<<<<"
-          find SideStore -maxdepth 2 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> Dependencies <<<<<<<<<<"
-          find Dependencies -maxdepth 2 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> Xcode-Derived-Data <<<<<<<<<<"
-          find ~/Library/Developer/Xcode/DerivedData -maxdepth 8 -exec ls -ld {} + | grep "Build/Products" >> tests-run-deriveddata.txt || true
-          echo ""
-
-      - uses: actions/upload-artifact@v4
-        if: always()
-        with: 
-          name: tests-run-deriveddata-${{ inputs.short_commit }}.txt
-          path: tests-run-deriveddata.txt
-
-      # we expect simulator to have been booted by now, so exit otherwise
-      - name: Simulator Boot Check
-        run: |
-          mkdir -p build/logs
-          make -B sim-boot-check | tee -a build/logs/tests-run.log
-          exit ${PIPESTATUS[0]}
-        shell: bash
-
-      - name: Start Recording UI tests (if DEBUG_RECORD_TESTS is set to 1)
-        if: ${{ vars.DEBUG_RECORD_TESTS == '1' }}
-        run: |
-          nohup xcrun simctl io booted recordVideo -f tests-recording.mp4 --codec h264 </dev/null > tests-recording.log 2>&1 &
-          RECORD_PID=$!
-          echo "RECORD_PID=$RECORD_PID" >> $GITHUB_ENV
-        shell: bash
-
-      - name: Run SideStore Tests
-        # using 'tee' to intercept stdout and log for detailed build-log
-        run: |
-          make run-tests 2>&1 | tee -a build/logs/tests-run.log && exit ${PIPESTATUS[0]}
-        # NSUnbufferedIO=YES make -B run-tests 2>&1 | tee build/logs/tests-run.log | xcpretty -r junit --output ./build/tests/test-results.xml && exit ${PIPESTATUS[0]}
-        shell: bash
-
-      - name: Stop Recording tests
-        if: ${{ always() && env.RECORD_PID != '' }}
-        run: |
-          kill -INT ${{ env.RECORD_PID }}
-        shell: bash
-
-      - name: (Tests-Run) List Files and Build artifacts
-        if: always()
-        run: |
-          echo ">>>>>>>>> Workdir <<<<<<<<<<"
-          ls -la .
-          echo ""
-
-          echo ">>>>>>>>> Build <<<<<<<<<<"
-          find build -maxdepth 3 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-        shell: bash
-
-      - name: Encrypt tests-run-logs for upload
-        id: encrypt-test-log
-        if: always()
-        run: |
-          DEFAULT_BUILD_LOG_PASSWORD=12345
-
-          BUILD_LOG_ZIP_PASSWORD=${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
-          BUILD_LOG_ZIP_PASSWORD=${BUILD_LOG_ZIP_PASSWORD:-$DEFAULT_BUILD_LOG_PASSWORD}
-
-          if [ "$BUILD_LOG_ZIP_PASSWORD" == "$DEFAULT_BUILD_LOG_PASSWORD" ]; then
-            echo "Warning: BUILD_LOG_ZIP_PASSWORD is not set. Defaulting to '${DEFAULT_BUILD_LOG_PASSWORD}'."
-          fi
-
-          pushd build/logs && zip -e -P "$BUILD_LOG_ZIP_PASSWORD" ../../encrypted-tests-run-logs.zip * || popd
-          echo "::set-output name=encrypted::true"
-        shell: bash
-
-      - name: Upload encrypted-tests-run-logs.zip
-        id: attach-encrypted-test-log
-        if: always() && steps.encrypt-test-log.outputs.encrypted == 'true'
-        uses: actions/upload-artifact@v4
-        with:
-          name: encrypted-tests-run-logs-${{ inputs.short_commit }}.zip
-          path: encrypted-tests-run-logs.zip
-
-      - name: Print tests-recording.log contents (if exists)
-        if: ${{ always() && env.RECORD_PID != '' }}
-        run: |
-          if [ -f tests-recording.log ]; then
-            echo "tests-recording.log found. Its contents:"
-            cat tests-recording.log
-          else
-            echo "tests-recording.log not found."
-          fi
-        shell: bash
-
-      - name: Check for tests-recording.mp4 presence
-        id: check-recording
-        if: ${{ always() && env.RECORD_PID != '' }}
-        run: |
-          if [ -f tests-recording.mp4 ]; then
-            echo "::set-output name=found::true"
-            echo "tests-recording.mp4 found."
-          else
-            echo "tests-recording.mp4 not found, skipping upload."
-            echo "::set-output name=found::false"
-          fi
-        shell: bash
-
-      - name: Upload tests-recording.mp4
-        id: upload-recording
-        if: ${{ always() && steps.check-recording.outputs.found == 'true' }}
-        uses: actions/upload-artifact@v4
-        with:
-          name: tests-recording-${{ inputs.short_commit }}.mp4
-          path: tests-recording.mp4
-
-      - name: Zip test-results
-        run: zip -r -9 ./test-results.zip ./build/tests
-        shell: bash
-
-      - name: Upload Test Artifacts
-        uses: actions/upload-artifact@v4
-        with:
-          name: test-results-${{ inputs.short_commit }}.zip
-          path: test-results.zip

.github/workflows/stable.yml

@@ -1,242 +1,135 @@
 name: Stable SideStore build
+
 on:
   push:
     tags:
-      - '[0-9]+.[0-9]+.[0-9]+' # example: 1.0.0
+      - '[0-9]+.[0-9]+.[0-9]+'
   workflow_dispatch:
 
+concurrency:
+  group: ${{ github.ref }}
+  cancel-in-progress: true
+
 jobs:
   build:
-    name: Build SideStore - stable (on tag push)
-    strategy:
-      fail-fast: false
-      matrix:
-        include:
-          - os: 'macos-26'
-            version: '26.0'
-    runs-on: ${{ matrix.os }}
+    name: Build SideStore - stable
+    runs-on: macos-26
+
+    env:
+      GH_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+      CHANNEL: stable
+      UPSTREAM_CHANNEL: ""
 
     steps:
-      - name: Checkout code
-        uses: actions/checkout@v4
+      - uses: actions/checkout@v4
         with:
           submodules: recursive
+          fetch-depth: 0
 
-      - name: Echo Build.xcconfig
+      - name: Find Last Successful commit
         run: |
-          echo "cat Build.xcconfig"
-          cat Build.xcconfig
-        shell: bash
+          LAST_SUCCESSFUL_COMMIT=$(python3 scripts/ci/workflow.py last-successful-commit \
+            "true" || echo "")
+          echo "LAST_SUCCESSFUL_COMMIT=$LAST_SUCCESSFUL_COMMIT" | tee -a $GITHUB_ENV
 
-      # - name: Change MARKETING_VERSION to the pushed tag that triggered this build
-      #   run: sed -e '/MARKETING_VERSION = .*/s/= .*/= ${{ github.ref_name }}/' -i '' Build.xcconfig
+      - run: brew install ldid xcbeautify
 
-      - name: Echo Updated Build.xcconfig
+      - name: Setup Env
         run: |
-          cat Build.xcconfig
-        shell: bash
+          MARKETING_VERSION=$(python3 scripts/ci/workflow.py get-marketing-version)
+          SHORT_COMMIT=$(python3 scripts/ci/workflow.py commit-id)
 
-      - name: Extract MARKETING_VERSION from Build.xcconfig
-        id: version
-        run: |
-          version=$(grep MARKETING_VERSION Build.xcconfig | sed -e 's/MARKETING_VERSION = //g')
-          echo "version=$version" >> $GITHUB_OUTPUT
-          echo "version=$version"
-
-          echo "MARKETING_VERSION=$version" >> $GITHUB_ENV
-          echo "MARKETING_VERSION=$version" >> $GITHUB_OUTPUT
-          echo "MARKETING_VERSION=$version"
-
-        shell: bash
-
-      - name: Fail the build if pushed tag and embedded MARKETING_VERSION in Build.xcconfig are mismatching
-        run: |
           if [ "$MARKETING_VERSION" != "${{ github.ref_name }}" ]; then
-            echo 'Version mismatch: $tag != $marketing_version ... '
-            echo "    expected-tag  : $MARKETING_VERSION"
-            echo "    pushed-tag    : ${{ github.ref_name }}"
+            echo "Version mismatch"
+            echo "Build.xcconfig: $MARKETING_VERSION"
+            echo "Tag: ${{ github.ref_name }}"
             exit 1
           fi
-          echo 'Version matches: $tag == $marketing_version ... '
-          echo "    expected-tag  : $MARKETING_VERSION"
-          echo "    pushed-tag    : ${{ github.ref_name }}"
-        shell: bash
 
-      - name: Install dependencies - ldid & xcbeautify
-        run: |
-          brew install ldid xcbeautify
+          echo "MARKETING_VERSION=$MARKETING_VERSION" | tee -a $GITHUB_ENV
+          echo "SHORT_COMMIT=$SHORT_COMMIT" | tee -a $GITHUB_ENV
 
       - name: Setup Xcode
         uses: maxim-lobanov/setup-xcode@v1.6.0
         with:
-          xcode-version: ${{ matrix.version }}
+          xcode-version: "26.0"
 
-      - name: (Build) Restore Xcode & SwiftPM Cache (Exact match)
-        id: xcode-cache-restore
+      - name: Restore Cache (exact)
+        id: xcode-cache-exact
         uses: actions/cache/restore@v3
         with:
           path: |
             ~/Library/Developer/Xcode/DerivedData
             ~/Library/Caches/org.swift.swiftpm
-          key: xcode-cache-build-stable-${{ github.sha }}
+          key: xcode-build-cache-stable-${{ github.sha }}
 
-      - name: (Build) Restore Xcode & SwiftPM Cache (Last Available)
-        id: xcode-cache-restore-recent
+      - name: Restore Cache (last)
+        if: steps.xcode-cache-exact.outputs.cache-hit != 'true'
+        id: xcode-cache-fallback
         uses: actions/cache/restore@v3
         with:
           path: |
             ~/Library/Developer/Xcode/DerivedData
             ~/Library/Caches/org.swift.swiftpm
-          key: xcode-cache-build-stable-
+          key: xcode-build-cache-stable-
 
-      - name: (Build) Clean previous build artifacts
+      - name: Build
+        id: build
+        env:
+          BUILD_LOG_ZIP_PASSWORD: ${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
         run: |
-          make clean
-          mkdir -p build/logs
-        shell: bash
+          python3 scripts/ci/workflow.py build; STATUS=$?
+          python3 scripts/ci/workflow.py encrypt-build
+          exit $STATUS
 
-      - name: (Build) List Files and derived data
-        if: always()
-        shell: bash
-        run: |
-          echo ">>>>>>>>> Workdir <<<<<<<<<<"
-          ls -la .
-          echo ""
-
-          echo ">>>>>>>>> SideStore <<<<<<<<<<"
-          find SideStore -maxdepth 2 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> Dependencies <<<<<<<<<<"
-          find Dependencies -maxdepth 2 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> Xcode-Derived-Data <<<<<<<<<<"
-          ls -la ~/Library/Developer/Xcode/DerivedData || true  # List contents if directory exists
-          echo ""
-
-      - name: Build SideStore.xcarchive
-        # using 'tee' to intercept stdout and log for detailed build-log
-        run: |
-          NSUnbufferedIO=YES make -B build 2>&1 | tee -a build/logs/build.log | xcbeautify --renderer github-actions && exit ${PIPESTATUS[0]}
-        shell: bash
-
-      - name: Fakesign app
-        run: make fakesign | tee -a build/logs/build.log
-        shell: bash
-
-      - name: Convert to IPA
-        run: make ipa | tee -a build/logs/build.log
-        shell: bash
-
-      - name: (Build) Save Xcode & SwiftPM Cache
-        id: cache-save
-        if: ${{ steps.xcode-cache-restore.outputs.cache-hit != 'true' }}
+      - name: Save Cache
+        if: ${{ steps.xcode-cache-fallback.outputs.cache-hit != 'true' }}
         uses: actions/cache/save@v3
         with:
           path: |
             ~/Library/Developer/Xcode/DerivedData
             ~/Library/Caches/org.swift.swiftpm
-          key: xcode-cache-build-stable-${{ github.sha }}
-        
-      - name: (Build) List Files and Build artifacts
-        run: |
-          echo ">>>>>>>>> Workdir <<<<<<<<<<"
-          ls -la .
-          echo ""
+          key: xcode-build-cache-stable-${{ github.sha }}
 
-          echo ">>>>>>>>> Build <<<<<<<<<<"
-          find build -maxdepth 3 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> SideStore <<<<<<<<<<"
-          find SideStore -maxdepth 3 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> SideStore.xcarchive <<<<<<<<<<"
-          find SideStore.xcarchive -maxdepth 3 -exec ls -ld {} +  || true  # List contents if directory exists
-          echo ""
-
-          echo ">>>>>>>>> Xcode-Derived-Data <<<<<<<<<<"
-          ls -la ~/Library/Developer/Xcode/DerivedData || true  # List contents if directory exists
-          echo ""
-        shell: bash
-
-      - name: Encrypt build-logs for upload
-        id: encrypt-build-log
-        run: |
-          DEFAULT_BUILD_LOG_PASSWORD=12345
-
-          BUILD_LOG_ZIP_PASSWORD=${{ secrets.BUILD_LOG_ZIP_PASSWORD }}
-          BUILD_LOG_ZIP_PASSWORD=${BUILD_LOG_ZIP_PASSWORD:-$DEFAULT_BUILD_LOG_PASSWORD}
-
-          if [ "$BUILD_LOG_ZIP_PASSWORD" == "$DEFAULT_BUILD_LOG_PASSWORD" ]; then
-            echo "Warning: BUILD_LOG_ZIP_PASSWORD is not set. Defaulting to '${DEFAULT_BUILD_LOG_PASSWORD}'."
-          fi
-          
-          pushd build/logs && zip -e -P "$BUILD_LOG_ZIP_PASSWORD" ../../encrypted-build-logs.zip * || popd
-          echo "::set-output name=encrypted::true"
-        shell: bash
-
-      - name: Upload encrypted-build-logs.zip
-        id: attach-encrypted-build-log
-        if: ${{ always() && steps.encrypt-build-log.outputs.encrypted == 'true' }}
-        uses: actions/upload-artifact@v4
+      - uses: actions/upload-artifact@v4
         with:
-          name: encrypted-build-logs-${{ steps.version.outputs.version }}.zip
-          path: encrypted-build-logs.zip
+          name: build-logs-${{ env.MARKETING_VERSION }}.zip
+          path: build-logs.zip
 
-      - name: Upload SideStore.ipa Artifact
-        uses: actions/upload-artifact@v4
+      - uses: actions/upload-artifact@v4
         with:
-          name: SideStore-${{ steps.version.outputs.version }}.ipa
+          name: SideStore-${{ env.MARKETING_VERSION }}.ipa
           path: SideStore.ipa
 
-      - name: Zip dSYMs
-        run: zip -r -9 ./SideStore.dSYMs.zip ./SideStore.xcarchive/dSYMs
-        shell: bash
-
-      - name: Upload *.dSYM Artifact
-        uses: actions/upload-artifact@v4
+      - uses: actions/upload-artifact@v4
         with:
-          name: SideStore-${{ steps.version.outputs.version }}-dSYMs.zip
+          name: SideStore-${{ env.MARKETING_VERSION }}-dSYMs.zip
           path: SideStore.dSYMs.zip
 
-      - name: Get current date
-        id: date
-        run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
-        shell: bash
+      - name: Generate Metadata
+        run: |
+          python3 scripts/ci/workflow.py dump-project-settings
+          PRODUCT_NAME=$(python3 scripts/ci/workflow.py read-product-name)
+          BUNDLE_ID=$(python3 scripts/ci/workflow.py read-bundle-id)
+          IPA_NAME="$PRODUCT_NAME.ipa"
 
-      - name: Get current date in AltStore date form
-        id: date_altstore
-        run: echo "date=$(date -u +'%Y-%m-%d')" >> $GITHUB_OUTPUT
-        shell: bash
+          python3 scripts/ci/workflow.py generate-metadata \
+            "${{ github.ref_name }}" \
+            "$SHORT_COMMIT" \
+            "$MARKETING_VERSION" \
+            "$CHANNEL" \
+            "$BUNDLE_ID" \
+            "$IPA_NAME" \
+            "$LAST_SUCCESSFUL_COMMIT"
 
       - name: Upload to releases
-        uses: IsaacShelton/update-existing-release@v1.3.1
-        with:
-          token: ${{ secrets.GITHUB_TOKEN }}
-          draft: true
-          release: ${{ github.ref_name }}   # name
-          tag: ${{ github.ref_name  }}
-           # stick with what the user pushed, do not use latest commit or anything, 
-           # ex: if we want to go back to previous release due to hot issue, dev can create a new tag pointing to that older working tag/commit so as to keep it as an update (to revert major issue)
-           #     in this case we do not want the tag to be auto-updated to latest
-          updateTag: false 
-          prerelease: false
-          files: >
-            SideStore.ipa 
-            SideStore.dSYMs.zip 
-            encrypted-build-logs.zip
-          body: |
-              <!-- NOTE: to reset SideSource cache, go to `https://apps.sidestore.io/reset-cache/nightly/<sidesource key>`. This is not included in the GitHub Action since it makes draft releases so they can be edited and have a changelog. -->
-              ## Changelog
-              
-              - TODO
-              
-              ## Build Info
-
-              Built at (UTC): `${{ steps.date.outputs.date }}`
-              Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
-              Commit SHA: `${{ github.sha }}`
-              Version: `${{ steps.version.outputs.version }}`
+        env:
+          GH_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+        run: |
+          python3 scripts/ci/workflow.py upload-release \
+            "${{ github.ref_name }}" \
+            "${{ github.ref_name }}" \
+            "$GITHUB_SHA" \
+            "$GITHUB_REPOSITORY" \
+            "$UPSTREAM_CHANNEL" \
+            "true"

.gitignore

@@ -69,4 +69,7 @@ SideStore/.skip-prebuilt-fetch-em_proxy
 test-recording.mp4
 test-recording.log
 altstore-sources.md
-local-build.sh
+local-build.sh
+
+source-metadata.json
+release-notes.md

AltStore/AppDelegate.swift

@@ -92,7 +92,6 @@ final class AppDelegate: UIResponder, UIApplicationDelegate {
             }
         }
         
-        self.setTintColor()
         self.setTintColor()
         self.prepareImageCache()
 

AltStore/Browse/FeaturedViewController.swift

@@ -368,7 +368,7 @@ private extension FeaturedViewController
             #keyPath(StoreApp._source._apps),
             #keyPath(StoreApp.bundleIdentifier),
             StoreApp.altstoreAppID,
-            #keyPath(StoreApp.installedApp),
+            #keyPath(StoreApp.installedApp)
         )
         
         let primaryFetchRequest = fetchRequest.copy() as! NSFetchRequest<StoreApp>

AltStore/Managing Apps/AppManager.swift

@@ -997,6 +997,7 @@ extension AppManager
             case .failure(let error): completionHandler(.failure(error))
             case .success(let installedApp): completionHandler(.success(installedApp))
             }
+            //UIApplication.shared.open(shortcutURLon, options: [:], completionHandler: nil)
         }
         installOperation.addDependency(sendAppOperation)
         

AltStore/Operations/InstallAppOperation.swift

@@ -11,6 +11,8 @@ import AltStoreCore
 import AltSign
 import Roxas
 
+let shortcutURLonDelay = URL(string: "shortcuts://run-shortcut?name=TurnOnDataDelay")!
+
 @objc(InstallAppOperation)
 final class InstallAppOperation: ResultOperation<InstalledApp>
 {
@@ -176,6 +178,13 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
             
             var installing = true
             if installedApp.storeApp?.bundleIdentifier.range(of: Bundle.Info.appbundleIdentifier) != nil {
+                do {
+                    // we need to flush changes to the disk now in case the changes are lost when iOS kills current process
+                    try installedApp.managedObjectContext?.save()
+                } catch {
+                    print("Failed to flush installedApp to disk: \(error)")
+                }
+                
                 // Reinstalling ourself will hang until we leave the app, so we need to exit it without force closing
                 DispatchQueue.main.asyncAfter(deadline: .now() + 3) {
                     if UIApplication.shared.applicationState != .active {
@@ -204,6 +213,10 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                             let alert = UIAlertController(title: "Finish Refresh", message: "Please reopen SideStore after the process is finished.To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen manually or by hitting Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
                             alert.addAction(UIAlertAction(title: NSLocalizedString("Continue", comment: ""), style: .default, handler: { _ in
                                 print("Going home")
+                                // Cell Shortcut
+                                UIApplication.shared.open(shortcutURLonDelay, options: [:]) { _ in
+                                    print("Cell OFF Shortcut finished execution.")}
+                                    
                                 UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
                             }))
 
@@ -220,6 +233,8 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                             }
                         }
                     }
+                    // Cell Shortcut
+                    UIApplication.shared.open(shortcutURLonDelay, options: [:]) { _ in print("Cell OFF Shortcut finished execution.")}
                     UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
                 }
             }

AltStore/Operations/Patch App/PatchAppOperation.swift

@@ -211,7 +211,6 @@ private extension PatchAppOperation
             #if targetEnvironment(simulator)
             throw PatchAppError.unsupportedOperatingSystemVersion(ProcessInfo.processInfo.operatingSystemVersion)
             #else
-            
             let spotlightPath = "Applications/Spotlight.app/Spotlight"
             let spotlightFileURL = self.patchDirectory.appendingPathComponent(spotlightPath)
             

AltStore/Operations/SendAppOperation.swift

@@ -25,39 +25,48 @@ final class SendAppOperation: ResultOperation<()>
         self.progress.totalUnitCount = 1
     }
     
-    override func main()
-    {
+    override func main() {
         super.main()
-        
-        if let error = self.context.error
-        {
+
+        if let error = self.context.error {
             return self.finish(.failure(error))
         }
-        
+
         guard let resignedApp = self.context.resignedApp else {
             return self.finish(.failure(OperationError.invalidParameters("SendAppOperation.main: self.resignedApp is nil")))
         }
-                
-        // self.context.resignedApp.fileURL points to the app bundle, but we want the .ipa.
+
+        let shortcutURLoff = URL(string: "shortcuts://run-shortcut?name=TurnOffData")!
+
         let app = AnyApp(name: resignedApp.name, bundleIdentifier: self.context.bundleIdentifier, url: resignedApp.fileURL, storeApp: nil)
         let fileURL = InstalledApp.refreshedIPAURL(for: app)
-        
         print("AFC App `fileURL`: \(fileURL.absoluteString)")
-        
-        if let data = NSData(contentsOf: fileURL) {
-            do {
-                let bytes = Data(data)
-                try yeetAppAFC(app.bundleIdentifier, bytes)
-                self.progress.completedUnitCount += 1
-                self.finish(.success(()))
-            } catch {
-                self.finish(.failure(MinimuxerError.RwAfc))
-                self.progress.completedUnitCount += 1
-                self.finish(.success(()))
+
+        // Wait for Shortcut to Finish Before Proceeding
+        UIApplication.shared.open(shortcutURLoff, options: [:]) { _ in
+            print("Shortcut finished execution. Proceeding with file transfer.")
+
+            DispatchQueue.global().async {
+                self.processFile(at: fileURL, for: app.bundleIdentifier)
             }
-        } else {
+        }
+    }
+
+    private func processFile(at fileURL: URL, for bundleIdentifier: String) {
+        guard let data = NSData(contentsOf: fileURL) else {
             print("IPA doesn't exist????")
-            self.finish(.failure(OperationError(.appNotFound(name: resignedApp.name))))
+            return self.finish(.failure(OperationError(.appNotFound(name: bundleIdentifier))))
+        }
+
+        do {
+            let bytes = Data(data)
+            try yeetAppAFC(bundleIdentifier, bytes)
+            self.progress.completedUnitCount += 1
+            self.finish(.success(()))
+        } catch {
+            self.finish(.failure(MinimuxerError.RwAfc))
+            self.progress.completedUnitCount += 1
+            self.finish(.success(()))
         }
     }
 }

AltStoreCore/Model/DatabaseManager/DatabaseManager.swift

@@ -399,6 +399,40 @@ private extension DatabaseManager
                 // For backwards compatibility reasons, we cannot use localApp's buildVersion as storeBuildVersion,
                 // or else the latest update will _always_ be considered new because we don't use buildVersions in our source (yet).
                 installedApp = InstalledApp(resignedApp: localApp, originalBundleIdentifier: StoreApp.altstoreAppID, certificateSerialNumber: serialNumber, storeBuildVersion: nil, context: context)
+                
+                // figure out if the current AltStoreApp is signed with "Use Main Profie" option
+                // by checking if the first extension's entitlement's application-identifier matches current one
+                repeat {
+                    guard let pluginURL = Bundle.main.builtInPlugInsURL else {
+                        installedApp.useMainProfile = true
+                        break
+                    }
+                    guard let pluginFolders = try? FileManager.default.contentsOfDirectory(at: pluginURL, includingPropertiesForKeys: nil) else {
+                        installedApp.useMainProfile = true
+                        break
+                    }
+                    
+                    guard let pluginFolder = pluginFolders.first, let altPluginApp = ALTApplication(fileURL: pluginFolder) else {
+                        installedApp.useMainProfile = true
+                        break
+                    }
+                    
+                    let entitlements = altPluginApp.entitlements
+                    guard let appId = entitlements[ALTEntitlement.applicationIdentifier] as? String else {
+                        installedApp.useMainProfile = false
+                        print("no ALTEntitlementApplicationIdentifier???")
+                        break
+                    }
+                    
+                    if appId.hasSuffix(Bundle.main.bundleIdentifier!) {
+                        installedApp.useMainProfile = true
+                    } else {
+                        installedApp.useMainProfile = false
+                    }
+                    
+                    
+                } while(false)
+                
                 installedApp.storeApp = storeApp
             }
             

SideStore/IfManager.swift

@@ -0,0 +1,132 @@
+//
+//  IfManager.swift
+//  AltStore
+//
+//  Created by ny on 2/27/26.
+//  Copyright © 2026 SideStore. All rights reserved.
+//
+
+import Foundation
+import Network
+
+fileprivate func uti(_ uint: UInt32) -> String? {
+    var buf = [CChar](repeating: 0, count: Int(NI_MAXHOST))
+    var addr = in_addr(s_addr: uint.bigEndian)
+    guard inet_ntop(AF_INET, &addr, &buf, UInt32(INET_ADDRSTRLEN)) != nil,
+        let str = String(utf8String: buf) else { return nil }
+    return str
+}
+
+fileprivate func socktouint(_ sock: inout sockaddr) -> UInt32 {
+    var buf = [CChar](repeating: 0, count: Int(NI_MAXHOST))
+    guard getnameinfo(&sock, socklen_t(sock.sa_len), &buf, socklen_t(buf.count), nil, socklen_t(0), NI_NUMERICHOST) == 0,
+          let name = String(utf8String: buf) else {
+        return 0
+    }
+    var addr = in_addr()
+    guard name.withCString({ cString in
+        inet_pton(AF_INET, cString, &addr)
+    }) == 1 else { return 0 }
+    return addr.s_addr.bigEndian
+}
+
+public struct NetInfo: Hashable, CustomStringConvertible {
+    public let name: String
+    public let hostIP: String
+    public let destIP: String
+    public let maskIP: String
+    
+    private let host: UInt32
+    private let dest: UInt32
+    private let mask: UInt32
+    
+    init(name: String, host: UInt32, dest: UInt32, mask: UInt32) {
+        self.name = name
+        self.host = host
+        self.dest = dest
+        self.mask = mask
+        self.hostIP = uti(host) ?? "10.7.0.0"
+        self.destIP = uti(dest) ?? "10.7.0.1"
+        self.maskIP = uti(mask) ?? "255.255.255.0"
+    }
+    
+    init?(_ ifaddr: ifaddrs) {
+        guard
+            let ianame = String(utf8String: ifaddr.ifa_name)
+        else { return nil }
+        
+        let host = socktouint(&ifaddr.ifa_addr.pointee)
+        let dest = socktouint(&ifaddr.ifa_dstaddr.pointee)
+        let mask = socktouint(&ifaddr.ifa_netmask.pointee)
+        
+        self.init(name: ianame, host: host, dest: dest, mask: mask)
+    }
+    
+    // computed networking values (still numeric internally)
+    public var minIP: UInt32 { host & mask }
+    public var maxIP: UInt32 { host | ~mask }
+    
+    public var minIPString: String { uti(minIP) ?? "nil" }
+    public var maxIPString: String { uti(maxIP) ?? "nil" }
+    
+    public var description: String {
+        "\(name) | ip=\(hostIP) dest=\(destIP) mask=\(maskIP) range=\(minIPString)-\(maxIPString)"
+    }
+}
+
+final class IfManager: Sendable {
+    public static let shared = IfManager()
+    nonisolated(unsafe) private(set) var addrs: Set<NetInfo> = Set()
+
+    private init() {
+        self.addrs = IfManager.query()
+    }
+
+    
+    public func query() {
+        addrs = IfManager.query()
+    }
+
+    private static func query() -> Set<NetInfo> {
+        var addrs = Set<NetInfo>()
+        var head: UnsafeMutablePointer<ifaddrs>? = nil
+        guard getifaddrs(&head) == 0, let first = head else { return addrs }
+        defer { freeifaddrs(head) }
+
+        var cursor: UnsafeMutablePointer<ifaddrs>? = first
+        while let current = cursor {
+            // we only want v4 interfaces that aren't loopback and aren't masked 255.255.255.255
+            let entry = current.pointee
+            let flags = Int32(entry.ifa_flags)
+
+            let isIPv4 = entry.ifa_addr.pointee.sa_family == UInt8(AF_INET)
+            let isActive = (flags & (IFF_UP | IFF_RUNNING | IFF_LOOPBACK)) == (IFF_UP | IFF_RUNNING)
+
+            if isIPv4, isActive, let info = NetInfo(entry), info.maskIP != "255.255.255.255" {
+                addrs.insert(info)
+            }
+
+            cursor = entry.ifa_next
+        }
+        return addrs
+    }
+    
+    private var nextLAN: NetInfo? {
+        addrs.first { $0.name.starts(with: "en") }
+    }
+    
+    var nextProbableSideVPN: NetInfo? {
+        // try old 10.7.0.1 first, then fallback to next v4
+        // user should only be connected to StosVPN/LocalDevVPN
+        addrs.first {
+            $0.hostIP == "10.7.0.1" ||
+            $0.name.starts(with: "utun")
+        }
+    }
+    
+    var sideVPNPatched: Bool {
+        nextLAN?.maskIP == nextProbableSideVPN?.maskIP &&
+        nextLAN?.maxIP == nextProbableSideVPN?.maxIP
+    }
+}
+

SideStore/MinimuxerWrapper.swift

@@ -13,14 +13,21 @@ var isMinimuxerReady: Bool {
     print("isMinimuxerReady property is always true on simulator")
     return true
     #else
-    return minimuxer.ready()
+    IfManager.shared.query()
+    if #available(iOS 26.4, *) {
+        print("Running patched check")
+        return minimuxer.ready() && IfManager.shared.sideVPNPatched
+    } else {
+        return minimuxer.ready()
+    }
     #endif
 }
 
-func minimuxerStartWithLogger(_ pairingFile: String,_ logPath: String,_ loggingEnabled: Bool) throws {
+func minimuxerStartWithLogger(_ pairingFile: String, _ logPath: String, _ loggingEnabled: Bool) throws {
     #if targetEnvironment(simulator)
-    print("minimuxerStartWithLogger(\(pairingFile), \(logPath), \(loggingEnabled) is no-op on simulator")
+    print("minimuxerStartWithLogger(\(pairingFile), \(logPath), \(loggingEnabled)) is no-op on simulator")
     #else
+    print("minimuxerStartWithLogger(\(pairingFile), \(logPath), \(loggingEnabled))")
     try minimuxer.startWithLogger(pairingFile, logPath, loggingEnabled)
     #endif
 }
@@ -37,7 +44,8 @@ func installProvisioningProfiles(_ profileData: Data) throws {
     #if targetEnvironment(simulator)
     print("installProvisioningProfiles(\(profileData)) is no-op on simulator")
     #else
-    try minimuxer.install_provisioning_profile(profileData.toRustByteSlice().forRust())
+    let slice = profileData.toRustByteSlice()
+    try minimuxer.install_provisioning_profile(slice.forRust())
     #endif
 }
 
@@ -55,7 +63,8 @@ func yeetAppAFC(_ bundleId: String, _ rawBytes: Data) throws {
     #if targetEnvironment(simulator)
     print("yeetAppAFC(\(bundleId), \(rawBytes)) is no-op on simulator")
     #else
-    try minimuxer.yeet_app_afc(bundleId, rawBytes.toRustByteSlice().forRust())
+    let slice = rawBytes.toRustByteSlice()
+    try minimuxer.yeet_app_afc(bundleId, slice.forRust())
     #endif
 }
 

scripts/ci/generate_release_notes.py

@@ -0,0 +1,298 @@
+#!/usr/bin/env python3
+import subprocess
+import sys
+import os
+import re
+from pathlib import Path
+
+IGNORED_AUTHORS = []
+
+TAG_MARKER = "###"
+HEADER_MARKER = "####"
+
+
+# ----------------------------------------------------------
+# helpers
+# ----------------------------------------------------------
+
+def run(cmd: str) -> str:
+    return subprocess.check_output(cmd, shell=True, text=True).strip()
+
+
+def commit_exists(rev: str) -> bool:
+    if not rev:
+        return False
+    try:
+        subprocess.check_output(
+            f"git rev-parse --verify {rev}^{{commit}}",
+            shell=True,
+            stderr=subprocess.DEVNULL,
+        )
+        return True
+    except subprocess.CalledProcessError:
+        return False
+
+
+def head_commit():
+    return run("git rev-parse HEAD")
+
+
+def first_commit():
+    return run("git rev-list --max-parents=0 HEAD").splitlines()[0]
+
+
+def repo_url():
+    url = run("git config --get remote.origin.url")
+    if url.startswith("git@"):
+        url = url.replace("git@", "https://").replace(":", "/")
+    return url.removesuffix(".git")
+
+
+def commit_messages(start, end="HEAD"):
+    out = run(f"git log {start}..{end} --pretty=format:%s")
+    return out.splitlines() if out else []
+
+
+def authors(range_expr, fmt="%an"):
+    try:
+        out = run(f"git log {range_expr} --pretty=format:{fmt}")
+        result = {a.strip() for a in out.splitlines() if a.strip()}
+        return result - set(IGNORED_AUTHORS)
+    except subprocess.CalledProcessError:
+        return set()
+
+
+def branch_base():
+    try:
+        default_ref = run("git rev-parse --abbrev-ref origin/HEAD")
+        default_branch = default_ref.split("/")[-1]
+        return run(f"git merge-base HEAD origin/{default_branch}")
+    except Exception:
+        return first_commit()
+
+
+def fmt_msg(msg):
+    msg = msg.lstrip()
+    if msg.startswith("-"):
+        msg = msg[1:].strip()
+    return f"- {msg}"
+
+
+def fmt_author(author):
+    return author if author.startswith("@") else f"@{author.split()[0]}"
+
+
+# ----------------------------------------------------------
+# release note generation
+# ----------------------------------------------------------
+
+def resolve_start_commit(last_successful: str):
+    if commit_exists(last_successful):
+        return last_successful
+
+    try:
+        return run("git rev-parse HEAD~10")
+    except Exception:
+        return first_commit()
+
+
+def generate_release_notes(last_successful, tag, branch):
+    current = head_commit()
+
+    # fallback if missing/invalid
+    if not last_successful or not commit_exists(last_successful):
+        try:
+            last_successful = run("git rev-parse HEAD~10")
+        except Exception:
+            last_successful = first_commit()
+
+    messages = commit_messages(last_successful, current)
+
+    # fallback if empty range
+    if not messages:
+        try:
+            last_successful = run("git rev-parse HEAD~10")
+        except Exception:
+            last_successful = first_commit()
+        messages = commit_messages(last_successful, current)
+
+    section = f"{TAG_MARKER} {tag}\n"
+    section += f"{HEADER_MARKER} What's Changed\n"
+
+    if not messages or last_successful == current:
+        section += "- Nothing...\n"
+    else:
+        for m in messages:
+            section += f"{fmt_msg(m)}\n"
+
+    if commit_exists(branch):
+        previous_range = branch
+    else:
+        previous_range = last_successful
+
+    prev_authors = authors(previous_range)
+    recent_authors = authors(f"{last_successful}..{current}")
+    new_authors = recent_authors - prev_authors
+
+    if new_authors:
+        section += f"\n{HEADER_MARKER} New Contributors\n"
+        for a in sorted(new_authors):
+            section += f"- {fmt_author(a)} made their first contribution\n"
+
+    if messages and last_successful != current:
+        url = repo_url()
+        section += (
+            f"\n{HEADER_MARKER} Full Changelog: "
+            f"[{ref_display(last_successful)}...{ref_display(current)}]"
+            f"({url}/compare/{last_successful}...{current})\n"
+        )
+
+    return section
+
+
+def ref_display(ref):
+    try:
+        tag = run(f'git describe --tags --exact-match "{ref}" 2>/dev/null || true').strip()
+
+        # allow only semantic version tags: X.Y.Z
+        if re.fullmatch(r'\d+\.\d+\.\d+', tag):
+            return tag
+    except Exception:
+        pass
+
+    return ref[:8]
+
+
+# ----------------------------------------------------------
+# markdown update
+# ----------------------------------------------------------
+
+def update_release_md(existing, new_section, tag):
+    if not existing:
+        return new_section
+
+    tag_lower = tag.lower()
+    is_special = tag_lower in {"alpha", "beta", "nightly"}
+
+    pattern = fr"(^{TAG_MARKER} .*$)"
+    parts = re.split(pattern, existing, flags=re.MULTILINE)
+
+    processed = []
+    special_seen = {"alpha": False, "beta": False, "nightly": False}
+    last_special_idx = -1
+
+    i = 0
+    while i < len(parts):
+        if i % 2 == 1:
+            header = parts[i]
+            name = header[3:].strip().lower()
+
+            if name in special_seen:
+                special_seen[name] = True
+                last_special_idx = len(processed)
+
+            if name == tag_lower:
+                i += 2
+                continue
+
+        processed.append(parts[i])
+        i += 1
+
+    insert_pos = 0
+    if is_special:
+        order = ["alpha", "beta", "nightly"]
+        for t in order:
+            if t == tag_lower:
+                break
+            if special_seen[t]:
+                idx = processed.index(f"{TAG_MARKER} {t}")
+                insert_pos = idx + 2
+    elif last_special_idx >= 0:
+        insert_pos = last_special_idx + 2
+
+    processed.insert(insert_pos, new_section)
+
+    result = ""
+    for part in processed:
+        if part.startswith(f"{TAG_MARKER} ") and not result.endswith("\n\n"):
+            result = result.rstrip("\n") + "\n\n"
+        result += part
+
+    return result.rstrip() + "\n"
+
+
+# ----------------------------------------------------------
+# retrieval
+# ----------------------------------------------------------
+
+def retrieve_tag(tag, file_path: Path):
+    if not file_path.exists():
+        return ""
+
+    content = file_path.read_text()
+
+    match = re.search(
+        fr"^{TAG_MARKER} {re.escape(tag)}$",
+        content,
+        re.MULTILINE | re.IGNORECASE,
+        )
+
+    if not match:
+        return ""
+
+    start = match.end()
+    if start < len(content) and content[start] == "\n":
+        start += 1
+
+    next_tag = re.search(fr"^{TAG_MARKER} ", content[start:], re.MULTILINE)
+    end = start + next_tag.start() if next_tag else len(content)
+
+    return content[start:end].strip()
+
+
+# ----------------------------------------------------------
+# entrypoint
+# ----------------------------------------------------------
+
+def main():
+    args = sys.argv[1:]
+
+    if not args:
+        sys.exit(
+            "Usage:\n"
+            "  generate_release_notes.py <last_successful> [tag] [branch] [--output-dir DIR]\n"
+            "  generate_release_notes.py --retrieve <tag> [--output-dir DIR]"
+        )
+
+    output_dir = Path.cwd()
+
+    if "--output-dir" in args:
+        idx = args.index("--output-dir")
+        output_dir = Path(args[idx + 1]).resolve()
+        del args[idx:idx + 2]
+
+    output_dir.mkdir(parents=True, exist_ok=True)
+    release_file = output_dir / "release-notes.md"
+
+    if args[0] == "--retrieve":
+        print(retrieve_tag(args[1], release_file))
+        return
+
+    last_successful = args[0]
+    tag = args[1] if len(args) > 1 else head_commit()
+    branch = args[2] if len(args) > 2 else (
+        os.environ.get("GITHUB_REF") or branch_base()
+    )
+
+    new_section = generate_release_notes(last_successful, tag, branch)
+
+    existing = release_file.read_text() if release_file.exists() else ""
+    updated = update_release_md(existing, new_section, tag)
+
+    release_file.write_text(updated)
+
+    print(new_section)
+
+
+if __name__ == "__main__":
+    main()

scripts/ci/generate_source_metadata.py

@@ -0,0 +1,176 @@
+#!/usr/bin/env python3
+import datetime
+import hashlib
+import json
+import subprocess
+from pathlib import Path
+import argparse
+import sys
+
+SCRIPT_DIR = Path(__file__).resolve().parent
+
+
+# ----------------------------------------------------------
+# helpers
+# ----------------------------------------------------------
+
+def resolve_script(name: str) -> Path:
+    p = Path.cwd() / name
+    if p.exists():
+        return p
+    return SCRIPT_DIR / name
+
+
+def sh(cmd: str, cwd: Path) -> str:
+    try:
+        return subprocess.check_output(
+            cmd,
+            shell=True,
+            cwd=cwd,
+            stderr=subprocess.STDOUT,
+        ).decode().strip()
+    except subprocess.CalledProcessError as e:
+        print(e.output.decode(), file=sys.stderr)
+        raise SystemExit(f"Command failed: {cmd}")
+
+
+def file_size(path: Path) -> int:
+    if not path.exists():
+        raise SystemExit(f"Missing file: {path}")
+    return path.stat().st_size
+
+
+def sha256(path: Path) -> str:
+    h = hashlib.sha256()
+    with open(path, "rb") as f:
+        while chunk := f.read(1024 * 1024):
+            h.update(chunk)
+    return h.hexdigest()
+
+
+# ----------------------------------------------------------
+# entry
+# ----------------------------------------------------------
+
+def main():
+    p = argparse.ArgumentParser()
+
+    p.add_argument("--repo-root", required=True)
+    p.add_argument("--ipa", required=True)
+    p.add_argument("--output-dir", required=True)
+
+    p.add_argument(
+        "--output-name",
+        default="source_metadata.json",
+    )
+
+    p.add_argument("--release-notes-dir", required=True)
+
+    p.add_argument("--release-tag", required=True)
+    p.add_argument("--marketing-version", required=True)
+    p.add_argument("--short-commit", required=True)
+    p.add_argument("--release-channel", required=True)
+    p.add_argument("--bundle-id", required=True)
+
+    # optional
+    p.add_argument("--last-successful-commit")
+
+    p.add_argument("--is-beta", action="store_true")
+
+    args = p.parse_args()
+
+    repo_root = Path(args.repo_root).resolve()
+    ipa_path = Path(args.ipa).resolve()
+    out_dir = Path(args.output_dir).resolve()
+    notes_dir = Path(args.release_notes_dir).resolve()
+
+    if not repo_root.is_dir():
+        raise SystemExit(f"Invalid repo root: {repo_root}")
+
+    if not ipa_path.is_file():
+        raise SystemExit(f"Invalid IPA path: {ipa_path}")
+
+    notes_dir.mkdir(parents=True, exist_ok=True)
+    out_dir.mkdir(parents=True, exist_ok=True)
+
+    out_file = out_dir / args.output_name
+
+    # ------------------------------------------------------
+    # generate release notes
+    # ------------------------------------------------------
+
+    print("Generating release notes…")
+
+    script = resolve_script("generate_release_notes.py")
+
+    if args.last_successful_commit:
+        gen_cmd = (
+            f"python3 {script} "
+            f"{args.last_successful_commit} {args.release_tag} "
+            f'--output-dir "{notes_dir}"'
+        )
+    else:
+        gen_cmd = (
+            f"python3 {script} "
+            f"{args.short_commit} {args.release_tag} "
+            f'--output-dir "{notes_dir}"'
+        )
+
+    sh(gen_cmd, cwd=repo_root)
+
+    # ------------------------------------------------------
+    # retrieve release notes
+    # ------------------------------------------------------
+
+    notes = sh(
+        (
+            f"python3 {script} "
+            f"--retrieve {args.release_tag} "
+            f"--output-dir \"{notes_dir}\""
+        ),
+        cwd=repo_root,
+    )
+
+    # ------------------------------------------------------
+    # compute metadata
+    # ------------------------------------------------------
+
+    now = datetime.datetime.now(datetime.timezone.utc)
+    formatted = now.strftime("%Y-%m-%dT%H:%M:%SZ")
+    human = now.strftime("%c")
+
+    localized_description = getFormattedLocalizedDescription(args.marketing_version, args.short_commit, human, notes)
+
+    metadata = {
+        "is_beta": bool(args.is_beta),
+        "bundle_identifier": args.bundle_id,
+        "version_ipa": args.marketing_version,
+        "version_date": formatted,
+        "release_channel": args.release_channel.lower(),
+        "size": file_size(ipa_path),
+        "sha256": sha256(ipa_path),
+        "download_url": (
+            "https://github.com/SideStore/SideStore/releases/download/"
+            f"{args.release_tag}/SideStore.ipa"
+        ),
+        "localized_description": localized_description,
+    }
+
+    with open(out_file, "w", encoding="utf-8") as f:
+        json.dump(metadata, f, indent=2, ensure_ascii=False)
+
+    print(f"Wrote {out_file}")
+
+def getFormattedLocalizedDescription(marketing_version, short_commit, human, notes):
+    return f"""
+This is release for:
+  - version: "{marketing_version}"
+  - revision: "{short_commit}"
+  - timestamp: "{human}"
+
+Release Notes:
+{notes}
+""".lstrip("\n")
+
+if __name__ == "__main__":
+    main()

scripts/ci/update_source_metadata.py

@@ -0,0 +1,181 @@
+#!/usr/bin/env python3
+
+import json
+import sys
+from pathlib import Path
+
+
+# ----------------------------------------------------------
+# metadata
+# ----------------------------------------------------------
+
+def load_metadata(metadata_file: Path):
+    if not metadata_file.exists():
+        raise SystemExit(f"Missing metadata file: {metadata_file}")
+
+    with open(metadata_file, "r", encoding="utf-8") as f:
+        meta = json.load(f)
+
+    print("  ====> Required parameter list <====")
+    for k, v in meta.items():
+        print(f"{k}: {v}")
+
+    required = [
+        "bundle_identifier",
+        "version_ipa",
+        "version_date",
+        "release_channel",
+        "size",
+        "sha256",
+        "localized_description",
+        "download_url",
+    ]
+
+    for r in required:
+        if not meta.get(r):
+            raise SystemExit("One or more required metadata fields missing")
+
+    meta["size"] = int(meta["size"])
+    meta["release_channel"] = meta["release_channel"].lower()
+
+    return meta
+
+
+# ----------------------------------------------------------
+# source loading
+# ----------------------------------------------------------
+
+def load_source(source_file: Path):
+    if source_file.exists():
+        with open(source_file, "r", encoding="utf-8") as f:
+            data = json.load(f)
+    else:
+        print("source.json missing — creating minimal structure")
+        data = {"version": 2, "apps": []}
+
+    if int(data.get("version", 1)) < 2:
+        raise SystemExit("Only v2 and above are supported")
+
+    return data
+
+
+# ----------------------------------------------------------
+# locate app
+# ----------------------------------------------------------
+
+def ensure_app(data, bundle_id):
+    apps = data.setdefault("apps", [])
+
+    app = next(
+        (a for a in apps if a.get("bundleIdentifier") == bundle_id),
+        None,
+    )
+
+    if app is None:
+        print("App entry missing — creating new app entry")
+        app = {
+            "bundleIdentifier": bundle_id,
+            "releaseChannels": [],
+        }
+        apps.append(app)
+
+    return app
+
+
+# ----------------------------------------------------------
+# update storefront
+# ----------------------------------------------------------
+
+def update_storefront_if_needed(app, meta):
+    if meta["release_channel"] == "stable":
+        app.update({
+            "version": meta["version_ipa"],
+            "versionDate": meta["version_date"],
+            "size": meta["size"],
+            "sha256": meta["sha256"],
+            "localizedDescription": meta["localized_description"],
+            "downloadURL": meta["download_url"],
+        })
+
+
+# ----------------------------------------------------------
+# update release channel (ORIGINAL FORMAT)
+# ----------------------------------------------------------
+
+def update_release_channel(app, meta):
+    channels = app.setdefault("releaseChannels", [])
+
+    new_version = {
+        "version": meta["version_ipa"],
+        "date": meta["version_date"],
+        "localizedDescription": meta["localized_description"],
+        "downloadURL": meta["download_url"],
+        "size": meta["size"],
+        "sha256": meta["sha256"],
+    }
+
+    tracks = [
+        t for t in channels
+        if isinstance(t, dict)
+        and t.get("track") == meta["release_channel"]
+    ]
+
+    if len(tracks) > 1:
+        raise SystemExit(f"Multiple tracks named {meta['release_channel']}")
+
+    if not tracks:
+        channels.insert(0, {
+            "track": meta["release_channel"],
+            "releases": [new_version],
+        })
+    else:
+        track = tracks[0]
+        releases = track.setdefault("releases", [])
+
+        if not releases:
+            releases.append(new_version)
+        else:
+            releases[0] = new_version
+
+
+# ----------------------------------------------------------
+# save
+# ----------------------------------------------------------
+
+def save_source(source_file: Path, data):
+    print("\nUpdated Sources File:\n")
+    print(json.dumps(data, indent=2, ensure_ascii=False))
+
+    source_file.parent.mkdir(parents=True, exist_ok=True)
+
+    with open(source_file, "w", encoding="utf-8") as f:
+        json.dump(data, f, indent=2, ensure_ascii=False)
+
+    print("JSON successfully updated.")
+
+
+# ----------------------------------------------------------
+# main
+# ----------------------------------------------------------
+
+def main():
+    if len(sys.argv) < 3:
+        print("Usage: python3 update_apps.py <metadata.json> <source.json>")
+        sys.exit(1)
+
+    metadata_file = Path(sys.argv[1])
+    source_file = Path(sys.argv[2])
+
+    meta = load_metadata(metadata_file)
+    data = load_source(source_file)
+
+    app = ensure_app(data, meta["bundle_identifier"])
+
+    update_storefront_if_needed(app, meta)
+    update_release_channel(app, meta)
+
+    save_source(source_file, data)
+
+
+if __name__ == "__main__":
+    main()

scripts/ci/workflow.py

@@ -0,0 +1,571 @@
+#!/usr/bin/env python3
+import os
+import sys
+import subprocess
+import datetime
+from pathlib import Path
+import time
+import json
+import re
+from posix import getcwd
+
+# REPO ROOT relative to script dir
+ROOT = Path(__file__).resolve().parents[2]
+SCRIPTS = ROOT / 'scripts/ci'
+BUILD_SETTINGS_OUTFILE = "project-build-settings.txt"
+
+# ----------------------------------------------------------
+# helpers
+# ----------------------------------------------------------
+
+def run(cmd, check=True, cwd=None):
+    wd = cwd if cwd is not None else ROOT
+    print(f"$ {cmd}", flush=True, file=sys.stderr)
+    subprocess.run(
+        cmd,
+        shell=True,
+        cwd=wd,
+        check=check,
+        stdout=sys.stderr,
+        stderr=sys.stderr,
+    )
+    print("", flush=True, file=sys.stderr)
+
+def runAndGet(cmd, cwd=None):
+    wd = cwd if cwd is not None else ROOT
+    print(f"$ {cmd}", flush=True, file=sys.stderr)
+    result = subprocess.run(
+        cmd,
+        shell=True,
+        cwd=wd,
+        stdout=subprocess.PIPE,
+        stderr=sys.stderr,
+        text=True,
+        check=True,
+    )
+    out = result.stdout.strip()
+    print(out, flush=True, file=sys.stderr)
+    print("", flush=True, file=sys.stderr)
+    return out
+
+def getenv(name, default=""):
+    return os.environ.get(name, default)
+
+# ----------------------------------------------------------
+# SHARED
+# ----------------------------------------------------------
+
+def short_commit():
+    return runAndGet("git rev-parse --short HEAD")
+
+def count_new_commits(last_commit):
+    if not last_commit or not last_commit.strip():
+        return 0
+
+    try:
+        total = int(runAndGet("git rev-list --count HEAD"))
+        if total == 1:
+            head = runAndGet("git rev-parse HEAD")
+            return 1 if head != last_commit else 0
+
+        out = runAndGet(f"git rev-list --count {last_commit}..HEAD")
+        return int(out)
+    except Exception:
+        return 0
+
+# ----------------------------------------------------------
+# PROJECT INFO
+# ----------------------------------------------------------
+def dump_project_settings(outdir=None):
+    outfile = Path(outdir).resolve() / BUILD_SETTINGS_OUTFILE if outdir else BUILD_SETTINGS_OUTFILE
+    run(f"xcodebuild -showBuildSettings 2>&1 > '{outfile}'")
+
+def _extract_setting(cmd):
+    out = runAndGet(cmd + " || true").strip()   # prevent grep failure from aborting
+    return out if out else None
+
+def _read_dumped_build_setting(name):
+    return _extract_setting(
+        f"cat '{BUILD_SETTINGS_OUTFILE}' "
+        f"| grep '{name} = ' "
+        "| tail -1 "
+        "| sed -e 's/.*= //g'"
+    )
+
+def query_build_setting(name):
+    return _extract_setting(
+        f"xcodebuild -showBuildSettings 2>&1 "
+        f"| grep '{name} = ' "
+        "| tail -1 "
+        "| sed -e 's/.*= //g'"
+    )
+
+def get_product_name():  return query_build_setting("PRODUCT_NAME")
+def get_bundle_id():     return query_build_setting("PRODUCT_BUNDLE_IDENTIFIER")
+def read_product_name(): return _read_dumped_build_setting("PRODUCT_NAME")
+def read_bundle_id():    return _read_dumped_build_setting("PRODUCT_BUNDLE_IDENTIFIER")
+
+def get_marketing_version():
+    return runAndGet(f"grep MARKETING_VERSION {ROOT}/Build.xcconfig | sed -e 's/MARKETING_VERSION = //g'")
+
+def set_marketing_version(version):
+    run(
+        f"sed -E -i '' "
+        f"'s/^MARKETING_VERSION = .*/MARKETING_VERSION = {version}/' "
+        f"{ROOT}/Build.xcconfig"
+    )
+
+
+def compute_normalized_version(marketing, build_num, short):
+    now = datetime.datetime.now(datetime.UTC)
+    date = now.strftime("%Y%m%d")   # normalized date
+    base = marketing.strip()
+    return f"{base}-{date}.{build_num}+{short}"
+
+# ----------------------------------------------------------
+# CLEAN
+# ----------------------------------------------------------
+
+def clean():
+    run("make clean")
+
+def clean_derived_data():
+    run("rm -rf ~/Library/Developer/Xcode/DerivedData/*", check=False)
+
+def clean_spm_cache():
+    run("rm -rf ~/Library/Caches/org.swift.swiftpm/*", check=False)
+
+# ----------------------------------------------------------
+# BUILD
+# ----------------------------------------------------------
+
+def build():
+    run("mkdir -p build/logs")
+    run(
+        "set -o pipefail && "
+        "NSUnbufferedIO=YES make -B build "
+        "2>&1 | tee -a build/logs/build.log | xcbeautify --renderer github-actions"
+    )
+    run("make fakesign | tee -a build/logs/build.log")
+    run("make ipa | tee -a build/logs/build.log")
+    run("zip -r -9 ./SideStore.dSYMs.zip ./SideStore.xcarchive/dSYMs")
+
+# ----------------------------------------------------------
+# TESTS BUILD
+# ----------------------------------------------------------
+
+def tests_build():
+    run("mkdir -p build/logs")
+    run(
+        "NSUnbufferedIO=YES make -B build-tests "
+        "2>&1 | tee -a build/logs/tests-build.log | xcbeautify --renderer github-actions"
+    )
+
+# ----------------------------------------------------------
+# TESTS RUN
+# ----------------------------------------------------------
+
+def is_sim_booted(model):
+    out = runAndGet(f'xcrun simctl list devices "{model}"')
+    return "Booted" in out
+
+def boot_sim_async(model):
+    log = ROOT / "build/logs/tests-run.log"
+    log.parent.mkdir(parents=True, exist_ok=True)
+
+    if is_sim_booted(model):
+        run(f'echo "Simulator {model} already booted." | tee -a {log}')
+        return
+
+    run(f'echo "Booting simulator {model} asynchronously..." | tee -a {log}')
+
+    with open(log, "a") as f:
+        subprocess.Popen(
+            ["xcrun", "simctl", "boot", model],
+            cwd=ROOT,
+            stdout=f,
+            stderr=subprocess.STDOUT,
+            start_new_session=True,
+        )
+
+def boot_sim_sync(model):
+    run("mkdir -p build/logs")
+
+    for i in range(1, 7):
+        if is_sim_booted(model):
+            run('echo "Simulator booted." | tee -a build/logs/tests-run.log')
+            return
+
+        run(f'echo "Simulator not ready (attempt {i}/6), retrying in 10s..." | tee -a build/logs/tests-run.log')
+        time.sleep(10)
+
+    raise SystemExit("Simulator failed to boot")
+
+def tests_run(model):
+    run("mkdir -p build/logs")
+
+    if not is_sim_booted(model):
+        boot_sim_sync(model)
+
+    run("make run-tests 2>&1 | tee -a build/logs/tests-run.log")
+    run("zip -r -9 ./test-results.zip ./build/tests")
+
+# ----------------------------------------------------------
+# LOG ENCRYPTION
+# ----------------------------------------------------------
+
+def encrypt_logs(name):
+    pwd = getenv("BUILD_LOG_ZIP_PASSWORD")
+    cwd = getcwd()
+    if not pwd or not pwd.strip():
+        print("BUILD_LOG_ZIP_PASSWORD not set — logs will be uploaded UNENCRYPTED", file=sys.stderr)
+        run(f'cd {cwd}/build/logs && zip -r {cwd}/{name}.zip *')
+        return
+    run(f'cd {cwd}/build/logs && zip -e -P "{pwd}" {cwd}/{name}.zip *')
+
+# ----------------------------------------------------------
+# RELEASE NOTES
+# ----------------------------------------------------------
+
+def release_notes(tag):
+    run(
+        f"python3 {SCRIPTS}/generate_release_notes.py "
+        f"{tag} "
+        f"--repo-root {ROOT} "
+        f"--output-dir {ROOT}"
+    )
+
+def retrieve_release_notes(tag):
+    return runAndGet(
+        f"python3 {SCRIPTS}/generate_release_notes.py "
+        f"--retrieve {tag} "
+        f"--output-dir {ROOT}"
+    )
+
+# ----------------------------------------------------------
+# DEPLOY SOURCE.JSON
+# ----------------------------------------------------------
+def generate_metadata(release_tag, short_commit, marketing_version, channel, bundle_id, ipa_name, last_successful_commit=None):
+    ipa_path = ROOT / ipa_name
+    metadata = 'source-metadata.json'
+
+    if not ipa_path.exists():
+        raise SystemExit(f"{ipa_path} missing")
+
+    cmd = (
+        f"python3 {SCRIPTS}/generate_source_metadata.py "
+        f"--repo-root {ROOT} "
+        f"--ipa {ipa_path} "
+        f"--output-dir {ROOT} "
+        f"--output-name {metadata} "
+        f"--release-notes-dir {ROOT} "
+        f"--release-tag {release_tag} "
+        f"--marketing-version {marketing_version} "
+        f"--short-commit {short_commit} "
+        f"--release-channel {channel} "
+        f"--bundle-id {bundle_id}"
+    )
+
+    if last_successful_commit:
+        cmd += f" --last-successful-commit {last_successful_commit}"
+
+    run(cmd)
+
+def deploy(repo, source_json, release_tag, marketing_version):
+    repo = (ROOT / repo).resolve()
+    source_json_path = repo / source_json
+    metadata = 'source-metadata.json'
+
+    if not repo.exists():
+        raise SystemExit(f"{repo} repo missing")
+
+    if not (repo / ".git").exists():
+        print("Repo is not a git repository, skipping deploy", file=sys.stderr)
+        return
+
+    if not source_json_path.exists():
+        raise SystemExit(f"{source_json} missing inside repo")
+
+    run("git config user.name 'GitHub Actions'", check=False)
+    run("git config user.email 'github-actions@github.com'", check=False)
+
+    # ------------------------------------------------------
+    run("git fetch origin main", check=False, cwd=repo)
+    run("git switch main || git switch -c main origin/main", cwd=repo)
+    run("git reset --hard origin/main", cwd=repo)
+    # ------------------------------------------------------
+
+    max_attempts = 5
+    for attempt in range(1, max_attempts + 1):
+        if attempt > 1:
+            run("git fetch --depth=1 origin HEAD", check=False, cwd=repo)
+            run("git reset --hard FETCH_HEAD", check=False, cwd=repo)
+
+        # regenerate after reset so we don't lose changes
+        run(f"python3 {SCRIPTS}/update_source_metadata.py '{ROOT}/{metadata}' '{source_json_path}'", cwd=repo)
+        run(f"git add --verbose {source_json}", cwd=repo)
+        run(f"git commit -m '{release_tag} - deployed {marketing_version}' || true", cwd=repo)
+
+        rc = subprocess.call("git push", shell=True, cwd=repo)
+
+        if rc == 0:
+            print("Deploy push succeeded", file=sys.stderr)
+            break
+
+        print(f"Push rejected (attempt {attempt}/{max_attempts}), retrying...", file=sys.stderr)
+        time.sleep(0.5)
+    else:
+        raise SystemExit("Deploy push failed after retries")
+
+
+def last_successful_commit(is_stable, tag=None):
+    is_stable = str(is_stable).lower() in ("1", "true", "yes")
+
+    try:
+        if is_stable:
+            prev_tag = runAndGet(
+                r'git tag --sort=-v:refname '
+                r'| grep -E "^[0-9]+\.[0-9]+\.[0-9]+$" '
+                r'| sed -n "2p" || true'
+            ).strip()
+
+            if prev_tag:
+                return runAndGet(f'git rev-parse "{prev_tag}^{{commit}}"')
+
+            return None   # ← changed
+
+        if tag:
+            exists = subprocess.call(
+                f'git rev-parse -q --verify "refs/tags/{tag}"',
+                shell=True,
+                stdout=subprocess.DEVNULL,
+                stderr=subprocess.DEVNULL,
+            ) == 0
+
+            if exists:
+                return runAndGet(f'git rev-parse "{tag}^{{commit}}"')
+
+    except Exception:
+        pass
+
+    return None
+
+def upload_release(release_name, release_tag, commit_sha, repo, upstream_tag_recommended, is_stable=False):
+    is_stable = str(is_stable).lower() in ("1", "true", "yes")
+    draft = False
+    prerelease = True
+    latest = False
+
+    if is_stable:
+        prerelease = False
+        latest = True
+
+    token = getenv("GH_TOKEN")
+    if token:
+        os.environ["GH_TOKEN"] = token
+
+    metadata_path = ROOT / "source-metadata.json"
+
+    if not metadata_path.exists():
+        raise SystemExit("source-metadata.json missing")
+
+    meta = json.loads(metadata_path.read_text())
+
+    marketing_version = meta.get("version_ipa")
+    build_datetime = meta.get("version_date")
+
+    dt = datetime.datetime.fromisoformat(
+        build_datetime.replace("Z", "+00:00")
+    )
+    built_time = dt.strftime("%a %b %d %H:%M:%S %Y")
+    built_date = dt.strftime("%Y-%m-%d")
+
+    release_notes = runAndGet(
+        f"python3 {SCRIPTS}/generate_release_notes.py "
+        f"--retrieve {release_tag} "
+        f"--output-dir {ROOT}"
+    )
+
+    if is_stable:
+        release_notes = re.sub(
+            r'(?im)^[ \t]*#{1,6}[ \t]*what[’\']?s[ \t]+changed[ \t]*$',
+            "## What's Changed",
+            release_notes,
+            flags=re.IGNORECASE | re.MULTILINE,
+        )
+
+    upstream_block = ""
+    if upstream_tag_recommended and upstream_tag_recommended.strip():
+        tag = upstream_tag_recommended.strip()
+        upstream_block = (
+            f"If you want to try out new features early but want a lower chance of bugs, "
+            f"you can look at [{repo} {tag}]"
+            f"(https://github.com/{repo}/releases?q={tag}).\n\n"
+        )
+
+    header = getFormattedUploadMsg(
+        release_name, commit_sha, repo, upstream_block,
+        built_time, built_date, marketing_version, is_stable,
+    )
+
+    body = header + release_notes.lstrip() + "\n"
+
+    body_file = ROOT / "release_body.md"
+    body_file.write_text(body, encoding="utf-8")
+
+    draft_flag = "--draft" if draft else ""
+    prerelease_flag = "--prerelease" if prerelease else ""
+    latest_flag = "--latest=true" if latest else ""
+
+    # create release if it doesn't exist
+    exists = subprocess.call(
+        f'gh release view "{release_tag}"',
+        shell=True,
+        cwd=ROOT,
+        stdout=subprocess.DEVNULL,
+        stderr=subprocess.DEVNULL,
+    ) == 0
+
+    if exists:
+        run(
+            f'gh release edit "{release_tag}" '
+            f'--title "{release_name}" '
+            f'--notes-file "{body_file}" '
+            f'{draft_flag} {prerelease_flag} {latest_flag}'
+        )
+    else:
+        run(
+            f'gh release create "{release_tag}" '
+            f'--title "{release_name}" '
+            f'--notes-file "{body_file}" '
+            f'{draft_flag} {prerelease_flag} {latest_flag}'
+        )
+
+    run(
+        f'gh release upload "{release_tag}" '
+        f'SideStore.ipa SideStore.dSYMs.zip build-logs.zip '
+        f'--clobber'
+    )
+
+    run(f'git tag -f "{release_tag}" "{commit_sha}"')
+    run(f'git push origin "refs/tags/{release_tag}" --force')
+
+
+def getFormattedUploadMsg(release_name, commit_sha, repo, upstream_block, built_time, built_date, marketing_version, is_stable):
+    experimental_header = ""
+    if not is_stable:
+        experimental_header = f"""
+This is an ⚠️ **EXPERIMENTAL** ⚠️ {release_name} build for commit [{commit_sha}](https://github.com/{repo}/commit/{commit_sha}).
+
+{release_name} builds are **extremely experimental builds only meant to be used by developers and beta testers. They often contain bugs and experimental features. Use at your own risk!**
+
+""".lstrip("\n")
+
+    header = f"""
+{experimental_header}{upstream_block}## Build Info
+
+Built at (UTC): `{built_time}`
+Built at (UTC date): `{built_date}`
+Commit SHA: `{commit_sha}`
+Version: `{marketing_version}`
+""".lstrip("\n")
+    return header
+
+# ----------------------------------------------------------
+# ENTRYPOINT
+# ----------------------------------------------------------
+
+COMMANDS = {
+    # ----------------------------------------------------------
+    # SHARED
+    # ----------------------------------------------------------
+    "commit-id"               : (short_commit,              0, ""),
+    "count-new-commits"       : (count_new_commits,         1, "<last_successful_commit>"),
+
+    # ----------------------------------------------------------
+    # PROJECT INFO
+    # ----------------------------------------------------------
+    "get-marketing-version"   : (get_marketing_version,     0, ""),
+    "set-marketing-version"   : (set_marketing_version,     1, "<normalized_version>"),
+    "compute-normalized"      : (compute_normalized_version,3, "<marketing> <build_num> <short_commit>"),
+    "get-product-name"        : (get_product_name,          0, ""),
+    "get-bundle-id"           : (get_bundle_id,             0, ""),
+    "dump-project-settings"   : (dump_project_settings,     0, ""),
+    "read-product-name"       : (read_product_name,         0, ""),
+    "read-bundle-id"          : (read_bundle_id,            0, ""),
+
+    # ----------------------------------------------------------
+    # CLEAN
+    # ----------------------------------------------------------
+    "clean"                   : (clean,                     0, ""),
+    "clean-derived-data"      : (clean_derived_data,        0, ""),
+    "clean-spm-cache"         : (clean_spm_cache,           0, ""),
+
+    # ----------------------------------------------------------
+    # BUILD
+    # ----------------------------------------------------------
+    "build"                   : (build,                     0, ""),
+
+    # ----------------------------------------------------------
+    # TESTS
+    # ----------------------------------------------------------
+    "tests-build"             : (tests_build,               0, ""),
+    "tests-run"               : (tests_run,                 1, "<model>"),
+    "boot-sim-async"          : (boot_sim_async,            1, "<model>"),
+    "boot-sim-sync"           : (boot_sim_sync,             1, "<model>"),
+
+    # ----------------------------------------------------------
+    # LOG ENCRYPTION
+    # ----------------------------------------------------------
+    "encrypt-build"           : (lambda: encrypt_logs("build-logs"),        0, ""),
+    "encrypt-tests-build"     : (lambda: encrypt_logs("tests-build-logs"),  0, ""),
+    "encrypt-tests-run"       : (lambda: encrypt_logs("tests-run-logs"),    0, ""),
+
+    # ----------------------------------------------------------
+    # RELEASE / DEPLOY
+    # ----------------------------------------------------------
+    "last-successful-commit"  : (last_successful_commit,     1, "<is_stable> [tag]"),
+    "release-notes"           : (release_notes,              1, "<tag>"),
+    "retrieve-release-notes"  : (retrieve_release_notes,     1, "<tag>"),
+    "generate-metadata"       : (generate_metadata,          7,
+                                 "<release_tag> <short_commit> <marketing_version> <channel> <bundle_id> <ipa_name> [last_successful_commit]"),
+    "deploy"                  : (deploy,                     4,
+                                 "<repo> <source_json> <release_tag> <marketing_version>"),
+    "upload-release"          : (upload_release,             5,
+                                 "<release_name> <release_tag> <commit_sha> <repo> <upstream_tag_recommended> [is_stable]"),}
+
+def main():
+    def usage():
+        lines = ["Available commands:"]
+        for name, (_, argc, arg_usage) in COMMANDS.items():
+            suffix = f" {arg_usage}" if arg_usage else ""
+            lines.append(f"  - {name}{suffix}")
+        return "\n".join(lines)
+
+    if len(sys.argv) < 2:
+        raise SystemExit(usage())
+
+    cmd = sys.argv[1]
+
+    if cmd not in COMMANDS:
+        raise SystemExit(
+            f"Unknown command '{cmd}'.\n\n{usage()}"
+        )
+
+    func, argc, arg_usage = COMMANDS[cmd]
+
+    if len(sys.argv) - 2 < argc:
+        suffix = f" {arg_usage}" if arg_usage else ""
+        raise SystemExit(f"Usage: workflow.py {cmd}{suffix}")
+
+    args = sys.argv[2:]
+
+    result = func(*args) if args else func()
+
+    # ONLY real outputs go to stdout
+    if result is not None:
+        sys.stdout.write(str(result))
+        sys.stdout.flush()
+
+if __name__ == "__main__":
+    main()

trustedapps.json

@@ -75,6 +75,14 @@
     {
       "identifier": "thatstel.la.altsource",
       "sourceURL": "https://alt.thatstel.la/"
+    },
+    {
+      "identifier": "com.deliacheminot.mona",
+      "sourceURL": "https://raw.githubusercontent.com/delia-cheminot/mona-hrt/refs/heads/main/ios_source.json"
+    },
+    {
+      "identifier": "moe.ampersand.app.source",
+      "sourceURL": "https://github.com/NyaomiDEV/Ampersand/releases/latest/download/altstore.json"
     }
   ],
   "sources": [
@@ -148,6 +156,14 @@
     {
       "identifier": "thatstel.la.altsource",
       "sourceURL": "https://alt.thatstel.la/"
+    },
+    {
+      "identifier": "com.deliacheminot.mona",
+      "sourceURL": "https://raw.githubusercontent.com/delia-cheminot/mona-hrt/refs/heads/main/ios_source.json"
+    },
+    {
+      "identifier": "moe.ampersand.app.source",
+      "sourceURL": "https://github.com/NyaomiDEV/Ampersand/releases/latest/download/altstore.json"
     }
   ]
 }

update_apps.py

@@ -1,192 +0,0 @@
-#!/usr/bin/env python3
-
-import os
-import json
-import sys
-
-# SIDESTORE_BUNDLE_ID = "com.SideStore.SideStore"
-
-# Set environment variables with default values
-VERSION_IPA = os.getenv("VERSION_IPA")
-VERSION_DATE = os.getenv("VERSION_DATE")
-IS_BETA = os.getenv("IS_BETA")
-RELEASE_CHANNEL = os.getenv("RELEASE_CHANNEL")
-SIZE = os.getenv("SIZE")
-SHA256 = os.getenv("SHA256")
-LOCALIZED_DESCRIPTION = os.getenv("LOCALIZED_DESCRIPTION")
-DOWNLOAD_URL = os.getenv("DOWNLOAD_URL")
-# BUNDLE_IDENTIFIER = os.getenv("BUNDLE_IDENTIFIER", SIDESTORE_BUNDLE_ID)
-BUNDLE_IDENTIFIER = os.getenv("BUNDLE_IDENTIFIER")
-
-# Uncomment to debug/test by simulating dummy input locally
-# VERSION_IPA = os.getenv("VERSION_IPA", "0.0.0")
-# VERSION_DATE = os.getenv("VERSION_DATE", "2000-12-18T00:00:00Z")
-# IS_BETA = os.getenv("IS_BETA", True)
-# RELEASE_CHANNEL = os.getenv("RELEASE_CHANNEL", "alpha")
-# SIZE = int(os.getenv("SIZE", "0"))  # Convert to integer
-# SHA256 = os.getenv("SHA256", "")
-# LOCALIZED_DESCRIPTION = os.getenv("LOCALIZED_DESCRIPTION", "Invalid Update")
-# DOWNLOAD_URL = os.getenv("DOWNLOAD_URL", "https://github.com/SideStore/SideStore/releases/download/0.0.0/SideStore.ipa")
-
-# Check if input file is provided
-if len(sys.argv) < 2:
-    print("Usage: python3 update_apps.py <input_file>")
-    sys.exit(1)
-
-input_file = sys.argv[1]
-print(f"Input File: {input_file}")
-
-# Debugging the environment variables
-print("  ====> Required parameter list <====")
-print("Bundle Identifier:", BUNDLE_IDENTIFIER)
-print("Version:", VERSION_IPA)
-print("Version Date:", VERSION_DATE)
-print("IsBeta:", IS_BETA)
-print("ReleaseChannel:", RELEASE_CHANNEL)
-print("Size:", SIZE)
-print("Sha256:", SHA256)
-print("Localized Description:", LOCALIZED_DESCRIPTION)
-print("Download URL:", DOWNLOAD_URL)
-
-if IS_BETA is None:
-    print("Setting IS_BETA = False since no value was provided")
-    IS_BETA = False
-
-if str(IS_BETA).lower() in ["true", "1", "yes"]:
-    IS_BETA = True
-
-# Read the input JSON file
-try:
-    with open(input_file, "r") as file:
-        data = json.load(file)
-except Exception as e:
-    print(f"Error reading the input file: {e}")
-    sys.exit(1)
-
-if (not BUNDLE_IDENTIFIER or 
-    not VERSION_IPA or 
-    not VERSION_DATE or 
-    not RELEASE_CHANNEL or 
-    not SIZE or 
-    not SHA256 or 
-    not LOCALIZED_DESCRIPTION or 
-    not DOWNLOAD_URL):
-    print("One or more required parameter(s) were not defined as environment variable(s)")
-    sys.exit(1)
-
-# Convert to integer
-SIZE = int(SIZE)
-
-# Process the JSON data
-updated = False
-
-# apps = data.get("apps", [])
-# appsToUpdate = [app for app in apps if app.get("bundleIdentifier") == BUNDLE_IDENTIFIER]
-# if len(appsToUpdate) == 0:
-#     print("No app with the specified bundle identifier found.")
-#     sys.exit(1)
-
-# if len(appsToUpdate) > 1:
-#     print(f"Multiple apps with same `bundleIdentifier` = ${BUNDLE_IDENTIFIER} are not allowed!")
-#     sys.exit(1)
-
-# app = appsToUpdate[0]
-# # Update app-level metadata for store front page
-# app.update({
-#     "beta": IS_BETA,
-# })
-
-# versions = app.get("versions", [])
-
-# versionIfExists = [version for version in versions if version == VERSION_IPA]
-# if versionIfExists:     # current version is a duplicate, so reject it
-#     print(f"`version` = ${VERSION_IPA} already exists!, new build cannot have an existing version, Aborting!")
-#     sys.exit(1)
-
-# # create an entry and keep ready
-# new_version = {
-#     "version": VERSION_IPA,
-#     "date": VERSION_DATE,
-#     "localizedDescription": LOCALIZED_DESCRIPTION,
-#     "downloadURL": DOWNLOAD_URL,
-#     "size": SIZE,
-#     "sha256": SHA256,
-# }
-
-# if versions is []:
-#     versions.append(new_version)
-# else:
-#     # versions.insert(0, new_version)     # insert at front
-#     versions[0] = new_version             # replace top one
-
-
-# make it lowecase
-RELEASE_CHANNEL = RELEASE_CHANNEL.lower()
-
-version = data.get("version", 1)
-if int(version) < 2:
-    print("Only v2 and above are supported for direct updates to sources.json on push")
-    sys.exit(1)
-
-for app in data.get("apps", []):
-    if app.get("bundleIdentifier") == BUNDLE_IDENTIFIER:
-        if RELEASE_CHANNEL == "stable" :
-            # Update app-level metadata for store front page
-            app.update({
-                "version": VERSION_IPA,
-                "versionDate": VERSION_DATE,
-                "size": SIZE,
-                "sha256": SHA256,
-                "localizedDescription": LOCALIZED_DESCRIPTION,
-                "downloadURL": DOWNLOAD_URL,
-            })
-        
-        # Process the versions array
-        channels = app.get("releaseChannels", [])
-        if not channels:
-            app["releaseChannels"] = channels
-
-        # create an entry and keep ready
-        new_version = {
-            "version": VERSION_IPA,
-            "date": VERSION_DATE,
-            "localizedDescription": LOCALIZED_DESCRIPTION,
-            "downloadURL": DOWNLOAD_URL,
-            "size": SIZE,
-            "sha256": SHA256,
-        }
-        
-        tracks = [track for track in channels if track.get("track") == RELEASE_CHANNEL]
-        if len(tracks) > 1:
-            print(f"Multiple tracks with same `track` name = ${RELEASE_CHANNEL} are not allowed!")
-            sys.exit(1)
-            
-        if not tracks:
-            # there was no entries in this release channel so create one
-            track = {
-                "track": RELEASE_CHANNEL,
-                "releases": [new_version]
-            }
-            channels.insert(0, track)
-        else:
-            track = tracks[0]   # first result is the selected track
-            # Update the existing TOP version object entry
-            track["releases"][0] = new_version
-
-        updated = True
-        break
-
-if not updated:
-    print("No app with the specified bundle identifier found.")
-    sys.exit(1)
-
-# Save the updated JSON to the input file
-try:
-    print("\nUpdated Sources File:\n")
-    print(json.dumps(data, indent=2, ensure_ascii=False))
-    with open(input_file, "w", encoding="utf-8") as file:
-        json.dump(data, file, indent=2, ensure_ascii=False)
-    print("JSON successfully updated.")
-except Exception as e:
-    print(f"Error writing to the file: {e}")
-    sys.exit(1)

update_release_notes.py

@@ -1,381 +0,0 @@
-#!/usr/bin/env python3
-import subprocess
-import sys
-import os
-import re
-
-IGNORED_AUTHORS = [
-
-]
-
-TAG_MARKER = "###"
-HEADER_MARKER = "####"
-
-def run_command(cmd):
-    """Run a shell command and return its trimmed output."""
-    return subprocess.check_output(cmd, shell=True, text=True).strip()
-
-def get_head_commit():
-    """Return the HEAD commit SHA."""
-    return run_command("git rev-parse HEAD")
-
-def get_commit_messages(last_successful, current="HEAD"):
-    """Return a list of commit messages between last_successful and current."""
-    cmd = f"git log {last_successful}..{current} --pretty=format:%s"
-    output = run_command(cmd)
-    if not output:
-        return []
-    return output.splitlines()
-
-def get_authors_in_range(commit_range, fmt="%an"):
-    """Return a set of commit authors in the given commit range using the given format."""
-    cmd = f"git log {commit_range} --pretty=format:{fmt}"
-    output = run_command(cmd)
-    if not output:
-        return set()
-    authors = set(line.strip() for line in output.splitlines() if line.strip())
-    authors = set(authors) - set(IGNORED_AUTHORS)
-    return authors
-
-def get_first_commit_of_repo():
-    """Return the first commit in the repository (root commit)."""
-    cmd = "git rev-list --max-parents=0 HEAD"
-    output = run_command(cmd)
-    return output.splitlines()[0]
-
-def get_branch():
-    """
-    Attempt to determine the branch base (the commit where the current branch diverged
-    from the default remote branch). Falls back to the repo's first commit.
-    """
-    try:
-        default_ref = run_command("git rev-parse --abbrev-ref origin/HEAD")
-        default_branch = default_ref.split('/')[-1]
-        base_commit = run_command(f"git merge-base HEAD origin/{default_branch}")
-        return base_commit
-    except Exception:
-        return get_first_commit_of_repo()
-
-def get_repo_url():
-    """Extract and clean the repository URL from the remote 'origin'."""
-    url = run_command("git config --get remote.origin.url")
-    if url.startswith("git@"):
-        url = url.replace("git@", "https://").replace(":", "/")
-    if url.endswith(".git"):
-        url = url[:-4]
-    return url
-
-def format_contributor(author):
-    """
-    Convert an author name to a GitHub username or first name.
-    If the author already starts with '@', return it;
-    otherwise, take the first token and prepend '@'.
-    """
-    if author.startswith('@'):
-        return author
-    return f"@{author.split()[0]}"
-
-def format_commit_message(msg):
-    """Format a commit message as a bullet point for the release notes."""
-    msg_clean = msg.lstrip()  # remove leading spaces
-    if msg_clean.startswith("-"):
-        msg_clean = msg_clean[1:].strip()  # remove leading '-' and spaces
-    return f"- {msg_clean}"
-
-# def generate_release_notes(last_successful, tag, branch):
-    """Generate release notes for the given tag."""
-    current_commit = get_head_commit()
-    messages = get_commit_messages(last_successful, current_commit)
-    
-    # Start with the tag header
-    new_section = f"{TAG_MARKER} {tag}\n"
-
-    # What's Changed section (always present)
-    new_section += f"{HEADER_MARKER} What's Changed\n"
-    
-    if not messages or last_successful == current_commit:
-        new_section += "- Nothing...\n"
-    else:
-        for msg in messages:
-            new_section += f"{format_commit_message(msg)}\n"
-    
-    # New Contributors section (only if there are new contributors)
-    all_previous_authors = get_authors_in_range(f"{branch}")
-    recent_authors = get_authors_in_range(f"{last_successful}..{current_commit}")
-    new_contributors = recent_authors - all_previous_authors
-    
-    if new_contributors:
-        new_section += f"\n{HEADER_MARKER} New Contributors\n"
-        for author in sorted(new_contributors):
-            new_section += f"- {format_contributor(author)} made their first contribution\n"
-    
-    # Full Changelog section (only if there are changes)
-    if messages and last_successful != current_commit:
-        repo_url = get_repo_url()
-        changelog_link = f"{repo_url}/compare/{last_successful}...{current_commit}"
-        new_section += f"\n{HEADER_MARKER} Full Changelog: [{last_successful[:8]}...{current_commit[:8]}]({changelog_link})\n"
-    
-    return new_section
-
-def generate_release_notes(last_successful, tag, branch):
-    """Generate release notes for the given tag."""
-    current_commit = get_head_commit()
-    try:
-        # Try to get commit messages using the provided last_successful commit
-        messages = get_commit_messages(last_successful, current_commit)
-    except subprocess.CalledProcessError:
-        # If the range is invalid (e.g. force push made last_successful obsolete),
-        # fall back to using the last 10 commits in the current branch.
-        print("\nInvalid revision range error, using last 10 commits as fallback.\n")
-        fallback_commit = run_command("git rev-parse HEAD~5")
-        messages = get_commit_messages(fallback_commit, current_commit)
-        last_successful = fallback_commit
-
-    # Start with the tag header
-    new_section = f"{TAG_MARKER} {tag}\n"
-
-    # What's Changed section (always present)
-    new_section += f"{HEADER_MARKER} What's Changed\n"
-    
-    if not messages or last_successful == current_commit:
-        new_section += "- Nothing...\n"
-    else:
-        for msg in messages:
-            new_section += f"{format_commit_message(msg)}\n"
-    
-    # New Contributors section (only if there are new contributors)
-    all_previous_authors = get_authors_in_range(f"{branch}")
-    recent_authors = get_authors_in_range(f"{last_successful}..{current_commit}")
-    new_contributors = recent_authors - all_previous_authors
-    
-    if new_contributors:
-        new_section += f"\n{HEADER_MARKER} New Contributors\n"
-        for author in sorted(new_contributors):
-            new_section += f"- {format_contributor(author)} made their first contribution\n"
-    
-    # Full Changelog section (only if there are changes)
-    if messages and last_successful != current_commit:
-        repo_url = get_repo_url()
-        changelog_link = f"{repo_url}/compare/{last_successful}...{current_commit}"
-        new_section += f"\n{HEADER_MARKER} Full Changelog: [{last_successful[:8]}...{current_commit[:8]}]({changelog_link})\n"
-    
-    return new_section
-
-def update_release_md(existing_content, new_section, tag):
-    """
-    Update input based on rules:
-    1. If tag exists, update it
-    2. Special tags (alpha, beta, nightly) stay at the top in that order
-    3. Numbered tags follow special tags
-    4. Remove duplicate tags
-    5. Insert new numbered tags at the top of the numbered section
-    """
-    tag_lower = tag.lower()
-    is_special_tag = tag_lower in ["alpha", "beta", "nightly"]
-    
-    # Parse the existing content into sections
-    if not existing_content:
-        return new_section
-    
-    # Split the content into sections by headers
-    pattern = fr'(^{TAG_MARKER} .*$)'
-    sections = re.split(pattern, existing_content, flags=re.MULTILINE)
-    
-    # Create a list to store the processed content
-    processed_sections = []
-    
-    # Track special tag positions and whether tag was found
-    special_tags_map = {"alpha": False, "beta": False, "nightly": False}
-    last_special_index = -1
-    tag_found = False
-    numbered_tag_index = -1
-    
-    i = 0
-    while i < len(sections):
-        # Check if this is a header
-        if i % 2 == 1:  # Headers are at odd indices
-            header = sections[i]
-            content = sections[i+1] if i+1 < len(sections) else ""
-            current_tag = header[3:].strip().lower()
-            
-            # Check for special tags to track their positions
-            if current_tag in special_tags_map:
-                special_tags_map[current_tag] = True
-                last_special_index = len(processed_sections)
-            
-            # Check if this is the first numbered tag
-            elif re.match(r'^[0-9]+\.[0-9]+(\.[0-9]+)?$', current_tag) and numbered_tag_index == -1:
-                numbered_tag_index = len(processed_sections)
-            
-            # If this is the tag we're updating, mark it but don't add yet
-            if current_tag == tag_lower:
-                if not tag_found:  # Replace the first occurrence
-                    tag_found = True
-                    i += 2  # Skip the content
-                    continue
-                else:  # Skip duplicate occurrences
-                    i += 2
-                    continue
-        
-        # Add the current section
-        processed_sections.append(sections[i])
-        i += 1
-    
-    # Determine where to insert the new section
-    if tag_found:
-        # We need to determine the insertion point
-        if is_special_tag:
-            # For special tags, insert after last special tag or at beginning
-            desired_index = -1
-            for pos, t in enumerate(["alpha", "beta", "nightly"]):
-                if t == tag_lower:
-                    desired_index = pos
-            
-            # Find position to insert
-            insert_pos = 0
-            for pos, t in enumerate(["alpha", "beta", "nightly"]):
-                if t == tag_lower:
-                    break
-                if special_tags_map[t]:
-                    insert_pos = processed_sections.index(f"{TAG_MARKER} {t}")
-                    insert_pos += 2  # Move past the header and content
-            
-            # Insert at the determined position
-            processed_sections.insert(insert_pos, new_section)
-            if insert_pos > 0 and not processed_sections[insert_pos-1].endswith('\n\n'):
-                processed_sections.insert(insert_pos, '\n\n')
-        else:
-            # For numbered tags, insert after special tags but before other numbered tags
-            insert_pos = 0
-            
-            if last_special_index >= 0:
-                # Insert after the last special tag
-                insert_pos = last_special_index + 2  # +2 to skip header and content
-            
-            processed_sections.insert(insert_pos, new_section)
-            if insert_pos > 0 and not processed_sections[insert_pos-1].endswith('\n\n'):
-                processed_sections.insert(insert_pos, '\n\n')
-    else:
-        # Tag doesn't exist yet, determine insertion point
-        if is_special_tag:
-            # For special tags, maintain alpha, beta, nightly order
-            special_tags = ["alpha", "beta", "nightly"]
-            insert_pos = 0
-            
-            for i, t in enumerate(special_tags):
-                if t == tag_lower:
-                    # Check if preceding special tags exist
-                    for prev_tag in special_tags[:i]:
-                        if special_tags_map[prev_tag]:
-                            # Find the position after this tag
-                            prev_index = processed_sections.index(f"{TAG_MARKER} {prev_tag}")
-                            insert_pos = prev_index + 2  # Skip header and content
-            
-            processed_sections.insert(insert_pos, new_section)
-            if insert_pos > 0 and not processed_sections[insert_pos-1].endswith('\n\n'):
-                processed_sections.insert(insert_pos, '\n\n')
-        else:
-            # For numbered tags, insert after special tags but before other numbered tags
-            insert_pos = 0
-            
-            if last_special_index >= 0:
-                # Insert after the last special tag
-                insert_pos = last_special_index + 2  # +2 to skip header and content
-            
-            processed_sections.insert(insert_pos, new_section)
-            if insert_pos > 0 and not processed_sections[insert_pos-1].endswith('\n\n'):
-                processed_sections.insert(insert_pos, '\n\n')
-    
-    # Combine sections ensuring proper spacing
-    result = ""
-    for i, section in enumerate(processed_sections):
-        if i > 0 and section.startswith(f"{TAG_MARKER} "):
-            # Ensure single blank line before headers
-            if not result.endswith("\n\n"):
-                result = result.rstrip("\n") + "\n\n"
-        result += section
-    
-    return result.rstrip() + "\n"
-
-
-def retrieve_tag_content(tag, file_path):
-    if not os.path.exists(file_path):
-        return ""
-    
-    with open(file_path, "r") as f:
-        content = f.read()
-    
-    # Create a pattern for the tag header (case-insensitive)
-    pattern = re.compile(fr'^{TAG_MARKER} ' + re.escape(tag) + r'$', re.MULTILINE | re.IGNORECASE)
-    
-    # Find the tag header
-    match = pattern.search(content)
-    if not match:
-        return ""
-    
-    # Start after the tag line
-    start_pos = match.end()
-    
-    # Skip a newline if present
-    if start_pos < len(content) and content[start_pos] == "\n":
-        start_pos += 1
-    
-    # Find the next tag header after the current tag's content
-    next_tag_match = re.search(fr'^{TAG_MARKER} ', content[start_pos:], re.MULTILINE)
-    
-    if next_tag_match:
-        end_pos = start_pos + next_tag_match.start()
-        return content[start_pos:end_pos].strip()
-    else:
-        # Return until the end of the file if this is the last tag
-        return content[start_pos:].strip()
-
-def main():
-    # Update input file
-    release_file = "release-notes.md"
-
-    # Usage: python release.py <last_successful_commit> [tag] [branch]
-    # Or: python release.py --retrieve <tagname>
-    args = sys.argv[1:]
-    
-    if len(args) < 1:
-        print("Usage: python release.py <last_successful_commit> [tag] [branch]")
-        print("   or: python release.py --retrieve <tagname>")
-        sys.exit(1)
-    
-    # Check if we're retrieving a tag
-    if args[0] == "--retrieve":
-        if len(args) < 2:
-            print("Error: Missing tag name after --retrieve")
-            sys.exit(1)
-        
-        tag_content = retrieve_tag_content(args[1], file_path=release_file)
-        if tag_content:
-            print(tag_content)
-        else:
-            print(f"Tag '{args[1]}' not found in '{release_file}'")
-        return
-    
-    # Original functionality for generating release notes
-    last_successful = args[0]
-    tag = args[1] if len(args) > 1 else get_head_commit()
-    branch = args[2] if len(args) > 2 else (os.environ.get("GITHUB_REF") or get_branch())
-    
-    # Generate release notes
-    new_section = generate_release_notes(last_successful, tag, branch)
-    
-    existing_content = ""
-    if os.path.exists(release_file):
-        with open(release_file, "r") as f:
-            existing_content = f.read()
-    
-    updated_content = update_release_md(existing_content, new_section, tag)
-    
-    with open(release_file, "w") as f:
-        f.write(updated_content)
-    
-    # Output the new section for display
-    print(new_section)
-
-if __name__ == "__main__":
-    main()