mirror of
https://github.com/SideStore/SideStore.git
synced 2026-04-11 13:15:38 +02:00
Compare commits
70 Commits
0.5.0
...
naturecode
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
8a8c5167c6 | ||
|
|
96f0d41986 | ||
|
|
f2b555beae | ||
|
|
d853791ad2 | ||
|
|
8f5b56f717 | ||
|
|
9f7d4dee49 | ||
|
|
458b8e491e | ||
|
|
495e621e69 | ||
|
|
c986512b5f | ||
|
|
d277754ae5 | ||
|
|
2ef2e2f26b | ||
|
|
23a53034fa | ||
|
|
ce57d72a78 | ||
|
|
502b89d890 | ||
|
|
5f0015fad0 | ||
|
|
c81236957b | ||
|
|
970ab38b27 | ||
|
|
8a5c31b81d | ||
|
|
8508fe79b5 | ||
|
|
3859e98801 | ||
|
|
a759c7be9e | ||
|
|
12fc6cf6e2 | ||
|
|
580db6530e | ||
|
|
9c67c237ee | ||
|
|
357d85a72e | ||
|
|
88ad828ce0 | ||
|
|
a95625a34a | ||
|
|
95e00d81f5 | ||
|
|
c2e386a5c5 | ||
|
|
a76aade4ff | ||
|
|
65c9986103 | ||
|
|
9e2b9b6639 | ||
|
|
cf373634d7 | ||
|
|
b3d5d976b4 | ||
|
|
c3c31995ce | ||
|
|
7e92e17429 | ||
|
|
88ab8fa8d7 | ||
|
|
ebe78932bf | ||
|
|
2e613e6d15 | ||
|
|
35ee92db12 | ||
|
|
04d9f760ad | ||
|
|
4f52743be8 | ||
|
|
32cae7a5b2 | ||
|
|
c2c0e3b790 | ||
|
|
6d36a30787 | ||
|
|
48a86ec6de | ||
|
|
5cff914ff3 | ||
|
|
70ea725ce3 | ||
|
|
78f12e45f9 | ||
|
|
e5061acc20 | ||
|
|
2d7bc51d30 | ||
|
|
9128b67ee8 | ||
|
|
551c004476 | ||
|
|
ed6a8d1379 | ||
|
|
766fb89e0b | ||
|
|
c5b8cb4459 | ||
|
|
0deae92829 | ||
|
|
cc5d2f1813 | ||
|
|
41151d0d49 | ||
|
|
52702264a3 | ||
|
|
6e297e1278 | ||
|
|
e3bb9b425f | ||
|
|
79255be79c | ||
|
|
7c836f5ba1 | ||
|
|
938bcd14ad | ||
|
|
229d79fc05 | ||
|
|
2d3dac2e1d | ||
|
|
e23f5e7894 | ||
|
|
571d27c814 | ||
|
|
dde6bd4fe3 |
2
.github/CODEOWNERS
vendored
2
.github/CODEOWNERS
vendored
@@ -1 +1 @@
|
||||
* @JoeMatt @lonkelle
|
||||
* @JoeMatt @lonkelle @nythepegasus @Spidy123222 @SternXD
|
||||
|
||||
2
.github/ISSUE_TEMPLATE/bug_report.yml
vendored
2
.github/ISSUE_TEMPLATE/bug_report.yml
vendored
@@ -10,7 +10,7 @@ body:
|
||||
value: |
|
||||
Thanks for taking the time to fill out this bug report! Before you continue filling out the report, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the bug you are experiencing** in case it has already been reported.
|
||||
|
||||
**Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
|
||||
**Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
|
||||
- type: textarea
|
||||
id: description
|
||||
attributes:
|
||||
|
||||
2
.github/ISSUE_TEMPLATE/config.yml
vendored
2
.github/ISSUE_TEMPLATE/config.yml
vendored
@@ -3,7 +3,7 @@ blank_issues_enabled: false
|
||||
|
||||
contact_links:
|
||||
- name: Discord
|
||||
url: https://discord.gg/RgpFBX3Q3k
|
||||
url: https://discord.gg/sidestore-949183273383395328
|
||||
about: If you need support, please go here first instead of making an issue!
|
||||
- name: GitHub Discussions
|
||||
url: https://github.com/SideStore/SideStore/discussions
|
||||
|
||||
2
.github/ISSUE_TEMPLATE/feature_request.yml
vendored
2
.github/ISSUE_TEMPLATE/feature_request.yml
vendored
@@ -10,7 +10,7 @@ body:
|
||||
value: |
|
||||
Thanks for taking the time to fill out this feature request! Before you continue filling out the form, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the feature you are suggestion** in case it has already been suggested.
|
||||
|
||||
**Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
|
||||
**Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
|
||||
- type: textarea
|
||||
id: description
|
||||
attributes:
|
||||
|
||||
1
.github/workflows/stable.yml
vendored
1
.github/workflows/stable.yml
vendored
@@ -3,6 +3,7 @@ on:
|
||||
push:
|
||||
tags:
|
||||
- '[0-9]+.[0-9]+.[0-9]+' # example: 1.0.0
|
||||
workflow_dispatch:
|
||||
|
||||
jobs:
|
||||
build:
|
||||
|
||||
2
.gitmodules
vendored
2
.gitmodules
vendored
@@ -9,7 +9,7 @@
|
||||
url = https://github.com/libimobiledevice/libusbmuxd.git
|
||||
[submodule "Dependencies/libplist"]
|
||||
path = Dependencies/libplist
|
||||
url = https://github.com/libimobiledevice/libplist.git
|
||||
url = https://github.com/SideStore/libplist.git
|
||||
[submodule "Dependencies/MarkdownAttributedString"]
|
||||
path = Dependencies/MarkdownAttributedString
|
||||
url = https://github.com/chockenberry/MarkdownAttributedString.git
|
||||
|
||||
@@ -5,9 +5,9 @@
|
||||
"color-space" : "srgb",
|
||||
"components" : {
|
||||
"alpha" : "1.000",
|
||||
"blue" : "0.518",
|
||||
"green" : "0.502",
|
||||
"red" : "0.004"
|
||||
"blue" : "175",
|
||||
"green" : "4",
|
||||
"red" : "115"
|
||||
}
|
||||
},
|
||||
"idiom" : "universal"
|
||||
@@ -23,9 +23,9 @@
|
||||
"color-space" : "srgb",
|
||||
"components" : {
|
||||
"alpha" : "1.000",
|
||||
"blue" : "0.404",
|
||||
"green" : "0.322",
|
||||
"red" : "0.008"
|
||||
"blue" : "150",
|
||||
"green" : "3",
|
||||
"red" : "99"
|
||||
}
|
||||
},
|
||||
"idiom" : "universal"
|
||||
|
||||
@@ -8,13 +8,39 @@
|
||||
|
||||
/* Begin PBXBuildFile section */
|
||||
03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E314122A05D4C00370A3C /* Bundle+AltStore.swift */; };
|
||||
0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0E1A1F902AE36A9600364CAD /* bytearray.c */; };
|
||||
0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = 0E764E162ADFF5740043DD4E /* AltBackup.ipa */; };
|
||||
0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166472ADFE0D1003015C1 /* out-limd.c */; };
|
||||
0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166522ADFE0D2003015C1 /* out-default.c */; };
|
||||
0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166552ADFE0D2003015C1 /* out-plutil.c */; };
|
||||
0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166562ADFE0D2003015C1 /* oplist.c */; };
|
||||
0EA166682ADFE122003015C1 /* jsmn.h in Headers */ = {isa = PBXBuildFile; fileRef = 0EA166632ADFE122003015C1 /* jsmn.h */; };
|
||||
0EA166692ADFE140003015C1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166452ADFE0D1003015C1 /* Array.cpp */; };
|
||||
0EA1666A2ADFE140003015C1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166492ADFE0D1003015C1 /* String.cpp */; };
|
||||
0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */; };
|
||||
0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166532ADFE0D2003015C1 /* Integer.cpp */; };
|
||||
0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166432ADFE0D1003015C1 /* Data.cpp */; };
|
||||
0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166512ADFE0D2003015C1 /* ptrarray.c */; };
|
||||
0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664F2ADFE0D1003015C1 /* hashtable.c */; };
|
||||
0EA166702ADFE140003015C1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166502ADFE0D2003015C1 /* Node.cpp */; };
|
||||
0EA166712ADFE140003015C1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166582ADFE0D2003015C1 /* Key.cpp */; };
|
||||
0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166462ADFE0D1003015C1 /* Dictionary.cpp */; };
|
||||
0EA166742ADFE140003015C1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166422ADFE0D1003015C1 /* Date.cpp */; };
|
||||
0EA166752ADFE140003015C1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166542ADFE0D2003015C1 /* Real.cpp */; };
|
||||
0EA166762ADFE140003015C1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664A2ADFE0D1003015C1 /* base64.c */; };
|
||||
0EA166772ADFE140003015C1 /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166412ADFE0D1003015C1 /* jplist.c */; };
|
||||
0EA166782ADFE140003015C1 /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166572ADFE0D2003015C1 /* jsmn.c */; };
|
||||
0EA166792ADFE140003015C1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166442ADFE0D1003015C1 /* bplist.c */; };
|
||||
0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664B2ADFE0D1003015C1 /* Uid.cpp */; };
|
||||
0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1665A2ADFE0D2003015C1 /* Structure.cpp */; };
|
||||
0EA1667D2ADFE140003015C1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166592ADFE0D2003015C1 /* xplist.c */; };
|
||||
0EA1667E2ADFE140003015C1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664C2ADFE0D1003015C1 /* time64.c */; };
|
||||
0EA4B9BC2AE4A414009209CE /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA4B9BB2AE4A3F6009209CE /* plist.c */; };
|
||||
19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */ = {isa = PBXBuildFile; fileRef = BF45872B2298D31600BD7491 /* libimobiledevice.a */; };
|
||||
19104DB52909C06D00C49C7B /* EmotionalDamage.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19104DB42909C06D00C49C7B /* EmotionalDamage.swift */; };
|
||||
19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DB22909C06C00C49C7B /* libEmotionalDamage.a */; };
|
||||
191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FAB290A5D92001A3B7C /* libminimuxer.a */; };
|
||||
191E5FDC290AFA5C001A3B7C /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 191E5FDB290AFA5C001A3B7C /* OpenSSL */; };
|
||||
191E607D290B2EA5001A3B7C /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FD0290A651D001A3B7C /* jsmn.c */; };
|
||||
191E607E290B2EA7001A3B7C /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FCF290A651D001A3B7C /* jplist.c */; };
|
||||
1920B04F2924AC8300744F60 /* Settings.bundle in Resources */ = {isa = PBXBuildFile; fileRef = 1920B04E2924AC8300744F60 /* Settings.bundle */; };
|
||||
19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */; };
|
||||
4879A95F2861046500FC1BBD /* AltSign in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A95E2861046500FC1BBD /* AltSign */; };
|
||||
@@ -25,7 +51,6 @@
|
||||
99F87D1829D8E4C900B40039 /* SwiftBridgeCore.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1629D8E4C900B40039 /* SwiftBridgeCore.swift */; };
|
||||
99F87D1929D8E4C900B40039 /* minimuxer.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1729D8E4C900B40039 /* minimuxer.swift */; };
|
||||
B3146ED2284F581E00BBC3FD /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; };
|
||||
B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; settings = {ATTRIBUTES = (CodeSignOnCopy, RemoveHeadersOnCopy, ); }; };
|
||||
B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F894295F7F9B002B1159 /* libfragmentzip.a */; };
|
||||
B33FFBAA295F8F78002259E6 /* preboard.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBA9295F8F78002259E6 /* preboard.c */; };
|
||||
B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBAB295F8F98002259E6 /* companion_proxy.c */; };
|
||||
@@ -74,7 +99,6 @@
|
||||
BF41B808233433C100C593A3 /* LoadingState.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF41B807233433C100C593A3 /* LoadingState.swift */; };
|
||||
BF42345A25101C35006D1EB2 /* WidgetView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF42345825101C1D006D1EB2 /* WidgetView.swift */; };
|
||||
BF44EEF0246B08BA002A52F2 /* BackupController.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEEF246B08BA002A52F2 /* BackupController.swift */; };
|
||||
BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */; };
|
||||
BF44EEFC246B4550002A52F2 /* RemoveAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */; };
|
||||
BF4587F82298D3AB00BD7491 /* service.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4587C82298D3A800BD7491 /* service.h */; };
|
||||
BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587C92298D3A800BD7491 /* diagnostics_relay.c */; };
|
||||
@@ -254,34 +278,6 @@
|
||||
BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = BFD247782284B9A700981D42 /* LaunchScreen.storyboard */; };
|
||||
BFD2478C2284C4C300981D42 /* AppIconImageView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478B2284C4C300981D42 /* AppIconImageView.swift */; };
|
||||
BFD2478F2284C8F900981D42 /* Button.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478E2284C8F900981D42 /* Button.swift */; };
|
||||
BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */; };
|
||||
BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE622A1A9CA000B7ED1 /* base64.c */; };
|
||||
BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE722A1A9CA000B7ED1 /* hashtable.c */; };
|
||||
BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */; };
|
||||
BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */; };
|
||||
BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEA22A1A9CA000B7ED1 /* bplist.c */; };
|
||||
BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEB22A1A9CA000B7ED1 /* String.cpp */; };
|
||||
BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEC22A1A9CA000B7ED1 /* time64.c */; };
|
||||
BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BED22A1A9CA000B7ED1 /* plist.h */; };
|
||||
BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEE22A1A9CA000B7ED1 /* plist.c */; };
|
||||
BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */; };
|
||||
BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF022A1A9CA000B7ED1 /* Date.cpp */; };
|
||||
BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */; };
|
||||
BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */; };
|
||||
BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF322A1A9CA000B7ED1 /* Real.cpp */; };
|
||||
BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF422A1A9CA000B7ED1 /* strbuf.h */; };
|
||||
BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF522A1A9CA000B7ED1 /* bytearray.c */; };
|
||||
BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF622A1A9CA000B7ED1 /* base64.h */; };
|
||||
BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF722A1A9CA000B7ED1 /* Data.cpp */; };
|
||||
BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF822A1A9CB000B7ED1 /* Array.cpp */; };
|
||||
BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF922A1A9CB000B7ED1 /* Node.cpp */; };
|
||||
BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */; };
|
||||
BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */; };
|
||||
BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */; };
|
||||
BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */; };
|
||||
BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */; };
|
||||
BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFF22A1A9CB000B7ED1 /* time64.h */; };
|
||||
BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C0022A1A9CB000B7ED1 /* xplist.c */; };
|
||||
BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1D22A1A9EC000B7ED1 /* node.c */; };
|
||||
BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1E22A1A9EC000B7ED1 /* node_list.c */; };
|
||||
BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1F22A1A9EC000B7ED1 /* cnary.c */; };
|
||||
@@ -336,6 +332,7 @@
|
||||
D57FE84428C7DB7100216002 /* ErrorLogViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */; };
|
||||
D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = D58916FD28C7C55C00E39C8B /* LoggedError.swift */; };
|
||||
D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D593F1932717749A006E82DE /* PatchAppOperation.swift */; };
|
||||
D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */; };
|
||||
D5CA0C4B280E141900469595 /* ManagedPatron.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4A280E141900469595 /* ManagedPatron.swift */; };
|
||||
D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */; };
|
||||
D5DAE0942804B0B80034D8D4 /* ScreenshotProcessor.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5DAE0932804B0B80034D8D4 /* ScreenshotProcessor.swift */; };
|
||||
@@ -482,7 +479,6 @@
|
||||
dstPath = "";
|
||||
dstSubfolderSpec = 10;
|
||||
files = (
|
||||
B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */,
|
||||
BF1614F2250822F100767AEA /* Roxas.framework in Embed Frameworks */,
|
||||
BF66EE862501AE50007EE018 /* AltStoreCore.framework in Embed Frameworks */,
|
||||
);
|
||||
@@ -503,12 +499,45 @@
|
||||
/* End PBXCopyFilesBuildPhase section */
|
||||
|
||||
/* Begin PBXFileReference section */
|
||||
0E1A1F902AE36A9600364CAD /* bytearray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = src/bytearray.c; sourceTree = "<group>"; };
|
||||
0E764E162ADFF5740043DD4E /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; name = AltBackup.ipa; path = AltStore/Resources/AltBackup.ipa; sourceTree = SOURCE_ROOT; };
|
||||
0EA166412ADFE0D1003015C1 /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA166422ADFE0D1003015C1 /* Date.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166432ADFE0D1003015C1 /* Data.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166442ADFE0D1003015C1 /* bplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA166452ADFE0D1003015C1 /* Array.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166462ADFE0D1003015C1 /* Dictionary.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166472ADFE0D1003015C1 /* out-limd.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-limd.c"; path = "Dependencies/libplist/src/out-limd.c"; sourceTree = SOURCE_ROOT; };
|
||||
0EA166492ADFE0D1003015C1 /* String.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA1664A2ADFE0D1003015C1 /* base64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA1664B2ADFE0D1003015C1 /* Uid.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA1664C2ADFE0D1003015C1 /* time64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA1664F2ADFE0D1003015C1 /* hashtable.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA166502ADFE0D2003015C1 /* Node.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166512ADFE0D2003015C1 /* ptrarray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA166522ADFE0D2003015C1 /* out-default.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-default.c"; path = "Dependencies/libplist/src/out-default.c"; sourceTree = SOURCE_ROOT; };
|
||||
0EA166532ADFE0D2003015C1 /* Integer.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166542ADFE0D2003015C1 /* Real.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166552ADFE0D2003015C1 /* out-plutil.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-plutil.c"; path = "Dependencies/libplist/src/out-plutil.c"; sourceTree = SOURCE_ROOT; };
|
||||
0EA166562ADFE0D2003015C1 /* oplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = oplist.c; path = Dependencies/libplist/src/oplist.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA166572ADFE0D2003015C1 /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA166582ADFE0D2003015C1 /* Key.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA166592ADFE0D2003015C1 /* xplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
|
||||
0EA1665A2ADFE0D2003015C1 /* Structure.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
|
||||
0EA1665F2ADFE122003015C1 /* time64_limits.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166602ADFE122003015C1 /* time64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166612ADFE122003015C1 /* bytearray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166622ADFE122003015C1 /* ptrarray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166632ADFE122003015C1 /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166642ADFE122003015C1 /* plist.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166652ADFE122003015C1 /* hashtable.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166662ADFE122003015C1 /* base64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA166672ADFE122003015C1 /* strbuf.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
|
||||
0EA4B9BB2AE4A3F6009209CE /* plist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
|
||||
19104DB22909C06C00C49C7B /* libEmotionalDamage.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libEmotionalDamage.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
||||
19104DB42909C06D00C49C7B /* EmotionalDamage.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EmotionalDamage.swift; sourceTree = "<group>"; };
|
||||
191E5FAB290A5D92001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
||||
191E5FCF290A651D001A3B7C /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
|
||||
191E5FD0290A651D001A3B7C /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
|
||||
191E5FD1290A651D001A3B7C /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
|
||||
1920B04E2924AC8300744F60 /* Settings.bundle */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.plug-in"; path = Settings.bundle; sourceTree = "<group>"; };
|
||||
19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SelectTeamViewController.swift; sourceTree = "<group>"; };
|
||||
9961EC2D29BE9F2E00AF2C6F /* minimuxer-helpers.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; name = "minimuxer-helpers.swift"; path = "Dependencies/minimuxer/minimuxer-helpers.swift"; sourceTree = SOURCE_ROOT; };
|
||||
@@ -573,7 +602,6 @@
|
||||
BF41B807233433C100C593A3 /* LoadingState.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoadingState.swift; sourceTree = "<group>"; };
|
||||
BF42345825101C1D006D1EB2 /* WidgetView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = WidgetView.swift; sourceTree = "<group>"; };
|
||||
BF44EEEF246B08BA002A52F2 /* BackupController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = BackupController.swift; sourceTree = "<group>"; };
|
||||
BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; path = AltBackup.ipa; sourceTree = "<group>"; };
|
||||
BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RemoveAppOperation.swift; sourceTree = "<group>"; };
|
||||
BF45872B2298D31600BD7491 /* libimobiledevice.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libimobiledevice.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
||||
BF4587C82298D3A800BD7491 /* service.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = service.h; path = Dependencies/libimobiledevice/src/service.h; sourceTree = SOURCE_ROOT; };
|
||||
@@ -759,34 +787,6 @@
|
||||
BFD2479E2284FBD000981D42 /* UIColor+AltStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "UIColor+AltStore.swift"; sourceTree = "<group>"; };
|
||||
BFD44605241188C300EAB90A /* CodableServerError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = CodableServerError.swift; sourceTree = "<group>"; };
|
||||
BFD52BD222A06EFB000B7ED1 /* ALTConstants.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTConstants.h; sourceTree = "<group>"; };
|
||||
BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BE622A1A9CA000B7ED1 /* base64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BE722A1A9CA000B7ED1 /* hashtable.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BEA22A1A9CA000B7ED1 /* bplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BEB22A1A9CA000B7ED1 /* String.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BEC22A1A9CA000B7ED1 /* time64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BED22A1A9CA000B7ED1 /* plist.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BEE22A1A9CA000B7ED1 /* plist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF022A1A9CA000B7ED1 /* Date.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF322A1A9CA000B7ED1 /* Real.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF422A1A9CA000B7ED1 /* strbuf.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF522A1A9CA000B7ED1 /* bytearray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = Dependencies/libplist/src/bytearray.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF622A1A9CA000B7ED1 /* base64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF722A1A9CA000B7ED1 /* Data.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF822A1A9CB000B7ED1 /* Array.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BF922A1A9CB000B7ED1 /* Node.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52BFF22A1A9CB000B7ED1 /* time64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
|
||||
BFD52C0022A1A9CB000B7ED1 /* xplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52C1D22A1A9EC000B7ED1 /* node.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node.c; path = Dependencies/libplist/libcnary/node.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52C1E22A1A9EC000B7ED1 /* node_list.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node_list.c; path = Dependencies/libplist/libcnary/node_list.c; sourceTree = SOURCE_ROOT; };
|
||||
BFD52C1F22A1A9EC000B7ED1 /* cnary.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = cnary.c; path = Dependencies/libplist/libcnary/cnary.c; sourceTree = SOURCE_ROOT; };
|
||||
@@ -840,6 +840,7 @@
|
||||
D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorLogViewController.swift; sourceTree = "<group>"; };
|
||||
D58916FD28C7C55C00E39C8B /* LoggedError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoggedError.swift; sourceTree = "<group>"; };
|
||||
D593F1932717749A006E82DE /* PatchAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchAppOperation.swift; sourceTree = "<group>"; };
|
||||
D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ClearAppCacheOperation.swift; sourceTree = "<group>"; };
|
||||
D5CA0C4A280E141900469595 /* ManagedPatron.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ManagedPatron.swift; sourceTree = "<group>"; };
|
||||
D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 10.xcdatamodel"; sourceTree = "<group>"; };
|
||||
D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcmappingmodel; path = AltStore9ToAltStore10.xcmappingmodel; sourceTree = "<group>"; };
|
||||
@@ -1192,37 +1193,41 @@
|
||||
BF4588562298DC6D00BD7491 /* libplist */ = {
|
||||
isa = PBXGroup;
|
||||
children = (
|
||||
BFD52BE622A1A9CA000B7ED1 /* base64.c */,
|
||||
BFD52BEA22A1A9CA000B7ED1 /* bplist.c */,
|
||||
BFD52BF522A1A9CA000B7ED1 /* bytearray.c */,
|
||||
BFD52BE722A1A9CA000B7ED1 /* hashtable.c */,
|
||||
191E5FCF290A651D001A3B7C /* jplist.c */,
|
||||
191E5FD0290A651D001A3B7C /* jsmn.c */,
|
||||
BFD52BEE22A1A9CA000B7ED1 /* plist.c */,
|
||||
BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */,
|
||||
BFD52BEC22A1A9CA000B7ED1 /* time64.c */,
|
||||
BFD52C0022A1A9CB000B7ED1 /* xplist.c */,
|
||||
BFD52BF822A1A9CB000B7ED1 /* Array.cpp */,
|
||||
BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */,
|
||||
BFD52BF722A1A9CA000B7ED1 /* Data.cpp */,
|
||||
BFD52BF022A1A9CA000B7ED1 /* Date.cpp */,
|
||||
BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */,
|
||||
BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */,
|
||||
BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */,
|
||||
BFD52BF922A1A9CB000B7ED1 /* Node.cpp */,
|
||||
BFD52BF322A1A9CA000B7ED1 /* Real.cpp */,
|
||||
BFD52BEB22A1A9CA000B7ED1 /* String.cpp */,
|
||||
BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */,
|
||||
BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */,
|
||||
BFD52BF622A1A9CA000B7ED1 /* base64.h */,
|
||||
BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */,
|
||||
BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */,
|
||||
191E5FD1290A651D001A3B7C /* jsmn.h */,
|
||||
BFD52BED22A1A9CA000B7ED1 /* plist.h */,
|
||||
BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */,
|
||||
BFD52BF422A1A9CA000B7ED1 /* strbuf.h */,
|
||||
BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */,
|
||||
BFD52BFF22A1A9CB000B7ED1 /* time64.h */,
|
||||
0EA166462ADFE0D1003015C1 /* Dictionary.cpp */,
|
||||
0E1A1F902AE36A9600364CAD /* bytearray.c */,
|
||||
0EA166442ADFE0D1003015C1 /* bplist.c */,
|
||||
0EA166432ADFE0D1003015C1 /* Data.cpp */,
|
||||
0EA166422ADFE0D1003015C1 /* Date.cpp */,
|
||||
0EA1664F2ADFE0D1003015C1 /* hashtable.c */,
|
||||
0EA166532ADFE0D2003015C1 /* Integer.cpp */,
|
||||
0EA166562ADFE0D2003015C1 /* oplist.c */,
|
||||
0EA166522ADFE0D2003015C1 /* out-default.c */,
|
||||
0EA166472ADFE0D1003015C1 /* out-limd.c */,
|
||||
0EA166552ADFE0D2003015C1 /* out-plutil.c */,
|
||||
0EA166492ADFE0D1003015C1 /* String.cpp */,
|
||||
0EA1665A2ADFE0D2003015C1 /* Structure.cpp */,
|
||||
0EA166452ADFE0D1003015C1 /* Array.cpp */,
|
||||
0EA1664A2ADFE0D1003015C1 /* base64.c */,
|
||||
0EA166572ADFE0D2003015C1 /* jsmn.c */,
|
||||
0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */,
|
||||
0EA4B9BB2AE4A3F6009209CE /* plist.c */,
|
||||
0EA166412ADFE0D1003015C1 /* jplist.c */,
|
||||
0EA166582ADFE0D2003015C1 /* Key.cpp */,
|
||||
0EA166512ADFE0D2003015C1 /* ptrarray.c */,
|
||||
0EA1664C2ADFE0D1003015C1 /* time64.c */,
|
||||
0EA166502ADFE0D2003015C1 /* Node.cpp */,
|
||||
0EA166542ADFE0D2003015C1 /* Real.cpp */,
|
||||
0EA1664B2ADFE0D1003015C1 /* Uid.cpp */,
|
||||
0EA166592ADFE0D2003015C1 /* xplist.c */,
|
||||
0EA166662ADFE122003015C1 /* base64.h */,
|
||||
0EA166652ADFE122003015C1 /* hashtable.h */,
|
||||
0EA166632ADFE122003015C1 /* jsmn.h */,
|
||||
0EA166642ADFE122003015C1 /* plist.h */,
|
||||
0EA166612ADFE122003015C1 /* bytearray.h */,
|
||||
0EA166622ADFE122003015C1 /* ptrarray.h */,
|
||||
0EA166672ADFE122003015C1 /* strbuf.h */,
|
||||
0EA1665F2ADFE122003015C1 /* time64_limits.h */,
|
||||
0EA166602ADFE122003015C1 /* time64.h */,
|
||||
BF4588892298DDEA00BD7491 /* libcnary */,
|
||||
);
|
||||
path = libplist;
|
||||
@@ -1619,7 +1624,7 @@
|
||||
BFD247962284D7C100981D42 /* Resources */ = {
|
||||
isa = PBXGroup;
|
||||
children = (
|
||||
BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */,
|
||||
0E764E162ADFF5740043DD4E /* AltBackup.ipa */,
|
||||
BFD247762284B9A700981D42 /* Assets.xcassets */,
|
||||
BF770E6822BD57DD002A40FE /* Silence.m4a */,
|
||||
);
|
||||
@@ -1694,6 +1699,7 @@
|
||||
D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */,
|
||||
D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */,
|
||||
D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */,
|
||||
D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */,
|
||||
BF7B44062725A4B8005288A4 /* Patch App */,
|
||||
);
|
||||
path = Operations;
|
||||
@@ -1780,32 +1786,26 @@
|
||||
isa = PBXHeadersBuildPhase;
|
||||
buildActionMask = 2147483647;
|
||||
files = (
|
||||
0EA166682ADFE122003015C1 /* jsmn.h in Headers */,
|
||||
BF4588112298D3AB00BD7491 /* misagent.h in Headers */,
|
||||
BF4588042298D3AB00BD7491 /* lockdown.h in Headers */,
|
||||
BF45880B2298D3AB00BD7491 /* mobilesync.h in Headers */,
|
||||
BF4588002298D3AB00BD7491 /* restore.h in Headers */,
|
||||
BF4588152298D3AB00BD7491 /* mobilebackup.h in Headers */,
|
||||
BF4588182298D3AB00BD7491 /* syslog_relay.h in Headers */,
|
||||
BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */,
|
||||
BF45881D2298D3AB00BD7491 /* file_relay.h in Headers */,
|
||||
BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */,
|
||||
BF4587FD2298D3AB00BD7491 /* sbservices.h in Headers */,
|
||||
BF4588362298D3C100BD7491 /* debug.h in Headers */,
|
||||
BF4588202298D3AB00BD7491 /* mobile_image_mounter.h in Headers */,
|
||||
BF4588122298D3AB00BD7491 /* house_arrest.h in Headers */,
|
||||
BF45881F2298D3AB00BD7491 /* device_link_service.h in Headers */,
|
||||
BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */,
|
||||
BF45880E2298D3AB00BD7491 /* debugserver.h in Headers */,
|
||||
BF4588102298D3AB00BD7491 /* heartbeat.h in Headers */,
|
||||
BF4587FA2298D3AB00BD7491 /* diagnostics_relay.h in Headers */,
|
||||
BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */,
|
||||
BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */,
|
||||
BF4588192298D3AB00BD7491 /* webinspector.h in Headers */,
|
||||
BF4588342298D3C100BD7491 /* userpref.h in Headers */,
|
||||
BF45880A2298D3AB00BD7491 /* screenshotr.h in Headers */,
|
||||
BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */,
|
||||
BF4587FE2298D3AB00BD7491 /* mobilebackup2.h in Headers */,
|
||||
BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */,
|
||||
BF45881C2298D3AB00BD7491 /* afc.h in Headers */,
|
||||
BF45881A2298D3AB00BD7491 /* mobileactivation.h in Headers */,
|
||||
BF4588052298D3AB00BD7491 /* idevice.h in Headers */,
|
||||
@@ -1813,7 +1813,6 @@
|
||||
BF4587F82298D3AB00BD7491 /* service.h in Headers */,
|
||||
BF4588252298D3AB00BD7491 /* property_list_service.h in Headers */,
|
||||
BF4588132298D3AB00BD7491 /* notification_proxy.h in Headers */,
|
||||
BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */,
|
||||
);
|
||||
runOnlyForDeploymentPostprocessing = 0;
|
||||
};
|
||||
@@ -2209,7 +2208,6 @@
|
||||
BFE60738231ADF49002B0E8E /* Settings.storyboard in Resources */,
|
||||
D57DF638271E32F000677701 /* PatchApp.storyboard in Resources */,
|
||||
BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */,
|
||||
BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */,
|
||||
BF770E6922BD57DD002A40FE /* Silence.m4a in Resources */,
|
||||
BFD247772284B9A700981D42 /* Assets.xcassets in Resources */,
|
||||
1920B04F2924AC8300744F60 /* Settings.bundle in Resources */,
|
||||
@@ -2217,6 +2215,7 @@
|
||||
BFB6B22423187A3D0022A802 /* NewsCollectionViewCell.xib in Resources */,
|
||||
BFD247752284B9A500981D42 /* Main.storyboard in Resources */,
|
||||
BFDB5B2622EFBBEA00F74113 /* BrowseCollectionViewCell.xib in Resources */,
|
||||
0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */,
|
||||
BFE6073C231AE1E7002B0E8E /* SettingsHeaderFooterView.xib in Resources */,
|
||||
BF29012F2318F6B100D88A45 /* AppBannerView.xib in Resources */,
|
||||
BFE6325A22A83BEB00F30809 /* Authentication.storyboard in Resources */,
|
||||
@@ -2292,69 +2291,73 @@
|
||||
isa = PBXSourcesBuildPhase;
|
||||
buildActionMask = 2147483647;
|
||||
files = (
|
||||
0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */,
|
||||
0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */,
|
||||
0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */,
|
||||
0EA166742ADFE140003015C1 /* Date.cpp in Sources */,
|
||||
0EA166712ADFE140003015C1 /* Key.cpp in Sources */,
|
||||
0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */,
|
||||
0EA1666A2ADFE140003015C1 /* String.cpp in Sources */,
|
||||
0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */,
|
||||
0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */,
|
||||
0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */,
|
||||
0EA166702ADFE140003015C1 /* Node.cpp in Sources */,
|
||||
0EA166752ADFE140003015C1 /* Real.cpp in Sources */,
|
||||
0EA166762ADFE140003015C1 /* base64.c in Sources */,
|
||||
0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */,
|
||||
BF45881B2298D3AB00BD7491 /* house_arrest.c in Sources */,
|
||||
BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */,
|
||||
0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */,
|
||||
BF4588232298D3AB00BD7491 /* mobilesync.c in Sources */,
|
||||
BF4588072298D3AB00BD7491 /* afc.c in Sources */,
|
||||
191E607D290B2EA5001A3B7C /* jsmn.c in Sources */,
|
||||
191E607E290B2EA7001A3B7C /* jplist.c in Sources */,
|
||||
BF4588082298D3AB00BD7491 /* mobile_image_mounter.c in Sources */,
|
||||
BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */,
|
||||
BF4588022298D3AB00BD7491 /* file_relay.c in Sources */,
|
||||
BF45880F2298D3AB00BD7491 /* debugserver.c in Sources */,
|
||||
0EA166792ADFE140003015C1 /* bplist.c in Sources */,
|
||||
0EA166772ADFE140003015C1 /* jplist.c in Sources */,
|
||||
BF4588162298D3AB00BD7491 /* restore.c in Sources */,
|
||||
BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */,
|
||||
BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */,
|
||||
BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */,
|
||||
BF4588092298D3AB00BD7491 /* installation_proxy.c in Sources */,
|
||||
0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */,
|
||||
0EA1667E2ADFE140003015C1 /* time64.c in Sources */,
|
||||
BF4587FF2298D3AB00BD7491 /* heartbeat.c in Sources */,
|
||||
BF4588222298D3AB00BD7491 /* mobileactivation.c in Sources */,
|
||||
BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */,
|
||||
BF4588212298D3AB00BD7491 /* idevice.c in Sources */,
|
||||
B343F885295F7C5D002B1159 /* tlv.c in Sources */,
|
||||
BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */,
|
||||
BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */,
|
||||
B343F87D295F7C5D002B1159 /* cbuf.c in Sources */,
|
||||
BF4588062298D3AB00BD7491 /* webinspector.c in Sources */,
|
||||
BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */,
|
||||
B343F883295F7C5D002B1159 /* thread.c in Sources */,
|
||||
BF45880D2298D3AB00BD7491 /* mobilebackup.c in Sources */,
|
||||
BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */,
|
||||
BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */,
|
||||
BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */,
|
||||
BF45883A2298D3C100BD7491 /* debug.c in Sources */,
|
||||
B343F881295F7C5D002B1159 /* termcolors.c in Sources */,
|
||||
0EA1667D2ADFE140003015C1 /* xplist.c in Sources */,
|
||||
B343F87E295F7C5D002B1159 /* collection.c in Sources */,
|
||||
BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */,
|
||||
B33FFBAA295F8F78002259E6 /* preboard.c in Sources */,
|
||||
B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */,
|
||||
BF4587FB2298D3AB00BD7491 /* notification_proxy.c in Sources */,
|
||||
BF4588352298D3C100BD7491 /* userpref.c in Sources */,
|
||||
BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */,
|
||||
0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */,
|
||||
B343F87C295F7C5D002B1159 /* opack.c in Sources */,
|
||||
BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */,
|
||||
BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */,
|
||||
B343F884295F7C5D002B1159 /* utils.c in Sources */,
|
||||
BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */,
|
||||
B343F87F295F7C5D002B1159 /* glue.c in Sources */,
|
||||
BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */,
|
||||
BF4588242298D3AB00BD7491 /* property_list_service.c in Sources */,
|
||||
BF45881E2298D3AB00BD7491 /* misagent.c in Sources */,
|
||||
0EA166692ADFE140003015C1 /* Array.cpp in Sources */,
|
||||
B343F880295F7C5D002B1159 /* socket.c in Sources */,
|
||||
BF4587FC2298D3AB00BD7491 /* sbservices.c in Sources */,
|
||||
BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */,
|
||||
0EA166782ADFE140003015C1 /* jsmn.c in Sources */,
|
||||
BF4588142298D3AB00BD7491 /* device_link_service.c in Sources */,
|
||||
BF4588172298D3AB00BD7491 /* screenshotr.c in Sources */,
|
||||
BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */,
|
||||
BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */,
|
||||
BF4588432298D40000BD7491 /* libusbmuxd.c in Sources */,
|
||||
0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */,
|
||||
0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */,
|
||||
BF4588032298D3AB00BD7491 /* syslog_relay.c in Sources */,
|
||||
BF4588272298D3AB00BD7491 /* service.c in Sources */,
|
||||
BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */,
|
||||
BF4588262298D3AB00BD7491 /* lockdown.c in Sources */,
|
||||
BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */,
|
||||
BF45880C2298D3AB00BD7491 /* mobilebackup2.c in Sources */,
|
||||
BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */,
|
||||
0EA4B9BC2AE4A414009209CE /* plist.c in Sources */,
|
||||
);
|
||||
runOnlyForDeploymentPostprocessing = 0;
|
||||
};
|
||||
@@ -2504,6 +2507,7 @@
|
||||
BFD6B03322DFF20800B86064 /* MyAppsComponents.swift in Sources */,
|
||||
BF41B808233433C100C593A3 /* LoadingState.swift in Sources */,
|
||||
BFF0B69A2322D7D0007A79E1 /* UIScreen+CompactHeight.swift in Sources */,
|
||||
D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */,
|
||||
D5F2F6A92720B7C20081CCF5 /* PatchViewController.swift in Sources */,
|
||||
B39F16132918D7C5002E9404 /* Consts.swift in Sources */,
|
||||
BF8F69C222E659F700049BA1 /* AppContentViewController.swift in Sources */,
|
||||
@@ -3224,6 +3228,7 @@
|
||||
"$(PROJECT_DIR)/Dependencies/libfragmentzip",
|
||||
"$(PROJECT_DIR)/Dependencies/libcurl",
|
||||
);
|
||||
OTHER_LDFLAGS = "";
|
||||
PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
|
||||
PRODUCT_NAME = "$(TARGET_NAME)";
|
||||
PROVISIONING_PROFILE_SPECIFIER = "";
|
||||
@@ -3258,6 +3263,7 @@
|
||||
"$(PROJECT_DIR)/Dependencies/libfragmentzip",
|
||||
"$(PROJECT_DIR)/Dependencies/libcurl",
|
||||
);
|
||||
OTHER_LDFLAGS = "";
|
||||
PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
|
||||
PRODUCT_NAME = "$(TARGET_NAME)";
|
||||
PROVISIONING_PROFILE_SPECIFIER = "";
|
||||
|
||||
@@ -6,7 +6,7 @@
|
||||
"location" : "https://github.com/SideStore/AltSign",
|
||||
"state" : {
|
||||
"branch" : "master",
|
||||
"revision" : "602b1aded00b08e82a2ddb802b3cde6817ba7156"
|
||||
"revision" : "cc6189f0f7cd8e5bd24943af9322e0ff9420e9f4"
|
||||
}
|
||||
},
|
||||
{
|
||||
@@ -14,8 +14,8 @@
|
||||
"kind" : "remoteSourceControl",
|
||||
"location" : "https://github.com/microsoft/appcenter-sdk-apple.git",
|
||||
"state" : {
|
||||
"revision" : "8354a50fe01a7e54e196d3b5493b5ab53dd5866a",
|
||||
"version" : "4.4.2"
|
||||
"revision" : "b2dc99cfedead0bad4e6573d86c5228c89cff332",
|
||||
"version" : "4.4.3"
|
||||
}
|
||||
},
|
||||
{
|
||||
@@ -59,8 +59,8 @@
|
||||
"kind" : "remoteSourceControl",
|
||||
"location" : "https://github.com/krzyzanowskim/OpenSSL",
|
||||
"state" : {
|
||||
"revision" : "0c70e4b7d22411a7fe3ff59b913d5b760b735ce1",
|
||||
"version" : "1.1.2100"
|
||||
"revision" : "0faf71a188bcfdf0245cab42886b9b240ca71c52",
|
||||
"version" : "1.1.2200"
|
||||
}
|
||||
},
|
||||
{
|
||||
@@ -68,8 +68,8 @@
|
||||
"kind" : "remoteSourceControl",
|
||||
"location" : "https://github.com/microsoft/PLCrashReporter.git",
|
||||
"state" : {
|
||||
"revision" : "6b27393cad517c067dceea85fadf050e70c4ceaa",
|
||||
"version" : "1.10.1"
|
||||
"revision" : "81cdec2b3827feb03286cb297f4c501a8eb98df1",
|
||||
"version" : "1.10.2"
|
||||
}
|
||||
},
|
||||
{
|
||||
@@ -77,8 +77,8 @@
|
||||
"kind" : "remoteSourceControl",
|
||||
"location" : "https://github.com/SwiftPackageIndex/SemanticVersion.git",
|
||||
"state" : {
|
||||
"revision" : "fc670910dc0903cc269b3d0b776cda5703979c4e",
|
||||
"version" : "0.3.5"
|
||||
"revision" : "a70840d5fca686ae3bd2fcf8aecc5ded0bd4f125",
|
||||
"version" : "0.3.6"
|
||||
}
|
||||
},
|
||||
{
|
||||
@@ -86,8 +86,8 @@
|
||||
"kind" : "remoteSourceControl",
|
||||
"location" : "https://github.com/sparkle-project/Sparkle.git",
|
||||
"state" : {
|
||||
"revision" : "286edd1fa22505a9e54d170e9fd07d775ea233f2",
|
||||
"version" : "2.1.0"
|
||||
"revision" : "f0ceaf5cc9f3f23daa0ccb6dcebd79fc96ccc7d9",
|
||||
"version" : "2.5.0"
|
||||
}
|
||||
},
|
||||
{
|
||||
@@ -95,8 +95,8 @@
|
||||
"kind" : "remoteSourceControl",
|
||||
"location" : "https://github.com/daltoniam/Starscream.git",
|
||||
"state" : {
|
||||
"revision" : "df8d82047f6654d8e4b655d1b1525c64e1059d21",
|
||||
"version" : "4.0.4"
|
||||
"revision" : "ac6c0fc9da221873e01bd1a0d4818498a71eef33",
|
||||
"version" : "4.0.6"
|
||||
}
|
||||
},
|
||||
{
|
||||
|
||||
@@ -90,14 +90,21 @@ private extension AppIDsViewController
|
||||
cell.bannerView.button.isUserInteractionEnabled = false
|
||||
|
||||
cell.bannerView.buttonLabel.isHidden = false
|
||||
|
||||
|
||||
let currentDate = Date()
|
||||
|
||||
let numberOfDays = expirationDate.numberOfCalendarDays(since: currentDate)
|
||||
let numberOfDaysText = (numberOfDays == 1) ? NSLocalizedString("1 day", comment: "") : String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
|
||||
cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
|
||||
let formatter = DateComponentsFormatter()
|
||||
formatter.unitsStyle = .full
|
||||
formatter.includesApproximationPhrase = false
|
||||
formatter.includesTimeRemainingPhrase = false
|
||||
formatter.allowedUnits = [.minute, .hour, .day]
|
||||
formatter.maximumUnitCount = 1
|
||||
|
||||
attributedAccessibilityLabel.mutableString.append(String(format: NSLocalizedString("Expires in %@.", comment: ""), numberOfDaysText) + " ")
|
||||
cell.bannerView.button.setTitle((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")).uppercased(), for: .normal)
|
||||
|
||||
// formatter.includesTimeRemainingPhrase = true
|
||||
|
||||
// attributedAccessibilityLabel.mutableString.append((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " ")
|
||||
}
|
||||
else
|
||||
{
|
||||
|
||||
@@ -8,6 +8,7 @@
|
||||
|
||||
import UIKit
|
||||
|
||||
import minimuxer
|
||||
import AltStoreCore
|
||||
import Roxas
|
||||
|
||||
@@ -77,7 +78,7 @@ private extension BrowseViewController
|
||||
NSSortDescriptor(keyPath: \StoreApp.name, ascending: true),
|
||||
NSSortDescriptor(keyPath: \StoreApp.bundleIdentifier, ascending: true)]
|
||||
fetchRequest.returnsObjectsAsFaults = false
|
||||
fetchRequest.predicate = NSPredicate(format: "%K != %@", #keyPath(StoreApp.bundleIdentifier), StoreApp.altstoreAppID)
|
||||
fetchRequest.predicate = NSPredicate(format: "%K != %@", #keyPath(StoreApp.sourceIdentifier), Source.altStoreIdentifier)
|
||||
|
||||
let dataSource = RSTFetchedResultsCollectionViewPrefetchingDataSource<StoreApp, UIImage>(fetchRequest: fetchRequest, managedObjectContext: DatabaseManager.shared.viewContext)
|
||||
dataSource.cellConfigurationHandler = { (cell, app, indexPath) in
|
||||
@@ -264,7 +265,13 @@ private extension BrowseViewController
|
||||
previousProgress?.cancel()
|
||||
return
|
||||
}
|
||||
|
||||
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
|
||||
_ = AppManager.shared.install(app, presentingViewController: self) { (result) in
|
||||
DispatchQueue.main.async {
|
||||
switch result
|
||||
|
||||
@@ -4,8 +4,8 @@
|
||||
<dict>
|
||||
<key>ALTAppGroups</key>
|
||||
<array>
|
||||
<string>group.com.SideStore.SideStore</string>
|
||||
<string>group.$(APP_GROUP_IDENTIFIER)</string>
|
||||
<string>group.com.SideStore.SideStore</string>
|
||||
</array>
|
||||
<key>ALTDeviceID</key>
|
||||
<string>00008101-000129D63698001E</string>
|
||||
|
||||
@@ -81,7 +81,7 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
|
||||
} else {
|
||||
// Show an alert explaining the pairing file
|
||||
// Create new Alert
|
||||
let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/install#pairing-process", preferredStyle: .alert)
|
||||
let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/getting-started/#pairing-file", preferredStyle: .alert)
|
||||
|
||||
// Create OK button with action handler
|
||||
let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
|
||||
@@ -155,7 +155,12 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
|
||||
try! FileManager.default.removeItem(at: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)"))
|
||||
displayError("minimuxer failed to start, please restart SideStore. \((error as? LocalizedError)?.failureReason ?? "UNKNOWN ERROR!!!!!! REPORT TO GITHUB ISSUES!")")
|
||||
}
|
||||
start_auto_mounter(documentsDirectory)
|
||||
if #available(iOS 17, *) {
|
||||
// TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
|
||||
}
|
||||
else {
|
||||
start_auto_mounter(documentsDirectory)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -307,6 +307,16 @@ extension AppManager
|
||||
presentingViewController.present(alertController, animated: true, completion: nil)
|
||||
}
|
||||
}
|
||||
|
||||
func clearAppCache(completion: @escaping (Result<Void, Error>) -> Void)
|
||||
{
|
||||
let clearAppCacheOperation = ClearAppCacheOperation()
|
||||
clearAppCacheOperation.resultHandler = { result in
|
||||
completion(result)
|
||||
}
|
||||
|
||||
self.run([clearAppCacheOperation], context: nil)
|
||||
}
|
||||
}
|
||||
|
||||
extension AppManager
|
||||
@@ -754,6 +764,12 @@ extension AppManager
|
||||
let progress = self.refreshProgress[app.bundleIdentifier]
|
||||
return progress
|
||||
}
|
||||
|
||||
func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
|
||||
{
|
||||
let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
|
||||
return isActivelyManaging
|
||||
}
|
||||
}
|
||||
|
||||
extension AppManager
|
||||
@@ -808,12 +824,6 @@ private extension AppManager
|
||||
}
|
||||
}
|
||||
|
||||
func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
|
||||
{
|
||||
let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
|
||||
return isActivelyManaging
|
||||
}
|
||||
|
||||
@discardableResult
|
||||
private func perform(_ operations: [AppOperation], presentingViewController: UIViewController?, group: RefreshGroup) -> RefreshGroup
|
||||
{
|
||||
@@ -948,7 +958,13 @@ private extension AppManager
|
||||
}
|
||||
else
|
||||
{
|
||||
DispatchQueue.main.schedule {
|
||||
UIApplication.shared.isIdleTimerDisabled = UserDefaults.standard.isIdleTimeoutDisableEnabled
|
||||
}
|
||||
performAppOperations()
|
||||
DispatchQueue.main.schedule {
|
||||
UIApplication.shared.isIdleTimerDisabled = false
|
||||
}
|
||||
}
|
||||
|
||||
return group
|
||||
@@ -1027,6 +1043,32 @@ private extension AppManager
|
||||
verifyOperation.addDependency(downloadOperation)
|
||||
|
||||
|
||||
/* Refresh Anisette Data */
|
||||
let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
|
||||
refreshAnisetteDataOperation.resultHandler = { (result) in
|
||||
switch result
|
||||
{
|
||||
case .failure(let error): context.error = error
|
||||
case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
|
||||
}
|
||||
}
|
||||
refreshAnisetteDataOperation.addDependency(verifyOperation)
|
||||
|
||||
|
||||
/* Fetch Provisioning Profiles */
|
||||
let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
|
||||
fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
|
||||
fetchProvisioningProfilesOperation.resultHandler = { (result) in
|
||||
switch result
|
||||
{
|
||||
case .failure(let error): context.error = error
|
||||
case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
|
||||
}
|
||||
}
|
||||
fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
|
||||
progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
|
||||
|
||||
|
||||
/* Deactivate Apps (if necessary) */
|
||||
let deactivateAppsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
|
||||
do
|
||||
@@ -1042,6 +1084,12 @@ private extension AppManager
|
||||
{
|
||||
throw error
|
||||
}
|
||||
|
||||
guard let profiles = context.provisioningProfiles else { throw OperationError.invalidParameters }
|
||||
if !profiles.contains(where: { $1.isFreeProvisioningProfile == true }) {
|
||||
operation.finish()
|
||||
return
|
||||
}
|
||||
|
||||
guard let app = context.app, let presentingViewController = context.authenticatedContext.presentingViewController else { throw OperationError.invalidParameters }
|
||||
|
||||
@@ -1061,7 +1109,7 @@ private extension AppManager
|
||||
operation.finish()
|
||||
}
|
||||
}
|
||||
deactivateAppsOperation.addDependency(verifyOperation)
|
||||
deactivateAppsOperation.addDependency(fetchProvisioningProfilesOperation)
|
||||
|
||||
|
||||
/* Patch App */
|
||||
@@ -1136,32 +1184,6 @@ private extension AppManager
|
||||
patchAppOperation.addDependency(deactivateAppsOperation)
|
||||
|
||||
|
||||
/* Refresh Anisette Data */
|
||||
let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
|
||||
refreshAnisetteDataOperation.resultHandler = { (result) in
|
||||
switch result
|
||||
{
|
||||
case .failure(let error): context.error = error
|
||||
case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
|
||||
}
|
||||
}
|
||||
refreshAnisetteDataOperation.addDependency(patchAppOperation)
|
||||
|
||||
|
||||
/* Fetch Provisioning Profiles */
|
||||
let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
|
||||
fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
|
||||
fetchProvisioningProfilesOperation.resultHandler = { (result) in
|
||||
switch result
|
||||
{
|
||||
case .failure(let error): context.error = error
|
||||
case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
|
||||
}
|
||||
}
|
||||
fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
|
||||
progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
|
||||
|
||||
|
||||
/* Resign */
|
||||
let resignAppOperation = ResignAppOperation(context: context)
|
||||
resignAppOperation.resultHandler = { (result) in
|
||||
@@ -1171,7 +1193,7 @@ private extension AppManager
|
||||
case .success(let resignedApp): context.resignedApp = resignedApp
|
||||
}
|
||||
}
|
||||
resignAppOperation.addDependency(fetchProvisioningProfilesOperation)
|
||||
resignAppOperation.addDependency(patchAppOperation)
|
||||
progress.addChild(resignAppOperation.progress, withPendingUnitCount: 20)
|
||||
|
||||
|
||||
@@ -1214,7 +1236,7 @@ private extension AppManager
|
||||
progress.addChild(installOperation.progress, withPendingUnitCount: 30)
|
||||
installOperation.addDependency(sendAppOperation)
|
||||
|
||||
let operations = [downloadOperation, verifyOperation, deactivateAppsOperation, patchAppOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, resignAppOperation, sendAppOperation, installOperation]
|
||||
let operations = [downloadOperation, verifyOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, deactivateAppsOperation, patchAppOperation, resignAppOperation, sendAppOperation, installOperation]
|
||||
group.add(operations)
|
||||
self.run(operations, context: group.context)
|
||||
|
||||
|
||||
@@ -15,6 +15,7 @@ import UniformTypeIdentifiers
|
||||
import AltStoreCore
|
||||
import AltSign
|
||||
import Roxas
|
||||
import minimuxer
|
||||
|
||||
import Nuke
|
||||
|
||||
@@ -328,21 +329,25 @@ private extension MyAppsViewController
|
||||
let currentDate = Date()
|
||||
|
||||
let numberOfDays = installedApp.expirationDate.numberOfCalendarDays(since: currentDate)
|
||||
let numberOfDaysText: String
|
||||
|
||||
if numberOfDays == 1
|
||||
{
|
||||
numberOfDaysText = NSLocalizedString("1 day", comment: "")
|
||||
}
|
||||
else
|
||||
{
|
||||
numberOfDaysText = String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
|
||||
}
|
||||
let formatter = DateComponentsFormatter()
|
||||
formatter.unitsStyle = .full
|
||||
formatter.includesApproximationPhrase = false
|
||||
formatter.includesTimeRemainingPhrase = false
|
||||
|
||||
formatter.allowedUnits = [.day, .hour, .minute]
|
||||
|
||||
formatter.maximumUnitCount = 1
|
||||
|
||||
|
||||
|
||||
cell.bannerView.button.setTitle(formatter.string(from: currentDate, to: installedApp.expirationDate)?.uppercased(), for: .normal)
|
||||
|
||||
cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
|
||||
cell.bannerView.button.accessibilityLabel = String(format: NSLocalizedString("Refresh %@", comment: ""), installedApp.name)
|
||||
|
||||
cell.bannerView.accessibilityLabel? += ". " + String(format: NSLocalizedString("Expires in %@", comment: ""), numberOfDaysText)
|
||||
|
||||
formatter.includesTimeRemainingPhrase = true
|
||||
|
||||
cell.bannerView.accessibilityLabel? += ". " + (formatter.string(from: currentDate, to: installedApp.expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " "
|
||||
|
||||
// Make sure refresh button is correct size.
|
||||
cell.layoutIfNeeded()
|
||||
@@ -640,6 +645,12 @@ private extension MyAppsViewController
|
||||
|
||||
@IBAction func refreshAllApps(_ sender: UIBarButtonItem)
|
||||
{
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
|
||||
self.isRefreshingAllApps = true
|
||||
self.collectionView.collectionViewLayout.invalidateLayout()
|
||||
|
||||
@@ -702,6 +713,12 @@ private extension MyAppsViewController
|
||||
|
||||
@IBAction func sideloadApp(_ sender: UIBarButtonItem)
|
||||
{
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
|
||||
let supportedTypes = UTType.types(tag: "ipa", tagClass: .filenameExtension, conformingTo: nil)
|
||||
|
||||
let documentPickerViewController = UIDocumentPickerViewController(forOpeningContentTypes: supportedTypes, asCopy: true)
|
||||
@@ -1006,6 +1023,12 @@ private extension MyAppsViewController
|
||||
|
||||
func refresh(_ installedApp: InstalledApp)
|
||||
{
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
|
||||
let previousProgress = AppManager.shared.refreshProgress(for: installedApp)
|
||||
guard previousProgress == nil else {
|
||||
previousProgress?.cancel()
|
||||
@@ -1027,6 +1050,12 @@ private extension MyAppsViewController
|
||||
|
||||
func activate(_ installedApp: InstalledApp)
|
||||
{
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
|
||||
func finish(_ result: Result<InstalledApp, Error>)
|
||||
{
|
||||
do
|
||||
@@ -1103,6 +1132,11 @@ private extension MyAppsViewController
|
||||
func deactivate(_ installedApp: InstalledApp, completionHandler: ((Result<InstalledApp, Error>) -> Void)? = nil)
|
||||
{
|
||||
guard installedApp.isActive else { return }
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
installedApp.isActive = false
|
||||
|
||||
AppManager.shared.deactivate(installedApp, presentingViewController: self) { (result) in
|
||||
@@ -1164,6 +1198,11 @@ private extension MyAppsViewController
|
||||
|
||||
func backup(_ installedApp: InstalledApp)
|
||||
{
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
let title = NSLocalizedString("Start Backup?", comment: "")
|
||||
let message = NSLocalizedString("This will replace any previous backups. Please leave SideStore open until the backup is complete.", comment: "")
|
||||
|
||||
@@ -1203,6 +1242,11 @@ private extension MyAppsViewController
|
||||
|
||||
func restore(_ installedApp: InstalledApp)
|
||||
{
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
let message = String(format: NSLocalizedString("This will replace all data you currently have in %@.", comment: ""), installedApp.name)
|
||||
let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to restore this backup?", comment: ""), message: message, preferredStyle: .actionSheet)
|
||||
alertController.addAction(.cancel)
|
||||
@@ -1306,6 +1350,16 @@ private extension MyAppsViewController
|
||||
@available(iOS 14, *)
|
||||
func enableJIT(for installedApp: InstalledApp)
|
||||
{
|
||||
if #available(iOS 17, *) {
|
||||
let toastView = ToastView(error: OperationError.tooNewError)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
if !minimuxer.ready() {
|
||||
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||
toastView.show(in: self)
|
||||
return
|
||||
}
|
||||
AppManager.shared.enableJIT(for: installedApp) { result in
|
||||
DispatchQueue.main.async {
|
||||
switch result
|
||||
@@ -1313,7 +1367,7 @@ private extension MyAppsViewController
|
||||
case .success: break
|
||||
case .failure(let error):
|
||||
let toastView = ToastView(error: error)
|
||||
toastView.show(in: self)
|
||||
toastView.show(in: self.navigationController?.view ?? self.view, duration: 5)
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1460,7 +1514,7 @@ extension MyAppsViewController
|
||||
let registeredAppIDs = team.appIDs.count
|
||||
|
||||
let maximumAppIDCount = 10
|
||||
let remainingAppIDs = max(maximumAppIDCount - registeredAppIDs, 0)
|
||||
let remainingAppIDs = maximumAppIDCount - registeredAppIDs
|
||||
|
||||
if remainingAppIDs == 1
|
||||
{
|
||||
@@ -1471,7 +1525,7 @@ extension MyAppsViewController
|
||||
footerView.textLabel.text = String(format: NSLocalizedString("%@ App IDs Remaining", comment: ""), NSNumber(value: remainingAppIDs))
|
||||
}
|
||||
|
||||
footerView.textLabel.isHidden = false
|
||||
footerView.textLabel.isHidden = remainingAppIDs < 0
|
||||
|
||||
case .individual, .organization, .unknown: footerView.textLabel.isHidden = true
|
||||
@unknown default: break
|
||||
|
||||
@@ -12,6 +12,7 @@ import Network
|
||||
|
||||
import AltStoreCore
|
||||
import AltSign
|
||||
import minimuxer
|
||||
|
||||
enum AuthenticationError: LocalizedError
|
||||
{
|
||||
@@ -593,7 +594,7 @@ private extension AuthenticationOperation
|
||||
|
||||
func registerCurrentDevice(for team: ALTTeam, session: ALTAppleAPISession, completionHandler: @escaping (Result<ALTDevice, Error>) -> Void)
|
||||
{
|
||||
guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else {
|
||||
guard let udid = fetch_udid()?.toString() else {
|
||||
return completionHandler(.failure(OperationError.unknownUDID))
|
||||
}
|
||||
|
||||
|
||||
@@ -105,8 +105,13 @@ final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<Inst
|
||||
} catch {
|
||||
self.finish(.failure(error))
|
||||
}
|
||||
start_auto_mounter(documentsDirectory)
|
||||
|
||||
if #available(iOS 17, *) {
|
||||
// TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
|
||||
}
|
||||
else {
|
||||
start_auto_mounter(documentsDirectory)
|
||||
}
|
||||
|
||||
self.managedObjectContext.perform {
|
||||
print("Apps to refresh:", self.installedApps.map(\.bundleIdentifier))
|
||||
|
||||
|
||||
@@ -55,9 +55,8 @@ class BackupAppOperation: ResultOperation<Void>
|
||||
let appName = installedApp.name
|
||||
self.appName = appName
|
||||
|
||||
guard let altstoreApp = InstalledApp.fetchAltStore(in: context) else { throw OperationError.appNotFound }
|
||||
let altstoreOpenURL = altstoreApp.openAppURL
|
||||
|
||||
let altstoreOpenURL = URL(string: "sidestore://")!
|
||||
|
||||
var returnURLComponents = URLComponents(url: altstoreOpenURL, resolvingAgainstBaseURL: false)
|
||||
returnURLComponents?.host = "appBackupResponse"
|
||||
guard let returnURL = returnURLComponents?.url else { throw OperationError.openAppFailed(name: appName) }
|
||||
|
||||
208
AltStore/Operations/ClearAppCacheOperation.swift
Normal file
208
AltStore/Operations/ClearAppCacheOperation.swift
Normal file
@@ -0,0 +1,208 @@
|
||||
//
|
||||
// ClearAppCacheOperation.swift
|
||||
// AltStore
|
||||
//
|
||||
// Created by Riley Testut on 9/27/22.
|
||||
// Copyright © 2022 Riley Testut. All rights reserved.
|
||||
//
|
||||
|
||||
import Foundation
|
||||
import AltStoreCore
|
||||
/*
|
||||
struct BatchError: ALTLocalizedError
|
||||
{
|
||||
|
||||
enum Code: Int, ALTErrorCode
|
||||
{
|
||||
typealias Error = BatchError
|
||||
|
||||
case batchError
|
||||
}
|
||||
|
||||
var code: Code = .batchError
|
||||
var underlyingErrors: [Error]
|
||||
|
||||
var errorTitle: String?
|
||||
var errorFailure: String?
|
||||
|
||||
init(errors: [Error])
|
||||
{
|
||||
self.underlyingErrors = errors
|
||||
}
|
||||
|
||||
var errorFailureReason: String {
|
||||
guard !self.underlyingErrors.isEmpty else { return NSLocalizedString("An unknown error occured.", comment: "") }
|
||||
|
||||
let errorMessages = self.underlyingErrors.map { $0.localizedDescription }
|
||||
|
||||
let message = errorMessages.joined(separator: "\n\n")
|
||||
return message
|
||||
}
|
||||
}
|
||||
*/
|
||||
@objc(ClearAppCacheOperation)
|
||||
class ClearAppCacheOperation: ResultOperation<Void>
|
||||
{
|
||||
private let coordinator = NSFileCoordinator()
|
||||
private let coordinatorQueue = OperationQueue()
|
||||
|
||||
override init()
|
||||
{
|
||||
self.coordinatorQueue.name = "AltStore - ClearAppCacheOperation Queue"
|
||||
}
|
||||
|
||||
override func main()
|
||||
{
|
||||
super.main()
|
||||
|
||||
var allErrors = [Error]()
|
||||
|
||||
self.clearTemporaryDirectory { result in
|
||||
switch result
|
||||
{
|
||||
//case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
|
||||
case .failure(let error): allErrors.append(error)
|
||||
case .success: break
|
||||
}
|
||||
|
||||
self.removeUninstalledAppBackupDirectories { result in
|
||||
switch result
|
||||
{
|
||||
//case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
|
||||
case .failure(let error): allErrors.append(error)
|
||||
case .success: break
|
||||
}
|
||||
|
||||
if allErrors.isEmpty
|
||||
{
|
||||
self.finish(.success(()))
|
||||
}
|
||||
else
|
||||
{
|
||||
self.finish(.failure(OperationError.cacheClearError(errors: allErrors.map({ error in
|
||||
return error.localizedDescription
|
||||
}))))
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
private extension ClearAppCacheOperation
|
||||
{
|
||||
func clearTemporaryDirectory(completion: @escaping (Result<Void, Error>) -> Void)
|
||||
{
|
||||
let intent = NSFileAccessIntent.writingIntent(with: FileManager.default.temporaryDirectory, options: [.forDeleting])
|
||||
self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
|
||||
do
|
||||
{
|
||||
if let error
|
||||
{
|
||||
throw error
|
||||
}
|
||||
|
||||
let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
|
||||
includingPropertiesForKeys: [],
|
||||
options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
|
||||
var errors = [Error]()
|
||||
|
||||
for fileURL in fileURLs
|
||||
{
|
||||
do
|
||||
{
|
||||
print("[ALTLog] Removing item from temporary directory:", fileURL.lastPathComponent)
|
||||
try FileManager.default.removeItem(at: fileURL)
|
||||
}
|
||||
catch
|
||||
{
|
||||
print("[ALTLog] Failed to remove \(fileURL.lastPathComponent) from temporary directory.", error)
|
||||
errors.append(error)
|
||||
}
|
||||
}
|
||||
|
||||
if !errors.isEmpty
|
||||
{
|
||||
completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
|
||||
return error.localizedDescription
|
||||
}))))
|
||||
}
|
||||
else
|
||||
{
|
||||
completion(.success(()))
|
||||
}
|
||||
}
|
||||
catch
|
||||
{
|
||||
completion(.failure(error))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
func removeUninstalledAppBackupDirectories(completion: @escaping (Result<Void, Error>) -> Void)
|
||||
{
|
||||
guard let backupsDirectory = FileManager.default.appBackupsDirectory else { return completion(.failure(OperationError.missingAppGroup)) }
|
||||
|
||||
DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
|
||||
let installedAppBundleIDs = Set(InstalledApp.all(in: context).map { $0.bundleIdentifier })
|
||||
|
||||
let intent = NSFileAccessIntent.writingIntent(with: backupsDirectory, options: [.forDeleting])
|
||||
self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
|
||||
do
|
||||
{
|
||||
if let error
|
||||
{
|
||||
throw error
|
||||
}
|
||||
|
||||
var isDirectory: ObjCBool = false
|
||||
guard FileManager.default.fileExists(atPath: intent.url.path, isDirectory: &isDirectory), isDirectory.boolValue else {
|
||||
completion(.success(()))
|
||||
return
|
||||
}
|
||||
|
||||
let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
|
||||
includingPropertiesForKeys: [.isDirectoryKey, .nameKey],
|
||||
options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
|
||||
var errors = [Error]()
|
||||
|
||||
|
||||
for backupDirectory in fileURLs
|
||||
{
|
||||
do
|
||||
{
|
||||
let resourceValues = try backupDirectory.resourceValues(forKeys: [.isDirectoryKey, .nameKey])
|
||||
guard let isDirectory = resourceValues.isDirectory, let bundleID = resourceValues.name else { continue }
|
||||
|
||||
if isDirectory && !installedAppBundleIDs.contains(bundleID) && !AppManager.shared.isActivelyManagingApp(withBundleID: bundleID)
|
||||
{
|
||||
print("[ALTLog] Removing backup directory for uninstalled app:", bundleID)
|
||||
try FileManager.default.removeItem(at: backupDirectory)
|
||||
}
|
||||
}
|
||||
catch
|
||||
{
|
||||
print("[ALTLog] Failed to remove app backup directory:", error)
|
||||
errors.append(error)
|
||||
}
|
||||
}
|
||||
|
||||
if !errors.isEmpty
|
||||
{
|
||||
completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
|
||||
return error.localizedDescription
|
||||
}))))
|
||||
}
|
||||
else
|
||||
{
|
||||
completion(.success(()))
|
||||
}
|
||||
}
|
||||
catch
|
||||
{
|
||||
print("[ALTLog] Failed to remove app backup directory:", error)
|
||||
completion(.failure(error))
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -39,21 +39,14 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
|
||||
let allIdentifiers = [installedApp.resignedBundleIdentifier] + appExtensionProfiles
|
||||
|
||||
for profile in allIdentifiers {
|
||||
var attempts = 5
|
||||
while (attempts > 0){
|
||||
print("Remove Provisioning profile attempts left: \(attempts)")
|
||||
do {
|
||||
try remove_provisioning_profile(profile)
|
||||
self.progress.completedUnitCount += 1
|
||||
installedApp.isActive = false
|
||||
self.finish(.success(installedApp))
|
||||
break
|
||||
} catch {
|
||||
attempts -= 1
|
||||
if (attempts <= 0){
|
||||
self.finish(.failure(error))
|
||||
}
|
||||
}
|
||||
do {
|
||||
try remove_provisioning_profile(profile)
|
||||
self.progress.completedUnitCount += 1
|
||||
installedApp.isActive = false
|
||||
self.finish(.success(installedApp))
|
||||
break
|
||||
} catch {
|
||||
self.finish(.failure(error))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -50,7 +50,7 @@ final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
|
||||
do {
|
||||
try debug_app(installedApp.resignedBundleIdentifier)
|
||||
self.finish(.success(()))
|
||||
break
|
||||
retries = 0
|
||||
} catch {
|
||||
retries -= 1
|
||||
if (retries <= 0){
|
||||
|
||||
@@ -218,7 +218,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
|
||||
self.socket.connect()
|
||||
}
|
||||
|
||||
func didReceive(event: WebSocketEvent, client: WebSocket) {
|
||||
func didReceive(event: WebSocketEvent, client: WebSocketClient) {
|
||||
switch event {
|
||||
case .text(let string):
|
||||
do {
|
||||
@@ -429,7 +429,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
|
||||
}
|
||||
}
|
||||
|
||||
extension WebSocket {
|
||||
extension WebSocketClient {
|
||||
func json(_ dictionary: [String: String]) {
|
||||
let data = try! JSONSerialization.data(withJSONObject: dictionary, options: [])
|
||||
self.write(string: String(data: data, encoding: .utf8)!)
|
||||
|
||||
@@ -262,10 +262,6 @@ extension FetchProvisioningProfilesOperation
|
||||
{
|
||||
throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
|
||||
}
|
||||
else
|
||||
{
|
||||
throw ALTAppleAPIError(.maximumAppIDLimitReached)
|
||||
}
|
||||
}
|
||||
}
|
||||
//App ID name must be ascii. If the name is not ascii, using bundleID instead
|
||||
|
||||
@@ -41,12 +41,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
|
||||
|
||||
guard
|
||||
let certificate = self.context.certificate,
|
||||
let resignedApp = self.context.resignedApp
|
||||
let resignedApp = self.context.resignedApp,
|
||||
let provisioningProfiles = self.context.provisioningProfiles
|
||||
else { return self.finish(.failure(OperationError.invalidParameters)) }
|
||||
|
||||
let backgroundContext = DatabaseManager.shared.persistentContainer.newBackgroundContext()
|
||||
backgroundContext.perform {
|
||||
|
||||
|
||||
/* App */
|
||||
let installedApp: InstalledApp
|
||||
|
||||
@@ -116,8 +118,7 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
|
||||
// Temporary directory and resigned .ipa no longer needed, so delete them now to ensure AltStore doesn't quit before we get the chance to.
|
||||
self.cleanUp()
|
||||
|
||||
var activeProfiles: Set<String>?
|
||||
if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit
|
||||
if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit, provisioningProfiles.contains(where: { $1.isFreeProvisioningProfile == true })
|
||||
{
|
||||
// When installing these new profiles, AltServer will remove all non-active profiles to ensure we remain under limit.
|
||||
|
||||
@@ -142,11 +143,10 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
|
||||
installedApp.isActive = false
|
||||
}
|
||||
}
|
||||
|
||||
activeProfiles = Set(activeApps.flatMap { (installedApp) -> [String] in
|
||||
let appExtensionProfiles = installedApp.appExtensions.map { $0.resignedBundleIdentifier }
|
||||
return [installedApp.resignedBundleIdentifier] + appExtensionProfiles
|
||||
})
|
||||
}
|
||||
else
|
||||
{
|
||||
installedApp.isActive = true
|
||||
}
|
||||
|
||||
var installing = true
|
||||
@@ -169,14 +169,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
|
||||
|
||||
let content = UNMutableNotificationContent()
|
||||
content.title = "Refreshing..."
|
||||
content.body = "To finish refreshing SideStore must go to the home screen. Please reopen after!"
|
||||
content.body = "SideStore will automatically move to the homescreen to finish refreshing!"
|
||||
let notification = UNNotificationRequest(identifier: Bundle.Info.appbundleIdentifier + ".FinishRefreshNotification", content: content, trigger: UNTimeIntervalNotificationTrigger(timeInterval: 2, repeats: false))
|
||||
UNUserNotificationCenter.current().add(notification)
|
||||
break
|
||||
default:
|
||||
print("Notifications are not enabled")
|
||||
|
||||
let alert = UIAlertController(title: "Finish Refresh", message: "To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen manually or by hitting Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
|
||||
let alert = UIAlertController(title: "Finish Refresh", message: "Please reopen SideStore after the process is finished.To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen manually or by hitting Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
|
||||
alert.addAction(UIAlertAction(title: NSLocalizedString("Continue", comment: ""), style: .default, handler: { _ in
|
||||
print("Going home")
|
||||
UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
|
||||
@@ -198,22 +198,15 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
|
||||
UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
|
||||
}
|
||||
}
|
||||
var attempts = 10
|
||||
while (attempts != 0){
|
||||
print("Install ipa attempts left: \(attempts)")
|
||||
do {
|
||||
try install_ipa(installedApp.bundleIdentifier)
|
||||
installing = false
|
||||
installedApp.refreshedDate = Date()
|
||||
self.finish(.success(installedApp))
|
||||
break
|
||||
} catch {
|
||||
attempts -= 1
|
||||
if (attempts <= 0){
|
||||
installing = false
|
||||
self.finish(.failure(MinimuxerError.InstallApp))
|
||||
}
|
||||
}
|
||||
|
||||
do {
|
||||
try install_ipa(installedApp.bundleIdentifier)
|
||||
installing = false
|
||||
installedApp.refreshedDate = Date()
|
||||
self.finish(.success(installedApp))
|
||||
} catch let error {
|
||||
installing = false
|
||||
self.finish(.failure(error))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -34,10 +34,14 @@ enum OperationError: LocalizedError
|
||||
case openAppFailed(name: String)
|
||||
case missingAppGroup
|
||||
|
||||
case noWiFi
|
||||
case tooNewError
|
||||
case anisetteV1Error(message: String)
|
||||
case provisioningError(result: String, message: String?)
|
||||
case anisetteV3Error(message: String)
|
||||
|
||||
case cacheClearError(errors: [String])
|
||||
|
||||
var failureReason: String? {
|
||||
switch self {
|
||||
case .unknown: return NSLocalizedString("An unknown error occured.", comment: "")
|
||||
@@ -53,9 +57,12 @@ enum OperationError: LocalizedError
|
||||
case .openAppFailed(let name): return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), name)
|
||||
case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be found.", comment: "")
|
||||
case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs.", comment: "")
|
||||
case .noWiFi: return NSLocalizedString("You do not appear to be connected to WiFi!\nSideStore will never be able to install or refresh applications without WiFi.", comment: "")
|
||||
case .tooNewError: return NSLocalizedString("iOS 17 has changed how JIT is enabled therefore SideStore cannot enable it at this time, sorry for any inconvenience.\nWe will let everyone know once we have a solution!", comment: "")
|
||||
case .anisetteV1Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: ""), message)
|
||||
case .provisioningError(let result, let message): return String(format: NSLocalizedString("An error occurred when provisioning: %@%@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), result, message != nil ? (" (" + message! + ")") : "")
|
||||
case .anisetteV3Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), message)
|
||||
case .cacheClearError(let errors): return String(format: NSLocalizedString("An error occurred while clearing cache: %@", comment: ""), errors.joined(separator: "\n"))
|
||||
}
|
||||
}
|
||||
|
||||
@@ -138,8 +145,8 @@ extension MinimuxerError: LocalizedError {
|
||||
return self.createService(name: "AFC")
|
||||
case .RwAfc:
|
||||
return NSLocalizedString("AFC was unable to manage files on the device", comment: "")
|
||||
case .InstallApp:
|
||||
return NSLocalizedString("Unable to install the app from the staging directory", comment: "")
|
||||
case .InstallApp(let message):
|
||||
return NSLocalizedString("Unable to install the app: \(message.toString())", comment: "")
|
||||
case .UninstallApp:
|
||||
return NSLocalizedString("Unable to uninstall the app", comment: "")
|
||||
|
||||
|
||||
@@ -41,19 +41,11 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
|
||||
guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
|
||||
|
||||
for p in profiles {
|
||||
var attempts = 5
|
||||
while (attempts > 0){
|
||||
print("Install provisioning profile attempts left: \(attempts)")
|
||||
do {
|
||||
let bytes = p.value.data.toRustByteSlice()
|
||||
try install_provisioning_profile(bytes.forRust())
|
||||
break
|
||||
} catch {
|
||||
attempts -= 1
|
||||
if (attempts <= 0) {
|
||||
self.finish(.failure(MinimuxerError.ProfileInstall))
|
||||
}
|
||||
}
|
||||
do {
|
||||
let bytes = p.value.data.toRustByteSlice()
|
||||
try install_provisioning_profile(bytes.forRust())
|
||||
} catch {
|
||||
self.finish(.failure(MinimuxerError.ProfileInstall))
|
||||
}
|
||||
|
||||
DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
|
||||
|
||||
@@ -11,6 +11,7 @@ import Roxas
|
||||
|
||||
import AltStoreCore
|
||||
import AltSign
|
||||
import minimuxer
|
||||
|
||||
@objc(ResignAppOperation)
|
||||
final class ResignAppOperation: ResultOperation<ALTApplication>
|
||||
@@ -181,7 +182,7 @@ private extension ResignAppOperation
|
||||
|
||||
if app.isAltStoreApp
|
||||
{
|
||||
guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else { throw OperationError.unknownUDID }
|
||||
guard let udid = fetch_udid()?.toString() as? String else { throw OperationError.unknownUDID }
|
||||
guard let pairingFileString = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.devicePairingString) as? String else { throw OperationError.unknownUDID }
|
||||
additionalValues[Bundle.Info.devicePairingString] = pairingFileString
|
||||
additionalValues[Bundle.Info.deviceID] = udid
|
||||
@@ -202,7 +203,7 @@ private extension ResignAppOperation
|
||||
// The embedded certificate + certificate identifier are already in app bundle, no need to update them.
|
||||
}
|
||||
}
|
||||
else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String
|
||||
else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = fetch_udid()?.toString() as? String
|
||||
{
|
||||
// There is an ALTDeviceID entry, so assume the app is using AltKit and replace it with the device's UDID.
|
||||
additionalValues[Bundle.Info.deviceID] = udid
|
||||
|
||||
@@ -45,21 +45,13 @@ final class SendAppOperation: ResultOperation<()>
|
||||
print("AFC App `fileURL`: \(fileURL.absoluteString)")
|
||||
|
||||
if let data = NSData(contentsOf: fileURL) {
|
||||
var attempts = 10
|
||||
while (attempts != 0){
|
||||
print("Send app attempts left: \(attempts)")
|
||||
do {
|
||||
let bytes = Data(data).toRustByteSlice()
|
||||
try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
|
||||
self.progress.completedUnitCount += 1
|
||||
self.finish(.success(()))
|
||||
break
|
||||
} catch {
|
||||
attempts -= 1
|
||||
if (attempts <= 0) {
|
||||
self.finish(.failure(MinimuxerError.RwAfc))
|
||||
}
|
||||
}
|
||||
do {
|
||||
let bytes = Data(data).toRustByteSlice()
|
||||
try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
|
||||
self.progress.completedUnitCount += 1
|
||||
self.finish(.success(()))
|
||||
} catch {
|
||||
self.finish(.failure(MinimuxerError.RwAfc))
|
||||
self.progress.completedUnitCount += 1
|
||||
self.finish(.success(()))
|
||||
}
|
||||
|
||||
Binary file not shown.
@@ -21,7 +21,7 @@
|
||||
<color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
|
||||
<rect key="frame" x="0.0" y="1126" width="375" height="25"/>
|
||||
<rect key="frame" x="0.0" y="1245" width="375" height="25"/>
|
||||
<autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
|
||||
<fontDescription key="fontDescription" type="system" pointSize="17"/>
|
||||
<color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
@@ -236,9 +236,45 @@
|
||||
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="NO"/>
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="GYp-O0-pse" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="444" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="GYp-O0-pse" id="vDG-ZV-xRS">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<subviews>
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Disable Idle Timeout" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PCh-Up-aJJ">
|
||||
<rect key="frame" x="30" y="15.5" width="166" height="20.5"/>
|
||||
<fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
|
||||
<color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<nil key="highlightedColor"/>
|
||||
</label>
|
||||
<switch opaque="NO" contentMode="scaleToFill" horizontalHuggingPriority="750" verticalHuggingPriority="750" contentHorizontalAlignment="center" contentVerticalAlignment="center" on="YES" translatesAutoresizingMaskIntoConstraints="NO" id="iQA-wm-5ag">
|
||||
<rect key="frame" x="296" y="10" width="51" height="31"/>
|
||||
<connections>
|
||||
<action selector="toggleNoIdleTimeoutEnabled:" destination="aMk-Xp-UL8" eventType="valueChanged" id="WSl-Jc-g5J"/>
|
||||
</connections>
|
||||
</switch>
|
||||
</subviews>
|
||||
<constraints>
|
||||
<constraint firstAttribute="trailingMargin" secondItem="iQA-wm-5ag" secondAttribute="trailing" id="MJ1-HF-Dln"/>
|
||||
<constraint firstItem="PCh-Up-aJJ" firstAttribute="leading" secondItem="vDG-ZV-xRS" secondAttribute="leadingMargin" id="Ocu-jn-RAQ"/>
|
||||
<constraint firstItem="iQA-wm-5ag" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="c6W-bN-VAb"/>
|
||||
<constraint firstItem="PCh-Up-aJJ" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="mL6-LB-cjn"/>
|
||||
</constraints>
|
||||
</tableViewCellContentView>
|
||||
<color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
|
||||
<userDefinedRuntimeAttributes>
|
||||
<userDefinedRuntimeAttribute type="number" keyPath="style">
|
||||
<integer key="value" value="2"/>
|
||||
</userDefinedRuntimeAttribute>
|
||||
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="495" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="amC-sE-8O0" id="GEO-2e-E4k">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
@@ -269,7 +305,7 @@
|
||||
<tableViewSection headerTitle="" id="eHy-qI-w5w">
|
||||
<cells>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="30h-59-88f" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="535" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="586" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="30h-59-88f" id="7qD-DW-Jls">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -309,7 +345,7 @@
|
||||
<tableViewSection headerTitle="" id="J90-vn-u2O">
|
||||
<cells>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="i4T-2q-jF3" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="626" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="677" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="i4T-2q-jF3" id="VTQ-H4-aCM">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -353,28 +389,28 @@
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="oHX-oR-nwJ" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="677" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="728" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="oHX-oR-nwJ" id="hN4-i5-igu">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<subviews>
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
|
||||
<rect key="frame" x="30" y="15.5" width="89" height="20.5"/>
|
||||
<fontDescription key="fontDescription" type="system" pointSize="17"/>
|
||||
<color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<nil key="highlightedColor"/>
|
||||
</label>
|
||||
<stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
|
||||
<stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
|
||||
<rect key="frame" x="198" y="15.5" width="147" height="20.5"/>
|
||||
<subviews>
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
|
||||
<rect key="frame" x="0.0" y="0.0" width="115" height="20.5"/>
|
||||
<fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
|
||||
<color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<nil key="highlightedColor"/>
|
||||
</label>
|
||||
<imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
|
||||
<imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
|
||||
<rect key="frame" x="129" y="0.0" width="18" height="20.5"/>
|
||||
</imageView>
|
||||
</subviews>
|
||||
@@ -397,7 +433,7 @@
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="0MT-ht-Sit" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="728" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="779" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="0MT-ht-Sit" id="OZp-WM-5H7">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -441,7 +477,7 @@
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="O5R-Al-lGj" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="779" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="830" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="O5R-Al-lGj" id="CrG-Mr-xQq">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -481,7 +517,7 @@
|
||||
<tableViewSection headerTitle="" id="OMa-EK-hRI">
|
||||
<cells>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="FMZ-as-Ljo" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="870" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="921" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="FMZ-as-Ljo" id="JzL-Of-A3T">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -514,7 +550,7 @@
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="Qca-pU-sJh" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="921" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="972" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="Qca-pU-sJh" id="QtU-8J-VQN">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -550,7 +586,7 @@
|
||||
</connections>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="rE2-P4-OaE" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="972" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="1023" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="rE2-P4-OaE" id="qIT-rz-ZUb">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -582,12 +618,45 @@
|
||||
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
|
||||
</userDefinedRuntimeAttributes>
|
||||
<connections>
|
||||
<segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="SSW-vL-86I"/>
|
||||
<segue destination="g8a-Rf-zWa" kind="show" id="vFC-Id-Ww6"/>
|
||||
</connections>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="eZ3-BT-q4D" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="1023" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="eZ3-BT-q4D" id="17m-VV-hzf">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<subviews>
|
||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Clear Cache" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="IbH-V1-ce3">
|
||||
<rect key="frame" x="30" y="15.5" width="98.5" height="20.5"/>
|
||||
<fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
|
||||
<color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<nil key="highlightedColor"/>
|
||||
</label>
|
||||
<imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="FZe-BJ-fOm">
|
||||
<rect key="frame" x="327" y="16.5" width="18" height="18"/>
|
||||
</imageView>
|
||||
</subviews>
|
||||
<constraints>
|
||||
<constraint firstItem="FZe-BJ-fOm" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="bGv-Np-5aO"/>
|
||||
<constraint firstAttribute="trailingMargin" secondItem="FZe-BJ-fOm" secondAttribute="trailing" id="ccb-JP-Eqi"/>
|
||||
<constraint firstItem="IbH-V1-ce3" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="iQJ-gN-sRF"/>
|
||||
<constraint firstItem="IbH-V1-ce3" firstAttribute="leading" secondItem="17m-VV-hzf" secondAttribute="leadingMargin" id="m1g-Y6-aT5"/>
|
||||
</constraints>
|
||||
</tableViewCellContentView>
|
||||
<color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||
<edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
|
||||
<userDefinedRuntimeAttributes>
|
||||
<userDefinedRuntimeAttribute type="number" keyPath="style">
|
||||
<integer key="value" value="2"/>
|
||||
</userDefinedRuntimeAttribute>
|
||||
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="1074" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VNn-u4-cN8" id="4bh-qe-l2N">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
@@ -619,7 +688,7 @@
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="e7s-hL-kv9" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="1074" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="1125" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="e7s-hL-kv9" id="yjL-Mu-HTk">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -652,7 +721,7 @@
|
||||
</userDefinedRuntimeAttributes>
|
||||
</tableViewCell>
|
||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||
<rect key="frame" x="0.0" y="1125" width="375" height="51"/>
|
||||
<rect key="frame" x="0.0" y="1176" width="375" height="51"/>
|
||||
<autoresizingMask key="autoresizingMask"/>
|
||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
|
||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||
@@ -689,7 +758,6 @@
|
||||
</sections>
|
||||
<connections>
|
||||
<outlet property="dataSource" destination="aMk-Xp-UL8" id="c6c-fR-8C4"/>
|
||||
<outlet property="delegate" destination="aMk-Xp-UL8" id="moP-1B-lRq"/>
|
||||
</connections>
|
||||
</tableView>
|
||||
<navigationItem key="navigationItem" title="Settings" id="Ddg-UQ-KJ8"/>
|
||||
@@ -698,6 +766,7 @@
|
||||
<outlet property="accountNameLabel" destination="CnN-M1-AYK" id="Ldc-Py-Bix"/>
|
||||
<outlet property="accountTypeLabel" destination="434-MW-Den" id="mNB-QE-4Jg"/>
|
||||
<outlet property="backgroundRefreshSwitch" destination="DPu-zD-Als" id="eiG-Hv-Vko"/>
|
||||
<outlet property="noIdleTimeoutSwitch" destination="iQA-wm-5ag" id="jHC-js-q0Y"/>
|
||||
<outlet property="versionLabel" destination="bUR-rp-Nw2" id="85I-5R-hqz"/>
|
||||
</connections>
|
||||
</tableViewController>
|
||||
|
||||
@@ -30,13 +30,14 @@ extension SettingsViewController
|
||||
fileprivate enum AppRefreshRow: Int, CaseIterable
|
||||
{
|
||||
case backgroundRefresh
|
||||
case noIdleTimeout
|
||||
|
||||
@available(iOS 14, *)
|
||||
case addToSiri
|
||||
|
||||
static var allCases: [AppRefreshRow] {
|
||||
guard #available(iOS 14, *) else { return [.backgroundRefresh] }
|
||||
return [.backgroundRefresh, .addToSiri]
|
||||
guard #available(iOS 14, *) else { return [.backgroundRefresh, .noIdleTimeout] }
|
||||
return [.backgroundRefresh, .noIdleTimeout, .addToSiri]
|
||||
}
|
||||
}
|
||||
|
||||
@@ -53,9 +54,11 @@ extension SettingsViewController
|
||||
case sendFeedback
|
||||
case refreshAttempts
|
||||
case errorLog
|
||||
case clearCache
|
||||
case resetPairingFile
|
||||
case resetAdiPb
|
||||
case advancedSettings
|
||||
|
||||
}
|
||||
}
|
||||
|
||||
@@ -73,6 +76,7 @@ final class SettingsViewController: UITableViewController
|
||||
@IBOutlet private var accountTypeLabel: UILabel!
|
||||
|
||||
@IBOutlet private var backgroundRefreshSwitch: UISwitch!
|
||||
@IBOutlet private var noIdleTimeoutSwitch: UISwitch!
|
||||
|
||||
@IBOutlet private var versionLabel: UILabel!
|
||||
|
||||
@@ -280,6 +284,11 @@ private extension SettingsViewController
|
||||
UserDefaults.standard.isBackgroundRefreshEnabled = sender.isOn
|
||||
}
|
||||
|
||||
@IBAction func toggleNoIdleTimeoutEnabled(_ sender: UISwitch)
|
||||
{
|
||||
UserDefaults.standard.isIdleTimeoutDisableEnabled = sender.isOn
|
||||
}
|
||||
|
||||
@available(iOS 14, *)
|
||||
@IBAction func addRefreshAppsShortcut()
|
||||
{
|
||||
@@ -291,6 +300,39 @@ private extension SettingsViewController
|
||||
self.present(viewController, animated: true, completion: nil)
|
||||
}
|
||||
|
||||
func clearCache()
|
||||
{
|
||||
let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to clear SideStore's cache?", comment: ""),
|
||||
message: NSLocalizedString("This will remove all temporary files as well as backups for uninstalled apps.", comment: ""),
|
||||
preferredStyle: .actionSheet)
|
||||
alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { [weak self] _ in
|
||||
self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
|
||||
})
|
||||
alertController.addAction(UIAlertAction(title: NSLocalizedString("Clear Cache", comment: ""), style: .destructive) { [weak self] _ in
|
||||
AppManager.shared.clearAppCache { result in
|
||||
DispatchQueue.main.async {
|
||||
self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
|
||||
|
||||
switch result
|
||||
{
|
||||
case .success: break
|
||||
case .failure(let error):
|
||||
let alertController = UIAlertController(title: NSLocalizedString("Unable to Clear Cache", comment: ""), message: error.localizedDescription, preferredStyle: .alert)
|
||||
alertController.addAction(.ok)
|
||||
self?.present(alertController, animated: true)
|
||||
}
|
||||
}
|
||||
}
|
||||
})
|
||||
|
||||
if let popoverController = alertController.popoverPresentationController {
|
||||
popoverController.sourceView = self.view
|
||||
popoverController.sourceRect = CGRect(x: self.view.bounds.midX, y: self.view.bounds.midY, width: 0, height: 0)
|
||||
}
|
||||
|
||||
self.present(alertController, animated: true)
|
||||
}
|
||||
|
||||
@IBAction func handleDebugModeGesture(_ gestureRecognizer: UISwipeGestureRecognizer)
|
||||
{
|
||||
self.debugGestureCounter += 1
|
||||
@@ -377,15 +419,26 @@ extension SettingsViewController
|
||||
{
|
||||
let cell = super.tableView(tableView, cellForRowAt: indexPath)
|
||||
|
||||
if #available(iOS 14, *) {}
|
||||
else if let cell = cell as? InsetGroupTableViewCell,
|
||||
indexPath.section == Section.appRefresh.rawValue,
|
||||
indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
|
||||
// if #available(iOS 14, *) {}
|
||||
// else if let cell = cell as? InsetGroupTableViewCell,
|
||||
// indexPath.section == Section.appRefresh.rawValue,
|
||||
// indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
|
||||
// {
|
||||
// // Only one row is visible pre-iOS 14.
|
||||
// cell.style = .single
|
||||
// }
|
||||
|
||||
if AppRefreshRow.AllCases().count == 1
|
||||
{
|
||||
// Only one row is visible pre-iOS 14.
|
||||
cell.style = .single
|
||||
if let cell = cell as? InsetGroupTableViewCell,
|
||||
indexPath.section == Section.appRefresh.rawValue,
|
||||
indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
|
||||
{
|
||||
cell.style = .single
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
return cell
|
||||
}
|
||||
|
||||
@@ -465,11 +518,13 @@ extension SettingsViewController
|
||||
switch row
|
||||
{
|
||||
case .backgroundRefresh: break
|
||||
case .noIdleTimeout: break
|
||||
case .addToSiri:
|
||||
guard #available(iOS 14, *) else { return }
|
||||
self.addRefreshAppsShortcut()
|
||||
}
|
||||
|
||||
|
||||
case .credits:
|
||||
let row = CreditsRow.allCases[indexPath.row]
|
||||
switch row
|
||||
@@ -507,6 +562,9 @@ extension SettingsViewController
|
||||
let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
|
||||
toastView.show(in: self)
|
||||
}
|
||||
|
||||
case .clearCache: self.clearCache()
|
||||
|
||||
case .resetPairingFile:
|
||||
let filename = "ALTPairingFile.mobiledevicepairing"
|
||||
let fm = FileManager.default
|
||||
@@ -559,6 +617,7 @@ extension SettingsViewController
|
||||
ELOG("UIApplication.openSettingsURLString invalid")
|
||||
}
|
||||
case .refreshAttempts, .errorLog: break
|
||||
|
||||
}
|
||||
|
||||
default: break
|
||||
|
||||
@@ -27,6 +27,7 @@ public extension UserDefaults
|
||||
@NSManaged var preferredServerID: String?
|
||||
|
||||
@NSManaged var isBackgroundRefreshEnabled: Bool
|
||||
@NSManaged var isIdleTimeoutDisableEnabled: Bool
|
||||
@NSManaged var isDebugModeEnabled: Bool
|
||||
@NSManaged var presentedLaunchReminderNotification: Bool
|
||||
|
||||
@@ -72,6 +73,7 @@ public extension UserDefaults
|
||||
|
||||
let defaults = [
|
||||
#keyPath(UserDefaults.isBackgroundRefreshEnabled): true,
|
||||
#keyPath(UserDefaults.isIdleTimeoutDisableEnabled): true,
|
||||
#keyPath(UserDefaults.isLegacyDeactivationSupported): isLegacyDeactivationSupported,
|
||||
#keyPath(UserDefaults.activeAppLimitIncludesExtensions): activeAppLimitIncludesExtensions,
|
||||
#keyPath(UserDefaults.localServerSupportsRefreshing): localServerSupportsRefreshing,
|
||||
|
||||
@@ -103,6 +103,7 @@
|
||||
<attribute name="externalURL" optional="YES" attributeType="URI"/>
|
||||
<attribute name="identifier" attributeType="String"/>
|
||||
<attribute name="imageURL" optional="YES" attributeType="URI"/>
|
||||
<attribute name="isDuplicate" optional="YES" attributeType="Boolean" usesScalarValueType="YES"/>
|
||||
<attribute name="isSilent" attributeType="Boolean" defaultValueString="YES" usesScalarValueType="YES"/>
|
||||
<attribute name="sortIndex" attributeType="Integer 32" defaultValueString="0" usesScalarValueType="YES"/>
|
||||
<attribute name="sourceIdentifier" optional="YES" attributeType="String"/>
|
||||
|
||||
@@ -222,7 +222,7 @@ private extension DatabaseManager
|
||||
|
||||
let storeApp: StoreApp
|
||||
|
||||
if let app = StoreApp.first(satisfying: NSPredicate(format: "%K == %@", #keyPath(StoreApp.bundleIdentifier), StoreApp.altstoreAppID), in: context)
|
||||
if let app = StoreApp.first(satisfying: NSPredicate(format: "%K == %@ AND %K == %@", #keyPath(StoreApp.bundleIdentifier), StoreApp.altstoreAppID, #keyPath(StoreApp.sourceIdentifier), Source.altStoreIdentifier), in: context)
|
||||
{
|
||||
storeApp = app
|
||||
}
|
||||
|
||||
@@ -108,6 +108,10 @@ public class InstalledApp: NSManagedObject, InstalledAppProtocol
|
||||
public func update(resignedApp: ALTApplication, certificateSerialNumber: String?)
|
||||
{
|
||||
self.name = resignedApp.name
|
||||
if storeApp != nil {
|
||||
// This might break things; maybe only do this if the bundle ID is SideStore's?
|
||||
self.name = storeApp!.name // If we don't do this, the name will always be SideStore in My Apps, even when using beta/nightly
|
||||
}
|
||||
|
||||
self.resignedBundleIdentifier = resignedApp.bundleIdentifier
|
||||
self.version = resignedApp.version
|
||||
@@ -178,7 +182,7 @@ public extension InstalledApp
|
||||
|
||||
class func fetchAltStore(in context: NSManagedObjectContext) -> InstalledApp?
|
||||
{
|
||||
let predicate = NSPredicate(format: "%K == %@", #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
|
||||
let predicate = NSPredicate(format: "%K == %@ AND %K != nil AND %K == %@", #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID, #keyPath(InstalledApp.storeApp), #keyPath(InstalledApp.storeApp.sourceIdentifier), Source.altStoreIdentifier)
|
||||
print("Fetch 'AltStore' Predicate: \(String(describing: predicate))")
|
||||
let altStore = InstalledApp.first(satisfying: predicate, in: context)
|
||||
return altStore
|
||||
|
||||
@@ -32,6 +32,15 @@ public class NewsItem: NSManagedObject, Decodable, Fetchable
|
||||
@NSManaged public var storeApp: StoreApp?
|
||||
@NSManaged public var source: Source?
|
||||
|
||||
@objc public var isDuplicate: Bool {
|
||||
if self.source == nil { return false }
|
||||
|
||||
// Hide news from sources that begin with the SideStore identifier, and aren't from the same source as the current SideStore source
|
||||
if self.source!.identifier.starts(with: Bundle.Info.appbundleIdentifier) && self.source!.identifier != Source.altStoreIdentifier { return true }
|
||||
|
||||
return false
|
||||
}
|
||||
|
||||
private enum CodingKeys: String, CodingKey
|
||||
{
|
||||
case identifier
|
||||
@@ -86,6 +95,9 @@ public extension NewsItem
|
||||
{
|
||||
@nonobjc class func fetchRequest() -> NSFetchRequest<NewsItem>
|
||||
{
|
||||
return NSFetchRequest<NewsItem>(entityName: "NewsItem")
|
||||
let fetchRequest = NSFetchRequest<NewsItem>(entityName: "NewsItem")
|
||||
fetchRequest.predicate = NSPredicate(format: "%K == NO",
|
||||
#keyPath(NewsItem.isDuplicate))
|
||||
return fetchRequest
|
||||
}
|
||||
}
|
||||
|
||||
@@ -11,29 +11,37 @@ import UIKit
|
||||
|
||||
public extension Source
|
||||
{
|
||||
#if ALPHA
|
||||
static let altStoreIdentifier = Bundle.Info.appbundleIdentifier
|
||||
#else
|
||||
static let altStoreIdentifier = Bundle.Info.appbundleIdentifier
|
||||
#endif
|
||||
static var altStoreIdentifier: String {
|
||||
let appVersion = Bundle.main.infoDictionary?["CFBundleShortVersionString"] as? String
|
||||
|
||||
if appVersion != nil {
|
||||
if appVersion!.contains("beta") {
|
||||
return Bundle.Info.appbundleIdentifier + ".Beta"
|
||||
}
|
||||
if appVersion!.contains("nightly") {
|
||||
return Bundle.Info.appbundleIdentifier + ".Nightly"
|
||||
}
|
||||
}
|
||||
|
||||
return Bundle.Info.appbundleIdentifier
|
||||
}
|
||||
|
||||
#if STAGING
|
||||
static let altStoreSourceBaseURL = "https://apps.sidestore.io/"
|
||||
|
||||
#if ALPHA
|
||||
static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
|
||||
#else
|
||||
static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
|
||||
#endif
|
||||
|
||||
#else
|
||||
|
||||
#if ALPHA
|
||||
static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
|
||||
#else
|
||||
static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
|
||||
#endif
|
||||
|
||||
#endif
|
||||
static var altStoreSourceURL: URL {
|
||||
let appVersion = Bundle.main.infoDictionary?["CFBundleShortVersionString"] as? String
|
||||
|
||||
if appVersion != nil {
|
||||
if appVersion!.contains("beta") {
|
||||
return URL(string: altStoreSourceBaseURL + "beta")!
|
||||
}
|
||||
if appVersion!.contains("nightly") {
|
||||
return URL(string: altStoreSourceBaseURL + "nightly")!
|
||||
}
|
||||
}
|
||||
|
||||
return URL(string: altStoreSourceBaseURL)!
|
||||
}
|
||||
}
|
||||
|
||||
public struct AppPermissionFeed: Codable {
|
||||
|
||||
@@ -343,16 +343,28 @@ public extension StoreApp
|
||||
{
|
||||
let app = StoreApp(context: context)
|
||||
app.name = "SideStore"
|
||||
|
||||
let currentAppVersion = Bundle.main.infoDictionary?["CFBundleShortVersionString"] as? String
|
||||
|
||||
if currentAppVersion != nil {
|
||||
if currentAppVersion!.contains("beta") {
|
||||
app.name += " (Beta)"
|
||||
}
|
||||
if currentAppVersion!.contains("nightly") {
|
||||
app.name += " (Nightly)"
|
||||
}
|
||||
}
|
||||
|
||||
app.bundleIdentifier = StoreApp.altstoreAppID
|
||||
app.developerName = "Side Team"
|
||||
app.localizedDescription = "SideStore is an alternative App Store."
|
||||
app.iconURL = URL(string: "https://user-images.githubusercontent.com/705880/63392210-540c5980-c37b-11e9-968c-8742fc68ab2e.png")!
|
||||
app.developerName = "SideStore Team"
|
||||
app.localizedDescription = "SideStore is an alternative app store for non-jailbroken devices.\n\nSideStore allows you to sideload other .ipa files and apps from the Files app or via the SideStore Library."
|
||||
app.iconURL = URL(string: "https://sidestore.io/assets/icon.png")!
|
||||
app.screenshotURLs = []
|
||||
app.sourceIdentifier = Source.altStoreIdentifier
|
||||
|
||||
let appVersion = AppVersion.makeAppVersion(version: "0.3.0",
|
||||
let appVersion = AppVersion.makeAppVersion(version: "0.0.0", // this is set to the current app version later
|
||||
date: Date(),
|
||||
downloadURL: URL(string: "http://rileytestut.com")!,
|
||||
downloadURL: URL(string: "https://sidestore.io")!,
|
||||
size: 0,
|
||||
appBundleID: app.bundleIdentifier,
|
||||
sourceID: Source.altStoreIdentifier,
|
||||
@@ -361,10 +373,6 @@ public extension StoreApp
|
||||
|
||||
print("makeAltStoreApp StoreApp: \(String(describing: app))")
|
||||
|
||||
#if BETA
|
||||
app.isBeta = true
|
||||
#endif
|
||||
|
||||
return app
|
||||
}
|
||||
}
|
||||
|
||||
@@ -4,8 +4,8 @@
|
||||
<dict>
|
||||
<key>ALTAppGroups</key>
|
||||
<array>
|
||||
<string>group.com.SideStore.SideStore</string>
|
||||
<string>group.$(APP_GROUP_IDENTIFIER)</string>
|
||||
<string>group.com.SideStore.SideStore</string>
|
||||
</array>
|
||||
<key>CFBundleDevelopmentRegion</key>
|
||||
<string>$(DEVELOPMENT_LANGUAGE)</string>
|
||||
|
||||
@@ -1,8 +1,8 @@
|
||||
// Configuration settings file format documentation can be found at:
|
||||
// https://help.apple.com/xcode/#/dev745c5c974
|
||||
|
||||
MARKETING_VERSION = 0.5.0
|
||||
CURRENT_PROJECT_VERSION = 5000
|
||||
MARKETING_VERSION = 0.5.5
|
||||
CURRENT_PROJECT_VERSION = 5050
|
||||
|
||||
// Vars to be overwritten by `CodeSigning.xcconfig` if exists
|
||||
DEVELOPMENT_TEAM = S32Z3HMYVQ
|
||||
|
||||
@@ -7,7 +7,7 @@ There are many ways to contribute to SideStore, so if you aren't a developer, th
|
||||
- [Writing documentation](https://github.com/SideStore/SideStore-Docs)
|
||||
- [Submitting detailed bug reports and suggesting new features](https://github.com/SideStore/SideStore/issues/new/choose)
|
||||
- Helping out with support
|
||||
- [Discord](https://discord.gg/RgpFBX3Q3k)
|
||||
- [Discord](https://discord.gg/sidestore-949183273383395328)
|
||||
- [GitHub Discussions](https://github.com/SideStore/SideStore/discussions)
|
||||
|
||||
However, this guide will focus on the development side of things. For now, we will only have setup information here, but you can [join our Discord](https://discord.gg/RgpFBX3Q3k) if you need help
|
||||
|
||||
2
Dependencies/Roxas
vendored
2
Dependencies/Roxas
vendored
Submodule Dependencies/Roxas updated: ac906cf490...c28b400621
2
Dependencies/libfragmentzip
vendored
2
Dependencies/libfragmentzip
vendored
Submodule Dependencies/libfragmentzip updated: 9a899fde3c...b7f9272acf
2
Dependencies/libimobiledevice
vendored
2
Dependencies/libimobiledevice
vendored
Submodule Dependencies/libimobiledevice updated: b314f04bd7...04c023317f
2
Dependencies/libimobiledevice-glue
vendored
2
Dependencies/libimobiledevice-glue
vendored
Submodule Dependencies/libimobiledevice-glue updated: 7eaa28ea95...214bafdde6
2
Dependencies/libplist
vendored
2
Dependencies/libplist
vendored
Submodule Dependencies/libplist updated: c3af449543...258d3c24aa
2
Dependencies/libusbmuxd
vendored
2
Dependencies/libusbmuxd
vendored
Submodule Dependencies/libusbmuxd updated: 6426362e5c...30e678d4e7
@@ -56,7 +56,7 @@ public extension Bundle
|
||||
public extension Bundle
|
||||
{
|
||||
static var baseAltStoreAppGroupID = "group." + Bundle.Info.appbundleIdentifier
|
||||
|
||||
|
||||
var appGroups: [String] {
|
||||
return self.infoDictionary?[Bundle.Info.appGroups] as? [String] ?? []
|
||||
}
|
||||
|
||||
@@ -4,6 +4,14 @@
|
||||
{
|
||||
"identifier": "io.sidestore.example"
|
||||
},
|
||||
{
|
||||
"identifier": "com.SideStore.SideStore",
|
||||
"sourceURL": "https://apps.sidestore.io/"
|
||||
},
|
||||
{
|
||||
"identifier": "com.SideStore.SideStore.Beta",
|
||||
"sourceURL": "https://apps.sidestore.io/beta"
|
||||
},
|
||||
{
|
||||
"identifier": "com.sidestoreapps.community",
|
||||
"sourceURL": "https://community-apps.sidestore.io/sidecommunity.json"
|
||||
@@ -24,10 +32,6 @@
|
||||
"identifier": "com.flyinghead.source",
|
||||
"sourceURL": "https://flyinghead.github.io/flycast-builds/altstore.json"
|
||||
},
|
||||
{
|
||||
"identifier": "com.emuplace.altstore",
|
||||
"sourceURL": "https://emuplace.app/altstore/altstore.json"
|
||||
},
|
||||
{
|
||||
"identifier": "dev.crystall1ne.repos.PojavLauncher",
|
||||
"sourceURL": "https://alt.crystall1ne.dev"
|
||||
@@ -43,6 +47,10 @@
|
||||
{
|
||||
"identifier": "stream.yattee",
|
||||
"sourceURL": "https://repos.yattee.stream/alt/apps.json"
|
||||
},
|
||||
{
|
||||
"identifier": "com.litritt.litsource",
|
||||
"sourceURL": "https://altstore.ignitedemulator.com/"
|
||||
}
|
||||
]
|
||||
}
|
||||
|
||||
Reference in New Issue
Block a user