Switch to apps.sidestore.io

Trusted Sources: Add stable and beta
News: fix duplicate news items from multiple SideStore release channel sources
2026-02-09 06:43:25 +01:00 · 2023-11-27 14:28:29 -08:00 · 2023-11-27 14:28:29 -08:00 · 2023-11-27 14:28:29 -08:00 · 2023-11-27 14:28:29 -08:00 · 2023-11-27 14:28:29 -08:00
49 changed files with 833 additions and 373 deletions
--- a/.github/CODEOWNERS
+++ b/.github/CODEOWNERS
@@ -1 +1 @@
-*       @JoeMatt @lonkelle
+*       @JoeMatt @lonkelle @nythepegasus @Spidy123222 @SternXD
--- a/.github/ISSUE_TEMPLATE/bug_report.yml
+++ b/.github/ISSUE_TEMPLATE/bug_report.yml
@@ -10,7 +10,7 @@ body:
      value: |
        Thanks for taking the time to fill out this bug report! Before you continue filling out the report, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the bug you are experiencing** in case it has already been reported.
        
-        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+        **Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
  - type: textarea
    id: description
    attributes:
--- a/.github/ISSUE_TEMPLATE/config.yml
+++ b/.github/ISSUE_TEMPLATE/config.yml
@@ -3,7 +3,7 @@ blank_issues_enabled: false

 contact_links:
  - name: Discord
-    url: https://discord.gg/RgpFBX3Q3k
+    url: https://discord.gg/sidestore-949183273383395328
    about: If you need support, please go here first instead of making an issue!
  - name: GitHub Discussions
    url: https://github.com/SideStore/SideStore/discussions
--- a/.github/ISSUE_TEMPLATE/feature_request.yml
+++ b/.github/ISSUE_TEMPLATE/feature_request.yml
@@ -10,7 +10,7 @@ body:
      value: |
        Thanks for taking the time to fill out this feature request! Before you continue filling out the form, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the feature you are suggestion** in case it has already been suggested.
        
-        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+        **Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
  - type: textarea
    id: description
    attributes:
--- a/.github/workflows/stable.yml
+++ b/.github/workflows/stable.yml
@@ -3,6 +3,7 @@ on:
  push:
    tags:
      - '[0-9]+.[0-9]+.[0-9]+' # example: 1.0.0
+  workflow_dispatch:

 jobs:
  build:
--- a/.gitmodules
+++ b/.gitmodules
@@ -9,7 +9,7 @@
 	url = https://github.com/libimobiledevice/libusbmuxd.git
 [submodule "Dependencies/libplist"]
 	path = Dependencies/libplist
-	url = https://github.com/libimobiledevice/libplist.git
+	url = https://github.com/SideStore/libplist.git
 [submodule "Dependencies/MarkdownAttributedString"]
 	path = Dependencies/MarkdownAttributedString
 	url = https://github.com/chockenberry/MarkdownAttributedString.git
--- a/AltBackup/Assets.xcassets/Background.colorset/Contents.json
+++ b/AltBackup/Assets.xcassets/Background.colorset/Contents.json
@@ -5,9 +5,9 @@
        "color-space" : "srgb",
        "components" : {
          "alpha" : "1.000",
-          "blue" : "0.518",
-          "green" : "0.502",
-          "red" : "0.004"
+          "blue" : "175",
+          "green" : "4",
+          "red" : "115"
        }
      },
      "idiom" : "universal"
@@ -23,9 +23,9 @@
        "color-space" : "srgb",
        "components" : {
          "alpha" : "1.000",
-          "blue" : "0.404",
-          "green" : "0.322",
-          "red" : "0.008"
+          "blue" : "150",
+          "green" : "3",
+          "red" : "99"
        }
      },
      "idiom" : "universal"
--- a/AltStore.xcodeproj/project.pbxproj
+++ b/AltStore.xcodeproj/project.pbxproj
@@ -8,13 +8,39 @@

 /* Begin PBXBuildFile section */
 		03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E314122A05D4C00370A3C /* Bundle+AltStore.swift */; };
+		0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0E1A1F902AE36A9600364CAD /* bytearray.c */; };
+		0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = 0E764E162ADFF5740043DD4E /* AltBackup.ipa */; };
+		0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166472ADFE0D1003015C1 /* out-limd.c */; };
+		0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166522ADFE0D2003015C1 /* out-default.c */; };
+		0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166552ADFE0D2003015C1 /* out-plutil.c */; };
+		0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166562ADFE0D2003015C1 /* oplist.c */; };
+		0EA166682ADFE122003015C1 /* jsmn.h in Headers */ = {isa = PBXBuildFile; fileRef = 0EA166632ADFE122003015C1 /* jsmn.h */; };
+		0EA166692ADFE140003015C1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166452ADFE0D1003015C1 /* Array.cpp */; };
+		0EA1666A2ADFE140003015C1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166492ADFE0D1003015C1 /* String.cpp */; };
+		0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */; };
+		0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166532ADFE0D2003015C1 /* Integer.cpp */; };
+		0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166432ADFE0D1003015C1 /* Data.cpp */; };
+		0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166512ADFE0D2003015C1 /* ptrarray.c */; };
+		0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664F2ADFE0D1003015C1 /* hashtable.c */; };
+		0EA166702ADFE140003015C1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166502ADFE0D2003015C1 /* Node.cpp */; };
+		0EA166712ADFE140003015C1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166582ADFE0D2003015C1 /* Key.cpp */; };
+		0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166462ADFE0D1003015C1 /* Dictionary.cpp */; };
+		0EA166742ADFE140003015C1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166422ADFE0D1003015C1 /* Date.cpp */; };
+		0EA166752ADFE140003015C1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166542ADFE0D2003015C1 /* Real.cpp */; };
+		0EA166762ADFE140003015C1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664A2ADFE0D1003015C1 /* base64.c */; };
+		0EA166772ADFE140003015C1 /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166412ADFE0D1003015C1 /* jplist.c */; };
+		0EA166782ADFE140003015C1 /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166572ADFE0D2003015C1 /* jsmn.c */; };
+		0EA166792ADFE140003015C1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166442ADFE0D1003015C1 /* bplist.c */; };
+		0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664B2ADFE0D1003015C1 /* Uid.cpp */; };
+		0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1665A2ADFE0D2003015C1 /* Structure.cpp */; };
+		0EA1667D2ADFE140003015C1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166592ADFE0D2003015C1 /* xplist.c */; };
+		0EA1667E2ADFE140003015C1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664C2ADFE0D1003015C1 /* time64.c */; };
+		0EA4B9BC2AE4A414009209CE /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA4B9BB2AE4A3F6009209CE /* plist.c */; };
 		19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */ = {isa = PBXBuildFile; fileRef = BF45872B2298D31600BD7491 /* libimobiledevice.a */; };
 		19104DB52909C06D00C49C7B /* EmotionalDamage.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19104DB42909C06D00C49C7B /* EmotionalDamage.swift */; };
 		19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DB22909C06C00C49C7B /* libEmotionalDamage.a */; };
 		191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FAB290A5D92001A3B7C /* libminimuxer.a */; };
 		191E5FDC290AFA5C001A3B7C /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 191E5FDB290AFA5C001A3B7C /* OpenSSL */; };
-		191E607D290B2EA5001A3B7C /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FD0290A651D001A3B7C /* jsmn.c */; };
-		191E607E290B2EA7001A3B7C /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FCF290A651D001A3B7C /* jplist.c */; };
 		1920B04F2924AC8300744F60 /* Settings.bundle in Resources */ = {isa = PBXBuildFile; fileRef = 1920B04E2924AC8300744F60 /* Settings.bundle */; };
 		19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */; };
 		4879A95F2861046500FC1BBD /* AltSign in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A95E2861046500FC1BBD /* AltSign */; };
@@ -25,7 +51,6 @@
 		99F87D1829D8E4C900B40039 /* SwiftBridgeCore.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1629D8E4C900B40039 /* SwiftBridgeCore.swift */; };
 		99F87D1929D8E4C900B40039 /* minimuxer.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1729D8E4C900B40039 /* minimuxer.swift */; };
 		B3146ED2284F581E00BBC3FD /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; };
-		B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; settings = {ATTRIBUTES = (CodeSignOnCopy, RemoveHeadersOnCopy, ); }; };
 		B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F894295F7F9B002B1159 /* libfragmentzip.a */; };
 		B33FFBAA295F8F78002259E6 /* preboard.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBA9295F8F78002259E6 /* preboard.c */; };
 		B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBAB295F8F98002259E6 /* companion_proxy.c */; };
@@ -74,7 +99,6 @@
 		BF41B808233433C100C593A3 /* LoadingState.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF41B807233433C100C593A3 /* LoadingState.swift */; };
 		BF42345A25101C35006D1EB2 /* WidgetView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF42345825101C1D006D1EB2 /* WidgetView.swift */; };
 		BF44EEF0246B08BA002A52F2 /* BackupController.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEEF246B08BA002A52F2 /* BackupController.swift */; };
-		BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */; };
 		BF44EEFC246B4550002A52F2 /* RemoveAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */; };
 		BF4587F82298D3AB00BD7491 /* service.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4587C82298D3A800BD7491 /* service.h */; };
 		BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587C92298D3A800BD7491 /* diagnostics_relay.c */; };
@@ -254,34 +278,6 @@
 		BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = BFD247782284B9A700981D42 /* LaunchScreen.storyboard */; };
 		BFD2478C2284C4C300981D42 /* AppIconImageView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478B2284C4C300981D42 /* AppIconImageView.swift */; };
 		BFD2478F2284C8F900981D42 /* Button.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478E2284C8F900981D42 /* Button.swift */; };
-		BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */; };
-		BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE622A1A9CA000B7ED1 /* base64.c */; };
-		BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE722A1A9CA000B7ED1 /* hashtable.c */; };
-		BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */; };
-		BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */; };
-		BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEA22A1A9CA000B7ED1 /* bplist.c */; };
-		BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEB22A1A9CA000B7ED1 /* String.cpp */; };
-		BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEC22A1A9CA000B7ED1 /* time64.c */; };
-		BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BED22A1A9CA000B7ED1 /* plist.h */; };
-		BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEE22A1A9CA000B7ED1 /* plist.c */; };
-		BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */; };
-		BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF022A1A9CA000B7ED1 /* Date.cpp */; };
-		BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */; };
-		BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */; };
-		BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF322A1A9CA000B7ED1 /* Real.cpp */; };
-		BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF422A1A9CA000B7ED1 /* strbuf.h */; };
-		BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF522A1A9CA000B7ED1 /* bytearray.c */; };
-		BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF622A1A9CA000B7ED1 /* base64.h */; };
-		BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF722A1A9CA000B7ED1 /* Data.cpp */; };
-		BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF822A1A9CB000B7ED1 /* Array.cpp */; };
-		BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF922A1A9CB000B7ED1 /* Node.cpp */; };
-		BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */; };
-		BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */; };
-		BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */; };
-		BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */; };
-		BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */; };
-		BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFF22A1A9CB000B7ED1 /* time64.h */; };
-		BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C0022A1A9CB000B7ED1 /* xplist.c */; };
 		BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1D22A1A9EC000B7ED1 /* node.c */; };
 		BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1E22A1A9EC000B7ED1 /* node_list.c */; };
 		BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1F22A1A9EC000B7ED1 /* cnary.c */; };
@@ -336,6 +332,7 @@
 		D57FE84428C7DB7100216002 /* ErrorLogViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */; };
 		D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = D58916FD28C7C55C00E39C8B /* LoggedError.swift */; };
 		D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D593F1932717749A006E82DE /* PatchAppOperation.swift */; };
+		D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */; };
 		D5CA0C4B280E141900469595 /* ManagedPatron.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4A280E141900469595 /* ManagedPatron.swift */; };
 		D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */; };
 		D5DAE0942804B0B80034D8D4 /* ScreenshotProcessor.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5DAE0932804B0B80034D8D4 /* ScreenshotProcessor.swift */; };
@@ -482,7 +479,6 @@
 			dstPath = "";
 			dstSubfolderSpec = 10;
 			files = (
-				B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */,
 				BF1614F2250822F100767AEA /* Roxas.framework in Embed Frameworks */,
 				BF66EE862501AE50007EE018 /* AltStoreCore.framework in Embed Frameworks */,
 			);
@@ -503,12 +499,45 @@
 /* End PBXCopyFilesBuildPhase section */

 /* Begin PBXFileReference section */
+		0E1A1F902AE36A9600364CAD /* bytearray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = src/bytearray.c; sourceTree = "<group>"; };
+		0E764E162ADFF5740043DD4E /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; name = AltBackup.ipa; path = AltStore/Resources/AltBackup.ipa; sourceTree = SOURCE_ROOT; };
+		0EA166412ADFE0D1003015C1 /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166422ADFE0D1003015C1 /* Date.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166432ADFE0D1003015C1 /* Data.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166442ADFE0D1003015C1 /* bplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166452ADFE0D1003015C1 /* Array.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166462ADFE0D1003015C1 /* Dictionary.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166472ADFE0D1003015C1 /* out-limd.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-limd.c"; path = "Dependencies/libplist/src/out-limd.c"; sourceTree = SOURCE_ROOT; };
+		0EA166492ADFE0D1003015C1 /* String.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664A2ADFE0D1003015C1 /* base64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
+		0EA1664B2ADFE0D1003015C1 /* Uid.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664C2ADFE0D1003015C1 /* time64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
+		0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664F2ADFE0D1003015C1 /* hashtable.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
+		0EA166502ADFE0D2003015C1 /* Node.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166512ADFE0D2003015C1 /* ptrarray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
+		0EA166522ADFE0D2003015C1 /* out-default.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-default.c"; path = "Dependencies/libplist/src/out-default.c"; sourceTree = SOURCE_ROOT; };
+		0EA166532ADFE0D2003015C1 /* Integer.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166542ADFE0D2003015C1 /* Real.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166552ADFE0D2003015C1 /* out-plutil.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-plutil.c"; path = "Dependencies/libplist/src/out-plutil.c"; sourceTree = SOURCE_ROOT; };
+		0EA166562ADFE0D2003015C1 /* oplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = oplist.c; path = Dependencies/libplist/src/oplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166572ADFE0D2003015C1 /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
+		0EA166582ADFE0D2003015C1 /* Key.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166592ADFE0D2003015C1 /* xplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
+		0EA1665A2ADFE0D2003015C1 /* Structure.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1665F2ADFE122003015C1 /* time64_limits.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
+		0EA166602ADFE122003015C1 /* time64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
+		0EA166612ADFE122003015C1 /* bytearray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
+		0EA166622ADFE122003015C1 /* ptrarray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
+		0EA166632ADFE122003015C1 /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
+		0EA166642ADFE122003015C1 /* plist.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
+		0EA166652ADFE122003015C1 /* hashtable.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
+		0EA166662ADFE122003015C1 /* base64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
+		0EA166672ADFE122003015C1 /* strbuf.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
+		0EA4B9BB2AE4A3F6009209CE /* plist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
 		19104DB22909C06C00C49C7B /* libEmotionalDamage.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libEmotionalDamage.a; sourceTree = BUILT_PRODUCTS_DIR; };
 		19104DB42909C06D00C49C7B /* EmotionalDamage.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EmotionalDamage.swift; sourceTree = "<group>"; };
 		191E5FAB290A5D92001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer.a; sourceTree = BUILT_PRODUCTS_DIR; };
-		191E5FCF290A651D001A3B7C /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
-		191E5FD0290A651D001A3B7C /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
-		191E5FD1290A651D001A3B7C /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
 		1920B04E2924AC8300744F60 /* Settings.bundle */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.plug-in"; path = Settings.bundle; sourceTree = "<group>"; };
 		19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SelectTeamViewController.swift; sourceTree = "<group>"; };
 		9961EC2D29BE9F2E00AF2C6F /* minimuxer-helpers.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; name = "minimuxer-helpers.swift"; path = "Dependencies/minimuxer/minimuxer-helpers.swift"; sourceTree = SOURCE_ROOT; };
@@ -573,7 +602,6 @@
 		BF41B807233433C100C593A3 /* LoadingState.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoadingState.swift; sourceTree = "<group>"; };
 		BF42345825101C1D006D1EB2 /* WidgetView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = WidgetView.swift; sourceTree = "<group>"; };
 		BF44EEEF246B08BA002A52F2 /* BackupController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = BackupController.swift; sourceTree = "<group>"; };
-		BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; path = AltBackup.ipa; sourceTree = "<group>"; };
 		BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RemoveAppOperation.swift; sourceTree = "<group>"; };
 		BF45872B2298D31600BD7491 /* libimobiledevice.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libimobiledevice.a; sourceTree = BUILT_PRODUCTS_DIR; };
 		BF4587C82298D3A800BD7491 /* service.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = service.h; path = Dependencies/libimobiledevice/src/service.h; sourceTree = SOURCE_ROOT; };
@@ -759,34 +787,6 @@
 		BFD2479E2284FBD000981D42 /* UIColor+AltStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "UIColor+AltStore.swift"; sourceTree = "<group>"; };
 		BFD44605241188C300EAB90A /* CodableServerError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = CodableServerError.swift; sourceTree = "<group>"; };
 		BFD52BD222A06EFB000B7ED1 /* ALTConstants.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTConstants.h; sourceTree = "<group>"; };
-		BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE622A1A9CA000B7ED1 /* base64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE722A1A9CA000B7ED1 /* hashtable.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
-		BFD52BEA22A1A9CA000B7ED1 /* bplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
-		BFD52BEB22A1A9CA000B7ED1 /* String.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BEC22A1A9CA000B7ED1 /* time64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
-		BFD52BED22A1A9CA000B7ED1 /* plist.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
-		BFD52BEE22A1A9CA000B7ED1 /* plist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
-		BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF022A1A9CA000B7ED1 /* Date.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF322A1A9CA000B7ED1 /* Real.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF422A1A9CA000B7ED1 /* strbuf.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF522A1A9CA000B7ED1 /* bytearray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = Dependencies/libplist/src/bytearray.c; sourceTree = SOURCE_ROOT; };
-		BFD52BF622A1A9CA000B7ED1 /* base64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF722A1A9CA000B7ED1 /* Data.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF822A1A9CB000B7ED1 /* Array.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF922A1A9CB000B7ED1 /* Node.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
-		BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
-		BFD52BFF22A1A9CB000B7ED1 /* time64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
-		BFD52C0022A1A9CB000B7ED1 /* xplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1D22A1A9EC000B7ED1 /* node.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node.c; path = Dependencies/libplist/libcnary/node.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1E22A1A9EC000B7ED1 /* node_list.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node_list.c; path = Dependencies/libplist/libcnary/node_list.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1F22A1A9EC000B7ED1 /* cnary.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = cnary.c; path = Dependencies/libplist/libcnary/cnary.c; sourceTree = SOURCE_ROOT; };
@@ -840,6 +840,7 @@
 		D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorLogViewController.swift; sourceTree = "<group>"; };
 		D58916FD28C7C55C00E39C8B /* LoggedError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoggedError.swift; sourceTree = "<group>"; };
 		D593F1932717749A006E82DE /* PatchAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchAppOperation.swift; sourceTree = "<group>"; };
+		D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ClearAppCacheOperation.swift; sourceTree = "<group>"; };
 		D5CA0C4A280E141900469595 /* ManagedPatron.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ManagedPatron.swift; sourceTree = "<group>"; };
 		D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 10.xcdatamodel"; sourceTree = "<group>"; };
 		D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcmappingmodel; path = AltStore9ToAltStore10.xcmappingmodel; sourceTree = "<group>"; };
@@ -1192,37 +1193,41 @@
 		BF4588562298DC6D00BD7491 /* libplist */ = {
 			isa = PBXGroup;
 			children = (
-				BFD52BE622A1A9CA000B7ED1 /* base64.c */,
-				BFD52BEA22A1A9CA000B7ED1 /* bplist.c */,
-				BFD52BF522A1A9CA000B7ED1 /* bytearray.c */,
-				BFD52BE722A1A9CA000B7ED1 /* hashtable.c */,
-				191E5FCF290A651D001A3B7C /* jplist.c */,
-				191E5FD0290A651D001A3B7C /* jsmn.c */,
-				BFD52BEE22A1A9CA000B7ED1 /* plist.c */,
-				BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */,
-				BFD52BEC22A1A9CA000B7ED1 /* time64.c */,
-				BFD52C0022A1A9CB000B7ED1 /* xplist.c */,
-				BFD52BF822A1A9CB000B7ED1 /* Array.cpp */,
-				BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */,
-				BFD52BF722A1A9CA000B7ED1 /* Data.cpp */,
-				BFD52BF022A1A9CA000B7ED1 /* Date.cpp */,
-				BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */,
-				BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */,
-				BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */,
-				BFD52BF922A1A9CB000B7ED1 /* Node.cpp */,
-				BFD52BF322A1A9CA000B7ED1 /* Real.cpp */,
-				BFD52BEB22A1A9CA000B7ED1 /* String.cpp */,
-				BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */,
-				BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */,
-				BFD52BF622A1A9CA000B7ED1 /* base64.h */,
-				BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */,
-				BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */,
-				191E5FD1290A651D001A3B7C /* jsmn.h */,
-				BFD52BED22A1A9CA000B7ED1 /* plist.h */,
-				BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */,
-				BFD52BF422A1A9CA000B7ED1 /* strbuf.h */,
-				BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */,
-				BFD52BFF22A1A9CB000B7ED1 /* time64.h */,
+				0EA166462ADFE0D1003015C1 /* Dictionary.cpp */,
+				0E1A1F902AE36A9600364CAD /* bytearray.c */,
+				0EA166442ADFE0D1003015C1 /* bplist.c */,
+				0EA166432ADFE0D1003015C1 /* Data.cpp */,
+				0EA166422ADFE0D1003015C1 /* Date.cpp */,
+				0EA1664F2ADFE0D1003015C1 /* hashtable.c */,
+				0EA166532ADFE0D2003015C1 /* Integer.cpp */,
+				0EA166562ADFE0D2003015C1 /* oplist.c */,
+				0EA166522ADFE0D2003015C1 /* out-default.c */,
+				0EA166472ADFE0D1003015C1 /* out-limd.c */,
+				0EA166552ADFE0D2003015C1 /* out-plutil.c */,
+				0EA166492ADFE0D1003015C1 /* String.cpp */,
+				0EA1665A2ADFE0D2003015C1 /* Structure.cpp */,
+				0EA166452ADFE0D1003015C1 /* Array.cpp */,
+				0EA1664A2ADFE0D1003015C1 /* base64.c */,
+				0EA166572ADFE0D2003015C1 /* jsmn.c */,
+				0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */,
+				0EA4B9BB2AE4A3F6009209CE /* plist.c */,
+				0EA166412ADFE0D1003015C1 /* jplist.c */,
+				0EA166582ADFE0D2003015C1 /* Key.cpp */,
+				0EA166512ADFE0D2003015C1 /* ptrarray.c */,
+				0EA1664C2ADFE0D1003015C1 /* time64.c */,
+				0EA166502ADFE0D2003015C1 /* Node.cpp */,
+				0EA166542ADFE0D2003015C1 /* Real.cpp */,
+				0EA1664B2ADFE0D1003015C1 /* Uid.cpp */,
+				0EA166592ADFE0D2003015C1 /* xplist.c */,
+				0EA166662ADFE122003015C1 /* base64.h */,
+				0EA166652ADFE122003015C1 /* hashtable.h */,
+				0EA166632ADFE122003015C1 /* jsmn.h */,
+				0EA166642ADFE122003015C1 /* plist.h */,
+				0EA166612ADFE122003015C1 /* bytearray.h */,
+				0EA166622ADFE122003015C1 /* ptrarray.h */,
+				0EA166672ADFE122003015C1 /* strbuf.h */,
+				0EA1665F2ADFE122003015C1 /* time64_limits.h */,
+				0EA166602ADFE122003015C1 /* time64.h */,
 				BF4588892298DDEA00BD7491 /* libcnary */,
 			);
 			path = libplist;
@@ -1619,7 +1624,7 @@
 		BFD247962284D7C100981D42 /* Resources */ = {
 			isa = PBXGroup;
 			children = (
-				BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */,
+				0E764E162ADFF5740043DD4E /* AltBackup.ipa */,
 				BFD247762284B9A700981D42 /* Assets.xcassets */,
 				BF770E6822BD57DD002A40FE /* Silence.m4a */,
 			);
@@ -1694,6 +1699,7 @@
 				D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */,
 				D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */,
 				D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */,
+				D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */,
 				BF7B44062725A4B8005288A4 /* Patch App */,
 			);
 			path = Operations;
@@ -1780,32 +1786,26 @@
 			isa = PBXHeadersBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				0EA166682ADFE122003015C1 /* jsmn.h in Headers */,
 				BF4588112298D3AB00BD7491 /* misagent.h in Headers */,
 				BF4588042298D3AB00BD7491 /* lockdown.h in Headers */,
 				BF45880B2298D3AB00BD7491 /* mobilesync.h in Headers */,
 				BF4588002298D3AB00BD7491 /* restore.h in Headers */,
 				BF4588152298D3AB00BD7491 /* mobilebackup.h in Headers */,
 				BF4588182298D3AB00BD7491 /* syslog_relay.h in Headers */,
-				BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */,
 				BF45881D2298D3AB00BD7491 /* file_relay.h in Headers */,
-				BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */,
 				BF4587FD2298D3AB00BD7491 /* sbservices.h in Headers */,
 				BF4588362298D3C100BD7491 /* debug.h in Headers */,
 				BF4588202298D3AB00BD7491 /* mobile_image_mounter.h in Headers */,
 				BF4588122298D3AB00BD7491 /* house_arrest.h in Headers */,
 				BF45881F2298D3AB00BD7491 /* device_link_service.h in Headers */,
-				BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */,
 				BF45880E2298D3AB00BD7491 /* debugserver.h in Headers */,
 				BF4588102298D3AB00BD7491 /* heartbeat.h in Headers */,
 				BF4587FA2298D3AB00BD7491 /* diagnostics_relay.h in Headers */,
-				BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */,
-				BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */,
 				BF4588192298D3AB00BD7491 /* webinspector.h in Headers */,
 				BF4588342298D3C100BD7491 /* userpref.h in Headers */,
 				BF45880A2298D3AB00BD7491 /* screenshotr.h in Headers */,
-				BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */,
 				BF4587FE2298D3AB00BD7491 /* mobilebackup2.h in Headers */,
-				BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */,
 				BF45881C2298D3AB00BD7491 /* afc.h in Headers */,
 				BF45881A2298D3AB00BD7491 /* mobileactivation.h in Headers */,
 				BF4588052298D3AB00BD7491 /* idevice.h in Headers */,
@@ -1813,7 +1813,6 @@
 				BF4587F82298D3AB00BD7491 /* service.h in Headers */,
 				BF4588252298D3AB00BD7491 /* property_list_service.h in Headers */,
 				BF4588132298D3AB00BD7491 /* notification_proxy.h in Headers */,
-				BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -2209,7 +2208,6 @@
 				BFE60738231ADF49002B0E8E /* Settings.storyboard in Resources */,
 				D57DF638271E32F000677701 /* PatchApp.storyboard in Resources */,
 				BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */,
-				BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */,
 				BF770E6922BD57DD002A40FE /* Silence.m4a in Resources */,
 				BFD247772284B9A700981D42 /* Assets.xcassets in Resources */,
 				1920B04F2924AC8300744F60 /* Settings.bundle in Resources */,
@@ -2217,6 +2215,7 @@
 				BFB6B22423187A3D0022A802 /* NewsCollectionViewCell.xib in Resources */,
 				BFD247752284B9A500981D42 /* Main.storyboard in Resources */,
 				BFDB5B2622EFBBEA00F74113 /* BrowseCollectionViewCell.xib in Resources */,
+				0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */,
 				BFE6073C231AE1E7002B0E8E /* SettingsHeaderFooterView.xib in Resources */,
 				BF29012F2318F6B100D88A45 /* AppBannerView.xib in Resources */,
 				BFE6325A22A83BEB00F30809 /* Authentication.storyboard in Resources */,
@@ -2292,69 +2291,73 @@
 			isa = PBXSourcesBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */,
+				0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */,
+				0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */,
+				0EA166742ADFE140003015C1 /* Date.cpp in Sources */,
+				0EA166712ADFE140003015C1 /* Key.cpp in Sources */,
+				0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */,
+				0EA1666A2ADFE140003015C1 /* String.cpp in Sources */,
+				0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */,
+				0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */,
+				0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */,
+				0EA166702ADFE140003015C1 /* Node.cpp in Sources */,
+				0EA166752ADFE140003015C1 /* Real.cpp in Sources */,
+				0EA166762ADFE140003015C1 /* base64.c in Sources */,
+				0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */,
 				BF45881B2298D3AB00BD7491 /* house_arrest.c in Sources */,
-				BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */,
+				0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */,
 				BF4588232298D3AB00BD7491 /* mobilesync.c in Sources */,
 				BF4588072298D3AB00BD7491 /* afc.c in Sources */,
-				191E607D290B2EA5001A3B7C /* jsmn.c in Sources */,
-				191E607E290B2EA7001A3B7C /* jplist.c in Sources */,
 				BF4588082298D3AB00BD7491 /* mobile_image_mounter.c in Sources */,
-				BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */,
 				BF4588022298D3AB00BD7491 /* file_relay.c in Sources */,
 				BF45880F2298D3AB00BD7491 /* debugserver.c in Sources */,
+				0EA166792ADFE140003015C1 /* bplist.c in Sources */,
+				0EA166772ADFE140003015C1 /* jplist.c in Sources */,
 				BF4588162298D3AB00BD7491 /* restore.c in Sources */,
-				BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */,
-				BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */,
 				BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */,
 				BF4588092298D3AB00BD7491 /* installation_proxy.c in Sources */,
+				0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */,
+				0EA1667E2ADFE140003015C1 /* time64.c in Sources */,
 				BF4587FF2298D3AB00BD7491 /* heartbeat.c in Sources */,
 				BF4588222298D3AB00BD7491 /* mobileactivation.c in Sources */,
-				BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */,
 				BF4588212298D3AB00BD7491 /* idevice.c in Sources */,
 				B343F885295F7C5D002B1159 /* tlv.c in Sources */,
-				BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */,
 				BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */,
 				B343F87D295F7C5D002B1159 /* cbuf.c in Sources */,
 				BF4588062298D3AB00BD7491 /* webinspector.c in Sources */,
-				BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */,
 				B343F883295F7C5D002B1159 /* thread.c in Sources */,
 				BF45880D2298D3AB00BD7491 /* mobilebackup.c in Sources */,
-				BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */,
-				BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */,
-				BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */,
 				BF45883A2298D3C100BD7491 /* debug.c in Sources */,
 				B343F881295F7C5D002B1159 /* termcolors.c in Sources */,
+				0EA1667D2ADFE140003015C1 /* xplist.c in Sources */,
 				B343F87E295F7C5D002B1159 /* collection.c in Sources */,
-				BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */,
 				B33FFBAA295F8F78002259E6 /* preboard.c in Sources */,
 				B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */,
 				BF4587FB2298D3AB00BD7491 /* notification_proxy.c in Sources */,
 				BF4588352298D3C100BD7491 /* userpref.c in Sources */,
-				BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */,
+				0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */,
 				B343F87C295F7C5D002B1159 /* opack.c in Sources */,
-				BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */,
-				BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */,
 				B343F884295F7C5D002B1159 /* utils.c in Sources */,
 				BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */,
 				B343F87F295F7C5D002B1159 /* glue.c in Sources */,
-				BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */,
 				BF4588242298D3AB00BD7491 /* property_list_service.c in Sources */,
 				BF45881E2298D3AB00BD7491 /* misagent.c in Sources */,
+				0EA166692ADFE140003015C1 /* Array.cpp in Sources */,
 				B343F880295F7C5D002B1159 /* socket.c in Sources */,
 				BF4587FC2298D3AB00BD7491 /* sbservices.c in Sources */,
-				BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */,
+				0EA166782ADFE140003015C1 /* jsmn.c in Sources */,
 				BF4588142298D3AB00BD7491 /* device_link_service.c in Sources */,
 				BF4588172298D3AB00BD7491 /* screenshotr.c in Sources */,
-				BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */,
-				BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */,
 				BF4588432298D40000BD7491 /* libusbmuxd.c in Sources */,
+				0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */,
+				0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */,
 				BF4588032298D3AB00BD7491 /* syslog_relay.c in Sources */,
 				BF4588272298D3AB00BD7491 /* service.c in Sources */,
-				BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */,
 				BF4588262298D3AB00BD7491 /* lockdown.c in Sources */,
 				BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */,
 				BF45880C2298D3AB00BD7491 /* mobilebackup2.c in Sources */,
-				BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */,
+				0EA4B9BC2AE4A414009209CE /* plist.c in Sources */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -2504,6 +2507,7 @@
 				BFD6B03322DFF20800B86064 /* MyAppsComponents.swift in Sources */,
 				BF41B808233433C100C593A3 /* LoadingState.swift in Sources */,
 				BFF0B69A2322D7D0007A79E1 /* UIScreen+CompactHeight.swift in Sources */,
+				D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */,
 				D5F2F6A92720B7C20081CCF5 /* PatchViewController.swift in Sources */,
 				B39F16132918D7C5002E9404 /* Consts.swift in Sources */,
 				BF8F69C222E659F700049BA1 /* AppContentViewController.swift in Sources */,
@@ -3224,6 +3228,7 @@
 					"$(PROJECT_DIR)/Dependencies/libfragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
 				);
+				OTHER_LDFLAGS = "";
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
@@ -3258,6 +3263,7 @@
 					"$(PROJECT_DIR)/Dependencies/libfragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
 				);
+				OTHER_LDFLAGS = "";
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
--- a/AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved
+++ b/AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved
@@ -6,7 +6,7 @@
      "location" : "https://github.com/SideStore/AltSign",
      "state" : {
        "branch" : "master",
-        "revision" : "602b1aded00b08e82a2ddb802b3cde6817ba7156"
+        "revision" : "cc6189f0f7cd8e5bd24943af9322e0ff9420e9f4"
      }
    },
    {
@@ -14,8 +14,8 @@
      "kind" : "remoteSourceControl",
      "location" : "https://github.com/microsoft/appcenter-sdk-apple.git",
      "state" : {
-        "revision" : "8354a50fe01a7e54e196d3b5493b5ab53dd5866a",
-        "version" : "4.4.2"
+        "revision" : "b2dc99cfedead0bad4e6573d86c5228c89cff332",
+        "version" : "4.4.3"
      }
    },
    {
@@ -59,8 +59,8 @@
      "kind" : "remoteSourceControl",
      "location" : "https://github.com/krzyzanowskim/OpenSSL",
      "state" : {
-        "revision" : "0c70e4b7d22411a7fe3ff59b913d5b760b735ce1",
-        "version" : "1.1.2100"
+        "revision" : "0faf71a188bcfdf0245cab42886b9b240ca71c52",
+        "version" : "1.1.2200"
      }
    },
    {
@@ -68,8 +68,8 @@
      "kind" : "remoteSourceControl",
      "location" : "https://github.com/microsoft/PLCrashReporter.git",
      "state" : {
-        "revision" : "6b27393cad517c067dceea85fadf050e70c4ceaa",
-        "version" : "1.10.1"
+        "revision" : "81cdec2b3827feb03286cb297f4c501a8eb98df1",
+        "version" : "1.10.2"
      }
    },
    {
@@ -77,8 +77,8 @@
      "kind" : "remoteSourceControl",
      "location" : "https://github.com/SwiftPackageIndex/SemanticVersion.git",
      "state" : {
-        "revision" : "fc670910dc0903cc269b3d0b776cda5703979c4e",
-        "version" : "0.3.5"
+        "revision" : "a70840d5fca686ae3bd2fcf8aecc5ded0bd4f125",
+        "version" : "0.3.6"
      }
    },
    {
@@ -86,8 +86,8 @@
      "kind" : "remoteSourceControl",
      "location" : "https://github.com/sparkle-project/Sparkle.git",
      "state" : {
-        "revision" : "286edd1fa22505a9e54d170e9fd07d775ea233f2",
-        "version" : "2.1.0"
+        "revision" : "f0ceaf5cc9f3f23daa0ccb6dcebd79fc96ccc7d9",
+        "version" : "2.5.0"
      }
    },
    {
@@ -95,8 +95,8 @@
      "kind" : "remoteSourceControl",
      "location" : "https://github.com/daltoniam/Starscream.git",
      "state" : {
-        "revision" : "df8d82047f6654d8e4b655d1b1525c64e1059d21",
-        "version" : "4.0.4"
+        "revision" : "ac6c0fc9da221873e01bd1a0d4818498a71eef33",
+        "version" : "4.0.6"
      }
    },
    {
--- a/IDs/AppIDsViewController.swift
+++ b/IDs/AppIDsViewController.swift
@@ -90,14 +90,21 @@ private extension AppIDsViewController
                cell.bannerView.button.isUserInteractionEnabled = false
                
                cell.bannerView.buttonLabel.isHidden = false
-                
+
                let currentDate = Date()
                
-                let numberOfDays = expirationDate.numberOfCalendarDays(since: currentDate)
-                let numberOfDaysText = (numberOfDays == 1) ? NSLocalizedString("1 day", comment: "") : String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
-                cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
+                let formatter = DateComponentsFormatter()
+                formatter.unitsStyle = .full
+                formatter.includesApproximationPhrase = false
+                formatter.includesTimeRemainingPhrase = false
+                formatter.allowedUnits = [.minute, .hour, .day]
+                formatter.maximumUnitCount = 1
                
-                attributedAccessibilityLabel.mutableString.append(String(format: NSLocalizedString("Expires in %@.", comment: ""), numberOfDaysText) + " ")
+                cell.bannerView.button.setTitle((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")).uppercased(), for: .normal)
+                
+                // formatter.includesTimeRemainingPhrase = true
+                
+                // attributedAccessibilityLabel.mutableString.append((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " ")
            }
            else
            {
--- a/AltStore/Browse/BrowseViewController.swift
+++ b/AltStore/Browse/BrowseViewController.swift
@@ -8,6 +8,7 @@

 import UIKit

+import minimuxer
 import AltStoreCore
 import Roxas

@@ -77,7 +78,7 @@ private extension BrowseViewController
                                        NSSortDescriptor(keyPath: \StoreApp.name, ascending: true),
                                        NSSortDescriptor(keyPath: \StoreApp.bundleIdentifier, ascending: true)]
        fetchRequest.returnsObjectsAsFaults = false
-        fetchRequest.predicate = NSPredicate(format: "%K != %@", #keyPath(StoreApp.bundleIdentifier), StoreApp.altstoreAppID)
+        fetchRequest.predicate = NSPredicate(format: "%K != %@", #keyPath(StoreApp.sourceIdentifier), Source.altStoreIdentifier)
        
        let dataSource = RSTFetchedResultsCollectionViewPrefetchingDataSource<StoreApp, UIImage>(fetchRequest: fetchRequest, managedObjectContext: DatabaseManager.shared.viewContext)
        dataSource.cellConfigurationHandler = { (cell, app, indexPath) in
@@ -264,7 +265,13 @@ private extension BrowseViewController
            previousProgress?.cancel()
            return
        }
-        
+
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
        _ = AppManager.shared.install(app, presentingViewController: self) { (result) in
            DispatchQueue.main.async {
                switch result
--- a/AltStore/Info.plist
+++ b/AltStore/Info.plist
@@ -4,8 +4,8 @@
 <dict>
 	<key>ALTAppGroups</key>
 	<array>
-		<string>group.com.SideStore.SideStore</string>
 		<string>group.$(APP_GROUP_IDENTIFIER)</string>
+		<string>group.com.SideStore.SideStore</string>
 	</array>
 	<key>ALTDeviceID</key>
 	<string>00008101-000129D63698001E</string>
--- a/AltStore/LaunchViewController.swift
+++ b/AltStore/LaunchViewController.swift
@@ -81,7 +81,7 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
        } else {
            // Show an alert explaining the pairing file
            // Create new Alert
-            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/install#pairing-process", preferredStyle: .alert)
+            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/getting-started/#pairing-file", preferredStyle: .alert)
            
            // Create OK button with action handler
            let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
@@ -155,7 +155,12 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
            try! FileManager.default.removeItem(at: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)"))
            displayError("minimuxer failed to start, please restart SideStore. \((error as? LocalizedError)?.failureReason ?? "UNKNOWN ERROR!!!!!! REPORT TO GITHUB ISSUES!")")
        }
-        start_auto_mounter(documentsDirectory)
+        if #available(iOS 17, *) {
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
+        }
    }
 }

--- a/Apps/AppManager.swift
+++ b/Apps/AppManager.swift
@@ -307,6 +307,16 @@ extension AppManager
            presentingViewController.present(alertController, animated: true, completion: nil)
        }
    }
+    
+    func clearAppCache(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let clearAppCacheOperation = ClearAppCacheOperation()
+        clearAppCacheOperation.resultHandler = { result in
+            completion(result)
+        }
+        
+        self.run([clearAppCacheOperation], context: nil)
+    }
 }

 extension AppManager
@@ -754,6 +764,12 @@ extension AppManager
        let progress = self.refreshProgress[app.bundleIdentifier]
        return progress
    }
+    
+    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
+    {
+        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
+        return isActivelyManaging
+    }
 }

 extension AppManager
@@ -808,12 +824,6 @@ private extension AppManager
        }
    }
    
-    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
-    {
-        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
-        return isActivelyManaging
-    }
-    
    @discardableResult
    private func perform(_ operations: [AppOperation], presentingViewController: UIViewController?, group: RefreshGroup) -> RefreshGroup
    {
@@ -948,7 +958,13 @@ private extension AppManager
        }
        else
        {
+            DispatchQueue.main.schedule {
+                UIApplication.shared.isIdleTimerDisabled = UserDefaults.standard.isIdleTimeoutDisableEnabled
+            }
            performAppOperations()
+            DispatchQueue.main.schedule {
+                UIApplication.shared.isIdleTimerDisabled = false
+            }
        }
        
        return group
@@ -1027,6 +1043,32 @@ private extension AppManager
        verifyOperation.addDependency(downloadOperation)
        
        
+        /* Refresh Anisette Data */
+        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
+        refreshAnisetteDataOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
+            }
+        }
+        refreshAnisetteDataOperation.addDependency(verifyOperation)
+
+
+        /* Fetch Provisioning Profiles */
+        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
+        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
+        fetchProvisioningProfilesOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
+            }
+        }
+        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
+        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
+
+
        /* Deactivate Apps (if necessary) */
        let deactivateAppsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
            do
@@ -1042,6 +1084,12 @@ private extension AppManager
                {
                    throw error
                }
+                
+                guard let profiles = context.provisioningProfiles else { throw OperationError.invalidParameters }
+                if !profiles.contains(where: { $1.isFreeProvisioningProfile == true }) {
+                    operation.finish()
+                    return
+                }
                                
                guard let app = context.app, let presentingViewController = context.authenticatedContext.presentingViewController else { throw OperationError.invalidParameters }
                
@@ -1061,7 +1109,7 @@ private extension AppManager
                operation.finish()
            }
        }
-        deactivateAppsOperation.addDependency(verifyOperation)
+        deactivateAppsOperation.addDependency(fetchProvisioningProfilesOperation)
        
        
        /* Patch App */
@@ -1136,32 +1184,6 @@ private extension AppManager
        patchAppOperation.addDependency(deactivateAppsOperation)
        
        
-        /* Refresh Anisette Data */
-        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
-        refreshAnisetteDataOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
-            }
-        }
-        refreshAnisetteDataOperation.addDependency(patchAppOperation)
-        
-        
-        /* Fetch Provisioning Profiles */
-        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
-        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
-        fetchProvisioningProfilesOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
-            }
-        }
-        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
-        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
-        
-        
        /* Resign */
        let resignAppOperation = ResignAppOperation(context: context)
        resignAppOperation.resultHandler = { (result) in
@@ -1171,7 +1193,7 @@ private extension AppManager
            case .success(let resignedApp): context.resignedApp = resignedApp
            }
        }
-        resignAppOperation.addDependency(fetchProvisioningProfilesOperation)
+        resignAppOperation.addDependency(patchAppOperation)
        progress.addChild(resignAppOperation.progress, withPendingUnitCount: 20)
        
        
@@ -1214,7 +1236,7 @@ private extension AppManager
        progress.addChild(installOperation.progress, withPendingUnitCount: 30)
        installOperation.addDependency(sendAppOperation)
        
-        let operations = [downloadOperation, verifyOperation, deactivateAppsOperation, patchAppOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, resignAppOperation, sendAppOperation, installOperation]
+        let operations = [downloadOperation, verifyOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, deactivateAppsOperation, patchAppOperation, resignAppOperation, sendAppOperation, installOperation]
        group.add(operations)
        self.run(operations, context: group.context)
        
--- a/Apps/MyAppsViewController.swift
+++ b/Apps/MyAppsViewController.swift
@@ -15,6 +15,7 @@ import UniformTypeIdentifiers
 import AltStoreCore
 import AltSign
 import Roxas
+import minimuxer

 import Nuke

@@ -328,21 +329,25 @@ private extension MyAppsViewController
            let currentDate = Date()
            
            let numberOfDays = installedApp.expirationDate.numberOfCalendarDays(since: currentDate)
-            let numberOfDaysText: String
            
-            if numberOfDays == 1
-            {
-                numberOfDaysText = NSLocalizedString("1 day", comment: "")
-            }
-            else
-            {
-                numberOfDaysText = String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
-            }
+            let formatter = DateComponentsFormatter()
+            formatter.unitsStyle = .full
+            formatter.includesApproximationPhrase = false
+            formatter.includesTimeRemainingPhrase = false
+            
+            formatter.allowedUnits = [.day, .hour, .minute]
+            
+            formatter.maximumUnitCount = 1
+            
+            
+            
+            cell.bannerView.button.setTitle(formatter.string(from: currentDate, to: installedApp.expirationDate)?.uppercased(), for: .normal)
            
-            cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
            cell.bannerView.button.accessibilityLabel = String(format: NSLocalizedString("Refresh %@", comment: ""), installedApp.name)
-            
-            cell.bannerView.accessibilityLabel? += ". " + String(format: NSLocalizedString("Expires in %@", comment: ""), numberOfDaysText)
+
+            formatter.includesTimeRemainingPhrase = true
+
+            cell.bannerView.accessibilityLabel? += ". " + (formatter.string(from: currentDate, to: installedApp.expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " "
            
            // Make sure refresh button is correct size.
            cell.layoutIfNeeded()
@@ -640,6 +645,12 @@ private extension MyAppsViewController
    
    @IBAction func refreshAllApps(_ sender: UIBarButtonItem)
    {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
        self.isRefreshingAllApps = true
        self.collectionView.collectionViewLayout.invalidateLayout()

@@ -702,6 +713,12 @@ private extension MyAppsViewController
    
    @IBAction func sideloadApp(_ sender: UIBarButtonItem)
    {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
        let supportedTypes = UTType.types(tag: "ipa", tagClass: .filenameExtension, conformingTo: nil)
        
        let documentPickerViewController = UIDocumentPickerViewController(forOpeningContentTypes: supportedTypes, asCopy: true)
@@ -1006,6 +1023,12 @@ private extension MyAppsViewController
    
    func refresh(_ installedApp: InstalledApp)
    {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
        let previousProgress = AppManager.shared.refreshProgress(for: installedApp)
        guard previousProgress == nil else {
            previousProgress?.cancel()
@@ -1027,6 +1050,12 @@ private extension MyAppsViewController
    
    func activate(_ installedApp: InstalledApp)
    {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
        func finish(_ result: Result<InstalledApp, Error>)
        {
            do
@@ -1103,6 +1132,11 @@ private extension MyAppsViewController
    func deactivate(_ installedApp: InstalledApp, completionHandler: ((Result<InstalledApp, Error>) -> Void)? = nil)
    {
        guard installedApp.isActive else { return }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
        installedApp.isActive = false
        
        AppManager.shared.deactivate(installedApp, presentingViewController: self) { (result) in
@@ -1164,6 +1198,11 @@ private extension MyAppsViewController
    
    func backup(_ installedApp: InstalledApp)
    {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
        let title = NSLocalizedString("Start Backup?", comment: "")
        let message = NSLocalizedString("This will replace any previous backups. Please leave SideStore open until the backup is complete.", comment: "")

@@ -1203,6 +1242,11 @@ private extension MyAppsViewController
    
    func restore(_ installedApp: InstalledApp)
    {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
        let message = String(format: NSLocalizedString("This will replace all data you currently have in %@.", comment: ""), installedApp.name)
        let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to restore this backup?", comment: ""), message: message, preferredStyle: .actionSheet)
        alertController.addAction(.cancel)
@@ -1306,6 +1350,16 @@ private extension MyAppsViewController
    @available(iOS 14, *)
    func enableJIT(for installedApp: InstalledApp)
    {
+        if #available(iOS 17, *) {
+            let toastView = ToastView(error: OperationError.tooNewError)
+            toastView.show(in: self)
+            return
+        }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
        AppManager.shared.enableJIT(for: installedApp) { result in
            DispatchQueue.main.async {
                switch result
@@ -1313,7 +1367,7 @@ private extension MyAppsViewController
                case .success: break
                case .failure(let error):
                    let toastView = ToastView(error: error)
-                    toastView.show(in: self)
+                    toastView.show(in: self.navigationController?.view ?? self.view, duration: 5)
                }
            }
        }
@@ -1460,7 +1514,7 @@ extension MyAppsViewController
                let registeredAppIDs = team.appIDs.count
                
                let maximumAppIDCount = 10
-                let remainingAppIDs = max(maximumAppIDCount - registeredAppIDs, 0)
+                let remainingAppIDs = maximumAppIDCount - registeredAppIDs
                
                if remainingAppIDs == 1
                {
@@ -1471,7 +1525,7 @@ extension MyAppsViewController
                    footerView.textLabel.text = String(format: NSLocalizedString("%@ App IDs Remaining", comment: ""), NSNumber(value: remainingAppIDs))
                }
                
-                footerView.textLabel.isHidden = false
+                footerView.textLabel.isHidden = remainingAppIDs < 0
                
            case .individual, .organization, .unknown: footerView.textLabel.isHidden = true
            @unknown default: break
--- a/AltStore/Operations/AuthenticationOperation.swift
+++ b/AltStore/Operations/AuthenticationOperation.swift
@@ -12,6 +12,7 @@ import Network

 import AltStoreCore
 import AltSign
+import minimuxer

 enum AuthenticationError: LocalizedError
 {
@@ -593,7 +594,7 @@ private extension AuthenticationOperation
    
    func registerCurrentDevice(for team: ALTTeam, session: ALTAppleAPISession, completionHandler: @escaping (Result<ALTDevice, Error>) -> Void)
    {
-        guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else {
+        guard let udid = fetch_udid()?.toString() else {
            return completionHandler(.failure(OperationError.unknownUDID))
        }
        
--- a/AltStore/Operations/BackgroundRefreshAppsOperation.swift
+++ b/AltStore/Operations/BackgroundRefreshAppsOperation.swift
@@ -105,8 +105,13 @@ final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<Inst
        } catch {
            self.finish(.failure(error))
        }
-        start_auto_mounter(documentsDirectory)
-        
+        if #available(iOS 17, *) {
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
+        }
+
        self.managedObjectContext.perform {
            print("Apps to refresh:", self.installedApps.map(\.bundleIdentifier))
            
--- a/AltStore/Operations/BackupAppOperation.swift
+++ b/AltStore/Operations/BackupAppOperation.swift
@@ -55,9 +55,8 @@ class BackupAppOperation: ResultOperation<Void>
                    let appName = installedApp.name
                    self.appName = appName
                    
-                    guard let altstoreApp = InstalledApp.fetchAltStore(in: context) else { throw OperationError.appNotFound }
-                    let altstoreOpenURL = altstoreApp.openAppURL
-                    
+                    let altstoreOpenURL = URL(string: "sidestore://")!
+
                    var returnURLComponents = URLComponents(url: altstoreOpenURL, resolvingAgainstBaseURL: false)
                    returnURLComponents?.host = "appBackupResponse"
                    guard let returnURL = returnURLComponents?.url else { throw OperationError.openAppFailed(name: appName) }
--- a/AltStore/Operations/ClearAppCacheOperation.swift
+++ b/AltStore/Operations/ClearAppCacheOperation.swift
@@ -0,0 +1,208 @@
+//
+//  ClearAppCacheOperation.swift
+//  AltStore
+//
+//  Created by Riley Testut on 9/27/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import Foundation
+import AltStoreCore
+/*
+struct BatchError: ALTLocalizedError
+{
+
+    enum Code: Int, ALTErrorCode
+    {
+        typealias Error = BatchError
+        
+        case batchError
+    }
+
+    var code: Code = .batchError
+    var underlyingErrors: [Error]
+    
+    var errorTitle: String?
+    var errorFailure: String?
+    
+    init(errors: [Error])
+    {
+        self.underlyingErrors = errors
+    }
+    
+    var errorFailureReason: String {
+        guard !self.underlyingErrors.isEmpty else { return NSLocalizedString("An unknown error occured.", comment: "") }
+        
+        let errorMessages = self.underlyingErrors.map { $0.localizedDescription }
+        
+        let message = errorMessages.joined(separator: "\n\n")
+        return message
+    }
+}
+*/
+@objc(ClearAppCacheOperation)
+class ClearAppCacheOperation: ResultOperation<Void>
+{
+    private let coordinator = NSFileCoordinator()
+    private let coordinatorQueue = OperationQueue()
+    
+    override init()
+    {
+        self.coordinatorQueue.name = "AltStore - ClearAppCacheOperation Queue"
+    }
+    
+    override func main()
+    {
+        super.main()
+        
+        var allErrors = [Error]()
+        
+        self.clearTemporaryDirectory { result in
+            switch result
+            {
+            //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+            case .failure(let error): allErrors.append(error)
+            case .success: break
+            }
+            
+            self.removeUninstalledAppBackupDirectories { result in
+                switch result
+                {
+                //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+                case .failure(let error): allErrors.append(error)
+                case .success: break
+                }
+                
+                if allErrors.isEmpty
+                {
+                    self.finish(.success(()))
+                }
+                else
+                {
+                    self.finish(.failure(OperationError.cacheClearError(errors: allErrors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+            }
+        }
+    }
+}
+
+private extension ClearAppCacheOperation
+{
+    func clearTemporaryDirectory(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let intent = NSFileAccessIntent.writingIntent(with: FileManager.default.temporaryDirectory, options: [.forDeleting])
+        self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+            do
+            {
+                if let error
+                {
+                    throw error
+                }
+                
+                let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                           includingPropertiesForKeys: [],
+                                                                           options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                var errors = [Error]()
+                
+                for fileURL in fileURLs
+                {
+                    do
+                    {
+                        print("[ALTLog] Removing item from temporary directory:", fileURL.lastPathComponent)
+                        try FileManager.default.removeItem(at: fileURL)
+                    }
+                    catch
+                    {
+                        print("[ALTLog] Failed to remove \(fileURL.lastPathComponent) from temporary directory.", error)
+                        errors.append(error)
+                    }
+                }
+                
+                if !errors.isEmpty
+                {
+                    completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+                else
+                {
+                    completion(.success(()))
+                }
+            }
+            catch
+            {
+                completion(.failure(error))
+            }
+        }
+    }
+    
+    func removeUninstalledAppBackupDirectories(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        guard let backupsDirectory = FileManager.default.appBackupsDirectory else { return completion(.failure(OperationError.missingAppGroup)) }
+        
+        DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
+            let installedAppBundleIDs = Set(InstalledApp.all(in: context).map { $0.bundleIdentifier })
+            
+            let intent = NSFileAccessIntent.writingIntent(with: backupsDirectory, options: [.forDeleting])
+            self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+                do
+                {
+                    if let error
+                    {
+                        throw error
+                    }
+                    
+                    var isDirectory: ObjCBool = false
+                    guard FileManager.default.fileExists(atPath: intent.url.path, isDirectory: &isDirectory), isDirectory.boolValue else {
+                        completion(.success(()))
+                        return
+                    }
+                    
+                    let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                               includingPropertiesForKeys: [.isDirectoryKey, .nameKey],
+                                                                               options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                    var errors = [Error]()
+                    
+                    
+                    for backupDirectory in fileURLs
+                    {
+                        do
+                        {
+                            let resourceValues = try backupDirectory.resourceValues(forKeys: [.isDirectoryKey, .nameKey])
+                            guard let isDirectory = resourceValues.isDirectory, let bundleID = resourceValues.name else { continue }
+
+                            if isDirectory && !installedAppBundleIDs.contains(bundleID) && !AppManager.shared.isActivelyManagingApp(withBundleID: bundleID)
+                            {
+                                print("[ALTLog] Removing backup directory for uninstalled app:", bundleID)
+                                try FileManager.default.removeItem(at: backupDirectory)
+                            }
+                        }
+                        catch
+                        {
+                            print("[ALTLog] Failed to remove app backup directory:", error)
+                            errors.append(error)
+                        }
+                    }
+                    
+                    if !errors.isEmpty
+                    {
+                        completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                            return error.localizedDescription
+                        }))))
+                    }
+                    else
+                    {
+                        completion(.success(()))
+                    }
+                }
+                catch
+                {
+                    print("[ALTLog] Failed to remove app backup directory:", error)
+                    completion(.failure(error))
+                }
+            }
+        }
+    }
+}
--- a/AltStore/Operations/DeactivateAppOperation.swift
+++ b/AltStore/Operations/DeactivateAppOperation.swift
@@ -39,21 +39,14 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
            let allIdentifiers = [installedApp.resignedBundleIdentifier] + appExtensionProfiles
            
            for profile in allIdentifiers {
-                var attempts = 5
-                while (attempts > 0){
-                    print("Remove Provisioning profile attempts left: \(attempts)")
-                    do {
-                        try remove_provisioning_profile(profile)
-                        self.progress.completedUnitCount += 1
-                        installedApp.isActive = false
-                        self.finish(.success(installedApp))
-                        break
-                    } catch {
-                        attempts -= 1
-                        if (attempts <= 0){
-                            self.finish(.failure(error))
-                        }
-                    }
+                do {
+                    try remove_provisioning_profile(profile)
+                    self.progress.completedUnitCount += 1
+                    installedApp.isActive = false
+                    self.finish(.success(installedApp))
+                    break
+                } catch {
+                    self.finish(.failure(error))
                }
            }
        }
--- a/AltStore/Operations/EnableJITOperation.swift
+++ b/AltStore/Operations/EnableJITOperation.swift
@@ -50,7 +50,7 @@ final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
                do {
                    try debug_app(installedApp.resignedBundleIdentifier)
                    self.finish(.success(()))
-                    break
+                    retries = 0
                } catch {
                    retries -= 1
                    if (retries <= 0){
--- a/AltStore/Operations/FetchAnisetteDataOperation.swift
+++ b/AltStore/Operations/FetchAnisetteDataOperation.swift
@@ -218,7 +218,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
        self.socket.connect()
    }
    
-    func didReceive(event: WebSocketEvent, client: WebSocket) {
+    func didReceive(event: WebSocketEvent, client: WebSocketClient) {
        switch event {
        case .text(let string):
            do {
@@ -429,7 +429,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
    }
 }

-extension WebSocket {
+extension WebSocketClient {
    func json(_ dictionary: [String: String]) {
        let data = try! JSONSerialization.data(withJSONObject: dictionary, options: [])
        self.write(string: String(data: data, encoding: .utf8)!)
--- a/AltStore/Operations/FetchProvisioningProfilesOperation.swift
+++ b/AltStore/Operations/FetchProvisioningProfilesOperation.swift
@@ -262,10 +262,6 @@ extension FetchProvisioningProfilesOperation
                            {
                                throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
                            }
-                            else
-                            {
-                                throw ALTAppleAPIError(.maximumAppIDLimitReached)
-                            }
                        }
                    }
                    //App ID name must be ascii. If the name is not ascii, using bundleID instead
--- a/AltStore/Operations/InstallAppOperation.swift
+++ b/AltStore/Operations/InstallAppOperation.swift
@@ -41,12 +41,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
        
        guard
            let certificate = self.context.certificate,
-            let resignedApp = self.context.resignedApp
+            let resignedApp = self.context.resignedApp,
+            let provisioningProfiles = self.context.provisioningProfiles
        else { return self.finish(.failure(OperationError.invalidParameters)) }
        
        let backgroundContext = DatabaseManager.shared.persistentContainer.newBackgroundContext()
        backgroundContext.perform {
            
+            
            /* App */
            let installedApp: InstalledApp
            
@@ -116,8 +118,7 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
            // Temporary directory and resigned .ipa no longer needed, so delete them now to ensure AltStore doesn't quit before we get the chance to.
            self.cleanUp()
            
-            var activeProfiles: Set<String>?
-            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit
+            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit, provisioningProfiles.contains(where: { $1.isFreeProvisioningProfile == true })
            {
                // When installing these new profiles, AltServer will remove all non-active profiles to ensure we remain under limit.
                
@@ -142,11 +143,10 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                        installedApp.isActive = false
                    }
                }
-
-                activeProfiles = Set(activeApps.flatMap { (installedApp) -> [String] in
-                    let appExtensionProfiles = installedApp.appExtensions.map { $0.resignedBundleIdentifier }
-                    return [installedApp.resignedBundleIdentifier] + appExtensionProfiles
-                })
+            }
+            else
+            {
+                installedApp.isActive = true
            }
            
            var installing = true
@@ -169,14 +169,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>

                            let content = UNMutableNotificationContent()
                            content.title = "Refreshing..."
-                            content.body = "To finish refreshing SideStore must go to the home screen. Please reopen after!"
+                            content.body = "SideStore will automatically move to the homescreen to finish refreshing!"
                            let notification = UNNotificationRequest(identifier: Bundle.Info.appbundleIdentifier + ".FinishRefreshNotification", content: content, trigger: UNTimeIntervalNotificationTrigger(timeInterval: 2, repeats: false))
                            UNUserNotificationCenter.current().add(notification)
                            break
                        default:
                            print("Notifications are not enabled")

-                            let alert = UIAlertController(title: "Finish Refresh", message: "To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen manually or by hitting Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
+                            let alert = UIAlertController(title: "Finish Refresh", message: "Please reopen SideStore after the process is finished.To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen manually or by hitting Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
                            alert.addAction(UIAlertAction(title: NSLocalizedString("Continue", comment: ""), style: .default, handler: { _ in
                                print("Going home")
                                UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
@@ -198,22 +198,15 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                    UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
                }
            }
-            var attempts = 10
-            while (attempts != 0){
-                print("Install ipa attempts left: \(attempts)")
-                do {
-                    try install_ipa(installedApp.bundleIdentifier)
-                    installing = false
-                    installedApp.refreshedDate = Date()
-                    self.finish(.success(installedApp))
-                    break
-                } catch {
-                    attempts -= 1
-                    if (attempts <= 0){
-                        installing = false
-                        self.finish(.failure(MinimuxerError.InstallApp))
-                    }
-                }
+            
+            do {
+                try install_ipa(installedApp.bundleIdentifier)
+                installing = false
+                installedApp.refreshedDate = Date()
+                self.finish(.success(installedApp))
+            } catch let error {
+                installing = false
+                self.finish(.failure(error))
            }
        }
    }
--- a/AltStore/Operations/OperationError.swift
+++ b/AltStore/Operations/OperationError.swift
@@ -34,10 +34,14 @@ enum OperationError: LocalizedError
    case openAppFailed(name: String)
    case missingAppGroup
    
+    case noWiFi
+    case tooNewError
    case anisetteV1Error(message: String)
    case provisioningError(result: String, message: String?)
    case anisetteV3Error(message: String)
    
+    case cacheClearError(errors: [String])
+    
    var failureReason: String? {
        switch self {
        case .unknown: return NSLocalizedString("An unknown error occured.", comment: "")
@@ -53,9 +57,12 @@ enum OperationError: LocalizedError
        case .openAppFailed(let name): return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), name)
        case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be found.", comment: "")
        case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs.", comment: "")
+        case .noWiFi: return NSLocalizedString("You do not appear to be connected to WiFi!\nSideStore will never be able to install or refresh applications without WiFi.", comment: "")
+        case .tooNewError: return NSLocalizedString("iOS 17 has changed how JIT is enabled therefore SideStore cannot enable it at this time, sorry for any inconvenience.\nWe will let everyone know once we have a solution!", comment: "")
        case .anisetteV1Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: ""), message)
        case .provisioningError(let result, let message): return String(format: NSLocalizedString("An error occurred when provisioning: %@%@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), result, message != nil ? (" (" + message! + ")") : "")
        case .anisetteV3Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), message)
+        case .cacheClearError(let errors): return String(format: NSLocalizedString("An error occurred while clearing cache: %@", comment: ""), errors.joined(separator: "\n"))
        }
    }
    
@@ -138,8 +145,8 @@ extension MinimuxerError: LocalizedError {
            return self.createService(name: "AFC")
        case .RwAfc:
            return NSLocalizedString("AFC was unable to manage files on the device", comment: "")
-        case .InstallApp:
-            return NSLocalizedString("Unable to install the app from the staging directory", comment: "")
+        case .InstallApp(let message):
+            return NSLocalizedString("Unable to install the app: \(message.toString())", comment: "")
        case .UninstallApp:
            return NSLocalizedString("Unable to uninstall the app", comment: "")

--- a/AltStore/Operations/RefreshAppOperation.swift
+++ b/AltStore/Operations/RefreshAppOperation.swift
@@ -41,19 +41,11 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
            guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
            
            for p in profiles {
-                var attempts = 5
-                while (attempts > 0){
-                    print("Install provisioning profile attempts left: \(attempts)")
-                    do {
-                        let bytes = p.value.data.toRustByteSlice()
-                        try install_provisioning_profile(bytes.forRust())
-                        break
-                    } catch {
-                        attempts -= 1
-                        if (attempts <= 0) {
-                            self.finish(.failure(MinimuxerError.ProfileInstall))
-                        }
-                    }
+                do {
+                    let bytes = p.value.data.toRustByteSlice()
+                    try install_provisioning_profile(bytes.forRust())
+                } catch {
+                    self.finish(.failure(MinimuxerError.ProfileInstall))
                }

                DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
--- a/AltStore/Operations/ResignAppOperation.swift
+++ b/AltStore/Operations/ResignAppOperation.swift
@@ -11,6 +11,7 @@ import Roxas

 import AltStoreCore
 import AltSign
+import minimuxer

@objc(ResignAppOperation)
 final class ResignAppOperation: ResultOperation<ALTApplication>
@@ -181,7 +182,7 @@ private extension ResignAppOperation

                if app.isAltStoreApp
                {
-                    guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else { throw OperationError.unknownUDID }
+                    guard let udid = fetch_udid()?.toString() as? String else { throw OperationError.unknownUDID }
                    guard let pairingFileString = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.devicePairingString) as? String else { throw OperationError.unknownUDID }                    
                    additionalValues[Bundle.Info.devicePairingString] = pairingFileString
                    additionalValues[Bundle.Info.deviceID] = udid
@@ -202,7 +203,7 @@ private extension ResignAppOperation
                        // The embedded certificate + certificate identifier are already in app bundle, no need to update them.
                    }
                }
-                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String
+                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = fetch_udid()?.toString() as? String
                {
                    // There is an ALTDeviceID entry, so assume the app is using AltKit and replace it with the device's UDID.
                    additionalValues[Bundle.Info.deviceID] = udid
--- a/AltStore/Operations/SendAppOperation.swift
+++ b/AltStore/Operations/SendAppOperation.swift
@@ -45,21 +45,13 @@ final class SendAppOperation: ResultOperation<()>
        print("AFC App `fileURL`: \(fileURL.absoluteString)")
        
        if let data = NSData(contentsOf: fileURL) {
-            var attempts = 10
-            while (attempts != 0){
-                print("Send app attempts left: \(attempts)")
-                do {
-                    let bytes = Data(data).toRustByteSlice()
-                    try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
-                    self.progress.completedUnitCount += 1
-                    self.finish(.success(()))
-                    break
-                } catch {
-                    attempts -= 1
-                    if (attempts <= 0) {
-                        self.finish(.failure(MinimuxerError.RwAfc))
-                    }
-                }
+            do {
+                let bytes = Data(data).toRustByteSlice()
+                try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
+                self.progress.completedUnitCount += 1
+                self.finish(.success(()))
+            } catch {
+                self.finish(.failure(MinimuxerError.RwAfc))
                self.progress.completedUnitCount += 1
                self.finish(.success(()))
            }
--- a/AltStore/Resources/AltBackup.ipa
+++ b/AltStore/Resources/AltBackup.ipa
--- a/AltStore/Settings/Settings.storyboard
+++ b/AltStore/Settings/Settings.storyboard
@@ -21,7 +21,7 @@
                        <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                        <color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                        <label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
-                            <rect key="frame" x="0.0" y="1126" width="375" height="25"/>
+                            <rect key="frame" x="0.0" y="1245" width="375" height="25"/>
                            <autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
                            <fontDescription key="fontDescription" type="system" pointSize="17"/>
                            <color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -236,9 +236,45 @@
                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="NO"/>
                                        </userDefinedRuntimeAttributes>
                                    </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="GYp-O0-pse" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
                                        <rect key="frame" x="0.0" y="444" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="GYp-O0-pse" id="vDG-ZV-xRS">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Disable Idle Timeout" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PCh-Up-aJJ">
+                                                    <rect key="frame" x="30" y="15.5" width="166" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <switch opaque="NO" contentMode="scaleToFill" horizontalHuggingPriority="750" verticalHuggingPriority="750" contentHorizontalAlignment="center" contentVerticalAlignment="center" on="YES" translatesAutoresizingMaskIntoConstraints="NO" id="iQA-wm-5ag">
+                                                    <rect key="frame" x="296" y="10" width="51" height="31"/>
+                                                    <connections>
+                                                        <action selector="toggleNoIdleTimeoutEnabled:" destination="aMk-Xp-UL8" eventType="valueChanged" id="WSl-Jc-g5J"/>
+                                                    </connections>
+                                                </switch>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstAttribute="trailingMargin" secondItem="iQA-wm-5ag" secondAttribute="trailing" id="MJ1-HF-Dln"/>
+                                                <constraint firstItem="PCh-Up-aJJ" firstAttribute="leading" secondItem="vDG-ZV-xRS" secondAttribute="leadingMargin" id="Ocu-jn-RAQ"/>
+                                                <constraint firstItem="iQA-wm-5ag" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="c6W-bN-VAb"/>
+                                                <constraint firstItem="PCh-Up-aJJ" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="mL6-LB-cjn"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="495" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="amC-sE-8O0" id="GEO-2e-E4k">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
@@ -269,7 +305,7 @@
                            <tableViewSection headerTitle="" id="eHy-qI-w5w">
                                <cells>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="30h-59-88f" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="535" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="586" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="30h-59-88f" id="7qD-DW-Jls">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -309,7 +345,7 @@
                            <tableViewSection headerTitle="" id="J90-vn-u2O">
                                <cells>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="i4T-2q-jF3" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="626" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="677" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="i4T-2q-jF3" id="VTQ-H4-aCM">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -353,28 +389,28 @@
                                        </userDefinedRuntimeAttributes>
                                    </tableViewCell>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="oHX-oR-nwJ" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="677" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="728" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="oHX-oR-nwJ" id="hN4-i5-igu">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
                                                    <rect key="frame" x="30" y="15.5" width="89" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
                                                </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
+                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
                                                    <rect key="frame" x="198" y="15.5" width="147" height="20.5"/>
                                                    <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
                                                            <rect key="frame" x="0.0" y="0.0" width="115" height="20.5"/>
                                                            <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                            <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                            <nil key="highlightedColor"/>
                                                        </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
                                                            <rect key="frame" x="129" y="0.0" width="18" height="20.5"/>
                                                        </imageView>
                                                    </subviews>
@@ -397,7 +433,7 @@
                                        </userDefinedRuntimeAttributes>
                                    </tableViewCell>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="0MT-ht-Sit" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="728" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="779" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="0MT-ht-Sit" id="OZp-WM-5H7">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -441,7 +477,7 @@
                                        </userDefinedRuntimeAttributes>
                                    </tableViewCell>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="O5R-Al-lGj" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="779" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="830" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="O5R-Al-lGj" id="CrG-Mr-xQq">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -481,7 +517,7 @@
                            <tableViewSection headerTitle="" id="OMa-EK-hRI">
                                <cells>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="FMZ-as-Ljo" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="870" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="921" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="FMZ-as-Ljo" id="JzL-Of-A3T">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -514,7 +550,7 @@
                                        </userDefinedRuntimeAttributes>
                                    </tableViewCell>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="Qca-pU-sJh" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="921" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="972" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="Qca-pU-sJh" id="QtU-8J-VQN">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -550,7 +586,7 @@
                                        </connections>
                                    </tableViewCell>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="rE2-P4-OaE" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="972" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1023" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="rE2-P4-OaE" id="qIT-rz-ZUb">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -582,12 +618,45 @@
                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                        </userDefinedRuntimeAttributes>
                                        <connections>
-                                            <segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="SSW-vL-86I"/>
+                                            <segue destination="g8a-Rf-zWa" kind="show" id="vFC-Id-Ww6"/>
                                        </connections>
                                    </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="eZ3-BT-q4D" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
                                        <rect key="frame" x="0.0" y="1023" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="eZ3-BT-q4D" id="17m-VV-hzf">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Clear Cache" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="IbH-V1-ce3">
+                                                    <rect key="frame" x="30" y="15.5" width="98.5" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="FZe-BJ-fOm">
+                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
+                                                </imageView>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="FZe-BJ-fOm" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="bGv-Np-5aO"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="FZe-BJ-fOm" secondAttribute="trailing" id="ccb-JP-Eqi"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="iQJ-gN-sRF"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="leading" secondItem="17m-VV-hzf" secondAttribute="leadingMargin" id="m1g-Y6-aT5"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VNn-u4-cN8" id="4bh-qe-l2N">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
@@ -619,7 +688,7 @@
                                        </userDefinedRuntimeAttributes>
                                    </tableViewCell>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="e7s-hL-kv9" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="e7s-hL-kv9" id="yjL-Mu-HTk">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -652,7 +721,7 @@
                                        </userDefinedRuntimeAttributes>
                                    </tableViewCell>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1176" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -689,7 +758,6 @@
                        </sections>
                        <connections>
                            <outlet property="dataSource" destination="aMk-Xp-UL8" id="c6c-fR-8C4"/>
-                            <outlet property="delegate" destination="aMk-Xp-UL8" id="moP-1B-lRq"/>
                        </connections>
                    </tableView>
                    <navigationItem key="navigationItem" title="Settings" id="Ddg-UQ-KJ8"/>
@@ -698,6 +766,7 @@
                        <outlet property="accountNameLabel" destination="CnN-M1-AYK" id="Ldc-Py-Bix"/>
                        <outlet property="accountTypeLabel" destination="434-MW-Den" id="mNB-QE-4Jg"/>
                        <outlet property="backgroundRefreshSwitch" destination="DPu-zD-Als" id="eiG-Hv-Vko"/>
+                        <outlet property="noIdleTimeoutSwitch" destination="iQA-wm-5ag" id="jHC-js-q0Y"/>
                        <outlet property="versionLabel" destination="bUR-rp-Nw2" id="85I-5R-hqz"/>
                    </connections>
                </tableViewController>
--- a/AltStore/Settings/SettingsViewController.swift
+++ b/AltStore/Settings/SettingsViewController.swift
@@ -30,13 +30,14 @@ extension SettingsViewController
    fileprivate enum AppRefreshRow: Int, CaseIterable
    {
        case backgroundRefresh
+        case noIdleTimeout
        
        @available(iOS 14, *)
        case addToSiri
        
        static var allCases: [AppRefreshRow] {
-            guard #available(iOS 14, *) else { return [.backgroundRefresh] }
-            return [.backgroundRefresh, .addToSiri]
+            guard #available(iOS 14, *) else { return [.backgroundRefresh, .noIdleTimeout] }
+            return [.backgroundRefresh, .noIdleTimeout, .addToSiri]
        }
    }
    
@@ -53,9 +54,11 @@ extension SettingsViewController
        case sendFeedback
        case refreshAttempts
        case errorLog
+        case clearCache
        case resetPairingFile
        case resetAdiPb
        case advancedSettings
+    
    }
 }

@@ -73,6 +76,7 @@ final class SettingsViewController: UITableViewController
    @IBOutlet private var accountTypeLabel: UILabel!
    
    @IBOutlet private var backgroundRefreshSwitch: UISwitch!
+    @IBOutlet private var noIdleTimeoutSwitch: UISwitch!
    
    @IBOutlet private var versionLabel: UILabel!
    
@@ -280,6 +284,11 @@ private extension SettingsViewController
        UserDefaults.standard.isBackgroundRefreshEnabled = sender.isOn
    }
    
+    @IBAction func toggleNoIdleTimeoutEnabled(_ sender: UISwitch)
+    {
+        UserDefaults.standard.isIdleTimeoutDisableEnabled = sender.isOn
+    }
+    
    @available(iOS 14, *)
    @IBAction func addRefreshAppsShortcut()
    {
@@ -291,6 +300,39 @@ private extension SettingsViewController
        self.present(viewController, animated: true, completion: nil)
    }
    
+    func clearCache()
+    {
+        let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to clear SideStore's cache?", comment: ""),
+                                                message: NSLocalizedString("This will remove all temporary files as well as backups for uninstalled apps.", comment: ""),
+                                                preferredStyle: .actionSheet)
+        alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { [weak self] _ in
+            self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+        })
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Clear Cache", comment: ""), style: .destructive) { [weak self] _ in
+            AppManager.shared.clearAppCache { result in
+                DispatchQueue.main.async {
+                    self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+                    
+                    switch result
+                    {
+                    case .success: break
+                    case .failure(let error):
+                        let alertController = UIAlertController(title: NSLocalizedString("Unable to Clear Cache", comment: ""), message: error.localizedDescription, preferredStyle: .alert)
+                        alertController.addAction(.ok)
+                        self?.present(alertController, animated: true)
+                    }
+                }
+            }
+        })
+        
+        if let popoverController = alertController.popoverPresentationController {
+            popoverController.sourceView = self.view
+            popoverController.sourceRect = CGRect(x: self.view.bounds.midX, y: self.view.bounds.midY, width: 0, height: 0)
+        }
+        
+        self.present(alertController, animated: true)
+    }
+    
    @IBAction func handleDebugModeGesture(_ gestureRecognizer: UISwipeGestureRecognizer)
    {
        self.debugGestureCounter += 1
@@ -377,15 +419,26 @@ extension SettingsViewController
    {
        let cell = super.tableView(tableView, cellForRowAt: indexPath)
        
-        if #available(iOS 14, *) {}
-        else if let cell = cell as? InsetGroupTableViewCell,
-                indexPath.section == Section.appRefresh.rawValue,
-                indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+//        if #available(iOS 14, *) {}
+//        else if let cell = cell as? InsetGroupTableViewCell,
+//                indexPath.section == Section.appRefresh.rawValue,
+//                indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+//        {
+//            // Only one row is visible pre-iOS 14.
+//            cell.style = .single
+//        }
+        
+        if AppRefreshRow.AllCases().count == 1
        {
-            // Only one row is visible pre-iOS 14.
-            cell.style = .single
+            if let cell = cell as? InsetGroupTableViewCell,
+               indexPath.section == Section.appRefresh.rawValue,
+               indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+            {
+                cell.style = .single
+            }
        }
        
+        
        return cell
    }
    
@@ -465,11 +518,13 @@ extension SettingsViewController
            switch row
            {
            case .backgroundRefresh: break
+            case .noIdleTimeout: break
            case .addToSiri:
                guard #available(iOS 14, *) else { return }
                self.addRefreshAppsShortcut()
            }
            
+            
        case .credits:
            let row = CreditsRow.allCases[indexPath.row]
            switch row
@@ -507,6 +562,9 @@ extension SettingsViewController
                    let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
                    toastView.show(in: self)
                }
+                
+            case .clearCache: self.clearCache()
+
            case .resetPairingFile:
                let filename = "ALTPairingFile.mobiledevicepairing"
                let fm = FileManager.default
@@ -559,6 +617,7 @@ extension SettingsViewController
                    ELOG("UIApplication.openSettingsURLString invalid")
                }
            case .refreshAttempts, .errorLog: break
+
            }
            
        default: break
--- a/AltStoreCore/Extensions/UserDefaults+AltStore.swift
+++ b/AltStoreCore/Extensions/UserDefaults+AltStore.swift
@@ -27,6 +27,7 @@ public extension UserDefaults
    @NSManaged var preferredServerID: String?
    
    @NSManaged var isBackgroundRefreshEnabled: Bool
+    @NSManaged var isIdleTimeoutDisableEnabled: Bool
    @NSManaged var isDebugModeEnabled: Bool
    @NSManaged var presentedLaunchReminderNotification: Bool
    
@@ -72,6 +73,7 @@ public extension UserDefaults
        
        let defaults = [
            #keyPath(UserDefaults.isBackgroundRefreshEnabled): true,
+            #keyPath(UserDefaults.isIdleTimeoutDisableEnabled): true,
            #keyPath(UserDefaults.isLegacyDeactivationSupported): isLegacyDeactivationSupported,
            #keyPath(UserDefaults.activeAppLimitIncludesExtensions): activeAppLimitIncludesExtensions,
            #keyPath(UserDefaults.localServerSupportsRefreshing): localServerSupportsRefreshing,
--- a/AltStoreCore/Model/AltStore.xcdatamodeld/AltStore
+++ b/AltStoreCore/Model/AltStore.xcdatamodeld/AltStore
@@ -103,6 +103,7 @@
        <attribute name="externalURL" optional="YES" attributeType="URI"/>
        <attribute name="identifier" attributeType="String"/>
        <attribute name="imageURL" optional="YES" attributeType="URI"/>
+        <attribute name="isDuplicate" optional="YES" attributeType="Boolean" usesScalarValueType="YES"/>
        <attribute name="isSilent" attributeType="Boolean" defaultValueString="YES" usesScalarValueType="YES"/>
        <attribute name="sortIndex" attributeType="Integer 32" defaultValueString="0" usesScalarValueType="YES"/>
        <attribute name="sourceIdentifier" optional="YES" attributeType="String"/>
--- a/AltStoreCore/Model/DatabaseManager.swift
+++ b/AltStoreCore/Model/DatabaseManager.swift
@@ -222,7 +222,7 @@ private extension DatabaseManager
            
            let storeApp: StoreApp
            
-            if let app = StoreApp.first(satisfying: NSPredicate(format: "%K == %@", #keyPath(StoreApp.bundleIdentifier), StoreApp.altstoreAppID), in: context)
+            if let app = StoreApp.first(satisfying: NSPredicate(format: "%K == %@ AND %K == %@", #keyPath(StoreApp.bundleIdentifier), StoreApp.altstoreAppID, #keyPath(StoreApp.sourceIdentifier), Source.altStoreIdentifier), in: context)
            {
                storeApp = app
            }
--- a/AltStoreCore/Model/InstalledApp.swift
+++ b/AltStoreCore/Model/InstalledApp.swift
@@ -108,6 +108,10 @@ public class InstalledApp: NSManagedObject, InstalledAppProtocol
    public func update(resignedApp: ALTApplication, certificateSerialNumber: String?)
    {
        self.name = resignedApp.name
+        if storeApp != nil {
+            // This might break things; maybe only do this if the bundle ID is SideStore's?
+            self.name = storeApp!.name // If we don't do this, the name will always be SideStore in My Apps, even when using beta/nightly
+        }
        
        self.resignedBundleIdentifier = resignedApp.bundleIdentifier
        self.version = resignedApp.version
@@ -178,7 +182,7 @@ public extension InstalledApp
    
    class func fetchAltStore(in context: NSManagedObjectContext) -> InstalledApp?
    {
-        let predicate = NSPredicate(format: "%K == %@", #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
+        let predicate = NSPredicate(format: "%K == %@ AND %K != nil AND %K == %@", #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID, #keyPath(InstalledApp.storeApp), #keyPath(InstalledApp.storeApp.sourceIdentifier), Source.altStoreIdentifier)
        print("Fetch 'AltStore' Predicate: \(String(describing: predicate))")
        let altStore = InstalledApp.first(satisfying: predicate, in: context)
        return altStore
--- a/AltStoreCore/Model/NewsItem.swift
+++ b/AltStoreCore/Model/NewsItem.swift
@@ -32,6 +32,15 @@ public class NewsItem: NSManagedObject, Decodable, Fetchable
    @NSManaged public var storeApp: StoreApp?
    @NSManaged public var source: Source?
    
+    @objc public var isDuplicate: Bool {
+        if self.source == nil { return false }
+        
+        // Hide news from sources that begin with the SideStore identifier, and aren't from the same source as the current SideStore source
+        if self.source!.identifier.starts(with: Bundle.Info.appbundleIdentifier) && self.source!.identifier != Source.altStoreIdentifier { return true }
+        
+        return false
+    }
+    
    private enum CodingKeys: String, CodingKey
    {
        case identifier
@@ -86,6 +95,9 @@ public extension NewsItem
 {
    @nonobjc class func fetchRequest() -> NSFetchRequest<NewsItem>
    {
-        return NSFetchRequest<NewsItem>(entityName: "NewsItem")
+        let fetchRequest = NSFetchRequest<NewsItem>(entityName: "NewsItem")
+        fetchRequest.predicate = NSPredicate(format: "%K == NO",
+                                             #keyPath(NewsItem.isDuplicate))
+        return fetchRequest
    }
 }
--- a/AltStoreCore/Model/Source.swift
+++ b/AltStoreCore/Model/Source.swift
@@ -11,29 +11,37 @@ import UIKit

 public extension Source
 {
-    #if ALPHA
-    static let altStoreIdentifier = Bundle.Info.appbundleIdentifier
-    #else
-    static let altStoreIdentifier = Bundle.Info.appbundleIdentifier
-    #endif
+    static var altStoreIdentifier: String {
+        let appVersion = Bundle.main.infoDictionary?["CFBundleShortVersionString"] as? String
+        
+        if appVersion != nil {
+            if appVersion!.contains("beta") {
+                return Bundle.Info.appbundleIdentifier + ".Beta"
+            }
+            if appVersion!.contains("nightly") {
+                return Bundle.Info.appbundleIdentifier + ".Nightly"
+            }
+        }
+        
+        return Bundle.Info.appbundleIdentifier
+    }
    
-    #if STAGING
+    static let altStoreSourceBaseURL = "https://apps.sidestore.io/"
    
-    #if ALPHA
-    static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
-    #else
-    static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
-    #endif
-    
-    #else
-    
-    #if ALPHA
-    static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
-    #else
-    static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
-    #endif
-    
-    #endif
+    static var altStoreSourceURL: URL {
+        let appVersion = Bundle.main.infoDictionary?["CFBundleShortVersionString"] as? String
+        
+        if appVersion != nil {
+            if appVersion!.contains("beta") {
+                return URL(string: altStoreSourceBaseURL + "beta")!
+            }
+            if appVersion!.contains("nightly") {
+                return URL(string: altStoreSourceBaseURL + "nightly")!
+            }
+        }
+        
+        return URL(string: altStoreSourceBaseURL)!
+    }
 }

 public struct AppPermissionFeed: Codable {
--- a/AltStoreCore/Model/StoreApp.swift
+++ b/AltStoreCore/Model/StoreApp.swift
@@ -343,16 +343,28 @@ public extension StoreApp
    {
        let app = StoreApp(context: context)
        app.name = "SideStore"
+        
+        let currentAppVersion = Bundle.main.infoDictionary?["CFBundleShortVersionString"] as? String
+        
+        if currentAppVersion != nil {
+            if currentAppVersion!.contains("beta") {
+                app.name += " (Beta)"
+            }
+            if currentAppVersion!.contains("nightly") {
+                app.name += " (Nightly)"
+            }
+        }
+        
        app.bundleIdentifier = StoreApp.altstoreAppID
-        app.developerName = "Side Team"
-        app.localizedDescription = "SideStore is an alternative App Store."
-        app.iconURL = URL(string: "https://user-images.githubusercontent.com/705880/63392210-540c5980-c37b-11e9-968c-8742fc68ab2e.png")!
+        app.developerName = "SideStore Team"
+        app.localizedDescription = "SideStore is an alternative app store for non-jailbroken devices.\n\nSideStore allows you to sideload other .ipa files and apps from the Files app or via the SideStore Library."
+        app.iconURL = URL(string: "https://sidestore.io/assets/icon.png")!
        app.screenshotURLs = []
        app.sourceIdentifier = Source.altStoreIdentifier
        
-        let appVersion = AppVersion.makeAppVersion(version: "0.3.0",
+        let appVersion = AppVersion.makeAppVersion(version: "0.0.0", // this is set to the current app version later
                                                   date: Date(),
-                                                   downloadURL: URL(string: "http://rileytestut.com")!,
+                                                   downloadURL: URL(string: "https://sidestore.io")!,
                                                   size: 0,
                                                   appBundleID: app.bundleIdentifier,
                                                   sourceID: Source.altStoreIdentifier,
@@ -361,10 +373,6 @@ public extension StoreApp
        
        print("makeAltStoreApp StoreApp: \(String(describing: app))")
        
-        #if BETA
-        app.isBeta = true
-        #endif
-        
        return app
    }
 }
--- a/AltWidget/Info.plist
+++ b/AltWidget/Info.plist
@@ -4,8 +4,8 @@
 <dict>
 	<key>ALTAppGroups</key>
 	<array>
-		<string>group.com.SideStore.SideStore</string>
 		<string>group.$(APP_GROUP_IDENTIFIER)</string>
+		<string>group.com.SideStore.SideStore</string>
 	</array>
 	<key>CFBundleDevelopmentRegion</key>
 	<string>$(DEVELOPMENT_LANGUAGE)</string>
--- a/Build.xcconfig
+++ b/Build.xcconfig
@@ -1,8 +1,8 @@
 // Configuration settings file format documentation can be found at:
 // https://help.apple.com/xcode/#/dev745c5c974

-MARKETING_VERSION = 0.5.0
-CURRENT_PROJECT_VERSION = 5000
+MARKETING_VERSION = 0.5.5
+CURRENT_PROJECT_VERSION = 5050

 // Vars to be overwritten by `CodeSigning.xcconfig` if exists
 DEVELOPMENT_TEAM = S32Z3HMYVQ
--- a/CONTRIBUTING.md
+++ b/CONTRIBUTING.md
@@ -7,7 +7,7 @@ There are many ways to contribute to SideStore, so if you aren't a developer, th
 -   [Writing documentation](https://github.com/SideStore/SideStore-Docs)
 -   [Submitting detailed bug reports and suggesting new features](https://github.com/SideStore/SideStore/issues/new/choose)
 -   Helping out with support
-    -   [Discord](https://discord.gg/RgpFBX3Q3k)
+    -   [Discord](https://discord.gg/sidestore-949183273383395328)
    -   [GitHub Discussions](https://github.com/SideStore/SideStore/discussions)

 However, this guide will focus on the development side of things. For now, we will only have setup information here, but you can [join our Discord](https://discord.gg/RgpFBX3Q3k) if you need help
--- a/Dependencies/Roxas
+++ b/Dependencies/Roxas
--- a/Dependencies/libfragmentzip
+++ b/Dependencies/libfragmentzip
--- a/Dependencies/libimobiledevice
+++ b/Dependencies/libimobiledevice
--- a/Dependencies/libimobiledevice-glue
+++ b/Dependencies/libimobiledevice-glue
--- a/Dependencies/libplist
+++ b/Dependencies/libplist
--- a/Dependencies/libusbmuxd
+++ b/Dependencies/libusbmuxd
--- a/Shared/Extensions/Bundle+AltStore.swift
+++ b/Shared/Extensions/Bundle+AltStore.swift
@@ -56,7 +56,7 @@ public extension Bundle
 public extension Bundle
 {
    static var baseAltStoreAppGroupID = "group." + Bundle.Info.appbundleIdentifier
-    
+
    var appGroups: [String] {
        return self.infoDictionary?[Bundle.Info.appGroups] as? [String] ?? []
    }
--- a/trustedapps.json
+++ b/trustedapps.json
@@ -4,6 +4,14 @@
    {
      "identifier": "io.sidestore.example"
    },
+    {
+      "identifier": "com.SideStore.SideStore",
+      "sourceURL": "https://apps.sidestore.io/"
+    },
+    {
+      "identifier": "com.SideStore.SideStore.Beta",
+      "sourceURL": "https://apps.sidestore.io/beta"
+    },
    {
      "identifier": "com.sidestoreapps.community",
      "sourceURL": "https://community-apps.sidestore.io/sidecommunity.json"
@@ -24,10 +32,6 @@
      "identifier": "com.flyinghead.source",
      "sourceURL": "https://flyinghead.github.io/flycast-builds/altstore.json"
    },
-    {
-      "identifier": "com.emuplace.altstore",
-      "sourceURL": "https://emuplace.app/altstore/altstore.json"
-    },
    {
      "identifier": "dev.crystall1ne.repos.PojavLauncher",
      "sourceURL": "https://alt.crystall1ne.dev"
@@ -43,6 +47,10 @@
    {
      "identifier": "stream.yattee",
      "sourceURL": "https://repos.yattee.stream/alt/apps.json"
+    },
+    {
+      "identifier": "com.litritt.litsource",
+      "sourceURL": "https://altstore.ignitedemulator.com/"
    }
  ]
 }
Author	SHA1	Message	Date
naturecodevoid	8a8c5167c6	Switch to apps.sidestore.io	2023-11-27 14:28:29 -08:00
naturecodevoid	96f0d41986	Trusted Sources: Add stable and beta	2023-11-27 14:28:29 -08:00
naturecodevoid	f2b555beae	News: fix duplicate news items from multiple SideStore release channel sources	2023-11-27 14:28:29 -08:00
naturecodevoid	d853791ad2	My Apps: Fix incorrect app name on first launch	2023-11-27 14:28:29 -08:00
naturecodevoid	8f5b56f717	Release channel support - Show SideStore in Browse if it's not from the current SideStore source - Change SideStore source URL and source ID based on if beta and nightly are in the version string - Use StoreApp name for InstalledApp name to allow for source-specified name to show up in My Apps	2023-11-27 14:28:29 -08:00
June Park	9f7d4dee49	[skip ci] bump nightly to 0.5.5 Signed-off-by: June Park <rjp2030@outlook.com>	2023-11-28 03:02:04 +09:00
June P	458b8e491e	bugfix: fix removal of attributes	2023-11-28 02:34:15 +09:00
Stern	495e621e69	Merge pull request #539 from junepark678/NoIdle feat(Operations): don't idle timeout during installations	2023-11-27 12:12:10 -05:00
June P	c986512b5f	bugfix: fix appending to a list that is nil	2023-11-28 02:04:14 +09:00
June Park	d277754ae5	Merge branch 'develop' into NoIdle Signed-off-by: June Park <rjp2030@outlook.com>	2023-11-28 00:46:48 +09:00
junepark678	2ef2e2f26b	bugfix: make it able to be toggled, fix bug in crash on installation	2023-11-28 00:44:47 +09:00
nythepegasus	23a53034fa	[skip ci] Bump nightly to 0.5.4 Signed-off-by: nythepegasus <nythepegasus84@gmail.com>	2023-11-27 10:39:41 -05:00
Stern	ce57d72a78	[skip ci] ci: add workflow_dispatch Signed-off-by: Stern <xsternent@gmail.com>	2023-11-27 10:18:06 -05:00
nythepegasus	502b89d890	[skip ci] Add other project maintainers to CODEOWNERS Signed-off-by: nythepegasus <nythepegasus84@gmail.com>	2023-11-27 09:37:25 -05:00
junepark678	5f0015fad0	chore(Clear Cache): do proper error handling	2023-11-27 09:31:36 -05:00
June Park	c81236957b	bugfix(settings): fix rounding issues on clear cache button (#536 )	2023-11-27 09:31:36 -05:00
Spidy123222	970ab38b27	move debug row	2023-11-27 09:31:36 -05:00
Spidy123222	8a5c31b81d	make button function again	2023-11-27 09:31:36 -05:00
Spidy123222	8508fe79b5	change order of settings debug section	2023-11-27 09:31:36 -05:00
Spidy123222	3859e98801	Add button to storyboard 🙄	2023-11-27 09:31:36 -05:00
Spidy123222	a759c7be9e	please fix to show button	2023-11-27 09:31:36 -05:00
Spidy123222	12fc6cf6e2	attempt fix settings	2023-11-27 09:31:36 -05:00
Spidy123222	580db6530e	fix the mighty error	2023-11-27 09:31:36 -05:00
Spidy123222	9c67c237ee	get rest of batcherror	2023-11-27 09:31:36 -05:00
Spidy123222	357d85a72e	please o riley build	2023-11-27 09:31:36 -05:00
Spidy123222	88ad828ce0	hopefully fix error code build error	2023-11-27 09:31:36 -05:00
Riley Testut	a95625a34a	Adds “Clear Cache” description to Techy Things section footer (cherry picked from commit `913db5131b`)	2023-11-27 09:31:36 -05:00
Riley Testut	95e00d81f5	Adds “Clear Cache” button to remove temporary files and uninstalled app backups (cherry picked from commit `3adfc9db6d`)	2023-11-27 09:31:36 -05:00
junepark678	c2e386a5c5	chore(App IDs, My Apps): change back to full	2023-11-27 09:22:19 -05:00
junepark678	a76aade4ff	chore(App IDs, My Apps): change to use `DateComponentsFormatter.UnitsStyle.abbreviated`	2023-11-27 09:22:19 -05:00
junepark678	65c9986103	bugfix(App IDs, My Apps): fix date display	2023-11-27 09:22:19 -05:00
junepark678	9e2b9b6639	bugfix(App IDs, My Apps): display only necessary information	2023-11-27 09:22:19 -05:00
junepark678	cf373634d7	bugfix(App IDs, My Apps): calculate in correct direction in time (we aren't time travelers)	2023-11-27 09:22:19 -05:00
junepark678	b3d5d976b4	feat(My Apps): make expiration dates more specific	2023-11-27 09:22:19 -05:00
junepark678	c3c31995ce	chore(App IDs): localize Unknown string	2023-11-27 09:22:19 -05:00
junepark678	7e92e17429	feat(App IDs): make expiration dates more specific	2023-11-27 09:22:19 -05:00
junepark678	88ab8fa8d7	feat: remove reliance on Info.plist for getting udid	2023-11-27 09:21:54 -05:00
junepark678	ebe78932bf	feat(Operations): don't idle timeout during installations	2023-11-26 10:51:33 +09:00
nythepegasus	2e613e6d15	[skip ci] Update Ignited source URL	2023-11-06 09:02:49 -05:00
Spidy123222	35ee92db12	Change pairing file link with new wiki link Signed-off-by: Spidy123222 <64176728+Spidy123222@users.noreply.github.com>	2023-10-23 13:12:23 -07:00
nythepegasus	04d9f760ad	Fix AltWidget App Group issue	2023-10-23 10:12:09 -04:00
naturecodevoid	4f52743be8	Revert most of xcodeproj changes	2023-10-21 20:44:49 -07:00
naturecodevoid	32cae7a5b2	Revert "Attempt to fix submodule dependencies for GH runner" This reverts commit `5cff914ff3`.	2023-10-21 20:30:32 -07:00
naturecodevoid	c2c0e3b790	Use forked libplist	2023-10-21 20:30:23 -07:00
nythepegasus	6d36a30787	[skip ci] Bump nightly to 0.5.3 Signed-off-by: nythepegasus <nythepegasus84@gmail.com>	2023-10-21 21:02:41 -04:00
nythepegasus	48a86ec6de	Update Roxas	2023-10-21 20:35:32 -04:00
nythepegasus	5cff914ff3	Attempt to fix submodule dependencies for GH runner	2023-10-21 20:34:44 -04:00
nythepegasus	70ea725ce3	Update limd/libplist submodules	2023-10-20 22:04:47 -04:00
nythepegasus	78f12e45f9	Add iOS 17 JIT error notice with other errors	2023-10-20 21:51:24 -04:00
nythepegasus	e5061acc20	Hardcode SideStore's URL scheme for now	2023-10-20 21:51:24 -04:00
nythepegasus	2d7bc51d30	Revert this change	2023-10-20 21:51:24 -04:00
nythepegasus	9128b67ee8	Add newly compiled AltBackup	2023-10-20 21:51:24 -04:00
Bogdan Seniuc	551c004476	Use provisioning profile details instead of guessing active app limit	2023-10-20 21:50:50 -04:00
Spidy123222	ed6a8d1379	[skip ci] Remove emuthreeds from trusted sources	2023-10-18 21:44:55 -07:00
nythepegasus	766fb89e0b	Change this to be hardcoded SideStore search	2023-10-17 17:38:09 -04:00
nythepegasus	c5b8cb4459	Remove buggy retry code finally	2023-10-17 17:37:29 -04:00
naturecodevoid	0deae92829	Bump version to 0.5.2 so nightly builds have a higher SemVer version than stable	2023-09-18 16:18:05 -07:00
naturecodevoid	cc5d2f1813	Build nightly with latest minimuxer changes to attempt to fix plist_from_memory crash	2023-09-18 16:17:14 -07:00
naturecodevoid	41151d0d49	0.5.1	2023-09-17 14:01:13 -07:00
Spidy123222	52702264a3	Change version to 0.5.2	2023-09-17 12:36:44 -07:00
naturecodevoid	6e297e1278	Update Swift Packages and submodules (#469 ) * Update Swift Packages * Update submodules * make sure it builds --------- Signed-off-by: naturecodevoid <44983869+naturecodevoid@users.noreply.github.com>	2023-09-17 10:45:55 -07:00
naturecodevoid	e3bb9b425f	[skip ci] Add more information to staging errors (#468 ) * Point to my forks and attempt to add more information to staging errors * Improve error message a bit * Revert fetch-prebuilt.sh changes * Undo some whitespace changes * missed one * oops * [skip ci] * [skip ci] * [skip ci] remove staging directory from install app error Signed-off-by: naturecodevoid <44983869+naturecodevoid@users.noreply.github.com> --------- Signed-off-by: naturecodevoid <44983869+naturecodevoid@users.noreply.github.com> Co-authored-by: Dadoum <dadoum@protonmail.com>	2023-09-17 10:37:49 -07:00
Spidy123222	79255be79c	Update Altsign (August 6) (#467 ) This changes the git commit or be our latest altsign version.	2023-09-16 01:51:35 -07:00
nythepegasus	7c836f5ba1	Update emuplace source Signed-off-by: nythepegasus <nythepegasus84@gmail.com>	2023-08-13 11:54:00 -04:00
Spidy123222	938bcd14ad	Add ignited source Signed-off-by: Spidy123222 <64176728+Spidy123222@users.noreply.github.com>	2023-08-06 14:15:51 -07:00
Joelle Stickney	229d79fc05	Removed Quantum Source Signed-off-by: Joelle Stickney <joellestickney+commit@gmail.com>	2023-08-06 16:26:24 -04:00
Joelle Stickney	2d3dac2e1d	Added Quantum Source to trusted sources Signed-off-by: Joelle Stickney <joellestickney+commit@gmail.com>	2023-08-06 15:30:21 -04:00
nythepegasus	e23f5e7894	[skip ci] Change Discord custom invite to static website invite Signed-off-by: nythepegasus <nythepegasus84@gmail.com>	2023-08-04 13:17:02 -04:00
Spidy123222	571d27c814	Fix message and put in proper spot. Signed-off-by: Spidy123222 <64176728+Spidy123222@users.noreply.github.com>	2023-07-27 23:42:32 -07:00
Spidy123222	dde6bd4fe3	Make Notification explanation smaller for refresh Signed-off-by: Spidy123222 <64176728+Spidy123222@users.noreply.github.com>	2023-07-27 23:17:58 -07:00