mirror of
https://github.com/SideStore/SideStore.git
synced 2026-04-10 04:35:41 +02:00
Compare commits
74 Commits
0.5.0
...
connect-de
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
94ee08c718 | ||
|
|
fd7dc94975 | ||
|
|
b78707808d | ||
|
|
d41518581a | ||
|
|
4abbfe6142 | ||
|
|
dae813d80c | ||
|
|
af89b178ad | ||
|
|
8c269207fd | ||
|
|
42ecd38517 | ||
|
|
9f7d4dee49 | ||
|
|
458b8e491e | ||
|
|
495e621e69 | ||
|
|
c986512b5f | ||
|
|
d277754ae5 | ||
|
|
2ef2e2f26b | ||
|
|
23a53034fa | ||
|
|
ce57d72a78 | ||
|
|
502b89d890 | ||
|
|
5f0015fad0 | ||
|
|
c81236957b | ||
|
|
970ab38b27 | ||
|
|
8a5c31b81d | ||
|
|
8508fe79b5 | ||
|
|
3859e98801 | ||
|
|
a759c7be9e | ||
|
|
12fc6cf6e2 | ||
|
|
580db6530e | ||
|
|
9c67c237ee | ||
|
|
357d85a72e | ||
|
|
88ad828ce0 | ||
|
|
a95625a34a | ||
|
|
95e00d81f5 | ||
|
|
c2e386a5c5 | ||
|
|
a76aade4ff | ||
|
|
65c9986103 | ||
|
|
9e2b9b6639 | ||
|
|
cf373634d7 | ||
|
|
b3d5d976b4 | ||
|
|
c3c31995ce | ||
|
|
7e92e17429 | ||
|
|
88ab8fa8d7 | ||
|
|
ebe78932bf | ||
|
|
2e613e6d15 | ||
|
|
35ee92db12 | ||
|
|
04d9f760ad | ||
|
|
4f52743be8 | ||
|
|
32cae7a5b2 | ||
|
|
c2c0e3b790 | ||
|
|
6d36a30787 | ||
|
|
48a86ec6de | ||
|
|
5cff914ff3 | ||
|
|
70ea725ce3 | ||
|
|
78f12e45f9 | ||
|
|
e5061acc20 | ||
|
|
2d7bc51d30 | ||
|
|
9128b67ee8 | ||
|
|
551c004476 | ||
|
|
ed6a8d1379 | ||
|
|
766fb89e0b | ||
|
|
c5b8cb4459 | ||
|
|
0deae92829 | ||
|
|
cc5d2f1813 | ||
|
|
41151d0d49 | ||
|
|
52702264a3 | ||
|
|
6e297e1278 | ||
|
|
e3bb9b425f | ||
|
|
79255be79c | ||
|
|
7c836f5ba1 | ||
|
|
938bcd14ad | ||
|
|
229d79fc05 | ||
|
|
2d3dac2e1d | ||
|
|
e23f5e7894 | ||
|
|
571d27c814 | ||
|
|
dde6bd4fe3 |
2
.github/CODEOWNERS
vendored
2
.github/CODEOWNERS
vendored
@@ -1 +1 @@
|
|||||||
* @JoeMatt @lonkelle
|
* @JoeMatt @lonkelle @nythepegasus @Spidy123222 @SternXD
|
||||||
|
|||||||
5
.github/ISSUE_TEMPLATE/bug_report.yml
vendored
5
.github/ISSUE_TEMPLATE/bug_report.yml
vendored
@@ -2,15 +2,14 @@ name: Bug Report
|
|||||||
description: Report a bug
|
description: Report a bug
|
||||||
title: "[BUG] "
|
title: "[BUG] "
|
||||||
labels: ["bug"]
|
labels: ["bug"]
|
||||||
assignees:
|
assignees: []
|
||||||
- naturecodevoid
|
|
||||||
body:
|
body:
|
||||||
- type: markdown
|
- type: markdown
|
||||||
attributes:
|
attributes:
|
||||||
value: |
|
value: |
|
||||||
Thanks for taking the time to fill out this bug report! Before you continue filling out the report, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the bug you are experiencing** in case it has already been reported.
|
Thanks for taking the time to fill out this bug report! Before you continue filling out the report, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the bug you are experiencing** in case it has already been reported.
|
||||||
|
|
||||||
**Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
|
**Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
|
||||||
- type: textarea
|
- type: textarea
|
||||||
id: description
|
id: description
|
||||||
attributes:
|
attributes:
|
||||||
|
|||||||
2
.github/ISSUE_TEMPLATE/config.yml
vendored
2
.github/ISSUE_TEMPLATE/config.yml
vendored
@@ -3,7 +3,7 @@ blank_issues_enabled: false
|
|||||||
|
|
||||||
contact_links:
|
contact_links:
|
||||||
- name: Discord
|
- name: Discord
|
||||||
url: https://discord.gg/RgpFBX3Q3k
|
url: https://discord.gg/sidestore-949183273383395328
|
||||||
about: If you need support, please go here first instead of making an issue!
|
about: If you need support, please go here first instead of making an issue!
|
||||||
- name: GitHub Discussions
|
- name: GitHub Discussions
|
||||||
url: https://github.com/SideStore/SideStore/discussions
|
url: https://github.com/SideStore/SideStore/discussions
|
||||||
|
|||||||
5
.github/ISSUE_TEMPLATE/feature_request.yml
vendored
5
.github/ISSUE_TEMPLATE/feature_request.yml
vendored
@@ -2,15 +2,14 @@ name: Feature Request
|
|||||||
description: Suggest a feature
|
description: Suggest a feature
|
||||||
title: "[FEATURE REQUEST] "
|
title: "[FEATURE REQUEST] "
|
||||||
labels: ["enhancement"]
|
labels: ["enhancement"]
|
||||||
assignees:
|
assignees: []
|
||||||
- naturecodevoid
|
|
||||||
body:
|
body:
|
||||||
- type: markdown
|
- type: markdown
|
||||||
attributes:
|
attributes:
|
||||||
value: |
|
value: |
|
||||||
Thanks for taking the time to fill out this feature request! Before you continue filling out the form, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the feature you are suggestion** in case it has already been suggested.
|
Thanks for taking the time to fill out this feature request! Before you continue filling out the form, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the feature you are suggestion** in case it has already been suggested.
|
||||||
|
|
||||||
**Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
|
**Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
|
||||||
- type: textarea
|
- type: textarea
|
||||||
id: description
|
id: description
|
||||||
attributes:
|
attributes:
|
||||||
|
|||||||
2
.github/workflows/nightly.yml
vendored
2
.github/workflows/nightly.yml
vendored
@@ -2,7 +2,7 @@ name: Nightly SideStore build
|
|||||||
on:
|
on:
|
||||||
push:
|
push:
|
||||||
branches:
|
branches:
|
||||||
- develop
|
- connect-develop
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
build:
|
build:
|
||||||
|
|||||||
2
.gitmodules
vendored
2
.gitmodules
vendored
@@ -9,7 +9,7 @@
|
|||||||
url = https://github.com/libimobiledevice/libusbmuxd.git
|
url = https://github.com/libimobiledevice/libusbmuxd.git
|
||||||
[submodule "Dependencies/libplist"]
|
[submodule "Dependencies/libplist"]
|
||||||
path = Dependencies/libplist
|
path = Dependencies/libplist
|
||||||
url = https://github.com/libimobiledevice/libplist.git
|
url = https://github.com/SideStore/libplist.git
|
||||||
[submodule "Dependencies/MarkdownAttributedString"]
|
[submodule "Dependencies/MarkdownAttributedString"]
|
||||||
path = Dependencies/MarkdownAttributedString
|
path = Dependencies/MarkdownAttributedString
|
||||||
url = https://github.com/chockenberry/MarkdownAttributedString.git
|
url = https://github.com/chockenberry/MarkdownAttributedString.git
|
||||||
|
|||||||
@@ -5,9 +5,9 @@
|
|||||||
"color-space" : "srgb",
|
"color-space" : "srgb",
|
||||||
"components" : {
|
"components" : {
|
||||||
"alpha" : "1.000",
|
"alpha" : "1.000",
|
||||||
"blue" : "0.518",
|
"blue" : "175",
|
||||||
"green" : "0.502",
|
"green" : "4",
|
||||||
"red" : "0.004"
|
"red" : "115"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
"idiom" : "universal"
|
"idiom" : "universal"
|
||||||
@@ -23,9 +23,9 @@
|
|||||||
"color-space" : "srgb",
|
"color-space" : "srgb",
|
||||||
"components" : {
|
"components" : {
|
||||||
"alpha" : "1.000",
|
"alpha" : "1.000",
|
||||||
"blue" : "0.404",
|
"blue" : "150",
|
||||||
"green" : "0.322",
|
"green" : "3",
|
||||||
"red" : "0.008"
|
"red" : "99"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
"idiom" : "universal"
|
"idiom" : "universal"
|
||||||
|
|||||||
@@ -8,13 +8,39 @@
|
|||||||
|
|
||||||
/* Begin PBXBuildFile section */
|
/* Begin PBXBuildFile section */
|
||||||
03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E314122A05D4C00370A3C /* Bundle+AltStore.swift */; };
|
03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E314122A05D4C00370A3C /* Bundle+AltStore.swift */; };
|
||||||
|
0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0E1A1F902AE36A9600364CAD /* bytearray.c */; };
|
||||||
|
0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = 0E764E162ADFF5740043DD4E /* AltBackup.ipa */; };
|
||||||
|
0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166472ADFE0D1003015C1 /* out-limd.c */; };
|
||||||
|
0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166522ADFE0D2003015C1 /* out-default.c */; };
|
||||||
|
0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166552ADFE0D2003015C1 /* out-plutil.c */; };
|
||||||
|
0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166562ADFE0D2003015C1 /* oplist.c */; };
|
||||||
|
0EA166682ADFE122003015C1 /* jsmn.h in Headers */ = {isa = PBXBuildFile; fileRef = 0EA166632ADFE122003015C1 /* jsmn.h */; };
|
||||||
|
0EA166692ADFE140003015C1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166452ADFE0D1003015C1 /* Array.cpp */; };
|
||||||
|
0EA1666A2ADFE140003015C1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166492ADFE0D1003015C1 /* String.cpp */; };
|
||||||
|
0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */; };
|
||||||
|
0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166532ADFE0D2003015C1 /* Integer.cpp */; };
|
||||||
|
0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166432ADFE0D1003015C1 /* Data.cpp */; };
|
||||||
|
0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166512ADFE0D2003015C1 /* ptrarray.c */; };
|
||||||
|
0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664F2ADFE0D1003015C1 /* hashtable.c */; };
|
||||||
|
0EA166702ADFE140003015C1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166502ADFE0D2003015C1 /* Node.cpp */; };
|
||||||
|
0EA166712ADFE140003015C1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166582ADFE0D2003015C1 /* Key.cpp */; };
|
||||||
|
0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166462ADFE0D1003015C1 /* Dictionary.cpp */; };
|
||||||
|
0EA166742ADFE140003015C1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166422ADFE0D1003015C1 /* Date.cpp */; };
|
||||||
|
0EA166752ADFE140003015C1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166542ADFE0D2003015C1 /* Real.cpp */; };
|
||||||
|
0EA166762ADFE140003015C1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664A2ADFE0D1003015C1 /* base64.c */; };
|
||||||
|
0EA166772ADFE140003015C1 /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166412ADFE0D1003015C1 /* jplist.c */; };
|
||||||
|
0EA166782ADFE140003015C1 /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166572ADFE0D2003015C1 /* jsmn.c */; };
|
||||||
|
0EA166792ADFE140003015C1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166442ADFE0D1003015C1 /* bplist.c */; };
|
||||||
|
0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664B2ADFE0D1003015C1 /* Uid.cpp */; };
|
||||||
|
0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1665A2ADFE0D2003015C1 /* Structure.cpp */; };
|
||||||
|
0EA1667D2ADFE140003015C1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166592ADFE0D2003015C1 /* xplist.c */; };
|
||||||
|
0EA1667E2ADFE140003015C1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664C2ADFE0D1003015C1 /* time64.c */; };
|
||||||
|
0EA4B9BC2AE4A414009209CE /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA4B9BB2AE4A3F6009209CE /* plist.c */; };
|
||||||
19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */ = {isa = PBXBuildFile; fileRef = BF45872B2298D31600BD7491 /* libimobiledevice.a */; };
|
19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */ = {isa = PBXBuildFile; fileRef = BF45872B2298D31600BD7491 /* libimobiledevice.a */; };
|
||||||
19104DB52909C06D00C49C7B /* EmotionalDamage.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19104DB42909C06D00C49C7B /* EmotionalDamage.swift */; };
|
19104DB52909C06D00C49C7B /* EmotionalDamage.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19104DB42909C06D00C49C7B /* EmotionalDamage.swift */; };
|
||||||
19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DB22909C06C00C49C7B /* libEmotionalDamage.a */; };
|
19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DB22909C06C00C49C7B /* libEmotionalDamage.a */; };
|
||||||
191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FAB290A5D92001A3B7C /* libminimuxer.a */; };
|
191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FAB290A5D92001A3B7C /* libminimuxer.a */; };
|
||||||
191E5FDC290AFA5C001A3B7C /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 191E5FDB290AFA5C001A3B7C /* OpenSSL */; };
|
191E5FDC290AFA5C001A3B7C /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 191E5FDB290AFA5C001A3B7C /* OpenSSL */; };
|
||||||
191E607D290B2EA5001A3B7C /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FD0290A651D001A3B7C /* jsmn.c */; };
|
|
||||||
191E607E290B2EA7001A3B7C /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FCF290A651D001A3B7C /* jplist.c */; };
|
|
||||||
1920B04F2924AC8300744F60 /* Settings.bundle in Resources */ = {isa = PBXBuildFile; fileRef = 1920B04E2924AC8300744F60 /* Settings.bundle */; };
|
1920B04F2924AC8300744F60 /* Settings.bundle in Resources */ = {isa = PBXBuildFile; fileRef = 1920B04E2924AC8300744F60 /* Settings.bundle */; };
|
||||||
19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */; };
|
19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */; };
|
||||||
4879A95F2861046500FC1BBD /* AltSign in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A95E2861046500FC1BBD /* AltSign */; };
|
4879A95F2861046500FC1BBD /* AltSign in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A95E2861046500FC1BBD /* AltSign */; };
|
||||||
@@ -25,7 +51,6 @@
|
|||||||
99F87D1829D8E4C900B40039 /* SwiftBridgeCore.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1629D8E4C900B40039 /* SwiftBridgeCore.swift */; };
|
99F87D1829D8E4C900B40039 /* SwiftBridgeCore.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1629D8E4C900B40039 /* SwiftBridgeCore.swift */; };
|
||||||
99F87D1929D8E4C900B40039 /* minimuxer.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1729D8E4C900B40039 /* minimuxer.swift */; };
|
99F87D1929D8E4C900B40039 /* minimuxer.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1729D8E4C900B40039 /* minimuxer.swift */; };
|
||||||
B3146ED2284F581E00BBC3FD /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; };
|
B3146ED2284F581E00BBC3FD /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; };
|
||||||
B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; settings = {ATTRIBUTES = (CodeSignOnCopy, RemoveHeadersOnCopy, ); }; };
|
|
||||||
B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F894295F7F9B002B1159 /* libfragmentzip.a */; };
|
B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F894295F7F9B002B1159 /* libfragmentzip.a */; };
|
||||||
B33FFBAA295F8F78002259E6 /* preboard.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBA9295F8F78002259E6 /* preboard.c */; };
|
B33FFBAA295F8F78002259E6 /* preboard.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBA9295F8F78002259E6 /* preboard.c */; };
|
||||||
B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBAB295F8F98002259E6 /* companion_proxy.c */; };
|
B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBAB295F8F98002259E6 /* companion_proxy.c */; };
|
||||||
@@ -74,7 +99,6 @@
|
|||||||
BF41B808233433C100C593A3 /* LoadingState.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF41B807233433C100C593A3 /* LoadingState.swift */; };
|
BF41B808233433C100C593A3 /* LoadingState.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF41B807233433C100C593A3 /* LoadingState.swift */; };
|
||||||
BF42345A25101C35006D1EB2 /* WidgetView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF42345825101C1D006D1EB2 /* WidgetView.swift */; };
|
BF42345A25101C35006D1EB2 /* WidgetView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF42345825101C1D006D1EB2 /* WidgetView.swift */; };
|
||||||
BF44EEF0246B08BA002A52F2 /* BackupController.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEEF246B08BA002A52F2 /* BackupController.swift */; };
|
BF44EEF0246B08BA002A52F2 /* BackupController.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEEF246B08BA002A52F2 /* BackupController.swift */; };
|
||||||
BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */; };
|
|
||||||
BF44EEFC246B4550002A52F2 /* RemoveAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */; };
|
BF44EEFC246B4550002A52F2 /* RemoveAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */; };
|
||||||
BF4587F82298D3AB00BD7491 /* service.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4587C82298D3A800BD7491 /* service.h */; };
|
BF4587F82298D3AB00BD7491 /* service.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4587C82298D3A800BD7491 /* service.h */; };
|
||||||
BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587C92298D3A800BD7491 /* diagnostics_relay.c */; };
|
BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587C92298D3A800BD7491 /* diagnostics_relay.c */; };
|
||||||
@@ -254,34 +278,6 @@
|
|||||||
BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = BFD247782284B9A700981D42 /* LaunchScreen.storyboard */; };
|
BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = BFD247782284B9A700981D42 /* LaunchScreen.storyboard */; };
|
||||||
BFD2478C2284C4C300981D42 /* AppIconImageView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478B2284C4C300981D42 /* AppIconImageView.swift */; };
|
BFD2478C2284C4C300981D42 /* AppIconImageView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478B2284C4C300981D42 /* AppIconImageView.swift */; };
|
||||||
BFD2478F2284C8F900981D42 /* Button.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478E2284C8F900981D42 /* Button.swift */; };
|
BFD2478F2284C8F900981D42 /* Button.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478E2284C8F900981D42 /* Button.swift */; };
|
||||||
BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */; };
|
|
||||||
BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE622A1A9CA000B7ED1 /* base64.c */; };
|
|
||||||
BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE722A1A9CA000B7ED1 /* hashtable.c */; };
|
|
||||||
BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */; };
|
|
||||||
BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */; };
|
|
||||||
BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEA22A1A9CA000B7ED1 /* bplist.c */; };
|
|
||||||
BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEB22A1A9CA000B7ED1 /* String.cpp */; };
|
|
||||||
BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEC22A1A9CA000B7ED1 /* time64.c */; };
|
|
||||||
BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BED22A1A9CA000B7ED1 /* plist.h */; };
|
|
||||||
BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEE22A1A9CA000B7ED1 /* plist.c */; };
|
|
||||||
BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */; };
|
|
||||||
BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF022A1A9CA000B7ED1 /* Date.cpp */; };
|
|
||||||
BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */; };
|
|
||||||
BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */; };
|
|
||||||
BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF322A1A9CA000B7ED1 /* Real.cpp */; };
|
|
||||||
BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF422A1A9CA000B7ED1 /* strbuf.h */; };
|
|
||||||
BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF522A1A9CA000B7ED1 /* bytearray.c */; };
|
|
||||||
BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF622A1A9CA000B7ED1 /* base64.h */; };
|
|
||||||
BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF722A1A9CA000B7ED1 /* Data.cpp */; };
|
|
||||||
BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF822A1A9CB000B7ED1 /* Array.cpp */; };
|
|
||||||
BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF922A1A9CB000B7ED1 /* Node.cpp */; };
|
|
||||||
BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */; };
|
|
||||||
BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */; };
|
|
||||||
BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */; };
|
|
||||||
BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */; };
|
|
||||||
BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */; };
|
|
||||||
BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFF22A1A9CB000B7ED1 /* time64.h */; };
|
|
||||||
BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C0022A1A9CB000B7ED1 /* xplist.c */; };
|
|
||||||
BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1D22A1A9EC000B7ED1 /* node.c */; };
|
BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1D22A1A9EC000B7ED1 /* node.c */; };
|
||||||
BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1E22A1A9EC000B7ED1 /* node_list.c */; };
|
BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1E22A1A9EC000B7ED1 /* node_list.c */; };
|
||||||
BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1F22A1A9EC000B7ED1 /* cnary.c */; };
|
BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1F22A1A9EC000B7ED1 /* cnary.c */; };
|
||||||
@@ -336,6 +332,7 @@
|
|||||||
D57FE84428C7DB7100216002 /* ErrorLogViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */; };
|
D57FE84428C7DB7100216002 /* ErrorLogViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */; };
|
||||||
D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = D58916FD28C7C55C00E39C8B /* LoggedError.swift */; };
|
D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = D58916FD28C7C55C00E39C8B /* LoggedError.swift */; };
|
||||||
D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D593F1932717749A006E82DE /* PatchAppOperation.swift */; };
|
D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D593F1932717749A006E82DE /* PatchAppOperation.swift */; };
|
||||||
|
D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */; };
|
||||||
D5CA0C4B280E141900469595 /* ManagedPatron.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4A280E141900469595 /* ManagedPatron.swift */; };
|
D5CA0C4B280E141900469595 /* ManagedPatron.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4A280E141900469595 /* ManagedPatron.swift */; };
|
||||||
D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */; };
|
D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */; };
|
||||||
D5DAE0942804B0B80034D8D4 /* ScreenshotProcessor.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5DAE0932804B0B80034D8D4 /* ScreenshotProcessor.swift */; };
|
D5DAE0942804B0B80034D8D4 /* ScreenshotProcessor.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5DAE0932804B0B80034D8D4 /* ScreenshotProcessor.swift */; };
|
||||||
@@ -482,7 +479,6 @@
|
|||||||
dstPath = "";
|
dstPath = "";
|
||||||
dstSubfolderSpec = 10;
|
dstSubfolderSpec = 10;
|
||||||
files = (
|
files = (
|
||||||
B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */,
|
|
||||||
BF1614F2250822F100767AEA /* Roxas.framework in Embed Frameworks */,
|
BF1614F2250822F100767AEA /* Roxas.framework in Embed Frameworks */,
|
||||||
BF66EE862501AE50007EE018 /* AltStoreCore.framework in Embed Frameworks */,
|
BF66EE862501AE50007EE018 /* AltStoreCore.framework in Embed Frameworks */,
|
||||||
);
|
);
|
||||||
@@ -503,12 +499,45 @@
|
|||||||
/* End PBXCopyFilesBuildPhase section */
|
/* End PBXCopyFilesBuildPhase section */
|
||||||
|
|
||||||
/* Begin PBXFileReference section */
|
/* Begin PBXFileReference section */
|
||||||
|
0E1A1F902AE36A9600364CAD /* bytearray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = src/bytearray.c; sourceTree = "<group>"; };
|
||||||
|
0E764E162ADFF5740043DD4E /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; name = AltBackup.ipa; path = AltStore/Resources/AltBackup.ipa; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166412ADFE0D1003015C1 /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166422ADFE0D1003015C1 /* Date.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166432ADFE0D1003015C1 /* Data.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166442ADFE0D1003015C1 /* bplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166452ADFE0D1003015C1 /* Array.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166462ADFE0D1003015C1 /* Dictionary.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166472ADFE0D1003015C1 /* out-limd.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-limd.c"; path = "Dependencies/libplist/src/out-limd.c"; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166492ADFE0D1003015C1 /* String.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA1664A2ADFE0D1003015C1 /* base64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA1664B2ADFE0D1003015C1 /* Uid.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA1664C2ADFE0D1003015C1 /* time64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA1664F2ADFE0D1003015C1 /* hashtable.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166502ADFE0D2003015C1 /* Node.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166512ADFE0D2003015C1 /* ptrarray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166522ADFE0D2003015C1 /* out-default.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-default.c"; path = "Dependencies/libplist/src/out-default.c"; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166532ADFE0D2003015C1 /* Integer.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166542ADFE0D2003015C1 /* Real.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166552ADFE0D2003015C1 /* out-plutil.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-plutil.c"; path = "Dependencies/libplist/src/out-plutil.c"; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166562ADFE0D2003015C1 /* oplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = oplist.c; path = Dependencies/libplist/src/oplist.c; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166572ADFE0D2003015C1 /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166582ADFE0D2003015C1 /* Key.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166592ADFE0D2003015C1 /* xplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA1665A2ADFE0D2003015C1 /* Structure.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA1665F2ADFE122003015C1 /* time64_limits.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166602ADFE122003015C1 /* time64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166612ADFE122003015C1 /* bytearray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166622ADFE122003015C1 /* ptrarray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166632ADFE122003015C1 /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166642ADFE122003015C1 /* plist.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166652ADFE122003015C1 /* hashtable.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166662ADFE122003015C1 /* base64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA166672ADFE122003015C1 /* strbuf.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
|
||||||
|
0EA4B9BB2AE4A3F6009209CE /* plist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
|
||||||
19104DB22909C06C00C49C7B /* libEmotionalDamage.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libEmotionalDamage.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
19104DB22909C06C00C49C7B /* libEmotionalDamage.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libEmotionalDamage.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
||||||
19104DB42909C06D00C49C7B /* EmotionalDamage.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EmotionalDamage.swift; sourceTree = "<group>"; };
|
19104DB42909C06D00C49C7B /* EmotionalDamage.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EmotionalDamage.swift; sourceTree = "<group>"; };
|
||||||
191E5FAB290A5D92001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
191E5FAB290A5D92001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
||||||
191E5FCF290A651D001A3B7C /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
191E5FD0290A651D001A3B7C /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
191E5FD1290A651D001A3B7C /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
|
|
||||||
1920B04E2924AC8300744F60 /* Settings.bundle */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.plug-in"; path = Settings.bundle; sourceTree = "<group>"; };
|
1920B04E2924AC8300744F60 /* Settings.bundle */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.plug-in"; path = Settings.bundle; sourceTree = "<group>"; };
|
||||||
19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SelectTeamViewController.swift; sourceTree = "<group>"; };
|
19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SelectTeamViewController.swift; sourceTree = "<group>"; };
|
||||||
9961EC2D29BE9F2E00AF2C6F /* minimuxer-helpers.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; name = "minimuxer-helpers.swift"; path = "Dependencies/minimuxer/minimuxer-helpers.swift"; sourceTree = SOURCE_ROOT; };
|
9961EC2D29BE9F2E00AF2C6F /* minimuxer-helpers.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; name = "minimuxer-helpers.swift"; path = "Dependencies/minimuxer/minimuxer-helpers.swift"; sourceTree = SOURCE_ROOT; };
|
||||||
@@ -573,7 +602,6 @@
|
|||||||
BF41B807233433C100C593A3 /* LoadingState.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoadingState.swift; sourceTree = "<group>"; };
|
BF41B807233433C100C593A3 /* LoadingState.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoadingState.swift; sourceTree = "<group>"; };
|
||||||
BF42345825101C1D006D1EB2 /* WidgetView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = WidgetView.swift; sourceTree = "<group>"; };
|
BF42345825101C1D006D1EB2 /* WidgetView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = WidgetView.swift; sourceTree = "<group>"; };
|
||||||
BF44EEEF246B08BA002A52F2 /* BackupController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = BackupController.swift; sourceTree = "<group>"; };
|
BF44EEEF246B08BA002A52F2 /* BackupController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = BackupController.swift; sourceTree = "<group>"; };
|
||||||
BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; path = AltBackup.ipa; sourceTree = "<group>"; };
|
|
||||||
BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RemoveAppOperation.swift; sourceTree = "<group>"; };
|
BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RemoveAppOperation.swift; sourceTree = "<group>"; };
|
||||||
BF45872B2298D31600BD7491 /* libimobiledevice.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libimobiledevice.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
BF45872B2298D31600BD7491 /* libimobiledevice.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libimobiledevice.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
||||||
BF4587C82298D3A800BD7491 /* service.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = service.h; path = Dependencies/libimobiledevice/src/service.h; sourceTree = SOURCE_ROOT; };
|
BF4587C82298D3A800BD7491 /* service.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = service.h; path = Dependencies/libimobiledevice/src/service.h; sourceTree = SOURCE_ROOT; };
|
||||||
@@ -759,34 +787,6 @@
|
|||||||
BFD2479E2284FBD000981D42 /* UIColor+AltStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "UIColor+AltStore.swift"; sourceTree = "<group>"; };
|
BFD2479E2284FBD000981D42 /* UIColor+AltStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "UIColor+AltStore.swift"; sourceTree = "<group>"; };
|
||||||
BFD44605241188C300EAB90A /* CodableServerError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = CodableServerError.swift; sourceTree = "<group>"; };
|
BFD44605241188C300EAB90A /* CodableServerError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = CodableServerError.swift; sourceTree = "<group>"; };
|
||||||
BFD52BD222A06EFB000B7ED1 /* ALTConstants.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTConstants.h; sourceTree = "<group>"; };
|
BFD52BD222A06EFB000B7ED1 /* ALTConstants.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTConstants.h; sourceTree = "<group>"; };
|
||||||
BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BE622A1A9CA000B7ED1 /* base64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BE722A1A9CA000B7ED1 /* hashtable.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BEA22A1A9CA000B7ED1 /* bplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BEB22A1A9CA000B7ED1 /* String.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BEC22A1A9CA000B7ED1 /* time64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BED22A1A9CA000B7ED1 /* plist.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BEE22A1A9CA000B7ED1 /* plist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BF022A1A9CA000B7ED1 /* Date.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BF322A1A9CA000B7ED1 /* Real.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BF422A1A9CA000B7ED1 /* strbuf.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BF522A1A9CA000B7ED1 /* bytearray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = Dependencies/libplist/src/bytearray.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BF622A1A9CA000B7ED1 /* base64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BF722A1A9CA000B7ED1 /* Data.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BF822A1A9CB000B7ED1 /* Array.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BF922A1A9CB000B7ED1 /* Node.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52BFF22A1A9CB000B7ED1 /* time64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52C0022A1A9CB000B7ED1 /* xplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
BFD52C1D22A1A9EC000B7ED1 /* node.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node.c; path = Dependencies/libplist/libcnary/node.c; sourceTree = SOURCE_ROOT; };
|
BFD52C1D22A1A9EC000B7ED1 /* node.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node.c; path = Dependencies/libplist/libcnary/node.c; sourceTree = SOURCE_ROOT; };
|
||||||
BFD52C1E22A1A9EC000B7ED1 /* node_list.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node_list.c; path = Dependencies/libplist/libcnary/node_list.c; sourceTree = SOURCE_ROOT; };
|
BFD52C1E22A1A9EC000B7ED1 /* node_list.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node_list.c; path = Dependencies/libplist/libcnary/node_list.c; sourceTree = SOURCE_ROOT; };
|
||||||
BFD52C1F22A1A9EC000B7ED1 /* cnary.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = cnary.c; path = Dependencies/libplist/libcnary/cnary.c; sourceTree = SOURCE_ROOT; };
|
BFD52C1F22A1A9EC000B7ED1 /* cnary.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = cnary.c; path = Dependencies/libplist/libcnary/cnary.c; sourceTree = SOURCE_ROOT; };
|
||||||
@@ -840,6 +840,7 @@
|
|||||||
D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorLogViewController.swift; sourceTree = "<group>"; };
|
D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorLogViewController.swift; sourceTree = "<group>"; };
|
||||||
D58916FD28C7C55C00E39C8B /* LoggedError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoggedError.swift; sourceTree = "<group>"; };
|
D58916FD28C7C55C00E39C8B /* LoggedError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoggedError.swift; sourceTree = "<group>"; };
|
||||||
D593F1932717749A006E82DE /* PatchAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchAppOperation.swift; sourceTree = "<group>"; };
|
D593F1932717749A006E82DE /* PatchAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchAppOperation.swift; sourceTree = "<group>"; };
|
||||||
|
D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ClearAppCacheOperation.swift; sourceTree = "<group>"; };
|
||||||
D5CA0C4A280E141900469595 /* ManagedPatron.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ManagedPatron.swift; sourceTree = "<group>"; };
|
D5CA0C4A280E141900469595 /* ManagedPatron.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ManagedPatron.swift; sourceTree = "<group>"; };
|
||||||
D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 10.xcdatamodel"; sourceTree = "<group>"; };
|
D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 10.xcdatamodel"; sourceTree = "<group>"; };
|
||||||
D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcmappingmodel; path = AltStore9ToAltStore10.xcmappingmodel; sourceTree = "<group>"; };
|
D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcmappingmodel; path = AltStore9ToAltStore10.xcmappingmodel; sourceTree = "<group>"; };
|
||||||
@@ -1192,37 +1193,41 @@
|
|||||||
BF4588562298DC6D00BD7491 /* libplist */ = {
|
BF4588562298DC6D00BD7491 /* libplist */ = {
|
||||||
isa = PBXGroup;
|
isa = PBXGroup;
|
||||||
children = (
|
children = (
|
||||||
BFD52BE622A1A9CA000B7ED1 /* base64.c */,
|
0EA166462ADFE0D1003015C1 /* Dictionary.cpp */,
|
||||||
BFD52BEA22A1A9CA000B7ED1 /* bplist.c */,
|
0E1A1F902AE36A9600364CAD /* bytearray.c */,
|
||||||
BFD52BF522A1A9CA000B7ED1 /* bytearray.c */,
|
0EA166442ADFE0D1003015C1 /* bplist.c */,
|
||||||
BFD52BE722A1A9CA000B7ED1 /* hashtable.c */,
|
0EA166432ADFE0D1003015C1 /* Data.cpp */,
|
||||||
191E5FCF290A651D001A3B7C /* jplist.c */,
|
0EA166422ADFE0D1003015C1 /* Date.cpp */,
|
||||||
191E5FD0290A651D001A3B7C /* jsmn.c */,
|
0EA1664F2ADFE0D1003015C1 /* hashtable.c */,
|
||||||
BFD52BEE22A1A9CA000B7ED1 /* plist.c */,
|
0EA166532ADFE0D2003015C1 /* Integer.cpp */,
|
||||||
BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */,
|
0EA166562ADFE0D2003015C1 /* oplist.c */,
|
||||||
BFD52BEC22A1A9CA000B7ED1 /* time64.c */,
|
0EA166522ADFE0D2003015C1 /* out-default.c */,
|
||||||
BFD52C0022A1A9CB000B7ED1 /* xplist.c */,
|
0EA166472ADFE0D1003015C1 /* out-limd.c */,
|
||||||
BFD52BF822A1A9CB000B7ED1 /* Array.cpp */,
|
0EA166552ADFE0D2003015C1 /* out-plutil.c */,
|
||||||
BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */,
|
0EA166492ADFE0D1003015C1 /* String.cpp */,
|
||||||
BFD52BF722A1A9CA000B7ED1 /* Data.cpp */,
|
0EA1665A2ADFE0D2003015C1 /* Structure.cpp */,
|
||||||
BFD52BF022A1A9CA000B7ED1 /* Date.cpp */,
|
0EA166452ADFE0D1003015C1 /* Array.cpp */,
|
||||||
BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */,
|
0EA1664A2ADFE0D1003015C1 /* base64.c */,
|
||||||
BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */,
|
0EA166572ADFE0D2003015C1 /* jsmn.c */,
|
||||||
BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */,
|
0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */,
|
||||||
BFD52BF922A1A9CB000B7ED1 /* Node.cpp */,
|
0EA4B9BB2AE4A3F6009209CE /* plist.c */,
|
||||||
BFD52BF322A1A9CA000B7ED1 /* Real.cpp */,
|
0EA166412ADFE0D1003015C1 /* jplist.c */,
|
||||||
BFD52BEB22A1A9CA000B7ED1 /* String.cpp */,
|
0EA166582ADFE0D2003015C1 /* Key.cpp */,
|
||||||
BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */,
|
0EA166512ADFE0D2003015C1 /* ptrarray.c */,
|
||||||
BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */,
|
0EA1664C2ADFE0D1003015C1 /* time64.c */,
|
||||||
BFD52BF622A1A9CA000B7ED1 /* base64.h */,
|
0EA166502ADFE0D2003015C1 /* Node.cpp */,
|
||||||
BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */,
|
0EA166542ADFE0D2003015C1 /* Real.cpp */,
|
||||||
BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */,
|
0EA1664B2ADFE0D1003015C1 /* Uid.cpp */,
|
||||||
191E5FD1290A651D001A3B7C /* jsmn.h */,
|
0EA166592ADFE0D2003015C1 /* xplist.c */,
|
||||||
BFD52BED22A1A9CA000B7ED1 /* plist.h */,
|
0EA166662ADFE122003015C1 /* base64.h */,
|
||||||
BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */,
|
0EA166652ADFE122003015C1 /* hashtable.h */,
|
||||||
BFD52BF422A1A9CA000B7ED1 /* strbuf.h */,
|
0EA166632ADFE122003015C1 /* jsmn.h */,
|
||||||
BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */,
|
0EA166642ADFE122003015C1 /* plist.h */,
|
||||||
BFD52BFF22A1A9CB000B7ED1 /* time64.h */,
|
0EA166612ADFE122003015C1 /* bytearray.h */,
|
||||||
|
0EA166622ADFE122003015C1 /* ptrarray.h */,
|
||||||
|
0EA166672ADFE122003015C1 /* strbuf.h */,
|
||||||
|
0EA1665F2ADFE122003015C1 /* time64_limits.h */,
|
||||||
|
0EA166602ADFE122003015C1 /* time64.h */,
|
||||||
BF4588892298DDEA00BD7491 /* libcnary */,
|
BF4588892298DDEA00BD7491 /* libcnary */,
|
||||||
);
|
);
|
||||||
path = libplist;
|
path = libplist;
|
||||||
@@ -1619,7 +1624,7 @@
|
|||||||
BFD247962284D7C100981D42 /* Resources */ = {
|
BFD247962284D7C100981D42 /* Resources */ = {
|
||||||
isa = PBXGroup;
|
isa = PBXGroup;
|
||||||
children = (
|
children = (
|
||||||
BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */,
|
0E764E162ADFF5740043DD4E /* AltBackup.ipa */,
|
||||||
BFD247762284B9A700981D42 /* Assets.xcassets */,
|
BFD247762284B9A700981D42 /* Assets.xcassets */,
|
||||||
BF770E6822BD57DD002A40FE /* Silence.m4a */,
|
BF770E6822BD57DD002A40FE /* Silence.m4a */,
|
||||||
);
|
);
|
||||||
@@ -1694,6 +1699,7 @@
|
|||||||
D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */,
|
D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */,
|
||||||
D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */,
|
D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */,
|
||||||
D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */,
|
D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */,
|
||||||
|
D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */,
|
||||||
BF7B44062725A4B8005288A4 /* Patch App */,
|
BF7B44062725A4B8005288A4 /* Patch App */,
|
||||||
);
|
);
|
||||||
path = Operations;
|
path = Operations;
|
||||||
@@ -1780,32 +1786,26 @@
|
|||||||
isa = PBXHeadersBuildPhase;
|
isa = PBXHeadersBuildPhase;
|
||||||
buildActionMask = 2147483647;
|
buildActionMask = 2147483647;
|
||||||
files = (
|
files = (
|
||||||
|
0EA166682ADFE122003015C1 /* jsmn.h in Headers */,
|
||||||
BF4588112298D3AB00BD7491 /* misagent.h in Headers */,
|
BF4588112298D3AB00BD7491 /* misagent.h in Headers */,
|
||||||
BF4588042298D3AB00BD7491 /* lockdown.h in Headers */,
|
BF4588042298D3AB00BD7491 /* lockdown.h in Headers */,
|
||||||
BF45880B2298D3AB00BD7491 /* mobilesync.h in Headers */,
|
BF45880B2298D3AB00BD7491 /* mobilesync.h in Headers */,
|
||||||
BF4588002298D3AB00BD7491 /* restore.h in Headers */,
|
BF4588002298D3AB00BD7491 /* restore.h in Headers */,
|
||||||
BF4588152298D3AB00BD7491 /* mobilebackup.h in Headers */,
|
BF4588152298D3AB00BD7491 /* mobilebackup.h in Headers */,
|
||||||
BF4588182298D3AB00BD7491 /* syslog_relay.h in Headers */,
|
BF4588182298D3AB00BD7491 /* syslog_relay.h in Headers */,
|
||||||
BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */,
|
|
||||||
BF45881D2298D3AB00BD7491 /* file_relay.h in Headers */,
|
BF45881D2298D3AB00BD7491 /* file_relay.h in Headers */,
|
||||||
BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */,
|
|
||||||
BF4587FD2298D3AB00BD7491 /* sbservices.h in Headers */,
|
BF4587FD2298D3AB00BD7491 /* sbservices.h in Headers */,
|
||||||
BF4588362298D3C100BD7491 /* debug.h in Headers */,
|
BF4588362298D3C100BD7491 /* debug.h in Headers */,
|
||||||
BF4588202298D3AB00BD7491 /* mobile_image_mounter.h in Headers */,
|
BF4588202298D3AB00BD7491 /* mobile_image_mounter.h in Headers */,
|
||||||
BF4588122298D3AB00BD7491 /* house_arrest.h in Headers */,
|
BF4588122298D3AB00BD7491 /* house_arrest.h in Headers */,
|
||||||
BF45881F2298D3AB00BD7491 /* device_link_service.h in Headers */,
|
BF45881F2298D3AB00BD7491 /* device_link_service.h in Headers */,
|
||||||
BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */,
|
|
||||||
BF45880E2298D3AB00BD7491 /* debugserver.h in Headers */,
|
BF45880E2298D3AB00BD7491 /* debugserver.h in Headers */,
|
||||||
BF4588102298D3AB00BD7491 /* heartbeat.h in Headers */,
|
BF4588102298D3AB00BD7491 /* heartbeat.h in Headers */,
|
||||||
BF4587FA2298D3AB00BD7491 /* diagnostics_relay.h in Headers */,
|
BF4587FA2298D3AB00BD7491 /* diagnostics_relay.h in Headers */,
|
||||||
BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */,
|
|
||||||
BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */,
|
|
||||||
BF4588192298D3AB00BD7491 /* webinspector.h in Headers */,
|
BF4588192298D3AB00BD7491 /* webinspector.h in Headers */,
|
||||||
BF4588342298D3C100BD7491 /* userpref.h in Headers */,
|
BF4588342298D3C100BD7491 /* userpref.h in Headers */,
|
||||||
BF45880A2298D3AB00BD7491 /* screenshotr.h in Headers */,
|
BF45880A2298D3AB00BD7491 /* screenshotr.h in Headers */,
|
||||||
BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */,
|
|
||||||
BF4587FE2298D3AB00BD7491 /* mobilebackup2.h in Headers */,
|
BF4587FE2298D3AB00BD7491 /* mobilebackup2.h in Headers */,
|
||||||
BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */,
|
|
||||||
BF45881C2298D3AB00BD7491 /* afc.h in Headers */,
|
BF45881C2298D3AB00BD7491 /* afc.h in Headers */,
|
||||||
BF45881A2298D3AB00BD7491 /* mobileactivation.h in Headers */,
|
BF45881A2298D3AB00BD7491 /* mobileactivation.h in Headers */,
|
||||||
BF4588052298D3AB00BD7491 /* idevice.h in Headers */,
|
BF4588052298D3AB00BD7491 /* idevice.h in Headers */,
|
||||||
@@ -1813,7 +1813,6 @@
|
|||||||
BF4587F82298D3AB00BD7491 /* service.h in Headers */,
|
BF4587F82298D3AB00BD7491 /* service.h in Headers */,
|
||||||
BF4588252298D3AB00BD7491 /* property_list_service.h in Headers */,
|
BF4588252298D3AB00BD7491 /* property_list_service.h in Headers */,
|
||||||
BF4588132298D3AB00BD7491 /* notification_proxy.h in Headers */,
|
BF4588132298D3AB00BD7491 /* notification_proxy.h in Headers */,
|
||||||
BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */,
|
|
||||||
);
|
);
|
||||||
runOnlyForDeploymentPostprocessing = 0;
|
runOnlyForDeploymentPostprocessing = 0;
|
||||||
};
|
};
|
||||||
@@ -2209,7 +2208,6 @@
|
|||||||
BFE60738231ADF49002B0E8E /* Settings.storyboard in Resources */,
|
BFE60738231ADF49002B0E8E /* Settings.storyboard in Resources */,
|
||||||
D57DF638271E32F000677701 /* PatchApp.storyboard in Resources */,
|
D57DF638271E32F000677701 /* PatchApp.storyboard in Resources */,
|
||||||
BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */,
|
BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */,
|
||||||
BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */,
|
|
||||||
BF770E6922BD57DD002A40FE /* Silence.m4a in Resources */,
|
BF770E6922BD57DD002A40FE /* Silence.m4a in Resources */,
|
||||||
BFD247772284B9A700981D42 /* Assets.xcassets in Resources */,
|
BFD247772284B9A700981D42 /* Assets.xcassets in Resources */,
|
||||||
1920B04F2924AC8300744F60 /* Settings.bundle in Resources */,
|
1920B04F2924AC8300744F60 /* Settings.bundle in Resources */,
|
||||||
@@ -2217,6 +2215,7 @@
|
|||||||
BFB6B22423187A3D0022A802 /* NewsCollectionViewCell.xib in Resources */,
|
BFB6B22423187A3D0022A802 /* NewsCollectionViewCell.xib in Resources */,
|
||||||
BFD247752284B9A500981D42 /* Main.storyboard in Resources */,
|
BFD247752284B9A500981D42 /* Main.storyboard in Resources */,
|
||||||
BFDB5B2622EFBBEA00F74113 /* BrowseCollectionViewCell.xib in Resources */,
|
BFDB5B2622EFBBEA00F74113 /* BrowseCollectionViewCell.xib in Resources */,
|
||||||
|
0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */,
|
||||||
BFE6073C231AE1E7002B0E8E /* SettingsHeaderFooterView.xib in Resources */,
|
BFE6073C231AE1E7002B0E8E /* SettingsHeaderFooterView.xib in Resources */,
|
||||||
BF29012F2318F6B100D88A45 /* AppBannerView.xib in Resources */,
|
BF29012F2318F6B100D88A45 /* AppBannerView.xib in Resources */,
|
||||||
BFE6325A22A83BEB00F30809 /* Authentication.storyboard in Resources */,
|
BFE6325A22A83BEB00F30809 /* Authentication.storyboard in Resources */,
|
||||||
@@ -2292,69 +2291,73 @@
|
|||||||
isa = PBXSourcesBuildPhase;
|
isa = PBXSourcesBuildPhase;
|
||||||
buildActionMask = 2147483647;
|
buildActionMask = 2147483647;
|
||||||
files = (
|
files = (
|
||||||
|
0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */,
|
||||||
|
0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */,
|
||||||
|
0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */,
|
||||||
|
0EA166742ADFE140003015C1 /* Date.cpp in Sources */,
|
||||||
|
0EA166712ADFE140003015C1 /* Key.cpp in Sources */,
|
||||||
|
0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */,
|
||||||
|
0EA1666A2ADFE140003015C1 /* String.cpp in Sources */,
|
||||||
|
0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */,
|
||||||
|
0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */,
|
||||||
|
0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */,
|
||||||
|
0EA166702ADFE140003015C1 /* Node.cpp in Sources */,
|
||||||
|
0EA166752ADFE140003015C1 /* Real.cpp in Sources */,
|
||||||
|
0EA166762ADFE140003015C1 /* base64.c in Sources */,
|
||||||
|
0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */,
|
||||||
BF45881B2298D3AB00BD7491 /* house_arrest.c in Sources */,
|
BF45881B2298D3AB00BD7491 /* house_arrest.c in Sources */,
|
||||||
BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */,
|
0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */,
|
||||||
BF4588232298D3AB00BD7491 /* mobilesync.c in Sources */,
|
BF4588232298D3AB00BD7491 /* mobilesync.c in Sources */,
|
||||||
BF4588072298D3AB00BD7491 /* afc.c in Sources */,
|
BF4588072298D3AB00BD7491 /* afc.c in Sources */,
|
||||||
191E607D290B2EA5001A3B7C /* jsmn.c in Sources */,
|
|
||||||
191E607E290B2EA7001A3B7C /* jplist.c in Sources */,
|
|
||||||
BF4588082298D3AB00BD7491 /* mobile_image_mounter.c in Sources */,
|
BF4588082298D3AB00BD7491 /* mobile_image_mounter.c in Sources */,
|
||||||
BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */,
|
|
||||||
BF4588022298D3AB00BD7491 /* file_relay.c in Sources */,
|
BF4588022298D3AB00BD7491 /* file_relay.c in Sources */,
|
||||||
BF45880F2298D3AB00BD7491 /* debugserver.c in Sources */,
|
BF45880F2298D3AB00BD7491 /* debugserver.c in Sources */,
|
||||||
|
0EA166792ADFE140003015C1 /* bplist.c in Sources */,
|
||||||
|
0EA166772ADFE140003015C1 /* jplist.c in Sources */,
|
||||||
BF4588162298D3AB00BD7491 /* restore.c in Sources */,
|
BF4588162298D3AB00BD7491 /* restore.c in Sources */,
|
||||||
BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */,
|
|
||||||
BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */,
|
|
||||||
BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */,
|
BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */,
|
||||||
BF4588092298D3AB00BD7491 /* installation_proxy.c in Sources */,
|
BF4588092298D3AB00BD7491 /* installation_proxy.c in Sources */,
|
||||||
|
0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */,
|
||||||
|
0EA1667E2ADFE140003015C1 /* time64.c in Sources */,
|
||||||
BF4587FF2298D3AB00BD7491 /* heartbeat.c in Sources */,
|
BF4587FF2298D3AB00BD7491 /* heartbeat.c in Sources */,
|
||||||
BF4588222298D3AB00BD7491 /* mobileactivation.c in Sources */,
|
BF4588222298D3AB00BD7491 /* mobileactivation.c in Sources */,
|
||||||
BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */,
|
|
||||||
BF4588212298D3AB00BD7491 /* idevice.c in Sources */,
|
BF4588212298D3AB00BD7491 /* idevice.c in Sources */,
|
||||||
B343F885295F7C5D002B1159 /* tlv.c in Sources */,
|
B343F885295F7C5D002B1159 /* tlv.c in Sources */,
|
||||||
BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */,
|
|
||||||
BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */,
|
BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */,
|
||||||
B343F87D295F7C5D002B1159 /* cbuf.c in Sources */,
|
B343F87D295F7C5D002B1159 /* cbuf.c in Sources */,
|
||||||
BF4588062298D3AB00BD7491 /* webinspector.c in Sources */,
|
BF4588062298D3AB00BD7491 /* webinspector.c in Sources */,
|
||||||
BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */,
|
|
||||||
B343F883295F7C5D002B1159 /* thread.c in Sources */,
|
B343F883295F7C5D002B1159 /* thread.c in Sources */,
|
||||||
BF45880D2298D3AB00BD7491 /* mobilebackup.c in Sources */,
|
BF45880D2298D3AB00BD7491 /* mobilebackup.c in Sources */,
|
||||||
BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */,
|
|
||||||
BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */,
|
|
||||||
BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */,
|
|
||||||
BF45883A2298D3C100BD7491 /* debug.c in Sources */,
|
BF45883A2298D3C100BD7491 /* debug.c in Sources */,
|
||||||
B343F881295F7C5D002B1159 /* termcolors.c in Sources */,
|
B343F881295F7C5D002B1159 /* termcolors.c in Sources */,
|
||||||
|
0EA1667D2ADFE140003015C1 /* xplist.c in Sources */,
|
||||||
B343F87E295F7C5D002B1159 /* collection.c in Sources */,
|
B343F87E295F7C5D002B1159 /* collection.c in Sources */,
|
||||||
BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */,
|
|
||||||
B33FFBAA295F8F78002259E6 /* preboard.c in Sources */,
|
B33FFBAA295F8F78002259E6 /* preboard.c in Sources */,
|
||||||
B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */,
|
B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */,
|
||||||
BF4587FB2298D3AB00BD7491 /* notification_proxy.c in Sources */,
|
BF4587FB2298D3AB00BD7491 /* notification_proxy.c in Sources */,
|
||||||
BF4588352298D3C100BD7491 /* userpref.c in Sources */,
|
BF4588352298D3C100BD7491 /* userpref.c in Sources */,
|
||||||
BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */,
|
0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */,
|
||||||
B343F87C295F7C5D002B1159 /* opack.c in Sources */,
|
B343F87C295F7C5D002B1159 /* opack.c in Sources */,
|
||||||
BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */,
|
|
||||||
BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */,
|
|
||||||
B343F884295F7C5D002B1159 /* utils.c in Sources */,
|
B343F884295F7C5D002B1159 /* utils.c in Sources */,
|
||||||
BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */,
|
BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */,
|
||||||
B343F87F295F7C5D002B1159 /* glue.c in Sources */,
|
B343F87F295F7C5D002B1159 /* glue.c in Sources */,
|
||||||
BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */,
|
|
||||||
BF4588242298D3AB00BD7491 /* property_list_service.c in Sources */,
|
BF4588242298D3AB00BD7491 /* property_list_service.c in Sources */,
|
||||||
BF45881E2298D3AB00BD7491 /* misagent.c in Sources */,
|
BF45881E2298D3AB00BD7491 /* misagent.c in Sources */,
|
||||||
|
0EA166692ADFE140003015C1 /* Array.cpp in Sources */,
|
||||||
B343F880295F7C5D002B1159 /* socket.c in Sources */,
|
B343F880295F7C5D002B1159 /* socket.c in Sources */,
|
||||||
BF4587FC2298D3AB00BD7491 /* sbservices.c in Sources */,
|
BF4587FC2298D3AB00BD7491 /* sbservices.c in Sources */,
|
||||||
BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */,
|
0EA166782ADFE140003015C1 /* jsmn.c in Sources */,
|
||||||
BF4588142298D3AB00BD7491 /* device_link_service.c in Sources */,
|
BF4588142298D3AB00BD7491 /* device_link_service.c in Sources */,
|
||||||
BF4588172298D3AB00BD7491 /* screenshotr.c in Sources */,
|
BF4588172298D3AB00BD7491 /* screenshotr.c in Sources */,
|
||||||
BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */,
|
|
||||||
BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */,
|
|
||||||
BF4588432298D40000BD7491 /* libusbmuxd.c in Sources */,
|
BF4588432298D40000BD7491 /* libusbmuxd.c in Sources */,
|
||||||
|
0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */,
|
||||||
|
0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */,
|
||||||
BF4588032298D3AB00BD7491 /* syslog_relay.c in Sources */,
|
BF4588032298D3AB00BD7491 /* syslog_relay.c in Sources */,
|
||||||
BF4588272298D3AB00BD7491 /* service.c in Sources */,
|
BF4588272298D3AB00BD7491 /* service.c in Sources */,
|
||||||
BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */,
|
|
||||||
BF4588262298D3AB00BD7491 /* lockdown.c in Sources */,
|
BF4588262298D3AB00BD7491 /* lockdown.c in Sources */,
|
||||||
BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */,
|
BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */,
|
||||||
BF45880C2298D3AB00BD7491 /* mobilebackup2.c in Sources */,
|
BF45880C2298D3AB00BD7491 /* mobilebackup2.c in Sources */,
|
||||||
BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */,
|
0EA4B9BC2AE4A414009209CE /* plist.c in Sources */,
|
||||||
);
|
);
|
||||||
runOnlyForDeploymentPostprocessing = 0;
|
runOnlyForDeploymentPostprocessing = 0;
|
||||||
};
|
};
|
||||||
@@ -2504,6 +2507,7 @@
|
|||||||
BFD6B03322DFF20800B86064 /* MyAppsComponents.swift in Sources */,
|
BFD6B03322DFF20800B86064 /* MyAppsComponents.swift in Sources */,
|
||||||
BF41B808233433C100C593A3 /* LoadingState.swift in Sources */,
|
BF41B808233433C100C593A3 /* LoadingState.swift in Sources */,
|
||||||
BFF0B69A2322D7D0007A79E1 /* UIScreen+CompactHeight.swift in Sources */,
|
BFF0B69A2322D7D0007A79E1 /* UIScreen+CompactHeight.swift in Sources */,
|
||||||
|
D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */,
|
||||||
D5F2F6A92720B7C20081CCF5 /* PatchViewController.swift in Sources */,
|
D5F2F6A92720B7C20081CCF5 /* PatchViewController.swift in Sources */,
|
||||||
B39F16132918D7C5002E9404 /* Consts.swift in Sources */,
|
B39F16132918D7C5002E9404 /* Consts.swift in Sources */,
|
||||||
BF8F69C222E659F700049BA1 /* AppContentViewController.swift in Sources */,
|
BF8F69C222E659F700049BA1 /* AppContentViewController.swift in Sources */,
|
||||||
@@ -3224,6 +3228,7 @@
|
|||||||
"$(PROJECT_DIR)/Dependencies/libfragmentzip",
|
"$(PROJECT_DIR)/Dependencies/libfragmentzip",
|
||||||
"$(PROJECT_DIR)/Dependencies/libcurl",
|
"$(PROJECT_DIR)/Dependencies/libcurl",
|
||||||
);
|
);
|
||||||
|
OTHER_LDFLAGS = "";
|
||||||
PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
|
PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
|
||||||
PRODUCT_NAME = "$(TARGET_NAME)";
|
PRODUCT_NAME = "$(TARGET_NAME)";
|
||||||
PROVISIONING_PROFILE_SPECIFIER = "";
|
PROVISIONING_PROFILE_SPECIFIER = "";
|
||||||
@@ -3258,6 +3263,7 @@
|
|||||||
"$(PROJECT_DIR)/Dependencies/libfragmentzip",
|
"$(PROJECT_DIR)/Dependencies/libfragmentzip",
|
||||||
"$(PROJECT_DIR)/Dependencies/libcurl",
|
"$(PROJECT_DIR)/Dependencies/libcurl",
|
||||||
);
|
);
|
||||||
|
OTHER_LDFLAGS = "";
|
||||||
PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
|
PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
|
||||||
PRODUCT_NAME = "$(TARGET_NAME)";
|
PRODUCT_NAME = "$(TARGET_NAME)";
|
||||||
PROVISIONING_PROFILE_SPECIFIER = "";
|
PROVISIONING_PROFILE_SPECIFIER = "";
|
||||||
|
|||||||
@@ -6,7 +6,7 @@
|
|||||||
"location" : "https://github.com/SideStore/AltSign",
|
"location" : "https://github.com/SideStore/AltSign",
|
||||||
"state" : {
|
"state" : {
|
||||||
"branch" : "master",
|
"branch" : "master",
|
||||||
"revision" : "602b1aded00b08e82a2ddb802b3cde6817ba7156"
|
"revision" : "cc6189f0f7cd8e5bd24943af9322e0ff9420e9f4"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
@@ -14,8 +14,8 @@
|
|||||||
"kind" : "remoteSourceControl",
|
"kind" : "remoteSourceControl",
|
||||||
"location" : "https://github.com/microsoft/appcenter-sdk-apple.git",
|
"location" : "https://github.com/microsoft/appcenter-sdk-apple.git",
|
||||||
"state" : {
|
"state" : {
|
||||||
"revision" : "8354a50fe01a7e54e196d3b5493b5ab53dd5866a",
|
"revision" : "b2dc99cfedead0bad4e6573d86c5228c89cff332",
|
||||||
"version" : "4.4.2"
|
"version" : "4.4.3"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
@@ -59,8 +59,8 @@
|
|||||||
"kind" : "remoteSourceControl",
|
"kind" : "remoteSourceControl",
|
||||||
"location" : "https://github.com/krzyzanowskim/OpenSSL",
|
"location" : "https://github.com/krzyzanowskim/OpenSSL",
|
||||||
"state" : {
|
"state" : {
|
||||||
"revision" : "0c70e4b7d22411a7fe3ff59b913d5b760b735ce1",
|
"revision" : "0faf71a188bcfdf0245cab42886b9b240ca71c52",
|
||||||
"version" : "1.1.2100"
|
"version" : "1.1.2200"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
@@ -68,8 +68,8 @@
|
|||||||
"kind" : "remoteSourceControl",
|
"kind" : "remoteSourceControl",
|
||||||
"location" : "https://github.com/microsoft/PLCrashReporter.git",
|
"location" : "https://github.com/microsoft/PLCrashReporter.git",
|
||||||
"state" : {
|
"state" : {
|
||||||
"revision" : "6b27393cad517c067dceea85fadf050e70c4ceaa",
|
"revision" : "81cdec2b3827feb03286cb297f4c501a8eb98df1",
|
||||||
"version" : "1.10.1"
|
"version" : "1.10.2"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
@@ -77,8 +77,8 @@
|
|||||||
"kind" : "remoteSourceControl",
|
"kind" : "remoteSourceControl",
|
||||||
"location" : "https://github.com/SwiftPackageIndex/SemanticVersion.git",
|
"location" : "https://github.com/SwiftPackageIndex/SemanticVersion.git",
|
||||||
"state" : {
|
"state" : {
|
||||||
"revision" : "fc670910dc0903cc269b3d0b776cda5703979c4e",
|
"revision" : "a70840d5fca686ae3bd2fcf8aecc5ded0bd4f125",
|
||||||
"version" : "0.3.5"
|
"version" : "0.3.6"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
@@ -86,8 +86,8 @@
|
|||||||
"kind" : "remoteSourceControl",
|
"kind" : "remoteSourceControl",
|
||||||
"location" : "https://github.com/sparkle-project/Sparkle.git",
|
"location" : "https://github.com/sparkle-project/Sparkle.git",
|
||||||
"state" : {
|
"state" : {
|
||||||
"revision" : "286edd1fa22505a9e54d170e9fd07d775ea233f2",
|
"revision" : "f0ceaf5cc9f3f23daa0ccb6dcebd79fc96ccc7d9",
|
||||||
"version" : "2.1.0"
|
"version" : "2.5.0"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
@@ -95,8 +95,8 @@
|
|||||||
"kind" : "remoteSourceControl",
|
"kind" : "remoteSourceControl",
|
||||||
"location" : "https://github.com/daltoniam/Starscream.git",
|
"location" : "https://github.com/daltoniam/Starscream.git",
|
||||||
"state" : {
|
"state" : {
|
||||||
"revision" : "df8d82047f6654d8e4b655d1b1525c64e1059d21",
|
"revision" : "ac6c0fc9da221873e01bd1a0d4818498a71eef33",
|
||||||
"version" : "4.0.4"
|
"version" : "4.0.6"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
|
|||||||
@@ -93,11 +93,18 @@ private extension AppIDsViewController
|
|||||||
|
|
||||||
let currentDate = Date()
|
let currentDate = Date()
|
||||||
|
|
||||||
let numberOfDays = expirationDate.numberOfCalendarDays(since: currentDate)
|
let formatter = DateComponentsFormatter()
|
||||||
let numberOfDaysText = (numberOfDays == 1) ? NSLocalizedString("1 day", comment: "") : String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
|
formatter.unitsStyle = .full
|
||||||
cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
|
formatter.includesApproximationPhrase = false
|
||||||
|
formatter.includesTimeRemainingPhrase = false
|
||||||
|
formatter.allowedUnits = [.minute, .hour, .day]
|
||||||
|
formatter.maximumUnitCount = 1
|
||||||
|
|
||||||
attributedAccessibilityLabel.mutableString.append(String(format: NSLocalizedString("Expires in %@.", comment: ""), numberOfDaysText) + " ")
|
cell.bannerView.button.setTitle((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")).uppercased(), for: .normal)
|
||||||
|
|
||||||
|
// formatter.includesTimeRemainingPhrase = true
|
||||||
|
|
||||||
|
// attributedAccessibilityLabel.mutableString.append((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " ")
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
|||||||
@@ -8,6 +8,7 @@
|
|||||||
|
|
||||||
import UIKit
|
import UIKit
|
||||||
|
|
||||||
|
import minimuxer
|
||||||
import AltStoreCore
|
import AltStoreCore
|
||||||
import Roxas
|
import Roxas
|
||||||
|
|
||||||
@@ -265,6 +266,12 @@ private extension BrowseViewController
|
|||||||
return
|
return
|
||||||
}
|
}
|
||||||
|
|
||||||
|
if !minimuxer.ready() {
|
||||||
|
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||||
|
toastView.show(in: self)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
_ = AppManager.shared.install(app, presentingViewController: self) { (result) in
|
_ = AppManager.shared.install(app, presentingViewController: self) { (result) in
|
||||||
DispatchQueue.main.async {
|
DispatchQueue.main.async {
|
||||||
switch result
|
switch result
|
||||||
|
|||||||
@@ -4,8 +4,8 @@
|
|||||||
<dict>
|
<dict>
|
||||||
<key>ALTAppGroups</key>
|
<key>ALTAppGroups</key>
|
||||||
<array>
|
<array>
|
||||||
<string>group.com.SideStore.SideStore</string>
|
|
||||||
<string>group.$(APP_GROUP_IDENTIFIER)</string>
|
<string>group.$(APP_GROUP_IDENTIFIER)</string>
|
||||||
|
<string>group.com.SideStore.SideStore</string>
|
||||||
</array>
|
</array>
|
||||||
<key>ALTDeviceID</key>
|
<key>ALTDeviceID</key>
|
||||||
<string>00008101-000129D63698001E</string>
|
<string>00008101-000129D63698001E</string>
|
||||||
|
|||||||
@@ -81,7 +81,7 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
|
|||||||
} else {
|
} else {
|
||||||
// Show an alert explaining the pairing file
|
// Show an alert explaining the pairing file
|
||||||
// Create new Alert
|
// Create new Alert
|
||||||
let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/install#pairing-process", preferredStyle: .alert)
|
let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/getting-started/#pairing-file", preferredStyle: .alert)
|
||||||
|
|
||||||
// Create OK button with action handler
|
// Create OK button with action handler
|
||||||
let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
|
let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
|
||||||
@@ -155,8 +155,13 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
|
|||||||
try! FileManager.default.removeItem(at: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)"))
|
try! FileManager.default.removeItem(at: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)"))
|
||||||
displayError("minimuxer failed to start, please restart SideStore. \((error as? LocalizedError)?.failureReason ?? "UNKNOWN ERROR!!!!!! REPORT TO GITHUB ISSUES!")")
|
displayError("minimuxer failed to start, please restart SideStore. \((error as? LocalizedError)?.failureReason ?? "UNKNOWN ERROR!!!!!! REPORT TO GITHUB ISSUES!")")
|
||||||
}
|
}
|
||||||
|
if #available(iOS 17, *) {
|
||||||
|
// TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
|
||||||
|
}
|
||||||
|
else {
|
||||||
start_auto_mounter(documentsDirectory)
|
start_auto_mounter(documentsDirectory)
|
||||||
}
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
extension LaunchViewController
|
extension LaunchViewController
|
||||||
|
|||||||
@@ -307,6 +307,16 @@ extension AppManager
|
|||||||
presentingViewController.present(alertController, animated: true, completion: nil)
|
presentingViewController.present(alertController, animated: true, completion: nil)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func clearAppCache(completion: @escaping (Result<Void, Error>) -> Void)
|
||||||
|
{
|
||||||
|
let clearAppCacheOperation = ClearAppCacheOperation()
|
||||||
|
clearAppCacheOperation.resultHandler = { result in
|
||||||
|
completion(result)
|
||||||
|
}
|
||||||
|
|
||||||
|
self.run([clearAppCacheOperation], context: nil)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
extension AppManager
|
extension AppManager
|
||||||
@@ -754,6 +764,12 @@ extension AppManager
|
|||||||
let progress = self.refreshProgress[app.bundleIdentifier]
|
let progress = self.refreshProgress[app.bundleIdentifier]
|
||||||
return progress
|
return progress
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
|
||||||
|
{
|
||||||
|
let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
|
||||||
|
return isActivelyManaging
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
extension AppManager
|
extension AppManager
|
||||||
@@ -808,12 +824,6 @@ private extension AppManager
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
|
|
||||||
{
|
|
||||||
let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
|
|
||||||
return isActivelyManaging
|
|
||||||
}
|
|
||||||
|
|
||||||
@discardableResult
|
@discardableResult
|
||||||
private func perform(_ operations: [AppOperation], presentingViewController: UIViewController?, group: RefreshGroup) -> RefreshGroup
|
private func perform(_ operations: [AppOperation], presentingViewController: UIViewController?, group: RefreshGroup) -> RefreshGroup
|
||||||
{
|
{
|
||||||
@@ -948,7 +958,13 @@ private extension AppManager
|
|||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
DispatchQueue.main.schedule {
|
||||||
|
UIApplication.shared.isIdleTimerDisabled = UserDefaults.standard.isIdleTimeoutDisableEnabled
|
||||||
|
}
|
||||||
performAppOperations()
|
performAppOperations()
|
||||||
|
DispatchQueue.main.schedule {
|
||||||
|
UIApplication.shared.isIdleTimerDisabled = false
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
return group
|
return group
|
||||||
@@ -1027,6 +1043,32 @@ private extension AppManager
|
|||||||
verifyOperation.addDependency(downloadOperation)
|
verifyOperation.addDependency(downloadOperation)
|
||||||
|
|
||||||
|
|
||||||
|
/* Refresh Anisette Data */
|
||||||
|
let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
|
||||||
|
refreshAnisetteDataOperation.resultHandler = { (result) in
|
||||||
|
switch result
|
||||||
|
{
|
||||||
|
case .failure(let error): context.error = error
|
||||||
|
case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
|
||||||
|
}
|
||||||
|
}
|
||||||
|
refreshAnisetteDataOperation.addDependency(verifyOperation)
|
||||||
|
|
||||||
|
|
||||||
|
/* Fetch Provisioning Profiles */
|
||||||
|
let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
|
||||||
|
fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
|
||||||
|
fetchProvisioningProfilesOperation.resultHandler = { (result) in
|
||||||
|
switch result
|
||||||
|
{
|
||||||
|
case .failure(let error): context.error = error
|
||||||
|
case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
|
||||||
|
}
|
||||||
|
}
|
||||||
|
fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
|
||||||
|
progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
|
||||||
|
|
||||||
|
|
||||||
/* Deactivate Apps (if necessary) */
|
/* Deactivate Apps (if necessary) */
|
||||||
let deactivateAppsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
|
let deactivateAppsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
|
||||||
do
|
do
|
||||||
@@ -1043,6 +1085,12 @@ private extension AppManager
|
|||||||
throw error
|
throw error
|
||||||
}
|
}
|
||||||
|
|
||||||
|
guard let profiles = context.provisioningProfiles else { throw OperationError.invalidParameters }
|
||||||
|
if !profiles.contains(where: { $1.isFreeProvisioningProfile == true }) {
|
||||||
|
operation.finish()
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
guard let app = context.app, let presentingViewController = context.authenticatedContext.presentingViewController else { throw OperationError.invalidParameters }
|
guard let app = context.app, let presentingViewController = context.authenticatedContext.presentingViewController else { throw OperationError.invalidParameters }
|
||||||
|
|
||||||
self?.deactivateApps(for: app, presentingViewController: presentingViewController) { result in
|
self?.deactivateApps(for: app, presentingViewController: presentingViewController) { result in
|
||||||
@@ -1061,7 +1109,7 @@ private extension AppManager
|
|||||||
operation.finish()
|
operation.finish()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
deactivateAppsOperation.addDependency(verifyOperation)
|
deactivateAppsOperation.addDependency(fetchProvisioningProfilesOperation)
|
||||||
|
|
||||||
|
|
||||||
/* Patch App */
|
/* Patch App */
|
||||||
@@ -1136,32 +1184,6 @@ private extension AppManager
|
|||||||
patchAppOperation.addDependency(deactivateAppsOperation)
|
patchAppOperation.addDependency(deactivateAppsOperation)
|
||||||
|
|
||||||
|
|
||||||
/* Refresh Anisette Data */
|
|
||||||
let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
|
|
||||||
refreshAnisetteDataOperation.resultHandler = { (result) in
|
|
||||||
switch result
|
|
||||||
{
|
|
||||||
case .failure(let error): context.error = error
|
|
||||||
case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
|
|
||||||
}
|
|
||||||
}
|
|
||||||
refreshAnisetteDataOperation.addDependency(patchAppOperation)
|
|
||||||
|
|
||||||
|
|
||||||
/* Fetch Provisioning Profiles */
|
|
||||||
let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
|
|
||||||
fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
|
|
||||||
fetchProvisioningProfilesOperation.resultHandler = { (result) in
|
|
||||||
switch result
|
|
||||||
{
|
|
||||||
case .failure(let error): context.error = error
|
|
||||||
case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
|
|
||||||
}
|
|
||||||
}
|
|
||||||
fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
|
|
||||||
progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
|
|
||||||
|
|
||||||
|
|
||||||
/* Resign */
|
/* Resign */
|
||||||
let resignAppOperation = ResignAppOperation(context: context)
|
let resignAppOperation = ResignAppOperation(context: context)
|
||||||
resignAppOperation.resultHandler = { (result) in
|
resignAppOperation.resultHandler = { (result) in
|
||||||
@@ -1171,7 +1193,7 @@ private extension AppManager
|
|||||||
case .success(let resignedApp): context.resignedApp = resignedApp
|
case .success(let resignedApp): context.resignedApp = resignedApp
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
resignAppOperation.addDependency(fetchProvisioningProfilesOperation)
|
resignAppOperation.addDependency(patchAppOperation)
|
||||||
progress.addChild(resignAppOperation.progress, withPendingUnitCount: 20)
|
progress.addChild(resignAppOperation.progress, withPendingUnitCount: 20)
|
||||||
|
|
||||||
|
|
||||||
@@ -1214,7 +1236,7 @@ private extension AppManager
|
|||||||
progress.addChild(installOperation.progress, withPendingUnitCount: 30)
|
progress.addChild(installOperation.progress, withPendingUnitCount: 30)
|
||||||
installOperation.addDependency(sendAppOperation)
|
installOperation.addDependency(sendAppOperation)
|
||||||
|
|
||||||
let operations = [downloadOperation, verifyOperation, deactivateAppsOperation, patchAppOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, resignAppOperation, sendAppOperation, installOperation]
|
let operations = [downloadOperation, verifyOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, deactivateAppsOperation, patchAppOperation, resignAppOperation, sendAppOperation, installOperation]
|
||||||
group.add(operations)
|
group.add(operations)
|
||||||
self.run(operations, context: group.context)
|
self.run(operations, context: group.context)
|
||||||
|
|
||||||
|
|||||||
@@ -15,6 +15,7 @@ import UniformTypeIdentifiers
|
|||||||
import AltStoreCore
|
import AltStoreCore
|
||||||
import AltSign
|
import AltSign
|
||||||
import Roxas
|
import Roxas
|
||||||
|
import minimuxer
|
||||||
|
|
||||||
import Nuke
|
import Nuke
|
||||||
|
|
||||||
@@ -328,21 +329,25 @@ private extension MyAppsViewController
|
|||||||
let currentDate = Date()
|
let currentDate = Date()
|
||||||
|
|
||||||
let numberOfDays = installedApp.expirationDate.numberOfCalendarDays(since: currentDate)
|
let numberOfDays = installedApp.expirationDate.numberOfCalendarDays(since: currentDate)
|
||||||
let numberOfDaysText: String
|
|
||||||
|
|
||||||
if numberOfDays == 1
|
let formatter = DateComponentsFormatter()
|
||||||
{
|
formatter.unitsStyle = .full
|
||||||
numberOfDaysText = NSLocalizedString("1 day", comment: "")
|
formatter.includesApproximationPhrase = false
|
||||||
}
|
formatter.includesTimeRemainingPhrase = false
|
||||||
else
|
|
||||||
{
|
formatter.allowedUnits = [.day, .hour, .minute]
|
||||||
numberOfDaysText = String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
|
|
||||||
}
|
formatter.maximumUnitCount = 1
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
cell.bannerView.button.setTitle(formatter.string(from: currentDate, to: installedApp.expirationDate)?.uppercased(), for: .normal)
|
||||||
|
|
||||||
cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
|
|
||||||
cell.bannerView.button.accessibilityLabel = String(format: NSLocalizedString("Refresh %@", comment: ""), installedApp.name)
|
cell.bannerView.button.accessibilityLabel = String(format: NSLocalizedString("Refresh %@", comment: ""), installedApp.name)
|
||||||
|
|
||||||
cell.bannerView.accessibilityLabel? += ". " + String(format: NSLocalizedString("Expires in %@", comment: ""), numberOfDaysText)
|
formatter.includesTimeRemainingPhrase = true
|
||||||
|
|
||||||
|
cell.bannerView.accessibilityLabel? += ". " + (formatter.string(from: currentDate, to: installedApp.expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " "
|
||||||
|
|
||||||
// Make sure refresh button is correct size.
|
// Make sure refresh button is correct size.
|
||||||
cell.layoutIfNeeded()
|
cell.layoutIfNeeded()
|
||||||
@@ -640,6 +645,12 @@ private extension MyAppsViewController
|
|||||||
|
|
||||||
@IBAction func refreshAllApps(_ sender: UIBarButtonItem)
|
@IBAction func refreshAllApps(_ sender: UIBarButtonItem)
|
||||||
{
|
{
|
||||||
|
if !minimuxer.ready() {
|
||||||
|
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||||
|
toastView.show(in: self)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
self.isRefreshingAllApps = true
|
self.isRefreshingAllApps = true
|
||||||
self.collectionView.collectionViewLayout.invalidateLayout()
|
self.collectionView.collectionViewLayout.invalidateLayout()
|
||||||
|
|
||||||
@@ -702,6 +713,12 @@ private extension MyAppsViewController
|
|||||||
|
|
||||||
@IBAction func sideloadApp(_ sender: UIBarButtonItem)
|
@IBAction func sideloadApp(_ sender: UIBarButtonItem)
|
||||||
{
|
{
|
||||||
|
if !minimuxer.ready() {
|
||||||
|
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||||
|
toastView.show(in: self)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
let supportedTypes = UTType.types(tag: "ipa", tagClass: .filenameExtension, conformingTo: nil)
|
let supportedTypes = UTType.types(tag: "ipa", tagClass: .filenameExtension, conformingTo: nil)
|
||||||
|
|
||||||
let documentPickerViewController = UIDocumentPickerViewController(forOpeningContentTypes: supportedTypes, asCopy: true)
|
let documentPickerViewController = UIDocumentPickerViewController(forOpeningContentTypes: supportedTypes, asCopy: true)
|
||||||
@@ -1006,6 +1023,12 @@ private extension MyAppsViewController
|
|||||||
|
|
||||||
func refresh(_ installedApp: InstalledApp)
|
func refresh(_ installedApp: InstalledApp)
|
||||||
{
|
{
|
||||||
|
if !minimuxer.ready() {
|
||||||
|
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||||
|
toastView.show(in: self)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
let previousProgress = AppManager.shared.refreshProgress(for: installedApp)
|
let previousProgress = AppManager.shared.refreshProgress(for: installedApp)
|
||||||
guard previousProgress == nil else {
|
guard previousProgress == nil else {
|
||||||
previousProgress?.cancel()
|
previousProgress?.cancel()
|
||||||
@@ -1027,6 +1050,12 @@ private extension MyAppsViewController
|
|||||||
|
|
||||||
func activate(_ installedApp: InstalledApp)
|
func activate(_ installedApp: InstalledApp)
|
||||||
{
|
{
|
||||||
|
if !minimuxer.ready() {
|
||||||
|
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||||
|
toastView.show(in: self)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
func finish(_ result: Result<InstalledApp, Error>)
|
func finish(_ result: Result<InstalledApp, Error>)
|
||||||
{
|
{
|
||||||
do
|
do
|
||||||
@@ -1103,6 +1132,11 @@ private extension MyAppsViewController
|
|||||||
func deactivate(_ installedApp: InstalledApp, completionHandler: ((Result<InstalledApp, Error>) -> Void)? = nil)
|
func deactivate(_ installedApp: InstalledApp, completionHandler: ((Result<InstalledApp, Error>) -> Void)? = nil)
|
||||||
{
|
{
|
||||||
guard installedApp.isActive else { return }
|
guard installedApp.isActive else { return }
|
||||||
|
if !minimuxer.ready() {
|
||||||
|
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||||
|
toastView.show(in: self)
|
||||||
|
return
|
||||||
|
}
|
||||||
installedApp.isActive = false
|
installedApp.isActive = false
|
||||||
|
|
||||||
AppManager.shared.deactivate(installedApp, presentingViewController: self) { (result) in
|
AppManager.shared.deactivate(installedApp, presentingViewController: self) { (result) in
|
||||||
@@ -1164,6 +1198,11 @@ private extension MyAppsViewController
|
|||||||
|
|
||||||
func backup(_ installedApp: InstalledApp)
|
func backup(_ installedApp: InstalledApp)
|
||||||
{
|
{
|
||||||
|
if !minimuxer.ready() {
|
||||||
|
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||||
|
toastView.show(in: self)
|
||||||
|
return
|
||||||
|
}
|
||||||
let title = NSLocalizedString("Start Backup?", comment: "")
|
let title = NSLocalizedString("Start Backup?", comment: "")
|
||||||
let message = NSLocalizedString("This will replace any previous backups. Please leave SideStore open until the backup is complete.", comment: "")
|
let message = NSLocalizedString("This will replace any previous backups. Please leave SideStore open until the backup is complete.", comment: "")
|
||||||
|
|
||||||
@@ -1203,6 +1242,11 @@ private extension MyAppsViewController
|
|||||||
|
|
||||||
func restore(_ installedApp: InstalledApp)
|
func restore(_ installedApp: InstalledApp)
|
||||||
{
|
{
|
||||||
|
if !minimuxer.ready() {
|
||||||
|
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||||
|
toastView.show(in: self)
|
||||||
|
return
|
||||||
|
}
|
||||||
let message = String(format: NSLocalizedString("This will replace all data you currently have in %@.", comment: ""), installedApp.name)
|
let message = String(format: NSLocalizedString("This will replace all data you currently have in %@.", comment: ""), installedApp.name)
|
||||||
let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to restore this backup?", comment: ""), message: message, preferredStyle: .actionSheet)
|
let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to restore this backup?", comment: ""), message: message, preferredStyle: .actionSheet)
|
||||||
alertController.addAction(.cancel)
|
alertController.addAction(.cancel)
|
||||||
@@ -1306,6 +1350,16 @@ private extension MyAppsViewController
|
|||||||
@available(iOS 14, *)
|
@available(iOS 14, *)
|
||||||
func enableJIT(for installedApp: InstalledApp)
|
func enableJIT(for installedApp: InstalledApp)
|
||||||
{
|
{
|
||||||
|
if #available(iOS 17, *) {
|
||||||
|
let toastView = ToastView(error: OperationError.tooNewError)
|
||||||
|
toastView.show(in: self)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
if !minimuxer.ready() {
|
||||||
|
let toastView = ToastView(error: MinimuxerError.NoConnection)
|
||||||
|
toastView.show(in: self)
|
||||||
|
return
|
||||||
|
}
|
||||||
AppManager.shared.enableJIT(for: installedApp) { result in
|
AppManager.shared.enableJIT(for: installedApp) { result in
|
||||||
DispatchQueue.main.async {
|
DispatchQueue.main.async {
|
||||||
switch result
|
switch result
|
||||||
@@ -1313,7 +1367,7 @@ private extension MyAppsViewController
|
|||||||
case .success: break
|
case .success: break
|
||||||
case .failure(let error):
|
case .failure(let error):
|
||||||
let toastView = ToastView(error: error)
|
let toastView = ToastView(error: error)
|
||||||
toastView.show(in: self)
|
toastView.show(in: self.navigationController?.view ?? self.view, duration: 5)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -1460,7 +1514,7 @@ extension MyAppsViewController
|
|||||||
let registeredAppIDs = team.appIDs.count
|
let registeredAppIDs = team.appIDs.count
|
||||||
|
|
||||||
let maximumAppIDCount = 10
|
let maximumAppIDCount = 10
|
||||||
let remainingAppIDs = max(maximumAppIDCount - registeredAppIDs, 0)
|
let remainingAppIDs = maximumAppIDCount - registeredAppIDs
|
||||||
|
|
||||||
if remainingAppIDs == 1
|
if remainingAppIDs == 1
|
||||||
{
|
{
|
||||||
@@ -1471,7 +1525,7 @@ extension MyAppsViewController
|
|||||||
footerView.textLabel.text = String(format: NSLocalizedString("%@ App IDs Remaining", comment: ""), NSNumber(value: remainingAppIDs))
|
footerView.textLabel.text = String(format: NSLocalizedString("%@ App IDs Remaining", comment: ""), NSNumber(value: remainingAppIDs))
|
||||||
}
|
}
|
||||||
|
|
||||||
footerView.textLabel.isHidden = false
|
footerView.textLabel.isHidden = remainingAppIDs < 0
|
||||||
|
|
||||||
case .individual, .organization, .unknown: footerView.textLabel.isHidden = true
|
case .individual, .organization, .unknown: footerView.textLabel.isHidden = true
|
||||||
@unknown default: break
|
@unknown default: break
|
||||||
|
|||||||
@@ -12,6 +12,7 @@ import Network
|
|||||||
|
|
||||||
import AltStoreCore
|
import AltStoreCore
|
||||||
import AltSign
|
import AltSign
|
||||||
|
import minimuxer
|
||||||
|
|
||||||
enum AuthenticationError: LocalizedError
|
enum AuthenticationError: LocalizedError
|
||||||
{
|
{
|
||||||
@@ -593,7 +594,7 @@ private extension AuthenticationOperation
|
|||||||
|
|
||||||
func registerCurrentDevice(for team: ALTTeam, session: ALTAppleAPISession, completionHandler: @escaping (Result<ALTDevice, Error>) -> Void)
|
func registerCurrentDevice(for team: ALTTeam, session: ALTAppleAPISession, completionHandler: @escaping (Result<ALTDevice, Error>) -> Void)
|
||||||
{
|
{
|
||||||
guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else {
|
guard let udid = fetch_udid()?.toString() else {
|
||||||
return completionHandler(.failure(OperationError.unknownUDID))
|
return completionHandler(.failure(OperationError.unknownUDID))
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -105,7 +105,12 @@ final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<Inst
|
|||||||
} catch {
|
} catch {
|
||||||
self.finish(.failure(error))
|
self.finish(.failure(error))
|
||||||
}
|
}
|
||||||
|
if #available(iOS 17, *) {
|
||||||
|
// TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
|
||||||
|
}
|
||||||
|
else {
|
||||||
start_auto_mounter(documentsDirectory)
|
start_auto_mounter(documentsDirectory)
|
||||||
|
}
|
||||||
|
|
||||||
self.managedObjectContext.perform {
|
self.managedObjectContext.perform {
|
||||||
print("Apps to refresh:", self.installedApps.map(\.bundleIdentifier))
|
print("Apps to refresh:", self.installedApps.map(\.bundleIdentifier))
|
||||||
|
|||||||
@@ -55,8 +55,7 @@ class BackupAppOperation: ResultOperation<Void>
|
|||||||
let appName = installedApp.name
|
let appName = installedApp.name
|
||||||
self.appName = appName
|
self.appName = appName
|
||||||
|
|
||||||
guard let altstoreApp = InstalledApp.fetchAltStore(in: context) else { throw OperationError.appNotFound }
|
let altstoreOpenURL = URL(string: "sidestore://")!
|
||||||
let altstoreOpenURL = altstoreApp.openAppURL
|
|
||||||
|
|
||||||
var returnURLComponents = URLComponents(url: altstoreOpenURL, resolvingAgainstBaseURL: false)
|
var returnURLComponents = URLComponents(url: altstoreOpenURL, resolvingAgainstBaseURL: false)
|
||||||
returnURLComponents?.host = "appBackupResponse"
|
returnURLComponents?.host = "appBackupResponse"
|
||||||
|
|||||||
208
AltStore/Operations/ClearAppCacheOperation.swift
Normal file
208
AltStore/Operations/ClearAppCacheOperation.swift
Normal file
@@ -0,0 +1,208 @@
|
|||||||
|
//
|
||||||
|
// ClearAppCacheOperation.swift
|
||||||
|
// AltStore
|
||||||
|
//
|
||||||
|
// Created by Riley Testut on 9/27/22.
|
||||||
|
// Copyright © 2022 Riley Testut. All rights reserved.
|
||||||
|
//
|
||||||
|
|
||||||
|
import Foundation
|
||||||
|
import AltStoreCore
|
||||||
|
/*
|
||||||
|
struct BatchError: ALTLocalizedError
|
||||||
|
{
|
||||||
|
|
||||||
|
enum Code: Int, ALTErrorCode
|
||||||
|
{
|
||||||
|
typealias Error = BatchError
|
||||||
|
|
||||||
|
case batchError
|
||||||
|
}
|
||||||
|
|
||||||
|
var code: Code = .batchError
|
||||||
|
var underlyingErrors: [Error]
|
||||||
|
|
||||||
|
var errorTitle: String?
|
||||||
|
var errorFailure: String?
|
||||||
|
|
||||||
|
init(errors: [Error])
|
||||||
|
{
|
||||||
|
self.underlyingErrors = errors
|
||||||
|
}
|
||||||
|
|
||||||
|
var errorFailureReason: String {
|
||||||
|
guard !self.underlyingErrors.isEmpty else { return NSLocalizedString("An unknown error occured.", comment: "") }
|
||||||
|
|
||||||
|
let errorMessages = self.underlyingErrors.map { $0.localizedDescription }
|
||||||
|
|
||||||
|
let message = errorMessages.joined(separator: "\n\n")
|
||||||
|
return message
|
||||||
|
}
|
||||||
|
}
|
||||||
|
*/
|
||||||
|
@objc(ClearAppCacheOperation)
|
||||||
|
class ClearAppCacheOperation: ResultOperation<Void>
|
||||||
|
{
|
||||||
|
private let coordinator = NSFileCoordinator()
|
||||||
|
private let coordinatorQueue = OperationQueue()
|
||||||
|
|
||||||
|
override init()
|
||||||
|
{
|
||||||
|
self.coordinatorQueue.name = "AltStore - ClearAppCacheOperation Queue"
|
||||||
|
}
|
||||||
|
|
||||||
|
override func main()
|
||||||
|
{
|
||||||
|
super.main()
|
||||||
|
|
||||||
|
var allErrors = [Error]()
|
||||||
|
|
||||||
|
self.clearTemporaryDirectory { result in
|
||||||
|
switch result
|
||||||
|
{
|
||||||
|
//case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
|
||||||
|
case .failure(let error): allErrors.append(error)
|
||||||
|
case .success: break
|
||||||
|
}
|
||||||
|
|
||||||
|
self.removeUninstalledAppBackupDirectories { result in
|
||||||
|
switch result
|
||||||
|
{
|
||||||
|
//case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
|
||||||
|
case .failure(let error): allErrors.append(error)
|
||||||
|
case .success: break
|
||||||
|
}
|
||||||
|
|
||||||
|
if allErrors.isEmpty
|
||||||
|
{
|
||||||
|
self.finish(.success(()))
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
self.finish(.failure(OperationError.cacheClearError(errors: allErrors.map({ error in
|
||||||
|
return error.localizedDescription
|
||||||
|
}))))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
private extension ClearAppCacheOperation
|
||||||
|
{
|
||||||
|
func clearTemporaryDirectory(completion: @escaping (Result<Void, Error>) -> Void)
|
||||||
|
{
|
||||||
|
let intent = NSFileAccessIntent.writingIntent(with: FileManager.default.temporaryDirectory, options: [.forDeleting])
|
||||||
|
self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
|
||||||
|
do
|
||||||
|
{
|
||||||
|
if let error
|
||||||
|
{
|
||||||
|
throw error
|
||||||
|
}
|
||||||
|
|
||||||
|
let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
|
||||||
|
includingPropertiesForKeys: [],
|
||||||
|
options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
|
||||||
|
var errors = [Error]()
|
||||||
|
|
||||||
|
for fileURL in fileURLs
|
||||||
|
{
|
||||||
|
do
|
||||||
|
{
|
||||||
|
print("[ALTLog] Removing item from temporary directory:", fileURL.lastPathComponent)
|
||||||
|
try FileManager.default.removeItem(at: fileURL)
|
||||||
|
}
|
||||||
|
catch
|
||||||
|
{
|
||||||
|
print("[ALTLog] Failed to remove \(fileURL.lastPathComponent) from temporary directory.", error)
|
||||||
|
errors.append(error)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if !errors.isEmpty
|
||||||
|
{
|
||||||
|
completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
|
||||||
|
return error.localizedDescription
|
||||||
|
}))))
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
completion(.success(()))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
catch
|
||||||
|
{
|
||||||
|
completion(.failure(error))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func removeUninstalledAppBackupDirectories(completion: @escaping (Result<Void, Error>) -> Void)
|
||||||
|
{
|
||||||
|
guard let backupsDirectory = FileManager.default.appBackupsDirectory else { return completion(.failure(OperationError.missingAppGroup)) }
|
||||||
|
|
||||||
|
DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
|
||||||
|
let installedAppBundleIDs = Set(InstalledApp.all(in: context).map { $0.bundleIdentifier })
|
||||||
|
|
||||||
|
let intent = NSFileAccessIntent.writingIntent(with: backupsDirectory, options: [.forDeleting])
|
||||||
|
self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
|
||||||
|
do
|
||||||
|
{
|
||||||
|
if let error
|
||||||
|
{
|
||||||
|
throw error
|
||||||
|
}
|
||||||
|
|
||||||
|
var isDirectory: ObjCBool = false
|
||||||
|
guard FileManager.default.fileExists(atPath: intent.url.path, isDirectory: &isDirectory), isDirectory.boolValue else {
|
||||||
|
completion(.success(()))
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
|
let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
|
||||||
|
includingPropertiesForKeys: [.isDirectoryKey, .nameKey],
|
||||||
|
options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
|
||||||
|
var errors = [Error]()
|
||||||
|
|
||||||
|
|
||||||
|
for backupDirectory in fileURLs
|
||||||
|
{
|
||||||
|
do
|
||||||
|
{
|
||||||
|
let resourceValues = try backupDirectory.resourceValues(forKeys: [.isDirectoryKey, .nameKey])
|
||||||
|
guard let isDirectory = resourceValues.isDirectory, let bundleID = resourceValues.name else { continue }
|
||||||
|
|
||||||
|
if isDirectory && !installedAppBundleIDs.contains(bundleID) && !AppManager.shared.isActivelyManagingApp(withBundleID: bundleID)
|
||||||
|
{
|
||||||
|
print("[ALTLog] Removing backup directory for uninstalled app:", bundleID)
|
||||||
|
try FileManager.default.removeItem(at: backupDirectory)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
catch
|
||||||
|
{
|
||||||
|
print("[ALTLog] Failed to remove app backup directory:", error)
|
||||||
|
errors.append(error)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if !errors.isEmpty
|
||||||
|
{
|
||||||
|
completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
|
||||||
|
return error.localizedDescription
|
||||||
|
}))))
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
completion(.success(()))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
catch
|
||||||
|
{
|
||||||
|
print("[ALTLog] Failed to remove app backup directory:", error)
|
||||||
|
completion(.failure(error))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -39,9 +39,6 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
|
|||||||
let allIdentifiers = [installedApp.resignedBundleIdentifier] + appExtensionProfiles
|
let allIdentifiers = [installedApp.resignedBundleIdentifier] + appExtensionProfiles
|
||||||
|
|
||||||
for profile in allIdentifiers {
|
for profile in allIdentifiers {
|
||||||
var attempts = 5
|
|
||||||
while (attempts > 0){
|
|
||||||
print("Remove Provisioning profile attempts left: \(attempts)")
|
|
||||||
do {
|
do {
|
||||||
try remove_provisioning_profile(profile)
|
try remove_provisioning_profile(profile)
|
||||||
self.progress.completedUnitCount += 1
|
self.progress.completedUnitCount += 1
|
||||||
@@ -49,13 +46,9 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
|
|||||||
self.finish(.success(installedApp))
|
self.finish(.success(installedApp))
|
||||||
break
|
break
|
||||||
} catch {
|
} catch {
|
||||||
attempts -= 1
|
|
||||||
if (attempts <= 0){
|
|
||||||
self.finish(.failure(error))
|
self.finish(.failure(error))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -50,7 +50,7 @@ final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
|
|||||||
do {
|
do {
|
||||||
try debug_app(installedApp.resignedBundleIdentifier)
|
try debug_app(installedApp.resignedBundleIdentifier)
|
||||||
self.finish(.success(()))
|
self.finish(.success(()))
|
||||||
break
|
retries = 0
|
||||||
} catch {
|
} catch {
|
||||||
retries -= 1
|
retries -= 1
|
||||||
if (retries <= 0){
|
if (retries <= 0){
|
||||||
|
|||||||
@@ -218,7 +218,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
|
|||||||
self.socket.connect()
|
self.socket.connect()
|
||||||
}
|
}
|
||||||
|
|
||||||
func didReceive(event: WebSocketEvent, client: WebSocket) {
|
func didReceive(event: WebSocketEvent, client: WebSocketClient) {
|
||||||
switch event {
|
switch event {
|
||||||
case .text(let string):
|
case .text(let string):
|
||||||
do {
|
do {
|
||||||
@@ -429,7 +429,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
extension WebSocket {
|
extension WebSocketClient {
|
||||||
func json(_ dictionary: [String: String]) {
|
func json(_ dictionary: [String: String]) {
|
||||||
let data = try! JSONSerialization.data(withJSONObject: dictionary, options: [])
|
let data = try! JSONSerialization.data(withJSONObject: dictionary, options: [])
|
||||||
self.write(string: String(data: data, encoding: .utf8)!)
|
self.write(string: String(data: data, encoding: .utf8)!)
|
||||||
|
|||||||
@@ -262,10 +262,6 @@ extension FetchProvisioningProfilesOperation
|
|||||||
{
|
{
|
||||||
throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
|
throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
|
||||||
}
|
}
|
||||||
else
|
|
||||||
{
|
|
||||||
throw ALTAppleAPIError(.maximumAppIDLimitReached)
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
//App ID name must be ascii. If the name is not ascii, using bundleID instead
|
//App ID name must be ascii. If the name is not ascii, using bundleID instead
|
||||||
|
|||||||
@@ -41,12 +41,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
|
|||||||
|
|
||||||
guard
|
guard
|
||||||
let certificate = self.context.certificate,
|
let certificate = self.context.certificate,
|
||||||
let resignedApp = self.context.resignedApp
|
let resignedApp = self.context.resignedApp,
|
||||||
|
let provisioningProfiles = self.context.provisioningProfiles
|
||||||
else { return self.finish(.failure(OperationError.invalidParameters)) }
|
else { return self.finish(.failure(OperationError.invalidParameters)) }
|
||||||
|
|
||||||
let backgroundContext = DatabaseManager.shared.persistentContainer.newBackgroundContext()
|
let backgroundContext = DatabaseManager.shared.persistentContainer.newBackgroundContext()
|
||||||
backgroundContext.perform {
|
backgroundContext.perform {
|
||||||
|
|
||||||
|
|
||||||
/* App */
|
/* App */
|
||||||
let installedApp: InstalledApp
|
let installedApp: InstalledApp
|
||||||
|
|
||||||
@@ -116,8 +118,7 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
|
|||||||
// Temporary directory and resigned .ipa no longer needed, so delete them now to ensure AltStore doesn't quit before we get the chance to.
|
// Temporary directory and resigned .ipa no longer needed, so delete them now to ensure AltStore doesn't quit before we get the chance to.
|
||||||
self.cleanUp()
|
self.cleanUp()
|
||||||
|
|
||||||
var activeProfiles: Set<String>?
|
if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit, provisioningProfiles.contains(where: { $1.isFreeProvisioningProfile == true })
|
||||||
if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit
|
|
||||||
{
|
{
|
||||||
// When installing these new profiles, AltServer will remove all non-active profiles to ensure we remain under limit.
|
// When installing these new profiles, AltServer will remove all non-active profiles to ensure we remain under limit.
|
||||||
|
|
||||||
@@ -142,11 +143,10 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
|
|||||||
installedApp.isActive = false
|
installedApp.isActive = false
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
}
|
||||||
activeProfiles = Set(activeApps.flatMap { (installedApp) -> [String] in
|
else
|
||||||
let appExtensionProfiles = installedApp.appExtensions.map { $0.resignedBundleIdentifier }
|
{
|
||||||
return [installedApp.resignedBundleIdentifier] + appExtensionProfiles
|
installedApp.isActive = true
|
||||||
})
|
|
||||||
}
|
}
|
||||||
|
|
||||||
var installing = true
|
var installing = true
|
||||||
@@ -169,14 +169,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
|
|||||||
|
|
||||||
let content = UNMutableNotificationContent()
|
let content = UNMutableNotificationContent()
|
||||||
content.title = "Refreshing..."
|
content.title = "Refreshing..."
|
||||||
content.body = "To finish refreshing SideStore must go to the home screen. Please reopen after!"
|
content.body = "SideStore will automatically move to the homescreen to finish refreshing!"
|
||||||
let notification = UNNotificationRequest(identifier: Bundle.Info.appbundleIdentifier + ".FinishRefreshNotification", content: content, trigger: UNTimeIntervalNotificationTrigger(timeInterval: 2, repeats: false))
|
let notification = UNNotificationRequest(identifier: Bundle.Info.appbundleIdentifier + ".FinishRefreshNotification", content: content, trigger: UNTimeIntervalNotificationTrigger(timeInterval: 2, repeats: false))
|
||||||
UNUserNotificationCenter.current().add(notification)
|
UNUserNotificationCenter.current().add(notification)
|
||||||
break
|
break
|
||||||
default:
|
default:
|
||||||
print("Notifications are not enabled")
|
print("Notifications are not enabled")
|
||||||
|
|
||||||
let alert = UIAlertController(title: "Finish Refresh", message: "To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen manually or by hitting Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
|
let alert = UIAlertController(title: "Finish Refresh", message: "Please reopen SideStore after the process is finished.To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen manually or by hitting Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
|
||||||
alert.addAction(UIAlertAction(title: NSLocalizedString("Continue", comment: ""), style: .default, handler: { _ in
|
alert.addAction(UIAlertAction(title: NSLocalizedString("Continue", comment: ""), style: .default, handler: { _ in
|
||||||
print("Going home")
|
print("Going home")
|
||||||
UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
|
UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
|
||||||
@@ -198,22 +198,15 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
|
|||||||
UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
|
UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
var attempts = 10
|
|
||||||
while (attempts != 0){
|
|
||||||
print("Install ipa attempts left: \(attempts)")
|
|
||||||
do {
|
do {
|
||||||
try install_ipa(installedApp.bundleIdentifier)
|
try install_ipa(installedApp.bundleIdentifier)
|
||||||
installing = false
|
installing = false
|
||||||
installedApp.refreshedDate = Date()
|
installedApp.refreshedDate = Date()
|
||||||
self.finish(.success(installedApp))
|
self.finish(.success(installedApp))
|
||||||
break
|
} catch let error {
|
||||||
} catch {
|
|
||||||
attempts -= 1
|
|
||||||
if (attempts <= 0){
|
|
||||||
installing = false
|
installing = false
|
||||||
self.finish(.failure(MinimuxerError.InstallApp))
|
self.finish(.failure(error))
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -34,10 +34,14 @@ enum OperationError: LocalizedError
|
|||||||
case openAppFailed(name: String)
|
case openAppFailed(name: String)
|
||||||
case missingAppGroup
|
case missingAppGroup
|
||||||
|
|
||||||
|
case noWiFi
|
||||||
|
case tooNewError
|
||||||
case anisetteV1Error(message: String)
|
case anisetteV1Error(message: String)
|
||||||
case provisioningError(result: String, message: String?)
|
case provisioningError(result: String, message: String?)
|
||||||
case anisetteV3Error(message: String)
|
case anisetteV3Error(message: String)
|
||||||
|
|
||||||
|
case cacheClearError(errors: [String])
|
||||||
|
|
||||||
var failureReason: String? {
|
var failureReason: String? {
|
||||||
switch self {
|
switch self {
|
||||||
case .unknown: return NSLocalizedString("An unknown error occured.", comment: "")
|
case .unknown: return NSLocalizedString("An unknown error occured.", comment: "")
|
||||||
@@ -53,9 +57,12 @@ enum OperationError: LocalizedError
|
|||||||
case .openAppFailed(let name): return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), name)
|
case .openAppFailed(let name): return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), name)
|
||||||
case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be found.", comment: "")
|
case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be found.", comment: "")
|
||||||
case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs.", comment: "")
|
case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs.", comment: "")
|
||||||
|
case .noWiFi: return NSLocalizedString("You do not appear to be connected to WiFi!\nSideStore will never be able to install or refresh applications without WiFi.", comment: "")
|
||||||
|
case .tooNewError: return NSLocalizedString("iOS 17 has changed how JIT is enabled therefore SideStore cannot enable it at this time, sorry for any inconvenience.\nWe will let everyone know once we have a solution!", comment: "")
|
||||||
case .anisetteV1Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: ""), message)
|
case .anisetteV1Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: ""), message)
|
||||||
case .provisioningError(let result, let message): return String(format: NSLocalizedString("An error occurred when provisioning: %@%@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), result, message != nil ? (" (" + message! + ")") : "")
|
case .provisioningError(let result, let message): return String(format: NSLocalizedString("An error occurred when provisioning: %@%@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), result, message != nil ? (" (" + message! + ")") : "")
|
||||||
case .anisetteV3Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), message)
|
case .anisetteV3Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), message)
|
||||||
|
case .cacheClearError(let errors): return String(format: NSLocalizedString("An error occurred while clearing cache: %@", comment: ""), errors.joined(separator: "\n"))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -138,8 +145,8 @@ extension MinimuxerError: LocalizedError {
|
|||||||
return self.createService(name: "AFC")
|
return self.createService(name: "AFC")
|
||||||
case .RwAfc:
|
case .RwAfc:
|
||||||
return NSLocalizedString("AFC was unable to manage files on the device", comment: "")
|
return NSLocalizedString("AFC was unable to manage files on the device", comment: "")
|
||||||
case .InstallApp:
|
case .InstallApp(let message):
|
||||||
return NSLocalizedString("Unable to install the app from the staging directory", comment: "")
|
return NSLocalizedString("Unable to install the app: \(message.toString())", comment: "")
|
||||||
case .UninstallApp:
|
case .UninstallApp:
|
||||||
return NSLocalizedString("Unable to uninstall the app", comment: "")
|
return NSLocalizedString("Unable to uninstall the app", comment: "")
|
||||||
|
|
||||||
|
|||||||
@@ -41,20 +41,12 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
|
|||||||
guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
|
guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
|
||||||
|
|
||||||
for p in profiles {
|
for p in profiles {
|
||||||
var attempts = 5
|
|
||||||
while (attempts > 0){
|
|
||||||
print("Install provisioning profile attempts left: \(attempts)")
|
|
||||||
do {
|
do {
|
||||||
let bytes = p.value.data.toRustByteSlice()
|
let bytes = p.value.data.toRustByteSlice()
|
||||||
try install_provisioning_profile(bytes.forRust())
|
try install_provisioning_profile(bytes.forRust())
|
||||||
break
|
|
||||||
} catch {
|
} catch {
|
||||||
attempts -= 1
|
|
||||||
if (attempts <= 0) {
|
|
||||||
self.finish(.failure(MinimuxerError.ProfileInstall))
|
self.finish(.failure(MinimuxerError.ProfileInstall))
|
||||||
}
|
}
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
|
DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
|
||||||
print("Sending refresh app request...")
|
print("Sending refresh app request...")
|
||||||
|
|||||||
@@ -11,6 +11,7 @@ import Roxas
|
|||||||
|
|
||||||
import AltStoreCore
|
import AltStoreCore
|
||||||
import AltSign
|
import AltSign
|
||||||
|
import minimuxer
|
||||||
|
|
||||||
@objc(ResignAppOperation)
|
@objc(ResignAppOperation)
|
||||||
final class ResignAppOperation: ResultOperation<ALTApplication>
|
final class ResignAppOperation: ResultOperation<ALTApplication>
|
||||||
@@ -181,7 +182,7 @@ private extension ResignAppOperation
|
|||||||
|
|
||||||
if app.isAltStoreApp
|
if app.isAltStoreApp
|
||||||
{
|
{
|
||||||
guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else { throw OperationError.unknownUDID }
|
guard let udid = fetch_udid()?.toString() as? String else { throw OperationError.unknownUDID }
|
||||||
guard let pairingFileString = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.devicePairingString) as? String else { throw OperationError.unknownUDID }
|
guard let pairingFileString = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.devicePairingString) as? String else { throw OperationError.unknownUDID }
|
||||||
additionalValues[Bundle.Info.devicePairingString] = pairingFileString
|
additionalValues[Bundle.Info.devicePairingString] = pairingFileString
|
||||||
additionalValues[Bundle.Info.deviceID] = udid
|
additionalValues[Bundle.Info.deviceID] = udid
|
||||||
@@ -202,7 +203,7 @@ private extension ResignAppOperation
|
|||||||
// The embedded certificate + certificate identifier are already in app bundle, no need to update them.
|
// The embedded certificate + certificate identifier are already in app bundle, no need to update them.
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String
|
else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = fetch_udid()?.toString() as? String
|
||||||
{
|
{
|
||||||
// There is an ALTDeviceID entry, so assume the app is using AltKit and replace it with the device's UDID.
|
// There is an ALTDeviceID entry, so assume the app is using AltKit and replace it with the device's UDID.
|
||||||
additionalValues[Bundle.Info.deviceID] = udid
|
additionalValues[Bundle.Info.deviceID] = udid
|
||||||
|
|||||||
@@ -45,21 +45,13 @@ final class SendAppOperation: ResultOperation<()>
|
|||||||
print("AFC App `fileURL`: \(fileURL.absoluteString)")
|
print("AFC App `fileURL`: \(fileURL.absoluteString)")
|
||||||
|
|
||||||
if let data = NSData(contentsOf: fileURL) {
|
if let data = NSData(contentsOf: fileURL) {
|
||||||
var attempts = 10
|
|
||||||
while (attempts != 0){
|
|
||||||
print("Send app attempts left: \(attempts)")
|
|
||||||
do {
|
do {
|
||||||
let bytes = Data(data).toRustByteSlice()
|
let bytes = Data(data).toRustByteSlice()
|
||||||
try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
|
try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
|
||||||
self.progress.completedUnitCount += 1
|
self.progress.completedUnitCount += 1
|
||||||
self.finish(.success(()))
|
self.finish(.success(()))
|
||||||
break
|
|
||||||
} catch {
|
} catch {
|
||||||
attempts -= 1
|
|
||||||
if (attempts <= 0) {
|
|
||||||
self.finish(.failure(MinimuxerError.RwAfc))
|
self.finish(.failure(MinimuxerError.RwAfc))
|
||||||
}
|
|
||||||
}
|
|
||||||
self.progress.completedUnitCount += 1
|
self.progress.completedUnitCount += 1
|
||||||
self.finish(.success(()))
|
self.finish(.success(()))
|
||||||
}
|
}
|
||||||
|
|||||||
Binary file not shown.
@@ -21,7 +21,7 @@
|
|||||||
<color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
<color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||||
<color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
<color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||||
<label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
|
<label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
|
||||||
<rect key="frame" x="0.0" y="1126" width="375" height="25"/>
|
<rect key="frame" x="0.0" y="1245" width="375" height="25"/>
|
||||||
<autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
|
<autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
|
||||||
<fontDescription key="fontDescription" type="system" pointSize="17"/>
|
<fontDescription key="fontDescription" type="system" pointSize="17"/>
|
||||||
<color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
<color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||||
@@ -236,14 +236,50 @@
|
|||||||
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="NO"/>
|
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="NO"/>
|
||||||
</userDefinedRuntimeAttributes>
|
</userDefinedRuntimeAttributes>
|
||||||
</tableViewCell>
|
</tableViewCell>
|
||||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="GYp-O0-pse" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
<rect key="frame" x="0.0" y="444" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="444" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="GYp-O0-pse" id="vDG-ZV-xRS">
|
||||||
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
|
<subviews>
|
||||||
|
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Disable Idle Timeout" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PCh-Up-aJJ">
|
||||||
|
<rect key="frame" x="30" y="15.5" width="166" height="20.5"/>
|
||||||
|
<fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
|
||||||
|
<color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||||
|
<nil key="highlightedColor"/>
|
||||||
|
</label>
|
||||||
|
<switch opaque="NO" contentMode="scaleToFill" horizontalHuggingPriority="750" verticalHuggingPriority="750" contentHorizontalAlignment="center" contentVerticalAlignment="center" on="YES" translatesAutoresizingMaskIntoConstraints="NO" id="iQA-wm-5ag">
|
||||||
|
<rect key="frame" x="296" y="10" width="51" height="31"/>
|
||||||
|
<connections>
|
||||||
|
<action selector="toggleNoIdleTimeoutEnabled:" destination="aMk-Xp-UL8" eventType="valueChanged" id="WSl-Jc-g5J"/>
|
||||||
|
</connections>
|
||||||
|
</switch>
|
||||||
|
</subviews>
|
||||||
|
<constraints>
|
||||||
|
<constraint firstAttribute="trailingMargin" secondItem="iQA-wm-5ag" secondAttribute="trailing" id="MJ1-HF-Dln"/>
|
||||||
|
<constraint firstItem="PCh-Up-aJJ" firstAttribute="leading" secondItem="vDG-ZV-xRS" secondAttribute="leadingMargin" id="Ocu-jn-RAQ"/>
|
||||||
|
<constraint firstItem="iQA-wm-5ag" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="c6W-bN-VAb"/>
|
||||||
|
<constraint firstItem="PCh-Up-aJJ" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="mL6-LB-cjn"/>
|
||||||
|
</constraints>
|
||||||
|
</tableViewCellContentView>
|
||||||
|
<color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||||
|
<edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
|
||||||
|
<userDefinedRuntimeAttributes>
|
||||||
|
<userDefinedRuntimeAttribute type="number" keyPath="style">
|
||||||
|
<integer key="value" value="2"/>
|
||||||
|
</userDefinedRuntimeAttribute>
|
||||||
|
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
|
||||||
|
</userDefinedRuntimeAttributes>
|
||||||
|
</tableViewCell>
|
||||||
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
|
<rect key="frame" x="0.0" y="495" width="375" height="51"/>
|
||||||
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="amC-sE-8O0" id="GEO-2e-E4k">
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="amC-sE-8O0" id="GEO-2e-E4k">
|
||||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<subviews>
|
<subviews>
|
||||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Add to Siri…" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="c6K-fI-CVr">
|
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Allow Siri To Refresh Apps…" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="c6K-fI-CVr">
|
||||||
<rect key="frame" x="30" y="15.5" width="100.5" height="20.5"/>
|
<rect key="frame" x="30" y="15.5" width="100.5" height="20.5"/>
|
||||||
<fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
|
<fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
|
||||||
<color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
<color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||||
@@ -269,7 +305,7 @@
|
|||||||
<tableViewSection headerTitle="" id="eHy-qI-w5w">
|
<tableViewSection headerTitle="" id="eHy-qI-w5w">
|
||||||
<cells>
|
<cells>
|
||||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="30h-59-88f" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="30h-59-88f" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
<rect key="frame" x="0.0" y="535" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="586" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="30h-59-88f" id="7qD-DW-Jls">
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="30h-59-88f" id="7qD-DW-Jls">
|
||||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
@@ -309,7 +345,7 @@
|
|||||||
<tableViewSection headerTitle="" id="J90-vn-u2O">
|
<tableViewSection headerTitle="" id="J90-vn-u2O">
|
||||||
<cells>
|
<cells>
|
||||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="i4T-2q-jF3" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="i4T-2q-jF3" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
<rect key="frame" x="0.0" y="626" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="677" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="i4T-2q-jF3" id="VTQ-H4-aCM">
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="i4T-2q-jF3" id="VTQ-H4-aCM">
|
||||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
@@ -353,28 +389,28 @@
|
|||||||
</userDefinedRuntimeAttributes>
|
</userDefinedRuntimeAttributes>
|
||||||
</tableViewCell>
|
</tableViewCell>
|
||||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="oHX-oR-nwJ" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="oHX-oR-nwJ" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
<rect key="frame" x="0.0" y="677" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="728" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="oHX-oR-nwJ" id="hN4-i5-igu">
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="oHX-oR-nwJ" id="hN4-i5-igu">
|
||||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<subviews>
|
<subviews>
|
||||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
|
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
|
||||||
<rect key="frame" x="30" y="15.5" width="89" height="20.5"/>
|
<rect key="frame" x="30" y="15.5" width="89" height="20.5"/>
|
||||||
<fontDescription key="fontDescription" type="system" pointSize="17"/>
|
<fontDescription key="fontDescription" type="system" pointSize="17"/>
|
||||||
<color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
<color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||||
<nil key="highlightedColor"/>
|
<nil key="highlightedColor"/>
|
||||||
</label>
|
</label>
|
||||||
<stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
|
<stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
|
||||||
<rect key="frame" x="198" y="15.5" width="147" height="20.5"/>
|
<rect key="frame" x="198" y="15.5" width="147" height="20.5"/>
|
||||||
<subviews>
|
<subviews>
|
||||||
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
|
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
|
||||||
<rect key="frame" x="0.0" y="0.0" width="115" height="20.5"/>
|
<rect key="frame" x="0.0" y="0.0" width="115" height="20.5"/>
|
||||||
<fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
|
<fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
|
||||||
<color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
<color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||||
<nil key="highlightedColor"/>
|
<nil key="highlightedColor"/>
|
||||||
</label>
|
</label>
|
||||||
<imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
|
<imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
|
||||||
<rect key="frame" x="129" y="0.0" width="18" height="20.5"/>
|
<rect key="frame" x="129" y="0.0" width="18" height="20.5"/>
|
||||||
</imageView>
|
</imageView>
|
||||||
</subviews>
|
</subviews>
|
||||||
@@ -397,7 +433,7 @@
|
|||||||
</userDefinedRuntimeAttributes>
|
</userDefinedRuntimeAttributes>
|
||||||
</tableViewCell>
|
</tableViewCell>
|
||||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="0MT-ht-Sit" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="0MT-ht-Sit" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
<rect key="frame" x="0.0" y="728" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="779" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="0MT-ht-Sit" id="OZp-WM-5H7">
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="0MT-ht-Sit" id="OZp-WM-5H7">
|
||||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
@@ -441,7 +477,7 @@
|
|||||||
</userDefinedRuntimeAttributes>
|
</userDefinedRuntimeAttributes>
|
||||||
</tableViewCell>
|
</tableViewCell>
|
||||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="O5R-Al-lGj" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="O5R-Al-lGj" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
<rect key="frame" x="0.0" y="779" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="830" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="O5R-Al-lGj" id="CrG-Mr-xQq">
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="O5R-Al-lGj" id="CrG-Mr-xQq">
|
||||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
@@ -481,7 +517,7 @@
|
|||||||
<tableViewSection headerTitle="" id="OMa-EK-hRI">
|
<tableViewSection headerTitle="" id="OMa-EK-hRI">
|
||||||
<cells>
|
<cells>
|
||||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="FMZ-as-Ljo" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="FMZ-as-Ljo" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
<rect key="frame" x="0.0" y="870" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="921" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="FMZ-as-Ljo" id="JzL-Of-A3T">
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="FMZ-as-Ljo" id="JzL-Of-A3T">
|
||||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
@@ -514,7 +550,7 @@
|
|||||||
</userDefinedRuntimeAttributes>
|
</userDefinedRuntimeAttributes>
|
||||||
</tableViewCell>
|
</tableViewCell>
|
||||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="Qca-pU-sJh" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="Qca-pU-sJh" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
<rect key="frame" x="0.0" y="921" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="972" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="Qca-pU-sJh" id="QtU-8J-VQN">
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="Qca-pU-sJh" id="QtU-8J-VQN">
|
||||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
@@ -550,7 +586,7 @@
|
|||||||
</connections>
|
</connections>
|
||||||
</tableViewCell>
|
</tableViewCell>
|
||||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="rE2-P4-OaE" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="rE2-P4-OaE" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
<rect key="frame" x="0.0" y="972" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="1023" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="rE2-P4-OaE" id="qIT-rz-ZUb">
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="rE2-P4-OaE" id="qIT-rz-ZUb">
|
||||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
@@ -582,12 +618,45 @@
|
|||||||
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
|
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
|
||||||
</userDefinedRuntimeAttributes>
|
</userDefinedRuntimeAttributes>
|
||||||
<connections>
|
<connections>
|
||||||
<segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="SSW-vL-86I"/>
|
<segue destination="g8a-Rf-zWa" kind="show" id="vFC-Id-Ww6"/>
|
||||||
</connections>
|
</connections>
|
||||||
</tableViewCell>
|
</tableViewCell>
|
||||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="eZ3-BT-q4D" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
<rect key="frame" x="0.0" y="1023" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="1023" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="eZ3-BT-q4D" id="17m-VV-hzf">
|
||||||
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
|
<subviews>
|
||||||
|
<label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Clear Cache" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="IbH-V1-ce3">
|
||||||
|
<rect key="frame" x="30" y="15.5" width="98.5" height="20.5"/>
|
||||||
|
<fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
|
||||||
|
<color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||||
|
<nil key="highlightedColor"/>
|
||||||
|
</label>
|
||||||
|
<imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="FZe-BJ-fOm">
|
||||||
|
<rect key="frame" x="327" y="16.5" width="18" height="18"/>
|
||||||
|
</imageView>
|
||||||
|
</subviews>
|
||||||
|
<constraints>
|
||||||
|
<constraint firstItem="FZe-BJ-fOm" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="bGv-Np-5aO"/>
|
||||||
|
<constraint firstAttribute="trailingMargin" secondItem="FZe-BJ-fOm" secondAttribute="trailing" id="ccb-JP-Eqi"/>
|
||||||
|
<constraint firstItem="IbH-V1-ce3" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="iQJ-gN-sRF"/>
|
||||||
|
<constraint firstItem="IbH-V1-ce3" firstAttribute="leading" secondItem="17m-VV-hzf" secondAttribute="leadingMargin" id="m1g-Y6-aT5"/>
|
||||||
|
</constraints>
|
||||||
|
</tableViewCellContentView>
|
||||||
|
<color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||||
|
<edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
|
||||||
|
<userDefinedRuntimeAttributes>
|
||||||
|
<userDefinedRuntimeAttribute type="number" keyPath="style">
|
||||||
|
<integer key="value" value="2"/>
|
||||||
|
</userDefinedRuntimeAttribute>
|
||||||
|
<userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
|
||||||
|
</userDefinedRuntimeAttributes>
|
||||||
|
</tableViewCell>
|
||||||
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
|
<rect key="frame" x="0.0" y="1074" width="375" height="51"/>
|
||||||
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VNn-u4-cN8" id="4bh-qe-l2N">
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VNn-u4-cN8" id="4bh-qe-l2N">
|
||||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
@@ -619,7 +688,7 @@
|
|||||||
</userDefinedRuntimeAttributes>
|
</userDefinedRuntimeAttributes>
|
||||||
</tableViewCell>
|
</tableViewCell>
|
||||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="e7s-hL-kv9" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="e7s-hL-kv9" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
<rect key="frame" x="0.0" y="1074" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="1125" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="e7s-hL-kv9" id="yjL-Mu-HTk">
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="e7s-hL-kv9" id="yjL-Mu-HTk">
|
||||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
@@ -652,7 +721,7 @@
|
|||||||
</userDefinedRuntimeAttributes>
|
</userDefinedRuntimeAttributes>
|
||||||
</tableViewCell>
|
</tableViewCell>
|
||||||
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
<tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
|
||||||
<rect key="frame" x="0.0" y="1125" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="1176" width="375" height="51"/>
|
||||||
<autoresizingMask key="autoresizingMask"/>
|
<autoresizingMask key="autoresizingMask"/>
|
||||||
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
|
<tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
|
||||||
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
<rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
|
||||||
@@ -689,7 +758,6 @@
|
|||||||
</sections>
|
</sections>
|
||||||
<connections>
|
<connections>
|
||||||
<outlet property="dataSource" destination="aMk-Xp-UL8" id="c6c-fR-8C4"/>
|
<outlet property="dataSource" destination="aMk-Xp-UL8" id="c6c-fR-8C4"/>
|
||||||
<outlet property="delegate" destination="aMk-Xp-UL8" id="moP-1B-lRq"/>
|
|
||||||
</connections>
|
</connections>
|
||||||
</tableView>
|
</tableView>
|
||||||
<navigationItem key="navigationItem" title="Settings" id="Ddg-UQ-KJ8"/>
|
<navigationItem key="navigationItem" title="Settings" id="Ddg-UQ-KJ8"/>
|
||||||
@@ -698,6 +766,7 @@
|
|||||||
<outlet property="accountNameLabel" destination="CnN-M1-AYK" id="Ldc-Py-Bix"/>
|
<outlet property="accountNameLabel" destination="CnN-M1-AYK" id="Ldc-Py-Bix"/>
|
||||||
<outlet property="accountTypeLabel" destination="434-MW-Den" id="mNB-QE-4Jg"/>
|
<outlet property="accountTypeLabel" destination="434-MW-Den" id="mNB-QE-4Jg"/>
|
||||||
<outlet property="backgroundRefreshSwitch" destination="DPu-zD-Als" id="eiG-Hv-Vko"/>
|
<outlet property="backgroundRefreshSwitch" destination="DPu-zD-Als" id="eiG-Hv-Vko"/>
|
||||||
|
<outlet property="noIdleTimeoutSwitch" destination="iQA-wm-5ag" id="jHC-js-q0Y"/>
|
||||||
<outlet property="versionLabel" destination="bUR-rp-Nw2" id="85I-5R-hqz"/>
|
<outlet property="versionLabel" destination="bUR-rp-Nw2" id="85I-5R-hqz"/>
|
||||||
</connections>
|
</connections>
|
||||||
</tableViewController>
|
</tableViewController>
|
||||||
|
|||||||
@@ -30,13 +30,14 @@ extension SettingsViewController
|
|||||||
fileprivate enum AppRefreshRow: Int, CaseIterable
|
fileprivate enum AppRefreshRow: Int, CaseIterable
|
||||||
{
|
{
|
||||||
case backgroundRefresh
|
case backgroundRefresh
|
||||||
|
case noIdleTimeout
|
||||||
|
|
||||||
@available(iOS 14, *)
|
@available(iOS 14, *)
|
||||||
case addToSiri
|
case addToSiri
|
||||||
|
|
||||||
static var allCases: [AppRefreshRow] {
|
static var allCases: [AppRefreshRow] {
|
||||||
guard #available(iOS 14, *) else { return [.backgroundRefresh] }
|
guard #available(iOS 14, *) else { return [.backgroundRefresh, .noIdleTimeout] }
|
||||||
return [.backgroundRefresh, .addToSiri]
|
return [.backgroundRefresh, .noIdleTimeout, .addToSiri]
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -53,9 +54,11 @@ extension SettingsViewController
|
|||||||
case sendFeedback
|
case sendFeedback
|
||||||
case refreshAttempts
|
case refreshAttempts
|
||||||
case errorLog
|
case errorLog
|
||||||
|
case clearCache
|
||||||
case resetPairingFile
|
case resetPairingFile
|
||||||
case resetAdiPb
|
case resetAdiPb
|
||||||
case advancedSettings
|
case advancedSettings
|
||||||
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -73,6 +76,7 @@ final class SettingsViewController: UITableViewController
|
|||||||
@IBOutlet private var accountTypeLabel: UILabel!
|
@IBOutlet private var accountTypeLabel: UILabel!
|
||||||
|
|
||||||
@IBOutlet private var backgroundRefreshSwitch: UISwitch!
|
@IBOutlet private var backgroundRefreshSwitch: UISwitch!
|
||||||
|
@IBOutlet private var noIdleTimeoutSwitch: UISwitch!
|
||||||
|
|
||||||
@IBOutlet private var versionLabel: UILabel!
|
@IBOutlet private var versionLabel: UILabel!
|
||||||
|
|
||||||
@@ -148,6 +152,7 @@ private extension SettingsViewController
|
|||||||
}
|
}
|
||||||
|
|
||||||
self.backgroundRefreshSwitch.isOn = UserDefaults.standard.isBackgroundRefreshEnabled
|
self.backgroundRefreshSwitch.isOn = UserDefaults.standard.isBackgroundRefreshEnabled
|
||||||
|
self.noIdleTimeoutSwitch.isOn = UserDefaults.standard.isIdleTimeoutDisableEnabled
|
||||||
|
|
||||||
if self.isViewLoaded
|
if self.isViewLoaded
|
||||||
{
|
{
|
||||||
@@ -199,7 +204,7 @@ private extension SettingsViewController
|
|||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Enable Background Refresh to automatically refresh apps in the background when connected to Wi-Fi.", comment: "")
|
settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Enable Background Refresh to automatically refresh apps in the background when connected to Wi-Fi. \n\nDisable the Idle Timeout toggle to allow SideStore to not let your device go to sleep during a refresh or install of any apps.", comment: "")
|
||||||
}
|
}
|
||||||
|
|
||||||
case .instructions:
|
case .instructions:
|
||||||
@@ -280,6 +285,11 @@ private extension SettingsViewController
|
|||||||
UserDefaults.standard.isBackgroundRefreshEnabled = sender.isOn
|
UserDefaults.standard.isBackgroundRefreshEnabled = sender.isOn
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@IBAction func toggleNoIdleTimeoutEnabled(_ sender: UISwitch)
|
||||||
|
{
|
||||||
|
UserDefaults.standard.isIdleTimeoutDisableEnabled = sender.isOn
|
||||||
|
}
|
||||||
|
|
||||||
@available(iOS 14, *)
|
@available(iOS 14, *)
|
||||||
@IBAction func addRefreshAppsShortcut()
|
@IBAction func addRefreshAppsShortcut()
|
||||||
{
|
{
|
||||||
@@ -291,6 +301,39 @@ private extension SettingsViewController
|
|||||||
self.present(viewController, animated: true, completion: nil)
|
self.present(viewController, animated: true, completion: nil)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func clearCache()
|
||||||
|
{
|
||||||
|
let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to clear SideStore's cache?", comment: ""),
|
||||||
|
message: NSLocalizedString("This will remove all temporary files as well as backups for uninstalled apps.", comment: ""),
|
||||||
|
preferredStyle: .actionSheet)
|
||||||
|
alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { [weak self] _ in
|
||||||
|
self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
|
||||||
|
})
|
||||||
|
alertController.addAction(UIAlertAction(title: NSLocalizedString("Clear Cache", comment: ""), style: .destructive) { [weak self] _ in
|
||||||
|
AppManager.shared.clearAppCache { result in
|
||||||
|
DispatchQueue.main.async {
|
||||||
|
self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
|
||||||
|
|
||||||
|
switch result
|
||||||
|
{
|
||||||
|
case .success: break
|
||||||
|
case .failure(let error):
|
||||||
|
let alertController = UIAlertController(title: NSLocalizedString("Unable to Clear Cache", comment: ""), message: error.localizedDescription, preferredStyle: .alert)
|
||||||
|
alertController.addAction(.ok)
|
||||||
|
self?.present(alertController, animated: true)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
})
|
||||||
|
|
||||||
|
if let popoverController = alertController.popoverPresentationController {
|
||||||
|
popoverController.sourceView = self.view
|
||||||
|
popoverController.sourceRect = CGRect(x: self.view.bounds.midX, y: self.view.bounds.midY, width: 0, height: 0)
|
||||||
|
}
|
||||||
|
|
||||||
|
self.present(alertController, animated: true)
|
||||||
|
}
|
||||||
|
|
||||||
@IBAction func handleDebugModeGesture(_ gestureRecognizer: UISwipeGestureRecognizer)
|
@IBAction func handleDebugModeGesture(_ gestureRecognizer: UISwipeGestureRecognizer)
|
||||||
{
|
{
|
||||||
self.debugGestureCounter += 1
|
self.debugGestureCounter += 1
|
||||||
@@ -377,14 +420,25 @@ extension SettingsViewController
|
|||||||
{
|
{
|
||||||
let cell = super.tableView(tableView, cellForRowAt: indexPath)
|
let cell = super.tableView(tableView, cellForRowAt: indexPath)
|
||||||
|
|
||||||
if #available(iOS 14, *) {}
|
// if #available(iOS 14, *) {}
|
||||||
else if let cell = cell as? InsetGroupTableViewCell,
|
// else if let cell = cell as? InsetGroupTableViewCell,
|
||||||
|
// indexPath.section == Section.appRefresh.rawValue,
|
||||||
|
// indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
|
||||||
|
// {
|
||||||
|
// // Only one row is visible pre-iOS 14.
|
||||||
|
// cell.style = .single
|
||||||
|
// }
|
||||||
|
|
||||||
|
if AppRefreshRow.AllCases().count == 1
|
||||||
|
{
|
||||||
|
if let cell = cell as? InsetGroupTableViewCell,
|
||||||
indexPath.section == Section.appRefresh.rawValue,
|
indexPath.section == Section.appRefresh.rawValue,
|
||||||
indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
|
indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
|
||||||
{
|
{
|
||||||
// Only one row is visible pre-iOS 14.
|
|
||||||
cell.style = .single
|
cell.style = .single
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
return cell
|
return cell
|
||||||
}
|
}
|
||||||
@@ -465,11 +519,13 @@ extension SettingsViewController
|
|||||||
switch row
|
switch row
|
||||||
{
|
{
|
||||||
case .backgroundRefresh: break
|
case .backgroundRefresh: break
|
||||||
|
case .noIdleTimeout: break
|
||||||
case .addToSiri:
|
case .addToSiri:
|
||||||
guard #available(iOS 14, *) else { return }
|
guard #available(iOS 14, *) else { return }
|
||||||
self.addRefreshAppsShortcut()
|
self.addRefreshAppsShortcut()
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
case .credits:
|
case .credits:
|
||||||
let row = CreditsRow.allCases[indexPath.row]
|
let row = CreditsRow.allCases[indexPath.row]
|
||||||
switch row
|
switch row
|
||||||
@@ -507,6 +563,9 @@ extension SettingsViewController
|
|||||||
let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
|
let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
|
||||||
toastView.show(in: self)
|
toastView.show(in: self)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
case .clearCache: self.clearCache()
|
||||||
|
|
||||||
case .resetPairingFile:
|
case .resetPairingFile:
|
||||||
let filename = "ALTPairingFile.mobiledevicepairing"
|
let filename = "ALTPairingFile.mobiledevicepairing"
|
||||||
let fm = FileManager.default
|
let fm = FileManager.default
|
||||||
@@ -559,6 +618,7 @@ extension SettingsViewController
|
|||||||
ELOG("UIApplication.openSettingsURLString invalid")
|
ELOG("UIApplication.openSettingsURLString invalid")
|
||||||
}
|
}
|
||||||
case .refreshAttempts, .errorLog: break
|
case .refreshAttempts, .errorLog: break
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
default: break
|
default: break
|
||||||
|
|||||||
@@ -27,6 +27,7 @@ public extension UserDefaults
|
|||||||
@NSManaged var preferredServerID: String?
|
@NSManaged var preferredServerID: String?
|
||||||
|
|
||||||
@NSManaged var isBackgroundRefreshEnabled: Bool
|
@NSManaged var isBackgroundRefreshEnabled: Bool
|
||||||
|
@NSManaged var isIdleTimeoutDisableEnabled: Bool
|
||||||
@NSManaged var isDebugModeEnabled: Bool
|
@NSManaged var isDebugModeEnabled: Bool
|
||||||
@NSManaged var presentedLaunchReminderNotification: Bool
|
@NSManaged var presentedLaunchReminderNotification: Bool
|
||||||
|
|
||||||
@@ -72,6 +73,7 @@ public extension UserDefaults
|
|||||||
|
|
||||||
let defaults = [
|
let defaults = [
|
||||||
#keyPath(UserDefaults.isBackgroundRefreshEnabled): true,
|
#keyPath(UserDefaults.isBackgroundRefreshEnabled): true,
|
||||||
|
#keyPath(UserDefaults.isIdleTimeoutDisableEnabled): true,
|
||||||
#keyPath(UserDefaults.isLegacyDeactivationSupported): isLegacyDeactivationSupported,
|
#keyPath(UserDefaults.isLegacyDeactivationSupported): isLegacyDeactivationSupported,
|
||||||
#keyPath(UserDefaults.activeAppLimitIncludesExtensions): activeAppLimitIncludesExtensions,
|
#keyPath(UserDefaults.activeAppLimitIncludesExtensions): activeAppLimitIncludesExtensions,
|
||||||
#keyPath(UserDefaults.localServerSupportsRefreshing): localServerSupportsRefreshing,
|
#keyPath(UserDefaults.localServerSupportsRefreshing): localServerSupportsRefreshing,
|
||||||
|
|||||||
@@ -20,17 +20,17 @@ public extension Source
|
|||||||
#if STAGING
|
#if STAGING
|
||||||
|
|
||||||
#if ALPHA
|
#if ALPHA
|
||||||
static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
|
static let altStoreSourceURL = URL(string: "https://connect.sidestore.io/")!
|
||||||
#else
|
#else
|
||||||
static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
|
static let altStoreSourceURL = URL(string: "https://connect.sidestore.io/")!
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
#else
|
#else
|
||||||
|
|
||||||
#if ALPHA
|
#if ALPHA
|
||||||
static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
|
static let altStoreSourceURL = URL(string: "https://connect.sidestore.io/")!
|
||||||
#else
|
#else
|
||||||
static let altStoreSourceURL = URL(string: "https://apps.sidestore.io/")!
|
static let altStoreSourceURL = URL(string: "https://connect.sidestore.io/")!
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
#endif
|
#endif
|
||||||
|
|||||||
@@ -4,8 +4,8 @@
|
|||||||
<dict>
|
<dict>
|
||||||
<key>ALTAppGroups</key>
|
<key>ALTAppGroups</key>
|
||||||
<array>
|
<array>
|
||||||
<string>group.com.SideStore.SideStore</string>
|
|
||||||
<string>group.$(APP_GROUP_IDENTIFIER)</string>
|
<string>group.$(APP_GROUP_IDENTIFIER)</string>
|
||||||
|
<string>group.com.SideStore.SideStore</string>
|
||||||
</array>
|
</array>
|
||||||
<key>CFBundleDevelopmentRegion</key>
|
<key>CFBundleDevelopmentRegion</key>
|
||||||
<string>$(DEVELOPMENT_LANGUAGE)</string>
|
<string>$(DEVELOPMENT_LANGUAGE)</string>
|
||||||
|
|||||||
@@ -1,8 +1,8 @@
|
|||||||
// Configuration settings file format documentation can be found at:
|
// Configuration settings file format documentation can be found at:
|
||||||
// https://help.apple.com/xcode/#/dev745c5c974
|
// https://help.apple.com/xcode/#/dev745c5c974
|
||||||
|
|
||||||
MARKETING_VERSION = 0.5.0
|
MARKETING_VERSION = 0.5.5
|
||||||
CURRENT_PROJECT_VERSION = 5000
|
CURRENT_PROJECT_VERSION = 5050
|
||||||
|
|
||||||
// Vars to be overwritten by `CodeSigning.xcconfig` if exists
|
// Vars to be overwritten by `CodeSigning.xcconfig` if exists
|
||||||
DEVELOPMENT_TEAM = S32Z3HMYVQ
|
DEVELOPMENT_TEAM = S32Z3HMYVQ
|
||||||
|
|||||||
@@ -7,7 +7,7 @@ There are many ways to contribute to SideStore, so if you aren't a developer, th
|
|||||||
- [Writing documentation](https://github.com/SideStore/SideStore-Docs)
|
- [Writing documentation](https://github.com/SideStore/SideStore-Docs)
|
||||||
- [Submitting detailed bug reports and suggesting new features](https://github.com/SideStore/SideStore/issues/new/choose)
|
- [Submitting detailed bug reports and suggesting new features](https://github.com/SideStore/SideStore/issues/new/choose)
|
||||||
- Helping out with support
|
- Helping out with support
|
||||||
- [Discord](https://discord.gg/RgpFBX3Q3k)
|
- [Discord](https://discord.gg/sidestore-949183273383395328)
|
||||||
- [GitHub Discussions](https://github.com/SideStore/SideStore/discussions)
|
- [GitHub Discussions](https://github.com/SideStore/SideStore/discussions)
|
||||||
|
|
||||||
However, this guide will focus on the development side of things. For now, we will only have setup information here, but you can [join our Discord](https://discord.gg/RgpFBX3Q3k) if you need help
|
However, this guide will focus on the development side of things. For now, we will only have setup information here, but you can [join our Discord](https://discord.gg/RgpFBX3Q3k) if you need help
|
||||||
|
|||||||
2
Dependencies/Roxas
vendored
2
Dependencies/Roxas
vendored
Submodule Dependencies/Roxas updated: ac906cf490...c28b400621
2
Dependencies/libfragmentzip
vendored
2
Dependencies/libfragmentzip
vendored
Submodule Dependencies/libfragmentzip updated: 9a899fde3c...b7f9272acf
2
Dependencies/libimobiledevice
vendored
2
Dependencies/libimobiledevice
vendored
Submodule Dependencies/libimobiledevice updated: b314f04bd7...04c023317f
2
Dependencies/libimobiledevice-glue
vendored
2
Dependencies/libimobiledevice-glue
vendored
Submodule Dependencies/libimobiledevice-glue updated: 7eaa28ea95...214bafdde6
2
Dependencies/libplist
vendored
2
Dependencies/libplist
vendored
Submodule Dependencies/libplist updated: c3af449543...258d3c24aa
2
Dependencies/libusbmuxd
vendored
2
Dependencies/libusbmuxd
vendored
Submodule Dependencies/libusbmuxd updated: 6426362e5c...30e678d4e7
@@ -24,10 +24,6 @@
|
|||||||
"identifier": "com.flyinghead.source",
|
"identifier": "com.flyinghead.source",
|
||||||
"sourceURL": "https://flyinghead.github.io/flycast-builds/altstore.json"
|
"sourceURL": "https://flyinghead.github.io/flycast-builds/altstore.json"
|
||||||
},
|
},
|
||||||
{
|
|
||||||
"identifier": "com.emuplace.altstore",
|
|
||||||
"sourceURL": "https://emuplace.app/altstore/altstore.json"
|
|
||||||
},
|
|
||||||
{
|
{
|
||||||
"identifier": "dev.crystall1ne.repos.PojavLauncher",
|
"identifier": "dev.crystall1ne.repos.PojavLauncher",
|
||||||
"sourceURL": "https://alt.crystall1ne.dev"
|
"sourceURL": "https://alt.crystall1ne.dev"
|
||||||
@@ -43,6 +39,10 @@
|
|||||||
{
|
{
|
||||||
"identifier": "stream.yattee",
|
"identifier": "stream.yattee",
|
||||||
"sourceURL": "https://repos.yattee.stream/alt/apps.json"
|
"sourceURL": "https://repos.yattee.stream/alt/apps.json"
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"identifier": "com.litritt.litsource",
|
||||||
|
"sourceURL": "https://altstore.ignitedemulator.com/"
|
||||||
}
|
}
|
||||||
]
|
]
|
||||||
}
|
}
|
||||||
|
|||||||
Reference in New Issue
Block a user