Enable building for connect branch.

Signed-off-by: Spidy123222 <64176728+Spidy123222@users.noreply.github.com>

.github/CODEOWNERS

@@ -1 +1 @@
-*       @JoeMatt @lonkelle
+*       @JoeMatt @lonkelle @nythepegasus @Spidy123222 @SternXD

.github/ISSUE_TEMPLATE/bug_report.yml

@@ -2,8 +2,7 @@ name: Bug Report
 description: Report a bug
 title: "[BUG] "
 labels: ["bug"]
-assignees:
+assignees: []
-  - naturecodevoid
 body:
   - type: markdown
     attributes:

.github/ISSUE_TEMPLATE/feature_request.yml

@@ -2,8 +2,7 @@ name: Feature Request
 description: Suggest a feature
 title: "[FEATURE REQUEST] "
 labels: ["enhancement"]
-assignees:
+assignees: []
-  - naturecodevoid
 body:
   - type: markdown
     attributes:

.github/workflows/nightly.yml

@@ -2,7 +2,7 @@ name: Nightly SideStore build
 on:
   push:
     branches:
-      - develop
+      - connect-develop
 
 jobs:
   build:

.gitmodules

@@ -9,7 +9,7 @@
 	url = https://github.com/libimobiledevice/libusbmuxd.git
 [submodule "Dependencies/libplist"]
 	path = Dependencies/libplist
-	url = https://github.com/libimobiledevice/libplist.git
+	url = https://github.com/SideStore/libplist.git
 [submodule "Dependencies/MarkdownAttributedString"]
 	path = Dependencies/MarkdownAttributedString
 	url = https://github.com/chockenberry/MarkdownAttributedString.git

AltBackup/Assets.xcassets/Background.colorset/Contents.json

@@ -5,9 +5,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "0.518",
+          "blue" : "175",
-          "green" : "0.502",
+          "green" : "4",
-          "red" : "0.004"
+          "red" : "115"
         }
       },
       "idiom" : "universal"
@@ -23,9 +23,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "0.404",
+          "blue" : "150",
-          "green" : "0.322",
+          "green" : "3",
-          "red" : "0.008"
+          "red" : "99"
         }
       },
       "idiom" : "universal"

AltStore.xcodeproj/project.pbxproj

@@ -8,13 +8,39 @@
 
 /* Begin PBXBuildFile section */
 		03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E314122A05D4C00370A3C /* Bundle+AltStore.swift */; };
+		0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0E1A1F902AE36A9600364CAD /* bytearray.c */; };
+		0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = 0E764E162ADFF5740043DD4E /* AltBackup.ipa */; };
+		0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166472ADFE0D1003015C1 /* out-limd.c */; };
+		0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166522ADFE0D2003015C1 /* out-default.c */; };
+		0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166552ADFE0D2003015C1 /* out-plutil.c */; };
+		0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166562ADFE0D2003015C1 /* oplist.c */; };
+		0EA166682ADFE122003015C1 /* jsmn.h in Headers */ = {isa = PBXBuildFile; fileRef = 0EA166632ADFE122003015C1 /* jsmn.h */; };
+		0EA166692ADFE140003015C1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166452ADFE0D1003015C1 /* Array.cpp */; };
+		0EA1666A2ADFE140003015C1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166492ADFE0D1003015C1 /* String.cpp */; };
+		0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */; };
+		0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166532ADFE0D2003015C1 /* Integer.cpp */; };
+		0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166432ADFE0D1003015C1 /* Data.cpp */; };
+		0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166512ADFE0D2003015C1 /* ptrarray.c */; };
+		0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664F2ADFE0D1003015C1 /* hashtable.c */; };
+		0EA166702ADFE140003015C1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166502ADFE0D2003015C1 /* Node.cpp */; };
+		0EA166712ADFE140003015C1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166582ADFE0D2003015C1 /* Key.cpp */; };
+		0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166462ADFE0D1003015C1 /* Dictionary.cpp */; };
+		0EA166742ADFE140003015C1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166422ADFE0D1003015C1 /* Date.cpp */; };
+		0EA166752ADFE140003015C1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166542ADFE0D2003015C1 /* Real.cpp */; };
+		0EA166762ADFE140003015C1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664A2ADFE0D1003015C1 /* base64.c */; };
+		0EA166772ADFE140003015C1 /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166412ADFE0D1003015C1 /* jplist.c */; };
+		0EA166782ADFE140003015C1 /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166572ADFE0D2003015C1 /* jsmn.c */; };
+		0EA166792ADFE140003015C1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166442ADFE0D1003015C1 /* bplist.c */; };
+		0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664B2ADFE0D1003015C1 /* Uid.cpp */; };
+		0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1665A2ADFE0D2003015C1 /* Structure.cpp */; };
+		0EA1667D2ADFE140003015C1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166592ADFE0D2003015C1 /* xplist.c */; };
+		0EA1667E2ADFE140003015C1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664C2ADFE0D1003015C1 /* time64.c */; };
+		0EA4B9BC2AE4A414009209CE /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA4B9BB2AE4A3F6009209CE /* plist.c */; };
 		19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */ = {isa = PBXBuildFile; fileRef = BF45872B2298D31600BD7491 /* libimobiledevice.a */; };
 		19104DB52909C06D00C49C7B /* EmotionalDamage.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19104DB42909C06D00C49C7B /* EmotionalDamage.swift */; };
 		19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DB22909C06C00C49C7B /* libEmotionalDamage.a */; };
 		191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FAB290A5D92001A3B7C /* libminimuxer.a */; };
 		191E5FDC290AFA5C001A3B7C /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 191E5FDB290AFA5C001A3B7C /* OpenSSL */; };
-		191E607D290B2EA5001A3B7C /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FD0290A651D001A3B7C /* jsmn.c */; };
-		191E607E290B2EA7001A3B7C /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FCF290A651D001A3B7C /* jplist.c */; };
 		1920B04F2924AC8300744F60 /* Settings.bundle in Resources */ = {isa = PBXBuildFile; fileRef = 1920B04E2924AC8300744F60 /* Settings.bundle */; };
 		19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */; };
 		4879A95F2861046500FC1BBD /* AltSign in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A95E2861046500FC1BBD /* AltSign */; };
@@ -25,7 +51,6 @@
 		99F87D1829D8E4C900B40039 /* SwiftBridgeCore.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1629D8E4C900B40039 /* SwiftBridgeCore.swift */; };
 		99F87D1929D8E4C900B40039 /* minimuxer.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1729D8E4C900B40039 /* minimuxer.swift */; };
 		B3146ED2284F581E00BBC3FD /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; };
-		B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; settings = {ATTRIBUTES = (CodeSignOnCopy, RemoveHeadersOnCopy, ); }; };
 		B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F894295F7F9B002B1159 /* libfragmentzip.a */; };
 		B33FFBAA295F8F78002259E6 /* preboard.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBA9295F8F78002259E6 /* preboard.c */; };
 		B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBAB295F8F98002259E6 /* companion_proxy.c */; };
@@ -74,7 +99,6 @@
 		BF41B808233433C100C593A3 /* LoadingState.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF41B807233433C100C593A3 /* LoadingState.swift */; };
 		BF42345A25101C35006D1EB2 /* WidgetView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF42345825101C1D006D1EB2 /* WidgetView.swift */; };
 		BF44EEF0246B08BA002A52F2 /* BackupController.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEEF246B08BA002A52F2 /* BackupController.swift */; };
-		BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */; };
 		BF44EEFC246B4550002A52F2 /* RemoveAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */; };
 		BF4587F82298D3AB00BD7491 /* service.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4587C82298D3A800BD7491 /* service.h */; };
 		BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587C92298D3A800BD7491 /* diagnostics_relay.c */; };
@@ -254,34 +278,6 @@
 		BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = BFD247782284B9A700981D42 /* LaunchScreen.storyboard */; };
 		BFD2478C2284C4C300981D42 /* AppIconImageView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478B2284C4C300981D42 /* AppIconImageView.swift */; };
 		BFD2478F2284C8F900981D42 /* Button.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478E2284C8F900981D42 /* Button.swift */; };
-		BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */; };
-		BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE622A1A9CA000B7ED1 /* base64.c */; };
-		BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE722A1A9CA000B7ED1 /* hashtable.c */; };
-		BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */; };
-		BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */; };
-		BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEA22A1A9CA000B7ED1 /* bplist.c */; };
-		BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEB22A1A9CA000B7ED1 /* String.cpp */; };
-		BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEC22A1A9CA000B7ED1 /* time64.c */; };
-		BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BED22A1A9CA000B7ED1 /* plist.h */; };
-		BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEE22A1A9CA000B7ED1 /* plist.c */; };
-		BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */; };
-		BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF022A1A9CA000B7ED1 /* Date.cpp */; };
-		BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */; };
-		BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */; };
-		BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF322A1A9CA000B7ED1 /* Real.cpp */; };
-		BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF422A1A9CA000B7ED1 /* strbuf.h */; };
-		BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF522A1A9CA000B7ED1 /* bytearray.c */; };
-		BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF622A1A9CA000B7ED1 /* base64.h */; };
-		BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF722A1A9CA000B7ED1 /* Data.cpp */; };
-		BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF822A1A9CB000B7ED1 /* Array.cpp */; };
-		BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF922A1A9CB000B7ED1 /* Node.cpp */; };
-		BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */; };
-		BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */; };
-		BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */; };
-		BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */; };
-		BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */; };
-		BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFF22A1A9CB000B7ED1 /* time64.h */; };
-		BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C0022A1A9CB000B7ED1 /* xplist.c */; };
 		BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1D22A1A9EC000B7ED1 /* node.c */; };
 		BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1E22A1A9EC000B7ED1 /* node_list.c */; };
 		BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1F22A1A9EC000B7ED1 /* cnary.c */; };
@@ -336,6 +332,7 @@
 		D57FE84428C7DB7100216002 /* ErrorLogViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */; };
 		D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = D58916FD28C7C55C00E39C8B /* LoggedError.swift */; };
 		D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D593F1932717749A006E82DE /* PatchAppOperation.swift */; };
+		D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */; };
 		D5CA0C4B280E141900469595 /* ManagedPatron.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4A280E141900469595 /* ManagedPatron.swift */; };
 		D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */; };
 		D5DAE0942804B0B80034D8D4 /* ScreenshotProcessor.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5DAE0932804B0B80034D8D4 /* ScreenshotProcessor.swift */; };
@@ -482,7 +479,6 @@
 			dstPath = "";
 			dstSubfolderSpec = 10;
 			files = (
-				B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */,
 				BF1614F2250822F100767AEA /* Roxas.framework in Embed Frameworks */,
 				BF66EE862501AE50007EE018 /* AltStoreCore.framework in Embed Frameworks */,
 			);
@@ -503,12 +499,45 @@
 /* End PBXCopyFilesBuildPhase section */
 
 /* Begin PBXFileReference section */
+		0E1A1F902AE36A9600364CAD /* bytearray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = src/bytearray.c; sourceTree = "<group>"; };
+		0E764E162ADFF5740043DD4E /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; name = AltBackup.ipa; path = AltStore/Resources/AltBackup.ipa; sourceTree = SOURCE_ROOT; };
+		0EA166412ADFE0D1003015C1 /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166422ADFE0D1003015C1 /* Date.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166432ADFE0D1003015C1 /* Data.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166442ADFE0D1003015C1 /* bplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166452ADFE0D1003015C1 /* Array.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166462ADFE0D1003015C1 /* Dictionary.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166472ADFE0D1003015C1 /* out-limd.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-limd.c"; path = "Dependencies/libplist/src/out-limd.c"; sourceTree = SOURCE_ROOT; };
+		0EA166492ADFE0D1003015C1 /* String.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664A2ADFE0D1003015C1 /* base64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
+		0EA1664B2ADFE0D1003015C1 /* Uid.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664C2ADFE0D1003015C1 /* time64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
+		0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664F2ADFE0D1003015C1 /* hashtable.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
+		0EA166502ADFE0D2003015C1 /* Node.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166512ADFE0D2003015C1 /* ptrarray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
+		0EA166522ADFE0D2003015C1 /* out-default.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-default.c"; path = "Dependencies/libplist/src/out-default.c"; sourceTree = SOURCE_ROOT; };
+		0EA166532ADFE0D2003015C1 /* Integer.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166542ADFE0D2003015C1 /* Real.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166552ADFE0D2003015C1 /* out-plutil.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-plutil.c"; path = "Dependencies/libplist/src/out-plutil.c"; sourceTree = SOURCE_ROOT; };
+		0EA166562ADFE0D2003015C1 /* oplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = oplist.c; path = Dependencies/libplist/src/oplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166572ADFE0D2003015C1 /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
+		0EA166582ADFE0D2003015C1 /* Key.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166592ADFE0D2003015C1 /* xplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
+		0EA1665A2ADFE0D2003015C1 /* Structure.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1665F2ADFE122003015C1 /* time64_limits.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
+		0EA166602ADFE122003015C1 /* time64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
+		0EA166612ADFE122003015C1 /* bytearray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
+		0EA166622ADFE122003015C1 /* ptrarray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
+		0EA166632ADFE122003015C1 /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
+		0EA166642ADFE122003015C1 /* plist.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
+		0EA166652ADFE122003015C1 /* hashtable.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
+		0EA166662ADFE122003015C1 /* base64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
+		0EA166672ADFE122003015C1 /* strbuf.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
+		0EA4B9BB2AE4A3F6009209CE /* plist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
 		19104DB22909C06C00C49C7B /* libEmotionalDamage.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libEmotionalDamage.a; sourceTree = BUILT_PRODUCTS_DIR; };
 		19104DB42909C06D00C49C7B /* EmotionalDamage.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EmotionalDamage.swift; sourceTree = "<group>"; };
 		191E5FAB290A5D92001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer.a; sourceTree = BUILT_PRODUCTS_DIR; };
-		191E5FCF290A651D001A3B7C /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
-		191E5FD0290A651D001A3B7C /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
-		191E5FD1290A651D001A3B7C /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
 		1920B04E2924AC8300744F60 /* Settings.bundle */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.plug-in"; path = Settings.bundle; sourceTree = "<group>"; };
 		19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SelectTeamViewController.swift; sourceTree = "<group>"; };
 		9961EC2D29BE9F2E00AF2C6F /* minimuxer-helpers.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; name = "minimuxer-helpers.swift"; path = "Dependencies/minimuxer/minimuxer-helpers.swift"; sourceTree = SOURCE_ROOT; };
@@ -573,7 +602,6 @@
 		BF41B807233433C100C593A3 /* LoadingState.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoadingState.swift; sourceTree = "<group>"; };
 		BF42345825101C1D006D1EB2 /* WidgetView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = WidgetView.swift; sourceTree = "<group>"; };
 		BF44EEEF246B08BA002A52F2 /* BackupController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = BackupController.swift; sourceTree = "<group>"; };
-		BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; path = AltBackup.ipa; sourceTree = "<group>"; };
 		BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RemoveAppOperation.swift; sourceTree = "<group>"; };
 		BF45872B2298D31600BD7491 /* libimobiledevice.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libimobiledevice.a; sourceTree = BUILT_PRODUCTS_DIR; };
 		BF4587C82298D3A800BD7491 /* service.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = service.h; path = Dependencies/libimobiledevice/src/service.h; sourceTree = SOURCE_ROOT; };
@@ -759,34 +787,6 @@
 		BFD2479E2284FBD000981D42 /* UIColor+AltStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "UIColor+AltStore.swift"; sourceTree = "<group>"; };
 		BFD44605241188C300EAB90A /* CodableServerError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = CodableServerError.swift; sourceTree = "<group>"; };
 		BFD52BD222A06EFB000B7ED1 /* ALTConstants.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTConstants.h; sourceTree = "<group>"; };
-		BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE622A1A9CA000B7ED1 /* base64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE722A1A9CA000B7ED1 /* hashtable.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
-		BFD52BEA22A1A9CA000B7ED1 /* bplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
-		BFD52BEB22A1A9CA000B7ED1 /* String.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BEC22A1A9CA000B7ED1 /* time64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
-		BFD52BED22A1A9CA000B7ED1 /* plist.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
-		BFD52BEE22A1A9CA000B7ED1 /* plist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
-		BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF022A1A9CA000B7ED1 /* Date.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF322A1A9CA000B7ED1 /* Real.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF422A1A9CA000B7ED1 /* strbuf.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF522A1A9CA000B7ED1 /* bytearray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = Dependencies/libplist/src/bytearray.c; sourceTree = SOURCE_ROOT; };
-		BFD52BF622A1A9CA000B7ED1 /* base64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF722A1A9CA000B7ED1 /* Data.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF822A1A9CB000B7ED1 /* Array.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF922A1A9CB000B7ED1 /* Node.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
-		BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
-		BFD52BFF22A1A9CB000B7ED1 /* time64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
-		BFD52C0022A1A9CB000B7ED1 /* xplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1D22A1A9EC000B7ED1 /* node.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node.c; path = Dependencies/libplist/libcnary/node.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1E22A1A9EC000B7ED1 /* node_list.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node_list.c; path = Dependencies/libplist/libcnary/node_list.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1F22A1A9EC000B7ED1 /* cnary.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = cnary.c; path = Dependencies/libplist/libcnary/cnary.c; sourceTree = SOURCE_ROOT; };
@@ -840,6 +840,7 @@
 		D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorLogViewController.swift; sourceTree = "<group>"; };
 		D58916FD28C7C55C00E39C8B /* LoggedError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoggedError.swift; sourceTree = "<group>"; };
 		D593F1932717749A006E82DE /* PatchAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchAppOperation.swift; sourceTree = "<group>"; };
+		D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ClearAppCacheOperation.swift; sourceTree = "<group>"; };
 		D5CA0C4A280E141900469595 /* ManagedPatron.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ManagedPatron.swift; sourceTree = "<group>"; };
 		D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 10.xcdatamodel"; sourceTree = "<group>"; };
 		D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcmappingmodel; path = AltStore9ToAltStore10.xcmappingmodel; sourceTree = "<group>"; };
@@ -1192,37 +1193,41 @@
 		BF4588562298DC6D00BD7491 /* libplist */ = {
 			isa = PBXGroup;
 			children = (
-				BFD52BE622A1A9CA000B7ED1 /* base64.c */,
+				0EA166462ADFE0D1003015C1 /* Dictionary.cpp */,
-				BFD52BEA22A1A9CA000B7ED1 /* bplist.c */,
+				0E1A1F902AE36A9600364CAD /* bytearray.c */,
-				BFD52BF522A1A9CA000B7ED1 /* bytearray.c */,
+				0EA166442ADFE0D1003015C1 /* bplist.c */,
-				BFD52BE722A1A9CA000B7ED1 /* hashtable.c */,
+				0EA166432ADFE0D1003015C1 /* Data.cpp */,
-				191E5FCF290A651D001A3B7C /* jplist.c */,
+				0EA166422ADFE0D1003015C1 /* Date.cpp */,
-				191E5FD0290A651D001A3B7C /* jsmn.c */,
+				0EA1664F2ADFE0D1003015C1 /* hashtable.c */,
-				BFD52BEE22A1A9CA000B7ED1 /* plist.c */,
+				0EA166532ADFE0D2003015C1 /* Integer.cpp */,
-				BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */,
+				0EA166562ADFE0D2003015C1 /* oplist.c */,
-				BFD52BEC22A1A9CA000B7ED1 /* time64.c */,
+				0EA166522ADFE0D2003015C1 /* out-default.c */,
-				BFD52C0022A1A9CB000B7ED1 /* xplist.c */,
+				0EA166472ADFE0D1003015C1 /* out-limd.c */,
-				BFD52BF822A1A9CB000B7ED1 /* Array.cpp */,
+				0EA166552ADFE0D2003015C1 /* out-plutil.c */,
-				BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */,
+				0EA166492ADFE0D1003015C1 /* String.cpp */,
-				BFD52BF722A1A9CA000B7ED1 /* Data.cpp */,
+				0EA1665A2ADFE0D2003015C1 /* Structure.cpp */,
-				BFD52BF022A1A9CA000B7ED1 /* Date.cpp */,
+				0EA166452ADFE0D1003015C1 /* Array.cpp */,
-				BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */,
+				0EA1664A2ADFE0D1003015C1 /* base64.c */,
-				BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */,
+				0EA166572ADFE0D2003015C1 /* jsmn.c */,
-				BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */,
+				0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */,
-				BFD52BF922A1A9CB000B7ED1 /* Node.cpp */,
+				0EA4B9BB2AE4A3F6009209CE /* plist.c */,
-				BFD52BF322A1A9CA000B7ED1 /* Real.cpp */,
+				0EA166412ADFE0D1003015C1 /* jplist.c */,
-				BFD52BEB22A1A9CA000B7ED1 /* String.cpp */,
+				0EA166582ADFE0D2003015C1 /* Key.cpp */,
-				BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */,
+				0EA166512ADFE0D2003015C1 /* ptrarray.c */,
-				BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */,
+				0EA1664C2ADFE0D1003015C1 /* time64.c */,
-				BFD52BF622A1A9CA000B7ED1 /* base64.h */,
+				0EA166502ADFE0D2003015C1 /* Node.cpp */,
-				BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */,
+				0EA166542ADFE0D2003015C1 /* Real.cpp */,
-				BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */,
+				0EA1664B2ADFE0D1003015C1 /* Uid.cpp */,
-				191E5FD1290A651D001A3B7C /* jsmn.h */,
+				0EA166592ADFE0D2003015C1 /* xplist.c */,
-				BFD52BED22A1A9CA000B7ED1 /* plist.h */,
+				0EA166662ADFE122003015C1 /* base64.h */,
-				BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */,
+				0EA166652ADFE122003015C1 /* hashtable.h */,
-				BFD52BF422A1A9CA000B7ED1 /* strbuf.h */,
+				0EA166632ADFE122003015C1 /* jsmn.h */,
-				BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */,
+				0EA166642ADFE122003015C1 /* plist.h */,
-				BFD52BFF22A1A9CB000B7ED1 /* time64.h */,
+				0EA166612ADFE122003015C1 /* bytearray.h */,
+				0EA166622ADFE122003015C1 /* ptrarray.h */,
+				0EA166672ADFE122003015C1 /* strbuf.h */,
+				0EA1665F2ADFE122003015C1 /* time64_limits.h */,
+				0EA166602ADFE122003015C1 /* time64.h */,
 				BF4588892298DDEA00BD7491 /* libcnary */,
 			);
 			path = libplist;
@@ -1619,7 +1624,7 @@
 		BFD247962284D7C100981D42 /* Resources */ = {
 			isa = PBXGroup;
 			children = (
-				BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */,
+				0E764E162ADFF5740043DD4E /* AltBackup.ipa */,
 				BFD247762284B9A700981D42 /* Assets.xcassets */,
 				BF770E6822BD57DD002A40FE /* Silence.m4a */,
 			);
@@ -1694,6 +1699,7 @@
 				D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */,
 				D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */,
 				D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */,
+				D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */,
 				BF7B44062725A4B8005288A4 /* Patch App */,
 			);
 			path = Operations;
@@ -1780,32 +1786,26 @@
 			isa = PBXHeadersBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				0EA166682ADFE122003015C1 /* jsmn.h in Headers */,
 				BF4588112298D3AB00BD7491 /* misagent.h in Headers */,
 				BF4588042298D3AB00BD7491 /* lockdown.h in Headers */,
 				BF45880B2298D3AB00BD7491 /* mobilesync.h in Headers */,
 				BF4588002298D3AB00BD7491 /* restore.h in Headers */,
 				BF4588152298D3AB00BD7491 /* mobilebackup.h in Headers */,
 				BF4588182298D3AB00BD7491 /* syslog_relay.h in Headers */,
-				BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */,
 				BF45881D2298D3AB00BD7491 /* file_relay.h in Headers */,
-				BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */,
 				BF4587FD2298D3AB00BD7491 /* sbservices.h in Headers */,
 				BF4588362298D3C100BD7491 /* debug.h in Headers */,
 				BF4588202298D3AB00BD7491 /* mobile_image_mounter.h in Headers */,
 				BF4588122298D3AB00BD7491 /* house_arrest.h in Headers */,
 				BF45881F2298D3AB00BD7491 /* device_link_service.h in Headers */,
-				BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */,
 				BF45880E2298D3AB00BD7491 /* debugserver.h in Headers */,
 				BF4588102298D3AB00BD7491 /* heartbeat.h in Headers */,
 				BF4587FA2298D3AB00BD7491 /* diagnostics_relay.h in Headers */,
-				BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */,
-				BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */,
 				BF4588192298D3AB00BD7491 /* webinspector.h in Headers */,
 				BF4588342298D3C100BD7491 /* userpref.h in Headers */,
 				BF45880A2298D3AB00BD7491 /* screenshotr.h in Headers */,
-				BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */,
 				BF4587FE2298D3AB00BD7491 /* mobilebackup2.h in Headers */,
-				BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */,
 				BF45881C2298D3AB00BD7491 /* afc.h in Headers */,
 				BF45881A2298D3AB00BD7491 /* mobileactivation.h in Headers */,
 				BF4588052298D3AB00BD7491 /* idevice.h in Headers */,
@@ -1813,7 +1813,6 @@
 				BF4587F82298D3AB00BD7491 /* service.h in Headers */,
 				BF4588252298D3AB00BD7491 /* property_list_service.h in Headers */,
 				BF4588132298D3AB00BD7491 /* notification_proxy.h in Headers */,
-				BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -2209,7 +2208,6 @@
 				BFE60738231ADF49002B0E8E /* Settings.storyboard in Resources */,
 				D57DF638271E32F000677701 /* PatchApp.storyboard in Resources */,
 				BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */,
-				BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */,
 				BF770E6922BD57DD002A40FE /* Silence.m4a in Resources */,
 				BFD247772284B9A700981D42 /* Assets.xcassets in Resources */,
 				1920B04F2924AC8300744F60 /* Settings.bundle in Resources */,
@@ -2217,6 +2215,7 @@
 				BFB6B22423187A3D0022A802 /* NewsCollectionViewCell.xib in Resources */,
 				BFD247752284B9A500981D42 /* Main.storyboard in Resources */,
 				BFDB5B2622EFBBEA00F74113 /* BrowseCollectionViewCell.xib in Resources */,
+				0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */,
 				BFE6073C231AE1E7002B0E8E /* SettingsHeaderFooterView.xib in Resources */,
 				BF29012F2318F6B100D88A45 /* AppBannerView.xib in Resources */,
 				BFE6325A22A83BEB00F30809 /* Authentication.storyboard in Resources */,
@@ -2292,69 +2291,73 @@
 			isa = PBXSourcesBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */,
+				0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */,
+				0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */,
+				0EA166742ADFE140003015C1 /* Date.cpp in Sources */,
+				0EA166712ADFE140003015C1 /* Key.cpp in Sources */,
+				0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */,
+				0EA1666A2ADFE140003015C1 /* String.cpp in Sources */,
+				0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */,
+				0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */,
+				0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */,
+				0EA166702ADFE140003015C1 /* Node.cpp in Sources */,
+				0EA166752ADFE140003015C1 /* Real.cpp in Sources */,
+				0EA166762ADFE140003015C1 /* base64.c in Sources */,
+				0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */,
 				BF45881B2298D3AB00BD7491 /* house_arrest.c in Sources */,
-				BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */,
+				0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */,
 				BF4588232298D3AB00BD7491 /* mobilesync.c in Sources */,
 				BF4588072298D3AB00BD7491 /* afc.c in Sources */,
-				191E607D290B2EA5001A3B7C /* jsmn.c in Sources */,
-				191E607E290B2EA7001A3B7C /* jplist.c in Sources */,
 				BF4588082298D3AB00BD7491 /* mobile_image_mounter.c in Sources */,
-				BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */,
 				BF4588022298D3AB00BD7491 /* file_relay.c in Sources */,
 				BF45880F2298D3AB00BD7491 /* debugserver.c in Sources */,
+				0EA166792ADFE140003015C1 /* bplist.c in Sources */,
+				0EA166772ADFE140003015C1 /* jplist.c in Sources */,
 				BF4588162298D3AB00BD7491 /* restore.c in Sources */,
-				BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */,
-				BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */,
 				BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */,
 				BF4588092298D3AB00BD7491 /* installation_proxy.c in Sources */,
+				0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */,
+				0EA1667E2ADFE140003015C1 /* time64.c in Sources */,
 				BF4587FF2298D3AB00BD7491 /* heartbeat.c in Sources */,
 				BF4588222298D3AB00BD7491 /* mobileactivation.c in Sources */,
-				BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */,
 				BF4588212298D3AB00BD7491 /* idevice.c in Sources */,
 				B343F885295F7C5D002B1159 /* tlv.c in Sources */,
-				BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */,
 				BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */,
 				B343F87D295F7C5D002B1159 /* cbuf.c in Sources */,
 				BF4588062298D3AB00BD7491 /* webinspector.c in Sources */,
-				BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */,
 				B343F883295F7C5D002B1159 /* thread.c in Sources */,
 				BF45880D2298D3AB00BD7491 /* mobilebackup.c in Sources */,
-				BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */,
-				BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */,
-				BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */,
 				BF45883A2298D3C100BD7491 /* debug.c in Sources */,
 				B343F881295F7C5D002B1159 /* termcolors.c in Sources */,
+				0EA1667D2ADFE140003015C1 /* xplist.c in Sources */,
 				B343F87E295F7C5D002B1159 /* collection.c in Sources */,
-				BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */,
 				B33FFBAA295F8F78002259E6 /* preboard.c in Sources */,
 				B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */,
 				BF4587FB2298D3AB00BD7491 /* notification_proxy.c in Sources */,
 				BF4588352298D3C100BD7491 /* userpref.c in Sources */,
-				BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */,
+				0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */,
 				B343F87C295F7C5D002B1159 /* opack.c in Sources */,
-				BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */,
-				BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */,
 				B343F884295F7C5D002B1159 /* utils.c in Sources */,
 				BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */,
 				B343F87F295F7C5D002B1159 /* glue.c in Sources */,
-				BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */,
 				BF4588242298D3AB00BD7491 /* property_list_service.c in Sources */,
 				BF45881E2298D3AB00BD7491 /* misagent.c in Sources */,
+				0EA166692ADFE140003015C1 /* Array.cpp in Sources */,
 				B343F880295F7C5D002B1159 /* socket.c in Sources */,
 				BF4587FC2298D3AB00BD7491 /* sbservices.c in Sources */,
-				BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */,
+				0EA166782ADFE140003015C1 /* jsmn.c in Sources */,
 				BF4588142298D3AB00BD7491 /* device_link_service.c in Sources */,
 				BF4588172298D3AB00BD7491 /* screenshotr.c in Sources */,
-				BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */,
-				BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */,
 				BF4588432298D40000BD7491 /* libusbmuxd.c in Sources */,
+				0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */,
+				0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */,
 				BF4588032298D3AB00BD7491 /* syslog_relay.c in Sources */,
 				BF4588272298D3AB00BD7491 /* service.c in Sources */,
-				BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */,
 				BF4588262298D3AB00BD7491 /* lockdown.c in Sources */,
 				BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */,
 				BF45880C2298D3AB00BD7491 /* mobilebackup2.c in Sources */,
-				BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */,
+				0EA4B9BC2AE4A414009209CE /* plist.c in Sources */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -2504,6 +2507,7 @@
 				BFD6B03322DFF20800B86064 /* MyAppsComponents.swift in Sources */,
 				BF41B808233433C100C593A3 /* LoadingState.swift in Sources */,
 				BFF0B69A2322D7D0007A79E1 /* UIScreen+CompactHeight.swift in Sources */,
+				D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */,
 				D5F2F6A92720B7C20081CCF5 /* PatchViewController.swift in Sources */,
 				B39F16132918D7C5002E9404 /* Consts.swift in Sources */,
 				BF8F69C222E659F700049BA1 /* AppContentViewController.swift in Sources */,
@@ -3224,6 +3228,7 @@
 					"$(PROJECT_DIR)/Dependencies/libfragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
 				);
+				OTHER_LDFLAGS = "";
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
@@ -3258,6 +3263,7 @@
 					"$(PROJECT_DIR)/Dependencies/libfragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
 				);
+				OTHER_LDFLAGS = "";
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";

AltStore/App IDs/AppIDsViewController.swift

@@ -90,14 +90,21 @@ private extension AppIDsViewController
                 cell.bannerView.button.isUserInteractionEnabled = false
                 
                 cell.bannerView.buttonLabel.isHidden = false
-                
+
                 let currentDate = Date()
                 
-                let numberOfDays = expirationDate.numberOfCalendarDays(since: currentDate)
+                let formatter = DateComponentsFormatter()
-                let numberOfDaysText = (numberOfDays == 1) ? NSLocalizedString("1 day", comment: "") : String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
+                formatter.unitsStyle = .full
-                cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
+                formatter.includesApproximationPhrase = false
+                formatter.includesTimeRemainingPhrase = false
+                formatter.allowedUnits = [.minute, .hour, .day]
+                formatter.maximumUnitCount = 1
                 
-                attributedAccessibilityLabel.mutableString.append(String(format: NSLocalizedString("Expires in %@.", comment: ""), numberOfDaysText) + " ")
+                cell.bannerView.button.setTitle((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")).uppercased(), for: .normal)
+                
+                // formatter.includesTimeRemainingPhrase = true
+                
+                // attributedAccessibilityLabel.mutableString.append((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " ")
             }
             else
             {

AltStore/Browse/BrowseViewController.swift

@@ -8,6 +8,7 @@
 
 import UIKit
 
+import minimuxer
 import AltStoreCore
 import Roxas
 
@@ -264,7 +265,13 @@ private extension BrowseViewController
             previousProgress?.cancel()
             return
         }
-        
+
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         _ = AppManager.shared.install(app, presentingViewController: self) { (result) in
             DispatchQueue.main.async {
                 switch result

AltStore/LaunchViewController.swift

@@ -81,7 +81,7 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
         } else {
             // Show an alert explaining the pairing file
             // Create new Alert
-            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/install#pairing-process", preferredStyle: .alert)
+            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/getting-started/#pairing-file", preferredStyle: .alert)
             
             // Create OK button with action handler
             let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
@@ -155,7 +155,12 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
             try! FileManager.default.removeItem(at: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)"))
             displayError("minimuxer failed to start, please restart SideStore. \((error as? LocalizedError)?.failureReason ?? "UNKNOWN ERROR!!!!!! REPORT TO GITHUB ISSUES!")")
         }
-        start_auto_mounter(documentsDirectory)
+        if #available(iOS 17, *) {
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
+        }
     }
 }
 

AltStore/Managing Apps/AppManager.swift

@@ -307,6 +307,16 @@ extension AppManager
             presentingViewController.present(alertController, animated: true, completion: nil)
         }
     }
+    
+    func clearAppCache(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let clearAppCacheOperation = ClearAppCacheOperation()
+        clearAppCacheOperation.resultHandler = { result in
+            completion(result)
+        }
+        
+        self.run([clearAppCacheOperation], context: nil)
+    }
 }
 
 extension AppManager
@@ -754,6 +764,12 @@ extension AppManager
         let progress = self.refreshProgress[app.bundleIdentifier]
         return progress
     }
+    
+    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
+    {
+        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
+        return isActivelyManaging
+    }
 }
 
 extension AppManager
@@ -808,12 +824,6 @@ private extension AppManager
         }
     }
     
-    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
-    {
-        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
-        return isActivelyManaging
-    }
-    
     @discardableResult
     private func perform(_ operations: [AppOperation], presentingViewController: UIViewController?, group: RefreshGroup) -> RefreshGroup
     {
@@ -948,7 +958,13 @@ private extension AppManager
         }
         else
         {
+            DispatchQueue.main.schedule {
+                UIApplication.shared.isIdleTimerDisabled = UserDefaults.standard.isIdleTimeoutDisableEnabled
+            }
             performAppOperations()
+            DispatchQueue.main.schedule {
+                UIApplication.shared.isIdleTimerDisabled = false
+            }
         }
         
         return group
@@ -1027,6 +1043,32 @@ private extension AppManager
         verifyOperation.addDependency(downloadOperation)
         
         
+        /* Refresh Anisette Data */
+        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
+        refreshAnisetteDataOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
+            }
+        }
+        refreshAnisetteDataOperation.addDependency(verifyOperation)
+
+
+        /* Fetch Provisioning Profiles */
+        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
+        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
+        fetchProvisioningProfilesOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
+            }
+        }
+        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
+        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
+
+
         /* Deactivate Apps (if necessary) */
         let deactivateAppsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
             do
@@ -1042,6 +1084,12 @@ private extension AppManager
                 {
                     throw error
                 }
+                
+                guard let profiles = context.provisioningProfiles else { throw OperationError.invalidParameters }
+                if !profiles.contains(where: { $1.isFreeProvisioningProfile == true }) {
+                    operation.finish()
+                    return
+                }
                                 
                 guard let app = context.app, let presentingViewController = context.authenticatedContext.presentingViewController else { throw OperationError.invalidParameters }
                 
@@ -1061,7 +1109,7 @@ private extension AppManager
                 operation.finish()
             }
         }
-        deactivateAppsOperation.addDependency(verifyOperation)
+        deactivateAppsOperation.addDependency(fetchProvisioningProfilesOperation)
         
         
         /* Patch App */
@@ -1136,32 +1184,6 @@ private extension AppManager
         patchAppOperation.addDependency(deactivateAppsOperation)
         
         
-        /* Refresh Anisette Data */
-        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
-        refreshAnisetteDataOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
-            }
-        }
-        refreshAnisetteDataOperation.addDependency(patchAppOperation)
-        
-        
-        /* Fetch Provisioning Profiles */
-        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
-        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
-        fetchProvisioningProfilesOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
-            }
-        }
-        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
-        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
-        
-        
         /* Resign */
         let resignAppOperation = ResignAppOperation(context: context)
         resignAppOperation.resultHandler = { (result) in
@@ -1171,7 +1193,7 @@ private extension AppManager
             case .success(let resignedApp): context.resignedApp = resignedApp
             }
         }
-        resignAppOperation.addDependency(fetchProvisioningProfilesOperation)
+        resignAppOperation.addDependency(patchAppOperation)
         progress.addChild(resignAppOperation.progress, withPendingUnitCount: 20)
         
         
@@ -1214,7 +1236,7 @@ private extension AppManager
         progress.addChild(installOperation.progress, withPendingUnitCount: 30)
         installOperation.addDependency(sendAppOperation)
         
-        let operations = [downloadOperation, verifyOperation, deactivateAppsOperation, patchAppOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, resignAppOperation, sendAppOperation, installOperation]
+        let operations = [downloadOperation, verifyOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, deactivateAppsOperation, patchAppOperation, resignAppOperation, sendAppOperation, installOperation]
         group.add(operations)
         self.run(operations, context: group.context)
         

AltStore/My Apps/MyAppsViewController.swift

@@ -15,6 +15,7 @@ import UniformTypeIdentifiers
 import AltStoreCore
 import AltSign
 import Roxas
+import minimuxer
 
 import Nuke
 
@@ -328,21 +329,25 @@ private extension MyAppsViewController
             let currentDate = Date()
             
             let numberOfDays = installedApp.expirationDate.numberOfCalendarDays(since: currentDate)
-            let numberOfDaysText: String
             
-            if numberOfDays == 1
+            let formatter = DateComponentsFormatter()
-            {
+            formatter.unitsStyle = .full
-                numberOfDaysText = NSLocalizedString("1 day", comment: "")
+            formatter.includesApproximationPhrase = false
-            }
+            formatter.includesTimeRemainingPhrase = false
-            else
+            
-            {
+            formatter.allowedUnits = [.day, .hour, .minute]
-                numberOfDaysText = String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
+            
-            }
+            formatter.maximumUnitCount = 1
+            
+            
+            
+            cell.bannerView.button.setTitle(formatter.string(from: currentDate, to: installedApp.expirationDate)?.uppercased(), for: .normal)
             
-            cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
             cell.bannerView.button.accessibilityLabel = String(format: NSLocalizedString("Refresh %@", comment: ""), installedApp.name)
-            
+
-            cell.bannerView.accessibilityLabel? += ". " + String(format: NSLocalizedString("Expires in %@", comment: ""), numberOfDaysText)
+            formatter.includesTimeRemainingPhrase = true
+
+            cell.bannerView.accessibilityLabel? += ". " + (formatter.string(from: currentDate, to: installedApp.expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " "
             
             // Make sure refresh button is correct size.
             cell.layoutIfNeeded()
@@ -640,6 +645,12 @@ private extension MyAppsViewController
     
     @IBAction func refreshAllApps(_ sender: UIBarButtonItem)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         self.isRefreshingAllApps = true
         self.collectionView.collectionViewLayout.invalidateLayout()
 
@@ -702,6 +713,12 @@ private extension MyAppsViewController
     
     @IBAction func sideloadApp(_ sender: UIBarButtonItem)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         let supportedTypes = UTType.types(tag: "ipa", tagClass: .filenameExtension, conformingTo: nil)
         
         let documentPickerViewController = UIDocumentPickerViewController(forOpeningContentTypes: supportedTypes, asCopy: true)
@@ -1006,6 +1023,12 @@ private extension MyAppsViewController
     
     func refresh(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         let previousProgress = AppManager.shared.refreshProgress(for: installedApp)
         guard previousProgress == nil else {
             previousProgress?.cancel()
@@ -1027,6 +1050,12 @@ private extension MyAppsViewController
     
     func activate(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         func finish(_ result: Result<InstalledApp, Error>)
         {
             do
@@ -1103,6 +1132,11 @@ private extension MyAppsViewController
     func deactivate(_ installedApp: InstalledApp, completionHandler: ((Result<InstalledApp, Error>) -> Void)? = nil)
     {
         guard installedApp.isActive else { return }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         installedApp.isActive = false
         
         AppManager.shared.deactivate(installedApp, presentingViewController: self) { (result) in
@@ -1164,6 +1198,11 @@ private extension MyAppsViewController
     
     func backup(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         let title = NSLocalizedString("Start Backup?", comment: "")
         let message = NSLocalizedString("This will replace any previous backups. Please leave SideStore open until the backup is complete.", comment: "")
 
@@ -1203,6 +1242,11 @@ private extension MyAppsViewController
     
     func restore(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         let message = String(format: NSLocalizedString("This will replace all data you currently have in %@.", comment: ""), installedApp.name)
         let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to restore this backup?", comment: ""), message: message, preferredStyle: .actionSheet)
         alertController.addAction(.cancel)
@@ -1306,6 +1350,16 @@ private extension MyAppsViewController
     @available(iOS 14, *)
     func enableJIT(for installedApp: InstalledApp)
     {
+        if #available(iOS 17, *) {
+            let toastView = ToastView(error: OperationError.tooNewError)
+            toastView.show(in: self)
+            return
+        }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         AppManager.shared.enableJIT(for: installedApp) { result in
             DispatchQueue.main.async {
                 switch result
@@ -1313,7 +1367,7 @@ private extension MyAppsViewController
                 case .success: break
                 case .failure(let error):
                     let toastView = ToastView(error: error)
-                    toastView.show(in: self)
+                    toastView.show(in: self.navigationController?.view ?? self.view, duration: 5)
                 }
             }
         }
@@ -1460,7 +1514,7 @@ extension MyAppsViewController
                 let registeredAppIDs = team.appIDs.count
                 
                 let maximumAppIDCount = 10
-                let remainingAppIDs = max(maximumAppIDCount - registeredAppIDs, 0)
+                let remainingAppIDs = maximumAppIDCount - registeredAppIDs
                 
                 if remainingAppIDs == 1
                 {
@@ -1471,7 +1525,7 @@ extension MyAppsViewController
                     footerView.textLabel.text = String(format: NSLocalizedString("%@ App IDs Remaining", comment: ""), NSNumber(value: remainingAppIDs))
                 }
                 
-                footerView.textLabel.isHidden = false
+                footerView.textLabel.isHidden = remainingAppIDs < 0
                 
             case .individual, .organization, .unknown: footerView.textLabel.isHidden = true
             @unknown default: break

AltStore/Operations/AuthenticationOperation.swift

@@ -12,6 +12,7 @@ import Network
 
 import AltStoreCore
 import AltSign
+import minimuxer
 
 enum AuthenticationError: LocalizedError
 {
@@ -593,7 +594,7 @@ private extension AuthenticationOperation
     
     func registerCurrentDevice(for team: ALTTeam, session: ALTAppleAPISession, completionHandler: @escaping (Result<ALTDevice, Error>) -> Void)
     {
-        guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else {
+        guard let udid = fetch_udid()?.toString() else {
             return completionHandler(.failure(OperationError.unknownUDID))
         }
         

AltStore/Operations/BackgroundRefreshAppsOperation.swift

@@ -105,8 +105,13 @@ final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<Inst
         } catch {
             self.finish(.failure(error))
         }
-        start_auto_mounter(documentsDirectory)
+        if #available(iOS 17, *) {
-        
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
+        }
+
         self.managedObjectContext.perform {
             print("Apps to refresh:", self.installedApps.map(\.bundleIdentifier))
             

AltStore/Operations/BackupAppOperation.swift

@@ -55,9 +55,8 @@ class BackupAppOperation: ResultOperation<Void>
                     let appName = installedApp.name
                     self.appName = appName
                     
-                    guard let altstoreApp = InstalledApp.fetchAltStore(in: context) else { throw OperationError.appNotFound }
+                    let altstoreOpenURL = URL(string: "sidestore://")!
-                    let altstoreOpenURL = altstoreApp.openAppURL
+
-                    
                     var returnURLComponents = URLComponents(url: altstoreOpenURL, resolvingAgainstBaseURL: false)
                     returnURLComponents?.host = "appBackupResponse"
                     guard let returnURL = returnURLComponents?.url else { throw OperationError.openAppFailed(name: appName) }

AltStore/Operations/ClearAppCacheOperation.swift

@@ -0,0 +1,208 @@
+//
+//  ClearAppCacheOperation.swift
+//  AltStore
+//
+//  Created by Riley Testut on 9/27/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import Foundation
+import AltStoreCore
+/*
+struct BatchError: ALTLocalizedError
+{
+
+    enum Code: Int, ALTErrorCode
+    {
+        typealias Error = BatchError
+        
+        case batchError
+    }
+
+    var code: Code = .batchError
+    var underlyingErrors: [Error]
+    
+    var errorTitle: String?
+    var errorFailure: String?
+    
+    init(errors: [Error])
+    {
+        self.underlyingErrors = errors
+    }
+    
+    var errorFailureReason: String {
+        guard !self.underlyingErrors.isEmpty else { return NSLocalizedString("An unknown error occured.", comment: "") }
+        
+        let errorMessages = self.underlyingErrors.map { $0.localizedDescription }
+        
+        let message = errorMessages.joined(separator: "\n\n")
+        return message
+    }
+}
+*/
+@objc(ClearAppCacheOperation)
+class ClearAppCacheOperation: ResultOperation<Void>
+{
+    private let coordinator = NSFileCoordinator()
+    private let coordinatorQueue = OperationQueue()
+    
+    override init()
+    {
+        self.coordinatorQueue.name = "AltStore - ClearAppCacheOperation Queue"
+    }
+    
+    override func main()
+    {
+        super.main()
+        
+        var allErrors = [Error]()
+        
+        self.clearTemporaryDirectory { result in
+            switch result
+            {
+            //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+            case .failure(let error): allErrors.append(error)
+            case .success: break
+            }
+            
+            self.removeUninstalledAppBackupDirectories { result in
+                switch result
+                {
+                //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+                case .failure(let error): allErrors.append(error)
+                case .success: break
+                }
+                
+                if allErrors.isEmpty
+                {
+                    self.finish(.success(()))
+                }
+                else
+                {
+                    self.finish(.failure(OperationError.cacheClearError(errors: allErrors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+            }
+        }
+    }
+}
+
+private extension ClearAppCacheOperation
+{
+    func clearTemporaryDirectory(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let intent = NSFileAccessIntent.writingIntent(with: FileManager.default.temporaryDirectory, options: [.forDeleting])
+        self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+            do
+            {
+                if let error
+                {
+                    throw error
+                }
+                
+                let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                           includingPropertiesForKeys: [],
+                                                                           options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                var errors = [Error]()
+                
+                for fileURL in fileURLs
+                {
+                    do
+                    {
+                        print("[ALTLog] Removing item from temporary directory:", fileURL.lastPathComponent)
+                        try FileManager.default.removeItem(at: fileURL)
+                    }
+                    catch
+                    {
+                        print("[ALTLog] Failed to remove \(fileURL.lastPathComponent) from temporary directory.", error)
+                        errors.append(error)
+                    }
+                }
+                
+                if !errors.isEmpty
+                {
+                    completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+                else
+                {
+                    completion(.success(()))
+                }
+            }
+            catch
+            {
+                completion(.failure(error))
+            }
+        }
+    }
+    
+    func removeUninstalledAppBackupDirectories(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        guard let backupsDirectory = FileManager.default.appBackupsDirectory else { return completion(.failure(OperationError.missingAppGroup)) }
+        
+        DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
+            let installedAppBundleIDs = Set(InstalledApp.all(in: context).map { $0.bundleIdentifier })
+            
+            let intent = NSFileAccessIntent.writingIntent(with: backupsDirectory, options: [.forDeleting])
+            self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+                do
+                {
+                    if let error
+                    {
+                        throw error
+                    }
+                    
+                    var isDirectory: ObjCBool = false
+                    guard FileManager.default.fileExists(atPath: intent.url.path, isDirectory: &isDirectory), isDirectory.boolValue else {
+                        completion(.success(()))
+                        return
+                    }
+                    
+                    let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                               includingPropertiesForKeys: [.isDirectoryKey, .nameKey],
+                                                                               options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                    var errors = [Error]()
+                    
+                    
+                    for backupDirectory in fileURLs
+                    {
+                        do
+                        {
+                            let resourceValues = try backupDirectory.resourceValues(forKeys: [.isDirectoryKey, .nameKey])
+                            guard let isDirectory = resourceValues.isDirectory, let bundleID = resourceValues.name else { continue }
+
+                            if isDirectory && !installedAppBundleIDs.contains(bundleID) && !AppManager.shared.isActivelyManagingApp(withBundleID: bundleID)
+                            {
+                                print("[ALTLog] Removing backup directory for uninstalled app:", bundleID)
+                                try FileManager.default.removeItem(at: backupDirectory)
+                            }
+                        }
+                        catch
+                        {
+                            print("[ALTLog] Failed to remove app backup directory:", error)
+                            errors.append(error)
+                        }
+                    }
+                    
+                    if !errors.isEmpty
+                    {
+                        completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                            return error.localizedDescription
+                        }))))
+                    }
+                    else
+                    {
+                        completion(.success(()))
+                    }
+                }
+                catch
+                {
+                    print("[ALTLog] Failed to remove app backup directory:", error)
+                    completion(.failure(error))
+                }
+            }
+        }
+    }
+}

AltStore/Operations/DeactivateAppOperation.swift

@@ -39,21 +39,14 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
             let allIdentifiers = [installedApp.resignedBundleIdentifier] + appExtensionProfiles
             
             for profile in allIdentifiers {
-                var attempts = 5
+                do {
-                while (attempts > 0){
+                    try remove_provisioning_profile(profile)
-                    print("Remove Provisioning profile attempts left: \(attempts)")
+                    self.progress.completedUnitCount += 1
-                    do {
+                    installedApp.isActive = false
-                        try remove_provisioning_profile(profile)
+                    self.finish(.success(installedApp))
-                        self.progress.completedUnitCount += 1
+                    break
-                        installedApp.isActive = false
+                } catch {
-                        self.finish(.success(installedApp))
+                    self.finish(.failure(error))
-                        break
-                    } catch {
-                        attempts -= 1
-                        if (attempts <= 0){
-                            self.finish(.failure(error))
-                        }
-                    }
                 }
             }
         }

AltStore/Operations/EnableJITOperation.swift

@@ -50,7 +50,7 @@ final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
                 do {
                     try debug_app(installedApp.resignedBundleIdentifier)
                     self.finish(.success(()))
-                    break
+                    retries = 0
                 } catch {
                     retries -= 1
                     if (retries <= 0){

AltStore/Operations/FetchProvisioningProfilesOperation.swift

@@ -262,10 +262,6 @@ extension FetchProvisioningProfilesOperation
                             {
                                 throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
                             }
-                            else
-                            {
-                                throw ALTAppleAPIError(.maximumAppIDLimitReached)
-                            }
                         }
                     }
                     //App ID name must be ascii. If the name is not ascii, using bundleID instead

AltStore/Operations/InstallAppOperation.swift

@@ -41,12 +41,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
         
         guard
             let certificate = self.context.certificate,
-            let resignedApp = self.context.resignedApp
+            let resignedApp = self.context.resignedApp,
+            let provisioningProfiles = self.context.provisioningProfiles
         else { return self.finish(.failure(OperationError.invalidParameters)) }
         
         let backgroundContext = DatabaseManager.shared.persistentContainer.newBackgroundContext()
         backgroundContext.perform {
             
+            
             /* App */
             let installedApp: InstalledApp
             
@@ -116,8 +118,7 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
             // Temporary directory and resigned .ipa no longer needed, so delete them now to ensure AltStore doesn't quit before we get the chance to.
             self.cleanUp()
             
-            var activeProfiles: Set<String>?
+            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit, provisioningProfiles.contains(where: { $1.isFreeProvisioningProfile == true })
-            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit
             {
                 // When installing these new profiles, AltServer will remove all non-active profiles to ensure we remain under limit.
                 
@@ -142,11 +143,10 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                         installedApp.isActive = false
                     }
                 }
-
+            }
-                activeProfiles = Set(activeApps.flatMap { (installedApp) -> [String] in
+            else
-                    let appExtensionProfiles = installedApp.appExtensions.map { $0.resignedBundleIdentifier }
+            {
-                    return [installedApp.resignedBundleIdentifier] + appExtensionProfiles
+                installedApp.isActive = true
-                })
             }
             
             var installing = true

AltStore/Operations/OperationError.swift

@@ -34,10 +34,14 @@ enum OperationError: LocalizedError
     case openAppFailed(name: String)
     case missingAppGroup
     
+    case noWiFi
+    case tooNewError
     case anisetteV1Error(message: String)
     case provisioningError(result: String, message: String?)
     case anisetteV3Error(message: String)
     
+    case cacheClearError(errors: [String])
+    
     var failureReason: String? {
         switch self {
         case .unknown: return NSLocalizedString("An unknown error occured.", comment: "")
@@ -53,9 +57,12 @@ enum OperationError: LocalizedError
         case .openAppFailed(let name): return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), name)
         case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be found.", comment: "")
         case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs.", comment: "")
+        case .noWiFi: return NSLocalizedString("You do not appear to be connected to WiFi!\nSideStore will never be able to install or refresh applications without WiFi.", comment: "")
+        case .tooNewError: return NSLocalizedString("iOS 17 has changed how JIT is enabled therefore SideStore cannot enable it at this time, sorry for any inconvenience.\nWe will let everyone know once we have a solution!", comment: "")
         case .anisetteV1Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: ""), message)
         case .provisioningError(let result, let message): return String(format: NSLocalizedString("An error occurred when provisioning: %@%@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), result, message != nil ? (" (" + message! + ")") : "")
         case .anisetteV3Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), message)
+        case .cacheClearError(let errors): return String(format: NSLocalizedString("An error occurred while clearing cache: %@", comment: ""), errors.joined(separator: "\n"))
         }
     }
     

AltStore/Operations/RefreshAppOperation.swift

@@ -41,19 +41,11 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
             guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
             
             for p in profiles {
-                var attempts = 5
+                do {
-                while (attempts > 0){
+                    let bytes = p.value.data.toRustByteSlice()
-                    print("Install provisioning profile attempts left: \(attempts)")
+                    try install_provisioning_profile(bytes.forRust())
-                    do {
+                } catch {
-                        let bytes = p.value.data.toRustByteSlice()
+                    self.finish(.failure(MinimuxerError.ProfileInstall))
-                        try install_provisioning_profile(bytes.forRust())
-                        break
-                    } catch {
-                        attempts -= 1
-                        if (attempts <= 0) {
-                            self.finish(.failure(MinimuxerError.ProfileInstall))
-                        }
-                    }
                 }
 
                 DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in

AltStore/Operations/ResignAppOperation.swift

@@ -11,6 +11,7 @@ import Roxas
 
 import AltStoreCore
 import AltSign
+import minimuxer
 
 @objc(ResignAppOperation)
 final class ResignAppOperation: ResultOperation<ALTApplication>
@@ -181,7 +182,7 @@ private extension ResignAppOperation
 
                 if app.isAltStoreApp
                 {
-                    guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else { throw OperationError.unknownUDID }
+                    guard let udid = fetch_udid()?.toString() as? String else { throw OperationError.unknownUDID }
                     guard let pairingFileString = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.devicePairingString) as? String else { throw OperationError.unknownUDID }                    
                     additionalValues[Bundle.Info.devicePairingString] = pairingFileString
                     additionalValues[Bundle.Info.deviceID] = udid
@@ -202,7 +203,7 @@ private extension ResignAppOperation
                         // The embedded certificate + certificate identifier are already in app bundle, no need to update them.
                     }
                 }
-                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String
+                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = fetch_udid()?.toString() as? String
                 {
                     // There is an ALTDeviceID entry, so assume the app is using AltKit and replace it with the device's UDID.
                     additionalValues[Bundle.Info.deviceID] = udid

AltStore/Operations/SendAppOperation.swift

@@ -45,21 +45,13 @@ final class SendAppOperation: ResultOperation<()>
         print("AFC App `fileURL`: \(fileURL.absoluteString)")
         
         if let data = NSData(contentsOf: fileURL) {
-            var attempts = 10
+            do {
-            while (attempts != 0){
+                let bytes = Data(data).toRustByteSlice()
-                print("Send app attempts left: \(attempts)")
+                try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
-                do {
+                self.progress.completedUnitCount += 1
-                    let bytes = Data(data).toRustByteSlice()
+                self.finish(.success(()))
-                    try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
+            } catch {
-                    self.progress.completedUnitCount += 1
+                self.finish(.failure(MinimuxerError.RwAfc))
-                    self.finish(.success(()))
-                    break
-                } catch {
-                    attempts -= 1
-                    if (attempts <= 0) {
-                        self.finish(.failure(MinimuxerError.RwAfc))
-                    }
-                }
                 self.progress.completedUnitCount += 1
                 self.finish(.success(()))
             }

AltStore/Settings/Settings.storyboard

@@ -21,7 +21,7 @@
                         <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
-                            <rect key="frame" x="0.0" y="1126" width="375" height="25"/>
+                            <rect key="frame" x="0.0" y="1245" width="375" height="25"/>
                             <autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
                             <fontDescription key="fontDescription" type="system" pointSize="17"/>
                             <color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -236,14 +236,50 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="NO"/>
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="GYp-O0-pse" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
                                         <rect key="frame" x="0.0" y="444" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="GYp-O0-pse" id="vDG-ZV-xRS">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Disable Idle Timeout" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PCh-Up-aJJ">
+                                                    <rect key="frame" x="30" y="15.5" width="166" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <switch opaque="NO" contentMode="scaleToFill" horizontalHuggingPriority="750" verticalHuggingPriority="750" contentHorizontalAlignment="center" contentVerticalAlignment="center" on="YES" translatesAutoresizingMaskIntoConstraints="NO" id="iQA-wm-5ag">
+                                                    <rect key="frame" x="296" y="10" width="51" height="31"/>
+                                                    <connections>
+                                                        <action selector="toggleNoIdleTimeoutEnabled:" destination="aMk-Xp-UL8" eventType="valueChanged" id="WSl-Jc-g5J"/>
+                                                    </connections>
+                                                </switch>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstAttribute="trailingMargin" secondItem="iQA-wm-5ag" secondAttribute="trailing" id="MJ1-HF-Dln"/>
+                                                <constraint firstItem="PCh-Up-aJJ" firstAttribute="leading" secondItem="vDG-ZV-xRS" secondAttribute="leadingMargin" id="Ocu-jn-RAQ"/>
+                                                <constraint firstItem="iQA-wm-5ag" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="c6W-bN-VAb"/>
+                                                <constraint firstItem="PCh-Up-aJJ" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="mL6-LB-cjn"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="495" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="amC-sE-8O0" id="GEO-2e-E4k">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Add to Siri…" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="c6K-fI-CVr">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Allow Siri To Refresh Apps…" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="c6K-fI-CVr">
                                                     <rect key="frame" x="30" y="15.5" width="100.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -269,7 +305,7 @@
                             <tableViewSection headerTitle="" id="eHy-qI-w5w">
                                 <cells>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="30h-59-88f" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="535" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="586" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="30h-59-88f" id="7qD-DW-Jls">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -309,7 +345,7 @@
                             <tableViewSection headerTitle="" id="J90-vn-u2O">
                                 <cells>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="i4T-2q-jF3" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="626" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="677" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="i4T-2q-jF3" id="VTQ-H4-aCM">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -353,28 +389,28 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="oHX-oR-nwJ" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="677" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="728" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="oHX-oR-nwJ" id="hN4-i5-igu">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
                                                     <rect key="frame" x="30" y="15.5" width="89" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
+                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
                                                     <rect key="frame" x="198" y="15.5" width="147" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
                                                             <rect key="frame" x="0.0" y="0.0" width="115" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
                                                             <rect key="frame" x="129" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
@@ -397,7 +433,7 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="0MT-ht-Sit" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="728" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="779" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="0MT-ht-Sit" id="OZp-WM-5H7">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -441,7 +477,7 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="O5R-Al-lGj" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="779" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="830" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="O5R-Al-lGj" id="CrG-Mr-xQq">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -481,7 +517,7 @@
                             <tableViewSection headerTitle="" id="OMa-EK-hRI">
                                 <cells>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="FMZ-as-Ljo" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="870" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="921" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="FMZ-as-Ljo" id="JzL-Of-A3T">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -514,7 +550,7 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="Qca-pU-sJh" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="921" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="972" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="Qca-pU-sJh" id="QtU-8J-VQN">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -550,7 +586,7 @@
                                         </connections>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="rE2-P4-OaE" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="972" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1023" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="rE2-P4-OaE" id="qIT-rz-ZUb">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -582,12 +618,45 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                         </userDefinedRuntimeAttributes>
                                         <connections>
-                                            <segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="SSW-vL-86I"/>
+                                            <segue destination="g8a-Rf-zWa" kind="show" id="vFC-Id-Ww6"/>
                                         </connections>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="eZ3-BT-q4D" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
                                         <rect key="frame" x="0.0" y="1023" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="eZ3-BT-q4D" id="17m-VV-hzf">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Clear Cache" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="IbH-V1-ce3">
+                                                    <rect key="frame" x="30" y="15.5" width="98.5" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="FZe-BJ-fOm">
+                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
+                                                </imageView>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="FZe-BJ-fOm" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="bGv-Np-5aO"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="FZe-BJ-fOm" secondAttribute="trailing" id="ccb-JP-Eqi"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="iQJ-gN-sRF"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="leading" secondItem="17m-VV-hzf" secondAttribute="leadingMargin" id="m1g-Y6-aT5"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VNn-u4-cN8" id="4bh-qe-l2N">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
@@ -619,7 +688,7 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="e7s-hL-kv9" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="e7s-hL-kv9" id="yjL-Mu-HTk">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -652,7 +721,7 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1176" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -689,7 +758,6 @@
                         </sections>
                         <connections>
                             <outlet property="dataSource" destination="aMk-Xp-UL8" id="c6c-fR-8C4"/>
-                            <outlet property="delegate" destination="aMk-Xp-UL8" id="moP-1B-lRq"/>
                         </connections>
                     </tableView>
                     <navigationItem key="navigationItem" title="Settings" id="Ddg-UQ-KJ8"/>
@@ -698,6 +766,7 @@
                         <outlet property="accountNameLabel" destination="CnN-M1-AYK" id="Ldc-Py-Bix"/>
                         <outlet property="accountTypeLabel" destination="434-MW-Den" id="mNB-QE-4Jg"/>
                         <outlet property="backgroundRefreshSwitch" destination="DPu-zD-Als" id="eiG-Hv-Vko"/>
+                        <outlet property="noIdleTimeoutSwitch" destination="iQA-wm-5ag" id="jHC-js-q0Y"/>
                         <outlet property="versionLabel" destination="bUR-rp-Nw2" id="85I-5R-hqz"/>
                     </connections>
                 </tableViewController>

AltStore/Settings/SettingsViewController.swift

@@ -30,13 +30,14 @@ extension SettingsViewController
     fileprivate enum AppRefreshRow: Int, CaseIterable
     {
         case backgroundRefresh
+        case noIdleTimeout
         
         @available(iOS 14, *)
         case addToSiri
         
         static var allCases: [AppRefreshRow] {
-            guard #available(iOS 14, *) else { return [.backgroundRefresh] }
+            guard #available(iOS 14, *) else { return [.backgroundRefresh, .noIdleTimeout] }
-            return [.backgroundRefresh, .addToSiri]
+            return [.backgroundRefresh, .noIdleTimeout, .addToSiri]
         }
     }
     
@@ -53,9 +54,11 @@ extension SettingsViewController
         case sendFeedback
         case refreshAttempts
         case errorLog
+        case clearCache
         case resetPairingFile
         case resetAdiPb
         case advancedSettings
+    
     }
 }
 
@@ -73,6 +76,7 @@ final class SettingsViewController: UITableViewController
     @IBOutlet private var accountTypeLabel: UILabel!
     
     @IBOutlet private var backgroundRefreshSwitch: UISwitch!
+    @IBOutlet private var noIdleTimeoutSwitch: UISwitch!
     
     @IBOutlet private var versionLabel: UILabel!
     
@@ -148,6 +152,7 @@ private extension SettingsViewController
         }
         
         self.backgroundRefreshSwitch.isOn = UserDefaults.standard.isBackgroundRefreshEnabled
+        self.noIdleTimeoutSwitch.isOn = UserDefaults.standard.isIdleTimeoutDisableEnabled
         
         if self.isViewLoaded
         {
@@ -199,7 +204,7 @@ private extension SettingsViewController
             }
             else
             {
-                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Enable Background Refresh to automatically refresh apps in the background when connected to Wi-Fi.", comment: "")
+                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Enable Background Refresh to automatically refresh apps in the background when connected to Wi-Fi. \n\nDisable the Idle Timeout toggle to allow SideStore to not let your device go to sleep during a refresh or install of any apps.", comment: "")
             }
             
         case .instructions:
@@ -280,6 +285,11 @@ private extension SettingsViewController
         UserDefaults.standard.isBackgroundRefreshEnabled = sender.isOn
     }
     
+    @IBAction func toggleNoIdleTimeoutEnabled(_ sender: UISwitch)
+    {
+        UserDefaults.standard.isIdleTimeoutDisableEnabled = sender.isOn
+    }
+    
     @available(iOS 14, *)
     @IBAction func addRefreshAppsShortcut()
     {
@@ -291,6 +301,39 @@ private extension SettingsViewController
         self.present(viewController, animated: true, completion: nil)
     }
     
+    func clearCache()
+    {
+        let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to clear SideStore's cache?", comment: ""),
+                                                message: NSLocalizedString("This will remove all temporary files as well as backups for uninstalled apps.", comment: ""),
+                                                preferredStyle: .actionSheet)
+        alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { [weak self] _ in
+            self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+        })
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Clear Cache", comment: ""), style: .destructive) { [weak self] _ in
+            AppManager.shared.clearAppCache { result in
+                DispatchQueue.main.async {
+                    self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+                    
+                    switch result
+                    {
+                    case .success: break
+                    case .failure(let error):
+                        let alertController = UIAlertController(title: NSLocalizedString("Unable to Clear Cache", comment: ""), message: error.localizedDescription, preferredStyle: .alert)
+                        alertController.addAction(.ok)
+                        self?.present(alertController, animated: true)
+                    }
+                }
+            }
+        })
+        
+        if let popoverController = alertController.popoverPresentationController {
+            popoverController.sourceView = self.view
+            popoverController.sourceRect = CGRect(x: self.view.bounds.midX, y: self.view.bounds.midY, width: 0, height: 0)
+        }
+        
+        self.present(alertController, animated: true)
+    }
+    
     @IBAction func handleDebugModeGesture(_ gestureRecognizer: UISwipeGestureRecognizer)
     {
         self.debugGestureCounter += 1
@@ -377,15 +420,26 @@ extension SettingsViewController
     {
         let cell = super.tableView(tableView, cellForRowAt: indexPath)
         
-        if #available(iOS 14, *) {}
+//        if #available(iOS 14, *) {}
-        else if let cell = cell as? InsetGroupTableViewCell,
+//        else if let cell = cell as? InsetGroupTableViewCell,
-                indexPath.section == Section.appRefresh.rawValue,
+//                indexPath.section == Section.appRefresh.rawValue,
-                indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+//                indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+//        {
+//            // Only one row is visible pre-iOS 14.
+//            cell.style = .single
+//        }
+        
+        if AppRefreshRow.AllCases().count == 1
         {
-            // Only one row is visible pre-iOS 14.
+            if let cell = cell as? InsetGroupTableViewCell,
-            cell.style = .single
+               indexPath.section == Section.appRefresh.rawValue,
+               indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+            {
+                cell.style = .single
+            }
         }
         
+        
         return cell
     }
     
@@ -465,11 +519,13 @@ extension SettingsViewController
             switch row
             {
             case .backgroundRefresh: break
+            case .noIdleTimeout: break
             case .addToSiri:
                 guard #available(iOS 14, *) else { return }
                 self.addRefreshAppsShortcut()
             }
             
+            
         case .credits:
             let row = CreditsRow.allCases[indexPath.row]
             switch row
@@ -507,6 +563,9 @@ extension SettingsViewController
                     let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
                     toastView.show(in: self)
                 }
+                
+            case .clearCache: self.clearCache()
+
             case .resetPairingFile:
                 let filename = "ALTPairingFile.mobiledevicepairing"
                 let fm = FileManager.default
@@ -559,6 +618,7 @@ extension SettingsViewController
                     ELOG("UIApplication.openSettingsURLString invalid")
                 }
             case .refreshAttempts, .errorLog: break
+
             }
             
         default: break

AltStoreCore/Extensions/UserDefaults+AltStore.swift

@@ -27,6 +27,7 @@ public extension UserDefaults
     @NSManaged var preferredServerID: String?
     
     @NSManaged var isBackgroundRefreshEnabled: Bool
+    @NSManaged var isIdleTimeoutDisableEnabled: Bool
     @NSManaged var isDebugModeEnabled: Bool
     @NSManaged var presentedLaunchReminderNotification: Bool
     
@@ -72,6 +73,7 @@ public extension UserDefaults
         
         let defaults = [
             #keyPath(UserDefaults.isBackgroundRefreshEnabled): true,
+            #keyPath(UserDefaults.isIdleTimeoutDisableEnabled): true,
             #keyPath(UserDefaults.isLegacyDeactivationSupported): isLegacyDeactivationSupported,
             #keyPath(UserDefaults.activeAppLimitIncludesExtensions): activeAppLimitIncludesExtensions,
             #keyPath(UserDefaults.localServerSupportsRefreshing): localServerSupportsRefreshing,

AltStoreCore/Model/Source.swift

@@ -20,17 +20,17 @@ public extension Source
     #if STAGING
     
     #if ALPHA
-    static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
+    static let altStoreSourceURL = URL(string: "https://connect.sidestore.io/")!
     #else
-    static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
+    static let altStoreSourceURL = URL(string: "https://connect.sidestore.io/")!
     #endif
     
     #else
     
     #if ALPHA
-    static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
+    static let altStoreSourceURL = URL(string: "https://connect.sidestore.io/")!
     #else
-    static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
+    static let altStoreSourceURL = URL(string: "https://connect.sidestore.io/")!
     #endif
     
     #endif

AltWidget/Info.plist

@@ -4,8 +4,8 @@
 <dict>
 	<key>ALTAppGroups</key>
 	<array>
-		<string>group.com.SideStore.SideStore</string>
 		<string>group.$(APP_GROUP_IDENTIFIER)</string>
+		<string>group.com.SideStore.SideStore</string>
 	</array>
 	<key>CFBundleDevelopmentRegion</key>
 	<string>$(DEVELOPMENT_LANGUAGE)</string>

Build.xcconfig

@@ -1,8 +1,8 @@
 // Configuration settings file format documentation can be found at:
 // https://help.apple.com/xcode/#/dev745c5c974
 
-MARKETING_VERSION = 0.5.1
+MARKETING_VERSION = 0.5.5
-CURRENT_PROJECT_VERSION = 5010
+CURRENT_PROJECT_VERSION = 5050
 
 // Vars to be overwritten by `CodeSigning.xcconfig` if exists
 DEVELOPMENT_TEAM = S32Z3HMYVQ

Shared/Extensions/Bundle+AltStore.swift

@@ -56,7 +56,7 @@ public extension Bundle
 public extension Bundle
 {
     static var baseAltStoreAppGroupID = "group." + Bundle.Info.appbundleIdentifier
-    
+
     var appGroups: [String] {
         return self.infoDictionary?[Bundle.Info.appGroups] as? [String] ?? []
     }

trustedapps.json

@@ -24,10 +24,6 @@
       "identifier": "com.flyinghead.source",
       "sourceURL": "https://flyinghead.github.io/flycast-builds/altstore.json"
     },
-    {
-      "identifier": "com.emuplace.altstore",
-      "sourceURL": "https://emuplace.app/altstore.json"
-    },
     {
       "identifier": "dev.crystall1ne.repos.PojavLauncher",
       "sourceURL": "https://alt.crystall1ne.dev"
@@ -46,7 +42,7 @@
     },
     {
       "identifier": "com.litritt.litsource",
-      "sourceURL": "https://apps.litritt.com/"
+      "sourceURL": "https://altstore.ignitedemulator.com/"
     }
   ]
 }