legal: developer's certificate of origin 1.1 (#686 )

Attempt to fix sharing ipa files
Yeah, yeah, I shouldn't commit to develop, I have a hunch though Signed-off-by: nythepegasus <me@nythepegas.us>
2026-02-09 14:53:25 +01:00 · 2024-09-07 14:23:16 -04:00 · 2024-09-02 08:19:28 -04:00 · 2024-08-20 17:53:50 +09:00 · 2024-08-19 11:14:42 +09:00 · 2024-08-16 21:28:42 -04:00
79 changed files with 3019 additions and 1202 deletions
--- a/.github/ISSUE_TEMPLATE/bug_report.yml
+++ b/.github/ISSUE_TEMPLATE/bug_report.yml
@@ -7,6 +7,7 @@ body:
  - type: markdown
    attributes:
      value: |
+        ## Please note that the issue tracker is not for support
        Thanks for taking the time to fill out this bug report! Before you continue filling out the report, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the bug you are experiencing** in case it has already been reported.
        
        **Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
--- a/.github/pull_request_template.md
+++ b/.github/pull_request_template.md
@@ -10,6 +10,3 @@
 <!-- Example: -->
 - [x] Finish UI changes
 - [ ] Test
-
-<!-- If your PR doesn't close an issue, you can remove the next line. -->
-Closes #1234
--- a/.github/workflows/attach_build_products.yml
+++ b/.github/workflows/attach_build_products.yml
@@ -20,3 +20,58 @@ jobs:
            format: name
            addTo: pull
            # addTo: pullandissues
+  nightly-link-comment:
+    if: github.event.workflow_run.event == 'pull_request' && github.event.workflow_run.conclusion == 'success'
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/github-script@v6
+        with:
+          # This snippet is public-domain, taken from
+          # https://github.com/oprypin/nightly.link/blob/master/.github/workflows/pr-comment.yml
+          script: |
+            async function upsertComment(owner, repo, issue_number, purpose, body) {
+              const {data: comments} = await github.rest.issues.listComments(
+                {owner, repo, issue_number});
+
+              const marker = `<!-- bot: ${purpose} -->`;
+              body = marker + "\n" + body;
+
+              const existing = comments.filter((c) => c.body.includes(marker));
+              if (existing.length > 0) {
+                const last = existing[existing.length - 1];
+                core.info(`Updating comment ${last.id}`);
+                await github.rest.issues.updateComment({
+                  owner, repo,
+                  body,
+                  comment_id: last.id,
+                });
+              } else {
+                core.info(`Creating a comment in issue / PR #${issue_number}`);
+                await github.rest.issues.createComment({issue_number, body, owner, repo});
+              }
+            }
+
+            const {owner, repo} = context.repo;
+            const run_id = ${{github.event.workflow_run.id}};
+
+            const pull_requests = ${{ toJSON(github.event.workflow_run.pull_requests) }};
+            if (!pull_requests.length) {
+              return core.error("This workflow doesn't match any pull requests!");
+            }
+
+            const artifacts = await github.paginate(
+              github.rest.actions.listWorkflowRunArtifacts, {owner, repo, run_id});
+            if (!artifacts.length) {
+              return core.error(`No artifacts found`);
+            }
+            let body = `Download the artifacts for this pull request (nightly.link):\n`;
+            for (const art of artifacts) {
+              body += `\n* [${art.name}.zip](https://nightly.link/${owner}/${repo}/actions/artifacts/${art.id}.zip)`;
+            }
+
+            core.info("Review thread message body:", body);
+
+            for (const pr of pull_requests) {
+              await upsertComment(owner, repo, pr.number,
+                "nightly-link", body);
+            }
--- a/.github/workflows/beta.yml
+++ b/.github/workflows/beta.yml
@@ -39,6 +39,13 @@ jobs:
        with:
          xcode-version: ${{ matrix.version }}

+      
+      - name: Cache Build
+        uses: irgaly/xcode-cache@v1
+        with:
+          key: xcode-cache-deriveddata-${{ github.sha }}
+          restore-keys: xcode-cache-deriveddata
+
      - name: Build SideStore
        run: make build | xcpretty && exit ${PIPESTATUS[0]}

--- a/.github/workflows/nightly.yml
+++ b/.github/workflows/nightly.yml
@@ -48,6 +48,12 @@ jobs:
        with:
          xcode-version: ${{ matrix.version }}

+      - name: Cache Build
+        uses: irgaly/xcode-cache@v1
+        with:
+          key: xcode-cache-deriveddata-${{ github.sha }}
+          restore-keys: xcode-cache-deriveddata-
+
      - name: Build SideStore
        run: make build | xcpretty && exit ${PIPESTATUS[0]}

@@ -101,6 +107,3 @@ jobs:
        with:
          name: SideStore-${{ steps.version.outputs.version }}-dSYM
          path: ./*.dSYM/
-
-      - name: Reset cache for apps.sidestore.io/nightly
-        run: sleep 10 && curl https://apps.sidestore.io/reset-cache/nightly/${{ secrets.SIDESOURCE_KEY }}
--- a/.github/workflows/pr.yml
+++ b/.github/workflows/pr.yml
@@ -39,6 +39,12 @@ jobs:
        with:
          xcode-version: ${{ matrix.version }}

+      - name: Cache Build
+        uses: irgaly/xcode-cache@v1
+        with:
+          key: xcode-cache-deriveddata-${{ github.sha }}
+          restore-keys: xcode-cache-deriveddata-
+
      - name: Build SideStore
        run: make build | xcpretty && exit ${PIPESTATUS[0]}

--- a/.github/workflows/stable.yml
+++ b/.github/workflows/stable.yml
@@ -39,6 +39,12 @@ jobs:
        with:
          xcode-version: ${{ matrix.version }}

+      - name: Cache Build
+        uses: irgaly/xcode-cache@v1
+        with:
+          key: xcode-cache-deriveddata-${{ github.sha }}
+          restore-keys: xcode-cache-deriveddata-
+
      - name: Build SideStore
        run: make build | xcpretty && exit ${PIPESTATUS[0]}

--- a/.gitignore
+++ b/.gitignore
@@ -19,7 +19,7 @@ archive.xcarchive
 *.perspectivev3
 !default.perspectivev3
 xcuserdata
-
+AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm 
 ## Other
 *.xccheckout
 *.moved-aside
--- a/AltStore.xcodeproj/project.pbxproj
+++ b/AltStore.xcodeproj/project.pbxproj
@@ -3,11 +3,13 @@
 	archiveVersion = 1;
 	classes = {
 	};
-	objectVersion = 52;
+	objectVersion = 54;
 	objects = {

 /* Begin PBXBuildFile section */
 		03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E314122A05D4C00370A3C /* Bundle+AltStore.swift */; };
+		0E05025A2BEC83C500879B5C /* OperatingSystemVersion+Comparable.swift in Sources */ = {isa = PBXBuildFile; fileRef = 0E0502592BEC83C500879B5C /* OperatingSystemVersion+Comparable.swift */; };
+		0E05025C2BEC947000879B5C /* String+SideStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = 0E05025B2BEC947000879B5C /* String+SideStore.swift */; };
 		0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0E1A1F902AE36A9600364CAD /* bytearray.c */; };
 		0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = 0E764E162ADFF5740043DD4E /* AltBackup.ipa */; };
 		0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166472ADFE0D1003015C1 /* out-limd.c */; };
@@ -35,13 +37,20 @@
 		0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1665A2ADFE0D2003015C1 /* Structure.cpp */; };
 		0EA1667D2ADFE140003015C1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166592ADFE0D2003015C1 /* xplist.c */; };
 		0EA1667E2ADFE140003015C1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664C2ADFE0D1003015C1 /* time64.c */; };
+		0EA4263A2C2230150026D7FB /* AnisetteServerList.swift in Sources */ = {isa = PBXBuildFile; fileRef = 0EA426392C2230150026D7FB /* AnisetteServerList.swift */; };
 		0EA4B9BC2AE4A414009209CE /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA4B9BB2AE4A3F6009209CE /* plist.c */; };
+		0EE7FDC42BE8BC7900D1E390 /* ALTLocalizedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = 0EE7FDC32BE8BC7900D1E390 /* ALTLocalizedError.swift */; };
+		0EE7FDC62BE8CEA300D1E390 /* ALTLocalizedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = 0EE7FDC32BE8BC7900D1E390 /* ALTLocalizedError.swift */; };
+		0EE7FDC72BE8CF4100D1E390 /* ALTWrappedError.m in Sources */ = {isa = PBXBuildFile; fileRef = 0EE7FDC02BE8BC2100D1E390 /* ALTWrappedError.m */; };
+		0EE7FDC82BE8CF4800D1E390 /* ALTWrappedError.h in Headers */ = {isa = PBXBuildFile; fileRef = 0EE7FDC22BE8BC4200D1E390 /* ALTWrappedError.h */; settings = {ATTRIBUTES = (Public, ); }; };
+		0EE7FDC92BE8D07400D1E390 /* NSError+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF6C336124197D700034FD24 /* NSError+AltStore.swift */; };
+		0EE7FDCB2BE8D12B00D1E390 /* ALTLocalizedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = 0EE7FDC32BE8BC7900D1E390 /* ALTLocalizedError.swift */; };
+		0EE7FDCD2BE9124400D1E390 /* ErrorDetailsViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 0EE7FDCC2BE9124400D1E390 /* ErrorDetailsViewController.swift */; };
 		19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */ = {isa = PBXBuildFile; fileRef = BF45872B2298D31600BD7491 /* libimobiledevice.a */; };
 		19104DB52909C06D00C49C7B /* EmotionalDamage.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19104DB42909C06D00C49C7B /* EmotionalDamage.swift */; };
 		19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DB22909C06C00C49C7B /* libEmotionalDamage.a */; };
 		191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FAB290A5D92001A3B7C /* libminimuxer.a */; };
 		191E5FDC290AFA5C001A3B7C /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 191E5FDB290AFA5C001A3B7C /* OpenSSL */; };
-		1920B04F2924AC8300744F60 /* Settings.bundle in Resources */ = {isa = PBXBuildFile; fileRef = 1920B04E2924AC8300744F60 /* Settings.bundle */; };
 		19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */; };
 		4879A95F2861046500FC1BBD /* AltSign in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A95E2861046500FC1BBD /* AltSign */; };
 		4879A9622861049C00FC1BBD /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A9612861049C00FC1BBD /* OpenSSL */; };
@@ -75,6 +84,7 @@
 		B3C395F7284F362400DA9E2F /* AppCenterAnalytics in Frameworks */ = {isa = PBXBuildFile; productRef = B3C395F6284F362400DA9E2F /* AppCenterAnalytics */; };
 		B3C395F9284F362400DA9E2F /* AppCenterCrashes in Frameworks */ = {isa = PBXBuildFile; productRef = B3C395F8284F362400DA9E2F /* AppCenterCrashes */; };
 		B3EE16B62925E27D00B3B1F5 /* AnisetteManager.swift in Sources */ = {isa = PBXBuildFile; fileRef = B3EE16B52925E27D00B3B1F5 /* AnisetteManager.swift */; };
+		BD4513AB2C6FA98C0052BCC0 /* AppExtensionView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BD4513AA2C6FA98C0052BCC0 /* AppExtensionView.swift */; };
 		BF02419622F2199300129732 /* RefreshAttemptsViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF02419522F2199300129732 /* RefreshAttemptsViewController.swift */; };
 		BF08858322DE795100DE9F1E /* MyAppsViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF08858222DE795100DE9F1E /* MyAppsViewController.swift */; };
 		BF08858522DE7EC800DE9F1E /* UpdateCollectionViewCell.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF08858422DE7EC800DE9F1E /* UpdateCollectionViewCell.swift */; };
@@ -162,7 +172,6 @@
 		BF58048A246A28F9008AE704 /* LaunchScreen.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = BF580488246A28F9008AE704 /* LaunchScreen.storyboard */; };
 		BF580496246A3CB5008AE704 /* UIColor+AltBackup.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF580495246A3CB5008AE704 /* UIColor+AltBackup.swift */; };
 		BF580498246A3D19008AE704 /* UIKit.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = BF580497246A3D19008AE704 /* UIKit.framework */; };
-		BF58049B246A432D008AE704 /* NSError+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF6C336124197D700034FD24 /* NSError+AltStore.swift */; };
 		BF663C4F2433ED8200DAA738 /* FileManager+DirectorySize.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF663C4E2433ED8200DAA738 /* FileManager+DirectorySize.swift */; };
 		BF66EE822501AE50007EE018 /* AltStoreCore.h in Headers */ = {isa = PBXBuildFile; fileRef = BF66EE802501AE50007EE018 /* AltStoreCore.h */; settings = {ATTRIBUTES = (Public, ); }; };
 		BF66EE852501AE50007EE018 /* AltStoreCore.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = BF66EE7E2501AE50007EE018 /* AltStoreCore.framework */; };
@@ -208,7 +217,6 @@
 		BF66EEE92501AED0007EE018 /* JSONDecoder+Properties.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF66EEE52501AED0007EE018 /* JSONDecoder+Properties.swift */; };
 		BF66EEEA2501AED0007EE018 /* UIColor+Hex.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF66EEE62501AED0007EE018 /* UIColor+Hex.swift */; };
 		BF66EEEB2501AED0007EE018 /* UIApplication+AppExtension.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF66EEE72501AED0007EE018 /* UIApplication+AppExtension.swift */; };
-		BF6C336224197D700034FD24 /* NSError+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF6C336124197D700034FD24 /* NSError+AltStore.swift */; };
 		BF6C8FAC242935ED00125131 /* NSAttributedString+Markdown.m in Sources */ = {isa = PBXBuildFile; fileRef = BF6C8FAA242935ED00125131 /* NSAttributedString+Markdown.m */; };
 		BF6C8FAE2429597900125131 /* BannerCollectionViewCell.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF6C8FAD2429597900125131 /* BannerCollectionViewCell.swift */; };
 		BF6C8FB02429599900125131 /* TextCollectionReusableView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF6C8FAF2429599900125131 /* TextCollectionReusableView.swift */; };
@@ -239,7 +247,7 @@
 		BF9ABA4B22DD1380008935CF /* NavigationBar.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF9ABA4A22DD137F008935CF /* NavigationBar.swift */; };
 		BF9ABA4D22DD16DE008935CF /* PillButton.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF9ABA4C22DD16DE008935CF /* PillButton.swift */; };
 		BFA8172B23C5633D001B5953 /* FetchAnisetteDataOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFA8172A23C5633D001B5953 /* FetchAnisetteDataOperation.swift */; };
-		BFAECC522501B0A400528F27 /* CodableServerError.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD44605241188C300EAB90A /* CodableServerError.swift */; };
+		BFAECC522501B0A400528F27 /* CodableError.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD44605241188C300EAB90A /* CodableError.swift */; };
 		BFAECC532501B0A400528F27 /* ServerProtocol.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E3128229F474900370A3C /* ServerProtocol.swift */; };
 		BFAECC542501B0A400528F27 /* NSError+ALTServerError.m in Sources */ = {isa = PBXBuildFile; fileRef = BF1E314922A060F400370A3C /* NSError+ALTServerError.m */; };
 		BFAECC552501B0A400528F27 /* Connection.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF18BFF624858BDE00DD5981 /* Connection.swift */; };
@@ -298,7 +306,7 @@
 		BFE60742231B07E6002B0E8E /* SettingsHeaderFooterView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFE60741231B07E6002B0E8E /* SettingsHeaderFooterView.swift */; };
 		BFE6325A22A83BEB00F30809 /* Authentication.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = BFE6325922A83BEB00F30809 /* Authentication.storyboard */; };
 		BFE6326C22A86FF300F30809 /* AuthenticationOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFE6326B22A86FF300F30809 /* AuthenticationOperation.swift */; };
-		BFECAC8824FD950E0077C41F /* CodableServerError.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD44605241188C300EAB90A /* CodableServerError.swift */; };
+		BFECAC8824FD950E0077C41F /* CodableError.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD44605241188C300EAB90A /* CodableError.swift */; };
 		BFECAC8924FD950E0077C41F /* ConnectionManager.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF18BFF22485828200DD5981 /* ConnectionManager.swift */; };
 		BFECAC8A24FD950E0077C41F /* ALTServerError+Conveniences.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFF767CB2489AB5C0097E58C /* ALTServerError+Conveniences.swift */; };
 		BFECAC8B24FD950E0077C41F /* ServerProtocol.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E3128229F474900370A3C /* ServerProtocol.swift */; };
@@ -499,6 +507,8 @@
 /* End PBXCopyFilesBuildPhase section */

 /* Begin PBXFileReference section */
+		0E0502592BEC83C500879B5C /* OperatingSystemVersion+Comparable.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "OperatingSystemVersion+Comparable.swift"; sourceTree = "<group>"; };
+		0E05025B2BEC947000879B5C /* String+SideStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "String+SideStore.swift"; sourceTree = "<group>"; };
 		0E1A1F902AE36A9600364CAD /* bytearray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = src/bytearray.c; sourceTree = "<group>"; };
 		0E764E162ADFF5740043DD4E /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; name = AltBackup.ipa; path = AltStore/Resources/AltBackup.ipa; sourceTree = SOURCE_ROOT; };
 		0EA166412ADFE0D1003015C1 /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
@@ -534,11 +544,15 @@
 		0EA166652ADFE122003015C1 /* hashtable.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
 		0EA166662ADFE122003015C1 /* base64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
 		0EA166672ADFE122003015C1 /* strbuf.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
+		0EA426392C2230150026D7FB /* AnisetteServerList.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = AnisetteServerList.swift; sourceTree = "<group>"; };
 		0EA4B9BB2AE4A3F6009209CE /* plist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
+		0EE7FDC02BE8BC2100D1E390 /* ALTWrappedError.m */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.objc; path = ALTWrappedError.m; sourceTree = "<group>"; };
+		0EE7FDC22BE8BC4200D1E390 /* ALTWrappedError.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTWrappedError.h; sourceTree = "<group>"; };
+		0EE7FDC32BE8BC7900D1E390 /* ALTLocalizedError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ALTLocalizedError.swift; sourceTree = "<group>"; };
+		0EE7FDCC2BE9124400D1E390 /* ErrorDetailsViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorDetailsViewController.swift; sourceTree = "<group>"; };
 		19104DB22909C06C00C49C7B /* libEmotionalDamage.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libEmotionalDamage.a; sourceTree = BUILT_PRODUCTS_DIR; };
 		19104DB42909C06D00C49C7B /* EmotionalDamage.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EmotionalDamage.swift; sourceTree = "<group>"; };
 		191E5FAB290A5D92001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer.a; sourceTree = BUILT_PRODUCTS_DIR; };
-		1920B04E2924AC8300744F60 /* Settings.bundle */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.plug-in"; path = Settings.bundle; sourceTree = "<group>"; };
 		19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SelectTeamViewController.swift; sourceTree = "<group>"; };
 		9961EC2D29BE9F2E00AF2C6F /* minimuxer-helpers.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; name = "minimuxer-helpers.swift"; path = "Dependencies/minimuxer/minimuxer-helpers.swift"; sourceTree = SOURCE_ROOT; };
 		99F87D1629D8E4C900B40039 /* SwiftBridgeCore.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; name = SwiftBridgeCore.swift; path = Dependencies/minimuxer/SwiftBridgeCore.swift; sourceTree = SOURCE_ROOT; };
@@ -571,6 +585,7 @@
 		B3C3960E284F4F9100DA9E2F /* AltStoreCore.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = AltStoreCore.xcconfig; sourceTree = "<group>"; };
 		B3C3960F284F53E900DA9E2F /* AltBackup.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = AltBackup.xcconfig; sourceTree = "<group>"; };
 		B3EE16B52925E27D00B3B1F5 /* AnisetteManager.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = AnisetteManager.swift; sourceTree = "<group>"; };
+		BD4513AA2C6FA98C0052BCC0 /* AppExtensionView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = AppExtensionView.swift; sourceTree = "<group>"; };
 		BF02419522F2199300129732 /* RefreshAttemptsViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RefreshAttemptsViewController.swift; sourceTree = "<group>"; };
 		BF08858222DE795100DE9F1E /* MyAppsViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = MyAppsViewController.swift; sourceTree = "<group>"; };
 		BF08858422DE7EC800DE9F1E /* UpdateCollectionViewCell.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = UpdateCollectionViewCell.swift; sourceTree = "<group>"; };
@@ -785,7 +800,7 @@
 		BFD2478B2284C4C300981D42 /* AppIconImageView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = AppIconImageView.swift; sourceTree = "<group>"; };
 		BFD2478E2284C8F900981D42 /* Button.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = Button.swift; sourceTree = "<group>"; };
 		BFD2479E2284FBD000981D42 /* UIColor+AltStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "UIColor+AltStore.swift"; sourceTree = "<group>"; };
-		BFD44605241188C300EAB90A /* CodableServerError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = CodableServerError.swift; sourceTree = "<group>"; };
+		BFD44605241188C300EAB90A /* CodableError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = CodableError.swift; sourceTree = "<group>"; };
 		BFD52BD222A06EFB000B7ED1 /* ALTConstants.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTConstants.h; sourceTree = "<group>"; };
 		BFD52C1D22A1A9EC000B7ED1 /* node.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node.c; path = Dependencies/libplist/libcnary/node.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1E22A1A9EC000B7ED1 /* node_list.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node_list.c; path = Dependencies/libplist/libcnary/node_list.c; sourceTree = SOURCE_ROOT; };
@@ -936,6 +951,16 @@
 /* End PBXFrameworksBuildPhase section */

 /* Begin PBXGroup section */
+		0EE7FDBF2BE8BBBF00D1E390 /* Errors */ = {
+			isa = PBXGroup;
+			children = (
+				0EE7FDC32BE8BC7900D1E390 /* ALTLocalizedError.swift */,
+				0EE7FDC02BE8BC2100D1E390 /* ALTWrappedError.m */,
+				0EE7FDC22BE8BC4200D1E390 /* ALTWrappedError.h */,
+			);
+			path = Errors;
+			sourceTree = "<group>";
+		};
 		19104DB32909C06D00C49C7B /* EmotionalDamage */ = {
 			isa = PBXGroup;
 			children = (
@@ -1061,7 +1086,7 @@
 			isa = PBXGroup;
 			children = (
 				BF1E3128229F474900370A3C /* ServerProtocol.swift */,
-				BFD44605241188C300EAB90A /* CodableServerError.swift */,
+				BFD44605241188C300EAB90A /* CodableError.swift */,
 			);
 			path = "Server Protocol";
 			sourceTree = "<group>";
@@ -1074,6 +1099,7 @@
 				BF18BFFF2485A75F00DD5981 /* Server Protocol */,
 				BFF767CF2489AC240097E58C /* Connections */,
 				BFF7C92D2578464D00E55F36 /* XPC */,
+				0EE7FDBF2BE8BBBF00D1E390 /* Errors */,
 				BFF767C32489A6800097E58C /* Extensions */,
 				BFF767C42489A6980097E58C /* Categories */,
 			);
@@ -1396,6 +1422,8 @@
 				BF66EEE62501AED0007EE018 /* UIColor+Hex.swift */,
 				BF66EEE42501AED0007EE018 /* UserDefaults+AltStore.swift */,
 				BF6A531F246DC1B0004F59C8 /* FileManager+SharedDirectories.swift */,
+				0E0502592BEC83C500879B5C /* OperatingSystemVersion+Comparable.swift */,
+				0E05025B2BEC947000879B5C /* String+SideStore.swift */,
 			);
 			path = Extensions;
 			sourceTree = "<group>";
@@ -1575,7 +1603,6 @@
 				BFD247962284D7C100981D42 /* Resources */,
 				BF6C8FA8242935CA00125131 /* Dependencies */,
 				BFD247972284D7D800981D42 /* Supporting Files */,
-				1920B04E2924AC8300744F60 /* Settings.bundle */,
 			);
 			path = AltStore;
 			sourceTree = "<group>";
@@ -1598,6 +1625,7 @@
 			children = (
 				BF0C4EBC22A1BD8B009A2DD7 /* AppManager.swift */,
 				BF88F97124F8727D00BB75DF /* AppManagerErrors.swift */,
+				BD4513AA2C6FA98C0052BCC0 /* AppExtensionView.swift */,
 			);
 			path = "Managing Apps";
 			sourceTree = "<group>";
@@ -1659,6 +1687,7 @@
 			children = (
 				BFE60737231ADF49002B0E8E /* Settings.storyboard */,
 				BFE60739231ADF82002B0E8E /* SettingsViewController.swift */,
+				0EA426392C2230150026D7FB /* AnisetteServerList.swift */,
 				BFE6073F231AFD2A002B0E8E /* InsetGroupTableViewCell.swift */,
 				BFE60741231B07E6002B0E8E /* SettingsHeaderFooterView.swift */,
 				BFE6073B231AE1E7002B0E8E /* SettingsHeaderFooterView.xib */,
@@ -1775,6 +1804,7 @@
 			children = (
 				D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */,
 				D54DED1328CBC44B008B27A0 /* ErrorLogTableViewCell.swift */,
+				0EE7FDCC2BE9124400D1E390 /* ErrorDetailsViewController.swift */,
 			);
 			path = "Error Log";
 			sourceTree = "<group>";
@@ -1827,6 +1857,7 @@
 				BFAECC5D2501B0BF00528F27 /* ALTConnection.h in Headers */,
 				BF66EE942501AEBC007EE018 /* ALTAppPermission.h in Headers */,
 				BFAECC602501B0BF00528F27 /* NSError+ALTServerError.h in Headers */,
+				0EE7FDC82BE8CF4800D1E390 /* ALTWrappedError.h in Headers */,
 				BFAECC5E2501B0BF00528F27 /* CFNotificationName+AltStore.h in Headers */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
@@ -2210,7 +2241,6 @@
 				BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */,
 				BF770E6922BD57DD002A40FE /* Silence.m4a in Resources */,
 				BFD247772284B9A700981D42 /* Assets.xcassets in Resources */,
-				1920B04F2924AC8300744F60 /* Settings.bundle in Resources */,
 				BFF0B6922321A305007A79E1 /* AboutPatreonHeaderView.xib in Resources */,
 				BFB6B22423187A3D0022A802 /* NewsCollectionViewCell.xib in Resources */,
 				BFD247752284B9A500981D42 /* Main.storyboard in Resources */,
@@ -2271,7 +2301,7 @@
 				BF1FE358251A9FB000C3CE09 /* NSXPCConnection+MachServices.swift in Sources */,
 				BFECAC8F24FD950E0077C41F /* Result+Conveniences.swift in Sources */,
 				BF8CAE472489E772004D6CCE /* DaemonRequestHandler.swift in Sources */,
-				BFECAC8824FD950E0077C41F /* CodableServerError.swift in Sources */,
+				BFECAC8824FD950E0077C41F /* CodableError.swift in Sources */,
 				BFC712C32512D5F100AB5EBE /* XPCConnection.swift in Sources */,
 				BFC712C52512D5F100AB5EBE /* XPCConnectionHandler.swift in Sources */,
 				BFECAC8A24FD950E0077C41F /* ALTServerError+Conveniences.swift in Sources */,
@@ -2368,8 +2398,8 @@
 				BF580496246A3CB5008AE704 /* UIColor+AltBackup.swift in Sources */,
 				BF580482246A28F7008AE704 /* ViewController.swift in Sources */,
 				BF44EEF0246B08BA002A52F2 /* BackupController.swift in Sources */,
+				0EE7FDC62BE8CEA300D1E390 /* ALTLocalizedError.swift in Sources */,
 				03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */,
-				BF58049B246A432D008AE704 /* NSError+AltStore.swift in Sources */,
 				BF58047E246A28F7008AE704 /* AppDelegate.swift in Sources */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
@@ -2385,7 +2415,7 @@
 				BF66EECD2501AECA007EE018 /* StoreAppPolicy.swift in Sources */,
 				BF66EEE82501AED0007EE018 /* UserDefaults+AltStore.swift in Sources */,
 				BF340E9A250AD39500A192CB /* ViewApp.intentdefinition in Sources */,
-				BFAECC522501B0A400528F27 /* CodableServerError.swift in Sources */,
+				BFAECC522501B0A400528F27 /* CodableError.swift in Sources */,
 				BF66EE9E2501AEC1007EE018 /* Fetchable.swift in Sources */,
 				BF66EEDF2501AECA007EE018 /* PatreonAccount.swift in Sources */,
 				BFAECC532501B0A400528F27 /* ServerProtocol.swift in Sources */,
@@ -2393,11 +2423,14 @@
 				BF66EE9D2501AEC1007EE018 /* AppProtocol.swift in Sources */,
 				BFC712C42512D5F100AB5EBE /* XPCConnection.swift in Sources */,
 				D5CA0C4B280E141900469595 /* ManagedPatron.swift in Sources */,
+				0E05025A2BEC83C500879B5C /* OperatingSystemVersion+Comparable.swift in Sources */,
 				BF66EE8C2501AEB2007EE018 /* Keychain.swift in Sources */,
 				BF66EED42501AECA007EE018 /* AltStore5ToAltStore6.xcmappingmodel in Sources */,
 				BF66EE972501AEBC007EE018 /* ALTAppPermission.m in Sources */,
 				BFAECC552501B0A400528F27 /* Connection.swift in Sources */,
 				BF66EEDA2501AECA007EE018 /* RefreshAttempt.swift in Sources */,
+				0E05025C2BEC947000879B5C /* String+SideStore.swift in Sources */,
+				0EE7FDCB2BE8D12B00D1E390 /* ALTLocalizedError.swift in Sources */,
 				BF66EEA92501AEC5007EE018 /* Tier.swift in Sources */,
 				BF66EEDB2501AECA007EE018 /* StoreApp.swift in Sources */,
 				BF66EEDE2501AECA007EE018 /* AppID.swift in Sources */,
@@ -2406,6 +2439,7 @@
 				BF66EEDD2501AECA007EE018 /* AppPermission.swift in Sources */,
 				D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */,
 				BFBF331B2526762200B7B8C9 /* AltStore8ToAltStore9.xcmappingmodel in Sources */,
+				0EE7FDC72BE8CF4100D1E390 /* ALTWrappedError.m in Sources */,
 				D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */,
 				BF989184250AACFC002ACF50 /* Date+RelativeDate.swift in Sources */,
 				BF66EE962501AEBC007EE018 /* ALTPatreonBenefitType.m in Sources */,
@@ -2430,6 +2464,7 @@
 				BF66EEEA2501AED0007EE018 /* UIColor+Hex.swift in Sources */,
 				BF66EECC2501AECA007EE018 /* Source.swift in Sources */,
 				BF66EED72501AECA007EE018 /* InstalledApp.swift in Sources */,
+				0EE7FDC92BE8D07400D1E390 /* NSError+AltStore.swift in Sources */,
 				BF66EECE2501AECA007EE018 /* InstalledAppPolicy.swift in Sources */,
 				BF1FE359251A9FB000C3CE09 /* NSXPCConnection+MachServices.swift in Sources */,
 				BF66EEA62501AEC5007EE018 /* PatreonAPI.swift in Sources */,
@@ -2485,7 +2520,6 @@
 				BF8F69C422E662D300049BA1 /* AppViewController.swift in Sources */,
 				BFF0B68E23219520007A79E1 /* PatreonViewController.swift in Sources */,
 				BFF00D302501BD7D00746320 /* Intents.intentdefinition in Sources */,
-				BF6C336224197D700034FD24 /* NSError+AltStore.swift in Sources */,
 				D5DAE0942804B0B80034D8D4 /* ScreenshotProcessor.swift in Sources */,
 				BFD2476E2284B9A500981D42 /* AppDelegate.swift in Sources */,
 				BF41B806233423AE00C593A3 /* TabBarController.swift in Sources */,
@@ -2501,6 +2535,7 @@
 				BF6C8FAE2429597900125131 /* BannerCollectionViewCell.swift in Sources */,
 				BF6F439223644C6E00A0B879 /* RefreshAltStoreViewController.swift in Sources */,
 				BFE60742231B07E6002B0E8E /* SettingsHeaderFooterView.swift in Sources */,
+				BD4513AB2C6FA98C0052BCC0 /* AppExtensionView.swift in Sources */,
 				BFE338E822F10E56002E24B9 /* LaunchViewController.swift in Sources */,
 				BFA8172B23C5633D001B5953 /* FetchAnisetteDataOperation.swift in Sources */,
 				BF9ABA4722DD0638008935CF /* BrowseCollectionViewCell.swift in Sources */,
@@ -2508,6 +2543,7 @@
 				BF41B808233433C100C593A3 /* LoadingState.swift in Sources */,
 				BFF0B69A2322D7D0007A79E1 /* UIScreen+CompactHeight.swift in Sources */,
 				D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */,
+				0EA4263A2C2230150026D7FB /* AnisetteServerList.swift in Sources */,
 				D5F2F6A92720B7C20081CCF5 /* PatchViewController.swift in Sources */,
 				B39F16132918D7C5002E9404 /* Consts.swift in Sources */,
 				BF8F69C222E659F700049BA1 /* AppContentViewController.swift in Sources */,
@@ -2533,9 +2569,11 @@
 				BFF00D322501BDA100746320 /* BackgroundRefreshAppsOperation.swift in Sources */,
 				BF0C4EBD22A1BD8B009A2DD7 /* AppManager.swift in Sources */,
 				BF2901312318F7A800D88A45 /* AppBannerView.swift in Sources */,
+				0EE7FDC42BE8BC7900D1E390 /* ALTLocalizedError.swift in Sources */,
 				BFF00D342501BDCF00746320 /* IntentHandler.swift in Sources */,
 				BFDBBD80246CB84F004ED2F3 /* RemoveAppBackupOperation.swift in Sources */,
 				BFF0B6942321CB85007A79E1 /* AuthenticationViewController.swift in Sources */,
+				0EE7FDCD2BE9124400D1E390 /* ErrorDetailsViewController.swift in Sources */,
 				BF3432FB246B894F0052F4A1 /* BackupAppOperation.swift in Sources */,
 				BF9ABA4922DD0742008935CF /* ScreenshotCollectionViewCell.swift in Sources */,
 				BF9ABA4D22DD16DE008935CF /* PillButton.swift in Sources */,
@@ -2965,6 +3003,7 @@
 					"@executable_path/Frameworks",
 					"@loader_path/Frameworks",
 				);
+				LLVM_LTO = YES_THIN;
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME:c99extidentifier)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
@@ -2993,6 +3032,7 @@
 				DYLIB_COMPATIBILITY_VERSION = 1;
 				DYLIB_CURRENT_VERSION = 1;
 				DYLIB_INSTALL_NAME_BASE = "@rpath";
+				GCC_OPTIMIZATION_LEVEL = fast;
 				INFOPLIST_FILE = AltStoreCore/Info.plist;
 				INSTALL_PATH = "$(LOCAL_LIBRARY_DIR)/Frameworks";
 				IPHONEOS_DEPLOYMENT_TARGET = 14.0;
@@ -3001,6 +3041,7 @@
 					"@executable_path/Frameworks",
 					"@loader_path/Frameworks",
 				);
+				LLVM_LTO = YES_THIN;
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME:c99extidentifier)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
@@ -3110,6 +3151,7 @@
 				CODE_SIGN_IDENTITY = "iPhone Developer";
 				COPY_PHASE_STRIP = NO;
 				DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym";
+				EAGER_LINKING = YES;
 				ENABLE_STRICT_OBJC_MSGSEND = YES;
 				ENABLE_TESTABILITY = YES;
 				GCC_C_LANGUAGE_STANDARD = gnu11;
@@ -3127,6 +3169,7 @@
 				GCC_WARN_UNUSED_FUNCTION = YES;
 				GCC_WARN_UNUSED_VARIABLE = YES;
 				IPHONEOS_DEPLOYMENT_TARGET = 12.2;
+				LLVM_LTO = YES_THIN;
 				MTL_ENABLE_DEBUG_INFO = INCLUDE_SOURCE;
 				MTL_FAST_MATH = YES;
 				ONLY_ACTIVE_ARCH = YES;
@@ -3137,6 +3180,7 @@
 				SDKROOT = iphoneos;
 				SUPPORTED_PLATFORMS = "iphonesimulator iphoneos macosx";
 				SWIFT_ACTIVE_COMPILATION_CONDITIONS = "DEBUG BETA";
+				SWIFT_ENFORCE_EXCLUSIVE_ACCESS = "debug-only";
 				SWIFT_OPTIMIZATION_LEVEL = "-Onone";
 				SYSTEM_HEADER_SEARCH_PATHS = "\"$(SRCROOT)/Dependencies/AltSign/Dependencies\"";
 			};
@@ -3178,10 +3222,12 @@
 				CODE_SIGN_IDENTITY = "iPhone Developer";
 				COPY_PHASE_STRIP = NO;
 				DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym";
+				EAGER_LINKING = YES;
 				ENABLE_NS_ASSERTIONS = NO;
 				ENABLE_STRICT_OBJC_MSGSEND = YES;
 				GCC_C_LANGUAGE_STANDARD = gnu11;
 				GCC_NO_COMMON_BLOCKS = YES;
+				GCC_OPTIMIZATION_LEVEL = fast;
 				GCC_WARN_64_TO_32_BIT_CONVERSION = YES;
 				GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR;
 				GCC_WARN_UNDECLARED_SELECTOR = YES;
@@ -3189,6 +3235,7 @@
 				GCC_WARN_UNUSED_FUNCTION = YES;
 				GCC_WARN_UNUSED_VARIABLE = YES;
 				IPHONEOS_DEPLOYMENT_TARGET = 12.2;
+				LLVM_LTO = YES_THIN;
 				MTL_ENABLE_DEBUG_INFO = NO;
 				MTL_FAST_MATH = YES;
 				OTHER_CPLUSPLUSFLAGS = (
@@ -3198,8 +3245,9 @@
 				SDKROOT = iphoneos;
 				SUPPORTED_PLATFORMS = "iphonesimulator iphoneos macosx";
 				SWIFT_ACTIVE_COMPILATION_CONDITIONS = "DEBUG BETA";
-				SWIFT_COMPILATION_MODE = wholemodule;
-				SWIFT_OPTIMIZATION_LEVEL = "-O";
+				SWIFT_COMPILATION_MODE = singlefile;
+				SWIFT_ENFORCE_EXCLUSIVE_ACCESS = "debug-only";
+				SWIFT_OPTIMIZATION_LEVEL = "-Osize";
 				SYSTEM_HEADER_SEARCH_PATHS = "\"$(SRCROOT)/Dependencies/AltSign/Dependencies\"";
 				VALIDATE_PRODUCT = YES;
 			};
@@ -3209,7 +3257,7 @@
 			isa = XCBuildConfiguration;
 			baseConfigurationReference = B3C3960B284F4C9800DA9E2F /* AltStore.xcconfig */;
 			buildSettings = {
-				ALWAYS_EMBED_SWIFT_STANDARD_LIBRARIES = YES;
+				ALWAYS_EMBED_SWIFT_STANDARD_LIBRARIES = NO;
 				ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
 				CLANG_ENABLE_MODULES = YES;
 				CODE_SIGN_ENTITLEMENTS = AltStore/AltStore.entitlements;
@@ -3217,8 +3265,10 @@
 				CODE_SIGN_STYLE = Automatic;
 				DEVELOPMENT_TEAM = "$(DEVELOPMENT_TEAM)";
 				ENABLE_BITCODE = NO;
+				GCC_UNROLL_LOOPS = YES;
 				INFOPLIST_FILE = AltStore/Info.plist;
 				IPHONEOS_DEPLOYMENT_TARGET = 14.0;
+				LD_EXPORT_SYMBOLS = NO;
 				LD_RUNPATH_SEARCH_PATHS = (
 					"$(inherited)",
 					"@executable_path/Frameworks",
@@ -3228,11 +3278,13 @@
 					"$(PROJECT_DIR)/Dependencies/libfragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
 				);
+				LLVM_LTO = YES_THIN;
 				OTHER_LDFLAGS = "";
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
 				SUPPORTED_PLATFORMS = "iphonesimulator iphoneos";
+				SWIFT_ENFORCE_EXCLUSIVE_ACCESS = "debug-only";
 				SWIFT_OBJC_BRIDGING_HEADER = "AltStore/AltStore-Bridging-Header.h";
 				SWIFT_OPTIMIZATION_LEVEL = "-Onone";
 				SWIFT_VERSION = 5.0;
@@ -3244,7 +3296,7 @@
 			isa = XCBuildConfiguration;
 			baseConfigurationReference = B3C3960B284F4C9800DA9E2F /* AltStore.xcconfig */;
 			buildSettings = {
-				ALWAYS_EMBED_SWIFT_STANDARD_LIBRARIES = YES;
+				ALWAYS_EMBED_SWIFT_STANDARD_LIBRARIES = NO;
 				ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
 				CLANG_ENABLE_MODULES = YES;
 				CODE_SIGN_ENTITLEMENTS = AltStore/AltStore.entitlements;
@@ -3252,8 +3304,11 @@
 				CODE_SIGN_STYLE = Automatic;
 				DEVELOPMENT_TEAM = "$(DEVELOPMENT_TEAM)";
 				ENABLE_BITCODE = NO;
+				GCC_OPTIMIZATION_LEVEL = fast;
+				GCC_UNROLL_LOOPS = YES;
 				INFOPLIST_FILE = AltStore/Info.plist;
 				IPHONEOS_DEPLOYMENT_TARGET = 14.0;
+				LD_EXPORT_SYMBOLS = NO;
 				LD_RUNPATH_SEARCH_PATHS = (
 					"$(inherited)",
 					"@executable_path/Frameworks",
@@ -3263,12 +3318,16 @@
 					"$(PROJECT_DIR)/Dependencies/libfragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
 				);
+				LLVM_LTO = YES_THIN;
 				OTHER_LDFLAGS = "";
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
 				SUPPORTED_PLATFORMS = "iphonesimulator iphoneos";
+				SWIFT_COMPILATION_MODE = singlefile;
+				SWIFT_ENFORCE_EXCLUSIVE_ACCESS = "debug-only";
 				SWIFT_OBJC_BRIDGING_HEADER = "AltStore/AltStore-Bridging-Header.h";
+				SWIFT_OPTIMIZATION_LEVEL = "-Osize";
 				SWIFT_VERSION = 5.0;
 				TARGETED_DEVICE_FAMILY = "1,2";
 			};
--- a/AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved
+++ b/AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved
@@ -1,113 +0,0 @@
-{
-  "pins" : [
-    {
-      "identity" : "altsign",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/SideStore/AltSign",
-      "state" : {
-        "branch" : "master",
-        "revision" : "cc6189f0f7cd8e5bd24943af9322e0ff9420e9f4"
-      }
-    },
-    {
-      "identity" : "appcenter-sdk-apple",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/microsoft/appcenter-sdk-apple.git",
-      "state" : {
-        "revision" : "b2dc99cfedead0bad4e6573d86c5228c89cff332",
-        "version" : "4.4.3"
-      }
-    },
-    {
-      "identity" : "imobiledevice.swift",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/SideStore/iMobileDevice.swift",
-      "state" : {
-        "revision" : "74e481106dd155c0cd21bca6795fd9fe5f751654",
-        "version" : "1.0.5"
-      }
-    },
-    {
-      "identity" : "keychainaccess",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/kishikawakatsumi/KeychainAccess.git",
-      "state" : {
-        "revision" : "84e546727d66f1adc5439debad16270d0fdd04e7",
-        "version" : "4.2.2"
-      }
-    },
-    {
-      "identity" : "launchatlogin",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/sindresorhus/LaunchAtLogin.git",
-      "state" : {
-        "revision" : "e8171b3e38a2816f579f58f3dac1522aa39efe41",
-        "version" : "4.2.0"
-      }
-    },
-    {
-      "identity" : "nuke",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/kean/Nuke.git",
-      "state" : {
-        "revision" : "9318d02a8a6d20af56505c9673261c1fd3b3aebe",
-        "version" : "7.6.3"
-      }
-    },
-    {
-      "identity" : "openssl",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/krzyzanowskim/OpenSSL",
-      "state" : {
-        "revision" : "0faf71a188bcfdf0245cab42886b9b240ca71c52",
-        "version" : "1.1.2200"
-      }
-    },
-    {
-      "identity" : "plcrashreporter",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/microsoft/PLCrashReporter.git",
-      "state" : {
-        "revision" : "81cdec2b3827feb03286cb297f4c501a8eb98df1",
-        "version" : "1.10.2"
-      }
-    },
-    {
-      "identity" : "semanticversion",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/SwiftPackageIndex/SemanticVersion.git",
-      "state" : {
-        "revision" : "a70840d5fca686ae3bd2fcf8aecc5ded0bd4f125",
-        "version" : "0.3.6"
-      }
-    },
-    {
-      "identity" : "sparkle",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/sparkle-project/Sparkle.git",
-      "state" : {
-        "revision" : "f0ceaf5cc9f3f23daa0ccb6dcebd79fc96ccc7d9",
-        "version" : "2.5.0"
-      }
-    },
-    {
-      "identity" : "starscream",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/daltoniam/Starscream.git",
-      "state" : {
-        "revision" : "ac6c0fc9da221873e01bd1a0d4818498a71eef33",
-        "version" : "4.0.6"
-      }
-    },
-    {
-      "identity" : "stprivilegedtask",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/JoeMatt/STPrivilegedTask.git",
-      "state" : {
-        "branch" : "master",
-        "revision" : "10a9150ef32d444af326beba76356ae9af95a3e7"
-      }
-    }
-  ],
-  "version" : 2
-}
--- a/AltStore/AltStore.entitlements
+++ b/AltStore/AltStore.entitlements
@@ -2,8 +2,12 @@
 <!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
 <plist version="1.0">
 <dict>
-	<key>aps-environment</key>
-	<string>development</string>
+	<key>com.apple.developer.kernel.extended-virtual-addressing</key>
+	<true/>
+	<key>com.apple.developer.kernel.increased-debugging-memory-limit</key>
+	<true/>
+	<key>com.apple.developer.kernel.increased-memory-limit</key>
+	<true/>
 	<key>com.apple.developer.siri</key>
 	<true/>
 	<key>com.apple.security.application-groups</key>
--- a/Detail/AppContentViewController.swift
+++ b/Detail/AppContentViewController.swift
@@ -81,7 +81,7 @@ final class AppContentViewController: UITableViewController
        self.subtitleLabel.text = self.app.subtitle
        self.descriptionTextView.text = self.app.localizedDescription
        
-        if let version = self.app.latestVersion
+        if let version = self.app.latestAvailableVersion
        {
            self.versionDescriptionTextView.text = version.localizedDescription
            self.versionLabel.text = String(format: NSLocalizedString("Version %@", comment: ""), version.version)
--- a/Detail/AppViewController.swift
+++ b/Detail/AppViewController.swift
@@ -384,7 +384,7 @@ private extension AppViewController
            button.progress = progress
        }
        
-        if let versionDate = self.app.latestVersion?.date, versionDate > Date()
+        if let versionDate = self.app.latestAvailableVersion?.date, versionDate > Date()
        {
            self.bannerView.button.countdownDate = versionDate
            self.navigationBarDownloadButton.countdownDate = versionDate
@@ -510,7 +510,7 @@ extension AppViewController
            catch
            {
                DispatchQueue.main.async {
-                    let toastView = ToastView(error: error)
+                    let toastView = ToastView(error: error, opensLog: true)
                    toastView.show(in: self)
                }
            }
--- a/AltStore/AppDelegate.swift
+++ b/AltStore/AppDelegate.swift
@@ -61,6 +61,8 @@ final class AppDelegate: UIResponder, UIApplicationDelegate {
        // Register default settings before doing anything else.
        UserDefaults.registerDefaults()
        
+        
+        
        DatabaseManager.shared.start { (error) in
            if let error = error
            {
@@ -380,7 +382,7 @@ private extension AppDelegate
                for update in updates
                {
                    guard !previousUpdates.contains(where: { $0[#keyPath(InstalledApp.bundleIdentifier)] == update.bundleIdentifier }) else { continue }
-                    guard let storeApp = update.storeApp, let version = storeApp.version else { continue }
+                    guard let storeApp = update.storeApp, let version = storeApp.latestSupportedVersion else { continue }
                    
                    let content = UNMutableNotificationContent()
                    content.title = NSLocalizedString("New Update Available", comment: "")
--- a/AltStore/Authentication/Authentication.storyboard
+++ b/AltStore/Authentication/Authentication.storyboard
@@ -1,9 +1,9 @@
 <?xml version="1.0" encoding="UTF-8"?>
-<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="20037" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
+<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="32700.99.1234" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
    <device id="retina4_7" orientation="portrait" appearance="light"/>
    <dependencies>
        <deployment identifier="iOS"/>
-        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="20020"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="22684"/>
        <capability name="Named colors" minToolsVersion="9.0"/>
        <capability name="Safe area layout guides" minToolsVersion="9.0"/>
        <capability name="documents saved in the Xcode 8 format" minToolsVersion="8.0"/>
@@ -13,8 +13,8 @@
        <scene sceneID="lNR-II-WoW">
            <objects>
                <navigationController storyboardIdentifier="navigationController" id="ZTo-53-dSL" sceneMemberID="viewController">
-                    <navigationBar key="navigationBar" contentMode="scaleToFill" insetsLayoutMarginsFromSafeArea="NO" barStyle="black" largeTitles="YES" id="Aej-RF-PfV" customClass="NavigationBar" customModule="AltStore" customModuleProvider="target">
-                        <rect key="frame" x="0.0" y="0.0" width="375" height="96"/>
+                    <navigationBar key="navigationBar" contentMode="scaleToFill" insetsLayoutMarginsFromSafeArea="NO" barStyle="black" largeTitles="YES" id="Aej-RF-PfV" customClass="NavigationBar" customModule="SideStore" customModuleProvider="target">
+                        <rect key="frame" x="0.0" y="20" width="375" height="96"/>
                        <autoresizingMask key="autoresizingMask"/>
                        <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                        <color key="barTintColor" name="SettingsBackground"/>
@@ -36,19 +36,19 @@
        <!--Authentication View Controller-->
        <scene sceneID="OCd-xc-Ms7">
            <objects>
-                <viewController storyboardIdentifier="authenticationViewController" id="yO1-iT-7NP" customClass="AuthenticationViewController" customModule="AltStore" customModuleProvider="target" sceneMemberID="viewController">
+                <viewController storyboardIdentifier="authenticationViewController" id="yO1-iT-7NP" customClass="AuthenticationViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
                    <view key="view" contentMode="scaleToFill" id="mjy-4S-hyH">
                        <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                        <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
                        <subviews>
                            <view hidden="YES" userInteractionEnabled="NO" contentMode="scaleToFill" translatesAutoresizingMaskIntoConstraints="NO" id="oyW-Fd-ojD" userLabel="Sizing View">
-                                <rect key="frame" x="0.0" y="44" width="375" height="623"/>
+                                <rect key="frame" x="0.0" y="64" width="375" height="603"/>
                            </view>
                            <scrollView clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" alwaysBounceVertical="YES" indicatorStyle="white" keyboardDismissMode="onDrag" translatesAutoresizingMaskIntoConstraints="NO" id="WXx-hX-AXv">
                                <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                                <subviews>
                                    <view contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" translatesAutoresizingMaskIntoConstraints="NO" id="2wp-qG-f0Z">
-                                        <rect key="frame" x="0.0" y="0.0" width="375" height="623"/>
+                                        <rect key="frame" x="0.0" y="0.0" width="375" height="603"/>
                                        <subviews>
                                            <stackView opaque="NO" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" axis="vertical" spacing="50" translatesAutoresizingMaskIntoConstraints="NO" id="YmX-7v-pxh">
                                                <rect key="frame" x="16" y="6" width="343" height="359.5"/>
@@ -57,7 +57,7 @@
                                                        <rect key="frame" x="0.0" y="0.0" width="343" height="67.5"/>
                                                        <subviews>
                                                            <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Welcome to SideStore." textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="EI2-V3-zQZ">
-                                                                <rect key="frame" x="0.0" y="0.0" width="332" height="41"/>
+                                                                <rect key="frame" x="0.0" y="0.0" width="343" height="41"/>
                                                                <fontDescription key="fontDescription" type="boldSystem" pointSize="34"/>
                                                                <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                                <nil key="highlightedColor"/>
@@ -179,7 +179,7 @@
                                                </subviews>
                                            </stackView>
                                            <stackView opaque="NO" contentMode="scaleToFill" verticalCompressionResistancePriority="250" axis="vertical" spacing="4" translatesAutoresizingMaskIntoConstraints="NO" id="DBk-rT-ZE8">
-                                                <rect key="frame" x="16" y="518.5" width="343" height="96.5"/>
+                                                <rect key="frame" x="16" y="498.5" width="343" height="96.5"/>
                                                <subviews>
                                                    <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Why do we need this?" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="p9U-0q-Kn8">
                                                        <rect key="frame" x="0.0" y="0.0" width="343" height="20.5"/>
@@ -198,6 +198,10 @@
                                            </stackView>
                                        </subviews>
                                        <constraints>
+                                            <constraint firstItem="DBk-rT-ZE8" firstAttribute="leading" secondItem="2wp-qG-f0Z" secondAttribute="leadingMargin" id="5AT-nV-ZP9"/>
+                                            <constraint firstAttribute="bottomMargin" secondItem="DBk-rT-ZE8" secondAttribute="bottom" id="HgY-oY-8KM"/>
+                                            <constraint firstAttribute="trailingMargin" secondItem="DBk-rT-ZE8" secondAttribute="trailing" id="VCf-bW-2K4"/>
+                                            <constraint firstItem="YmX-7v-pxh" firstAttribute="top" secondItem="2wp-qG-f0Z" secondAttribute="top" constant="6" id="iUr-Nd-tkt"/>
                                            <constraint firstItem="DBk-rT-ZE8" firstAttribute="top" relation="greaterThanOrEqual" secondItem="YmX-7v-pxh" secondAttribute="bottom" constant="8" symbolic="YES" id="zTU-eY-DWd"/>
                                        </constraints>
                                    </view>
@@ -215,19 +219,15 @@
                        <constraints>
                            <constraint firstAttribute="bottom" secondItem="WXx-hX-AXv" secondAttribute="bottom" id="0jL-Ky-ju6"/>
                            <constraint firstAttribute="leadingMargin" secondItem="YmX-7v-pxh" secondAttribute="leading" id="2PO-lG-dmB"/>
-                            <constraint firstItem="DBk-rT-ZE8" firstAttribute="leading" secondItem="2wp-qG-f0Z" secondAttribute="leadingMargin" id="5AT-nV-ZP9"/>
                            <constraint firstItem="oyW-Fd-ojD" firstAttribute="top" secondItem="zMn-DV-fpy" secondAttribute="top" id="730-db-ukB"/>
-                            <constraint firstItem="2wp-qG-f0Z" firstAttribute="bottomMargin" secondItem="DBk-rT-ZE8" secondAttribute="bottom" id="HgY-oY-8KM"/>
                            <constraint firstItem="zMn-DV-fpy" firstAttribute="trailing" secondItem="oyW-Fd-ojD" secondAttribute="trailing" id="KGE-CN-SWf"/>
                            <constraint firstItem="WXx-hX-AXv" firstAttribute="top" secondItem="mjy-4S-hyH" secondAttribute="top" id="LPQ-bF-ic0"/>
                            <constraint firstItem="zMn-DV-fpy" firstAttribute="trailing" secondItem="WXx-hX-AXv" secondAttribute="trailing" id="MG7-A6-pKp"/>
                            <constraint firstAttribute="trailingMargin" secondItem="YmX-7v-pxh" secondAttribute="trailing" id="O4T-nu-o3e"/>
                            <constraint firstItem="zMn-DV-fpy" firstAttribute="bottom" secondItem="oyW-Fd-ojD" secondAttribute="bottom" id="PuX-ab-cEq"/>
                            <constraint firstItem="oyW-Fd-ojD" firstAttribute="leading" secondItem="zMn-DV-fpy" secondAttribute="leading" id="SzC-gC-Nvi"/>
-                            <constraint firstItem="2wp-qG-f0Z" firstAttribute="trailingMargin" secondItem="DBk-rT-ZE8" secondAttribute="trailing" id="VCf-bW-2K4"/>
                            <constraint firstItem="WXx-hX-AXv" firstAttribute="leading" secondItem="zMn-DV-fpy" secondAttribute="leading" id="d08-zF-5X6"/>
                            <constraint firstItem="2wp-qG-f0Z" firstAttribute="height" secondItem="oyW-Fd-ojD" secondAttribute="height" id="dFN-pw-TWt"/>
-                            <constraint firstItem="YmX-7v-pxh" firstAttribute="top" secondItem="2wp-qG-f0Z" secondAttribute="top" constant="6" id="iUr-Nd-tkt"/>
                            <constraint firstItem="2wp-qG-f0Z" firstAttribute="width" secondItem="oyW-Fd-ojD" secondAttribute="width" id="rYO-GN-0Lk"/>
                        </constraints>
                    </view>
@@ -258,13 +258,13 @@
        <!--How it works-->
        <scene sceneID="dMt-EA-SGy">
            <objects>
-                <viewController storyboardIdentifier="instructionsViewController" hidesBottomBarWhenPushed="YES" id="aFi-fb-W0B" customClass="InstructionsViewController" customModule="AltStore" customModuleProvider="target" sceneMemberID="viewController">
+                <viewController storyboardIdentifier="instructionsViewController" hidesBottomBarWhenPushed="YES" id="aFi-fb-W0B" customClass="InstructionsViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
                    <view key="view" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" id="Otz-hn-WGS">
                        <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                        <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
                        <subviews>
                            <stackView opaque="NO" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" axis="vertical" distribution="equalSpacing" translatesAutoresizingMaskIntoConstraints="NO" id="bp6-55-IG2">
-                                <rect key="frame" x="0.0" y="44" width="375" height="564"/>
+                                <rect key="frame" x="0.0" y="64" width="375" height="544"/>
                                <subviews>
                                    <stackView opaque="NO" contentMode="scaleToFill" alignment="center" spacing="20" translatesAutoresizingMaskIntoConstraints="NO" id="FjP-tm-w7K">
                                        <rect key="frame" x="16" y="35" width="343" height="95.5"/>
@@ -298,7 +298,7 @@
                                        </subviews>
                                    </stackView>
                                    <stackView opaque="NO" contentMode="scaleToFill" alignment="center" spacing="20" translatesAutoresizingMaskIntoConstraints="NO" id="LpI-Jt-SzX">
-                                        <rect key="frame" x="16" y="168" width="343" height="95.5"/>
+                                        <rect key="frame" x="16" y="161" width="343" height="95.5"/>
                                        <subviews>
                                            <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="2" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="0LW-eE-qHa">
                                                <rect key="frame" x="0.0" y="0.0" width="59" height="95.5"/>
@@ -310,7 +310,7 @@
                                                <nil key="highlightedColor"/>
                                            </label>
                                            <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="5" translatesAutoresizingMaskIntoConstraints="NO" id="dMu-eg-gIO">
-                                                <rect key="frame" x="79" y="17" width="264" height="61.5"/>
+                                                <rect key="frame" x="79" y="17.5" width="264" height="60.5"/>
                                                <subviews>
                                                    <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Connect to Wi-Fi and VPN" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="esj-pD-D4A">
                                                        <rect key="frame" x="0.0" y="0.0" width="264" height="20.5"/>
@@ -319,7 +319,7 @@
                                                        <nil key="highlightedColor"/>
                                                    </label>
                                                    <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Enable SideStore VPN in Wireguard and be able to use Sidestore on the go." textAlignment="natural" lineBreakMode="tailTruncation" numberOfLines="2" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="4rk-ge-FSj">
-                                                        <rect key="frame" x="0.0" y="25.5" width="264" height="36"/>
+                                                        <rect key="frame" x="0.0" y="25.5" width="264" height="35"/>
                                                        <fontDescription key="fontDescription" type="system" pointSize="16"/>
                                                        <color key="textColor" white="1" alpha="0.59999999999999998" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                        <nil key="highlightedColor"/>
@@ -329,7 +329,7 @@
                                        </subviews>
                                    </stackView>
                                    <stackView opaque="NO" contentMode="scaleToFill" alignment="center" spacing="20" translatesAutoresizingMaskIntoConstraints="NO" id="tfb-ja-9UC">
-                                        <rect key="frame" x="16" y="300.5" width="343" height="95.5"/>
+                                        <rect key="frame" x="16" y="287.5" width="343" height="95.5"/>
                                        <subviews>
                                            <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="3" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="nVr-El-Csi">
                                                <rect key="frame" x="0.0" y="0.0" width="59" height="95.5"/>
@@ -341,7 +341,7 @@
                                                <nil key="highlightedColor"/>
                                            </label>
                                            <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="5" translatesAutoresizingMaskIntoConstraints="NO" id="z6Y-zi-teL">
-                                                <rect key="frame" x="79" y="16" width="264" height="64"/>
+                                                <rect key="frame" x="79" y="15.5" width="264" height="64"/>
                                                <subviews>
                                                    <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Download Apps" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="JeJ-bk-UCA">
                                                        <rect key="frame" x="0.0" y="0.0" width="264" height="20.5"/>
@@ -360,7 +360,7 @@
                                        </subviews>
                                    </stackView>
                                    <stackView opaque="NO" contentMode="scaleToFill" alignment="center" spacing="20" translatesAutoresizingMaskIntoConstraints="NO" id="X3r-G1-vf2">
-                                        <rect key="frame" x="16" y="433.5" width="343" height="95.5"/>
+                                        <rect key="frame" x="16" y="413.5" width="343" height="95.5"/>
                                        <subviews>
                                            <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="4" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="i2U-NL-plG">
                                                <rect key="frame" x="0.0" y="0.0" width="59" height="95.5"/>
@@ -434,7 +434,7 @@
        <!--Refresh AltStore-->
        <scene sceneID="9Vh-dM-OqX">
            <objects>
-                <viewController storyboardIdentifier="refreshAltStoreViewController" id="aoK-yE-UVT" customClass="RefreshAltStoreViewController" customModule="AltStore" customModuleProvider="target" sceneMemberID="viewController">
+                <viewController storyboardIdentifier="refreshAltStoreViewController" id="aoK-yE-UVT" customClass="RefreshAltStoreViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
                    <view key="view" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" id="R83-kV-365">
                        <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                        <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
@@ -445,7 +445,7 @@
                            <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="8" translatesAutoresizingMaskIntoConstraints="NO" id="tDQ-ao-1Jg">
                                <rect key="frame" x="16" y="570" width="343" height="89"/>
                                <subviews>
-                                    <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="xcg-hT-tDe" customClass="PillButton" customModule="AltStore" customModuleProvider="target">
+                                    <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="xcg-hT-tDe" customClass="PillButton" customModule="SideStore" customModuleProvider="target">
                                        <rect key="frame" x="0.0" y="0.0" width="343" height="51"/>
                                        <color key="backgroundColor" name="SettingsHighlighted"/>
                                        <constraints>
@@ -493,12 +493,12 @@
                </viewController>
                <placeholder placeholderIdentifier="IBFirstResponder" id="Chr-7g-qEw" userLabel="First Responder" customClass="UIResponder" sceneMemberID="firstResponder"/>
            </objects>
-            <point key="canvasLocation" x="2967" y="736"/>
+            <point key="canvasLocation" x="3025" y="734"/>
        </scene>
        <!--Select a Team-->
        <scene sceneID="ioQ-WB-CLJ">
            <objects>
-                <viewController storyboardIdentifier="selectTeamViewController" hidesBottomBarWhenPushed="YES" id="kOD-4P-a6L" customClass="SelectTeamViewController" customModule="AltStore" customModuleProvider="target" sceneMemberID="viewController">
+                <viewController storyboardIdentifier="selectTeamViewController" hidesBottomBarWhenPushed="YES" id="kOD-4P-a6L" customClass="SelectTeamViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
                    <tableView key="view" clipsSubviews="YES" contentMode="scaleToFill" alwaysBounceVertical="YES" indicatorStyle="white" dataMode="prototypes" style="grouped" separatorStyle="none" rowHeight="60" estimatedRowHeight="-1" sectionHeaderHeight="18" sectionFooterHeight="18" id="fWW-kX-ifH">
                        <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                        <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
@@ -506,11 +506,11 @@
                        <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                        <color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                        <prototypes>
-                            <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" accessoryType="disclosureIndicator" indentationWidth="10" reuseIdentifier="TeamCell" textLabel="6ip-34-gmM" detailTextLabel="knk-Wf-PKf" style="IBUITableViewCellStyleSubtitle" id="qeQ-eb-2SC" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                            <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" accessoryType="disclosureIndicator" indentationWidth="10" reuseIdentifier="TeamCell" textLabel="6ip-34-gmM" detailTextLabel="knk-Wf-PKf" style="IBUITableViewCellStyleSubtitle" id="qeQ-eb-2SC" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
                                <rect key="frame" x="0.0" y="55.5" width="375" height="60"/>
                                <autoresizingMask key="autoresizingMask"/>
                                <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="qeQ-eb-2SC" id="bT4-Fc-u6I">
-                                    <rect key="frame" x="0.0" y="0.0" width="334" height="60"/>
+                                    <rect key="frame" x="0.0" y="0.0" width="334.5" height="60"/>
                                    <autoresizingMask key="autoresizingMask"/>
                                    <subviews>
                                        <label opaque="NO" multipleTouchEnabled="YES" contentMode="left" insetsLayoutMarginsFromSafeArea="NO" text="Team 1" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="6ip-34-gmM">
@@ -550,20 +550,19 @@
                </viewController>
                <placeholder placeholderIdentifier="IBFirstResponder" id="yH5-jU-aez" userLabel="First Responder" sceneMemberID="firstResponder"/>
            </objects>
-            <point key="canvasLocation" x="1401" y="734"/>
-
+            <point key="canvasLocation" x="2114" y="734"/>
        </scene>
-</scenes>
-<color key="tintColor" name="Primary"/>
-<resources>
-    <namedColor name="Primary">
-        <color red="0.0040000001899898052" green="0.50199997425079346" blue="0.51800000667572021" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
-    </namedColor>
+    </scenes>
+    <color key="tintColor" name="Primary"/>
+    <resources>
+        <namedColor name="Primary">
+            <color red="0.64313725490196083" green="0.019607843137254902" blue="0.98039215686274506" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+        </namedColor>
        <namedColor name="SettingsBackground">
-            <color red="0.0039215686274509803" green="0.50196078431372548" blue="0.51764705882352946" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.45098039215686275" green="0.015686274509803921" blue="0.68627450980392157" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
        </namedColor>
        <namedColor name="SettingsHighlighted">
-            <color red="0.0080000003799796104" green="0.32199999690055847" blue="0.40400001406669617" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.38823529411764707" green="0.011764705882352941" blue="0.58823529411764708" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
        </namedColor>
    </resources>
 </document>
--- a/AltStore/Authentication/AuthenticationViewController.swift
+++ b/AltStore/Authentication/AuthenticationViewController.swift
@@ -108,11 +108,9 @@ private extension AuthenticationViewController
                
            case .failure(let error as NSError):
                DispatchQueue.main.async {
-                    let error = error.withLocalizedFailure(NSLocalizedString("Failed to Log In", comment: ""))
-                    
+                    let error = error.withLocalizedTitle(NSLocalizedString("Failed to Log In", comment: ""))
+
                    let toastView = ToastView(error: error)
-                    toastView.textLabel.textColor = .altPink
-                    toastView.detailTextLabel.textColor = .altPink
                    toastView.show(in: self)
                    self.toastView = toastView
                    
--- a/AltStore/Browse/BrowseViewController.swift
+++ b/AltStore/Browse/BrowseViewController.swift
@@ -114,9 +114,9 @@ private extension BrowseViewController
                let progress = AppManager.shared.installationProgress(for: app)
                cell.bannerView.button.progress = progress
                
-                if let versionDate = app.latestVersion?.date, versionDate > Date()
+                if let versionDate = app.latestSupportedVersion?.date, versionDate > Date()
                {
-                    cell.bannerView.button.countdownDate = app.versionDate
+                    cell.bannerView.button.countdownDate = versionDate
                }
                else
                {
@@ -278,7 +278,7 @@ private extension BrowseViewController
                {
                case .failure(OperationError.cancelled): break // Ignore
                case .failure(let error):
-                    let toastView = ToastView(error: error)
+                    let toastView = ToastView(error: error, opensLog: true)
                    toastView.show(in: self)
                
                case .success: print("Installed app:", app.bundleIdentifier)
--- a/AltStore/Components/ToastView.swift
+++ b/AltStore/Components/ToastView.swift
@@ -18,8 +18,17 @@ extension TimeInterval

 final class ToastView: RSTToastView
 {
+    static let openErrorLogNotification = Notification.Name("ALTOpenErrorLogNotification")
+
    var preferredDuration: TimeInterval
-    
+
+    var opensErrorLog: Bool = false
+
+    convenience init(text: String, detailText: String?, opensLog: Bool = false) {
+        self.init(text: text, detailText: detailText)
+        self.opensErrorLog = opensLog
+    }
+
    override init(text: String, detailText detailedText: String?)
    {
        if detailedText == nil
@@ -43,53 +52,43 @@ final class ToastView: RSTToastView
            // RSTToastView does not expose stack view containing labels,
            // so we access it indirectly as the labels' superview.
            stackView.spacing = (detailedText != nil) ? 4.0 : 0.0
+            stackView.alignment = .leading
        }
+        self.addTarget(self, action: #selector(ToastView.showErrorLog), for: .touchUpInside)
    }
-    
+
+    convenience init(error: Error, opensLog: Bool = false) {
+        self.init(error: error)
+        self.opensErrorLog = opensLog
+    }
+
    convenience init(error: Error)
    {
        var error = error as NSError
        var underlyingError = error.underlyingError
        
-        var preferredDuration: TimeInterval?
-        
        if
            let unwrappedUnderlyingError = underlyingError,
            error.domain == AltServerErrorDomain && error.code == ALTServerError.Code.underlyingError.rawValue
        {
-            // Treat underlyingError as the primary error.
-            
+            // Treat underlyingError as the primary error, but keep localized title + failure.
+            let nsError = error as NSError
            error = unwrappedUnderlyingError as NSError
+
+            if let localizedTitle = nsError.localizedTitle {
+                error = error.withLocalizedTitle(localizedTitle)
+            }
+            if let localizedFailure = nsError.localizedFailure {
+                error = error.withLocalizedFailure(localizedFailure)
+            }
+
            underlyingError = nil
-            
-            preferredDuration = .longToastViewDuration
        }
-        
-        let text: String
-        let detailText: String?
-        
-        if let failure = error.localizedFailure
-        {
-            text = failure
-            detailText = error.localizedFailureReason ?? error.localizedRecoverySuggestion ?? underlyingError?.localizedDescription ?? error.localizedDescription
-        }
-        else if let reason = error.localizedFailureReason
-        {
-            text = reason
-            detailText = error.localizedRecoverySuggestion ?? underlyingError?.localizedDescription
-        }
-        else
-        {
-            text = error.localizedDescription
-            detailText = underlyingError?.localizedDescription ?? error.localizedRecoverySuggestion
-        }
-        
+        let text = error.localizedTitle ?? NSLocalizedString("Operation Failed", comment: "")
+        let detailText = error.localizedDescription
+
+
        self.init(text: text, detailText: detailText)
-        
-        if let preferredDuration = preferredDuration
-        {
-            self.preferredDuration = preferredDuration
-        }
    }
    
    required init(coder aDecoder: NSCoder) {
@@ -112,6 +111,18 @@ final class ToastView: RSTToastView
    
    override func show(in view: UIView, duration: TimeInterval)
    {
+        if opensErrorLog, #available(iOS 13.0, *), case let configuration = UIImage.SymbolConfiguration(font: self.textLabel.font),
+           let icon = UIImage(systemName: "chevron.right.circle", withConfiguration: configuration) {
+            let tintedIcon = icon.withTintColor(.white, renderingMode: .alwaysOriginal)
+            let moreIconImageView = UIImageView(image: tintedIcon)
+            moreIconImageView.translatesAutoresizingMaskIntoConstraints = false
+            self.addSubview(moreIconImageView)
+            NSLayoutConstraint.activate([
+                moreIconImageView.trailingAnchor.constraint(equalTo: self.trailingAnchor, constant: -self.layoutMargins.right),
+                moreIconImageView.centerYAnchor.constraint(equalTo: self.textLabel.centerYAnchor),
+                moreIconImageView.leadingAnchor.constraint(greaterThanOrEqualToSystemSpacingAfter: self.textLabel.trailingAnchor, multiplier: 1.0)
+            ])
+        }
        super.show(in: view, duration: duration)
        
        let announcement = (self.textLabel.text ?? "") + ". " + (self.detailTextLabel.text ?? "")
@@ -127,4 +138,10 @@ final class ToastView: RSTToastView
    {
        self.show(in: view, duration: self.preferredDuration)
    }
+
+    @objc
+    func showErrorLog() {
+        guard self.opensErrorLog else { return }
+        NotificationCenter.default.post(name: ToastView.openErrorLogNotification, object: self)
+    }
 }
--- a/AltStore/Info.plist
+++ b/AltStore/Info.plist
@@ -92,7 +92,7 @@
 	<key>LSRequiresIPhoneOS</key>
 	<true/>
 	<key>LSSupportsOpeningDocumentsInPlace</key>
-	<true/>
+	<false/>
 	<key>NSAppTransportSecurity</key>
 	<dict>
 		<key>NSAllowsArbitraryLoads</key>
--- a/AltStore/Intents/IntentHandler.swift
+++ b/AltStore/Intents/IntentHandler.swift
@@ -8,6 +8,7 @@

 import Foundation

+import minimuxer
 import AltStoreCore

@available(iOS 14, *)
@@ -39,8 +40,12 @@ final class IntentHandler: NSObject, RefreshAllIntentHandling
        
        // Give ourselves 9 extra seconds before starting handle() timeout timer.
        // 10 seconds or longer results in timeout regardless.
-        self.queue.asyncAfter(deadline: .now() + 9.0) {
-            self.finish(intent, response: RefreshAllIntentResponse(code: .ready, userActivity: nil))
+        self.queue.asyncAfter(deadline: .now() + 8.0) {
+            if minimuxer.ready() {
+                self.finish(intent, response: RefreshAllIntentResponse(code: .success, userActivity: nil))
+            } else {
+                self.finish(intent, response: RefreshAllIntentResponse(code: .failure, userActivity: nil))
+            }
        }
        
        if !DatabaseManager.shared.isStarted
@@ -52,12 +57,14 @@ final class IntentHandler: NSObject, RefreshAllIntentHandling
                }
                else
                {
+                    self.finish(intent, response: RefreshAllIntentResponse(code: .ready, userActivity: nil))
                    self.refreshApps(intent: intent)
                }
            }
        }
        else
        {
+            self.finish(intent, response: RefreshAllIntentResponse(code: .ready, userActivity: nil))
            self.refreshApps(intent: intent)
        }
    }
@@ -83,6 +90,11 @@ final class IntentHandler: NSObject, RefreshAllIntentHandling
                    // We took too long to finish and return the final result,
                    // so we'll now present a normal notification when finished.
                    operation.presentsFinishedNotification = true
+                    if minimuxer.ready() {
+                        self.finish(intent, response: RefreshAllIntentResponse(code: .success, userActivity: nil))
+                    } else {
+                        self.finish(intent, response: RefreshAllIntentResponse(code: .failure, userActivity: nil))
+                    }
                }
                
                self.finish(intent, response: RefreshAllIntentResponse(code: .inProgress, userActivity: nil))
@@ -106,6 +118,8 @@ private extension IntentHandler
            {
                // Queue response in case refreshing finishes after confirm() but before handle().
                self.queuedResponses[intent] = response
+                
+                UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
            }
        }
    }
@@ -126,10 +140,12 @@ private extension IntentHandler
                    }
                    
                    self.finish(intent, response: RefreshAllIntentResponse(code: .success, userActivity: nil))
+                    UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
                }
-                catch RefreshError.noInstalledApps
+                catch ~RefreshErrorCode.noInstalledApps
                {
                    self.finish(intent, response: RefreshAllIntentResponse(code: .success, userActivity: nil))
+                    UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
                }
                catch let error as NSError
                {
--- a/AltStore/LaunchViewController.swift
+++ b/AltStore/LaunchViewController.swift
@@ -49,6 +49,43 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
    
    override func viewDidAppear(_ animated: Bool) {
        super.viewDidAppear(true)
+        if #available(iOS 17, *), !UserDefaults.standard.sidejitenable {
+            DispatchQueue.global().async {
+                self.isSideJITServerDetected() { result in
+                    DispatchQueue.main.async {
+                        switch result {
+                        case .success():
+                            let dialogMessage = UIAlertController(title: "SideJITServer Detected", message: "Would you like to enable SideJITServer", preferredStyle: .alert)
+                            
+                            // Create OK button with action handler
+                            let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
+                                UserDefaults.standard.sidejitenable = true
+                            })
+                            
+                            let cancel = UIAlertAction(title: "Cancel", style: .cancel)
+                            //Add OK button to a dialog message
+                            dialogMessage.addAction(ok)
+                            dialogMessage.addAction(cancel)
+                            
+                            // Present Alert to
+                            self.present(dialogMessage, animated: true, completion: nil)
+                        case .failure(_):
+                            print("Cannot find sideJITServer")
+                        }
+                    }
+                }
+            }
+        }
+        
+        if #available(iOS 17, *), UserDefaults.standard.sidejitenable {
+            DispatchQueue.global().async {
+                self.askfornetwork()
+            }
+            print("SideJITServer Enabled")
+        }
+        
+        
+        
        #if !targetEnvironment(simulator)
        start_em_proxy(bind_addr: Consts.Proxy.serverURL)
        
@@ -60,6 +97,46 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
        #endif
    }
    
+    func askfornetwork() {
+        let address = UserDefaults.standard.textInputSideJITServerurl ?? ""
+        
+        var SJSURL = address
+        
+        if (UserDefaults.standard.textInputSideJITServerurl ?? "").isEmpty {
+          SJSURL = "http://sidejitserver._http._tcp.local:8080"
+        }
+        
+        // Create a network operation at launch to Refresh SideJITServer
+        let url = URL(string: "\(SJSURL)/re/")!
+        let task = URLSession.shared.dataTask(with: url) { (data, response, error) in
+            print(data)
+        }
+        task.resume()
+    }
+    
+    func isSideJITServerDetected(completion: @escaping (Result<Void, Error>) -> Void) {
+        let address = UserDefaults.standard.textInputSideJITServerurl ?? ""
+        
+        var SJSURL = address
+        
+        if (UserDefaults.standard.textInputSideJITServerurl ?? "").isEmpty {
+          SJSURL = "http://sidejitserver._http._tcp.local:8080"
+        }
+        
+        // Create a network operation at launch to Refresh SideJITServer
+        let url = URL(string: SJSURL)!
+        let task = URLSession.shared.dataTask(with: url) { (data, response, error) in
+            if let error = error {
+                print("No SideJITServer on Network")
+                completion(.failure(error))
+                return
+            }
+            completion(.success(()))
+        }
+        task.resume()
+        return
+    }
+    
    func fetchPairingFile() -> String? {
        let filename = "ALTPairingFile.mobiledevicepairing"
        let fm = FileManager.default
@@ -82,7 +159,7 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
        } else {
            // Show an alert explaining the pairing file
            // Create new Alert
-            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/getting-started/#pairing-file", preferredStyle: .alert)
+            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file or select \"Help\" for help.", preferredStyle: .alert)
            
            // Create OK button with action handler
            let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
@@ -97,7 +174,18 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
                UserDefaults.standard.isPairingReset = false
             })
            
-            //Add OK button to a dialog message
+            //Add "help" button to take user to wiki
+            let wikiOption = UIAlertAction(title: "Help", style: .default) { (action) in
+                let wikiURL: String = "https://docs.sidestore.io/docs/getting-started/pairing-file"
+                if let url = URL(string: wikiURL) {
+                    UIApplication.shared.open(url)
+                }
+                sleep(2)
+                exit(0)
+            }
+            
+            //Add buttons to dialog message
+            dialogMessage.addAction(wikiOption)
            dialogMessage.addAction(ok)

            // Present Alert to
--- a/Apps/AppExtensionView.swift
+++ b/Apps/AppExtensionView.swift
@@ -0,0 +1,81 @@
+//
+//  AppExtensionView.swift
+//  SideStore
+//
+//  Created by June P on 8/17/24.
+//  Copyright © 2024 SideStore. All rights reserved.
+//
+
+import SwiftUI
+import CAltSign
+
+extension ALTApplication: Identifiable {}
+
+struct AppExtensionView: View {
+    var extensions: Set<ALTApplication>
+    @State var selection: [ALTApplication] = []
+        
+    var completion: (_ selection: [ALTApplication]) -> Any?
+    
+    var body: some View {
+        NavigationView {
+            List {
+                ForEach(self.extensions.sorted {
+                    $0.bundleIdentifier < $1.bundleIdentifier
+                }, id: \.self) { item in
+                    MultipleSelectionRow(title: item.bundleIdentifier, isSelected: !selection.contains(item)) {
+                        if self.selection.contains(item) {
+                            self.selection.removeAll(where: { $0 == item })
+                        }
+                        else {
+                            self.selection.append(item)
+                        }
+                    }
+                }
+            }
+            .navigationTitle("App Extensions")
+            .onDisappear {
+                _ = completion(selection)
+            }
+        }
+    }
+}
+
+struct MultipleSelectionRow: View {
+    var title: String
+    var isSelected: Bool
+    var action: () -> Void
+
+    var body: some View {
+        SwiftUI.Button(action: self.action) {
+            HStack {
+                Text(self.title)
+                if self.isSelected {
+                    Spacer()
+                    Image(systemName: "checkmark")
+                }
+            }
+        }
+    }
+}
+
+class AppExtensionViewHostingController: UIHostingController<AppExtensionView> {
+    
+    
+    var completion: Optional<(_ selection: [ALTApplication]) -> Any?> = nil
+    
+    required init(extensions: Set<ALTApplication>, completion: @escaping (_ selection: [ALTApplication]) -> Any?) {
+        self.completion = completion
+        super.init(rootView: AppExtensionView(extensions: extensions, completion: completion))
+    }
+    
+    @MainActor required dynamic init?(coder aDecoder: NSCoder) {
+        super.init(coder: aDecoder)
+    }
+}
+
+extension AppExtensionViewHostingController: UIPopoverPresentationControllerDelegate {
+    func adaptivePresentationStyle(for controller: UIPresentationController) -> UIModalPresentationStyle {
+        return .none
+    }
+}
--- a/Apps/AppManager.swift
+++ b/Apps/AppManager.swift
@@ -8,12 +8,14 @@

 import Foundation
 import UIKit
+import SwiftUI
 import UserNotifications
 import MobileCoreServices
 import Intents
 import Combine
 import WidgetKit

+import minimuxer
 import AltStoreCore
 import AltSign
 import Roxas
@@ -37,17 +39,12 @@ final class AppManagerPublisher: ObservableObject
    fileprivate(set) var refreshProgress = [String: Progress]()
 }

-private func ==(lhs: OperatingSystemVersion, rhs: OperatingSystemVersion) -> Bool
-{
-    return (lhs.majorVersion == rhs.majorVersion && lhs.minorVersion == rhs.minorVersion && lhs.patchVersion == rhs.patchVersion)
-}
-
 final class AppManager
 {
    static let shared = AppManager()
    
    private(set) var updatePatronsResult: Result<Void, Error>?
-    
+        
    private let operationQueue = OperationQueue()
    private let serialOperationQueue = OperationQueue()

@@ -317,6 +314,35 @@ extension AppManager
        
        self.run([clearAppCacheOperation], context: nil)
    }
+
+    func log(_ error: Error, operation: LoggedError.Operation, app: AppProtocol)
+    {
+        switch error {
+        case ~OperationError.Code.cancelled: return // Don't log cancelled events
+        default: break
+        }
+        // Sanitize NSError on same thread before performing background task.
+        let sanitizedError = (error as NSError).sanitizedForSerialization()
+
+        DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
+            var app = app
+            if let managedApp = app as? NSManagedObject, let tempApp = context.object(with: managedApp.objectID) as? AppProtocol
+            {
+                app = tempApp
+            }
+
+            do
+            {
+                _ = LoggedError(error: sanitizedError, app: app, operation: operation, context: context)
+                try context.save()
+            }
+            catch let saveError
+            {
+                print("[ALTLog] Failed to log error \(sanitizedError.domain) code \(sanitizedError.code) for \(app.bundleIdentifier):", saveError)
+            }
+        }
+    }
+
 }

 extension AppManager
@@ -369,7 +395,7 @@ extension AppManager
                    case .success(let source): fetchedSources.insert(source)
                    case .failure(let error):
                        let source = managedObjectContext.object(with: source.objectID) as! Source
-                        source.error = (error as NSError).sanitizedForCoreData()
+                        source.error = (error as NSError).sanitizedForSerialization()
                        errors[source] = error
                    }
                    
@@ -457,7 +483,7 @@ extension AppManager
        group.completionHandler = { (results) in
            do
            {
-                guard let result = results.values.first else { throw context.error ?? OperationError.unknown }
+                guard let result = results.values.first else { throw context.error ?? OperationError.unknown() }
                completionHandler(result)
            }
            catch
@@ -476,7 +502,7 @@ extension AppManager
    func update(_ app: InstalledApp, presentingViewController: UIViewController?, context: AuthenticatedOperationContext = AuthenticatedOperationContext(), completionHandler: @escaping (Result<InstalledApp, Error>) -> Void) -> Progress
    {
        guard let storeApp = app.storeApp else {
-            completionHandler(.failure(OperationError.appNotFound))
+            completionHandler(.failure(OperationError.appNotFound(name: app.name)))
            return Progress.discreteProgress(totalUnitCount: 1)
        }
        
@@ -484,7 +510,7 @@ extension AppManager
        group.completionHandler = { (results) in
            do
            {
-                guard let result = results.values.first else { throw OperationError.unknown }
+                guard let result = results.values.first else { throw OperationError.unknown() }
                completionHandler(result)
            }
            catch
@@ -520,8 +546,8 @@ extension AppManager
        group.completionHandler = { (results) in
            do
            {
-                guard let result = results.values.first else { throw OperationError.unknown }
-                
+                guard let result = results.values.first else { throw OperationError.unknown() }
+
                let installedApp = try result.get()
                assert(installedApp.managedObjectContext != nil)
                
@@ -559,7 +585,7 @@ extension AppManager
            group.completionHandler = { (results) in
                do
                {
-                    guard let result = results.values.first else { throw OperationError.unknown }
+                    guard let result = results.values.first else { throw OperationError.unknown() }

                    let installedApp = try result.get()
                    assert(installedApp.managedObjectContext != nil)
@@ -585,8 +611,8 @@ extension AppManager
        group.completionHandler = { (results) in
            do
            {
-                guard let result = results.values.first else { throw OperationError.unknown }
-                
+                guard let result = results.values.first else { throw OperationError.unknown() }
+
                let installedApp = try result.get()
                assert(installedApp.managedObjectContext != nil)
                
@@ -610,7 +636,7 @@ extension AppManager
        group.completionHandler = { (results) in
            do
            {
-                guard let result = results.values.first else { throw OperationError.unknown }
+                guard let result = results.values.first else { throw OperationError.unknown() }
                
                let installedApp = try result.get()
                assert(installedApp.managedObjectContext != nil)
@@ -680,13 +706,20 @@ extension AppManager
            var installedApp: InstalledApp?
        }
        
+        let appName = installedApp.name
        let context = Context()
        context.installedApp = installedApp
        
        
        let enableJITOperation = EnableJITOperation(context: context)
        enableJITOperation.resultHandler = { (result) in
-            completionHandler(result)
+            switch result {
+            case .success: completionHandler(.success(()))
+            case .failure(let nsError as NSError):
+                let localizedTitle = String(format: NSLocalizedString("Failed to enable JIT for %@", comment: ""), appName)
+                let error = nsError.withLocalizedTitle(localizedTitle)
+                self.log(error, operation: .enableJIT, app: installedApp)
+            }
        }
        
        self.run([enableJITOperation], context: context, requiresSerialQueue: true)
@@ -822,6 +855,18 @@ private extension AppManager
            
            return bundleIdentifier
        }
+
+        var loggedErrorOperation: LoggedError.Operation {
+            switch self {
+            case .install: return .install
+            case .update: return .update
+            case .refresh: return .refresh
+            case .activate: return .activate
+            case .deactivate: return .deactivate
+            case .backup: return .backup
+            case .restore: return .restore
+            }
+        }
    }
    
    @discardableResult
@@ -970,6 +1015,88 @@ private extension AppManager
        return group
    }
    
+    func removeAppExtensions(from application: ALTApplication, extensions: Set<ALTApplication>, _ presentingViewController: UIViewController, completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        guard !application.appExtensions.isEmpty else { return completion(.success(())) }
+        
+        let firstSentence: String
+        
+        if UserDefaults.standard.activeAppLimitIncludesExtensions
+        {
+            firstSentence = NSLocalizedString("Non-developer Apple IDs are limited to 3 active apps and app extensions.", comment: "")
+        }
+        else
+        {
+            firstSentence = NSLocalizedString("Non-developer Apple IDs are limited to creating 10 App IDs per week.", comment: "")
+        }
+        
+        let message = firstSentence + " " + NSLocalizedString("Would you like to remove this app's extensions so they don't count towards your limit? There are \(extensions.count) Extensions", comment: "")
+        
+        let alertController = UIAlertController(title: NSLocalizedString("App Contains Extensions", comment: ""), message: message, preferredStyle: .alert)
+        alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style, handler: { (action) in
+            completion(.failure(OperationError.cancelled))
+        }))
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Keep App Extensions", comment: ""), style: .default) { (action) in
+            completion(.success(()))
+        })
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Remove App Extensions", comment: ""), style: .destructive) { (action) in
+            do
+            {
+                for appExtension in application.appExtensions
+                {
+                    try FileManager.default.removeItem(at: appExtension.fileURL)
+                }
+                
+                completion(.success(()))
+            }
+            catch
+            {
+                completion(.failure(error))
+            }
+        })
+        
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Choose App Extensions", comment: ""), style: .default) { (action) in
+            let popoverContentController = AppExtensionViewHostingController(extensions: extensions) { (selection) in
+                do
+                {
+                    for appExtension in selection
+                    {
+                        print("Deleting extension \(appExtension.bundleIdentifier)")
+                        
+                        try FileManager.default.removeItem(at: appExtension.fileURL)
+                    }
+                    completion(.success(()))
+                }
+                catch
+                {
+                    completion(.failure(error))
+                }
+                return nil
+            }
+            
+            let suiview = popoverContentController.view!
+            suiview.translatesAutoresizingMaskIntoConstraints = false
+            
+            popoverContentController.modalPresentationStyle = .popover
+            
+            if let popoverPresentationController = popoverContentController.popoverPresentationController {
+                popoverPresentationController.sourceView = presentingViewController.view
+                popoverPresentationController.sourceRect = CGRect(x: 50, y: 50, width: 4, height: 4)
+                popoverPresentationController.delegate = popoverContentController
+                
+                DispatchQueue.main.async {
+                    presentingViewController.present(popoverContentController, animated: true)
+                }
+            }
+            
+
+        })
+        
+        DispatchQueue.main.async {
+            presentingViewController.present(alertController, animated: true)
+        }
+    }
+    
    private func _install(_ app: AppProtocol, operation appOperation: AppOperation, group: RefreshGroup, context: InstallAppOperationContext? = nil, additionalEntitlements: [ALTEntitlement: Any]? = nil, cacheApp: Bool = true, completionHandler: @escaping (Result<InstalledApp, Error>) -> Void) -> Progress
    {
        let progress = Progress.discreteProgress(totalUnitCount: 100)
@@ -1042,6 +1169,44 @@ private extension AppManager
        }
        verifyOperation.addDependency(downloadOperation)
        
+        /* Remove App Extensions */
+        
+        let removeAppExtensionsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
+            do
+            {
+                if let error = context.error
+                {
+                    throw error
+                }
+
+                guard case .install = appOperation else {
+                    operation.finish()
+                    return
+                }
+                
+                guard let extensions = context.app?.appExtensions else { throw OperationError.invalidParameters }
+                
+                guard let app = context.app, let presentingViewController = context.authenticatedContext.presentingViewController else { throw OperationError.invalidParameters }
+                
+                
+                self?.removeAppExtensions(from: app, extensions: extensions, presentingViewController) { result in
+                    switch result {
+                    case .success(): break
+                    case .failure(let error): context.error = error
+                    }
+                    operation.finish()
+                }
+                
+            }
+            catch
+            {
+                group.context.error = error
+                operation.finish()
+            }
+        }
+        
+        removeAppExtensionsOperation.addDependency(verifyOperation)
+        
        
        /* Refresh Anisette Data */
        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
@@ -1052,7 +1217,7 @@ private extension AppManager
            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
            }
        }
-        refreshAnisetteDataOperation.addDependency(verifyOperation)
+        refreshAnisetteDataOperation.addDependency(removeAppExtensionsOperation)


        /* Fetch Provisioning Profiles */
@@ -1062,7 +1227,9 @@ private extension AppManager
            switch result
            {
            case .failure(let error): context.error = error
-            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
+            case .success(let provisioningProfiles): 
+                context.provisioningProfiles = provisioningProfiles
+                print("PROVISIONING PROFILES \(context.provisioningProfiles)")
            }
        }
        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
@@ -1111,7 +1278,6 @@ private extension AppManager
        }
        deactivateAppsOperation.addDependency(fetchProvisioningProfilesOperation)
        
-        
        /* Patch App */
        let patchAppOperation = RSTAsyncBlockOperation { operation in
            do
@@ -1236,7 +1402,7 @@ private extension AppManager
        progress.addChild(installOperation.progress, withPendingUnitCount: 30)
        installOperation.addDependency(sendAppOperation)
        
-        let operations = [downloadOperation, verifyOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, deactivateAppsOperation, patchAppOperation, resignAppOperation, sendAppOperation, installOperation]
+        let operations = [downloadOperation, verifyOperation, removeAppExtensionsOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, deactivateAppsOperation, patchAppOperation, resignAppOperation, sendAppOperation, installOperation]
        group.add(operations)
        self.run(operations, context: group.context)
        
@@ -1269,14 +1435,21 @@ private extension AppManager
            case .success(let installedApp):
                completionHandler(.success(installedApp))
                
-            case .failure(ALTServerError.unknownRequest), .failure(OperationError.appNotFound):
+            case .failure(MinimuxerError.ProfileInstall):
+                completionHandler(.failure(OperationError.noWiFi))
+                
+            case .failure(ALTServerError.unknownRequest), .failure(OperationError.appNotFound(name: app.name)):
                // Fall back to installation if AltServer doesn't support newer provisioning profile requests,
                // OR if the cached app could not be found and we may need to redownload it.
                app.managedObjectContext?.performAndWait { // Must performAndWait to ensure we add operations before we return.
-                    let installProgress = self._install(app, operation: operation, group: group) { (result) in
-                        completionHandler(result)
+                    if minimuxer.ready() {
+                        let installProgress = self._install(app, operation: operation, group: group) { (result) in
+                            completionHandler(result)
+                        }
+                        progress.addChild(installProgress, withPendingUnitCount: 40)
+                    } else {
+                        completionHandler(.failure(OperationError.noWiFi))
                    }
-                    progress.addChild(installProgress, withPendingUnitCount: 40)
                }
                
            case .failure(let error):
@@ -1543,7 +1716,7 @@ private extension AppManager
        }
        
        guard let application = ALTApplication(fileURL: app.fileURL) else {
-            completionHandler(.failure(OperationError.appNotFound))
+            completionHandler(.failure(OperationError.appNotFound(name: app.name)))
            return progress
        }
        
@@ -1555,8 +1728,8 @@ private extension AppManager
                    let temporaryDirectoryURL = context.temporaryDirectory.appendingPathComponent("AltBackup-" + UUID().uuidString)
                    try FileManager.default.createDirectory(at: temporaryDirectoryURL, withIntermediateDirectories: true, attributes: nil)
                    
-                    guard let altbackupFileURL = Bundle.main.url(forResource: "AltBackup", withExtension: "ipa") else { throw OperationError.appNotFound }
-                    
+                    guard let altbackupFileURL = Bundle.main.url(forResource: "AltBackup", withExtension: "ipa") else { throw OperationError.appNotFound(name: app.name) }
+
                    let unzippedAppBundleURL = try FileManager.default.unzipAppBundle(at: altbackupFileURL, toDirectory: temporaryDirectoryURL)
                    guard let unzippedAppBundle = Bundle(url: unzippedAppBundleURL) else { throw OperationError.invalidApp }
                    
@@ -1694,11 +1867,35 @@ private extension AppManager
            do { try installedApp.managedObjectContext?.save() }
            catch { print("Error saving installed app.", error) }
        }
-        catch
+        catch let nsError as NSError
        {
+            var appName: String!
+            if let app = operation.app as? (NSManagedObject & AppProtocol) {
+                if let context = app.managedObjectContext {
+                    context.performAndWait {
+                        appName = app.name
+                    }
+                } else {
+                    appName = NSLocalizedString("Unknown App", comment: "")
+                }
+            } else {
+                appName = operation.app.name
+            }
+
+            let localizedTitle: String
+            switch operation {
+            case .install: localizedTitle = String(format: NSLocalizedString("Failed to Install %@", comment: ""), appName)
+            case .refresh: localizedTitle = String(format: NSLocalizedString("Failed to Refresh %@", comment: ""), appName)
+            case .update: localizedTitle = String(format: NSLocalizedString("Failed to Update %@", comment: ""), appName)
+            case .activate: localizedTitle = String(format: NSLocalizedString("Failed to Activate %@", comment: ""), appName)
+            case .deactivate: localizedTitle = String(format: NSLocalizedString("Failed to Deactivate %@", comment: ""), appName)
+            case .backup: localizedTitle = String(format: NSLocalizedString("Failed to Backup %@", comment: ""), appName)
+            case .restore: localizedTitle = String(format: NSLocalizedString("Failed to Restore %@ Backup", comment: ""), appName)
+            }
+            let error = nsError.withLocalizedTitle(localizedTitle)
            group.set(.failure(error), forAppWithBundleIdentifier: operation.bundleIdentifier)
            
-            self.log(error, for: operation)
+            self.log(error, operation: operation.loggedErrorOperation, app: operation.app)
        }
    }
    
@@ -1715,51 +1912,15 @@ private extension AppManager
        let trigger = UNTimeIntervalNotificationTrigger(timeInterval: timeIntervalUntilNotification, repeats: false)
        
        let content = UNMutableNotificationContent()
-        content.title = NSLocalizedString("AltStore Expiring Soon", comment: "")
-        content.body = NSLocalizedString("AltStore will expire in 24 hours. Open the app and refresh it to prevent it from expiring.", comment: "")
+        content.title = NSLocalizedString("SideStore Expiring Soon", comment: "")
+        content.body = NSLocalizedString("SideStore will expire in 24 hours. Open the app and refresh it to prevent it from expiring.", comment: "")
        content.sound = .default
        
        let request = UNNotificationRequest(identifier: AppManager.expirationWarningNotificationID, content: content, trigger: trigger)
        UNUserNotificationCenter.current().add(request)
    }
    
-    func log(_ error: Error, for operation: AppOperation)
-    {
-        // Sanitize NSError on same thread before performing background task.
-        let sanitizedError = (error as NSError).sanitizedForCoreData()
-        
-        let loggedErrorOperation: LoggedError.Operation = {
-            switch operation
-            {
-            case .install: return .install
-            case .update: return .update
-            case .refresh: return .refresh
-            case .activate: return .activate
-            case .deactivate: return .deactivate
-            case .backup: return .backup
-            case .restore: return .restore
-            }
-        }()
-                    
-        DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
-            var app = operation.app
-            if let managedApp = app as? NSManagedObject, let tempApp = context.object(with: managedApp.objectID) as? AppProtocol
-            {
-                app = tempApp
-            }
-            
-            do
-            {
-                _ = LoggedError(error: sanitizedError, app: app, operation: loggedErrorOperation, context: context)
-                try context.save()
-            }
-            catch let saveError
-            {
-                print("[ALTLog] Failed to log error \(sanitizedError.domain) code \(sanitizedError.code) for \(app.bundleIdentifier):", saveError)
-            }
-        }
-    }
-    
+
    func run(_ operations: [Foundation.Operation], context: OperationContext?, requiresSerialQueue: Bool = false)
    {
        // Find "Install AltStore" operation if it already exists in `context`
--- a/Apps/AppManagerErrors.swift
+++ b/Apps/AppManagerErrors.swift
@@ -22,13 +22,27 @@ extension AppManager
        
        var managedObjectContext: NSManagedObjectContext?
        
-        var errorDescription: String? {
-            if let error = self.primaryError
-            {
-                return error.localizedDescription
+        var localizedTitle: String? {
+            var localizedTitle: String?
+            self.managedObjectContext?.performAndWait {
+                if self.sources?.count == 1 {
+                    localizedTitle = NSLocalizedString("Failed to refresh Store", comment: "")
+                } else if self.errors.count == 1 {
+                    guard let source = self.errors.keys.first else { return }
+                    localizedTitle = String(format: NSLocalizedString("Failed to refresh Source '%@'", comment: ""), source.name)
+                } else {
+                    localizedTitle = String(format: NSLocalizedString("Failed to refresh %@ Sources", comment: ""), NSNumber(value: self.errors.count))
+                }
            }
-            else
-            {
+            return localizedTitle
+        }
+
+        var errorDescription: String? {
+            if let error = self.primaryError {
+                return error.localizedDescription
+            } else if let error = self.errors.values.first, self.errors.count == 1 {
+                return error.localizedDescription
+            } else {
                var localizedDescription: String?
                
                self.managedObjectContext?.performAndWait {
@@ -67,8 +81,14 @@ extension AppManager
        }
        
        var errorUserInfo: [String : Any] {
-            guard let error = self.errors.values.first, self.errors.count == 1 else { return [:] }
-            return [NSUnderlyingErrorKey: error]
+            let errors = Array(self.errors.values)
+            var userInfo = [String: Any]()
+            userInfo[ALTLocalizedTitleErrorKey] = self.localizedTitle
+            userInfo[NSUnderlyingErrorKey] = self.primaryError
+            if #available(iOS 14.5, *), !errors.isEmpty {
+                userInfo[NSMultipleUnderlyingErrorsKey] = errors
+            }
+            return userInfo
        }
        
        init(_ error: Error)
--- a/Apps/MyAppsViewController.swift
+++ b/Apps/MyAppsViewController.swift
@@ -155,6 +155,13 @@ final class MyAppsViewController: UICollectionViewController
    @IBAction func unwindToMyAppsViewController(_ segue: UIStoryboardSegue)
    {
    }
+    var minimuxerStatus: Bool {
+        guard minimuxer.ready() else {
+            ToastView(error: (OperationError.noWiFi as NSError).withLocalizedTitle("No WiFi or VPN!")).show(in: self)
+            return false
+        }
+        return true
+    }
 }

 private extension MyAppsViewController
@@ -188,7 +195,7 @@ private extension MyAppsViewController
    func makeUpdatesDataSource() -> RSTFetchedResultsCollectionViewPrefetchingDataSource<InstalledApp, UIImage>
    {
        let fetchRequest = InstalledApp.updatesFetchRequest()
-        fetchRequest.sortDescriptors = [NSSortDescriptor(keyPath: \InstalledApp.storeApp?.latestVersion?.date, ascending: true),
+        fetchRequest.sortDescriptors = [NSSortDescriptor(keyPath: \InstalledApp.storeApp?.latestSupportedVersion?.date, ascending: false),
                                        NSSortDescriptor(keyPath: \InstalledApp.name, ascending: true)]
        fetchRequest.returnsObjectsAsFaults = false
        
@@ -197,21 +204,21 @@ private extension MyAppsViewController
        dataSource.cellIdentifierHandler = { _ in "UpdateCell" }
        dataSource.cellConfigurationHandler = { [weak self] (cell, installedApp, indexPath) in
            guard let self = self else { return }
-            guard let app = installedApp.storeApp, let latestVersion = app.latestVersion else { return }
+            guard let app = installedApp.storeApp, let latestSupportedVersion = app.latestSupportedVersion else { return }
            
            let cell = cell as! UpdateCollectionViewCell
            cell.layoutMargins.left = self.view.layoutMargins.left
            cell.layoutMargins.right = self.view.layoutMargins.right
            
            cell.tintColor = app.tintColor ?? .altPrimary
-            cell.versionDescriptionTextView.text = app.versionDescription
+            cell.versionDescriptionTextView.text = latestSupportedVersion.localizedDescription
            
            cell.bannerView.iconImageView.image = nil
            cell.bannerView.iconImageView.isIndicatingActivity = true
            
            cell.bannerView.configure(for: app)
            
-            let versionDate = Date().relativeDateString(since: latestVersion.date, dateFormatter: self.dateFormatter)
+            let versionDate = Date().relativeDateString(since: latestSupportedVersion.date, dateFormatter: self.dateFormatter)
            cell.bannerView.subtitleLabel.text = versionDate
            
            let appName: String
@@ -225,7 +232,7 @@ private extension MyAppsViewController
                appName = app.name
            }
            
-            cell.bannerView.accessibilityLabel = String(format: NSLocalizedString("%@ %@ update. Released on %@.", comment: ""), appName, latestVersion.version, versionDate)
+            cell.bannerView.accessibilityLabel = String(format: NSLocalizedString("%@ %@ update. Released on %@.", comment: ""), appName, latestSupportedVersion.version, versionDate)
            
            cell.bannerView.button.isIndicatingActivity = false
            cell.bannerView.button.addTarget(self, action: #selector(MyAppsViewController.updateApp(_:)), for: .primaryActionTriggered)
@@ -528,11 +535,9 @@ private extension MyAppsViewController
                
                guard !failures.isEmpty else { return }
                
-                let toastView: ToastView
-                
                if let failure = failures.first, results.count == 1
                {
-                    toastView = ToastView(error: failure.value)
+                    ToastView(error: failure.value).show(in: self)
                }
                else
                {
@@ -550,11 +555,10 @@ private extension MyAppsViewController
                    let error = failures.first?.value as NSError?
                    let detailText = error?.localizedFailure ?? error?.localizedFailureReason ?? error?.localizedDescription
                    
-                    toastView = ToastView(text: localizedText, detailText: detailText)
+                    let toastView = ToastView(text: localizedText, detailText: detailText, opensLog: true)
                    toastView.preferredDuration = 4.0
+                    toastView.show(in: self)
                }
-                
-                toastView.show(in: self)
            }
            
            self.refreshGroup = nil
@@ -645,11 +649,7 @@ private extension MyAppsViewController
    
    @IBAction func refreshAllApps(_ sender: UIBarButtonItem)
    {
-        if !minimuxer.ready() {
-            let toastView = ToastView(error: MinimuxerError.NoConnection)
-            toastView.show(in: self)
-            return
-        }
+        guard minimuxerStatus else { return }

        self.isRefreshingAllApps = true
        self.collectionView.collectionViewLayout.invalidateLayout()
@@ -694,8 +694,7 @@ private extension MyAppsViewController
                    self.collectionView.reloadItems(at: [indexPath])
                    
                case .failure(let error):
-                    let toastView = ToastView(error: error)
-                    toastView.show(in: self)
+                    ToastView(error: error, opensLog: true).show(in: self)
                    
                    self.collectionView.reloadItems(at: [indexPath])
                    
@@ -713,11 +712,7 @@ private extension MyAppsViewController
    
    @IBAction func sideloadApp(_ sender: UIBarButtonItem)
    {
-        if !minimuxer.ready() {
-            let toastView = ToastView(error: MinimuxerError.NoConnection)
-            toastView.show(in: self)
-            return
-        }
+        guard minimuxerStatus else { return }

        let supportedTypes = UTType.types(tag: "ipa", tagClass: .filenameExtension, conformingTo: nil)
        
@@ -788,7 +783,7 @@ private extension MyAppsViewController
        }
        
        let unzipProgress = Progress.discreteProgress(totalUnitCount: 1)
-        let unzipAppOperation = BlockOperation {
+        let unzipAppOperation = BlockOperation { 
            do
            {
                if let error = context.error
@@ -820,38 +815,7 @@ private extension MyAppsViewController
        {
            unzipAppOperation.addDependency(downloadOperation)
        }
-        
-        let removeAppExtensionsProgress = Progress.discreteProgress(totalUnitCount: 1)
-        let removeAppExtensionsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
-            do
-            {
-                if let error = context.error
-                {
-                    throw error
-                }
                
-                guard let application = context.application else { throw OperationError.invalidParameters }
-                
-                DispatchQueue.main.async {
-                    self?.removeAppExtensions(from: application) { (result) in
-                        switch result
-                        {
-                        case .success: removeAppExtensionsProgress.completedUnitCount = 1
-                        case .failure(let error): context.error = error
-                        }
-                        operation.finish()
-                    }
-                }
-            }
-            catch
-            {
-                context.error = error
-                operation.finish()
-            }
-        }
-        removeAppExtensionsOperation.addDependency(unzipAppOperation)
-        progress.addChild(removeAppExtensionsProgress, withPendingUnitCount: 5)
-        
        let installProgress = Progress.discreteProgress(totalUnitCount: 100)
        let installAppOperation = RSTAsyncBlockOperation { (operation) in
            do
@@ -900,22 +864,23 @@ private extension MyAppsViewController
                    completion(.failure((OperationError.cancelled)))
                    
                case .failure(let error):
-                    let toastView = ToastView(error: error)
-                    toastView.show(in: self)
-                    
+                    ToastView(error: error, opensLog: true).show(in: self)
+
                    completion(.failure(error))
                }
            }
        }
+        
+        installAppOperation.addDependency(unzipAppOperation)
+        
        progress.addChild(installProgress, withPendingUnitCount: 65)
-        installAppOperation.addDependency(removeAppExtensionsOperation)
        
        self.sideloadingProgress = progress
        self.sideloadingProgressView.progress = 0
        self.sideloadingProgressView.isHidden = false
        self.sideloadingProgressView.observedProgress = self.sideloadingProgress
        
-        let operations = [downloadOperation, unzipAppOperation, removeAppExtensionsOperation, installAppOperation].compactMap { $0 }
+        let operations = [downloadOperation, unzipAppOperation, installAppOperation].compactMap { $0 }
        self.operationQueue.addOperations(operations, waitUntilFinished: false)
    }
    
@@ -964,49 +929,6 @@ private extension MyAppsViewController
        
        cell.bannerView.iconImageView.isIndicatingActivity = false
    }
-    
-    func removeAppExtensions(from application: ALTApplication, completion: @escaping (Result<Void, Error>) -> Void)
-    {
-        guard !application.appExtensions.isEmpty else { return completion(.success(())) }
-        
-        let firstSentence: String
-        
-        if UserDefaults.standard.activeAppLimitIncludesExtensions
-        {
-            firstSentence = NSLocalizedString("Non-developer Apple IDs are limited to 3 active apps and app extensions.", comment: "")
-        }
-        else
-        {
-            firstSentence = NSLocalizedString("Non-developer Apple IDs are limited to creating 10 App IDs per week.", comment: "")
-        }
-        
-        let message = firstSentence + " " + NSLocalizedString("Would you like to remove this app's extensions so they don't count towards your limit?", comment: "")
-        
-        let alertController = UIAlertController(title: NSLocalizedString("App Contains Extensions", comment: ""), message: message, preferredStyle: .alert)
-        alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style, handler: { (action) in
-            completion(.failure(OperationError.cancelled))
-        }))
-        alertController.addAction(UIAlertAction(title: NSLocalizedString("Keep App Extensions", comment: ""), style: .default) { (action) in
-            completion(.success(()))
-        })
-        alertController.addAction(UIAlertAction(title: NSLocalizedString("Remove App Extensions", comment: ""), style: .destructive) { (action) in
-            do
-            {
-                for appExtension in application.appExtensions
-                {
-                    try FileManager.default.removeItem(at: appExtension.fileURL)
-                }
-                
-                completion(.success(()))
-            }
-            catch
-            {
-                completion(.failure(error))
-            }
-        })
-        
-        self.present(alertController, animated: true, completion: nil)
-    }
 }

 private extension MyAppsViewController
@@ -1016,18 +938,13 @@ private extension MyAppsViewController
        UIApplication.shared.open(installedApp.openAppURL) { success in
            guard !success else { return }
            
-            let toastView = ToastView(error: OperationError.openAppFailed(name: installedApp.name))
-            toastView.show(in: self)
+            ToastView(error: OperationError.openAppFailed(name: installedApp.name), opensLog: true).show(in: self)
        }
    }
    
    func refresh(_ installedApp: InstalledApp)
    {
-        if !minimuxer.ready() {
-            let toastView = ToastView(error: MinimuxerError.NoConnection)
-            toastView.show(in: self)
-            return
-        }
+        guard minimuxerStatus else { return }

        let previousProgress = AppManager.shared.refreshProgress(for: installedApp)
        guard previousProgress == nil else {
@@ -1050,11 +967,7 @@ private extension MyAppsViewController
    
    func activate(_ installedApp: InstalledApp)
    {
-        if !minimuxer.ready() {
-            let toastView = ToastView(error: MinimuxerError.NoConnection)
-            toastView.show(in: self)
-            return
-        }
+        guard minimuxerStatus else { return }

        func finish(_ result: Result<InstalledApp, Error>)
        {
@@ -1076,8 +989,7 @@ private extension MyAppsViewController
                DispatchQueue.main.async {
                    installedApp.isActive = false
                    
-                    let toastView = ToastView(error: error)
-                    toastView.show(in: self)
+                    ToastView(error: error, opensLog: true).show(in: self)
                }
            }
        }
@@ -1131,12 +1043,8 @@ private extension MyAppsViewController
    
    func deactivate(_ installedApp: InstalledApp, completionHandler: ((Result<InstalledApp, Error>) -> Void)? = nil)
    {
-        guard installedApp.isActive else { return }
-        if !minimuxer.ready() {
-            let toastView = ToastView(error: MinimuxerError.NoConnection)
-            toastView.show(in: self)
-            return
-        }
+        guard installedApp.isActive, minimuxerStatus else { return }
+
        installedApp.isActive = false
        
        AppManager.shared.deactivate(installedApp, presentingViewController: self) { (result) in
@@ -1149,13 +1057,12 @@ private extension MyAppsViewController
            }
            catch
            {
-                print("Failed to activate app:", error)
+                print("Failed to deactivate app:", error)
                
                DispatchQueue.main.async {
                    installedApp.isActive = true
                    
-                    let toastView = ToastView(error: error)
-                    toastView.show(in: self)
+                    ToastView(error: error, opensLog: true).show(in: self)
                }
            }
            
@@ -1177,7 +1084,7 @@ private extension MyAppsViewController
            message = NSLocalizedString("This will also erase all backup data for this app.", comment: "")
        }

-        let alertController = UIAlertController(title: title, message: message, preferredStyle: .actionSheet)
+        let alertController = UIAlertController(title: title, message: message, preferredStyle: .alert)
        alertController.addAction(.cancel)
        alertController.addAction(UIAlertAction(title: NSLocalizedString("Remove", comment: ""), style: .destructive, handler: { (action) in
            AppManager.shared.remove(installedApp) { (result) in
@@ -1186,8 +1093,7 @@ private extension MyAppsViewController
                case .success: break
                case .failure(let error):
                    DispatchQueue.main.async {
-                        let toastView = ToastView(error: error)
-                        toastView.show(in: self)
+                        ToastView(error: error, opensLog: true).show(in: self)
                    }
                }
            }
@@ -1198,11 +1104,8 @@ private extension MyAppsViewController
    
    func backup(_ installedApp: InstalledApp)
    {
-        if !minimuxer.ready() {
-            let toastView = ToastView(error: MinimuxerError.NoConnection)
-            toastView.show(in: self)
-            return
-        }
+        guard minimuxerStatus else { return }
+
        let title = NSLocalizedString("Start Backup?", comment: "")
        let message = NSLocalizedString("This will replace any previous backups. Please leave SideStore open until the backup is complete.", comment: "")

@@ -1224,9 +1127,8 @@ private extension MyAppsViewController
                    print("Failed to back up app:", error)
                    
                    DispatchQueue.main.async {
-                        let toastView = ToastView(error: error)
-                        toastView.show(in: self)
-                        
+                        ToastView(error: error, opensLog: true).show(in: self)
+
                        self.collectionView.reloadSections([Section.activeApps.rawValue, Section.inactiveApps.rawValue])
                    }
                }
@@ -1242,11 +1144,8 @@ private extension MyAppsViewController
    
    func restore(_ installedApp: InstalledApp)
    {
-        if !minimuxer.ready() {
-            let toastView = ToastView(error: MinimuxerError.NoConnection)
-            toastView.show(in: self)
-            return
-        }
+        guard minimuxerStatus else { return }
+
        let message = String(format: NSLocalizedString("This will replace all data you currently have in %@.", comment: ""), installedApp.name)
        let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to restore this backup?", comment: ""), message: message, preferredStyle: .actionSheet)
        alertController.addAction(.cancel)
@@ -1264,8 +1163,7 @@ private extension MyAppsViewController
                    print("Failed to restore app:", error)
                    
                    DispatchQueue.main.async {
-                        let toastView = ToastView(error: error)
-                        toastView.show(in: self)
+                        ToastView(error: error, opensLog: true).show(in: self)
                    }
                }
            }
@@ -1340,8 +1238,7 @@ private extension MyAppsViewController
                print("Failed to change app icon.", error)
                
                DispatchQueue.main.async {
-                    let toastView = ToastView(error: error)
-                    toastView.show(in: self)
+                    ToastView(error: error, opensLog: true).show(in: self)
                }
            }
        }
@@ -1350,24 +1247,28 @@ private extension MyAppsViewController
    @available(iOS 14, *)
    func enableJIT(for installedApp: InstalledApp)
    {
-        if #available(iOS 17, *) {
-            let toastView = ToastView(error: OperationError.tooNewError)
-            toastView.show(in: self)
-            return
-        }
-        if !minimuxer.ready() {
-            let toastView = ToastView(error: MinimuxerError.NoConnection)
-            toastView.show(in: self)
+        
+        let sidejitenabled = UserDefaults.standard.sidejitenable
+        
+        if #unavailable(iOS 17) {
+            guard minimuxerStatus else { return }
+        }
+        
+
+        if #available(iOS 17, *), !sidejitenabled {
+            ToastView(error: (OperationError.tooNewError as NSError).withLocalizedTitle("No iOS 17 On Device JIT!"), opensLog: true).show(in: self)
+            AppManager.shared.log(OperationError.tooNewError, operation: .enableJIT, app: installedApp)
            return
        }
+        
        AppManager.shared.enableJIT(for: installedApp) { result in
            DispatchQueue.main.async {
                switch result
                {
                case .success: break
                case .failure(let error):
-                    let toastView = ToastView(error: error)
-                    toastView.show(in: self.navigationController?.view ?? self.view, duration: 5)
+                    ToastView(error: error, opensLog: true).show(in: self)
+                    AppManager.shared.log(error, operation: .enableJIT, app: installedApp)
                }
            }
        }
--- a/AltStore/News/NewsViewController.swift
+++ b/AltStore/News/NewsViewController.swift
@@ -313,9 +313,8 @@ private extension NewsViewController
                {
                case .failure(OperationError.cancelled): break // Ignore
                case .failure(let error):
-                    let toastView = ToastView(error: error)
-                    toastView.show(in: self)
-                    
+                    ToastView(error: error, opensLog: true).show(in: self)
+
                case .success: print("Installed app:", storeApp.bundleIdentifier)
                }
                
@@ -391,9 +390,9 @@ extension NewsViewController
            let progress = AppManager.shared.installationProgress(for: storeApp)
            footerView.bannerView.button.progress = progress
            
-            if let versionDate = storeApp.latestVersion?.date, versionDate > Date()
+            if let versionDate = storeApp.latestSupportedVersion?.date, versionDate > Date()
            {
-                footerView.bannerView.button.countdownDate = storeApp.versionDate
+                footerView.bannerView.button.countdownDate = versionDate
            }
            else
            {
--- a/AltStore/Operations/AuthenticationOperation.swift
+++ b/AltStore/Operations/AuthenticationOperation.swift
@@ -14,7 +14,8 @@ import AltStoreCore
 import AltSign
 import minimuxer

-enum AuthenticationError: LocalizedError
+typealias AuthenticationError = AuthenticationErrorCode.Error
+enum AuthenticationErrorCode: Int, ALTErrorEnum, CaseIterable
 {
    case noTeam
    case noCertificate
@@ -23,11 +24,11 @@ enum AuthenticationError: LocalizedError
    case missingPrivateKey
    case missingCertificate
    
-    var errorDescription: String? {
+    var errorFailureReason: String {
        switch self {
-        case .noTeam: return NSLocalizedString("Developer team could not be found.", comment: "")
+        case .noTeam: return NSLocalizedString("Your Apple ID has no developer teams?", comment: "")
+        case .noCertificate: return NSLocalizedString("The developer certificate could not be found.", comment: "")
        case .teamSelectorError: return NSLocalizedString("Error presenting team selector view.", comment: "")
-        case .noCertificate: return NSLocalizedString("Developer certificate could not be found.", comment: "")
        case .missingPrivateKey: return NSLocalizedString("The certificate's private key could not be found.", comment: "")
        case .missingCertificate: return NSLocalizedString("The certificate could not be found.", comment: "")
        }
@@ -213,8 +214,8 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
                guard
                    let account = Account.first(satisfying: NSPredicate(format: "%K == %@", #keyPath(Account.identifier), altTeam.account.identifier), in: context),
                    let team = Team.first(satisfying: NSPredicate(format: "%K == %@", #keyPath(Team.identifier), altTeam.identifier), in: context)
-                else { throw AuthenticationError.noTeam }
-                
+                else { throw AuthenticationError(.noTeam) }
+
                // Account
                account.isActiveAccount = true
                
@@ -432,7 +433,7 @@ private extension AuthenticationOperation
                    }
                    else
                    {
-                        completionHandler(.failure(error ?? OperationError.unknown))
+                        completionHandler(.failure(error ?? OperationError.unknown()))
                    }
                }
            }
@@ -449,7 +450,7 @@ private extension AuthenticationOperation
                 if let team = teams.first {
                     return completionHandler(.success(team))
                 } else {
-                     return completionHandler(.failure(AuthenticationError.noTeam))
+                     return completionHandler(.failure(AuthenticationError(.noTeam)))
                 }
             } else {
                 DispatchQueue.main.async {
@@ -460,7 +461,7 @@ private extension AuthenticationOperation

                     if !self.present(selectTeamViewController)
                     {
-                         return completionHandler(.failure(AuthenticationError.noTeam))
+                         return completionHandler(.failure(AuthenticationError(.noTeam)))
                     }
                 }
             }
@@ -489,20 +490,20 @@ private extension AuthenticationOperation
    {
        func requestCertificate()
        {
-            let machineName = "AltStore - " + UIDevice.current.name
+            let machineName: String = "SideStore - \(team.account.firstName)'s \(UIDevice.current.name)"
            ALTAppleAPI.shared.addCertificate(machineName: machineName, to: team, session: session) { (certificate, error) in
                do
                {
                    let certificate = try Result(certificate, error).get()
-                    guard let privateKey = certificate.privateKey else { throw AuthenticationError.missingPrivateKey }
-                    
+                    guard let privateKey = certificate.privateKey else { throw AuthenticationError(.missingPrivateKey) }
+
                    ALTAppleAPI.shared.fetchCertificates(for: team, session: session) { (certificates, error) in
                        do
                        {
                            let certificates = try Result(certificates, error).get()
                            
                            guard let certificate = certificates.first(where: { $0.serialNumber == certificate.serialNumber }) else {
-                                throw AuthenticationError.missingCertificate
+                                throw AuthenticationError(.missingCertificate)
                            }
                            
                            certificate.privateKey = privateKey
@@ -523,16 +524,50 @@ private extension AuthenticationOperation
        
        func replaceCertificate(from certificates: [ALTCertificate])
        {
-            guard let certificate = certificates.first(where: { $0.machineName?.starts(with: "AltStore") == true }) ?? certificates.first else { return completionHandler(.failure(AuthenticationError.noCertificate)) }
+            let ourCertificates = certificates.filter { a in
+                a.machineName?.starts(with: "SideStore") == true || a.machineName?.starts(with: "AltStore") == true
+            }
            
-            ALTAppleAPI.shared.revoke(certificate, for: team, session: session) { (success, error) in
-                if let error = error, !success
+            if ourCertificates.isEmpty {
+                return requestCertificate()
+            }
+            
+            // We don't have private keys for any of the certificates,
+            // so we need to revoke one and create a new one.
+            var certsText = ""
+            for certificate in ourCertificates {
+                if let name = certificate.machineName {
+                    certsText.append("\(name)\n")
+                }
+            }
+            
+            let alertController = UIAlertController(title: NSLocalizedString("Would you like to revoke your previous certificates?\n\(certsText)", comment: ""), message: nil, preferredStyle: .alert)
+            
+            let noAction = UIAlertAction(title: NSLocalizedString("No", comment: ""), style: .default) { (action) in
+                requestCertificate()
+            }
+            let yesAction = UIAlertAction(title: NSLocalizedString("Yes", comment: ""), style: .default) { (action) in
+                for certificate in ourCertificates {
+                    ALTAppleAPI.shared.revoke(certificate, for: team, session: session) { (success, error) in
+                        if let error = error, !success
+                        {
+                            completionHandler(.failure(error))
+                        }
+                    }
+                }
+                requestCertificate()
+            }
+            alertController.addAction(noAction)
+            alertController.addAction(yesAction)
+            
+            DispatchQueue.main.async {
+                if self.navigationController.presentingViewController != nil
                {
-                    completionHandler(.failure(error))
+                    self.navigationController.present(alertController, animated: true, completion: nil)
                }
                else
                {
-                    requestCertificate()
+                    self.presentingViewController?.present(alertController, animated: true, completion: nil)
                }
            }
        }
@@ -580,8 +615,6 @@ private extension AuthenticationOperation
                }
                else
                {
-                    // We don't have private keys for any of the certificates,
-                    // so we need to revoke one and create a new one.
                    replaceCertificate(from: certificates)
                }
            }
--- a/AltStore/Operations/BackgroundRefreshAppsOperation.swift
+++ b/AltStore/Operations/BackgroundRefreshAppsOperation.swift
@@ -13,11 +13,12 @@ import AltStoreCore
 import EmotionalDamage
 import minimuxer

-enum RefreshError: LocalizedError
+typealias RefreshError = RefreshErrorCode.Error
+enum RefreshErrorCode: Int, ALTErrorEnum, CaseIterable
 {
    case noInstalledApps
    
-    var errorDescription: String? {
+    var errorFailureReason: String {
        switch self
        {
        case .noInstalledApps: return NSLocalizedString("No active apps require refreshing.", comment: "")
@@ -94,7 +95,7 @@ final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<Inst
        super.main()
        
        guard !self.installedApps.isEmpty else {
-            self.finish(.failure(RefreshError.noInstalledApps))
+            self.finish(.failure(RefreshError(.noInstalledApps)))
            return
        }
        start_em_proxy(bind_addr: Consts.Proxy.serverURL)
@@ -107,8 +108,7 @@ final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<Inst
        }
        if #available(iOS 17, *) {
            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
-        }
-        else {
+        } else {
            start_auto_mounter(documentsDirectory)
        }

@@ -203,7 +203,7 @@ private extension BackgroundRefreshAppsOperation
            
            let content = UNMutableNotificationContent()
            
-            var shouldPresentAlert = false
+            var shouldPresentAlert = true
            
            do
            {
@@ -219,20 +219,18 @@ private extension BackgroundRefreshAppsOperation
                content.title = NSLocalizedString("Refreshed Apps", comment: "")
                content.body = NSLocalizedString("All apps have been refreshed.", comment: "")
            }
-            catch RefreshError.noInstalledApps
+            catch ~OperationError.Code.noWiFi, ~RefreshErrorCode.noInstalledApps
            {
                shouldPresentAlert = false
            }
            catch
            {
                print("Failed to refresh apps in background.", error)
-                
+
                content.title = NSLocalizedString("Failed to Refresh Apps", comment: "")
                content.body = error.localizedDescription
-                
-                shouldPresentAlert = false
            }
-            
+
            if shouldPresentAlert
            {
                let trigger = UNTimeIntervalNotificationTrigger(timeInterval: delay + 1, repeats: false)
--- a/AltStore/Operations/BackupAppOperation.swift
+++ b/AltStore/Operations/BackupAppOperation.swift
@@ -55,12 +55,15 @@ class BackupAppOperation: ResultOperation<Void>
                    let appName = installedApp.name
                    self.appName = appName
                    
-                    let altstoreOpenURL = URL(string: "sidestore://")!
+                    guard let altstoreApp = InstalledApp.fetchAltStore(in: context) else {
+                        throw OperationError.appNotFound(name: appName)
+                    }
+                    let altstoreOpenURL = altstoreApp.openAppURL

                    var returnURLComponents = URLComponents(url: altstoreOpenURL, resolvingAgainstBaseURL: false)
                    returnURLComponents?.host = "appBackupResponse"
                    guard let returnURL = returnURLComponents?.url else { throw OperationError.openAppFailed(name: appName) }
-                    
+
                    var openURLComponents = URLComponents()
                    openURLComponents.scheme = installedApp.openAppURL.scheme
                    openURLComponents.host = self.action.rawValue
--- a/AltStore/Operations/DownloadAppOperation.swift
+++ b/AltStore/Operations/DownloadAppOperation.swift
@@ -12,66 +12,108 @@ import Roxas
 import AltStoreCore
 import AltSign

-private extension DownloadAppOperation
-{
-    struct DependencyError: ALTLocalizedError
-    {
-        let dependency: Dependency
-        let error: Error
-        
-        var failure: String? {
-            return String(format: NSLocalizedString("Could not download “%@”.", comment: ""), self.dependency.preferredFilename)
-        }
-        
-        var underlyingError: Error? {
-            return self.error
-        }
-    }
-}
-
@objc(DownloadAppOperation)
 final class DownloadAppOperation: ResultOperation<ALTApplication>
 {
    let app: AppProtocol
    let context: AppOperationContext
-    
+
+    private let appName: String
    private let bundleIdentifier: String
-    private var sourceURL: URL?
    private let destinationURL: URL
-    
+
    private let session = URLSession(configuration: .default)
    private let temporaryDirectory = FileManager.default.uniqueTemporaryURL()
-    
+
    init(app: AppProtocol, destinationURL: URL, context: AppOperationContext)
    {
        self.app = app
        self.context = context
-        
+
+        self.appName = app.name
        self.bundleIdentifier = app.bundleIdentifier
-        self.sourceURL = app.url
        self.destinationURL = destinationURL
-        
+
        super.init()
-        
+
        // App = 3, Dependencies = 1
        self.progress.totalUnitCount = 4
    }
-    
+
    override func main()
    {
        super.main()
-        
+
        if let error = self.context.error
        {
            self.finish(.failure(error))
            return
        }
-        
+
        print("Downloading App:", self.bundleIdentifier)
-        
-        guard let sourceURL = self.sourceURL else { return self.finish(.failure(OperationError.appNotFound)) }
-        
-        self.downloadApp(from: sourceURL) { result in
+
+        self.localizedFailure = String(format: NSLocalizedString("%@ could not be downloaded.", comment: ""), self.appName)
+
+        guard let storeApp = self.app as? StoreApp else { return self.download(self.app) }
+        storeApp.managedObjectContext?.perform {
+            do {
+                let latestVersion = try self.verify(storeApp)
+                self.download(latestVersion)
+            } catch let error as VerificationError where error.code == .iOSVersionNotSupported {
+                guard let presentingViewController = self.context.presentingViewController,
+                      let latestSupportedVersion = storeApp.latestSupportedVersion,
+                      case let version = latestSupportedVersion.version,
+                      version != storeApp.installedApp?.version else {
+                    return self.finish(.failure(error))
+                }
+                let title = NSLocalizedString("Unsupported iOS Version", comment: "")
+                let message = error.localizedDescription + "\n\n" + NSLocalizedString("Would you like to download the last version compatible with this device instead?", comment: "")
+
+                DispatchQueue.main.async {
+                    let alertController = UIAlertController(title: title, message: message, preferredStyle: .alert)
+                    alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { _ in
+                        self.finish(.failure(OperationError.cancelled))
+                    })
+                    alertController.addAction(UIAlertAction(title: String(format: NSLocalizedString("Download %@ %@", comment: ""), self.appName, version), style: .default) { _ in
+                        self.download(latestSupportedVersion)
+                    })
+                    presentingViewController.present(alertController, animated: true)
+                }
+            } catch {
+                self.finish(.failure(error))
+            }
+        }
+    }
+
+    override func finish(_ result: Result<ALTApplication, any Error>) {
+        do {
+            try FileManager.default.removeItem(at: self.temporaryDirectory)
+        } catch {
+            print("Failed to remove DownloadAppOperation temporary directory: \(self.temporaryDirectory).", error)
+        }
+        super.finish(result)
+    }
+}
+
+private extension DownloadAppOperation {
+    func verify(_ storeApp: StoreApp) throws -> AppVersion {
+        guard let version = storeApp.latestAvailableVersion else {
+            let failureReason = String(format: NSLocalizedString("The latest version of %@ could not be determined.", comment: ""), self.appName)
+            throw OperationError.unknown(failureReason: failureReason)
+        }
+        if let minOSVersion = version.minOSVersion, !ProcessInfo.processInfo.isOperatingSystemAtLeast(minOSVersion) {
+            throw VerificationError.iOSVersionNotSupported(app: storeApp, requiredOSVersion: minOSVersion)
+        } else if let maxOSVersion = version.maxOSVersion, ProcessInfo.processInfo.operatingSystemVersion > maxOSVersion {
+            throw VerificationError.iOSVersionNotSupported(app: storeApp, requiredOSVersion: maxOSVersion)
+        }
+
+        return version
+    }
+
+    func download(@Managed _ app: AppProtocol) {
+        guard let sourceURL = $app.url else { return self.finish(.failure(OperationError.appNotFound(name: self.appName))) }
+
+        self.downloadIPA(from: sourceURL) { result in
            do
            {
                let application = try result.get()
@@ -112,24 +154,7 @@ final class DownloadAppOperation: ResultOperation<ALTApplication>
        }
    }
    
-    override func finish(_ result: Result<ALTApplication, Error>)
-    {
-        do
-        {
-            try FileManager.default.removeItem(at: self.temporaryDirectory)
-        }
-        catch
-        {
-            print("Failed to remove DownloadAppOperation temporary directory: \(self.temporaryDirectory).", error)
-        }
-        
-        super.finish(result)
-    }
-}
-
-private extension DownloadAppOperation
-{
-    func downloadApp(from sourceURL: URL, completionHandler: @escaping (Result<ALTApplication, Error>) -> Void)
+    func downloadIPA(from sourceURL: URL, completionHandler: @escaping (Result<ALTApplication, Error>) -> Void)
    {
        func finishOperation(_ result: Result<URL, Error>)
        {
@@ -138,8 +163,8 @@ private extension DownloadAppOperation
                let fileURL = try result.get()
                
                var isDirectory: ObjCBool = false
-                guard FileManager.default.fileExists(atPath: fileURL.path, isDirectory: &isDirectory) else { throw OperationError.appNotFound }
-                
+                guard FileManager.default.fileExists(atPath: fileURL.path, isDirectory: &isDirectory) else { throw OperationError.appNotFound(name: self.appName) }
+
                try FileManager.default.createDirectory(at: self.temporaryDirectory, withIntermediateDirectories: true, attributes: nil)
                
                let appBundleURL: URL
@@ -178,6 +203,9 @@ private extension DownloadAppOperation
            let downloadTask = self.session.downloadTask(with: sourceURL) { (fileURL, response, error) in
                do
                {
+                    if let response = response as? HTTPURLResponse {
+                        guard response.statusCode != 404 else { throw CocoaError(.fileNoSuchFile, userInfo: [NSURLErrorKey: sourceURL]) }
+                    }
                    let (fileURL, _) = try Result((fileURL, response), error).get()
                    finishOperation(.success(fileURL))
                    
@@ -252,7 +280,7 @@ private extension DownloadAppOperation
            let altstorePlist = try PropertyListDecoder().decode(AltStorePlist.self, from: data)
                        
            var dependencyURLs = Set<URL>()
-            var dependencyError: DependencyError?
+            var dependencyError: Error?
            
            let dispatchGroup = DispatchGroup()
            let progress = Progress(totalUnitCount: Int64(altstorePlist.dependencies.count), parent: self.progress, pendingUnitCount: 1)
@@ -285,7 +313,7 @@ private extension DownloadAppOperation
        }
        catch let error as DecodingError
        {
-            let nsError = (error as NSError).withLocalizedFailure(String(format: NSLocalizedString("Could not download dependencies for %@.", comment: ""), application.name))
+            let nsError = (error as NSError).withLocalizedFailure(String(format: NSLocalizedString("Could not determine dependencies for %@.", comment: ""), application.name))
            completionHandler(.failure(nsError))
        }
        catch
@@ -294,7 +322,7 @@ private extension DownloadAppOperation
        }
    }
    
-    func download(_ dependency: Dependency, for application: ALTApplication, progress: Progress, completionHandler: @escaping (Result<URL, DependencyError>) -> Void)
+    func download(_ dependency: Dependency, for application: ALTApplication, progress: Progress, completionHandler: @escaping (Result<URL, Error>) -> Void)
    {
        let downloadTask = self.session.downloadTask(with: dependency.downloadURL) { (fileURL, response, error) in
            do
@@ -315,9 +343,10 @@ private extension DownloadAppOperation
                
                completionHandler(.success(destinationURL))
            }
-            catch
+            catch let error as NSError
            {
-                completionHandler(.failure(DependencyError(dependency: dependency, error: error)))
+                let localizedFailure = String(format: NSLocalizedString("The dependency '%@' could not be downloaded.", comment: ""), dependency.preferredFilename)
+                completionHandler(.failure(error.withLocalizedFailure(localizedFailure)))
            }
        }
        progress.addChild(downloadTask.progress, withPendingUnitCount: 1)
--- a/AltStore/Operations/EnableJITOperation.swift
+++ b/AltStore/Operations/EnableJITOperation.swift
@@ -9,9 +9,17 @@
 import UIKit
 import Combine
 import minimuxer
+import UniformTypeIdentifiers

 import AltStoreCore

+enum SideJITServerErrorType: Error {
+     case invalidURL
+     case errorConnecting
+     case deviceNotFound
+     case other(String)
+ }
+
@available(iOS 14, *)
 protocol EnableJITContext
 {
@@ -43,21 +51,105 @@ final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
        }
        
        guard let installedApp = self.context.installedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
-        
-        installedApp.managedObjectContext?.perform {
-            var retries = 3
-            while (retries > 0){
-                do {
-                    try debug_app(installedApp.resignedBundleIdentifier)
-                    self.finish(.success(()))
-                    retries = 0
-                } catch {
-                    retries -= 1
-                    if (retries <= 0){
-                        self.finish(.failure(error))
+        if #available(iOS 17, *) {
+            let sideJITenabled = UserDefaults.standard.sidejitenable
+            let SideJITIP = UserDefaults.standard.textInputSideJITServerurl ?? ""
+            
+            if sideJITenabled {
+                installedApp.managedObjectContext?.perform {
+                    EnableJITSideJITServer(serverurl: SideJITIP, installedapp: installedApp) { result in
+                        switch result {
+                        case .failure(let error):
+                            switch error {
+                            case .invalidURL, .errorConnecting:
+                                self.finish(.failure(OperationError.unableToConnectSideJIT))
+                            case .deviceNotFound:
+                                self.finish(.failure(OperationError.unableToRespondSideJITDevice))
+                            case .other(let message):
+                                if let startRange = message.range(of: "<p>"),
+                                   let endRange = message.range(of: "</p>", range: startRange.upperBound..<message.endIndex) {
+                                    let pContent = message[startRange.upperBound..<endRange.lowerBound]
+                                    self.finish(.failure(OperationError.SideJITIssue(error: String(pContent))))
+                                    print(message + " + " + String(pContent))
+                                } else {
+                                    print(message)
+                                    self.finish(.failure(OperationError.SideJITIssue(error: message)))
+                                }
+                            }
+                        case .success():
+                            self.finish(.success(()))
+                            print("Thank you for using this, it was made by Stossy11 and tested by trolley or sniper1239408")
+                        }
+                    }
+                    return
+                }
+            }
+      } else {
+            installedApp.managedObjectContext?.perform {
+                var retries = 3
+                while (retries > 0){
+                    do {
+                        try debug_app(installedApp.resignedBundleIdentifier)
+                        self.finish(.success(()))
+                        retries = 0
+                    } catch {
+                        retries -= 1
+                        if (retries <= 0){
+                            self.finish(.failure(error))
+                        }
                    }
                }
            }
        }
    }
 }
+
+@available(iOS 17, *)
+func EnableJITSideJITServer(serverurl: String, installedapp: InstalledApp, completion: @escaping (Result<Void, SideJITServerErrorType>) -> Void) {
+    guard let udid = fetch_udid()?.toString() else {
+        completion(.failure(.other("Unable to get UDID")))
+        return
+    }
+    
+    var SJSURL = serverurl
+    
+     if (UserDefaults.standard.textInputSideJITServerurl ?? "").isEmpty {
+      SJSURL = "http://sidejitserver._http._tcp.local:8080"
+     }
+    
+    if !SJSURL.hasPrefix("http") {
+        completion(.failure(.invalidURL))
+        return
+    }
+    
+    let fullurl = SJSURL + "/\(udid)/" + installedapp.resignedBundleIdentifier
+    
+    let url = URL(string: fullurl)!
+    
+    let task = URLSession.shared.dataTask(with: url) {(data, response, error) in
+        if let error = error {
+            completion(.failure(.errorConnecting))
+            return
+        }
+        
+        guard let data = data, let datastring = String(data: data, encoding: .utf8) else { return }
+        
+        if datastring == "Enabled JIT for '\(installedapp.name)'!" {
+            let content = UNMutableNotificationContent()
+            content.title = "JIT Successfully Enabled"
+            content.subtitle = "JIT Enabled For \(installedapp.name)"
+            content.sound = UNNotificationSound.default
+
+            let trigger = UNTimeIntervalNotificationTrigger(timeInterval: 0.1, repeats: false)
+            let request = UNNotificationRequest(identifier: "EnabledJIT", content: content, trigger: nil)
+
+            UNUserNotificationCenter.current().add(request)
+            completion(.success(()))
+        } else {
+            let errorType: SideJITServerErrorType = datastring == "Could not find device!" ? .deviceNotFound : .other(datastring)
+            completion(.failure(errorType))
+        }
+    }
+    
+    task.resume()
+}
--- a/AltStore/Operations/FetchAnisetteDataOperation.swift
+++ b/AltStore/Operations/FetchAnisetteDataOperation.swift
@@ -45,7 +45,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
            return
        }
        
-        self.url = AnisetteManager.currentURL
+        self.url = URL(string: UserDefaults.standard.menuAnisetteURL)
        print("Anisette URL: \(self.url!.absoluteString)")
        
        if let identifier = Keychain.shared.identifier,
@@ -408,6 +408,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
    func fetchAnisetteV3(_ identifier: String, _ adiPb: String) {
        fetchClientInfo {
            print("Fetching anisette V3")
+            let url = UserDefaults.standard.menuAnisetteURL
            var request = URLRequest(url: self.url!.appendingPathComponent("v3").appendingPathComponent("get_headers"))
            request.httpMethod = "POST"
            request.httpBody = try! JSONSerialization.data(withJSONObject: [
--- a/AltStore/Operations/FetchProvisioningProfilesOperation.swift
+++ b/AltStore/Operations/FetchProvisioningProfilesOperation.swift
@@ -45,8 +45,8 @@ final class FetchProvisioningProfilesOperation: ResultOperation<[String: ALTProv
            let session = self.context.session
        else { return self.finish(.failure(OperationError.invalidParameters)) }
        
-        guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
-        
+        guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound(name: nil))) }
+
        self.progress.totalUnitCount = Int64(1 + app.appExtensions.count)
        
        self.prepareProvisioningProfile(for: app, parentApp: nil, team: team, session: session) { (result) in
@@ -260,7 +260,7 @@ extension FetchProvisioningProfilesOperation
                        {
                            if let expirationDate = sortedExpirationDates.first
                            {
-                                throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
+                                throw OperationError.maximumAppIDLimitReached(appName: application.name, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, expirationDate: expirationDate)
                            }
                        }
                    }
@@ -286,7 +286,7 @@ extension FetchProvisioningProfilesOperation
                            {
                                if let expirationDate = sortedExpirationDates.first
                                {
-                                    throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
+                                    throw OperationError.maximumAppIDLimitReached(appName: application.name, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, expirationDate: expirationDate)
                                }
                                else
                                {
--- a/AltStore/Operations/Operation.swift
+++ b/AltStore/Operations/Operation.swift
@@ -12,7 +12,10 @@ import Roxas
 class ResultOperation<ResultType>: Operation
 {
    var resultHandler: ((Result<ResultType, Error>) -> Void)?
-    
+
+    // Should only be set by subclasses
+    var localizedFailure: String?
+
    @available(*, unavailable)
    override func finish()
    {
@@ -22,16 +25,20 @@ class ResultOperation<ResultType>: Operation
    func finish(_ result: Result<ResultType, Error>)
    {
        guard !self.isFinished else { return }
-        
+
+        var result = result
+
        if self.isCancelled
        {
-            self.resultHandler?(.failure(OperationError.cancelled))
+            result = .failure(OperationError.cancelled)
        }
-        else
-        {
-            self.resultHandler?(result)
+        else if case .failure(let nsError as NSError) = result, let localizedFailure, nsError.localizedFailure == nil {
+            // Error doesn't have its own localizedFailure, so we give it the Operation's (if it exists)
+            let error = nsError.withLocalizedFailure(localizedFailure)
+            result = .failure(error)
        }
-        
+        self.resultHandler?(result)
+
        super.finish()
    }
 }
--- a/AltStore/Operations/OperationError.swift
+++ b/AltStore/Operations/OperationError.swift
@@ -8,71 +8,186 @@

 import Foundation
 import AltSign
+import AltStoreCore
 import minimuxer

-enum OperationError: LocalizedError
+extension OperationError
 {
-    static let domain = OperationError.unknown._domain
+    enum Code: Int, ALTErrorCode, CaseIterable {
+        typealias Error = OperationError
+
+        // General
+        case unknown = 1000
+        case unknownResult
+        case cancelled
+        case timedOut
+        case unableToConnectSideJIT
+        case unableToRespondSideJITDevice
+        case wrongSideJITIP
+        case SideJITIssue // (error: String)
+        case refreshsidejit
+        case notAuthenticated
+        case appNotFound
+        case unknownUDID
+        case invalidApp
+        case invalidParameters
+        case maximumAppIDLimitReached//((application: ALTApplication, requiredAppIDs: Int, availableAppIDs: Int, nextExpirationDate: Date)
+        case noSources
+        case openAppFailed//(name: String)
+        case missingAppGroup
+
+        // Connection
+        case noWiFi = 1200
+        case tooNewError
+        case anisetteV1Error//(message: String)
+        case provisioningError//(result: String, message: String?)
+        case anisetteV3Error//(message: String)
+
+        case cacheClearError//(errors: [String])
+    }
+
+    static let unknownResult: OperationError = .init(code: .unknownResult)
+    static let cancelled: OperationError = .init(code: .cancelled)
+    static let timedOut: OperationError = .init(code: .timedOut)
+    static let unableToConnectSideJIT: OperationError = .init(code: .unableToConnectSideJIT)
+    static let unableToRespondSideJITDevice: OperationError = .init(code: .unableToRespondSideJITDevice)
+    static let wrongSideJITIP: OperationError = .init(code: .wrongSideJITIP)
+    static let notAuthenticated: OperationError = .init(code: .notAuthenticated)
+    static let unknownUDID: OperationError = .init(code: .unknownUDID)
+    static let invalidApp: OperationError = .init(code: .invalidApp)
+    static let invalidParameters: OperationError = .init(code: .invalidParameters)
+    static let noSources: OperationError = .init(code: .noSources)
+    static let missingAppGroup: OperationError = .init(code: .missingAppGroup)
+
+    static let noWiFi: OperationError = .init(code: .noWiFi)
+    static let tooNewError: OperationError = .init(code: .tooNewError)
+    static let provisioningError: OperationError = .init(code: .provisioningError)
+    static let anisetteV1Error: OperationError = .init(code: .anisetteV1Error)
+    static let anisetteV3Error: OperationError = .init(code: .anisetteV3Error)
+
+    static let cacheClearError: OperationError = .init(code: .cacheClearError)
+
+    static func unknown(failureReason: String? = nil, file: String = #fileID, line: UInt = #line) -> OperationError {
+        OperationError(code: .unknown, failureReason: failureReason, sourceFile: file, sourceLine: line)
+    }
+
+    static func appNotFound(name: String?) -> OperationError {
+        OperationError(code: .appNotFound, appName: name)
+    }
+
+    static func openAppFailed(name: String?) -> OperationError {
+        OperationError(code: .openAppFailed, appName: name)
+    }
    
-    case unknown
-    case unknownResult
-    case cancelled
-    case timedOut
+    static func SideJITIssue(error: String?) -> OperationError {
+        var o = OperationError(code: .SideJITIssue)
+        o.errorFailure = error
+        return o
+    }
    
-    case notAuthenticated
-    case appNotFound
-    
-    case unknownUDID
-    
-    case invalidApp
-    case invalidParameters
-    
-    case maximumAppIDLimitReached(application: ALTApplication, requiredAppIDs: Int, availableAppIDs: Int, nextExpirationDate: Date)
-    
-    case noSources
-    
-    case openAppFailed(name: String)
-    case missingAppGroup
-    
-    case noWiFi
-    case tooNewError
-    case anisetteV1Error(message: String)
-    case provisioningError(result: String, message: String?)
-    case anisetteV3Error(message: String)
-    
-    case cacheClearError(errors: [String])
-    
-    var failureReason: String? {
-        switch self {
-        case .unknown: return NSLocalizedString("An unknown error occured.", comment: "")
+    static func maximumAppIDLimitReached(appName: String, requiredAppIDs: Int, availableAppIDs: Int, expirationDate: Date) -> OperationError {
+        OperationError(code: .maximumAppIDLimitReached, appName: appName, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, expirationDate: expirationDate)
+    }
+
+    static func provisioningError(result: String, message: String?) -> OperationError {
+        var o = OperationError(code: .provisioningError, failureReason: result)
+        o.errorTitle = message
+        return o
+    }
+
+    static func cacheClearError(errors: [String]) -> OperationError {
+        OperationError(code: .cacheClearError, failureReason: errors.joined(separator: "\n"))
+    }
+
+    static func anisetteV1Error(message: String) -> OperationError {
+        OperationError(code: .anisetteV1Error, failureReason: message)
+    }
+
+    static func anisetteV3Error(message: String) -> OperationError {
+        OperationError(code: .anisetteV3Error, failureReason: message)
+    }
+
+}
+
+
+struct OperationError: ALTLocalizedError {
+
+    let code: Code
+
+    var errorTitle: String?
+    var errorFailure: String?
+
+    var appName: String?
+
+    var requiredAppIDs: Int?
+    var availableAppIDs: Int?
+    var expirationDate: Date?
+
+    var sourceFile: String?
+    var sourceLine: UInt?
+
+    private var _failureReason: String?
+
+    private init(code: Code, failureReason: String? = nil,
+                 appName: String? = nil, requiredAppIDs: Int? = nil, availableAppIDs: Int? = nil,
+                 expirationDate: Date? = nil, sourceFile: String? = nil, sourceLine: UInt? = nil){
+        self.code = code
+        self._failureReason = failureReason
+
+        self.appName = appName
+        self.requiredAppIDs = requiredAppIDs
+        self.availableAppIDs = availableAppIDs
+        self.expirationDate = expirationDate
+        self.sourceFile = sourceFile
+        self.sourceLine = sourceLine
+    }
+
+    var errorFailureReason: String {
+        switch self.code {
+        case .unknown:
+            var failureReason = self._failureReason ?? NSLocalizedString("An unknown error occurred.", comment: "")
+            guard let sourceFile, let sourceLine else { return failureReason }
+            failureReason += " (\(sourceFile) line \(sourceLine)"
+            return failureReason
        case .unknownResult: return NSLocalizedString("The operation returned an unknown result.", comment: "")
        case .cancelled: return NSLocalizedString("The operation was cancelled.", comment: "")
        case .timedOut: return NSLocalizedString("The operation timed out.", comment: "")
        case .notAuthenticated: return NSLocalizedString("You are not signed in.", comment: "")
-        case .appNotFound: return NSLocalizedString("App not found.", comment: "")
-        case .unknownUDID: return NSLocalizedString("Unknown device UDID.", comment: "")
-        case .invalidApp: return NSLocalizedString("The app is invalid.", comment: "")
+        case .unknownUDID: return NSLocalizedString("SideStore could not determine this device's UDID.", comment: "")
+        case .invalidApp: return NSLocalizedString("The app is in an invalid format.", comment: "")
        case .invalidParameters: return NSLocalizedString("Invalid parameters.", comment: "")
+        case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs within a 7 day period.", comment: "")
        case .noSources: return NSLocalizedString("There are no SideStore sources.", comment: "")
-        case .openAppFailed(let name): return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), name)
-        case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be found.", comment: "")
-        case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs.", comment: "")
-        case .noWiFi: return NSLocalizedString("You do not appear to be connected to WiFi!\nSideStore will never be able to install or refresh applications without WiFi.", comment: "")
-        case .tooNewError: return NSLocalizedString("iOS 17 has changed how JIT is enabled therefore SideStore cannot enable it at this time, sorry for any inconvenience.\nWe will let everyone know once we have a solution!", comment: "")
-        case .anisetteV1Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: ""), message)
-        case .provisioningError(let result, let message): return String(format: NSLocalizedString("An error occurred when provisioning: %@%@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), result, message != nil ? (" (" + message! + ")") : "")
-        case .anisetteV3Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), message)
-        case .cacheClearError(let errors): return String(format: NSLocalizedString("An error occurred while clearing cache: %@", comment: ""), errors.joined(separator: "\n"))
+        case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be accessed.", comment: "")
+        case .appNotFound:
+            let appName = self.appName ?? NSLocalizedString("The app", comment: "")
+            return String(format: NSLocalizedString("%@ could not be found.", comment: ""), appName)
+        case .openAppFailed:
+            let appName = self.appName ?? NSLocalizedString("The app", comment: "")
+            return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), appName)
+        case .noWiFi: return NSLocalizedString("You do not appear to be connected to WiFi and/or the WireGuard VPN!\nSideStore will never be able to install or refresh applications without WiFi and the WireGuard VPN.", comment: "")
+        case .tooNewError: return NSLocalizedString("iOS 17 has changed how JIT is enabled therefore SideStore cannot enable it without SideJITServer at this time, sorry for any inconvenience.\nWe will let everyone know once we have a solution!", comment: "")
+        case .unableToConnectSideJIT: return NSLocalizedString("Unable to connect to SideJITServer Please check that you are on the Same Wi-Fi and your Firewall has been set correctly", comment: "")
+        case .unableToRespondSideJITDevice: return NSLocalizedString("SideJITServer is unable to connect to your iDevice Please make sure you have paired your Device by doing 'SideJITServer -y' or try Refreshing SideJITServer from Settings", comment: "")
+        case .wrongSideJITIP: return NSLocalizedString("Incorrect SideJITServer IP Please make sure that you are on the Samw Wifi as SideJITServer", comment: "")
+        case .refreshsidejit: return NSLocalizedString("Unable to find App Please try Refreshing SideJITServer from Settings", comment: "")
+        case .anisetteV1Error: return NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: "")
+        case .provisioningError: return NSLocalizedString("An error occurred when provisioning: %@ %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: "")
+        case .anisetteV3Error: return NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: "")
+        case .cacheClearError: return NSLocalizedString("An error occurred while clearing cache: %@", comment: "")
+        case .SideJITIssue: return NSLocalizedString("An error occurred while using SideJIT: %@", comment: "")
        }
    }
    
    var recoverySuggestion: String? {
-        switch self
+        switch self.code
        {
-        case .maximumAppIDLimitReached(let application, let requiredAppIDs, let availableAppIDs, let date):
+        case .noWiFi: return NSLocalizedString("Make sure the VPN is toggled on and you are connected to any WiFi network!", comment: "")
+        case .maximumAppIDLimitReached:
            let baseMessage = NSLocalizedString("Delete sideloaded apps to free up App ID slots.", comment: "")
-            let message: String
-            
+            guard let appName, let requiredAppIDs, let availableAppIDs, let expirationDate else { return baseMessage }
+            var message: String
+
            if requiredAppIDs > 1
            {
                let availableText: String
@@ -84,23 +199,23 @@ enum OperationError: LocalizedError
                default: availableText = String(format: NSLocalizedString("only %@ are available", comment: ""), NSNumber(value: availableAppIDs))
                }
                
-                let prefixMessage = String(format: NSLocalizedString("%@ requires %@ App IDs, but %@.", comment: ""), application.name, NSNumber(value: requiredAppIDs), availableText)
-                message = prefixMessage + " " + baseMessage
+                let prefixMessage = String(format: NSLocalizedString("%@ requires %@ App IDs, but %@.", comment: ""), appName, NSNumber(value: requiredAppIDs), availableText)
+                message = prefixMessage + " " + baseMessage + "\n\n"
            }
            else
            {
-                let dateComponents = Calendar.current.dateComponents([.day, .hour, .minute], from: Date(), to: date)
-                
-                let dateComponentsFormatter = DateComponentsFormatter()
-                dateComponentsFormatter.maximumUnitCount = 1
-                dateComponentsFormatter.unitsStyle = .full
-                
-                let remainingTime = dateComponentsFormatter.string(from: dateComponents)!
-                
-                let remainingTimeMessage = String(format: NSLocalizedString("You can register another App ID in %@.", comment: ""), remainingTime)
-                message = baseMessage + " " + remainingTimeMessage
+                message = baseMessage + " "
            }
-            
+
+            let dateComponents = Calendar.current.dateComponents([.day, .hour, .minute], from: Date(), to: expirationDate)
+            let dateFormatter = DateComponentsFormatter()
+            dateFormatter.maximumUnitCount = 1
+            dateFormatter.unitsStyle = .full
+
+            let remainingTime = dateFormatter.string(from: dateComponents)!
+
+            message += String(format: NSLocalizedString("You can register another App ID in %@.", comment: ""), remainingTime)
+
            return message
            
        default: return nil
@@ -114,7 +229,7 @@ extension MinimuxerError: LocalizedError {
        case .NoDevice:
            return NSLocalizedString("Cannot fetch the device from the muxer", comment: "")
        case .NoConnection:
-            return NSLocalizedString("Unable to connect to the device, make sure Wireguard is enabled and you're connected to WiFi", comment: "")
+            return NSLocalizedString("Unable to connect to the device, make sure Wireguard is enabled and you're connected to WiFi. This could mean an invalid pairing.", comment: "")
        case .PairingFile:
            return NSLocalizedString("Invalid pairing file. Your pairing file either didn't have a UDID, or it wasn't a valid plist. Please use jitterbugpair to generate it", comment: "")
            
@@ -144,7 +259,7 @@ extension MinimuxerError: LocalizedError {
        case .CreateAfc:
            return self.createService(name: "AFC")
        case .RwAfc:
-            return NSLocalizedString("AFC was unable to manage files on the device", comment: "")
+            return NSLocalizedString("AFC was unable to manage files on the device. This usually means an invalid pairing.", comment: "")
        case .InstallApp(let message):
            return NSLocalizedString("Unable to install the app: \(message.toString())", comment: "")
        case .UninstallApp:
--- a/App/PatchAppOperation.swift
+++ b/App/PatchAppOperation.swift
@@ -25,22 +25,38 @@ protocol PatchAppContext
    var error: Error? { get }
 }

-enum PatchAppError: LocalizedError
+extension PatchAppError
 {
-    case unsupportedOperatingSystemVersion(OperatingSystemVersion)
-    
-    var errorDescription: String? {
-        switch self
-        {
-        case .unsupportedOperatingSystemVersion(let osVersion):
-            var osVersionString = "\(osVersion.majorVersion).\(osVersion.minorVersion)"
-            if osVersion.patchVersion != 0
-            {
-                osVersionString += ".\(osVersion.patchVersion)"
+    enum Code: Int, ALTErrorCode, CaseIterable {
+        typealias Error = PatchAppError
+
+        case unsupportedOperatingSystemVersion
+    }
+
+    static func unsupportedOperatingSystemVersion(_ osVersion: OperatingSystemVersion) -> PatchAppError {
+        PatchAppError(code: .unsupportedOperatingSystemVersion, osVersion: osVersion)
+    }
+}
+
+struct PatchAppError: ALTLocalizedError {
+    let code: Code
+
+    var errorTitle: String?
+    var errorFailure: String?
+
+    var osVersion: OperatingSystemVersion?
+
+    var errorFailureReason: String {
+        switch self.code {
+        case .unsupportedOperatingSystemVersion:
+            let osVersionString: String
+
+            if let osVersion = self.osVersion?.stringValue {
+                osVersionString = NSLocalizedString("iOS", comment: "") + " " + osVersion
+            } else {
+                osVersionString = NSLocalizedString("your device's iOS version", comment: "")
            }
-            
-            let errorDescription = String(format: NSLocalizedString("The OTA download URL for iOS %@ could not be determined.", comment: ""), osVersionString)
-            return errorDescription
+            return String(format: NSLocalizedString("The OTA download URL for %@ could not be determined.", comment: ""), osVersionString)
        }
    }
 }
--- a/App/PatchViewController.swift
+++ b/App/PatchViewController.swift
@@ -439,7 +439,7 @@ private extension PatchViewController
                            
                            do
                            {
-                                guard let (bundleIdentifier, result) = results.first else { throw refreshGroup?.context.error ?? OperationError.unknown }
+                                guard let (bundleIdentifier, result) = results.first else { throw refreshGroup?.context.error ?? OperationError.unknown() }
                                _ = try result.get()
                                
                                if var patchedApps = UserDefaults.standard.patchedApps, let index = patchedApps.firstIndex(of: bundleIdentifier)
--- a/AltStore/Operations/RefreshAppOperation.swift
+++ b/AltStore/Operations/RefreshAppOperation.swift
@@ -38,8 +38,8 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
            if let error = self.context.error { return self.finish(.failure(error)) }
            
            guard let profiles = self.context.provisioningProfiles else { return self.finish(.failure(OperationError.invalidParameters)) }
-            guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
-            
+            guard let app = self.context.app else { return self.finish(.failure(OperationError(.appNotFound(name: nil)))) }
+
            for p in profiles {
                do {
                    let bytes = p.value.data.toRustByteSlice()
@@ -49,14 +49,13 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
                }

                DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
-                print("Sending refresh app request...")
                    
                    self.progress.completedUnitCount += 1
                    
                    let predicate = NSPredicate(format: "%K == %@", #keyPath(InstalledApp.bundleIdentifier), app.bundleIdentifier)
                    self.managedObjectContext.perform {
                        guard let installedApp = InstalledApp.first(satisfying: predicate, in: self.managedObjectContext) else {
-                            self.finish(.failure(OperationError.appNotFound))
+                            self.finish(.failure(OperationError(.appNotFound(name: app.name))))
                            return
                        }
                        installedApp.update(provisioningProfile: p.value)
--- a/AltStore/Operations/SendAppOperation.swift
+++ b/AltStore/Operations/SendAppOperation.swift
@@ -57,7 +57,7 @@ final class SendAppOperation: ResultOperation<()>
            }
        } else {
            print("IPA doesn't exist????")
-            self.finish(.failure(OperationError.appNotFound))
+            self.finish(.failure(OperationError(.appNotFound(name: resignedApp.name))))
        }
    }
 }
--- a/AltStore/Operations/VerifyAppOperation.swift
+++ b/AltStore/Operations/VerifyAppOperation.swift
@@ -8,48 +8,87 @@

 import Foundation

+import AltStoreCore
 import AltSign
 import Roxas

-enum VerificationError: ALTLocalizedError
+extension VerificationError
 {
-    case privateEntitlements(ALTApplication, entitlements: [String: Any])
-    case mismatchedBundleIdentifiers(ALTApplication, sourceBundleID: String)
-    case iOSVersionNotSupported(ALTApplication)
+    enum Code: Int, ALTErrorCode, CaseIterable {
+        typealias Error = VerificationError
+
+        case privateEntitlements
+        case mismatchedBundleIdentifiers
+        case iOSVersionNotSupported
+    }
+
+    static func privateEntitlements(_ entitlements: [String: Any], app: ALTApplication) -> VerificationError {
+        VerificationError(code: .privateEntitlements, app: app, entitlements: entitlements)
+    }
+
+    static func mismatchedBundleIdentifiers(sourceBundleID: String, app: ALTApplication) -> VerificationError {
+        VerificationError(code: .mismatchedBundleIdentifiers, app: app, sourceBundleID: sourceBundleID)
+    }
+
+    static func iOSVersionNotSupported(app: AppProtocol, osVersion: OperatingSystemVersion = ProcessInfo.processInfo.operatingSystemVersion, requiredOSVersion: OperatingSystemVersion?) -> VerificationError {
+        VerificationError(code: .iOSVersionNotSupported, app: app)
+    }
+}
+
+struct VerificationError: ALTLocalizedError {
+    let code: Code
+
+    var errorTitle: String?
+    var errorFailure: String?
+
+    @Managed var app: AppProtocol?
+    var entitlements: [String: Any]?
+    var sourceBundleID: String?
+    var deviceOSVersion: OperatingSystemVersion?
+    var requiredOSVersion: OperatingSystemVersion?
    
-    var app: ALTApplication {
-        switch self
-        {
-        case .privateEntitlements(let app, _): return app
-        case .mismatchedBundleIdentifiers(let app, _): return app
-        case .iOSVersionNotSupported(let app): return app
+    var errorDescription: String? {
+        switch self.code {
+        case .iOSVersionNotSupported:
+            guard let deviceOSVersion else { return nil }
+
+            var failureReason = self.errorFailureReason
+            if self.app == nil {
+                let firstLetter = failureReason.prefix(1).lowercased()
+                failureReason = firstLetter + failureReason.dropFirst()
+            }
+
+            return String(formatted: "This device is running iOS %@, but %@", deviceOSVersion.stringValue, failureReason)
+        default: return nil
        }
    }
-    
-    var failure: String? {
-        return String(format: NSLocalizedString("“%@” could not be installed.", comment: ""), app.name)
-    }
-    
-    var failureReason: String? {
-        switch self
+
+    var errorFailureReason: String {
+        switch self.code
        {
-        case .privateEntitlements(let app, _):
-            return String(format: NSLocalizedString("“%@” requires private permissions.", comment: ""), app.name)
-            
-        case .mismatchedBundleIdentifiers(let app, let sourceBundleID):
-            return String(format: NSLocalizedString("The bundle ID “%@” does not match the one specified by the source (“%@”).", comment: ""), app.bundleIdentifier, sourceBundleID)
-            
-        case .iOSVersionNotSupported(let app):
-            let name = app.name
-            
-            var version = "iOS \(app.minimumiOSVersion.majorVersion).\(app.minimumiOSVersion.minorVersion)"
-            if app.minimumiOSVersion.patchVersion > 0
-            {
-                version += ".\(app.minimumiOSVersion.patchVersion)"
+        case .privateEntitlements:
+            let appName = self.$app.name ?? NSLocalizedString("The app", comment: "")
+            return String(formatted: "“%@” requires private permissions.", appName)
+
+        case .mismatchedBundleIdentifiers:
+            if let appBundleID = self.$app.bundleIdentifier, let bundleID = self.sourceBundleID {
+                return String(formatted: "The bundle ID '%@' does not match the one specified by the source ('%@').", appBundleID, bundleID)
+            } else {
+                return NSLocalizedString("The bundle ID does not match the one specified by the source.", comment: "")
+            }
+
+        case .iOSVersionNotSupported:
+            let appName = self.$app.name ?? NSLocalizedString("The app", comment: "")
+            let deviceOSVersion = self.deviceOSVersion ?? ProcessInfo.processInfo.operatingSystemVersion
+
+            guard let requiredOSVersion else {
+                return String(formatted: "%@ does not support iOS %@.", appName, deviceOSVersion.stringValue)
+            }
+            if deviceOSVersion > requiredOSVersion {
+                return String(formatted: "%@ requires iOS %@ or earlier", appName, requiredOSVersion.stringValue)
+            } else {
+                return String(formatted: "%@ requires iOS %@ or later", appName, requiredOSVersion.stringValue)
            }
-            
-            let localizedDescription = String(format: NSLocalizedString("%@ requires %@.", comment: ""), name, version)
-            return localizedDescription
        }
    }
 }
@@ -80,12 +119,14 @@ final class VerifyAppOperation: ResultOperation<Void>
            
            guard let app = self.context.app else { throw OperationError.invalidParameters }
            
-            guard app.bundleIdentifier == self.context.bundleIdentifier else {
-                throw VerificationError.mismatchedBundleIdentifiers(app, sourceBundleID: self.context.bundleIdentifier)
+            if !["ny.litritt.ignited", "com.litritt.ignited"].contains(where: { $0 == app.bundleIdentifier }) {
+                guard app.bundleIdentifier == self.context.bundleIdentifier else {
+                    throw VerificationError.mismatchedBundleIdentifiers(sourceBundleID: self.context.bundleIdentifier, app: app)
+                }
            }
            
            guard ProcessInfo.processInfo.isOperatingSystemAtLeast(app.minimumiOSVersion) else {
-                throw VerificationError.iOSVersionNotSupported(app)
+                throw VerificationError.iOSVersionNotSupported(app: app, requiredOSVersion: app.minimumiOSVersion)
            }
            
            if #available(iOS 13.5, *)
@@ -116,7 +157,7 @@ final class VerifyAppOperation: ResultOperation<Void>
                    let entitlements = try PropertyListSerialization.propertyList(from: entitlementsPlist.data(using: .utf8)!, options: [], format: nil) as! [String: Any]
                    
                    app.hasPrivateEntitlements = true
-                    let error = VerificationError.privateEntitlements(app, entitlements: entitlements)
+                    let error = VerificationError.privateEntitlements(entitlements, app: app)
                    self.process(error) { (result) in
                        self.finish(result.mapError { $0 as Error })
                    }
@@ -145,9 +186,10 @@ private extension VerifyAppOperation
        guard let presentingViewController = self.context.presentingViewController else { return completion(.failure(error)) }
        
        DispatchQueue.main.async {
-            switch error
+            switch error.code
            {
-            case .privateEntitlements(_, let entitlements):
+            case .privateEntitlements:
+                guard let entitlements = error.entitlements else { return completion(.failure(error)) }
                let permissions = entitlements.keys.sorted().joined(separator: "\n")
                let message = String(format: NSLocalizedString("""
                    You must allow access to these private permissions before continuing:
@@ -166,8 +208,7 @@ private extension VerifyAppOperation
                }))
                presentingViewController.present(alertController, animated: true, completion: nil)
                
-            case .mismatchedBundleIdentifiers: return completion(.failure(error))
-            case .iOSVersionNotSupported: return completion(.failure(error))
+            case .mismatchedBundleIdentifiers, .iOSVersionNotSupported: return completion(.failure(error))
            }
        }
    }
--- a/AltStore/Settings.bundle/Root.plist
+++ b/AltStore/Settings.bundle/Root.plist
@@ -1,75 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
-<plist version="1.0">
-<dict>
-	<key>StringsTable</key>
-	<string>Root</string>
-	<key>ApplicationGroupContainerIdentifier</key>
-	<string>group.$(APP_GROUP_IDENTIFIER)</string>
-	<key>PreferenceSpecifiers</key>
-	<array>
-		<dict>
-			<key>Type</key>
-			<string>PSMultiValueSpecifier</string>
-			<key>Title</key>
-			<string>Anisette Server</string>
-			<key>Key</key>
-			<string>customAnisetteURL</string>
-			<key>DefaultValue</key>
-			<string>https://ani.sidestore.io</string>
-			<key>Titles</key>
-			<array>
-				<string>SideStore</string>
-				<string>SideStore (.zip)</string>
-				<string>SideStore (.xyz)</string>
-				<string>Macley (US)</string>
-				<string>Jawshoeadan</string>
-				<string>WesleyBryie</string>
-			</array>
-			<key>Values</key>
-			<array>
-				<string>https://ani.sidestore.io</string>
-				<string>https://ani.sidestore.zip</string>
-				<string>https://ani.846969.xyz</string>
-				<string>http://5.249.163.88:6969/</string>
-				<string>https://anisette.jawshoeadan.me</string>
-				<string>https://ani.wesbryie.com</string>
-			</array>
-		</dict>
-		<dict>
-			<key>Type</key>
-			<string>PSGroupSpecifier</string>
-			<key>Title</key>
-			<string>Danger Zone</string>
-			<key>FooterText</key>
-			<string>If you disable the toggle then app will use the server you input into the &quot;Anisette URL&quot; box rather than one selected from the above selector.</string>
-		</dict>
-		<dict>
-			<key>Type</key>
-			<string>PSToggleSwitchSpecifier</string>
-			<key>Title</key>
-			<string>Use preferred servers</string>
-			<key>Key</key>
-			<string>textServer</string>
-			<key>DefaultValue</key>
-			<true/>
-			<key>FooterText</key>
-			<string>chicken</string>
-		</dict>
-		<dict>
-			<key>Type</key>
-			<string>PSTextFieldSpecifier</string>
-			<key>Title</key>
-			<string>Anisette URL</string>
-			<key>Key</key>
-			<string>textInputAnisetteURL</string>
-			<key>AutocapitalizationType</key>
-			<string>None</string>
-			<key>AutocorrectionType</key>
-			<string>No</string>
-			<key>KeyboardType</key>
-			<string>URL</string>
-		</dict>
-	</array>
-</dict>
-</plist>
--- a/AltStore/Settings.bundle/en.lproj/Root.strings
+++ b/AltStore/Settings.bundle/en.lproj/Root.strings
--- a/AltStore/Settings/AnisetteManager.swift
+++ b/AltStore/Settings/AnisetteManager.swift
@@ -10,6 +10,11 @@ import Foundation

 public struct AnisetteManager {
    
+    var menuURL: String {
+        var url: String
+        url = UserDefaults.standard.menuAnisetteURL
+        return url
+    }
    /// User defined URL from Settings/UserDefaults
    static var userURL: String? {
        var urlString: String?
--- a/AltStore/Settings/AnisetteServerList.swift
+++ b/AltStore/Settings/AnisetteServerList.swift
@@ -0,0 +1,190 @@
+//
+//  AnisetteServerList.swift
+//  SideStore
+//
+//  Created by ny on 6/18/24.
+//  Copyright © 2024 SideStore. All rights reserved.
+//
+
+import UIKit
+import SwiftUI
+import AltStoreCore
+
+typealias SUIButton = SwiftUI.Button
+
+// MARK: - AnisetteServerData
+struct AnisetteServerData: Codable {
+    let servers: [Server]
+}
+
+// MARK: - Server
+struct Server: Codable {
+    var name: String
+    var address: String
+}
+
+class AnisetteViewModel: ObservableObject {
+    @Published var selected: String = ""
+
+    @Published var source: String = "https://servers.sidestore.io/servers.json"
+    @Published var servers: [Server] = []
+    
+    func getListOfServers() {
+        guard let url = URL(string: source) else { return }
+        URLSession.shared.dataTask(with: url) { data, response, error in
+            if let error = error {
+                return
+            }
+            if let data = data {
+                do {
+                    let decoder = Foundation.JSONDecoder()
+                    let servers = try decoder.decode(AnisetteServerData.self, from: data)
+                    DispatchQueue.main.async {
+                        self.servers = servers.servers
+                    }
+                } catch {
+                    // Handle decoding error
+                    print("Failed to decode JSON: \(error)")
+                }
+            }
+        }.resume()
+    }
+}
+
+struct AnisetteServers: View {
+    @Environment(\.presentationMode) var presentationMode
+    @StateObject var viewModel: AnisetteViewModel = AnisetteViewModel()
+    @State var selected: String? = nil
+    var errorCallback: () -> ()
+
+    var body: some View {
+        ZStack {
+            Color(UIColor.systemBackground)
+                .ignoresSafeArea()
+                .onAppear {
+                    viewModel.getListOfServers()
+                }
+            VStack {
+                if #available(iOS 16.0, *) {
+                    SwiftUI.List($viewModel.servers, id: \.address, selection: $selected) { server in
+                        HStack {
+                            VStack(alignment: .leading) {
+                                Text("\(server.name.wrappedValue)")
+                                    .font(.headline)
+                                    .foregroundColor(.primary)
+                                Text("\(server.address.wrappedValue)")
+                                    .font(.subheadline)
+                                    .foregroundColor(.secondary)
+                            }
+                            Spacer()
+                            if selected != nil {
+                                if server.address.wrappedValue == selected {
+                                    Spacer()
+                                    Image(systemName: "checkmark.circle.fill")
+                                        .foregroundColor(.accentColor)
+                                        .onAppear {
+                                            UserDefaults.standard.menuAnisetteURL = server.address.wrappedValue
+                                            print(UserDefaults.synchronize(.standard)())
+                                            print(UserDefaults.standard.menuAnisetteURL)
+                                            print(server.address.wrappedValue)
+                                        }
+                                }
+                            }
+                        }
+                        .padding()
+                        .background(RoundedRectangle(cornerRadius: 10).fill(Color(UIColor.secondarySystemBackground)))
+                        .shadow(color: Color.black.opacity(0.2), radius: 5, x: 0, y: 5)
+                    }
+                    .listStyle(.plain)
+                    .scrollContentBackground(.hidden)
+                    .listRowBackground(Color(UIColor.systemBackground))
+                } else {
+                    List(selection: $selected) {
+                        ForEach($viewModel.servers, id: \.name) { server in
+                            VStack {
+                                HStack {
+                                    Text("\(server.name.wrappedValue)")
+                                        .foregroundColor(.primary)
+                                        .frame(alignment: .center)
+                                    Text("\(server.address.wrappedValue)")
+                                        .foregroundColor(.secondary)
+                                        .frame(alignment: .center)
+                                }
+                            }
+                            Spacer()
+                        }
+                        .padding()
+                        .background(RoundedRectangle(cornerRadius: 10).fill(Color(UIColor.secondarySystemBackground)))
+                        .shadow(color: Color.black.opacity(0.2), radius: 5, x: 0, y: 5)
+                    }
+                    .listStyle(.plain)
+                }
+                
+                VStack(spacing: 16) {
+                    TextField("Anisette Server List", text: $viewModel.source)
+                        .padding()
+                        .background(RoundedRectangle(cornerRadius: 10).fill(Color(UIColor.secondarySystemFill)))
+                        .foregroundColor(.primary)
+                        .frame(height: 60)
+                        .shadow(color: Color.black.opacity(0.2), radius: 5, x: 0, y: 5)
+                        .onChange(of: viewModel.source) { newValue in
+                            UserDefaults.standard.menuAnisetteList = newValue
+                            viewModel.getListOfServers()
+                        }
+
+                    HStack(spacing: 16) {
+                        SUIButton(action: {
+                            presentationMode.wrappedValue.dismiss()
+                        }) {
+                            Text("Back")
+                                .fontWeight(.semibold)
+                                .frame(maxWidth: .infinity)
+                        }
+                        .buttonStyle(PlainButtonStyle())
+                        .padding()
+                        .background(RoundedRectangle(cornerRadius: 10).fill(Color.accentColor))
+                        .foregroundColor(.white)
+                        .shadow(color: Color.accentColor.opacity(0.4), radius: 10, x: 0, y: 5)
+
+                        SUIButton(action: {
+                            viewModel.getListOfServers()
+                        }) {
+                            Text("Refresh Servers")
+                                .fontWeight(.semibold)
+                                .frame(maxWidth: .infinity)
+                        }
+                        .buttonStyle(PlainButtonStyle())
+                        .padding()
+                        .background(RoundedRectangle(cornerRadius: 10).fill(Color.accentColor))
+                        .foregroundColor(.white)
+                        .shadow(color: Color.accentColor.opacity(0.4), radius: 10, x: 0, y: 5)
+                    }
+
+                    SUIButton(action: {
+                        #if !DEBUG
+                        if Keychain.shared.adiPb != nil {
+                            Keychain.shared.adiPb = nil
+                        }
+                        #endif
+                        print("Cleared adi.pb from keychain")
+                        errorCallback()
+                        presentationMode.wrappedValue.dismiss()
+                    }) {
+                        Text("Reset adi.pb")
+                            .fontWeight(.semibold)
+                            .frame(maxWidth: .infinity)
+                    }
+                    .buttonStyle(PlainButtonStyle())
+                    .padding()
+                    .background(RoundedRectangle(cornerRadius: 10).fill(Color.red))
+                    .foregroundColor(.white)
+                    .shadow(color: Color.red.opacity(0.4), radius: 10, x: 0, y: 5)
+                }
+                .padding(.horizontal)
+                .padding(.bottom)
+            }
+        }
+        .navigationBarHidden(true)
+        .navigationTitle("")
+    }
+}
--- a/Log/ErrorDetailsViewController.swift
+++ b/Log/ErrorDetailsViewController.swift
@@ -0,0 +1,53 @@
+//
+//  ErrorDetailsViewController.swift
+//  AltStore
+//
+//  Created by Riley Testut on 10/5/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import UIKit
+
+import AltStoreCore
+
+class ErrorDetailsViewController: UIViewController
+{
+    var loggedError: LoggedError?
+
+    @IBOutlet private var textView: UITextView!
+
+    override func viewDidLoad()
+    {
+        super.viewDidLoad()
+
+        if let error = self.loggedError?.error
+        {
+            self.title = error.localizedErrorCode
+
+            let font = self.textView.font ?? UIFont.preferredFont(forTextStyle: .body)
+            let detailedDescription = error.formattedDetailedDescription(with: font)
+            self.textView.attributedText = detailedDescription
+        }
+        else
+        {
+            self.title = NSLocalizedString("Error Details", comment: "")
+        }
+
+        self.navigationController?.navigationBar.tintColor = .altPrimary
+
+        if #available(iOS 15, *), let sheetController = self.navigationController?.sheetPresentationController
+        {
+            sheetController.detents = [.medium(), .large()]
+            sheetController.selectedDetentIdentifier = .medium
+            sheetController.prefersGrabberVisible = true
+        }
+    }
+
+    override func viewDidLayoutSubviews()
+    {
+        super.viewDidLayoutSubviews()
+
+        self.textView.textContainerInset.left = self.view.layoutMargins.left
+        self.textView.textContainerInset.right = self.view.layoutMargins.right
+    }
+}
--- a/Log/ErrorLogTableViewCell.swift
+++ b/Log/ErrorLogTableViewCell.swift
@@ -8,6 +8,16 @@

 import UIKit

+@objc(ErrorLogMenuButton)
+private final class ErrorLogMenuButton: UIButton {
+    @available(iOS 14.0, *)
+    override func menuAttachmentPoint(for configuration: UIContextMenuConfiguration) -> CGPoint {
+        var point = super.menuAttachmentPoint(for: configuration)
+        point.y = self.bounds.midY
+        return point
+    }
+}
+
@objc(ErrorLogTableViewCell)
 final class ErrorLogTableViewCell: UITableViewCell
 {
--- a/Log/ErrorLogViewController.swift
+++ b/Log/ErrorLogViewController.swift
@@ -21,6 +21,13 @@ final class ErrorLogViewController: UITableViewController
    private lazy var dataSource = self.makeDataSource()
    private var expandedErrorIDs = Set<NSManagedObjectID>()
    
+    private var isScrolling = false {
+        didSet {
+            guard self.isScrolling != oldValue else { return }
+            self.updateButtonInteractivity()
+        }
+    }
+
    private lazy var timeFormatter: DateFormatter = {
        let dateFormatter = DateFormatter()
        dateFormatter.dateStyle = .none
@@ -39,6 +46,15 @@ final class ErrorLogViewController: UITableViewController
        self.tableView.dataSource = self.dataSource
        self.tableView.prefetchDataSource = self.dataSource
    }
+
+    override func prepare(for segue: UIStoryboardSegue, sender: Any?) {
+        guard let loggedError = sender as? LoggedError, segue.identifier == "showErrorDetails" else { return }
+
+        let navigationController = segue.destination as! UINavigationController
+
+        let errorDetailsViewController = navigationController.viewControllers.first as! ErrorDetailsViewController
+        errorDetailsViewController.loggedError = loggedError
+    }
 }

 private extension ErrorLogViewController
@@ -60,14 +76,8 @@ private extension ErrorLogViewController
            let cell = cell as! ErrorLogTableViewCell
            cell.dateLabel.text = self.timeFormatter.string(from: loggedError.date)
            cell.errorFailureLabel.text = loggedError.localizedFailure ?? NSLocalizedString("Operation Failed", comment: "")
-            
-            switch loggedError.domain
-            {
-            case AltServerErrorDomain: cell.errorCodeLabel?.text = String(format: NSLocalizedString("AltServer Error %@", comment: ""), NSNumber(value: loggedError.code))
-            case OperationError.domain: cell.errorCodeLabel?.text = String(format: NSLocalizedString("AltStore Error %@", comment: ""), NSNumber(value: loggedError.code))
-            default: cell.errorCodeLabel?.text = loggedError.error.localizedErrorCode
-            }
-            
+            cell.errorCodeLabel.text = loggedError.error.localizedErrorCode
+
            let nsError = loggedError.error as NSError
            let errorDescription = [nsError.localizedDescription, nsError.localizedRecoverySuggestion].compactMap { $0 }.joined(separator: "\n\n")
            cell.errorDescriptionTextView.text = errorDescription
@@ -93,12 +103,19 @@ private extension ErrorLogViewController
                    },
                    UIAction(title: NSLocalizedString("Search FAQ", comment: ""), image: UIImage(systemName: "magnifyingglass")) { [weak self] _ in
                        self?.searchFAQ(for: loggedError)
+                    },
+                    UIAction(title: NSLocalizedString("View More Details", comment: ""), image: UIImage(systemName: "ellipsis.circle")) { [weak self] _ in
+
                    }
                ])

                cell.menuButton.menu = menu
+                cell.menuButton.showsMenuAsPrimaryAction = self.isScrolling ? false : true
+                cell.selectionStyle = .none
+            } else {
+                cell.menuButton.isUserInteractionEnabled = false
            }
-            
+
            // Include errorDescriptionTextView's text in cell summary.
            cell.accessibilityLabel = [cell.errorFailureLabel.text, cell.dateLabel.text, cell.errorCodeLabel.text, cell.errorDescriptionTextView.text].compactMap { $0 }.joined(separator: ". ")
            
@@ -232,22 +249,27 @@ private extension ErrorLogViewController
    
    func searchFAQ(for loggedError: LoggedError)
    {
-        let baseURL = URL(string: "https://faq.altstore.io/getting-started/troubleshooting-guide")!
+        let baseURL = URL(string: "https://faq.altstore.io/getting-started/error-codes")!
        var components = URLComponents(url: baseURL, resolvingAgainstBaseURL: false)!
        
-        let query = [loggedError.domain, "\(loggedError.code)"].joined(separator: "+")
+        let query = [loggedError.domain, "\(loggedError.error.displayCode)"].joined(separator: "+")
        components.queryItems = [URLQueryItem(name: "q", value: query)]
        
        let safariViewController = SFSafariViewController(url: components.url ?? baseURL)
        safariViewController.preferredControlTintColor = .altPrimary
        self.present(safariViewController, animated: true)
    }
+
+    func viewMoreDetails(for loggedError: LoggedError) {
+        self.performSegue(withIdentifier: "showErrorDetails", sender: loggedError)
+    }
 }

 extension ErrorLogViewController
 {
    override func tableView(_ tableView: UITableView, didSelectRowAt indexPath: IndexPath)
    {
+        guard #unavailable(iOS 14) else { return }
        let loggedError = self.dataSource.item(at: indexPath)
        
        let alertController = UIAlertController(title: nil, message: nil, preferredStyle: .actionSheet)
@@ -321,3 +343,32 @@ extension ErrorLogViewController: QLPreviewControllerDataSource {
        return fileURL as QLPreviewItem
    }
 }
+
+extension ErrorLogViewController
+{
+    override func scrollViewWillBeginDragging(_ scrollView: UIScrollView)
+    {
+        self.isScrolling = true
+    }
+
+    override func scrollViewDidEndDecelerating(_ scrollView: UIScrollView)
+    {
+        self.isScrolling = false
+    }
+
+    override func scrollViewDidEndDragging(_ scrollView: UIScrollView, willDecelerate decelerate: Bool)
+    {
+        guard !decelerate else { return }
+        self.isScrolling = false
+    }
+
+    private func updateButtonInteractivity()
+    {
+        guard #available(iOS 14, *) else { return }
+
+        for case let cell as ErrorLogTableViewCell in self.tableView.visibleCells
+        {
+            cell.menuButton.showsMenuAsPrimaryAction = self.isScrolling ? false : true
+        }
+    }
+}
--- a/AltStore/Settings/Settings.storyboard
+++ b/AltStore/Settings/Settings.storyboard
@@ -1,9 +1,9 @@
 <?xml version="1.0" encoding="UTF-8"?>
-<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="21507" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES" initialViewController="5Rz-4h-jJ8">
+<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="23090" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES" initialViewController="5Rz-4h-jJ8">
    <device id="retina4_7" orientation="portrait" appearance="light"/>
    <dependencies>
        <deployment identifier="iOS"/>
-        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21505"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="23079"/>
        <capability name="Named colors" minToolsVersion="9.0"/>
        <capability name="Safe area layout guides" minToolsVersion="9.0"/>
        <capability name="System colors in document resources" minToolsVersion="11.0"/>
@@ -20,8 +20,8 @@
                        <color key="backgroundColor" name="SettingsBackground"/>
                        <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                        <color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
-                        <label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
-                            <rect key="frame" x="0.0" y="1245" width="375" height="25"/>
+                        <label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="wordWrap" numberOfLines="0" baselineAdjustment="alignBaselines" adjustsFontForContentSizeCategory="YES" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
+                            <rect key="frame" x="0.0" y="1296" width="375" height="25"/>
                            <autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
                            <fontDescription key="fontDescription" type="system" pointSize="17"/>
                            <color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -280,7 +280,7 @@
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Allow Siri To Refresh Apps…" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="c6K-fI-CVr">
-                                                    <rect key="frame" x="30" y="15.5" width="100.5" height="20.5"/>
+                                                    <rect key="frame" x="30" y="15.5" width="228.5" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
@@ -395,22 +395,22 @@
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
                                                    <rect key="frame" x="30" y="15.5" width="89" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
                                                </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
+                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
                                                    <rect key="frame" x="198" y="15.5" width="147" height="20.5"/>
                                                    <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
                                                            <rect key="frame" x="0.0" y="0.0" width="115" height="20.5"/>
                                                            <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                            <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                            <nil key="highlightedColor"/>
                                                        </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
                                                            <rect key="frame" x="129" y="0.0" width="18" height="20.5"/>
                                                        </imageView>
                                                    </subviews>
@@ -618,11 +618,44 @@
                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                        </userDefinedRuntimeAttributes>
                                        <connections>
-                                            <segue destination="g8a-Rf-zWa" kind="show" id="vFC-Id-Ww6"/>
+                                            <segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="vFC-Id-Ww6"/>
                                        </connections>
                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VrV-qI-zXF" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VrV-qI-zXF" id="w1r-uY-4pD">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="SideJITServer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="46q-DB-5nc">
+                                                    <rect key="frame" x="30" y="15.5" width="183" height="21"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="wvD-eZ-nQI">
+                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
+                                                </imageView>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="wvD-eZ-nQI" firstAttribute="centerY" secondItem="w1r-uY-4pD" secondAttribute="centerY" id="O6Y-Y1-yxv"/>
+                                                <constraint firstItem="46q-DB-5nc" firstAttribute="centerY" secondItem="w1r-uY-4pD" secondAttribute="centerY" id="ROS-YF-6jb"/>
+                                                <constraint firstItem="46q-DB-5nc" firstAttribute="leading" secondItem="w1r-uY-4pD" secondAttribute="leadingMargin" id="acd-O8-WTI"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="wvD-eZ-nQI" secondAttribute="trailing" id="taB-EP-QMM"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="eZ3-BT-q4D" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1023" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="eZ3-BT-q4D" id="17m-VV-hzf">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -655,7 +688,7 @@
                                        </userDefinedRuntimeAttributes>
                                    </tableViewCell>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1176" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VNn-u4-cN8" id="4bh-qe-l2N">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -688,14 +721,14 @@
                                        </userDefinedRuntimeAttributes>
                                    </tableViewCell>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="e7s-hL-kv9" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1227" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="e7s-hL-kv9" id="yjL-Mu-HTk">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Reset adi.pb" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="eds-Dj-36y">
-                                                    <rect key="frame" x="30" y="15.5" width="102" height="20.5"/>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Anisette Servers" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="eds-Dj-36y">
+                                                    <rect key="frame" x="30" y="15.5" width="135.5" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
@@ -713,39 +746,6 @@
                                        </tableViewCellContentView>
                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
-                                        <userDefinedRuntimeAttributes>
-                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
-                                                <integer key="value" value="2"/>
-                                            </userDefinedRuntimeAttribute>
-                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
-                                        </userDefinedRuntimeAttributes>
-                                    </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1176" width="375" height="51"/>
-                                        <autoresizingMask key="autoresizingMask"/>
-                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
-                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
-                                            <autoresizingMask key="autoresizingMask"/>
-                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Advanced Settings" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="OcM-OM-uDE">
-                                                    <rect key="frame" x="30" y="15.5" width="154" height="20.5"/>
-                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
-                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
-                                                    <nil key="highlightedColor"/>
-                                                </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Pcu-Sy-yfZ">
-                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
-                                                </imageView>
-                                            </subviews>
-                                            <constraints>
-                                                <constraint firstAttribute="trailingMargin" secondItem="Pcu-Sy-yfZ" secondAttribute="trailing" id="CFy-IO-4eb"/>
-                                                <constraint firstItem="OcM-OM-uDE" firstAttribute="centerY" secondItem="BcT-Fs-KNg" secondAttribute="centerY" id="OGl-h4-FPx"/>
-                                                <constraint firstItem="Pcu-Sy-yfZ" firstAttribute="centerY" secondItem="BcT-Fs-KNg" secondAttribute="centerY" id="R7L-4O-lTn"/>
-                                                <constraint firstItem="OcM-OM-uDE" firstAttribute="leading" secondItem="BcT-Fs-KNg" secondAttribute="leadingMargin" id="yoh-C6-UC5"/>
-                                            </constraints>
-                                        </tableViewCellContentView>
-                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
-                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
                                        <userDefinedRuntimeAttributes>
                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
                                                <integer key="value" value="3"/>
@@ -782,7 +782,7 @@
                    <toolbarItems/>
                    <simulatedTabBarMetrics key="simulatedBottomBarMetrics"/>
                    <navigationBar key="navigationBar" contentMode="scaleToFill" insetsLayoutMarginsFromSafeArea="NO" barStyle="black" largeTitles="YES" id="Jtn-cs-Tvp" customClass="NavigationBar" customModule="SideStore" customModuleProvider="target">
-                        <rect key="frame" x="0.0" y="0.0" width="375" height="96"/>
+                        <rect key="frame" x="0.0" y="20" width="375" height="96"/>
                        <autoresizingMask key="autoresizingMask"/>
                        <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                        <color key="barTintColor" name="SettingsBackground"/>
@@ -883,7 +883,7 @@
                        <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
                        <subviews>
                            <textView clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" layoutMarginsFollowReadableWidth="YES" contentInsetAdjustmentBehavior="never" indicatorStyle="white" editable="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oQQ-pR-oKc">
-                                <rect key="frame" x="0.0" y="44" width="375" height="574"/>
+                                <rect key="frame" x="0.0" y="64" width="375" height="554"/>
                                <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
                                <string key="text">Jay Freeman (ldid) 
 Copyright (C) 2007-2012 Jay Freeman (saurik)
@@ -1117,7 +1117,7 @@ Settings by i cons from the Noun Project</string>
                                                </textView>
                                            </subviews>
                                        </stackView>
-                                        <button opaque="NO" contentMode="scaleToFill" showsMenuAsPrimaryAction="YES" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="ba2-EY-tf5">
+                                        <button opaque="NO" contentMode="scaleToFill" showsMenuAsPrimaryAction="YES" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="ba2-EY-tf5" customClass="ErrorLogMenuButton">
                                            <rect key="frame" x="0.0" y="0.0" width="343" height="107.5"/>
                                            <accessibility key="accessibilityConfiguration">
                                                <bool key="isElement" value="NO"/>
@@ -1166,11 +1166,73 @@ Settings by i cons from the Noun Project</string>
                            </barButtonItem>
                        </rightBarButtonItems>
                    </navigationItem>
+                    <connections>
+                        <segue destination="7gm-d1-zWK" kind="presentation" identifier="showErrorDetails" id="9vz-y6-evp"/>
+                    </connections>
                </tableViewController>
                <placeholder placeholderIdentifier="IBFirstResponder" id="rU1-TZ-TD8" userLabel="First Responder" sceneMemberID="firstResponder"/>
            </objects>
            <point key="canvasLocation" x="1697" y="1774"/>
        </scene>
+        <!--Error Details View Controller-->
+        <scene sceneID="XNO-Yg-I7t">
+            <objects>
+                <viewController id="xB2-Se-VVg" customClass="ErrorDetailsViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
+                    <view key="view" contentMode="scaleToFill" id="eBQ-se-VIy">
+                        <rect key="frame" x="0.0" y="0.0" width="375" height="647"/>
+                        <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
+                        <subviews>
+                            <textView clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="scaleToFill" editable="NO" textAlignment="natural" translatesAutoresizingMaskIntoConstraints="NO" id="ctd-NB-4ov">
+                                <rect key="frame" x="0.0" y="0.0" width="375" height="647"/>
+                                <color key="backgroundColor" systemColor="systemBackgroundColor"/>
+                                <color key="textColor" systemColor="labelColor"/>
+                                <fontDescription key="fontDescription" style="UICTFontTextStyleBody"/>
+                                <textInputTraits key="textInputTraits" autocapitalizationType="sentences"/>
+                            </textView>
+                        </subviews>
+                        <viewLayoutGuide key="safeArea" id="Nm8-69-Ngi"/>
+                        <color key="backgroundColor" systemColor="systemBackgroundColor"/>
+                        <constraints>
+                            <constraint firstItem="ctd-NB-4ov" firstAttribute="leading" secondItem="eBQ-se-VIy" secondAttribute="leading" id="Cv1-Te-gBH"/>
+                            <constraint firstItem="ctd-NB-4ov" firstAttribute="top" secondItem="eBQ-se-VIy" secondAttribute="top" id="HRY-Rg-iMI"/>
+                            <constraint firstAttribute="trailing" secondItem="ctd-NB-4ov" secondAttribute="trailing" id="Lc1-K7-iuq"/>
+                            <constraint firstAttribute="bottom" secondItem="ctd-NB-4ov" secondAttribute="bottom" id="zCz-Cy-Y5z"/>
+                        </constraints>
+                    </view>
+                    <navigationItem key="navigationItem" id="XpE-V9-EaY">
+                        <barButtonItem key="rightBarButtonItem" style="done" systemItem="done" id="rnr-dX-4Ev">
+                            <connections>
+                                <segue destination="ZSp-1n-UJ9" kind="unwind" unwindAction="unwindFromErrorDetails:" id="TFu-zD-QyF"/>
+                            </connections>
+                        </barButtonItem>
+                    </navigationItem>
+                    <connections>
+                        <outlet property="textView" destination="ctd-NB-4ov" id="x2C-9R-Xz1"/>
+                    </connections>
+                </viewController>
+                <placeholder placeholderIdentifier="IBFirstResponder" id="8AM-Vx-XTN" userLabel="First Responder" customClass="UIResponder" sceneMemberID="firstResponder"/>
+                <exit id="ZSp-1n-UJ9" userLabel="Exit" sceneMemberID="exit"/>
+            </objects>
+            <point key="canvasLocation" x="3389.5999999999999" y="1772.5637181409297"/>
+        </scene>
+        <!--Navigation Controller-->
+        <scene sceneID="4LJ-Od-dCK">
+            <objects>
+                <navigationController automaticallyAdjustsScrollViewInsets="NO" id="7gm-d1-zWK" sceneMemberID="viewController">
+                    <toolbarItems/>
+                    <navigationBar key="navigationBar" contentMode="scaleToFill" id="dI0-sh-yGf">
+                        <rect key="frame" x="0.0" y="0.0" width="375" height="56"/>
+                        <autoresizingMask key="autoresizingMask"/>
+                    </navigationBar>
+                    <nil name="viewControllers"/>
+                    <connections>
+                        <segue destination="xB2-Se-VVg" kind="relationship" relationship="rootViewController" id="RpP-UM-JfJ"/>
+                    </connections>
+                </navigationController>
+                <placeholder placeholderIdentifier="IBFirstResponder" id="OXW-bf-HIj" userLabel="First Responder" customClass="UIResponder" sceneMemberID="firstResponder"/>
+            </objects>
+            <point key="canvasLocation" x="2554" y="1773"/>
+        </scene>
    </scenes>
    <resources>
        <image name="Next" width="18" height="18"/>
@@ -1183,7 +1245,10 @@ Settings by i cons from the Noun Project</string>
            <color white="0.0" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
        </systemColor>
        <systemColor name="labelColor">
-            <color red="0.0" green="0.0" blue="0.0" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color white="0.0" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+        </systemColor>
+        <systemColor name="systemBackgroundColor">
+            <color white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
        </systemColor>
    </resources>
 </document>
--- a/AltStore/Settings/SettingsViewController.swift
+++ b/AltStore/Settings/SettingsViewController.swift
@@ -7,6 +7,7 @@
 //

 import UIKit
+import SwiftUI
 import SafariServices
 import MessageUI
 import Intents
@@ -54,9 +55,10 @@ extension SettingsViewController
        case sendFeedback
        case refreshAttempts
        case errorLog
+        case refreshSideJITServer
        case clearCache
        case resetPairingFile
-        case resetAdiPb
+        case anisetteServers
        case advancedSettings
    
    }
@@ -78,6 +80,8 @@ final class SettingsViewController: UITableViewController
    @IBOutlet private var backgroundRefreshSwitch: UISwitch!
    @IBOutlet private var noIdleTimeoutSwitch: UISwitch!
    
+    @IBOutlet private var refreshSideJITServer: UILabel!
+    
    @IBOutlet private var versionLabel: UILabel!
    
    override var preferredStatusBarStyle: UIStatusBarStyle {
@@ -89,6 +93,7 @@ final class SettingsViewController: UITableViewController
        super.init(coder: aDecoder)
        
        NotificationCenter.default.addObserver(self, selector: #selector(SettingsViewController.openPatreonSettings(_:)), name: AppDelegate.openPatreonSettingsDeepLinkNotification, object: nil)
+        NotificationCenter.default.addObserver(self, selector: #selector(SettingsViewController.openErrorLog(_:)), name: ToastView.openErrorLogNotification, object: nil)
    }
    
    override func viewDidLoad()
@@ -106,16 +111,13 @@ final class SettingsViewController: UITableViewController
        debugModeGestureRecognizer.numberOfTouchesRequired = 3
        self.tableView.addGestureRecognizer(debugModeGestureRecognizer)
        
-        print(Bundle.main.infoDictionary)
        var versionString: String = ""
        if let version = Bundle.main.object(forInfoDictionaryKey: "CFBundleShortVersionString") as? String
        {
            versionString += "SideStore \(version)"
            if let xcode = Bundle.main.object(forInfoDictionaryKey: "DTXcode") as? String {
-                print(xcode)
                versionString += " - Xcode \(xcode) - "
                if let build = Bundle.main.object(forInfoDictionaryKey: "DTXcodeBuild") as? String {
-                    print(build)
                    versionString += "\(build)"
                }
            }
@@ -130,8 +132,14 @@ final class SettingsViewController: UITableViewController
        {
            versionString += "SideStore\t"
        }
-        self.versionLabel.text = NSLocalizedString(versionString, comment: "SideStore Version")
+        versionString += "\n\(Bundle.Info.appbundleIdentifier)"

+        self.versionLabel.text = NSLocalizedString(versionString, comment: "SideStore Version")
+        
+        self.versionLabel.numberOfLines = 0
+        self.versionLabel.lineBreakMode = .byWordWrapping
+        self.versionLabel.setNeedsUpdateConstraints()
+        
        self.tableView.contentInset.bottom = 40
        
        self.update()
@@ -149,6 +157,18 @@ final class SettingsViewController: UITableViewController
        
        self.update()
    }
+    
+    override func prepare(for segue: UIStoryboardSegue, sender: Any?) {
+        if segue.identifier == "anisetteServers" {
+            let controller = UIHostingController(rootView: AnisetteServers(selected: UserDefaults.standard.menuAnisetteURL, errorCallback: {
+                ToastView(text: "Cleared adi.pb!", detailText: "You will need to log back into Apple ID in SideStore.").show(in: self)
+            }))
+            self.show(controller, sender: nil)
+        } else {
+            super.prepare(for: segue, sender: sender)
+        }
+    }
+
 }

 private extension SettingsViewController
@@ -405,6 +425,15 @@ private extension SettingsViewController
            self.performSegue(withIdentifier: "showPatreon", sender: nil)
        }
    }
+
+    @objc func openErrorLog(_: Notification) {
+        guard self.presentedViewController == nil else { return }
+
+        self.navigationController?.popViewController(animated: false)
+        DispatchQueue.main.asyncAfter(deadline: .now() + 0.1) {
+            self.performSegue(withIdentifier: "showErrorLog", sender: nil)
+        }
+    }
 }

 extension SettingsViewController
@@ -437,14 +466,14 @@ extension SettingsViewController
    {
        let cell = super.tableView(tableView, cellForRowAt: indexPath)
        
-//        if #available(iOS 14, *) {}
-//        else if let cell = cell as? InsetGroupTableViewCell,
-//                indexPath.section == Section.appRefresh.rawValue,
-//                indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
-//        {
-//            // Only one row is visible pre-iOS 14.
-//            cell.style = .single
-//        }
+        if #available(iOS 14, *) {}
+        else if let cell = cell as? InsetGroupTableViewCell,
+                indexPath.section == Section.appRefresh.rawValue,
+                indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+        {
+            // Only one row is visible pre-iOS 14.
+            cell.style = .single
+        }
        
        if AppRefreshRow.AllCases().count == 1
        {
@@ -512,7 +541,7 @@ extension SettingsViewController
        switch section
        {
        case .signIn where self.activeTeam != nil: return 1.0
-        case .account where self.activeTeam == nil: return 1.0            
+        case .account where self.activeTeam == nil: return 1.0
        case .signIn, .patreon, .appRefresh:
            let height = self.preferredHeight(for: self.prototypeHeaderFooterView, in: section, isHeader: false)
            return height
@@ -558,34 +587,158 @@ extension SettingsViewController
            switch row
            {
            case .sendFeedback:
-                if MFMailComposeViewController.canSendMail()
-                {
-                    let mailViewController = MFMailComposeViewController()
-                    mailViewController.mailComposeDelegate = self
-                    mailViewController.setToRecipients(["support@sidestore.io"])
-                    
-                    if let version = Bundle.main.object(forInfoDictionaryKey: "CFBundleShortVersionString") as? String
-                    {
-                        mailViewController.setSubject("SideStore Beta \(version) Feedback")
+                let alertController = UIAlertController(title: "Send Feedback", message: "Choose a method to send feedback:", preferredStyle: .actionSheet)
+                
+                // Option 1: GitHub
+                alertController.addAction(UIAlertAction(title: "GitHub", style: .default) { _ in
+                    if let githubURL = URL(string: "https://github.com/SideStore/SideStore/issues") {
+                        let safariViewController = SFSafariViewController(url: githubURL)
+                        safariViewController.preferredControlTintColor = .altPrimary
+                        self.present(safariViewController, animated: true, completion: nil)
                    }
-                    else
-                    {
-                        mailViewController.setSubject("SideStore Beta Feedback")
+                })
+                
+                // Option 2: Discord
+                alertController.addAction(UIAlertAction(title: "Discord", style: .default) { _ in
+                    if let discordURL = URL(string: "https://discord.gg/sidestore-949183273383395328") {
+                        let safariViewController = SFSafariViewController(url: discordURL)
+                        safariViewController.preferredControlTintColor = .altPrimary
+                        self.present(safariViewController, animated: true, completion: nil)
                    }
-                    
-                    self.present(mailViewController, animated: true, completion: nil)
-                }
-                else
-                {
-                    let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
-                    toastView.show(in: self)
+                })
+                
+                // Option 3: Mail
+//                alertController.addAction(UIAlertAction(title: "Send Email", style: .default) { _ in
+//                    if MFMailComposeViewController.canSendMail() {
+//                        let mailViewController = MFMailComposeViewController()
+//                        mailViewController.mailComposeDelegate = self
+//                        mailViewController.setToRecipients(["support@sidestore.io"])
+//
+//                        if let version = Bundle.main.object(forInfoDictionaryKey: "CFBundleShortVersionString") as? String {
+//                            mailViewController.setSubject("SideStore Beta \(version) Feedback")
+//                        } else {
+//                            mailViewController.setSubject("SideStore Beta Feedback")
+//                        }
+//
+//                       self.present(mailViewController, animated: true, completion: nil)
+//                  } else {
+//                      let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
+//                      toastView.show(in: self)
+//                }
+//            })
+                
+                // Cancel action
+                alertController.addAction(UIAlertAction(title: "Cancel", style: .cancel, handler: nil))
+                
+                // For iPad: Set the source view if presenting on iPad to avoid crashes
+                if let popoverController = alertController.popoverPresentationController {
+                    popoverController.sourceView = self.view
+                    popoverController.sourceRect = self.view.bounds
                }
                
-            case .clearCache: self.clearCache()
+                // Present the action sheet
+                self.present(alertController, animated: true, completion: nil)
+                
+            case .refreshSideJITServer:
+                if #available(iOS 17, *) {
+                
+                   let alertController = UIAlertController(
+                      title: NSLocalizedString("SideJITServer", comment: ""),
+                      message: NSLocalizedString("Settings for SideJITServer", comment: ""),
+                      preferredStyle: UIAlertController.Style.actionSheet)
+                    
+                    
+                    if UserDefaults.standard.sidejitenable {
+                        alertController.addAction(UIAlertAction(title: NSLocalizedString("Disable", comment: ""), style: .default){ _ in
+                            UserDefaults.standard.sidejitenable = false
+                        })
+                    } else {
+                        alertController.addAction(UIAlertAction(title: NSLocalizedString("Enable", comment: ""), style: .default){ _ in
+                            UserDefaults.standard.sidejitenable = true
+                        })
+                    }
+                    
+                    alertController.addAction(UIAlertAction(title: NSLocalizedString("Server Address", comment: ""), style: .default){ _ in
+                        let alertController1 = UIAlertController(title: "SideJITServer Address", message: "Please Enter the SideJITServer Address Below. (this is not needed if SideJITServer has already been detected)", preferredStyle: .alert)
+                        

+                        alertController1.addTextField { textField in
+                            textField.placeholder = "SideJITServer Address"
+                        }
+                        
+                        
+                        let cancelAction = UIAlertAction(title: "Cancel", style: .cancel, handler: nil)
+                        alertController1.addAction(cancelAction)
+                        
+
+                        let okAction = UIAlertAction(title: "OK", style: .default) { _ in
+                            if let text = alertController1.textFields?.first?.text {
+                                UserDefaults.standard.textInputSideJITServerurl = text
+                            }
+                        }
+                        
+                        alertController1.addAction(okAction)
+                        
+                        // Present the alert controller
+                        self.present(alertController1, animated: true)
+                    })
+                    
+
+                   alertController.addAction(UIAlertAction(title: NSLocalizedString("Refresh", comment: ""), style: .destructive){ _ in
+                      if UserDefaults.standard.sidejitenable {
+                         var SJSURL = ""
+                          if (UserDefaults.standard.textInputSideJITServerurl ?? "").isEmpty {
+                            SJSURL = "http://sidejitserver._http._tcp.local:8080"
+                         } else {
+                            SJSURL = UserDefaults.standard.textInputSideJITServerurl ?? ""
+                         }
+                        
+                          
+                         let url = URL(string: SJSURL + "/re/")!
+
+                         let task = URLSession.shared.dataTask(with: url) { (data, response, error) in
+                            if let error = error {
+                               print("Error: \(error)")
+                            } else {
+                               // Do nothing with data or response
+                            }
+                         }
+
+                         task.resume()
+                      }
+                   })
+                    
+
+                   let cancelAction = UIAlertAction(title: "Cancel", style: .cancel, handler: nil)
+                   alertController.addAction(cancelAction)
+                   //Fix crash on iPad
+                   alertController.popoverPresentationController?.sourceView = self.tableView
+                   alertController.popoverPresentationController?.sourceRect = self.tableView.rectForRow(at: indexPath)
+                   self.present(alertController, animated: true)
+                   self.tableView.deselectRow(at: indexPath, animated: true)
+                } else {
+                   let alertController = UIAlertController(
+                      title: NSLocalizedString("You are not on iOS 17+ This will not work", comment: ""),
+                      message: NSLocalizedString("This is meant for 'SideJITServer' and it only works on iOS 17+ ", comment: ""),
+                      preferredStyle: UIAlertController.Style.actionSheet)
+
+                   alertController.addAction(.cancel)
+                   //Fix crash on iPad
+                   alertController.popoverPresentationController?.sourceView = self.tableView
+                   alertController.popoverPresentationController?.sourceRect = self.tableView.rectForRow(at: indexPath)
+                   self.present(alertController, animated: true)
+                   self.tableView.deselectRow(at: indexPath, animated: true)
+                }
+
+                
+            case .clearCache: self.clearCache()
+                
            case .resetPairingFile:
+                
                let filename = "ALTPairingFile.mobiledevicepairing"
+                
                let fm = FileManager.default
+                
                let documentsPath = fm.documentsDirectory.appendingPathComponent("/\(filename)")
                let alertController = UIAlertController(
                    title: NSLocalizedString("Are you sure to reset the pairing file?", comment: ""),
@@ -608,25 +761,12 @@ extension SettingsViewController
                alertController.popoverPresentationController?.sourceRect = self.tableView.rectForRow(at: indexPath)
                self.present(alertController, animated: true)
                self.tableView.deselectRow(at: indexPath, animated: true)
-            case .resetAdiPb:
-                let alertController = UIAlertController(
-                    title: NSLocalizedString("Are you sure you want to reset the adi.pb file?", comment: ""),
-                    message: NSLocalizedString("The adi.pb file is used to generate anisette data, which is required to log into an Apple ID. If you are having issues with account related things, you can try this. However, you will be required to do 2FA again. This will do nothing if you are using an older anisette server.", comment: ""),
-                    preferredStyle: UIAlertController.Style.actionSheet)
                
-                alertController.addAction(UIAlertAction(title: NSLocalizedString("Reset adi.pb", comment: ""), style: .destructive){ _ in
-                    if Keychain.shared.adiPb != nil {
-                        Keychain.shared.adiPb = nil
-                        print("Cleared adi.pb from keychain")
-                    }
-                    self.tableView.deselectRow(at: indexPath, animated: true)
-                })
-                alertController.addAction(.cancel)
-                //Fix crash on iPad
-                alertController.popoverPresentationController?.sourceView = self.tableView
-                alertController.popoverPresentationController?.sourceRect = self.tableView.rectForRow(at: indexPath)
-                self.present(alertController, animated: true)
-                self.tableView.deselectRow(at: indexPath, animated: true)
+            case .anisetteServers:
+                self.prepare(for: UIStoryboardSegue(identifier: "anisetteServers", source: self, destination: UIHostingController(rootView: AnisetteServers(selected: "", errorCallback: {
+                    ToastView(text: "Reset adi.pb", detailText: "Buh").show(in: self)
+                }))), sender: nil)
+//                self.performSegue(withIdentifier: "anisetteServers", sender: nil)
            case .advancedSettings:
                // Create the URL that deep links to your app's custom settings.
                if let url = URL(string: UIApplication.openSettingsURLString) {
--- a/AltStore/Sources/SourcesViewController.swift
+++ b/AltStore/Sources/SourcesViewController.swift
@@ -12,17 +12,22 @@ import CoreData
 import AltStoreCore
 import Roxas

-struct SourceError: LocalizedError
+struct SourceError: ALTLocalizedError
 {
-    enum Code
+    enum Code: Int, ALTErrorCode
    {
+        typealias Error = SourceError
+
        case unsupported
    }
    
    var code: Code
+    var errorTitle: String?
+    var errorFailure: String?
+
    @Managed var source: Source
    
-    var errorDescription: String? {
+    var errorFailureReason: String {
        switch self.code
        {
        case .unsupported: return String(format: NSLocalizedString("The source “%@” is not supported by this version of SideStore.", comment: ""), self.$source.name)
--- a/AltStore/TabBarController.swift
+++ b/AltStore/TabBarController.swift
@@ -33,6 +33,7 @@ final class TabBarController: UITabBarController
        NotificationCenter.default.addObserver(self, selector: #selector(TabBarController.openPatreonSettings(_:)), name: AppDelegate.openPatreonSettingsDeepLinkNotification, object: nil)
        NotificationCenter.default.addObserver(self, selector: #selector(TabBarController.importApp(_:)), name: AppDelegate.importAppDeepLinkNotification, object: nil)
        NotificationCenter.default.addObserver(self, selector: #selector(TabBarController.presentSources(_:)), name: AppDelegate.addSourceDeepLinkNotification, object: nil)
+        NotificationCenter.default.addObserver(self, selector: #selector(TabBarController.openErrorLog(_:)), name: ToastView.openErrorLogNotification, object: nil)
    }
    
    override func viewDidAppear(_ animated: Bool)
@@ -141,4 +142,7 @@ private extension TabBarController
    {
        self.selectedIndex = Tab.myApps.rawValue
    }
+    @objc func openErrorLog(_: Notification){
+        self.selectedIndex = Tab.settings.rawValue
+    }
 }
--- a/AltStore/Types/Managed.swift
+++ b/AltStore/Types/Managed.swift
@@ -10,23 +10,27 @@ import Foundation
 import CoreData

@propertyWrapper @dynamicMemberLookup
-struct Managed<ManagedObject: NSManagedObject>
+struct Managed<ManagedObject>
 {
    var wrappedValue: ManagedObject {
        didSet {
-            self.managedObjectContext = self.wrappedValue.managedObjectContext
+            self.managedObjectContext = self.managedObject?.managedObjectContext
        }
    }
-    private var managedObjectContext: NSManagedObjectContext?
-    
+
    var projectedValue: Managed<ManagedObject> {
        return self
    }
    
+    private var managedObjectContext: NSManagedObjectContext?
+    private var managedObject: NSManagedObject? {
+        return self.wrappedValue as? NSManagedObject
+    }
+
    init(wrappedValue: ManagedObject)
    {
        self.wrappedValue = wrappedValue
-        self.managedObjectContext = wrappedValue.managedObjectContext
+        self.managedObjectContext = self.managedObject?.managedObjectContext
    }
    
    subscript<T>(dynamicMember keyPath: KeyPath<ManagedObject, T>) -> T
@@ -46,4 +50,18 @@ struct Managed<ManagedObject: NSManagedObject>
        
        return result
    }
+
+    // Optionals
+    subscript<Wrapped, T>(dynamicMember keyPath: KeyPath<Wrapped, T>) -> T? where ManagedObject == Optional<Wrapped> {
+        var result: T?
+
+        if let context = self.managedObjectContext {
+            context.performAndWait {
+                result = self.wrappedValue?[keyPath: keyPath] as? T
+            }
+        } else {
+            result = self.wrappedValue?[keyPath: keyPath] as? T
+        }
+        return result
+    }
 }
--- a/AltStoreCore/AltStoreCore.h
+++ b/AltStoreCore/AltStoreCore.h
@@ -23,5 +23,6 @@ FOUNDATION_EXPORT const unsigned char AltStoreCoreVersionString[];
 // Shared
 #import <AltStoreCore/ALTConstants.h>
 #import <AltStoreCore/ALTConnection.h>
+#import <AltStoreCore/ALTWrappedError.h>
 #import <AltStoreCore/NSError+ALTServerError.h>
 #import <AltStoreCore/CFNotificationName+AltStore.h>
--- a/AltStoreCore/Extensions/OperatingSystemVersion+Comparable.swift
+++ b/AltStoreCore/Extensions/OperatingSystemVersion+Comparable.swift
@@ -0,0 +1,18 @@
+//
+//  OperatingSystemVersion+Comparable.swift
+//  AltStoreCore
+//
+//  Created by nythepegasus on 5/9/24.
+//
+
+import Foundation
+
+extension OperatingSystemVersion: Comparable {
+    public static func ==(lhs: OperatingSystemVersion, rhs: OperatingSystemVersion) -> Bool {
+        return lhs.majorVersion == rhs.majorVersion && lhs.minorVersion == rhs.minorVersion && lhs.patchVersion == rhs.patchVersion
+    }
+    
+    public static func <(lhs: OperatingSystemVersion, rhs: OperatingSystemVersion) -> Bool {
+        return lhs.stringValue.compare(rhs.stringValue, options: .numeric) == .orderedAscending
+    }
+}
--- a/AltStoreCore/Extensions/String+SideStore.swift
+++ b/AltStoreCore/Extensions/String+SideStore.swift
@@ -0,0 +1,14 @@
+//
+//  String+SideStore.swift
+//  AltStoreCore
+//
+//  Created by nythepegasus on 5/9/24.
+//
+
+import Foundation
+
+public extension String {
+    init(formatted: String, comment: String? = nil, _ args: String...) {
+        self.init(format: NSLocalizedString(formatted, comment: comment ?? ""), args)
+    }
+}
--- a/AltStoreCore/Extensions/UserDefaults+AltStore.swift
+++ b/AltStoreCore/Extensions/UserDefaults+AltStore.swift
@@ -22,8 +22,12 @@ public extension UserDefaults
    @NSManaged var firstLaunch: Date?
    @NSManaged var requiresAppGroupMigration: Bool
    @NSManaged var textServer: Bool
+    @NSManaged var sidejitenable: Bool
+    @NSManaged var textInputSideJITServerurl: String?
    @NSManaged var textInputAnisetteURL: String?
    @NSManaged var customAnisetteURL: String?
+    @NSManaged var menuAnisetteURL: String
+    @NSManaged var menuAnisetteList: String
    @NSManaged var preferredServerID: String?
    
    @NSManaged var isBackgroundRefreshEnabled: Bool
@@ -79,8 +83,9 @@ public extension UserDefaults
            #keyPath(UserDefaults.isLegacyDeactivationSupported): isLegacyDeactivationSupported,
            #keyPath(UserDefaults.activeAppLimitIncludesExtensions): activeAppLimitIncludesExtensions,
            #keyPath(UserDefaults.localServerSupportsRefreshing): localServerSupportsRefreshing,
-            #keyPath(UserDefaults.requiresAppGroupMigration): true
-        ]
+            #keyPath(UserDefaults.requiresAppGroupMigration): true,
+            #keyPath(UserDefaults.menuAnisetteURL): "https://ani.sidestore.io"
+        ] as [String : Any]
        
        UserDefaults.standard.register(defaults: defaults)
        UserDefaults.shared.register(defaults: defaults)
--- a/AltStoreCore/Model/AppVersion.swift
+++ b/AltStoreCore/Model/AppVersion.swift
@@ -40,7 +40,7 @@ public class AppVersion: NSManagedObject, Decodable, Fetchable
    
    /* Relationships */
    @NSManaged public private(set) var app: StoreApp?
-    @NSManaged public private(set) var latestVersionApp: StoreApp?
+    @NSManaged @objc(latestVersionApp) public internal(set) var latestSupportedVersionApp: StoreApp?
    
    private override init(entity: NSEntityDescription, insertInto context: NSManagedObjectContext?)
    {
@@ -54,6 +54,8 @@ public class AppVersion: NSManagedObject, Decodable, Fetchable
        case localizedDescription
        case downloadURL
        case size
+        case minOSVersion
+        case maxOSVersion
    }
    
    public required init(from decoder: Decoder) throws
@@ -72,6 +74,9 @@ public class AppVersion: NSManagedObject, Decodable, Fetchable
            
            self.downloadURL = try container.decode(URL.self, forKey: .downloadURL)
            self.size = try container.decode(Int64.self, forKey: .size)
+
+            self._minOSVersion = try container.decodeIfPresent(String.self, forKey: .minOSVersion)
+            self._maxOSVersion = try container.decodeIfPresent(String.self, forKey: .maxOSVersion)
        }
        catch
        {
@@ -113,4 +118,13 @@ public extension AppVersion

        return appVersion
    }
+    
+    var isSupported: Bool {
+        if let minOSVersion = self.minOSVersion, !ProcessInfo.processInfo.isOperatingSystemAtLeast(minOSVersion) {
+            return false
+        } else if let maxOSVersion = self.maxOSVersion, ProcessInfo.processInfo.operatingSystemVersion > maxOSVersion {
+            return false
+        }
+        return true
+    }
 }
--- a/AltStoreCore/Model/DatabaseManager.swift
+++ b/AltStoreCore/Model/DatabaseManager.swift
@@ -13,11 +13,11 @@ import Roxas

 extension CFNotificationName
 {
-    fileprivate static let willAccessDatabase = CFNotificationName("com.rileytestut.AltStore.WillAccessDatabase" as CFString)
+    fileprivate static let willMigrateDatabase = CFNotificationName("com.rileytestut.AltStore.WillMigrateDatabase" as CFString)
 }

-private let ReceivedWillAccessDatabaseNotification: @convention(c) (CFNotificationCenter?, UnsafeMutableRawPointer?, CFNotificationName?, UnsafeRawPointer?, CFDictionary?) -> Void = { (center, observer, name, object, userInfo) in
-    DatabaseManager.shared.receivedWillAccessDatabaseNotification()
+private let ReceivedWillMigrateDatabaseNotification: @convention(c) (CFNotificationCenter?, UnsafeMutableRawPointer?, CFNotificationName?, UnsafeRawPointer?, CFDictionary?) -> Void = { (center, observer, name, object, userInfo) in
+    DatabaseManager.shared.receivedWillMigrateDatabaseNotification()
 }

 fileprivate class PersistentContainer: RSTPersistentContainer
@@ -52,15 +52,15 @@ public class DatabaseManager
    private let coordinator = NSFileCoordinator()
    private let coordinatorQueue = OperationQueue()
    
-    private var ignoreWillAccessDatabaseNotification = false
-    
+    private var ignoreWillMigrateDatabaseNotification = false
+
    private init()
    {
        self.persistentContainer = PersistentContainer(name: "AltStore", bundle: Bundle(for: DatabaseManager.self))
        self.persistentContainer.preferredMergePolicy = MergePolicy()
        
        let observer = Unmanaged.passUnretained(self).toOpaque()
-        CFNotificationCenterAddObserver(CFNotificationCenterGetDarwinNotifyCenter(), observer, ReceivedWillAccessDatabaseNotification, CFNotificationName.willAccessDatabase.rawValue, nil, .deliverImmediately)
+        CFNotificationCenterAddObserver(CFNotificationCenterGetDarwinNotifyCenter(), observer, ReceivedWillMigrateDatabaseNotification, CFNotificationName.willMigrateDatabase.rawValue, nil, .deliverImmediately)
    }
 }

@@ -87,10 +87,13 @@ public extension DatabaseManager
            
            guard !self.isStarted else { return finish(nil) }
            
-            // Quit any other running AltStore processes to prevent concurrent database access during and after migration.
-            self.ignoreWillAccessDatabaseNotification = true
-            CFNotificationCenterPostNotification(CFNotificationCenterGetDarwinNotifyCenter(), .willAccessDatabase, nil, nil, true)
-            
+            if self.persistentContainer.isMigrationRequired {
+
+                // Quit any other running AltStore processes to prevent concurrent database access during and after migration.
+                self.ignoreWillMigrateDatabaseNotification = true
+                CFNotificationCenterPostNotification(CFNotificationCenterGetDarwinNotifyCenter(), .willMigrateDatabase, nil, nil, true)
+            }
+
            self.migrateDatabaseToAppGroupIfNeeded { (result) in
                switch result
                {
@@ -229,7 +232,7 @@ private extension DatabaseManager
            else
            {
                storeApp = StoreApp.makeAltStoreApp(in: context)
-                storeApp.latestVersion?.version = localApp.version
+                storeApp.latestSupportedVersion?.version = localApp.version
                storeApp.source = altStoreSource
            }
                        
@@ -417,13 +420,13 @@ private extension DatabaseManager
        }
    }
    
-    func receivedWillAccessDatabaseNotification()
+    func receivedWillMigrateDatabaseNotification()
    {
-        defer { self.ignoreWillAccessDatabaseNotification = false }
-        
+        defer { self.ignoreWillMigrateDatabaseNotification = false }
+
        // Ignore notifications sent by the current process.
-        guard !self.ignoreWillAccessDatabaseNotification else { return }
-        
+        guard !self.ignoreWillMigrateDatabaseNotification else { return }
+
        exit(104)
    }
 }
--- a/AltStoreCore/Model/InstalledApp.swift
+++ b/AltStoreCore/Model/InstalledApp.swift
@@ -62,14 +62,14 @@ public class InstalledApp: NSManagedObject, InstalledAppProtocol
    
    @objc public var hasUpdate: Bool {
        if self.storeApp == nil { return false }
-        if self.storeApp!.latestVersion == nil { return false }
-        
+        if self.storeApp!.latestSupportedVersion == nil { return false }
+
        let currentVersion = SemanticVersion(self.version)
-        let latestVersion = SemanticVersion(self.storeApp!.latestVersion!.version)
-        
+        let latestVersion = SemanticVersion(self.storeApp!.latestSupportedVersion!.version)
+
        if currentVersion == nil || latestVersion == nil {
            // One of the versions is not valid SemVer, fall back to comparing the version strings by character
-            return self.version < self.storeApp!.latestVersion!.version
+            return self.version < self.storeApp!.latestSupportedVersion!.version
        }
        
        return currentVersion! < latestVersion!
@@ -163,8 +163,8 @@ public extension InstalledApp
    class func updatesFetchRequest() -> NSFetchRequest<InstalledApp>
    {
        let fetchRequest = InstalledApp.fetchRequest() as NSFetchRequest<InstalledApp>
-        fetchRequest.predicate = NSPredicate(format: "%K == YES AND %K == YES",
-                                             #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.hasUpdate))
+        fetchRequest.predicate = NSPredicate(format: "%K == YES AND %K != nil AND %K != %K",
+                                             #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.storeApp), #keyPath(InstalledApp.version), #keyPath(InstalledApp.storeApp.latestSupportedVersion.version))
        return fetchRequest
    }
    
@@ -275,14 +275,12 @@ public extension InstalledApp
        
        do { try FileManager.default.createDirectory(at: appsDirectoryURL, withIntermediateDirectories: true, attributes: nil) }
        catch { print("Creating App Directory Error: \(error)") }
-        print("`appsDirectoryURL` is set to: \(appsDirectoryURL.absoluteString)")
        return appsDirectoryURL
    }
    
    class var legacyAppsDirectoryURL: URL {
        let baseDirectory = FileManager.default.applicationSupportDirectory
        let appsDirectoryURL = baseDirectory.appendingPathComponent("Apps")
-        print("legacy `appsDirectoryURL` is set to: \(appsDirectoryURL.absoluteString)")
        return appsDirectoryURL
    }
    
--- a/AltStoreCore/Model/LoggedError.swift
+++ b/AltStoreCore/Model/LoggedError.swift
@@ -19,6 +19,8 @@ extension LoggedError
        case deactivate
        case backup
        case restore
+        case connection
+        case enableJIT
    }
 }

@@ -66,7 +68,12 @@ public class LoggedError: NSManagedObject, Fetchable
        self.date = date
        self._operation = operation?.rawValue
        
-        let nsError = error as NSError
+        let nsError: NSError
+        if let error = error as? ALTServerError, error.code == .underlyingError, let underlyingError = error.underlyingError {
+            nsError = underlyingError as NSError
+        } else {
+            nsError = error as NSError
+        }
        self.domain = nsError.domain
        self.code = Int32(nsError.code)
        self.userInfo = nsError.userInfo
@@ -91,7 +98,7 @@ public extension LoggedError
        return app
    }
    
-    var error: Error {
+    var error: NSError {
        let nsError = NSError(domain: self.domain, code: Int(self.code), userInfo: self.userInfo)
        return nsError
    }
@@ -113,6 +120,8 @@ public extension LoggedError
        case .deactivate: return String(format: NSLocalizedString("Deactivate %@ Failed", comment: ""), self.appName)
        case .backup: return String(format: NSLocalizedString("Backup %@ Failed", comment: ""), self.appName)
        case .restore: return String(format: NSLocalizedString("Restore %@ Failed", comment: ""), self.appName)
+        case .connection: return String(format: NSLocalizedString("Connection during %@ Failed", comment: ""), self.appName)
+        case .enableJIT: return String(format: NSLocalizedString("Enabling JIT for %@ Failed", comment: ""), self.appName)
        }
    }
 }
--- a/AltStoreCore/Model/MergePolicy.swift
+++ b/AltStoreCore/Model/MergePolicy.swift
@@ -44,7 +44,7 @@ open class MergePolicy: RSTRelationshipPreservingMergePolicy
                    let conflictingAppVersions = conflict.conflictingObjects.lazy.compactMap { $0 as? AppVersion }
                    
                    // Primary AppVersion == AppVersion whose latestVersionApp.latestVersion points back to itself.
-                    if let primaryAppVersion = conflictingAppVersions.first(where: { $0.latestVersionApp?.latestVersion == $0 }),
+                    if let primaryAppVersion = conflictingAppVersions.first(where: { $0.latestSupportedVersionApp?.latestSupportedVersion == $0 }),
                       let secondaryAppVersion = conflictingAppVersions.first(where: { $0 != primaryAppVersion })
                    {
                        secondaryAppVersion.managedObjectContext?.delete(secondaryAppVersion)
--- a/AltStoreCore/Model/Migrations/Policies/StoreApp10ToStoreApp11Policy.swift
+++ b/AltStoreCore/Model/Migrations/Policies/StoreApp10ToStoreApp11Policy.swift
@@ -48,7 +48,7 @@ fileprivate extension NSManagedObject
    
    func setStoreAppLatestVersion(_ appVersion: NSManagedObject)
    {
-        self.setValue(appVersion, forKey: #keyPath(StoreApp.latestVersion))
+        self.setValue(appVersion, forKey: #keyPath(StoreApp.latestSupportedVersion))
        
        let versions = NSOrderedSet(array: [appVersion])
        self.setValue(versions, forKey: #keyPath(StoreApp._versions))
--- a/AltStoreCore/Model/StoreApp.swift
+++ b/AltStoreCore/Model/StoreApp.swift
@@ -146,7 +146,7 @@ public class StoreApp: NSManagedObject, Decodable, Fetchable
    @NSManaged @objc(source) public var _source: Source?
    @NSManaged @objc(permissions) public var _permissions: NSOrderedSet
    
-    @NSManaged public private(set) var latestVersion: AppVersion?
+    @NSManaged @objc(latestVersion) public private(set) var latestSupportedVersion: AppVersion?
    @NSManaged @objc(versions) public private(set) var _versions: NSOrderedSet
    
    @NSManaged public private(set) var loggedErrors: NSSet /* Set<LoggedError> */ // Use NSSet to avoid eagerly fetching values.
@@ -169,31 +169,6 @@ public class StoreApp: NSManagedObject, Decodable, Fetchable
        return self._versions.array as! [AppVersion]
    }
    
-    @nonobjc public var size: Int64? {
-        guard let version = self.latestVersion else { return nil }
-        return version.size
-    }
-    
-    @nonobjc public var version: String? {
-        guard let version = self.latestVersion else { return nil }
-        return version.version
-    }
-    
-    @nonobjc public var versionDescription: String? {
-        guard let version = self.latestVersion else { return nil }
-        return version.localizedDescription
-    }
-    
-    @nonobjc public var versionDate: Date? {
-        guard let version = self.latestVersion else { return nil }
-        return version.date
-    }
-    
-    @nonobjc public var downloadURL: URL? {
-        guard let version = self.latestVersion else { return nil }
-        return version.downloadURL
-    }
-    
    private override init(entity: NSEntityDescription, insertInto context: NSManagedObjectContext?)
    {
        super.init(entity: entity, insertInto: context)
@@ -314,16 +289,30 @@ public class StoreApp: NSManagedObject, Decodable, Fetchable
    }
 }

-private extension StoreApp
+internal extension StoreApp
 {
    func setVersions(_ versions: [AppVersion])
    {
-        guard let latestVersion = versions.first else { preconditionFailure("StoreApp must have at least one AppVersion.") }
-        
-        self.latestVersion = latestVersion
        self._versions = NSOrderedSet(array: versions)
        
+        let latestSupportedVersion = versions.first(where: { $0.isSupported })
+        self.latestSupportedVersion = latestSupportedVersion
+        
+        for case let version as AppVersion in self._versions
+        {
+            if version == latestSupportedVersion
+            {
+                version.latestSupportedVersionApp = self
+            }
+            else
+            {
+                // Ensure we replace any previous relationship when merging.
+                version.latestSupportedVersionApp = nil
+            }
+        }
+                
        // Preserve backwards compatibility by assigning legacy property values.
+        guard let latestVersion = versions.first else { preconditionFailure("StoreApp must have at least one AppVersion.") }
        self._version = latestVersion.version
        self._versionDate = latestVersion.date
        self._versionDescription = latestVersion.localizedDescription
@@ -334,6 +323,10 @@ private extension StoreApp

 public extension StoreApp
 {
+    var latestAvailableVersion: AppVersion? {
+        return self._versions.firstObject as? AppVersion
+    }
+    
    @nonobjc class func fetchRequest() -> NSFetchRequest<StoreApp>
    {
        return NSFetchRequest<StoreApp>(entityName: "StoreApp")
--- a/AltStoreCore/Protocols/AppProtocol.swift
+++ b/AltStoreCore/Protocols/AppProtocol.swift
@@ -40,7 +40,7 @@ extension ALTApplication: AppProtocol
 extension StoreApp: AppProtocol
 {
    public var url: URL? {
-        return self.downloadURL
+        return self.latestAvailableVersion?.downloadURL
    }
 }

@@ -50,3 +50,17 @@ extension InstalledApp: AppProtocol
        return self.fileURL
    }
 }
+
+extension AppVersion: AppProtocol {
+    public var name: String {
+        return self.app?.name ?? self.bundleIdentifier
+    }
+
+    public var bundleIdentifier: String {
+        return self.appBundleID
+    }
+
+    public var url: URL? {
+        return self.downloadURL
+    }
+}
--- a/Build.xcconfig
+++ b/Build.xcconfig
@@ -1,8 +1,8 @@
 // Configuration settings file format documentation can be found at:
 // https://help.apple.com/xcode/#/dev745c5c974

-MARKETING_VERSION = 0.5.6
-CURRENT_PROJECT_VERSION = 5060
+MARKETING_VERSION = 0.5.8
+CURRENT_PROJECT_VERSION = 5080

 // Vars to be overwritten by `CodeSigning.xcconfig` if exists
 DEVELOPMENT_TEAM = S32Z3HMYVQ
--- a/CERTIFICATE-OF-ORIGIN.md
+++ b/CERTIFICATE-OF-ORIGIN.md
@@ -0,0 +1,37 @@
+
+
+Developer Certificate of Origin
+Version 1.1
+
+Copyright (C) 2004, 2006 The Linux Foundation and its contributors.
+
+Everyone is permitted to copy and distribute verbatim copies of this
+license document, but changing it is not allowed.
+
+
+Developer's Certificate of Origin 1.1
+
+By making a contribution to this project, I certify that:
+
+(a) The contribution was created in whole or in part by me and I
+    have the right to submit it under the open source license
+    indicated in the file; or
+
+(b) The contribution is based upon previous work that, to the best
+    of my knowledge, is covered under an appropriate open source
+    license and I have the right under that license to submit that
+    work with modifications, whether created in whole or in part
+    by me, under the same open source license (unless I am
+    permitted to submit under a different license), as indicated
+    in the file; or
+
+(c) The contribution was provided directly to me by some other
+    person who certified (a), (b) or (c) and I have not modified
+    it.
+
+(d) I understand and agree that this project and the contribution
+    are public and that a record of the contribution (including all
+    personal information I submit with it, including my sign-off) is
+    maintained indefinitely and may be redistributed consistent with
+    this project or the open source license(s) involved.
+
--- a/CONTRIBUTING.md
+++ b/CONTRIBUTING.md
@@ -2,6 +2,8 @@

 Thank you for your interest in contributing to SideStore! SideStore is a community driven project, and it's made possible by people like you.

+By contributing to this Project (SideStore), you agree to the Developer's Certificate of Origin found in [CERTIFICATE-OF-ORIGIN.md](CERTIFICATE-OF-ORIGIN.md). Any contributions to this project after the addition of the Developer's Certificate of Origin are subject to its policy.
+
 There are many ways to contribute to SideStore, so if you aren't a developer, there are still many other ways you can help out:

 -   [Writing documentation](https://github.com/SideStore/SideStore-Docs)
--- a/Dependencies/Roxas
+++ b/Dependencies/Roxas
--- a/Dependencies/minimuxer.xcodeproj/project.pbxproj
+++ b/Dependencies/minimuxer.xcodeproj/project.pbxproj
@@ -24,7 +24,7 @@
 			outputFiles = (
 				"$(OBJECT_FILE_DIR)/$(CARGO_XCODE_TARGET_ARCH)-$(EXECUTABLE_NAME)",
 			);
-			script = "# generated with cargo-xcode 1.5.0\n# modified to use prebuilt binaries\n\nset -eu;\n\nBUILT_SRC=\"./minimuxer/$LIB_FILE_NAME.a\"\nln -f -- \"$BUILT_SRC\" \"$TARGET_BUILD_DIR/$EXECUTABLE_PATH\" || cp \"$BUILT_SRC\" \"$TARGET_BUILD_DIR/$EXECUTABLE_PATH\"\necho \"$BUILT_SRC -> $TARGET_BUILD_DIR/$EXECUTABLE_PATH\"\n\n# xcode generates dep file, but for its own path, so append our rename to it\n#DEP_FILE_SRC=\"minimuxer/target/${CARGO_XCODE_TARGET_TRIPLE}/release/${CARGO_XCODE_CARGO_DEP_FILE_NAME}\"\n#if [ -f \"$DEP_FILE_SRC\" ]; then\n#    DEP_FILE_DST=\"${DERIVED_FILE_DIR}/${CARGO_XCODE_TARGET_ARCH}-${EXECUTABLE_NAME}.d\"\n#    cp -f \"$DEP_FILE_SRC\" \"$DEP_FILE_DST\"\n#    echo >> \"$DEP_FILE_DST\" \"$SCRIPT_OUTPUT_FILE_0: $BUILT_SRC\"\n#fi\n\n# lipo script needs to know all the platform-specific files that have been built\n# archs is in the file name, so that paths don't stay around after archs change\n# must match input for LipoScript\n#FILE_LIST=\"${DERIVED_FILE_DIR}/${ARCHS}-${EXECUTABLE_NAME}.xcfilelist\"\n#touch \"$FILE_LIST\"\n#if ! egrep -q \"$SCRIPT_OUTPUT_FILE_0\" \"$FILE_LIST\" ; then\n#    echo >> \"$FILE_LIST\" \"$SCRIPT_OUTPUT_FILE_0\"\n#fi\n";
+			script = "# generated with cargo-xcode 1.5.0\n# modified to use prebuilt binaries\n\nset -eu;\n\nBUILT_SRC=\"./minimuxer/${LIB_FILE_NAME+libminimuxer-ios}.a\"\nln -f -- \"$BUILT_SRC\" \"$TARGET_BUILD_DIR/$EXECUTABLE_PATH\" || cp \"$BUILT_SRC\" \"$TARGET_BUILD_DIR/$EXECUTABLE_PATH\"\necho \"$BUILT_SRC -> $TARGET_BUILD_DIR/$EXECUTABLE_PATH\"\n\n# xcode generates dep file, but for its own path, so append our rename to it\n#DEP_FILE_SRC=\"minimuxer/target/${CARGO_XCODE_TARGET_TRIPLE}/release/${CARGO_XCODE_CARGO_DEP_FILE_NAME}\"\n#if [ -f \"$DEP_FILE_SRC\" ]; then\n#    DEP_FILE_DST=\"${DERIVED_FILE_DIR}/${CARGO_XCODE_TARGET_ARCH}-${EXECUTABLE_NAME}.d\"\n#    cp -f \"$DEP_FILE_SRC\" \"$DEP_FILE_DST\"\n#    echo >> \"$DEP_FILE_DST\" \"$SCRIPT_OUTPUT_FILE_0: $BUILT_SRC\"\n#fi\n\n# lipo script needs to know all the platform-specific files that have been built\n# archs is in the file name, so that paths don't stay around after archs change\n# must match input for LipoScript\n#FILE_LIST=\"${DERIVED_FILE_DIR}/${ARCHS}-${EXECUTABLE_NAME}.xcfilelist\"\n#touch \"$FILE_LIST\"\n#if ! egrep -q \"$SCRIPT_OUTPUT_FILE_0\" \"$FILE_LIST\" ; then\n#    echo >> \"$FILE_LIST\" \"$SCRIPT_OUTPUT_FILE_0\"\n#fi\n";
 		};
 /* End PBXBuildRule section */

--- a/README.md
+++ b/README.md
@@ -6,6 +6,7 @@
 [![PRs Welcome](https://img.shields.io/badge/PRs-welcome-brightgreen.svg)](https://makeapullrequest.com)
 [![Nightly SideStore build](https://github.com/SideStore/SideStore/actions/workflows/nightly.yml/badge.svg)](https://github.com/SideStore/SideStore/actions/workflows/nightly.yml)
 [![.github/workflows/beta.yml](https://github.com/SideStore/SideStore/actions/workflows/beta.yml/badge.svg)](https://github.com/SideStore/SideStore/actions/workflows/beta.yml)
+[![Discord](https://img.shields.io/discord/949183273383395328?label=Discord)](https://discord.gg/sidestore-949183273383395328)

 ![Alt](https://repobeats.axiom.co/api/embed/3a329ce95955690b9a9366f8d5598626a847d96c.svg "Repobeats analytics image")

--- a/Shared/Categories/NSError+ALTServerError.m
+++ b/Shared/Categories/NSError+ALTServerError.m
@@ -8,9 +8,16 @@

 #import "NSError+ALTServerError.h"

-NSErrorDomain const AltServerErrorDomain = @"com.rileytestut.AltServer";
-NSErrorDomain const AltServerInstallationErrorDomain = @"com.rileytestut.AltServer.Installation";
-NSErrorDomain const AltServerConnectionErrorDomain = @"com.rileytestut.AltServer.Connection";
+#if TARGET_OS_OSX
+#import "AltServer-Swift.h"
+#else
+#import "AltStoreCore/AltStoreCore-Swift.h"
+#endif
+
+NSErrorDomain const AltServerErrorDomain = @"AltServer.ServerError";
+NSErrorDomain const AltServerInstallationErrorDomain = @"AltServer.InstallationError";
+NSErrorDomain const AltServerConnectionErrorDomain = @"AltServer.ConnectionError";
+

 NSErrorUserInfoKey const ALTUnderlyingErrorDomainErrorKey = @"underlyingErrorDomain";
 NSErrorUserInfoKey const ALTUnderlyingErrorCodeErrorKey = @"underlyingErrorCode";
@@ -24,8 +31,16 @@ NSErrorUserInfoKey const ALTOperatingSystemVersionErrorKey = @"ALTOperatingSyste

 + (void)load
 {
-    [NSError setUserInfoValueProviderForDomain:AltServerErrorDomain provider:^id _Nullable(NSError * _Nonnull error, NSErrorUserInfoKey  _Nonnull userInfoKey) {
-        if ([userInfoKey isEqualToString:NSLocalizedFailureReasonErrorKey])
+    [NSError alt_setUserInfoValueProviderForDomain:AltServerErrorDomain provider:^id _Nullable(NSError * _Nonnull error, NSErrorUserInfoKey _Nonnull userInfoKey) {
+        if ([userInfoKey isEqualToString:NSLocalizedDescriptionKey])
+        {
+            return [error altserver_localizedDescription];
+        }
+        else if ([userInfoKey isEqualToString:NSLocalizedFailureErrorKey])
+        {
+            return [error altserver_localizedFailure];
+        }
+        else if ([userInfoKey isEqualToString:NSLocalizedFailureReasonErrorKey])
        {
            return [error altserver_localizedFailureReason];
        }
@@ -41,10 +56,10 @@ NSErrorUserInfoKey const ALTOperatingSystemVersionErrorKey = @"ALTOperatingSyste
        return nil;
    }];
    
-    [NSError setUserInfoValueProviderForDomain:AltServerConnectionErrorDomain provider:^id _Nullable(NSError * _Nonnull error, NSErrorUserInfoKey  _Nonnull userInfoKey) {
-        if ([userInfoKey isEqualToString:NSLocalizedDescriptionKey])
+    [NSError alt_setUserInfoValueProviderForDomain:AltServerConnectionErrorDomain provider:^id _Nullable(NSError * _Nonnull error, NSErrorUserInfoKey  _Nonnull userInfoKey) {
+        if ([userInfoKey isEqualToString:NSLocalizedFailureReasonErrorKey])
        {
-            return [error altserver_connection_localizedDescription];
+            return [error altserver_connection_localizedFailureReason];
        }
        else if ([userInfoKey isEqualToString:NSLocalizedRecoverySuggestionErrorKey])
        {
@@ -55,6 +70,53 @@ NSErrorUserInfoKey const ALTOperatingSystemVersionErrorKey = @"ALTOperatingSyste
    }];
 }

+- (nullable NSString *)altserver_localizedDescription
+{
+    switch ((ALTServerError)self.code)
+    {
+        case ALTServerErrorUnderlyingError:
+        {
+            // We're wrapping another error, so return the wrapped error's localized description.
+            NSError *underlyingError = self.userInfo[NSUnderlyingErrorKey];
+            return underlyingError.localizedDescription;
+        }
+
+        default:
+            return nil;
+    }
+}
+
+- (nullable NSString *)altserver_localizedFailure
+{
+    switch ((ALTServerError)self.code)
+    {
+        case ALTServerErrorUnderlyingError:
+        {
+            NSError *underlyingError = self.userInfo[NSUnderlyingErrorKey];
+            return underlyingError.alt_localizedFailure;
+        }
+
+        case ALTServerErrorConnectionFailed:
+        {
+            NSError *underlyingError = self.userInfo[NSUnderlyingErrorKey];
+            if (underlyingError.localizedFailureReason != nil)
+            {
+                // Only return localized failure if there is an underlying error with failure reason.
+#if TARGET_OS_OSX
+                return NSLocalizedString(@"There was an error connecting to the device.", @"");
+#else
+                return NSLocalizedString(@"AltServer could not establish a connection to SideStore.", @"");
+#endif
+            }
+
+            return nil;
+        }
+
+        default:
+            return nil;
+    }
+}
+
 - (nullable NSString *)altserver_localizedFailureReason
 {
    switch ((ALTServerError)self.code)
@@ -80,12 +142,21 @@ NSErrorUserInfoKey const ALTOperatingSystemVersionErrorKey = @"ALTOperatingSyste
            return NSLocalizedString(@"An unknown error occured.", @"");
            
        case ALTServerErrorConnectionFailed:
+        {
+            NSError *underlyingError = self.userInfo[NSUnderlyingErrorKey];
+            if (underlyingError.localizedFailureReason != nil)
+            {
+                return underlyingError.localizedFailureReason;
+            }
+
+            // Return fallback failure reason if there isn't an underlying error with failure reason.
 #if TARGET_OS_OSX
            return NSLocalizedString(@"There was an error connecting to the device.", @"");
 #else
            return NSLocalizedString(@"Could not connect to SideStore.", @"");
 #endif
-            
+        }
+
        case ALTServerErrorLostConnection:
            return NSLocalizedString(@"Lost connection to SideStore.", @"");
            
@@ -93,8 +164,8 @@ NSErrorUserInfoKey const ALTOperatingSystemVersionErrorKey = @"ALTOperatingSyste
            return NSLocalizedString(@"SideStore could not find this device.", @"");
            
        case ALTServerErrorDeviceWriteFailed:
-            return NSLocalizedString(@"Failed to write app data to device.", @"");
-            
+            return NSLocalizedString(@"SideStore could not write data to this device.", @"");
+
        case ALTServerErrorInvalidRequest:
            return NSLocalizedString(@"SideStore received an invalid request.", @"");
            
@@ -102,14 +173,20 @@ NSErrorUserInfoKey const ALTOperatingSystemVersionErrorKey = @"ALTOperatingSyste
            return NSLocalizedString(@"SideStore sent an invalid response.", @"");
            
        case ALTServerErrorInvalidApp:
-            return NSLocalizedString(@"The app is invalid.", @"");
-            
+            return NSLocalizedString(@"The app is in an invalid format.", @"");
+
        case ALTServerErrorInstallationFailed:
+        {
+            NSError *underlyingError = self.userInfo[NSUnderlyingErrorKey];
+            if (underlyingError != nil) {
+                return underlyingError.localizedFailureReason ?: underlyingError.localizedDescription;
+            }
            return NSLocalizedString(@"An error occured while installing the app.", @"");
-            
+        }
+
        case ALTServerErrorMaximumFreeAppLimitReached:
-            return NSLocalizedString(@"Cannot activate more than 3 apps with a non-developer Apple ID.", @"");
-            
+            return NSLocalizedString(@"You cannot activate more than 3 apps with a non-developer Apple ID.", @"");
+
        case ALTServerErrorUnsupportediOSVersion:
            return NSLocalizedString(@"Your device must be running iOS 12.2 or later to install SideStore.", @"");
            
@@ -117,8 +194,8 @@ NSErrorUserInfoKey const ALTOperatingSystemVersionErrorKey = @"ALTOperatingSyste
            return NSLocalizedString(@"SideStore does not support this request.", @"");
            
        case ALTServerErrorUnknownResponse:
-            return NSLocalizedString(@"Received an unknown response from SideStore.", @"");
-            
+            return NSLocalizedString(@"SideStore received an unknown response from SideStore.", @"");
+
        case ALTServerErrorInvalidAnisetteData:
            return NSLocalizedString(@"The provided anisette data is invalid.", @"");
            
@@ -153,7 +230,19 @@ NSErrorUserInfoKey const ALTOperatingSystemVersionErrorKey = @"ALTOperatingSyste
 {
    switch ((ALTServerError)self.code)
    {
+        case ALTServerErrorUnderlyingError:
+        {
+            NSError *underlyingError = self.userInfo[NSUnderlyingErrorKey];
+            return underlyingError.localizedRecoverySuggestion;
+        }
        case ALTServerErrorConnectionFailed:
+        {
+            NSError *underlyingError = self.userInfo[NSUnderlyingErrorKey];
+            if (underlyingError.localizedRecoverySuggestion != nil){
+                return underlyingError.localizedRecoverySuggestion;
+            }
+			// If there is no underlying error found, fall through to AltServerErrorDeviceNotFound
+        }
        case ALTServerErrorDeviceNotFound:
            return NSLocalizedString(@"Make sure you have trusted this device with your computer and Wi-Fi sync is enabled.", @"");
            
@@ -182,6 +271,13 @@ NSErrorUserInfoKey const ALTOperatingSystemVersionErrorKey = @"ALTOperatingSyste
 {
    switch ((ALTServerError)self.code)
    {
+        case ALTServerErrorUnderlyingError:
+        {
+            NSError *underlyingError = self.userInfo[NSUnderlyingErrorKey];
+            return underlyingError.alt_localizedDebugDescription;
+
+        }
+
        case ALTServerErrorIncompatibleDeveloperDisk:
        {
            NSString *path = self.userInfo[NSFilePathErrorKey];
@@ -191,7 +287,7 @@ NSErrorUserInfoKey const ALTOperatingSystemVersionErrorKey = @"ALTOperatingSyste
            }

            NSString *osVersion = [self altserver_osVersion] ?: NSLocalizedString(@"this device's OS version", @"");
-            NSString *debugDescription = [NSString stringWithFormat:NSLocalizedString(@"The Developer disk located at\n\n%@\n\nis incompatible with %@.", @""), path, osVersion];
+            NSString *debugDescription = [NSString stringWithFormat:NSLocalizedString(@"The Developer disk located at %@ is incompatible with %@.", @""), path, osVersion];
            return debugDescription;
        }
            
@@ -232,7 +328,7 @@ NSErrorUserInfoKey const ALTOperatingSystemVersionErrorKey = @"ALTOperatingSyste

 #pragma mark - AltServerConnectionErrorDomain -

- (nullable NSString *)altserver_connection_localizedDescription
+- (nullable NSString *)altserver_connection_localizedFailureReason
 {
    switch ((ALTServerConnectionError)self.code)
    {
--- a/Shared/Errors/ALTLocalizedError.swift
+++ b/Shared/Errors/ALTLocalizedError.swift
@@ -0,0 +1,182 @@
+//
+//  ALTLocalizedError.swift
+//  AltStore
+//
+//  Created by Riley Testut on 10/14/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import Foundation
+import AltSign
+
+public let ALTLocalizedTitleErrorKey = "ALTLocalizedTitle"
+public let ALTLocalizedDescriptionKey = "ALTLocalizedDescription"
+
+public protocol ALTLocalizedError<Code>: LocalizedError, CustomNSError, CustomStringConvertible
+{
+    associatedtype Code: ALTErrorCode
+
+    var code: Code { get }
+    var errorFailureReason: String { get }
+
+    var errorTitle: String? { get set }
+    var errorFailure: String? { get set }
+
+    var sourceFile: String? { get set }
+    var sourceLine: UInt? { get set }
+}
+
+public extension ALTLocalizedError
+{
+    var sourceFile: String? {
+        get { nil }
+        set {}
+    }
+
+    var sourceLine: UInt? {
+        get { nil }
+        set {}
+    }
+}
+
+public protocol ALTErrorCode: RawRepresentable where RawValue == Int
+{
+    associatedtype Error: ALTLocalizedError where Error.Code == Self
+
+    static var errorDomain: String { get } // Optional
+}
+
+public protocol ALTErrorEnum: ALTErrorCode
+{
+    associatedtype Error = DefaultLocalizedError<Self>
+
+    var errorFailureReason: String { get }
+}
+
+/// LocalizedError & CustomNSError & CustomStringConvertible
+public extension ALTLocalizedError
+{
+    var errorCode: Int { self.code.rawValue }
+
+    var errorDescription: String? {
+        guard (self as NSError).localizedFailure == nil else {
+            // Error has localizedFailure, so return nil to construct localizedDescription from it + localizedFailureReason.
+            return nil
+        }
+
+        // Otherwise, return failureReason for localizedDescription to avoid system prepending "Operation Failed" message.
+        return self.failureReason
+    }
+
+    var failureReason: String? {
+        return self.errorFailureReason
+    }
+
+    var errorUserInfo: [String : Any] {
+        let userInfo: [String: Any?] = [
+            NSLocalizedFailureErrorKey: self.errorFailure,
+            ALTLocalizedTitleErrorKey: self.errorTitle,
+//            ALTSourceFileErrorKey: self.sourceFile, // TODO: Figure out where these come from
+//            ALTSourceLineErrorKey: self.sourceLine,
+        ]
+
+        return userInfo.compactMapValues { $0 }
+    }
+
+    var description: String {
+        let description = "\(self.localizedErrorCode) “\(self.localizedDescription)”"
+        return description
+    }
+}
+
+/// Default Implementations
+public extension ALTLocalizedError where Code: ALTErrorEnum
+{
+    static var errorDomain: String {
+        return Code.errorDomain
+    }
+
+    // ALTErrorEnum Codes provide their failure reason directly.
+    var errorFailureReason: String {
+        return self.code.errorFailureReason
+    }
+}
+
+/// Default Implementations
+public extension ALTErrorCode
+{
+    static var errorDomain: String {
+        let typeName = String(reflecting: Self.self) // "\(Self.self)" doesn't include module name, but String(reflecting:) does.
+        let errorDomain = typeName.replacingOccurrences(of: "ErrorCode", with: "Error")
+        return errorDomain
+    }
+}
+
+public extension ALTLocalizedError
+{
+    // Allows us to initialize errors with localizedTitle + localizedFailure
+    // while still using the error's custom initializer at callsite.
+    init(_ error: Self, localizedTitle: String? = nil, localizedFailure: String? = nil)
+    {
+        self = error
+
+        if let localizedTitle
+        {
+            self.errorTitle = localizedTitle
+        }
+
+        if let localizedFailure
+        {
+            self.errorFailure = localizedFailure
+        }
+    }
+}
+
+public struct DefaultLocalizedError<Code: ALTErrorEnum>: ALTLocalizedError
+{
+    public let code: Code
+
+    public var errorTitle: String?
+    public var errorFailure: String?
+    public var sourceFile: String?
+    public var sourceLine: UInt?
+
+    public init(_ code: Code, localizedTitle: String? = nil, localizedFailure: String? = nil, sourceFile: String? = #fileID, sourceLine: UInt? = #line)
+    {
+        self.code = code
+        self.errorTitle = localizedTitle
+        self.errorFailure = localizedFailure
+        self.sourceFile = sourceFile
+        self.sourceLine = sourceLine
+    }
+}
+
+/// Custom Operators
+/// These allow us to pattern match ALTErrorCodes against arbitrary errors via ~ prefix.
+prefix operator ~
+public prefix func ~<Code: ALTErrorCode>(expression: Code) -> NSError
+{
+    let nsError = NSError(domain: Code.errorDomain, code: expression.rawValue)
+    return nsError
+}
+
+public func ~=(pattern: any Swift.Error, value: any Swift.Error) -> Bool
+{
+    let isMatch = pattern._domain == value._domain && pattern._code == value._code
+    return isMatch
+}
+
+// These operators *should* allow us to match ALTErrorCodes against arbitrary errors,
+// but they don't work as of iOS 16.1 and Swift 5.7.
+//
+//public func ~=<Error: ALTLocalizedError>(pattern: Error, value: Swift.Error) -> Bool
+//{
+//    let isMatch = pattern._domain == value._domain && pattern._code == value._code
+//    return isMatch
+//}
+//
+//public func ~=<Code: ALTErrorCode>(pattern: Code, value: Swift.Error) -> Bool
+//{
+//    let isMatch = Code.errorDomain == value._domain && pattern.rawValue == value._code
+//    return isMatch
+//}
--- a/Shared/Errors/ALTWrappedError.h
+++ b/Shared/Errors/ALTWrappedError.h
@@ -0,0 +1,25 @@
+//
+//  ALTWrappedError.h
+//  AltStoreCore
+//
+//  Created by Riley Testut on 11/28/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+#import <Foundation/Foundation.h>
+
+NS_ASSUME_NONNULL_BEGIN
+
+// Overrides localizedDescription to check userInfoValueProvider for failure reason
+// instead of default behavior which just returns NSLocalizedFailureErrorKey if present.
+//
+// Must be written in Objective-C for Swift.Error <-> NSError bridging to work correctly.
+@interface ALTWrappedError : NSError
+
+@property (copy, nonatomic) NSError *wrappedError;
+
+- (instancetype)initWithError:(NSError *)error userInfo:(NSDictionary<NSString *, id> *)userInfo;
+
+@end
+
+NS_ASSUME_NONNULL_END
--- a/Shared/Errors/ALTWrappedError.m
+++ b/Shared/Errors/ALTWrappedError.m
@@ -0,0 +1,73 @@
+//
+//  ALTWrappedError.m
+//  AltStoreCore
+//
+//  Created by Riley Testut on 11/28/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+#import "ALTWrappedError.h"
+
+@implementation ALTWrappedError
+
+ (BOOL)supportsSecureCoding
+{
+    // Required in order to serialize errors for legacy AltServer communication.
+    return YES;
+}
+
+- (instancetype)initWithError:(NSError *)error userInfo:(NSDictionary<NSString *,id> *)userInfo
+{
+    self = [super initWithDomain:error.domain code:error.code userInfo:userInfo];
+    if (self)
+    {
+        if ([error isKindOfClass:[ALTWrappedError class]])
+        {
+            _wrappedError = [(ALTWrappedError *)error wrappedError];
+        }
+        else
+        {
+            _wrappedError = [error copy];
+        }
+    }
+
+    return self;
+}
+
+- (NSString *)localizedDescription
+{
+    NSString *localizedFailure = self.userInfo[NSLocalizedFailureErrorKey];
+    if (localizedFailure != nil)
+    {
+        NSString *wrappedLocalizedDescription = self.wrappedError.userInfo[NSLocalizedDescriptionKey];
+        NSString *localizedFailureReason = wrappedLocalizedDescription ?: self.wrappedError.localizedFailureReason ?: self.wrappedError.localizedDescription;
+
+        NSString *localizedDescription = [NSString stringWithFormat:@"%@ %@", localizedFailure, localizedFailureReason];
+        return localizedDescription;
+    }
+
+    // localizedFailure is nil, so return wrappedError's localizedDescription.
+    return self.wrappedError.localizedDescription;
+}
+
+- (NSString *)localizedFailureReason
+{
+    return self.wrappedError.localizedFailureReason;
+}
+
+- (NSString *)localizedRecoverySuggestion
+{
+    return self.wrappedError.localizedRecoverySuggestion;
+}
+
+- (NSString *)debugDescription
+{
+    return self.wrappedError.debugDescription;
+}
+
+- (NSString *)helpAnchor
+{
+    return self.wrappedError.helpAnchor;
+}
+
+@end
--- a/Shared/Extensions/ALTServerError+Conveniences.swift
+++ b/Shared/Extensions/ALTServerError+Conveniences.swift
@@ -22,12 +22,8 @@ public extension ALTServerError
        case is EncodingError: self = ALTServerError(.invalidResponse, underlyingError: error)
        case let error as NSError:
            var userInfo = error.userInfo
-            if !userInfo.keys.contains(NSUnderlyingErrorKey)
-            {
-                // Assign underlying error (if there isn't already one).
-                userInfo[NSUnderlyingErrorKey] = error
-            }
-            
+            userInfo[NSUnderlyingErrorKey] = error
+
            self = ALTServerError(.underlyingError, userInfo: userInfo)
        }
    }
--- a/Shared/Extensions/NSError+AltStore.swift
+++ b/Shared/Extensions/NSError+AltStore.swift
@@ -8,7 +8,17 @@

 import Foundation

-extension NSError
+#if canImport(UIKit)
+import UIKit
+public typealias ALTFont = UIFont
+#elseif canImport(AppKit)
+import AppKit
+public typealias ALTFont = NSFont
+#endif
+
+import AltSign
+
+public extension NSError
 {
    @objc(alt_localizedFailure)
    var localizedFailure: String? {
@@ -21,52 +31,52 @@ extension NSError
        let debugDescription = (self.userInfo[NSDebugDescriptionErrorKey] as? String) ?? (NSError.userInfoValueProvider(forDomain: self.domain)?(self, NSDebugDescriptionErrorKey) as? String)
        return debugDescription
    }
-    
+
+    @objc(alt_localizedTitle)
+    var localizedTitle: String? {
+        return self.userInfo[ALTLocalizedTitleErrorKey] as? String
+    }
+
    @objc(alt_errorWithLocalizedFailure:)
    func withLocalizedFailure(_ failure: String) -> NSError
    {
-        var userInfo = self.userInfo
-        userInfo[NSLocalizedFailureErrorKey] = failure
-        
-        if let failureReason = self.localizedFailureReason
+        switch self
        {
-            userInfo[NSLocalizedFailureReasonErrorKey] = failureReason
+        case var error as any ALTLocalizedError:
+            error.errorFailure = failure
+            return error as NSError
+
+        default:
+            var userInfo = self.userInfo
+            userInfo[NSLocalizedFailureReasonErrorKey] = failure
+
+            return ALTWrappedError(error: self, userInfo: userInfo)
        }
-        else if self.localizedFailure == nil && self.localizedFailureReason == nil && self.localizedDescription.contains(self.localizedErrorCode)
+    }
+    @objc(alt_errorWithLocalizedTitle:)
+    func withLocalizedTitle(_ title: String) -> NSError {
+		switch self
        {
-            // Default localizedDescription, so replace with just the localized error code portion.
-            userInfo[NSLocalizedFailureReasonErrorKey] = "(\(self.localizedErrorCode).)"
+        case var error as any ALTLocalizedError:
+            error.errorTitle = title
+            return error as NSError
+
+        default:
+            var userInfo = self.userInfo
+            userInfo[ALTLocalizedTitleErrorKey] = title
+            return ALTWrappedError(error: self, userInfo: userInfo)
+
        }
-        else
-        {
-            userInfo[NSLocalizedFailureReasonErrorKey] = self.localizedDescription
-        }
-        
-        if let localizedDescription = NSError.userInfoValueProvider(forDomain: self.domain)?(self, NSLocalizedDescriptionKey) as? String
-        {
-            userInfo[NSLocalizedDescriptionKey] = localizedDescription
-        }
-        
-        // Don't accidentally remove localizedDescription from dictionary
-        // userInfo[NSLocalizedDescriptionKey] = NSError.userInfoValueProvider(forDomain: self.domain)?(self, NSLocalizedDescriptionKey) as? String
-        
-        if let recoverySuggestion = self.localizedRecoverySuggestion
-        {
-            userInfo[NSLocalizedRecoverySuggestionErrorKey] = recoverySuggestion
-        }
-        
-        let error = NSError(domain: self.domain, code: self.code, userInfo: userInfo)
-        return error
    }
    
-    func sanitizedForCoreData() -> NSError
+    func sanitizedForSerialization() -> NSError
    {
        var userInfo = self.userInfo
-        userInfo[NSLocalizedFailureErrorKey] = self.localizedFailure
        userInfo[NSLocalizedDescriptionKey] = self.localizedDescription
        userInfo[NSLocalizedFailureReasonErrorKey] = self.localizedFailureReason
        userInfo[NSLocalizedRecoverySuggestionErrorKey] = self.localizedRecoverySuggestion
-        
+        userInfo[NSDebugDescriptionErrorKey] = self.localizedDebugDescription
+
        // Remove userInfo values that don't conform to NSSecureEncoding.
        userInfo = userInfo.filter { (key, value) in
            return (value as AnyObject) is NSSecureCoding
@@ -75,69 +85,165 @@ extension NSError
        // Sanitize underlying errors.
        if let underlyingError = userInfo[NSUnderlyingErrorKey] as? Error
        {
-            let sanitizedError = (underlyingError as NSError).sanitizedForCoreData()
+            let sanitizedError = (underlyingError as NSError).sanitizedForSerialization()
            userInfo[NSUnderlyingErrorKey] = sanitizedError
        }
        
        if #available(iOS 14.5, macOS 11.3, *), let underlyingErrors = userInfo[NSMultipleUnderlyingErrorsKey] as? [Error]
        {
-            let sanitizedErrors = underlyingErrors.map { ($0 as NSError).sanitizedForCoreData() }
+            let sanitizedErrors = underlyingErrors.map { ($0 as NSError).sanitizedForSerialization() }
            userInfo[NSMultipleUnderlyingErrorsKey] = sanitizedErrors
        }
        
        let error = NSError(domain: self.domain, code: self.code, userInfo: userInfo)
        return error
    }
+    func formattedDetailedDescription(with font: ALTFont) -> NSAttributedString {
+#if canImport(UIKit)
+        let boldFontDescriptor = font.fontDescriptor.withSymbolicTraits(.traitBold) ?? font.fontDescriptor
+#else
+        let boldFontDescriptor = font.fontDescriptor.withSymbolicTraits(.bold)
+#endif
+        let boldFont = ALTFont(descriptor: boldFontDescriptor, size: font.pointSize) ?? font
+
+        var preferredKeyOrder = [
+            NSDebugDescriptionErrorKey,
+            NSLocalizedDescriptionKey,
+            NSLocalizedFailureErrorKey,
+            NSLocalizedFailureReasonErrorKey,
+            NSLocalizedRecoverySuggestionErrorKey,
+            ALTLocalizedTitleErrorKey,
+//            ALTSourceFileErrorKey,
+//            ALTSourceLineErrorKey,
+            NSUnderlyingErrorKey
+        ]
+
+        if #available(iOS 14.5, macOS 11.3, *) {
+            preferredKeyOrder.append(NSMultipleUnderlyingErrorsKey)
+        }
+
+        var userInfo = self.userInfo
+        userInfo[NSDebugDescriptionErrorKey] = self.localizedDebugDescription
+        userInfo[NSLocalizedFailureErrorKey] = self.localizedFailure
+        userInfo[NSLocalizedFailureReasonErrorKey] = self.localizedFailureReason
+        userInfo[NSLocalizedRecoverySuggestionErrorKey] = self.localizedRecoverySuggestion
+
+        let sortedUserInfo = userInfo.sorted { a, b in
+            let indexA = preferredKeyOrder.firstIndex(of: a.key)
+            let indexB = preferredKeyOrder.firstIndex(of: b.key)
+            switch (indexA, indexB) {
+            case (let indexA?, let indexB?): return indexA < indexB
+            case (_?, nil): return true // indexA exists, indexB is nil, indexA should come first
+            case (nil, _?): return false // indexB exists, indexB is nil, indexB should come first
+            case (nil, nil): return a.key < b.key // both nil, so sort alphabetically
+            }
+        }
+
+        let detailedDescription = NSMutableAttributedString()
+
+        for (key, value) in sortedUserInfo
+        {
+            let keyName: String
+            switch key
+            {
+            case NSDebugDescriptionErrorKey: keyName = NSLocalizedString("Debug Description", comment: "")
+            case NSLocalizedDescriptionKey: keyName = NSLocalizedString("Error Description", comment: "")
+            case NSLocalizedFailureErrorKey: keyName = NSLocalizedString("Failure", comment: "")
+            case NSLocalizedFailureReasonErrorKey: keyName = NSLocalizedString("Failure Reason", comment: "")
+            case NSLocalizedRecoverySuggestionErrorKey: keyName = NSLocalizedString("Recovery Suggestion", comment: "")
+            case ALTLocalizedTitleErrorKey: keyName = NSLocalizedString("Title", comment: "")
+//            case ALTSourceFileErrorKey: keyName = NSLocalizedString("Source File", comment: "")
+//            case ALTSourceLineErrorKey: keyName = NSLocalizedString("Source Line", comment: "")
+            case NSUnderlyingErrorKey: keyName = NSLocalizedString("Underlying Error", comment: "")
+            default:
+                if #available(iOS 14.5, macOS 11.3, *), key == NSMultipleUnderlyingErrorsKey
+                {
+                    keyName = NSLocalizedString("Underlying Errors", comment: "")
+                }
+                else
+                {
+                    keyName = key
+                }
+            }
+
+            let attributedKey = NSAttributedString(string: keyName, attributes: [.font: boldFont])
+            let attributedValue = NSAttributedString(string: String(describing: value), attributes: [.font: font])
+
+            let attributedString = NSMutableAttributedString(attributedString: attributedKey)
+            attributedString.mutableString.append("\n")
+            attributedString.append(attributedValue)
+
+            if !detailedDescription.string.isEmpty
+            {
+                detailedDescription.mutableString.append("\n\n")
+            }
+
+            detailedDescription.append(attributedString)
+        }
+
+        // Support dark mode
+		#if canImport(UIKit)
+        if #available(iOS 13, *)
+        {
+            detailedDescription.addAttribute(.foregroundColor, value: UIColor.label, range: NSMakeRange(0, detailedDescription.length))
+        }
+		#else
+        detailedDescription.addAttribute(.foregroundColor, value: NSColor.labelColor, range: NSMakeRange(0, detailedDescription.length))
+		#endif
+
+        return detailedDescription
+    }
 }

-extension Error
+public extension NSError
+{
+    typealias UserInfoProvider = (Error, String) -> Any?
+
+    @objc
+    class func alt_setUserInfoValueProvider(forDomain domain: String, provider: UserInfoProvider?) {
+        NSError.setUserInfoValueProvider(forDomain: domain) { error, key in
+			let nsError = error as NSError
+
+            switch key{
+            case NSLocalizedDescriptionKey:
+                if nsError.localizedFailure != nil {
+                    // Error has localizedFailure, so return nil to construct localizedDescription from it + localizedFailureReason
+                    return nil
+                } else if let localizedDescription = provider?(error, NSLocalizedDescriptionKey) as? String {
+                    // Only call provider() if there is no localizedFailure
+                    return localizedDescription
+                }
+
+                /* Otherwise return failureReason for localizedDescription to avoid system prepending "Operation Failed" message
+                   Do NOT return provider(NSLocalizedFailureReason) which might be unexpectedly nil if unrecognized error code. */
+
+                return nsError.localizedFailureReason
+
+            default:
+                return provider?(error, key)
+            }
+        }
+    }
+}
+
+public extension Error
 {
    var underlyingError: Error? {
-        let underlyingError = (self as NSError).userInfo[NSUnderlyingErrorKey] as? Error
-        return underlyingError
+		return (self as NSError).userInfo[NSUnderlyingErrorKey] as? Error
    }
-    
+
    var localizedErrorCode: String {
-        let localizedErrorCode = String(format: NSLocalizedString("%@ error %@", comment: ""), (self as NSError).domain, (self as NSError).code as NSNumber)
-        return localizedErrorCode
+        return String(format: NSLocalizedString("%@ %@", comment: ""), (self as NSError).domain, self.displayCode as NSNumber)
    }
-}

-protocol ALTLocalizedError: LocalizedError, CustomNSError
-{
-    var failure: String? { get }
-    
-    var underlyingError: Error? { get }
-}
+    var displayCode: Int {
+        guard let serverError = self as? ALTServerError else {
+            return (self as NSError).code
+        }

-extension ALTLocalizedError
-{
-    var errorUserInfo: [String : Any] {
-        let userInfo = ([
-            NSLocalizedDescriptionKey: self.errorDescription,
-            NSLocalizedFailureReasonErrorKey: self.failureReason,
-            NSLocalizedFailureErrorKey: self.failure,
-            NSUnderlyingErrorKey: self.underlyingError
-        ] as [String: Any?]).compactMapValues { $0 }
-        return userInfo
+        /* We want AltServerError codes to start at 2000, but we can't change them without breaking AltServer compatibility.
+           Instead we just add 2000 when displaying code to the user to make it appear as if the codes start at 2000 anyway.
+         */
+        return 2000 + serverError.code.rawValue
    }
-    
-    var underlyingError: Error? {
-        // Error's default implementation calls errorUserInfo,
-        // but ALTLocalizedError.errorUserInfo calls underlyingError.
-        // Return nil to prevent infinite recursion.
-        return nil
-    }
-    
-    var errorDescription: String? {
-        guard let errorFailure = self.failure else { return (self.underlyingError as NSError?)?.localizedDescription }
-        guard let failureReason = self.failureReason else { return errorFailure }
-        
-        let errorDescription = errorFailure + " " + failureReason
-        return errorDescription
-    }
-    
-    var failureReason: String? { (self.underlyingError as NSError?)?.localizedDescription }
-    var recoverySuggestion: String? { (self.underlyingError as NSError?)?.localizedRecoverySuggestion }
-    var helpAnchor: String? { (self.underlyingError as NSError?)?.helpAnchor }
 }
--- a/Protocol/CodableError.swift
+++ b/Protocol/CodableError.swift
@@ -0,0 +1,249 @@
+//
+//  CodableError.swift
+//  AltKit
+//
+//  Created by Riley Testut on 3/5/20.
+//  Copyright © 2020 Riley Testut. All rights reserved.
+//
+
+import Foundation
+
+// Can only automatically conform ALTServerError.Code to Codable, not ALTServerError itself
+extension ALTServerError.Code: Codable {}
+
+private extension ErrorUserInfoKey
+{
+    static let altLocalizedDescription: String = "ALTLocalizedDescription"
+    static let altLocalizedFailureReason: String = "ALTLocalizedFailureReason"
+    static let altLocalizedRecoverySuggestion: String = "ALTLocalizedRecoverySuggestion"
+    static let altDebugDescription: String = "ALTDebugDescription"
+}
+
+extension CodableError
+{
+    enum UserInfoValue: Codable
+    {
+        case unknown
+        case string(String)
+        case number(Int)
+        case error(NSError)
+        case codableError(CodableError)
+        indirect case array([UserInfoValue])
+        indirect case dictionary([String: UserInfoValue])
+
+        var value: Any? {
+            switch self
+            {
+            case .unknown: return nil
+            case .string(let string): return string
+            case .number(let number): return number
+            case .error(let error): return error
+            case .codableError(let error): return error.error
+            case .array(let array): return array.compactMap { $0.value } // .compactMap instead of .map to ensure nil values are removed.
+            case .dictionary(let dictionary): return dictionary.compactMapValues { $0.value } // .compactMapValues instead of .mapValues to ensure nil values are removed.
+            }
+        }
+
+        var codableValue: Codable? {
+            switch self
+            {
+            case .unknown, .string, .number: return self.value as? Codable
+            case .codableError(let error): return error
+            case .error(let nsError):
+                // Ignore error because we don't want to fail completely if error contains invalid user info value.
+                let sanitizedError = nsError.sanitizedForSerialization()
+                let data = try? NSKeyedArchiver.archivedData(withRootObject: sanitizedError, requiringSecureCoding: true)
+                return data
+
+            case .array(let array): return array
+            case .dictionary(let dictionary): return dictionary
+            }
+        }
+
+        init(_ rawValue: Any?)
+        {
+            switch rawValue
+            {
+            case let string as String: self = .string(string)
+            case let number as Int: self = .number(number)
+            case let error as NSError: self = .codableError(CodableError(error: error))
+            case let array as [Any]: self = .array(array.compactMap(UserInfoValue.init))
+            case let dictionary as [String: Any]: self = .dictionary(dictionary.compactMapValues(UserInfoValue.init))
+            default: self = .unknown
+            }
+        }
+
+        init(from decoder: Decoder) throws
+        {
+            let container = try decoder.singleValueContainer()
+
+            if
+                let data = try? container.decode(Data.self),
+                let error = try? NSKeyedUnarchiver.unarchivedObject(ofClass: NSError.self, from: data)
+            {
+                self = .error(error)
+            }
+            else if let codableError = try? container.decode(CodableError.self)
+            {
+                self = .codableError(codableError)
+            }
+            else if let string = try? container.decode(String.self)
+            {
+                self = .string(string)
+            }
+            else if let number = try? container.decode(Int.self)
+            {
+                self = .number(number)
+            }
+            else if let array = try? container.decode([UserInfoValue].self)
+            {
+                self = .array(array)
+            }
+            else if let dictionary = try? container.decode([String: UserInfoValue].self)
+            {
+                self = .dictionary(dictionary)
+            }
+            else
+            {
+                self = .unknown
+            }
+        }
+
+        func encode(to encoder: Encoder) throws
+        {
+            var container = encoder.singleValueContainer()
+
+            if let value = self.codableValue
+            {
+                try container.encode(value)
+            }
+            else
+            {
+                try container.encodeNil()
+            }
+        }
+    }
+}
+
+struct CodableError: Codable
+{
+    var error: Error {
+        return self.rawError ?? NSError(domain: self.errorDomain, code: self.errorCode, userInfo: self.userInfo ?? [:])
+    }
+    private var rawError: Error?
+
+    private var errorDomain: String
+    private var errorCode: Int
+    private var userInfo: [String: Any]?
+
+    private enum CodingKeys: String, CodingKey
+    {
+        case errorDomain
+        case errorCode
+        case legacyUserInfo = "userInfo"
+        case errorUserInfo
+    }
+
+    init(error: Error)
+    {
+        self.rawError = error
+
+        let nsError = error as NSError
+        self.errorDomain = nsError.domain
+        self.errorCode = nsError.code
+
+        if !nsError.userInfo.isEmpty
+        {
+            self.userInfo = nsError.userInfo
+        }
+    }
+
+    init(from decoder: Decoder) throws
+    {
+        let container = try decoder.container(keyedBy: CodingKeys.self)
+
+        // Assume ALTServerError.errorDomain if no explicit domain provided.
+        self.errorDomain = try container.decodeIfPresent(String.self, forKey: .errorDomain) ?? ALTServerError.errorDomain
+        self.errorCode = try container.decode(Int.self, forKey: .errorCode)
+
+        if let rawUserInfo = try container.decodeIfPresent([String: UserInfoValue].self, forKey: .errorUserInfo)
+        {
+            // Attempt decoding from .errorUserInfo first, because it will gracefully handle unknown user info values.
+
+            // Copy ALTLocalized... values to NSLocalized... if provider is nil or if error is unrecognized.
+            // This ensures we preserve error messages if receiving an unknown error.
+            var userInfo = rawUserInfo.compactMapValues { $0.value }
+
+            // Recognized == the provider returns value for NSLocalizedFailureReasonErrorKey, or error is ALTServerError.underlyingError.
+            let provider = NSError.userInfoValueProvider(forDomain: self.errorDomain)
+            let isRecognizedError = (
+                provider?(self.error, NSLocalizedFailureReasonErrorKey) != nil ||
+                (self.error._domain == ALTServerError.errorDomain && self.error._code == ALTServerError.underlyingError.rawValue)
+            )
+
+            if !isRecognizedError
+            {
+                // Error not recognized, so copy over NSLocalizedDescriptionKey and NSLocalizedFailureReasonErrorKey.
+                userInfo[NSLocalizedDescriptionKey] = userInfo[ErrorUserInfoKey.altLocalizedDescription]
+                userInfo[NSLocalizedFailureReasonErrorKey] = userInfo[ErrorUserInfoKey.altLocalizedFailureReason]
+            }
+
+            // Copy over NSLocalizedRecoverySuggestionErrorKey and NSDebugDescriptionErrorKey if provider returns nil.
+            if provider?(self.error, NSLocalizedRecoverySuggestionErrorKey) == nil
+            {
+                userInfo[NSLocalizedRecoverySuggestionErrorKey] = userInfo[ErrorUserInfoKey.altLocalizedRecoverySuggestion]
+            }
+
+            if provider?(self.error, NSDebugDescriptionErrorKey) == nil
+            {
+                userInfo[NSDebugDescriptionErrorKey] = userInfo[ErrorUserInfoKey.altDebugDescription]
+            }
+
+            userInfo[ErrorUserInfoKey.altLocalizedDescription] = nil
+            userInfo[ErrorUserInfoKey.altLocalizedFailureReason] = nil
+            userInfo[ErrorUserInfoKey.altLocalizedRecoverySuggestion] = nil
+            userInfo[ErrorUserInfoKey.altDebugDescription] = nil
+
+            self.userInfo = userInfo
+        }
+        else if let rawUserInfo = try container.decodeIfPresent([String: UserInfoValue].self, forKey: .legacyUserInfo)
+        {
+            // Fall back to decoding .legacyUserInfo, which only supports String and NSError values.
+            let userInfo = rawUserInfo.compactMapValues { $0.value }
+            self.userInfo = userInfo
+        }
+    }
+
+    func encode(to encoder: Encoder) throws
+    {
+        var container = encoder.container(keyedBy: CodingKeys.self)
+        try container.encode(self.errorDomain, forKey: .errorDomain)
+        try container.encode(self.errorCode, forKey: .errorCode)
+
+        let rawLegacyUserInfo = self.userInfo?.compactMapValues { (value) -> UserInfoValue? in
+            // .legacyUserInfo only supports String and NSError values.
+            switch value
+            {
+            case let string as String: return .string(string)
+            case let error as NSError: return .error(error) // Must use .error, not .codableError for backwards compatibility.
+            default: return nil
+            }
+        }
+        try container.encodeIfPresent(rawLegacyUserInfo, forKey: .legacyUserInfo)
+
+        let nsError = self.error as NSError
+
+        var userInfo = self.userInfo ?? [:]
+        userInfo[ErrorUserInfoKey.altLocalizedDescription] = nsError.localizedDescription
+        userInfo[ErrorUserInfoKey.altLocalizedFailureReason] = nsError.localizedFailureReason
+        userInfo[ErrorUserInfoKey.altLocalizedRecoverySuggestion] = nsError.localizedRecoverySuggestion
+        userInfo[ErrorUserInfoKey.altDebugDescription] = nsError.localizedDebugDescription
+
+        // No need to use alternate key. This is a no-op if userInfo already contains localizedFailure,
+        // but it caches the UserInfoProvider value if one exists.
+        userInfo[NSLocalizedFailureErrorKey] = nsError.localizedFailure
+
+        let rawUserInfo = userInfo.compactMapValues { UserInfoValue($0) }
+        try container.encodeIfPresent(rawUserInfo, forKey: .errorUserInfo)
+    }
+}
--- a/Protocol/CodableServerError.swift
+++ b/Protocol/CodableServerError.swift
@@ -1,126 +0,0 @@
-//
-//  CodableServerError.swift
-//  AltKit
-//
-//  Created by Riley Testut on 3/5/20.
-//  Copyright © 2020 Riley Testut. All rights reserved.
-//
-
-import Foundation
-
-// Can only automatically conform ALTServerError.Code to Codable, not ALTServerError itself
-extension ALTServerError.Code: Codable {}
-
-extension CodableServerError
-{
-    enum UserInfoValue: Codable
-    {
-        case string(String)
-        case error(NSError)
-        
-        public init(from decoder: Decoder) throws
-        {
-            let container = try decoder.singleValueContainer()
-
-            if
-                let data = try? container.decode(Data.self),
-                let error = try? NSKeyedUnarchiver.unarchivedObject(ofClass: NSError.self, from: data)
-            {
-                self = .error(error)
-            }
-            else if let string = try? container.decode(String.self)
-            {
-                self = .string(string)
-            }
-            else
-            {
-                throw DecodingError.dataCorruptedError(in: container, debugDescription: "UserInfoValue value cannot be decoded")
-            }
-        }
-        
-        func encode(to encoder: Encoder) throws
-        {
-            var container = encoder.singleValueContainer()
-            
-            switch self
-            {
-            case .string(let string): try container.encode(string)
-            case .error(let error):
-                guard let data = try? NSKeyedArchiver.archivedData(withRootObject: error, requiringSecureCoding: true) else {
-                    let context = EncodingError.Context(codingPath: container.codingPath, debugDescription: "UserInfoValue value \(self) cannot be encoded")
-                    throw EncodingError.invalidValue(self, context)
-                }
-                
-                try container.encode(data)
-            }
-        }
-    }
-}
-
-struct CodableServerError: Codable
-{
-    var error: ALTServerError {
-        return ALTServerError(self.errorCode, userInfo: self.userInfo ?? [:])
-    }
-    
-    private var errorCode: ALTServerError.Code
-    private var userInfo: [String: Any]?
-    
-    private enum CodingKeys: String, CodingKey
-    {
-        case errorCode
-        case userInfo
-    }
-
-    init(error: ALTServerError)
-    {
-        self.errorCode = error.code
-        
-        var userInfo = error.userInfo
-        if let localizedRecoverySuggestion = (error as NSError).localizedRecoverySuggestion
-        {
-            userInfo[NSLocalizedRecoverySuggestionErrorKey] = localizedRecoverySuggestion
-        }
-        
-        if !userInfo.isEmpty
-        {
-            self.userInfo = userInfo
-        }
-    }
-    
-    init(from decoder: Decoder) throws
-    {
-        let container = try decoder.container(keyedBy: CodingKeys.self)
-        
-        let errorCode = try container.decode(Int.self, forKey: .errorCode)
-        self.errorCode = ALTServerError.Code(rawValue: errorCode) ?? .unknown
-        
-        let rawUserInfo = try container.decodeIfPresent([String: UserInfoValue].self, forKey: .userInfo)
-        
-        let userInfo = rawUserInfo?.mapValues { (value) -> Any in
-            switch value
-            {
-            case .string(let string): return string
-            case .error(let error): return error
-            }
-        }
-        self.userInfo = userInfo
-    }
-    
-    func encode(to encoder: Encoder) throws
-    {
-        var container = encoder.container(keyedBy: CodingKeys.self)
-        try container.encode(self.error.code.rawValue, forKey: .errorCode)
-        
-        let rawUserInfo = self.userInfo?.compactMapValues { (value) -> UserInfoValue? in
-            switch value
-            {
-            case let string as String: return .string(string)
-            case let error as NSError: return .error(error)
-            default: return nil
-            }
-        }
-        try container.encodeIfPresent(rawUserInfo, forKey: .userInfo)
-    }
-}
-
--- a/Protocol/ServerProtocol.swift
+++ b/Protocol/ServerProtocol.swift
@@ -197,20 +197,20 @@ public enum ServerResponse: Decodable
 // from easily changing response format for a request in the future.
 public struct ErrorResponse: ServerMessageProtocol
 {
-    public var version = 2
+    public var version = 3
    public var identifier = "ErrorResponse"
    
    public var error: ALTServerError {
-        return self.serverError?.error ?? ALTServerError(self.errorCode)
+        return self.serverError.map { ALTServerError($0.error) } ?? ALTServerError(self.errorCode)
    }
-    private var serverError: CodableServerError?
+    private var serverError: CodableError?
    
    // Legacy (v1)
    private var errorCode: ALTServerError.Code
    
    public init(error: ALTServerError)
    {
-        self.serverError = CodableServerError(error: error)
+        self.serverError = CodableError(error: error)
        self.errorCode = error.code
    }
 }
Author	SHA1	Message	Date
polymo1	bfb4a90fdd	legal: developer's certificate of origin 1.1 (#686 )	2024-09-07 14:23:16 -04:00
nythepegasus	d1b6bedc30	Attempt to fix sharing ipa files Yeah, yeah, I shouldn't commit to develop, I have a hunch though Signed-off-by: nythepegasus <me@nythepegas.us>	2024-09-02 08:19:28 -04:00
June Park	b78c75d829	[skip ci] Update bug_report.yml Signed-off-by: June Park <me@pythonplayer123.dev>	2024-08-20 17:53:50 +09:00
June	4518f07b5b	add entitlements	2024-08-19 11:14:42 +09:00
June Park	b4e18c50d3	Selective app extension removal (#677 )	2024-08-16 21:28:42 -04:00
June Park	d18482a04a	[no ci] Update pr.yml to cache builds Signed-off-by: June Park <me@pythonplayer123.dev>	2024-08-17 10:14:04 +09:00
June	f3d9dd777d	Make app extension popup less annoying by not showing when refreshing (it doesn't do anything anyway)	2024-08-17 00:16:55 +09:00
June Park	e117c4b9a3	Remove cache clear We don't need to do this anymore Signed-off-by: June Park <me@pythonplayer123.dev>	2024-08-16 15:41:02 +09:00
June	95666178e5	Fix certificate issues	2024-08-16 15:34:57 +09:00
June Park	56403466b9	[skip ci] add caches to stable.yml Signed-off-by: June Park <me@pythonplayer123.dev>	2024-08-16 14:32:25 +09:00
June Park	c7344ef548	[skip ci] add caches to beta Signed-off-by: June Park <me@pythonplayer123.dev>	2024-08-16 14:30:47 +09:00
June Park	71c4abfce8	Make caches not have workflow name Signed-off-by: June Park <me@pythonplayer123.dev>	2024-08-16 14:30:13 +09:00
nythepegasus	0613af2240	Bump SideStore Version to 0.5.8 For this current nightly track of commits until we "officially" release it Signed-off-by: nythepegasus <me@nythepegas.us>	2024-08-16 01:22:58 -04:00
J. Laymon	dd832ad6df	Better pairing file info (#676 ) makes the pop up give you a button to press for help rather than giving a plaintext url to a page that doesn't exist	2024-08-16 01:20:53 -04:00
June P	8cf7bc9998	[build] need to see if caching works	2024-08-16 13:40:04 +09:00
June	c1cf11c04c	Increase runtime performance	2024-08-16 13:32:35 +09:00
June Park	0058c40f46	Add incremental builds Signed-off-by: June Park <me@pythonplayer123.dev>	2024-08-16 13:17:07 +09:00
June	1397389f95	Make app extensions optional across the board	2024-08-16 12:58:06 +09:00
June Park	6a2d3e1d22	Delete AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved Signed-off-by: June Park <me@pythonplayer123.dev>	2024-08-15 22:13:19 +09:00
June	46ac704013	more descriptive machine names for generated certs	2024-08-15 22:09:16 +09:00
June Park	0fdab2a5c5	Makes revoking optional (#675 )	2024-08-14 20:08:37 -07:00
June Park	8f4586bfef	Add nightly.link description Signed-off-by: June Park <me@pythonplayer123.dev>	2024-08-15 12:00:39 +09:00
June	52d0c9861f	More descriptive errors	2024-08-15 11:21:50 +09:00
stossy11	feace61eb4	Fix SideJITServer Support for iOS 17+ (#674 ) * FIx SideJITServer Support * Fix SideJITServer Address * Add Warning when Overwriting SideJITServer Address * Fix Optional Value for SideJITServer URL * Update SideJITServer Address Overwriting * Fix Enabling JIT and Fix IP Address Loop * Fix No WiFi or VPN! error when using SideJITServer	2024-08-14 16:58:26 -07:00
June Park	1f5cc8f283	Make it so we don't flood altstore Signed-off-by: June Park <me@pythonplayer123.dev>	2024-08-14 21:34:22 +09:00
June Park	60b8520237	Add nightly.link support Pushing directly as this shouldn't mess anything other than CI up Signed-off-by: June Park <me@pythonplayer123.dev>	2024-08-14 21:14:27 +09:00
Stern	6a67c5e9a2	Merge pull request #673 from 0-Blu/develop Added more feedback options.	2024-08-13 14:48:17 -04:00
Stephen	bcc241518c	Update SettingsViewController.swift Signed-off-by: Stephen <158498287+0-Blu@users.noreply.github.com>	2024-08-13 14:15:31 -04:00
Stephen	6dfa8f1556	Update SettingsViewController.swift Signed-off-by: Stephen <158498287+0-Blu@users.noreply.github.com>	2024-08-12 22:30:15 -04:00
Stephen	19dde692b2	Added more feedback options. Signed-off-by: Stephen <158498287+0-Blu@users.noreply.github.com>	2024-08-12 19:21:59 -07:00
Stern	14dc93b5d2	Merge pull request #672 from 0-Blu/develop UI Improvements for the Anisette Servers View.	2024-08-12 20:46:44 -04:00
Stephen	547620235e	Update AnisetteServerList.swift Signed-off-by: Stephen <158498287+0-Blu@users.noreply.github.com>	2024-08-12 20:31:13 -04:00
Stephen	b43fd0a54b	Fixed Dark Mode for AnisetteServerList.swift Signed-off-by: Stephen <158498287+0-Blu@users.noreply.github.com>	2024-08-12 16:53:45 -04:00
Stephen	8b782c9416	Better AnisetteServerList.swift (NEEDS TESTING!!!!!!) Signed-off-by: Stephen <158498287+0-Blu@users.noreply.github.com>	2024-08-12 15:14:57 -04:00
nythepegasus	aab4e62e24	Bump SideStore version to 0.5.7 Signed-off-by: nythepegasus <nythepegasus84@gmail.com>	2024-08-05 21:44:59 -04:00
June Park	1713fccfc4	merge AltStore 1.6.3, add dynamic anisette lists, merge SideJITServer integration * Change error from Swift.Error to NSError * Adds ResultOperation.localizedFailure * Finish Riley's monster commit `3b38d725d7` May the Gods have mercy on my soul. * Fix format strings I broke * Include "Enable JIT" errors in Error Log * Fix minimuxer status checking * [skip ci] Update the no wifi message to include VPN * Opens Error Log when tapping ToastView * Fixes Error Log context menu covering cell content * Fixes Error Log context menu appearing while scrolling * Fixes incorrect Search FAQ URL * Fix Error Log showing UIAlertController on iOS 14+ * Fix Error Log not showing UIAlertController on iOS <=13 * Fix wrong color in AuthenticationViewController * Fix typo * Fixes logging non-AltServerErrors as AltServerError.underlyingError * Limits quitting other AltStore/SideStore processes to database migrations * Skips logging cancelled errors * Replaces StoreApp.latestVersion with latestSupportedVersion + latestAvailableVersion We now store the latest supported version as a relationship on StoreApp, rather than the latest available version. This allows us to reference the latest supported version in predicates and sort descriptors. However, we kept the underlying Core Data property name the same to avoid extra migration. * Conforms OperatingSystemVersion to Comparable * Parses AppVersion.minOSVersion/maxOSVersion from source JSON * Supports non-NSManagedObjects for @Managed properties This allows us to use @Managed with properties that may or may not be NSManagedObjects at runtime (e.g. protocols). If they are, Managed will keep strong reference to context like before. * Supports optional @Managed properties * Conforms AppVersion to AppProtocol * Verifies min/max OS version before downloading app + asks user to download older app version if necessary * Improves error message when file does not exist at AppVersion.downloadURL * Removes unnecessary StoreApp convenience properties * Removes unnecessary StoreApp convenience properties as well as fix other issues * Remove Settings bundle, add SwiftUI view instead Fix refresh all shortcut intent * Update AuthenticationOperation.swift Signed-off-by: June Park <rjp2030@outlook.com> * Fix build issues given by develop * Add availability check to fix CI build(?) * If it's gonna be that way... --------- Signed-off-by: June Park <rjp2030@outlook.com> Co-authored-by: nythepegasus <nythepegasus84@gmail.com> Co-authored-by: Riley Testut <riley@rileytestut.com> Co-authored-by: ny <me@nythepegas.us>	2024-08-05 21:43:52 -04:00
Stern	83ece72ae1	Merge pull request #658 from therealFoxster/develop Rename "AltStore" to "SideStore"	2024-07-19 18:50:32 -04:00
Foxster	d60bcc49e1	Rename "AltStore" to "SideStore"	2024-07-17 16:21:39 -07:00
bogotesr	bc9c37adda	Revert "improve UX on intro popup" This reverts commit `2583c7f617`.	2024-07-12 02:40:26 -07:00
bogotesr	2583c7f617	improve UX on intro popup fixes that the url for the pairing file info was out of date adds button for taking user to that page rather than just having a url in text	2024-07-12 02:37:06 -07:00
polymo1	fea5229e02	add(readme): discord badge	2024-07-07 20:07:36 -04:00
stossy11	68be615057	Add SideJITServer Support for Enabling JIT on iOS 17+ in app (#630 )	2024-06-16 16:43:25 -07:00
Stern	370cafcba0	Merge pull request #612 from stossy11/MyAnisette Add Stossy11 Anisette Server	2024-04-29 09:03:05 -04:00
stossy11	f923c1602e	Add Stossy11 Anisette Server	2024-04-29 23:01:07 +10:00