[skip ci] Add other project maintainers to CODEOWNERS

Signed-off-by: nythepegasus <nythepegasus84@gmail.com>
chore(Clear Cache): do proper error handling
2026-02-09 23:03:27 +01:00 · 2023-11-27 09:37:25 -05:00 · 2023-11-27 09:31:36 -05:00 · 2023-11-27 09:31:36 -05:00 · 2023-11-27 09:31:36 -05:00 · 2023-11-27 09:31:36 -05:00
70 changed files with 1141 additions and 441 deletions
--- a/.github/CODEOWNERS
+++ b/.github/CODEOWNERS
@@ -1 +1 @@
-*       @JoeMatt @lonkelle
+*       @JoeMatt @lonkelle @nythepegasus @Spidy123222 @SternXD
--- a/.github/ISSUE_TEMPLATE/bug_report.yml
+++ b/.github/ISSUE_TEMPLATE/bug_report.yml
@@ -10,7 +10,7 @@ body:
      value: |
        Thanks for taking the time to fill out this bug report! Before you continue filling out the report, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the bug you are experiencing** in case it has already been reported.
        
-        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+        **Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
  - type: textarea
    id: description
    attributes:
--- a/.github/ISSUE_TEMPLATE/config.yml
+++ b/.github/ISSUE_TEMPLATE/config.yml
@@ -3,7 +3,7 @@ blank_issues_enabled: false

 contact_links:
  - name: Discord
-    url: https://discord.gg/RgpFBX3Q3k
+    url: https://discord.gg/sidestore-949183273383395328
    about: If you need support, please go here first instead of making an issue!
  - name: GitHub Discussions
    url: https://github.com/SideStore/SideStore/discussions
--- a/.github/ISSUE_TEMPLATE/feature_request.yml
+++ b/.github/ISSUE_TEMPLATE/feature_request.yml
@@ -10,7 +10,7 @@ body:
      value: |
        Thanks for taking the time to fill out this feature request! Before you continue filling out the form, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the feature you are suggestion** in case it has already been suggested.
        
-        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+        **Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
  - type: textarea
    id: description
    attributes:
--- a/.gitmodules
+++ b/.gitmodules
@@ -9,7 +9,7 @@
 	url = https://github.com/libimobiledevice/libusbmuxd.git
 [submodule "Dependencies/libplist"]
 	path = Dependencies/libplist
-	url = https://github.com/libimobiledevice/libplist.git
+	url = https://github.com/SideStore/libplist.git
 [submodule "Dependencies/MarkdownAttributedString"]
 	path = Dependencies/MarkdownAttributedString
 	url = https://github.com/chockenberry/MarkdownAttributedString.git
--- a/AltBackup/Assets.xcassets/Background.colorset/Contents.json
+++ b/AltBackup/Assets.xcassets/Background.colorset/Contents.json
@@ -5,9 +5,9 @@
        "color-space" : "srgb",
        "components" : {
          "alpha" : "1.000",
-          "blue" : "0.518",
-          "green" : "0.502",
-          "red" : "0.004"
+          "blue" : "175",
+          "green" : "4",
+          "red" : "115"
        }
      },
      "idiom" : "universal"
@@ -23,9 +23,9 @@
        "color-space" : "srgb",
        "components" : {
          "alpha" : "1.000",
-          "blue" : "0.404",
-          "green" : "0.322",
-          "red" : "0.008"
+          "blue" : "150",
+          "green" : "3",
+          "red" : "99"
        }
      },
      "idiom" : "universal"
--- a/AltStore.xcodeproj/project.pbxproj
+++ b/AltStore.xcodeproj/project.pbxproj
@@ -8,13 +8,39 @@

 /* Begin PBXBuildFile section */
 		03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E314122A05D4C00370A3C /* Bundle+AltStore.swift */; };
+		0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0E1A1F902AE36A9600364CAD /* bytearray.c */; };
+		0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = 0E764E162ADFF5740043DD4E /* AltBackup.ipa */; };
+		0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166472ADFE0D1003015C1 /* out-limd.c */; };
+		0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166522ADFE0D2003015C1 /* out-default.c */; };
+		0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166552ADFE0D2003015C1 /* out-plutil.c */; };
+		0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166562ADFE0D2003015C1 /* oplist.c */; };
+		0EA166682ADFE122003015C1 /* jsmn.h in Headers */ = {isa = PBXBuildFile; fileRef = 0EA166632ADFE122003015C1 /* jsmn.h */; };
+		0EA166692ADFE140003015C1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166452ADFE0D1003015C1 /* Array.cpp */; };
+		0EA1666A2ADFE140003015C1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166492ADFE0D1003015C1 /* String.cpp */; };
+		0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */; };
+		0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166532ADFE0D2003015C1 /* Integer.cpp */; };
+		0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166432ADFE0D1003015C1 /* Data.cpp */; };
+		0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166512ADFE0D2003015C1 /* ptrarray.c */; };
+		0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664F2ADFE0D1003015C1 /* hashtable.c */; };
+		0EA166702ADFE140003015C1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166502ADFE0D2003015C1 /* Node.cpp */; };
+		0EA166712ADFE140003015C1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166582ADFE0D2003015C1 /* Key.cpp */; };
+		0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166462ADFE0D1003015C1 /* Dictionary.cpp */; };
+		0EA166742ADFE140003015C1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166422ADFE0D1003015C1 /* Date.cpp */; };
+		0EA166752ADFE140003015C1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166542ADFE0D2003015C1 /* Real.cpp */; };
+		0EA166762ADFE140003015C1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664A2ADFE0D1003015C1 /* base64.c */; };
+		0EA166772ADFE140003015C1 /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166412ADFE0D1003015C1 /* jplist.c */; };
+		0EA166782ADFE140003015C1 /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166572ADFE0D2003015C1 /* jsmn.c */; };
+		0EA166792ADFE140003015C1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166442ADFE0D1003015C1 /* bplist.c */; };
+		0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664B2ADFE0D1003015C1 /* Uid.cpp */; };
+		0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1665A2ADFE0D2003015C1 /* Structure.cpp */; };
+		0EA1667D2ADFE140003015C1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166592ADFE0D2003015C1 /* xplist.c */; };
+		0EA1667E2ADFE140003015C1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664C2ADFE0D1003015C1 /* time64.c */; };
+		0EA4B9BC2AE4A414009209CE /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA4B9BB2AE4A3F6009209CE /* plist.c */; };
 		19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */ = {isa = PBXBuildFile; fileRef = BF45872B2298D31600BD7491 /* libimobiledevice.a */; };
 		19104DB52909C06D00C49C7B /* EmotionalDamage.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19104DB42909C06D00C49C7B /* EmotionalDamage.swift */; };
 		19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DB22909C06C00C49C7B /* libEmotionalDamage.a */; };
 		191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FAB290A5D92001A3B7C /* libminimuxer.a */; };
 		191E5FDC290AFA5C001A3B7C /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 191E5FDB290AFA5C001A3B7C /* OpenSSL */; };
-		191E607D290B2EA5001A3B7C /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FD0290A651D001A3B7C /* jsmn.c */; };
-		191E607E290B2EA7001A3B7C /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FCF290A651D001A3B7C /* jplist.c */; };
 		1920B04F2924AC8300744F60 /* Settings.bundle in Resources */ = {isa = PBXBuildFile; fileRef = 1920B04E2924AC8300744F60 /* Settings.bundle */; };
 		19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */; };
 		4879A95F2861046500FC1BBD /* AltSign in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A95E2861046500FC1BBD /* AltSign */; };
@@ -25,7 +51,6 @@
 		99F87D1829D8E4C900B40039 /* SwiftBridgeCore.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1629D8E4C900B40039 /* SwiftBridgeCore.swift */; };
 		99F87D1929D8E4C900B40039 /* minimuxer.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1729D8E4C900B40039 /* minimuxer.swift */; };
 		B3146ED2284F581E00BBC3FD /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; };
-		B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; settings = {ATTRIBUTES = (CodeSignOnCopy, RemoveHeadersOnCopy, ); }; };
 		B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F894295F7F9B002B1159 /* libfragmentzip.a */; };
 		B33FFBAA295F8F78002259E6 /* preboard.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBA9295F8F78002259E6 /* preboard.c */; };
 		B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBAB295F8F98002259E6 /* companion_proxy.c */; };
@@ -74,7 +99,6 @@
 		BF41B808233433C100C593A3 /* LoadingState.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF41B807233433C100C593A3 /* LoadingState.swift */; };
 		BF42345A25101C35006D1EB2 /* WidgetView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF42345825101C1D006D1EB2 /* WidgetView.swift */; };
 		BF44EEF0246B08BA002A52F2 /* BackupController.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEEF246B08BA002A52F2 /* BackupController.swift */; };
-		BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */; };
 		BF44EEFC246B4550002A52F2 /* RemoveAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */; };
 		BF4587F82298D3AB00BD7491 /* service.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4587C82298D3A800BD7491 /* service.h */; };
 		BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587C92298D3A800BD7491 /* diagnostics_relay.c */; };
@@ -254,34 +278,6 @@
 		BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = BFD247782284B9A700981D42 /* LaunchScreen.storyboard */; };
 		BFD2478C2284C4C300981D42 /* AppIconImageView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478B2284C4C300981D42 /* AppIconImageView.swift */; };
 		BFD2478F2284C8F900981D42 /* Button.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478E2284C8F900981D42 /* Button.swift */; };
-		BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */; };
-		BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE622A1A9CA000B7ED1 /* base64.c */; };
-		BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE722A1A9CA000B7ED1 /* hashtable.c */; };
-		BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */; };
-		BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */; };
-		BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEA22A1A9CA000B7ED1 /* bplist.c */; };
-		BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEB22A1A9CA000B7ED1 /* String.cpp */; };
-		BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEC22A1A9CA000B7ED1 /* time64.c */; };
-		BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BED22A1A9CA000B7ED1 /* plist.h */; };
-		BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEE22A1A9CA000B7ED1 /* plist.c */; };
-		BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */; };
-		BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF022A1A9CA000B7ED1 /* Date.cpp */; };
-		BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */; };
-		BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */; };
-		BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF322A1A9CA000B7ED1 /* Real.cpp */; };
-		BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF422A1A9CA000B7ED1 /* strbuf.h */; };
-		BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF522A1A9CA000B7ED1 /* bytearray.c */; };
-		BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF622A1A9CA000B7ED1 /* base64.h */; };
-		BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF722A1A9CA000B7ED1 /* Data.cpp */; };
-		BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF822A1A9CB000B7ED1 /* Array.cpp */; };
-		BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF922A1A9CB000B7ED1 /* Node.cpp */; };
-		BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */; };
-		BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */; };
-		BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */; };
-		BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */; };
-		BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */; };
-		BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFF22A1A9CB000B7ED1 /* time64.h */; };
-		BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C0022A1A9CB000B7ED1 /* xplist.c */; };
 		BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1D22A1A9EC000B7ED1 /* node.c */; };
 		BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1E22A1A9EC000B7ED1 /* node_list.c */; };
 		BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1F22A1A9EC000B7ED1 /* cnary.c */; };
@@ -336,6 +332,7 @@
 		D57FE84428C7DB7100216002 /* ErrorLogViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */; };
 		D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = D58916FD28C7C55C00E39C8B /* LoggedError.swift */; };
 		D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D593F1932717749A006E82DE /* PatchAppOperation.swift */; };
+		D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */; };
 		D5CA0C4B280E141900469595 /* ManagedPatron.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4A280E141900469595 /* ManagedPatron.swift */; };
 		D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */; };
 		D5DAE0942804B0B80034D8D4 /* ScreenshotProcessor.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5DAE0932804B0B80034D8D4 /* ScreenshotProcessor.swift */; };
@@ -482,7 +479,6 @@
 			dstPath = "";
 			dstSubfolderSpec = 10;
 			files = (
-				B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */,
 				BF1614F2250822F100767AEA /* Roxas.framework in Embed Frameworks */,
 				BF66EE862501AE50007EE018 /* AltStoreCore.framework in Embed Frameworks */,
 			);
@@ -503,12 +499,45 @@
 /* End PBXCopyFilesBuildPhase section */

 /* Begin PBXFileReference section */
+		0E1A1F902AE36A9600364CAD /* bytearray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = src/bytearray.c; sourceTree = "<group>"; };
+		0E764E162ADFF5740043DD4E /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; name = AltBackup.ipa; path = AltStore/Resources/AltBackup.ipa; sourceTree = SOURCE_ROOT; };
+		0EA166412ADFE0D1003015C1 /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166422ADFE0D1003015C1 /* Date.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166432ADFE0D1003015C1 /* Data.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166442ADFE0D1003015C1 /* bplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166452ADFE0D1003015C1 /* Array.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166462ADFE0D1003015C1 /* Dictionary.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166472ADFE0D1003015C1 /* out-limd.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-limd.c"; path = "Dependencies/libplist/src/out-limd.c"; sourceTree = SOURCE_ROOT; };
+		0EA166492ADFE0D1003015C1 /* String.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664A2ADFE0D1003015C1 /* base64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
+		0EA1664B2ADFE0D1003015C1 /* Uid.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664C2ADFE0D1003015C1 /* time64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
+		0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664F2ADFE0D1003015C1 /* hashtable.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
+		0EA166502ADFE0D2003015C1 /* Node.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166512ADFE0D2003015C1 /* ptrarray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
+		0EA166522ADFE0D2003015C1 /* out-default.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-default.c"; path = "Dependencies/libplist/src/out-default.c"; sourceTree = SOURCE_ROOT; };
+		0EA166532ADFE0D2003015C1 /* Integer.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166542ADFE0D2003015C1 /* Real.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166552ADFE0D2003015C1 /* out-plutil.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-plutil.c"; path = "Dependencies/libplist/src/out-plutil.c"; sourceTree = SOURCE_ROOT; };
+		0EA166562ADFE0D2003015C1 /* oplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = oplist.c; path = Dependencies/libplist/src/oplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166572ADFE0D2003015C1 /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
+		0EA166582ADFE0D2003015C1 /* Key.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166592ADFE0D2003015C1 /* xplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
+		0EA1665A2ADFE0D2003015C1 /* Structure.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1665F2ADFE122003015C1 /* time64_limits.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
+		0EA166602ADFE122003015C1 /* time64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
+		0EA166612ADFE122003015C1 /* bytearray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
+		0EA166622ADFE122003015C1 /* ptrarray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
+		0EA166632ADFE122003015C1 /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
+		0EA166642ADFE122003015C1 /* plist.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
+		0EA166652ADFE122003015C1 /* hashtable.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
+		0EA166662ADFE122003015C1 /* base64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
+		0EA166672ADFE122003015C1 /* strbuf.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
+		0EA4B9BB2AE4A3F6009209CE /* plist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
 		19104DB22909C06C00C49C7B /* libEmotionalDamage.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libEmotionalDamage.a; sourceTree = BUILT_PRODUCTS_DIR; };
 		19104DB42909C06D00C49C7B /* EmotionalDamage.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EmotionalDamage.swift; sourceTree = "<group>"; };
 		191E5FAB290A5D92001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer.a; sourceTree = BUILT_PRODUCTS_DIR; };
-		191E5FCF290A651D001A3B7C /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
-		191E5FD0290A651D001A3B7C /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
-		191E5FD1290A651D001A3B7C /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
 		1920B04E2924AC8300744F60 /* Settings.bundle */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.plug-in"; path = Settings.bundle; sourceTree = "<group>"; };
 		19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SelectTeamViewController.swift; sourceTree = "<group>"; };
 		9961EC2D29BE9F2E00AF2C6F /* minimuxer-helpers.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; name = "minimuxer-helpers.swift"; path = "Dependencies/minimuxer/minimuxer-helpers.swift"; sourceTree = SOURCE_ROOT; };
@@ -573,7 +602,6 @@
 		BF41B807233433C100C593A3 /* LoadingState.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoadingState.swift; sourceTree = "<group>"; };
 		BF42345825101C1D006D1EB2 /* WidgetView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = WidgetView.swift; sourceTree = "<group>"; };
 		BF44EEEF246B08BA002A52F2 /* BackupController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = BackupController.swift; sourceTree = "<group>"; };
-		BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; path = AltBackup.ipa; sourceTree = "<group>"; };
 		BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RemoveAppOperation.swift; sourceTree = "<group>"; };
 		BF45872B2298D31600BD7491 /* libimobiledevice.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libimobiledevice.a; sourceTree = BUILT_PRODUCTS_DIR; };
 		BF4587C82298D3A800BD7491 /* service.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = service.h; path = Dependencies/libimobiledevice/src/service.h; sourceTree = SOURCE_ROOT; };
@@ -759,34 +787,6 @@
 		BFD2479E2284FBD000981D42 /* UIColor+AltStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "UIColor+AltStore.swift"; sourceTree = "<group>"; };
 		BFD44605241188C300EAB90A /* CodableServerError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = CodableServerError.swift; sourceTree = "<group>"; };
 		BFD52BD222A06EFB000B7ED1 /* ALTConstants.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTConstants.h; sourceTree = "<group>"; };
-		BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE622A1A9CA000B7ED1 /* base64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE722A1A9CA000B7ED1 /* hashtable.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
-		BFD52BEA22A1A9CA000B7ED1 /* bplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
-		BFD52BEB22A1A9CA000B7ED1 /* String.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BEC22A1A9CA000B7ED1 /* time64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
-		BFD52BED22A1A9CA000B7ED1 /* plist.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
-		BFD52BEE22A1A9CA000B7ED1 /* plist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
-		BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF022A1A9CA000B7ED1 /* Date.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF322A1A9CA000B7ED1 /* Real.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF422A1A9CA000B7ED1 /* strbuf.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF522A1A9CA000B7ED1 /* bytearray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = Dependencies/libplist/src/bytearray.c; sourceTree = SOURCE_ROOT; };
-		BFD52BF622A1A9CA000B7ED1 /* base64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF722A1A9CA000B7ED1 /* Data.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF822A1A9CB000B7ED1 /* Array.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF922A1A9CB000B7ED1 /* Node.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
-		BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
-		BFD52BFF22A1A9CB000B7ED1 /* time64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
-		BFD52C0022A1A9CB000B7ED1 /* xplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1D22A1A9EC000B7ED1 /* node.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node.c; path = Dependencies/libplist/libcnary/node.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1E22A1A9EC000B7ED1 /* node_list.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node_list.c; path = Dependencies/libplist/libcnary/node_list.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1F22A1A9EC000B7ED1 /* cnary.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = cnary.c; path = Dependencies/libplist/libcnary/cnary.c; sourceTree = SOURCE_ROOT; };
@@ -840,6 +840,7 @@
 		D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorLogViewController.swift; sourceTree = "<group>"; };
 		D58916FD28C7C55C00E39C8B /* LoggedError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoggedError.swift; sourceTree = "<group>"; };
 		D593F1932717749A006E82DE /* PatchAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchAppOperation.swift; sourceTree = "<group>"; };
+		D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ClearAppCacheOperation.swift; sourceTree = "<group>"; };
 		D5CA0C4A280E141900469595 /* ManagedPatron.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ManagedPatron.swift; sourceTree = "<group>"; };
 		D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 10.xcdatamodel"; sourceTree = "<group>"; };
 		D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcmappingmodel; path = AltStore9ToAltStore10.xcmappingmodel; sourceTree = "<group>"; };
@@ -1192,37 +1193,41 @@
 		BF4588562298DC6D00BD7491 /* libplist */ = {
 			isa = PBXGroup;
 			children = (
-				BFD52BE622A1A9CA000B7ED1 /* base64.c */,
-				BFD52BEA22A1A9CA000B7ED1 /* bplist.c */,
-				BFD52BF522A1A9CA000B7ED1 /* bytearray.c */,
-				BFD52BE722A1A9CA000B7ED1 /* hashtable.c */,
-				191E5FCF290A651D001A3B7C /* jplist.c */,
-				191E5FD0290A651D001A3B7C /* jsmn.c */,
-				BFD52BEE22A1A9CA000B7ED1 /* plist.c */,
-				BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */,
-				BFD52BEC22A1A9CA000B7ED1 /* time64.c */,
-				BFD52C0022A1A9CB000B7ED1 /* xplist.c */,
-				BFD52BF822A1A9CB000B7ED1 /* Array.cpp */,
-				BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */,
-				BFD52BF722A1A9CA000B7ED1 /* Data.cpp */,
-				BFD52BF022A1A9CA000B7ED1 /* Date.cpp */,
-				BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */,
-				BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */,
-				BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */,
-				BFD52BF922A1A9CB000B7ED1 /* Node.cpp */,
-				BFD52BF322A1A9CA000B7ED1 /* Real.cpp */,
-				BFD52BEB22A1A9CA000B7ED1 /* String.cpp */,
-				BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */,
-				BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */,
-				BFD52BF622A1A9CA000B7ED1 /* base64.h */,
-				BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */,
-				BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */,
-				191E5FD1290A651D001A3B7C /* jsmn.h */,
-				BFD52BED22A1A9CA000B7ED1 /* plist.h */,
-				BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */,
-				BFD52BF422A1A9CA000B7ED1 /* strbuf.h */,
-				BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */,
-				BFD52BFF22A1A9CB000B7ED1 /* time64.h */,
+				0EA166462ADFE0D1003015C1 /* Dictionary.cpp */,
+				0E1A1F902AE36A9600364CAD /* bytearray.c */,
+				0EA166442ADFE0D1003015C1 /* bplist.c */,
+				0EA166432ADFE0D1003015C1 /* Data.cpp */,
+				0EA166422ADFE0D1003015C1 /* Date.cpp */,
+				0EA1664F2ADFE0D1003015C1 /* hashtable.c */,
+				0EA166532ADFE0D2003015C1 /* Integer.cpp */,
+				0EA166562ADFE0D2003015C1 /* oplist.c */,
+				0EA166522ADFE0D2003015C1 /* out-default.c */,
+				0EA166472ADFE0D1003015C1 /* out-limd.c */,
+				0EA166552ADFE0D2003015C1 /* out-plutil.c */,
+				0EA166492ADFE0D1003015C1 /* String.cpp */,
+				0EA1665A2ADFE0D2003015C1 /* Structure.cpp */,
+				0EA166452ADFE0D1003015C1 /* Array.cpp */,
+				0EA1664A2ADFE0D1003015C1 /* base64.c */,
+				0EA166572ADFE0D2003015C1 /* jsmn.c */,
+				0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */,
+				0EA4B9BB2AE4A3F6009209CE /* plist.c */,
+				0EA166412ADFE0D1003015C1 /* jplist.c */,
+				0EA166582ADFE0D2003015C1 /* Key.cpp */,
+				0EA166512ADFE0D2003015C1 /* ptrarray.c */,
+				0EA1664C2ADFE0D1003015C1 /* time64.c */,
+				0EA166502ADFE0D2003015C1 /* Node.cpp */,
+				0EA166542ADFE0D2003015C1 /* Real.cpp */,
+				0EA1664B2ADFE0D1003015C1 /* Uid.cpp */,
+				0EA166592ADFE0D2003015C1 /* xplist.c */,
+				0EA166662ADFE122003015C1 /* base64.h */,
+				0EA166652ADFE122003015C1 /* hashtable.h */,
+				0EA166632ADFE122003015C1 /* jsmn.h */,
+				0EA166642ADFE122003015C1 /* plist.h */,
+				0EA166612ADFE122003015C1 /* bytearray.h */,
+				0EA166622ADFE122003015C1 /* ptrarray.h */,
+				0EA166672ADFE122003015C1 /* strbuf.h */,
+				0EA1665F2ADFE122003015C1 /* time64_limits.h */,
+				0EA166602ADFE122003015C1 /* time64.h */,
 				BF4588892298DDEA00BD7491 /* libcnary */,
 			);
 			path = libplist;
@@ -1619,7 +1624,7 @@
 		BFD247962284D7C100981D42 /* Resources */ = {
 			isa = PBXGroup;
 			children = (
-				BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */,
+				0E764E162ADFF5740043DD4E /* AltBackup.ipa */,
 				BFD247762284B9A700981D42 /* Assets.xcassets */,
 				BF770E6822BD57DD002A40FE /* Silence.m4a */,
 			);
@@ -1694,6 +1699,7 @@
 				D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */,
 				D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */,
 				D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */,
+				D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */,
 				BF7B44062725A4B8005288A4 /* Patch App */,
 			);
 			path = Operations;
@@ -1780,32 +1786,26 @@
 			isa = PBXHeadersBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				0EA166682ADFE122003015C1 /* jsmn.h in Headers */,
 				BF4588112298D3AB00BD7491 /* misagent.h in Headers */,
 				BF4588042298D3AB00BD7491 /* lockdown.h in Headers */,
 				BF45880B2298D3AB00BD7491 /* mobilesync.h in Headers */,
 				BF4588002298D3AB00BD7491 /* restore.h in Headers */,
 				BF4588152298D3AB00BD7491 /* mobilebackup.h in Headers */,
 				BF4588182298D3AB00BD7491 /* syslog_relay.h in Headers */,
-				BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */,
 				BF45881D2298D3AB00BD7491 /* file_relay.h in Headers */,
-				BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */,
 				BF4587FD2298D3AB00BD7491 /* sbservices.h in Headers */,
 				BF4588362298D3C100BD7491 /* debug.h in Headers */,
 				BF4588202298D3AB00BD7491 /* mobile_image_mounter.h in Headers */,
 				BF4588122298D3AB00BD7491 /* house_arrest.h in Headers */,
 				BF45881F2298D3AB00BD7491 /* device_link_service.h in Headers */,
-				BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */,
 				BF45880E2298D3AB00BD7491 /* debugserver.h in Headers */,
 				BF4588102298D3AB00BD7491 /* heartbeat.h in Headers */,
 				BF4587FA2298D3AB00BD7491 /* diagnostics_relay.h in Headers */,
-				BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */,
-				BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */,
 				BF4588192298D3AB00BD7491 /* webinspector.h in Headers */,
 				BF4588342298D3C100BD7491 /* userpref.h in Headers */,
 				BF45880A2298D3AB00BD7491 /* screenshotr.h in Headers */,
-				BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */,
 				BF4587FE2298D3AB00BD7491 /* mobilebackup2.h in Headers */,
-				BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */,
 				BF45881C2298D3AB00BD7491 /* afc.h in Headers */,
 				BF45881A2298D3AB00BD7491 /* mobileactivation.h in Headers */,
 				BF4588052298D3AB00BD7491 /* idevice.h in Headers */,
@@ -1813,7 +1813,6 @@
 				BF4587F82298D3AB00BD7491 /* service.h in Headers */,
 				BF4588252298D3AB00BD7491 /* property_list_service.h in Headers */,
 				BF4588132298D3AB00BD7491 /* notification_proxy.h in Headers */,
-				BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -2209,7 +2208,6 @@
 				BFE60738231ADF49002B0E8E /* Settings.storyboard in Resources */,
 				D57DF638271E32F000677701 /* PatchApp.storyboard in Resources */,
 				BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */,
-				BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */,
 				BF770E6922BD57DD002A40FE /* Silence.m4a in Resources */,
 				BFD247772284B9A700981D42 /* Assets.xcassets in Resources */,
 				1920B04F2924AC8300744F60 /* Settings.bundle in Resources */,
@@ -2217,6 +2215,7 @@
 				BFB6B22423187A3D0022A802 /* NewsCollectionViewCell.xib in Resources */,
 				BFD247752284B9A500981D42 /* Main.storyboard in Resources */,
 				BFDB5B2622EFBBEA00F74113 /* BrowseCollectionViewCell.xib in Resources */,
+				0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */,
 				BFE6073C231AE1E7002B0E8E /* SettingsHeaderFooterView.xib in Resources */,
 				BF29012F2318F6B100D88A45 /* AppBannerView.xib in Resources */,
 				BFE6325A22A83BEB00F30809 /* Authentication.storyboard in Resources */,
@@ -2292,69 +2291,73 @@
 			isa = PBXSourcesBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */,
+				0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */,
+				0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */,
+				0EA166742ADFE140003015C1 /* Date.cpp in Sources */,
+				0EA166712ADFE140003015C1 /* Key.cpp in Sources */,
+				0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */,
+				0EA1666A2ADFE140003015C1 /* String.cpp in Sources */,
+				0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */,
+				0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */,
+				0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */,
+				0EA166702ADFE140003015C1 /* Node.cpp in Sources */,
+				0EA166752ADFE140003015C1 /* Real.cpp in Sources */,
+				0EA166762ADFE140003015C1 /* base64.c in Sources */,
+				0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */,
 				BF45881B2298D3AB00BD7491 /* house_arrest.c in Sources */,
-				BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */,
+				0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */,
 				BF4588232298D3AB00BD7491 /* mobilesync.c in Sources */,
 				BF4588072298D3AB00BD7491 /* afc.c in Sources */,
-				191E607D290B2EA5001A3B7C /* jsmn.c in Sources */,
-				191E607E290B2EA7001A3B7C /* jplist.c in Sources */,
 				BF4588082298D3AB00BD7491 /* mobile_image_mounter.c in Sources */,
-				BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */,
 				BF4588022298D3AB00BD7491 /* file_relay.c in Sources */,
 				BF45880F2298D3AB00BD7491 /* debugserver.c in Sources */,
+				0EA166792ADFE140003015C1 /* bplist.c in Sources */,
+				0EA166772ADFE140003015C1 /* jplist.c in Sources */,
 				BF4588162298D3AB00BD7491 /* restore.c in Sources */,
-				BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */,
-				BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */,
 				BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */,
 				BF4588092298D3AB00BD7491 /* installation_proxy.c in Sources */,
+				0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */,
+				0EA1667E2ADFE140003015C1 /* time64.c in Sources */,
 				BF4587FF2298D3AB00BD7491 /* heartbeat.c in Sources */,
 				BF4588222298D3AB00BD7491 /* mobileactivation.c in Sources */,
-				BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */,
 				BF4588212298D3AB00BD7491 /* idevice.c in Sources */,
 				B343F885295F7C5D002B1159 /* tlv.c in Sources */,
-				BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */,
 				BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */,
 				B343F87D295F7C5D002B1159 /* cbuf.c in Sources */,
 				BF4588062298D3AB00BD7491 /* webinspector.c in Sources */,
-				BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */,
 				B343F883295F7C5D002B1159 /* thread.c in Sources */,
 				BF45880D2298D3AB00BD7491 /* mobilebackup.c in Sources */,
-				BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */,
-				BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */,
-				BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */,
 				BF45883A2298D3C100BD7491 /* debug.c in Sources */,
 				B343F881295F7C5D002B1159 /* termcolors.c in Sources */,
+				0EA1667D2ADFE140003015C1 /* xplist.c in Sources */,
 				B343F87E295F7C5D002B1159 /* collection.c in Sources */,
-				BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */,
 				B33FFBAA295F8F78002259E6 /* preboard.c in Sources */,
 				B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */,
 				BF4587FB2298D3AB00BD7491 /* notification_proxy.c in Sources */,
 				BF4588352298D3C100BD7491 /* userpref.c in Sources */,
-				BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */,
+				0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */,
 				B343F87C295F7C5D002B1159 /* opack.c in Sources */,
-				BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */,
-				BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */,
 				B343F884295F7C5D002B1159 /* utils.c in Sources */,
 				BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */,
 				B343F87F295F7C5D002B1159 /* glue.c in Sources */,
-				BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */,
 				BF4588242298D3AB00BD7491 /* property_list_service.c in Sources */,
 				BF45881E2298D3AB00BD7491 /* misagent.c in Sources */,
+				0EA166692ADFE140003015C1 /* Array.cpp in Sources */,
 				B343F880295F7C5D002B1159 /* socket.c in Sources */,
 				BF4587FC2298D3AB00BD7491 /* sbservices.c in Sources */,
-				BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */,
+				0EA166782ADFE140003015C1 /* jsmn.c in Sources */,
 				BF4588142298D3AB00BD7491 /* device_link_service.c in Sources */,
 				BF4588172298D3AB00BD7491 /* screenshotr.c in Sources */,
-				BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */,
-				BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */,
 				BF4588432298D40000BD7491 /* libusbmuxd.c in Sources */,
+				0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */,
+				0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */,
 				BF4588032298D3AB00BD7491 /* syslog_relay.c in Sources */,
 				BF4588272298D3AB00BD7491 /* service.c in Sources */,
-				BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */,
 				BF4588262298D3AB00BD7491 /* lockdown.c in Sources */,
 				BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */,
 				BF45880C2298D3AB00BD7491 /* mobilebackup2.c in Sources */,
-				BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */,
+				0EA4B9BC2AE4A414009209CE /* plist.c in Sources */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -2504,6 +2507,7 @@
 				BFD6B03322DFF20800B86064 /* MyAppsComponents.swift in Sources */,
 				BF41B808233433C100C593A3 /* LoadingState.swift in Sources */,
 				BFF0B69A2322D7D0007A79E1 /* UIScreen+CompactHeight.swift in Sources */,
+				D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */,
 				D5F2F6A92720B7C20081CCF5 /* PatchViewController.swift in Sources */,
 				B39F16132918D7C5002E9404 /* Consts.swift in Sources */,
 				BF8F69C222E659F700049BA1 /* AppContentViewController.swift in Sources */,
@@ -3221,9 +3225,10 @@
 				);
 				LIBRARY_SEARCH_PATHS = (
 					"$(inherited)",
-					"$(PROJECT_DIR)/Dependencies/fragmentzip",
+					"$(PROJECT_DIR)/Dependencies/libfragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
 				);
+				OTHER_LDFLAGS = "";
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
@@ -3255,9 +3260,10 @@
 				);
 				LIBRARY_SEARCH_PATHS = (
 					"$(inherited)",
-					"$(PROJECT_DIR)/Dependencies/fragmentzip",
+					"$(PROJECT_DIR)/Dependencies/libfragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
 				);
+				OTHER_LDFLAGS = "";
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
--- a/AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved
+++ b/AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved
@@ -6,7 +6,7 @@
      "location" : "https://github.com/SideStore/AltSign",
      "state" : {
        "branch" : "master",
-        "revision" : "7e0e7edcf8fbc44ac1e35da3e9030a297aa18b84"
+        "revision" : "cc6189f0f7cd8e5bd24943af9322e0ff9420e9f4"
      }
    },
    {
@@ -14,8 +14,17 @@
      "kind" : "remoteSourceControl",
      "location" : "https://github.com/microsoft/appcenter-sdk-apple.git",
      "state" : {
-        "revision" : "8354a50fe01a7e54e196d3b5493b5ab53dd5866a",
-        "version" : "4.4.2"
+        "revision" : "b2dc99cfedead0bad4e6573d86c5228c89cff332",
+        "version" : "4.4.3"
+      }
+    },
+    {
+      "identity" : "imobiledevice.swift",
+      "kind" : "remoteSourceControl",
+      "location" : "https://github.com/SideStore/iMobileDevice.swift",
+      "state" : {
+        "revision" : "74e481106dd155c0cd21bca6795fd9fe5f751654",
+        "version" : "1.0.5"
      }
    },
    {
@@ -50,8 +59,8 @@
      "kind" : "remoteSourceControl",
      "location" : "https://github.com/krzyzanowskim/OpenSSL",
      "state" : {
-        "revision" : "033fcb41dac96b1b6effa945ca1f9ade002370b2",
-        "version" : "1.1.1501"
+        "revision" : "0faf71a188bcfdf0245cab42886b9b240ca71c52",
+        "version" : "1.1.2200"
      }
    },
    {
@@ -59,8 +68,8 @@
      "kind" : "remoteSourceControl",
      "location" : "https://github.com/microsoft/PLCrashReporter.git",
      "state" : {
-        "revision" : "6b27393cad517c067dceea85fadf050e70c4ceaa",
-        "version" : "1.10.1"
+        "revision" : "81cdec2b3827feb03286cb297f4c501a8eb98df1",
+        "version" : "1.10.2"
      }
    },
    {
@@ -68,8 +77,8 @@
      "kind" : "remoteSourceControl",
      "location" : "https://github.com/SwiftPackageIndex/SemanticVersion.git",
      "state" : {
-        "revision" : "fc670910dc0903cc269b3d0b776cda5703979c4e",
-        "version" : "0.3.5"
+        "revision" : "a70840d5fca686ae3bd2fcf8aecc5ded0bd4f125",
+        "version" : "0.3.6"
      }
    },
    {
@@ -77,8 +86,8 @@
      "kind" : "remoteSourceControl",
      "location" : "https://github.com/sparkle-project/Sparkle.git",
      "state" : {
-        "revision" : "286edd1fa22505a9e54d170e9fd07d775ea233f2",
-        "version" : "2.1.0"
+        "revision" : "f0ceaf5cc9f3f23daa0ccb6dcebd79fc96ccc7d9",
+        "version" : "2.5.0"
      }
    },
    {
@@ -86,8 +95,8 @@
      "kind" : "remoteSourceControl",
      "location" : "https://github.com/daltoniam/Starscream.git",
      "state" : {
-        "revision" : "df8d82047f6654d8e4b655d1b1525c64e1059d21",
-        "version" : "4.0.4"
+        "revision" : "ac6c0fc9da221873e01bd1a0d4818498a71eef33",
+        "version" : "4.0.6"
      }
    },
    {
--- a/Detail/AppViewController.swift
+++ b/Detail/AppViewController.swift
@@ -217,8 +217,8 @@ final class AppViewController: UIViewController
                        
            self._shouldResetLayout = false
        }
-        
-        let statusBarHeight = UIApplication.shared.statusBarFrame.height
+                
+        let statusBarHeight = self.view.window?.windowScene?.statusBarManager?.statusBarFrame.height ?? 0
        let cornerRadius = self.contentViewControllerShadowView.layer.cornerRadius
        
        let inset = 12 as CGFloat
@@ -323,7 +323,7 @@ final class AppViewController: UIViewController
        
        self.backButtonContainerView.layer.cornerRadius = self.backButtonContainerView.bounds.midY
        
-        self.scrollView.scrollIndicatorInsets.top = statusBarHeight
+        self.scrollView.verticalScrollIndicatorInsets.top = statusBarHeight
        
        // Adjust content offset + size.
        let contentOffset = self.scrollView.contentOffset
--- a/IDs/AppIDsViewController.swift
+++ b/IDs/AppIDsViewController.swift
@@ -91,13 +91,18 @@ private extension AppIDsViewController
                
                cell.bannerView.buttonLabel.isHidden = false
                
-                let currentDate = Date()
+                let formatter = DateComponentsFormatter()
+                formatter.unitsStyle = .full
+                formatter.includesApproximationPhrase = false
+                formatter.includesTimeRemainingPhrase = false
+                formatter.allowedUnits = [.minute, .hour, .day]
+                formatter.maximumUnitCount = 1
                
-                let numberOfDays = expirationDate.numberOfCalendarDays(since: currentDate)
-                let numberOfDaysText = (numberOfDays == 1) ? NSLocalizedString("1 day", comment: "") : String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
-                cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
+                cell.bannerView.button.setTitle(formatter.string(from: Date(), to: expirationDate)?.uppercased(), for: .normal)
                
-                attributedAccessibilityLabel.mutableString.append(String(format: NSLocalizedString("Expires in %@.", comment: ""), numberOfDaysText) + " ")
+                formatter.includesTimeRemainingPhrase = true
+                
+                attributedAccessibilityLabel.mutableString.append((formatter.string(from: Date(), to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " ")
            }
            else
            {
@@ -206,7 +211,7 @@ extension AppIDsViewController: UICollectionViewDelegateFlowLayout
                **App IDs can't be deleted**, but they do expire after one week. SideStore will automatically renew App IDs for all active apps once they've expired.
                """, comment: "")
                
-                let attributedText = NSAttributedString(markdownRepresentation: text, attributes: [.font: headerView.textLabel.font as Any])
+                let attributedText = NSAttributedString(markdownRepresentation: text)
                headerView.textLabel.attributedText = attributedText
            }
            else
--- a/AltStore/Browse/BrowseViewController.swift
+++ b/AltStore/Browse/BrowseViewController.swift
@@ -8,6 +8,7 @@

 import UIKit

+import minimuxer
 import AltStoreCore
 import Roxas

@@ -264,7 +265,13 @@ private extension BrowseViewController
            previousProgress?.cancel()
            return
        }
-        
+
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
        _ = AppManager.shared.install(app, presentingViewController: self) { (result) in
            DispatchQueue.main.async {
                switch result
--- a/AltStore/Components/CollapsingTextView.swift
+++ b/AltStore/Components/CollapsingTextView.swift
@@ -22,7 +22,7 @@ final class CollapsingTextView: UITextView
        }
    }
    
-    var lineSpacing: CGFloat = 2 {
+    var lineSpacing: Double = 2 {
        didSet {
            self.setNeedsLayout()
        }
@@ -34,7 +34,19 @@ final class CollapsingTextView: UITextView
    {
        super.awakeFromNib()
        
-        self.layoutManager.delegate = self
+        self.initialize()
+    }
+    
+    private func initialize()
+    {
+        if #available(iOS 16, *)
+        {
+            self.updateText()
+        }
+        else
+        {
+            self.layoutManager.delegate = self
+        }
        
        self.textContainerInset = .zero
        self.textContainer.lineFragmentPadding = 0
@@ -108,6 +120,25 @@ private extension CollapsingTextView
    {
        self.isCollapsed.toggle()
    }
+    
+    @available(iOS 16, *)
+    func updateText()
+    {
+        do
+        {
+            let style = NSMutableParagraphStyle()
+            style.lineSpacing = self.lineSpacing
+            
+            var attributedText = try AttributedString(self.attributedText, including: \.uiKit)
+            attributedText[AttributeScopes.UIKitAttributes.ParagraphStyleAttribute.self] = style
+            
+            self.attributedText = NSAttributedString(attributedText)
+        }
+        catch
+        {
+            print("[ALTLog] Failed to update CollapsingTextView line spacing:", error)
+        }
+    }
 }

 extension CollapsingTextView: NSLayoutManagerDelegate
--- a/AltStore/Components/PillButton.swift
+++ b/AltStore/Components/PillButton.swift
@@ -8,6 +8,12 @@

 import UIKit

+extension PillButton
+{
+    static let minimumSize = CGSize(width: 77, height: 31)
+    static let contentInsets = NSDirectionalEdgeInsets(top: 7, leading: 13, bottom: 7, trailing: 13)
+}
+
 final class PillButton: UIButton
 {
    override var accessibilityValue: String? {
@@ -70,9 +76,7 @@ final class PillButton: UIButton
    }()
    
    override var intrinsicContentSize: CGSize {
-        var size = super.intrinsicContentSize
-        size.width += 26
-        size.height += 3
+        let size = self.sizeThatFits(CGSize(width: Double.infinity, height: .infinity))
        return size
    }
    
@@ -88,6 +92,8 @@ final class PillButton: UIButton
        self.layer.masksToBounds = true
        self.accessibilityTraits.formUnion([.updatesFrequently, .button])
        
+        self.contentEdgeInsets = UIEdgeInsets(top: Self.contentInsets.top, left: Self.contentInsets.leading, bottom: Self.contentInsets.bottom, right: Self.contentInsets.trailing)
+        
        self.activityIndicatorView.style = .medium
        self.activityIndicatorView.isUserInteractionEnabled = false
        
@@ -119,6 +125,15 @@ final class PillButton: UIButton
        
        self.update()
    }
+    
+    override func sizeThatFits(_ size: CGSize) -> CGSize
+    {
+        var size = super.sizeThatFits(size)
+        size.width = max(size.width, PillButton.minimumSize.width)
+        size.height = max(size.height, PillButton.minimumSize.height)
+        
+        return size
+    }
 }

 private extension PillButton
--- a/AltStore/Info.plist
+++ b/AltStore/Info.plist
@@ -14,7 +14,7 @@
 	<key>ALTPairingFile</key>
 	<string>&lt;insert pairing file here&gt;</string>
 	<key>ALTAnisetteURL</key>
-	<string>http://ani.sidestore.io:6969</string>
+	<string>https://ani.sidestore.io</string>
 	<key>CFBundleDevelopmentRegion</key>
 	<string>$(DEVELOPMENT_LANGUAGE)</string>
 	<key>CFBundleDocumentTypes</key>
--- a/AltStore/LaunchViewController.swift
+++ b/AltStore/LaunchViewController.swift
@@ -81,7 +81,7 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
        } else {
            // Show an alert explaining the pairing file
            // Create new Alert
-            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/install#pairing-process", preferredStyle: .alert)
+            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/getting-started/#pairing-file", preferredStyle: .alert)
            
            // Create OK button with action handler
            let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
@@ -155,7 +155,12 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
            try! FileManager.default.removeItem(at: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)"))
            displayError("minimuxer failed to start, please restart SideStore. \((error as? LocalizedError)?.failureReason ?? "UNKNOWN ERROR!!!!!! REPORT TO GITHUB ISSUES!")")
        }
-        start_auto_mounter(documentsDirectory)
+        if #available(iOS 17, *) {
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
+        }
    }
 }

--- a/Apps/AppManager.swift
+++ b/Apps/AppManager.swift
@@ -307,6 +307,16 @@ extension AppManager
            presentingViewController.present(alertController, animated: true, completion: nil)
        }
    }
+    
+    func clearAppCache(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let clearAppCacheOperation = ClearAppCacheOperation()
+        clearAppCacheOperation.resultHandler = { result in
+            completion(result)
+        }
+        
+        self.run([clearAppCacheOperation], context: nil)
+    }
 }

 extension AppManager
@@ -754,6 +764,12 @@ extension AppManager
        let progress = self.refreshProgress[app.bundleIdentifier]
        return progress
    }
+    
+    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
+    {
+        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
+        return isActivelyManaging
+    }
 }

 extension AppManager
@@ -808,12 +824,6 @@ private extension AppManager
        }
    }
    
-    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
-    {
-        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
-        return isActivelyManaging
-    }
-    
    @discardableResult
    private func perform(_ operations: [AppOperation], presentingViewController: UIViewController?, group: RefreshGroup) -> RefreshGroup
    {
@@ -1027,6 +1037,32 @@ private extension AppManager
        verifyOperation.addDependency(downloadOperation)
        
        
+        /* Refresh Anisette Data */
+        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
+        refreshAnisetteDataOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
+            }
+        }
+        refreshAnisetteDataOperation.addDependency(verifyOperation)
+
+
+        /* Fetch Provisioning Profiles */
+        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
+        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
+        fetchProvisioningProfilesOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
+            }
+        }
+        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
+        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
+
+
        /* Deactivate Apps (if necessary) */
        let deactivateAppsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
            do
@@ -1042,6 +1078,12 @@ private extension AppManager
                {
                    throw error
                }
+                
+                guard let profiles = context.provisioningProfiles else { throw OperationError.invalidParameters }
+                if !profiles.contains(where: { $1.isFreeProvisioningProfile == true }) {
+                    operation.finish()
+                    return
+                }
                                
                guard let app = context.app, let presentingViewController = context.authenticatedContext.presentingViewController else { throw OperationError.invalidParameters }
                
@@ -1061,7 +1103,7 @@ private extension AppManager
                operation.finish()
            }
        }
-        deactivateAppsOperation.addDependency(verifyOperation)
+        deactivateAppsOperation.addDependency(fetchProvisioningProfilesOperation)
        
        
        /* Patch App */
@@ -1136,32 +1178,6 @@ private extension AppManager
        patchAppOperation.addDependency(deactivateAppsOperation)
        
        
-        /* Refresh Anisette Data */
-        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
-        refreshAnisetteDataOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
-            }
-        }
-        refreshAnisetteDataOperation.addDependency(patchAppOperation)
-        
-        
-        /* Fetch Provisioning Profiles */
-        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
-        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
-        fetchProvisioningProfilesOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
-            }
-        }
-        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
-        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
-        
-        
        /* Resign */
        let resignAppOperation = ResignAppOperation(context: context)
        resignAppOperation.resultHandler = { (result) in
@@ -1171,7 +1187,7 @@ private extension AppManager
            case .success(let resignedApp): context.resignedApp = resignedApp
            }
        }
-        resignAppOperation.addDependency(fetchProvisioningProfilesOperation)
+        resignAppOperation.addDependency(patchAppOperation)
        progress.addChild(resignAppOperation.progress, withPendingUnitCount: 20)
        
        
@@ -1214,7 +1230,7 @@ private extension AppManager
        progress.addChild(installOperation.progress, withPendingUnitCount: 30)
        installOperation.addDependency(sendAppOperation)
        
-        let operations = [downloadOperation, verifyOperation, deactivateAppsOperation, patchAppOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, resignAppOperation, sendAppOperation, installOperation]
+        let operations = [downloadOperation, verifyOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, deactivateAppsOperation, patchAppOperation, resignAppOperation, sendAppOperation, installOperation]
        group.add(operations)
        self.run(operations, context: group.context)
        
--- a/Apps/MyAppsViewController.swift
+++ b/Apps/MyAppsViewController.swift
@@ -10,10 +10,12 @@ import UIKit
 import MobileCoreServices
 import Intents
 import Combine
+import UniformTypeIdentifiers

 import AltStoreCore
 import AltSign
 import Roxas
+import minimuxer

 import Nuke

@@ -327,21 +329,25 @@ private extension MyAppsViewController
            let currentDate = Date()
            
            let numberOfDays = installedApp.expirationDate.numberOfCalendarDays(since: currentDate)
-            let numberOfDaysText: String
            
-            if numberOfDays == 1
-            {
-                numberOfDaysText = NSLocalizedString("1 day", comment: "")
-            }
-            else
-            {
-                numberOfDaysText = String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
-            }
+            let formatter = DateComponentsFormatter()
+            formatter.unitsStyle = .full
+            formatter.includesApproximationPhrase = false
+            formatter.includesTimeRemainingPhrase = false
+            
+            formatter.allowedUnits = [.day, .hour, .minute]
+            
+            formatter.maximumUnitCount = 1
+            
+            
+            
+            cell.bannerView.button.setTitle(formatter.string(from: currentDate, to: installedApp.expirationDate)?.uppercased(), for: .normal)
            
-            cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
            cell.bannerView.button.accessibilityLabel = String(format: NSLocalizedString("Refresh %@", comment: ""), installedApp.name)
-            
-            cell.bannerView.accessibilityLabel? += ". " + String(format: NSLocalizedString("Expires in %@", comment: ""), numberOfDaysText)
+
+            formatter.includesTimeRemainingPhrase = true
+
+            cell.bannerView.accessibilityLabel? += ". " + (formatter.string(from: currentDate, to: installedApp.expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " "
            
            // Make sure refresh button is correct size.
            cell.layoutIfNeeded()
@@ -639,6 +645,12 @@ private extension MyAppsViewController
    
    @IBAction func refreshAllApps(_ sender: UIBarButtonItem)
    {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
        self.isRefreshingAllApps = true
        self.collectionView.collectionViewLayout.invalidateLayout()

@@ -701,18 +713,15 @@ private extension MyAppsViewController
    
    @IBAction func sideloadApp(_ sender: UIBarButtonItem)
    {
-        let supportedTypes: [String]
-        
-        if let types = UTTypeCreateAllIdentifiersForTag(kUTTagClassFilenameExtension, "ipa" as CFString, nil)?.takeRetainedValue()
-        {
-            supportedTypes = (types as NSArray).map { $0 as! String }
-        }
-        else
-        {
-            supportedTypes = ["com.apple.itunes.ipa"] // Declared by the system.
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
        }
+
+        let supportedTypes = UTType.types(tag: "ipa", tagClass: .filenameExtension, conformingTo: nil)
        
-        let documentPickerViewController = UIDocumentPickerViewController(documentTypes: supportedTypes, in: .import)
+        let documentPickerViewController = UIDocumentPickerViewController(forOpeningContentTypes: supportedTypes, asCopy: true)
        documentPickerViewController.delegate = self
        self.present(documentPickerViewController, animated: true, completion: nil)
    }
@@ -1014,6 +1023,12 @@ private extension MyAppsViewController
    
    func refresh(_ installedApp: InstalledApp)
    {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
        let previousProgress = AppManager.shared.refreshProgress(for: installedApp)
        guard previousProgress == nil else {
            previousProgress?.cancel()
@@ -1035,6 +1050,12 @@ private extension MyAppsViewController
    
    func activate(_ installedApp: InstalledApp)
    {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
        func finish(_ result: Result<InstalledApp, Error>)
        {
            do
@@ -1111,6 +1132,11 @@ private extension MyAppsViewController
    func deactivate(_ installedApp: InstalledApp, completionHandler: ((Result<InstalledApp, Error>) -> Void)? = nil)
    {
        guard installedApp.isActive else { return }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
        installedApp.isActive = false
        
        AppManager.shared.deactivate(installedApp, presentingViewController: self) { (result) in
@@ -1172,6 +1198,11 @@ private extension MyAppsViewController
    
    func backup(_ installedApp: InstalledApp)
    {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
        let title = NSLocalizedString("Start Backup?", comment: "")
        let message = NSLocalizedString("This will replace any previous backups. Please leave SideStore open until the backup is complete.", comment: "")

@@ -1211,6 +1242,11 @@ private extension MyAppsViewController
    
    func restore(_ installedApp: InstalledApp)
    {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
        let message = String(format: NSLocalizedString("This will replace all data you currently have in %@.", comment: ""), installedApp.name)
        let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to restore this backup?", comment: ""), message: message, preferredStyle: .actionSheet)
        alertController.addAction(.cancel)
@@ -1246,8 +1282,11 @@ private extension MyAppsViewController
    {
        guard let backupURL = FileManager.default.backupDirectoryURL(for: installedApp) else { return }
        
-        let documentPicker = UIDocumentPickerViewController(url: backupURL, in: .exportToService)
-        documentPicker.delegate = self
+        let documentPicker = UIDocumentPickerViewController(forExporting: [backupURL], asCopy: true)
+        
+        // Don't set delegate to avoid conflicting with import callbacks.
+        // documentPicker.delegate = self
+        
        self.present(documentPicker, animated: true, completion: nil)
    }
    
@@ -1311,6 +1350,16 @@ private extension MyAppsViewController
    @available(iOS 14, *)
    func enableJIT(for installedApp: InstalledApp)
    {
+        if #available(iOS 17, *) {
+            let toastView = ToastView(error: OperationError.tooNewError)
+            toastView.show(in: self)
+            return
+        }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
        AppManager.shared.enableJIT(for: installedApp) { result in
            DispatchQueue.main.async {
                switch result
@@ -1318,7 +1367,7 @@ private extension MyAppsViewController
                case .success: break
                case .failure(let error):
                    let toastView = ToastView(error: error)
-                    toastView.show(in: self)
+                    toastView.show(in: self.navigationController?.view ?? self.view, duration: 5)
                }
            }
        }
@@ -1465,7 +1514,7 @@ extension MyAppsViewController
                let registeredAppIDs = team.appIDs.count
                
                let maximumAppIDCount = 10
-                let remainingAppIDs = max(maximumAppIDCount - registeredAppIDs, 0)
+                let remainingAppIDs = maximumAppIDCount - registeredAppIDs
                
                if remainingAppIDs == 1
                {
@@ -1476,7 +1525,7 @@ extension MyAppsViewController
                    footerView.textLabel.text = String(format: NSLocalizedString("%@ App IDs Remaining", comment: ""), NSNumber(value: remainingAppIDs))
                }
                
-                footerView.textLabel.isHidden = false
+                footerView.textLabel.isHidden = remainingAppIDs < 0
                
            case .individual, .organization, .unknown: footerView.textLabel.isHidden = true
            @unknown default: break
@@ -2050,15 +2099,8 @@ extension MyAppsViewController: UIDocumentPickerDelegate
    {
        guard let fileURL = urls.first else { return }
        
-        switch controller.documentPickerMode
-        {
-        case .import, .open:
-            self.sideloadApp(at: fileURL) { (result) in
-                print("Sideloaded app at \(fileURL) with result:", result)
-            }
-        
-        case .exportToService, .moveToService: break
-        @unknown default: break
+        self.sideloadApp(at: fileURL) { (result) in
+            print("Sideloaded app at \(fileURL) with result:", result)
        }
    }
 }
--- a/AltStore/News/NewsViewController.swift
+++ b/AltStore/News/NewsViewController.swift
@@ -426,6 +426,10 @@ extension NewsViewController: UICollectionViewDelegateFlowLayout
            return previousSize
        }
        
+        // Take layout margins into account.
+        self.prototypeCell.layoutMargins.left = self.view.layoutMargins.left
+        self.prototypeCell.layoutMargins.right = self.view.layoutMargins.right
+        
        let widthConstraint = self.prototypeCell.contentView.widthAnchor.constraint(equalToConstant: collectionView.bounds.width)
        NSLayoutConstraint.activate([widthConstraint])
        defer { NSLayoutConstraint.deactivate([widthConstraint]) }
--- a/AltStore/Operations/AuthenticationOperation.swift
+++ b/AltStore/Operations/AuthenticationOperation.swift
@@ -12,6 +12,7 @@ import Network

 import AltStoreCore
 import AltSign
+import minimuxer

 enum AuthenticationError: LocalizedError
 {
@@ -593,7 +594,7 @@ private extension AuthenticationOperation
    
    func registerCurrentDevice(for team: ALTTeam, session: ALTAppleAPISession, completionHandler: @escaping (Result<ALTDevice, Error>) -> Void)
    {
-        guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else {
+        guard let udid = fetch_udid()?.toString() else {
            return completionHandler(.failure(OperationError.unknownUDID))
        }
        
--- a/AltStore/Operations/BackgroundRefreshAppsOperation.swift
+++ b/AltStore/Operations/BackgroundRefreshAppsOperation.swift
@@ -105,8 +105,13 @@ final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<Inst
        } catch {
            self.finish(.failure(error))
        }
-        start_auto_mounter(documentsDirectory)
-        
+        if #available(iOS 17, *) {
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
+        }
+
        self.managedObjectContext.perform {
            print("Apps to refresh:", self.installedApps.map(\.bundleIdentifier))
            
--- a/AltStore/Operations/BackupAppOperation.swift
+++ b/AltStore/Operations/BackupAppOperation.swift
@@ -29,6 +29,9 @@ class BackupAppOperation: ResultOperation<Void>
    private var appName: String?
    private var timeoutTimer: Timer?
    
+    private weak var applicationWillReturnObserver: NSObjectProtocol?
+    private weak var backupResponseObserver: NSObjectProtocol?
+    
    init(action: Action, context: InstallAppOperationContext)
    {
        self.action = action
@@ -43,10 +46,7 @@ class BackupAppOperation: ResultOperation<Void>
        
        do
        {
-            if let error = self.context.error
-            {
-                throw error
-            }
+            if let error = self.context.error { throw error }
            
            guard let installedApp = self.context.installedApp, let context = installedApp.managedObjectContext else { throw OperationError.invalidParameters }
            context.perform {
@@ -55,9 +55,8 @@ class BackupAppOperation: ResultOperation<Void>
                    let appName = installedApp.name
                    self.appName = appName
                    
-                    guard let altstoreApp = InstalledApp.fetchAltStore(in: context) else { throw OperationError.appNotFound }
-                    let altstoreOpenURL = altstoreApp.openAppURL
-                    
+                    let altstoreOpenURL = URL(string: "sidestore://")!
+
                    var returnURLComponents = URLComponents(url: altstoreOpenURL, resolvingAgainstBaseURL: false)
                    returnURLComponents?.host = "appBackupResponse"
                    guard let returnURL = returnURLComponents?.url else { throw OperationError.openAppFailed(name: appName) }
@@ -153,8 +152,11 @@ private extension BackupAppOperation
 {
    func registerObservers()
    {
-        var applicationWillReturnObserver: NSObjectProtocol!
-        applicationWillReturnObserver = NotificationCenter.default.addObserver(forName: UIApplication.willEnterForegroundNotification, object: nil, queue: .main) { [weak self] (notification) in
+        self.applicationWillReturnObserver = NotificationCenter.default.addObserver(forName: UIApplication.willEnterForegroundNotification, object: nil, queue: .main) { [weak self] (notification) in
+            defer {
+                self?.applicationWillReturnObserver.map { NotificationCenter.default.removeObserver($0) }
+            }
+
            guard let self = self, !self.isFinished else { return }
            
            self.timeoutTimer = Timer.scheduledTimer(withTimeInterval: 5, repeats: false) { [weak self] (timer) in
@@ -166,18 +168,17 @@ private extension BackupAppOperation
                    self.finish(.failure(OperationError.timedOut))
                }
            }
-            
-            NotificationCenter.default.removeObserver(applicationWillReturnObserver!)
        }
        
-        var backupResponseObserver: NSObjectProtocol!
-        backupResponseObserver = NotificationCenter.default.addObserver(forName: AppDelegate.appBackupDidFinish, object: nil, queue: nil) { [weak self] (notification) in
+        self.backupResponseObserver = NotificationCenter.default.addObserver(forName: AppDelegate.appBackupDidFinish, object: nil, queue: nil) { [weak self] (notification) in
+            defer {
+                self?.backupResponseObserver.map { NotificationCenter.default.removeObserver($0) }
+            }
+            
            self?.timeoutTimer?.invalidate()
            
            let result = notification.userInfo?[AppDelegate.appBackupResultKey] as? Result<Void, Error> ?? .failure(OperationError.unknownResult)
            self?.finish(result)
-            
-            NotificationCenter.default.removeObserver(backupResponseObserver!)
        }
    }
 }
--- a/AltStore/Operations/ClearAppCacheOperation.swift
+++ b/AltStore/Operations/ClearAppCacheOperation.swift
@@ -0,0 +1,208 @@
+//
+//  ClearAppCacheOperation.swift
+//  AltStore
+//
+//  Created by Riley Testut on 9/27/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import Foundation
+import AltStoreCore
+/*
+struct BatchError: ALTLocalizedError
+{
+
+    enum Code: Int, ALTErrorCode
+    {
+        typealias Error = BatchError
+        
+        case batchError
+    }
+
+    var code: Code = .batchError
+    var underlyingErrors: [Error]
+    
+    var errorTitle: String?
+    var errorFailure: String?
+    
+    init(errors: [Error])
+    {
+        self.underlyingErrors = errors
+    }
+    
+    var errorFailureReason: String {
+        guard !self.underlyingErrors.isEmpty else { return NSLocalizedString("An unknown error occured.", comment: "") }
+        
+        let errorMessages = self.underlyingErrors.map { $0.localizedDescription }
+        
+        let message = errorMessages.joined(separator: "\n\n")
+        return message
+    }
+}
+*/
+@objc(ClearAppCacheOperation)
+class ClearAppCacheOperation: ResultOperation<Void>
+{
+    private let coordinator = NSFileCoordinator()
+    private let coordinatorQueue = OperationQueue()
+    
+    override init()
+    {
+        self.coordinatorQueue.name = "AltStore - ClearAppCacheOperation Queue"
+    }
+    
+    override func main()
+    {
+        super.main()
+        
+        var allErrors = [Error]()
+        
+        self.clearTemporaryDirectory { result in
+            switch result
+            {
+            //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+            case .failure(let error): allErrors.append(error)
+            case .success: break
+            }
+            
+            self.removeUninstalledAppBackupDirectories { result in
+                switch result
+                {
+                //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+                case .failure(let error): allErrors.append(error)
+                case .success: break
+                }
+                
+                if allErrors.isEmpty
+                {
+                    self.finish(.success(()))
+                }
+                else
+                {
+                    self.finish(.failure(OperationError.cacheClearError(errors: allErrors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+            }
+        }
+    }
+}
+
+private extension ClearAppCacheOperation
+{
+    func clearTemporaryDirectory(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let intent = NSFileAccessIntent.writingIntent(with: FileManager.default.temporaryDirectory, options: [.forDeleting])
+        self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+            do
+            {
+                if let error
+                {
+                    throw error
+                }
+                
+                let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                           includingPropertiesForKeys: [],
+                                                                           options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                var errors = [Error]()
+                
+                for fileURL in fileURLs
+                {
+                    do
+                    {
+                        print("[ALTLog] Removing item from temporary directory:", fileURL.lastPathComponent)
+                        try FileManager.default.removeItem(at: fileURL)
+                    }
+                    catch
+                    {
+                        print("[ALTLog] Failed to remove \(fileURL.lastPathComponent) from temporary directory.", error)
+                        errors.append(error)
+                    }
+                }
+                
+                if !errors.isEmpty
+                {
+                    completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+                else
+                {
+                    completion(.success(()))
+                }
+            }
+            catch
+            {
+                completion(.failure(error))
+            }
+        }
+    }
+    
+    func removeUninstalledAppBackupDirectories(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        guard let backupsDirectory = FileManager.default.appBackupsDirectory else { return completion(.failure(OperationError.missingAppGroup)) }
+        
+        DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
+            let installedAppBundleIDs = Set(InstalledApp.all(in: context).map { $0.bundleIdentifier })
+            
+            let intent = NSFileAccessIntent.writingIntent(with: backupsDirectory, options: [.forDeleting])
+            self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+                do
+                {
+                    if let error
+                    {
+                        throw error
+                    }
+                    
+                    var isDirectory: ObjCBool = false
+                    guard FileManager.default.fileExists(atPath: intent.url.path, isDirectory: &isDirectory), isDirectory.boolValue else {
+                        completion(.success(()))
+                        return
+                    }
+                    
+                    let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                               includingPropertiesForKeys: [.isDirectoryKey, .nameKey],
+                                                                               options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                    var errors = [Error]()
+                    
+                    
+                    for backupDirectory in fileURLs
+                    {
+                        do
+                        {
+                            let resourceValues = try backupDirectory.resourceValues(forKeys: [.isDirectoryKey, .nameKey])
+                            guard let isDirectory = resourceValues.isDirectory, let bundleID = resourceValues.name else { continue }
+
+                            if isDirectory && !installedAppBundleIDs.contains(bundleID) && !AppManager.shared.isActivelyManagingApp(withBundleID: bundleID)
+                            {
+                                print("[ALTLog] Removing backup directory for uninstalled app:", bundleID)
+                                try FileManager.default.removeItem(at: backupDirectory)
+                            }
+                        }
+                        catch
+                        {
+                            print("[ALTLog] Failed to remove app backup directory:", error)
+                            errors.append(error)
+                        }
+                    }
+                    
+                    if !errors.isEmpty
+                    {
+                        completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                            return error.localizedDescription
+                        }))))
+                    }
+                    else
+                    {
+                        completion(.success(()))
+                    }
+                }
+                catch
+                {
+                    print("[ALTLog] Failed to remove app backup directory:", error)
+                    completion(.failure(error))
+                }
+            }
+        }
+    }
+}
--- a/AltStore/Operations/DeactivateAppOperation.swift
+++ b/AltStore/Operations/DeactivateAppOperation.swift
@@ -31,11 +31,7 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
    {
        super.main()
        
-        if let error = self.context.error
-        {
-            self.finish(.failure(error))
-            return
-        }
+        if let error = self.context.error { return self.finish(.failure(error)) }
        
        DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
            let installedApp = context.object(with: self.app.objectID) as! InstalledApp
@@ -45,14 +41,14 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
            for profile in allIdentifiers {
                do {
                    try remove_provisioning_profile(profile)
+                    self.progress.completedUnitCount += 1
+                    installedApp.isActive = false
+                    self.finish(.success(installedApp))
+                    break
                } catch {
-                    return self.finish(.failure(error))
+                    self.finish(.failure(error))
                }
            }
-            
-            self.progress.completedUnitCount += 1
-            installedApp.isActive = false
-            self.finish(.success(installedApp))
        }
    }
 }
--- a/AltStore/Operations/EnableJITOperation.swift
+++ b/AltStore/Operations/EnableJITOperation.swift
@@ -45,13 +45,19 @@ final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
        guard let installedApp = self.context.installedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
        
        installedApp.managedObjectContext?.perform {
-            do {
-                try debug_app(installedApp.resignedBundleIdentifier)
-            } catch {
-                return self.finish(.failure(error))
+            var retries = 3
+            while (retries > 0){
+                do {
+                    try debug_app(installedApp.resignedBundleIdentifier)
+                    self.finish(.success(()))
+                    retries = 0
+                } catch {
+                    retries -= 1
+                    if (retries <= 0){
+                        self.finish(.failure(error))
+                    }
+                }
            }
-            
-            self.finish(.success(()))
        }
    }
 }
--- a/AltStore/Operations/FetchAnisetteDataOperation.swift
+++ b/AltStore/Operations/FetchAnisetteDataOperation.swift
@@ -218,7 +218,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
        self.socket.connect()
    }
    
-    func didReceive(event: WebSocketEvent, client: WebSocket) {
+    func didReceive(event: WebSocketEvent, client: WebSocketClient) {
        switch event {
        case .text(let string):
            do {
@@ -429,7 +429,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
    }
 }

-extension WebSocket {
+extension WebSocketClient {
    func json(_ dictionary: [String: String]) {
        let data = try! JSONSerialization.data(withJSONObject: dictionary, options: [])
        self.write(string: String(data: data, encoding: .utf8)!)
--- a/AltStore/Operations/FetchProvisioningProfilesOperation.swift
+++ b/AltStore/Operations/FetchProvisioningProfilesOperation.swift
@@ -262,10 +262,6 @@ extension FetchProvisioningProfilesOperation
                            {
                                throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
                            }
-                            else
-                            {
-                                throw ALTAppleAPIError(.maximumAppIDLimitReached)
-                            }
                        }
                    }
                    //App ID name must be ascii. If the name is not ascii, using bundleID instead
--- a/AltStore/Operations/InstallAppOperation.swift
+++ b/AltStore/Operations/InstallAppOperation.swift
@@ -41,7 +41,8 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
        
        guard
            let certificate = self.context.certificate,
-            let resignedApp = self.context.resignedApp
+            let resignedApp = self.context.resignedApp,
+            let provisioningProfiles = self.context.provisioningProfiles
        else { return self.finish(.failure(OperationError.invalidParameters)) }
        
        let backgroundContext = DatabaseManager.shared.persistentContainer.newBackgroundContext()
@@ -116,8 +117,7 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
            // Temporary directory and resigned .ipa no longer needed, so delete them now to ensure AltStore doesn't quit before we get the chance to.
            self.cleanUp()
            
-            var activeProfiles: Set<String>?
-            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit
+            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit, provisioningProfiles.contains(where: { $1.isFreeProvisioningProfile == true })
            {
                // When installing these new profiles, AltServer will remove all non-active profiles to ensure we remain under limit.
                
@@ -142,15 +142,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                        installedApp.isActive = false
                    }
                }
-
-                activeProfiles = Set(activeApps.flatMap { (installedApp) -> [String] in
-                    let appExtensionProfiles = installedApp.appExtensions.map { $0.resignedBundleIdentifier }
-                    return [installedApp.resignedBundleIdentifier] + appExtensionProfiles
-                })
+            }
+            else
+            {
+                installedApp.isActive = true
            }
            
            var installing = true
-            if installedApp.storeApp?.bundleIdentifier == Bundle.Info.appbundleIdentifier {
+            if installedApp.storeApp?.bundleIdentifier.range(of: Bundle.Info.appbundleIdentifier) != nil {
                // Reinstalling ourself will hang until we leave the app, so we need to exit it without force closing
                DispatchQueue.main.asyncAfter(deadline: .now() + 3) {
                    if UIApplication.shared.applicationState != .active {
@@ -162,30 +161,26 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                        return
                    }
                    print("We are still installing after 3 seconds")
-                    
                    UNUserNotificationCenter.current().getNotificationSettings { settings in
                        switch (settings.authorizationStatus) {
                        case .authorized, .ephemeral, .provisional:
                            print("Notifications are enabled")
-                            
+
                            let content = UNMutableNotificationContent()
                            content.title = "Refreshing..."
-                            content.body = "To finish refreshing, SideStore must be moved to the background, which it does by opening Safari. Please reopen SideStore after it is done refreshing!"
+                            content.body = "SideStore will automatically move to the homescreen to finish refreshing!"
                            let notification = UNNotificationRequest(identifier: Bundle.Info.appbundleIdentifier + ".FinishRefreshNotification", content: content, trigger: UNTimeIntervalNotificationTrigger(timeInterval: 2, repeats: false))
                            UNUserNotificationCenter.current().add(notification)
-                            
-                            DispatchQueue.main.async { UIApplication.shared.open(URL(string: "x-web-search://")!) }
-                            
                            break
                        default:
                            print("Notifications are not enabled")
-                            
-                            let alert = UIAlertController(title: "Finish Refresh", message: "To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen or open Safari by pressing Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
+
+                            let alert = UIAlertController(title: "Finish Refresh", message: "Please reopen SideStore after the process is finished.To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen manually or by hitting Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
                            alert.addAction(UIAlertAction(title: NSLocalizedString("Continue", comment: ""), style: .default, handler: { _ in
-                                print("Opening Safari")
-                                DispatchQueue.main.async { UIApplication.shared.open(URL(string: "x-web-search://")!) }
+                                print("Going home")
+                                UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
                            }))
-                            
+
                            DispatchQueue.main.async {
                                let keyWindow = UIApplication.shared.windows.filter { $0.isKeyWindow }.first
                                if var topController = keyWindow?.rootViewController {
@@ -194,27 +189,24 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                                    }
                                    topController.present(alert, animated: true)
                                } else {
-                                    print("No key window? Let's just open Safari")
-                                    UIApplication.shared.open(URL(string: "x-web-search://")!)
+                                    print("No key window? Let's just go home")
                                }
                            }
-                            
-                            break
                        }
                    }
+                    UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
                }
            }
            
            do {
                try install_ipa(installedApp.bundleIdentifier)
                installing = false
-            } catch {
+                installedApp.refreshedDate = Date()
+                self.finish(.success(installedApp))
+            } catch let error {
                installing = false
-                return self.finish(.failure(error))
+                self.finish(.failure(error))
            }
-            
-            installedApp.refreshedDate = Date()
-            self.finish(.success(installedApp))
        }
    }
    
--- a/AltStore/Operations/OperationError.swift
+++ b/AltStore/Operations/OperationError.swift
@@ -34,10 +34,14 @@ enum OperationError: LocalizedError
    case openAppFailed(name: String)
    case missingAppGroup
    
+    case noWiFi
+    case tooNewError
    case anisetteV1Error(message: String)
    case provisioningError(result: String, message: String?)
    case anisetteV3Error(message: String)
    
+    case cacheClearError(errors: [String])
+    
    var failureReason: String? {
        switch self {
        case .unknown: return NSLocalizedString("An unknown error occured.", comment: "")
@@ -53,9 +57,12 @@ enum OperationError: LocalizedError
        case .openAppFailed(let name): return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), name)
        case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be found.", comment: "")
        case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs.", comment: "")
+        case .noWiFi: return NSLocalizedString("You do not appear to be connected to WiFi!\nSideStore will never be able to install or refresh applications without WiFi.", comment: "")
+        case .tooNewError: return NSLocalizedString("iOS 17 has changed how JIT is enabled therefore SideStore cannot enable it at this time, sorry for any inconvenience.\nWe will let everyone know once we have a solution!", comment: "")
        case .anisetteV1Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: ""), message)
        case .provisioningError(let result, let message): return String(format: NSLocalizedString("An error occurred when provisioning: %@%@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), result, message != nil ? (" (" + message! + ")") : "")
        case .anisetteV3Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), message)
+        case .cacheClearError(let errors): return String(format: NSLocalizedString("An error occurred while clearing cache: %@", comment: ""), errors.joined(separator: "\n"))
        }
    }
    
@@ -138,8 +145,8 @@ extension MinimuxerError: LocalizedError {
            return self.createService(name: "AFC")
        case .RwAfc:
            return NSLocalizedString("AFC was unable to manage files on the device", comment: "")
-        case .InstallApp:
-            return NSLocalizedString("Unable to install the app from the staging directory", comment: "")
+        case .InstallApp(let message):
+            return NSLocalizedString("Unable to install the app: \(message.toString())", comment: "")
        case .UninstallApp:
            return NSLocalizedString("Unable to uninstall the app", comment: "")

--- a/AltStore/Operations/RefreshAppOperation.swift
+++ b/AltStore/Operations/RefreshAppOperation.swift
@@ -35,31 +35,28 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
        
        do
        {
-            if let error = self.context.error
-            {
-                throw error
-            }
+            if let error = self.context.error { return self.finish(.failure(error)) }
            
-            guard let profiles = self.context.provisioningProfiles else { throw OperationError.invalidParameters }
+            guard let profiles = self.context.provisioningProfiles else { return self.finish(.failure(OperationError.invalidParameters)) }
+            guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
            
-            guard let app = self.context.app else { throw OperationError.appNotFound }
-            
-            DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
-                print("Sending refresh app request...")
+            for p in profiles {
+                do {
+                    let bytes = p.value.data.toRustByteSlice()
+                    try install_provisioning_profile(bytes.forRust())
+                } catch {
+                    self.finish(.failure(MinimuxerError.ProfileInstall))
+                }

-                for p in profiles {
-                    do {
-                        let bytes = p.value.data.toRustByteSlice()
-                        try install_provisioning_profile(bytes.forRust())
-                    } catch {
-                        return self.finish(.failure(error))
-                    }
+                DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
+                print("Sending refresh app request...")
                    
                    self.progress.completedUnitCount += 1
                    
                    let predicate = NSPredicate(format: "%K == %@", #keyPath(InstalledApp.bundleIdentifier), app.bundleIdentifier)
                    self.managedObjectContext.perform {
                        guard let installedApp = InstalledApp.first(satisfying: predicate, in: self.managedObjectContext) else {
+                            self.finish(.failure(OperationError.appNotFound))
                            return
                        }
                        installedApp.update(provisioningProfile: p.value)
@@ -72,9 +69,5 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
                }
            }
        }
-        catch
-        {
-            self.finish(.failure(error))
-        }
    }
 }
--- a/AltStore/Operations/ResignAppOperation.swift
+++ b/AltStore/Operations/ResignAppOperation.swift
@@ -11,6 +11,7 @@ import Roxas

 import AltStoreCore
 import AltSign
+import minimuxer

@objc(ResignAppOperation)
 final class ResignAppOperation: ResultOperation<ALTApplication>
@@ -181,7 +182,7 @@ private extension ResignAppOperation

                if app.isAltStoreApp
                {
-                    guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else { throw OperationError.unknownUDID }
+                    guard let udid = fetch_udid()?.toString() as? String else { throw OperationError.unknownUDID }
                    guard let pairingFileString = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.devicePairingString) as? String else { throw OperationError.unknownUDID }                    
                    additionalValues[Bundle.Info.devicePairingString] = pairingFileString
                    additionalValues[Bundle.Info.deviceID] = udid
@@ -202,7 +203,7 @@ private extension ResignAppOperation
                        // The embedded certificate + certificate identifier are already in app bundle, no need to update them.
                    }
                }
-                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String
+                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = fetch_udid()?.toString() as? String
                {
                    // There is an ALTDeviceID entry, so assume the app is using AltKit and replace it with the device's UDID.
                    additionalValues[Bundle.Info.deviceID] = udid
@@ -227,6 +228,7 @@ private extension ResignAppOperation
                
                // Prepare app
                try prepare(appBundle, additionalInfoDictionaryValues: additionalValues)
+                try self.removeMissingAppExtensionReferences(from: appBundle)
                
                if let directory = appBundle.builtInPlugInsURL, let enumerator = FileManager.default.enumerator(at: directory, includingPropertiesForKeys: nil, options: [.skipsSubdirectoryDescendants])
                {
@@ -267,4 +269,28 @@ private extension ResignAppOperation
        
        return progress
    }
+    
+    func removeMissingAppExtensionReferences(from bundle: Bundle) throws
+    {
+        // If app extensions have been removed from an app (either by AltStore or the developer),
+        // we must remove all references to them from SC_Info/Manifest.plist (if it exists).
+        
+        let scInfoURL = bundle.bundleURL.appendingPathComponent("SC_Info")
+        let manifestPlistURL = scInfoURL.appendingPathComponent("Manifest.plist")
+        
+        guard let manifestPlist = NSMutableDictionary(contentsOf: manifestPlistURL), let sinfReplicationPaths = manifestPlist["SinfReplicationPaths"] as? [String] else { return }
+        
+        // Remove references to missing files.
+        let filteredReplicationPaths = sinfReplicationPaths.filter { path in
+            guard let fileURL = URL(string: path, relativeTo: bundle.bundleURL) else { return false }
+            
+            let fileExists = FileManager.default.fileExists(atPath: fileURL.path)
+            return fileExists
+        }
+        
+        manifestPlist["SinfReplicationPaths"] = filteredReplicationPaths
+        
+        // Save updated Manifest.plist to disk.
+        try manifestPlist.write(to: manifestPlistURL)
+    }
 }
--- a/AltStore/Operations/SendAppOperation.swift
+++ b/AltStore/Operations/SendAppOperation.swift
@@ -33,8 +33,7 @@ final class SendAppOperation: ResultOperation<()>
        
        if let error = self.context.error
        {
-            self.finish(.failure(error))
-            return
+            return self.finish(.failure(error))
        }
        
        guard let resignedApp = self.context.resignedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
@@ -49,15 +48,16 @@ final class SendAppOperation: ResultOperation<()>
            do {
                let bytes = Data(data).toRustByteSlice()
                try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
+                self.progress.completedUnitCount += 1
+                self.finish(.success(()))
            } catch {
-                return self.finish(.failure(error))
+                self.finish(.failure(MinimuxerError.RwAfc))
+                self.progress.completedUnitCount += 1
+                self.finish(.success(()))
            }
-            
-            self.progress.completedUnitCount += 1
-            self.finish(.success(()))
        } else {
            print("IPA doesn't exist????")
-            self.finish(.failure(ALTServerError(.underlyingError)))
+            self.finish(.failure(OperationError.appNotFound))
        }
    }
 }
--- a/AltStore/Resources/AltBackup.ipa
+++ b/AltStore/Resources/AltBackup.ipa
--- a/AltStore/Resources/Assets.xcassets/AppIcon.appiconset/Contents.json
+++ b/AltStore/Resources/Assets.xcassets/AppIcon.appiconset/Contents.json
@@ -1 +1,158 @@
-{"images":[{"size":"60x60","expected-size":"180","filename":"180.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"40x40","expected-size":"80","filename":"80.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"40x40","expected-size":"120","filename":"120.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"60x60","expected-size":"120","filename":"120.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"57x57","expected-size":"57","filename":"57.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"1x"},{"size":"29x29","expected-size":"58","filename":"58.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"29x29","expected-size":"29","filename":"29.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"1x"},{"size":"29x29","expected-size":"87","filename":"87.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"57x57","expected-size":"114","filename":"114.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"20x20","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"20x20","expected-size":"60","filename":"60.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"1024x1024","filename":"1024.png","expected-size":"1024","idiom":"ios-marketing","folder":"Assets.xcassets/AppIcon.appiconset/","scale":"1x"},{"size":"40x40","expected-size":"80","filename":"80.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"72x72","expected-size":"72","filename":"72.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"76x76","expected-size":"152","filename":"152.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"50x50","expected-size":"100","filename":"100.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"29x29","expected-size":"58","filename":"58.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"76x76","expected-size":"76","filename":"76.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"29x29","expected-size":"29","filename":"29.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"50x50","expected-size":"50","filename":"50.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"72x72","expected-size":"144","filename":"144.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"40x40","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"83.5x83.5","expected-size":"167","filename":"167.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"20x20","expected-size":"20","filename":"20.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"20x20","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"}]}
+{
+  "images" : [
+    {
+      "filename" : "40.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "60.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "29.png",
+      "idiom" : "iphone",
+      "scale" : "1x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "58.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "87.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "80.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "120.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "57.png",
+      "idiom" : "iphone",
+      "scale" : "1x",
+      "size" : "57x57"
+    },
+    {
+      "filename" : "114.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "57x57"
+    },
+    {
+      "filename" : "120.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "60x60"
+    },
+    {
+      "filename" : "180.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "60x60"
+    },
+    {
+      "filename" : "20.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "40.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "29.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "58.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "40.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "80.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "50.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "50x50"
+    },
+    {
+      "filename" : "100.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "50x50"
+    },
+    {
+      "filename" : "72.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "72x72"
+    },
+    {
+      "filename" : "144.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "72x72"
+    },
+    {
+      "filename" : "76.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "76x76"
+    },
+    {
+      "filename" : "152.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "76x76"
+    },
+    {
+      "filename" : "167.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "83.5x83.5"
+    },
+    {
+      "filename" : "1024.png",
+      "idiom" : "ios-marketing",
+      "scale" : "1x",
+      "size" : "1024x1024"
+    }
+  ],
+  "info" : {
+    "author" : "xcode",
+    "version" : 1
+  }
+}
--- a/AltStore/Resources/Assets.xcassets/Riley.imageset/Contents.json
+++ b/AltStore/Resources/Assets.xcassets/Riley.imageset/Contents.json
@@ -1,12 +0,0 @@
-{
-  "images" : [
-    {
-      "filename" : "riley.jpg",
-      "idiom" : "universal"
-    }
-  ],
-  "info" : {
-    "author" : "xcode",
-    "version" : 1
-  }
-}
--- a/AltStore/Resources/Assets.xcassets/Riley.imageset/riley.jpg
+++ b/AltStore/Resources/Assets.xcassets/Riley.imageset/riley.jpg
--- a/AltStore/Resources/Assets.xcassets/Shane.imageset/Contents.json
+++ b/AltStore/Resources/Assets.xcassets/Shane.imageset/Contents.json
@@ -1,12 +0,0 @@
-{
-  "images" : [
-    {
-      "filename" : "shane.jpeg",
-      "idiom" : "universal"
-    }
-  ],
-  "info" : {
-    "author" : "xcode",
-    "version" : 1
-  }
-}
--- a/AltStore/Resources/Assets.xcassets/Shane.imageset/shane.jpeg
+++ b/AltStore/Resources/Assets.xcassets/Shane.imageset/shane.jpeg
--- a/AltStore/Resources/Assets.xcassets/SideStore.imageset/1024.png
+++ b/AltStore/Resources/Assets.xcassets/SideStore.imageset/1024.png
--- a/AltStore/Resources/Assets.xcassets/SideStore.imageset/Contents.json
+++ b/AltStore/Resources/Assets.xcassets/SideStore.imageset/Contents.json
@@ -0,0 +1,21 @@
+{
+  "images" : [
+    {
+      "filename" : "1024.png",
+      "idiom" : "universal",
+      "scale" : "1x"
+    },
+    {
+      "idiom" : "universal",
+      "scale" : "2x"
+    },
+    {
+      "idiom" : "universal",
+      "scale" : "3x"
+    }
+  ],
+  "info" : {
+    "author" : "xcode",
+    "version" : 1
+  }
+}
--- a/AltStore/Settings.bundle/Root.plist
+++ b/AltStore/Settings.bundle/Root.plist
@@ -30,9 +30,9 @@
 			</array>
 			<key>Values</key>
 			<array>
-				<string>http://ani.sidestore.io:6969</string>
-				<string>http://us1.sternserv.tech</string>
-				<string>http://de1.sternserv.tech</string>
+				<string>https://ani.sidestore.io</string>
+				<string>http://5.249.163.88:6969/</string>
+				<string>http://45.132.246.138:6969/</string>
 				<string>https://sign.rheaa.xyz</string>
 				<string>https://sideloadly.io/anisette/irGb3Quww8zrhgqnzmrx</string>
 				<string>http://45.33.29.114</string>
--- a/AltStore/Settings/AboutPatreonHeaderView.xib
+++ b/AltStore/Settings/AboutPatreonHeaderView.xib
@@ -1,27 +1,27 @@
 <?xml version="1.0" encoding="UTF-8"?>
-<document type="com.apple.InterfaceBuilder3.CocoaTouch.XIB" version="3.0" toolsVersion="21225" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
+<document type="com.apple.InterfaceBuilder3.CocoaTouch.XIB" version="3.0" toolsVersion="21507" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
    <device id="retina6_1" orientation="portrait" appearance="light"/>
    <dependencies>
        <deployment identifier="iOS"/>
-        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21207"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21505"/>
        <capability name="Named colors" minToolsVersion="9.0"/>
        <capability name="documents saved in the Xcode 8 format" minToolsVersion="8.0"/>
    </dependencies>
    <objects>
        <placeholder placeholderIdentifier="IBFilesOwner" id="-1" userLabel="File's Owner"/>
        <placeholder placeholderIdentifier="IBFirstResponder" id="-2" customClass="UIResponder"/>
-        <collectionReusableView opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" insetsLayoutMarginsFromSafeArea="NO" reuseIdentifier="AboutHeader" id="xq2-Pl-zaG" customClass="AboutPatreonHeaderView" customModule="AltStore" customModuleProvider="target">
-            <rect key="frame" x="0.0" y="0.0" width="375" height="445"/>
+        <collectionReusableView opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" insetsLayoutMarginsFromSafeArea="NO" reuseIdentifier="AboutHeader" id="xq2-Pl-zaG" customClass="AboutPatreonHeaderView" customModule="SideStore" customModuleProvider="target">
+            <rect key="frame" x="0.0" y="0.0" width="390" height="682"/>
            <autoresizingMask key="autoresizingMask"/>
            <subviews>
                <stackView opaque="NO" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" axis="vertical" spacing="25" translatesAutoresizingMaskIntoConstraints="NO" id="XiA-Jf-XMp">
-                    <rect key="frame" x="16" y="2" width="343" height="393"/>
+                    <rect key="frame" x="16" y="2" width="358" height="630"/>
                    <subviews>
                        <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="5Ol-zN-wYv">
-                            <rect key="frame" x="0.0" y="0.0" width="343" height="317"/>
+                            <rect key="frame" x="0.0" y="0.0" width="358" height="426"/>
                            <subviews>
                                <stackView opaque="NO" contentMode="scaleToFill" alignment="center" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="f7H-EV-7Sx">
-                                    <rect key="frame" x="0.0" y="0.0" width="343" height="55"/>
+                                    <rect key="frame" x="0.0" y="0.0" width="358" height="55"/>
                                    <subviews>
                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="SideStore" translatesAutoresizingMaskIntoConstraints="NO" id="pn6-Ic-MJm">
                                            <rect key="frame" x="0.0" y="0.0" width="55" height="55"/>
@@ -31,7 +31,7 @@
                                            </constraints>
                                        </imageView>
                                        <stackView opaque="NO" contentMode="scaleToFill" distribution="equalSpacing" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="si2-MA-3RH">
-                                            <rect key="frame" x="65" y="0.0" width="278" height="55"/>
+                                            <rect key="frame" x="65" y="0.0" width="293" height="55"/>
                                            <subviews>
                                                <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="2" translatesAutoresizingMaskIntoConstraints="NO" id="hkS-oz-wiT">
                                                    <rect key="frame" x="0.0" y="0.0" width="83" height="55"/>
@@ -51,7 +51,7 @@
                                                    </subviews>
                                                </stackView>
                                                <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="2" translatesAutoresizingMaskIntoConstraints="NO" id="TFB-qo-cbh">
-                                                    <rect key="frame" x="195" y="0.0" width="83" height="55"/>
+                                                    <rect key="frame" x="210" y="0.0" width="83" height="55"/>
                                                    <subviews>
                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="Zpb-k3-y7l">
                                                            <rect key="frame" x="0.0" y="0.0" width="83" height="50"/>
@@ -75,11 +75,13 @@
                                    </constraints>
                                </stackView>
                                <textView clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="scaleToFill" scrollEnabled="NO" editable="NO" textAlignment="natural" selectable="NO" translatesAutoresizingMaskIntoConstraints="NO" id="FeG-e5-LJl">
-                                    <rect key="frame" x="0.0" y="65" width="343" height="252"/>
+                                    <rect key="frame" x="0.0" y="65" width="358" height="361"/>
                                    <color key="backgroundColor" white="1" alpha="0.13" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
-                                    <string key="text">Hello, thank you for using SideStore!
+                                    <string key="text">Thank you for using SideStore!
        
-If you would subscribe to the patreon that would support us and make sure we can continue developing SideStore for you.
+Subscribing to the patreon supports us and makes sure we can continue developing SideStore for you.
+    
+Following us on social media allows us to give quick updates and spread the word about sideloading!
        
 -SideTeam</string>
                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -89,10 +91,10 @@ If you would subscribe to the patreon that would support us and make sure we can
                            </subviews>
                        </stackView>
                        <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="13" translatesAutoresizingMaskIntoConstraints="NO" id="QS9-vO-bj8">
-                            <rect key="frame" x="0.0" y="342" width="343" height="51"/>
+                            <rect key="frame" x="0.0" y="451" width="358" height="179"/>
                            <subviews>
                                <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="yEi-L6-kQ8">
-                                    <rect key="frame" x="0.0" y="0.0" width="343" height="51"/>
+                                    <rect key="frame" x="0.0" y="0.0" width="358" height="51"/>
                                    <color key="backgroundColor" name="SettingsHighlighted"/>
                                    <constraints>
                                        <constraint firstAttribute="height" constant="51" id="l4o-vb-cMy"/>
@@ -102,6 +104,28 @@ If you would subscribe to the patreon that would support us and make sure we can
                                        <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                    </state>
                                </button>
+                                <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="hov-Ce-LaM" userLabel="Twitter Button">
+                                    <rect key="frame" x="0.0" y="64" width="358" height="51"/>
+                                    <color key="backgroundColor" name="SettingsHighlighted"/>
+                                    <constraints>
+                                        <constraint firstAttribute="height" constant="51" id="m0M-GX-KKG"/>
+                                    </constraints>
+                                    <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="19"/>
+                                    <state key="normal" title="Follow us on Twitter!">
+                                        <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                    </state>
+                                </button>
+                                <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="VdY-7Q-amF" userLabel="Twitter Button">
+                                    <rect key="frame" x="0.0" y="128" width="358" height="51"/>
+                                    <color key="backgroundColor" name="SettingsHighlighted"/>
+                                    <constraints>
+                                        <constraint firstAttribute="height" constant="51" id="kDo-b8-6tZ"/>
+                                    </constraints>
+                                    <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="19"/>
+                                    <state key="normal" title="Follow us on Instagram!">
+                                        <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                    </state>
+                                </button>
                            </subviews>
                        </stackView>
                    </subviews>
@@ -114,19 +138,21 @@ If you would subscribe to the patreon that would support us and make sure we can
                <constraint firstItem="XiA-Jf-XMp" firstAttribute="top" secondItem="xq2-Pl-zaG" secondAttribute="top" constant="2" id="j8p-JX-Dcz"/>
            </constraints>
            <connections>
+                <outlet property="instagramButton" destination="VdY-7Q-amF" id="5kj-9x-k4F"/>
                <outlet property="rileyImageView" destination="pn6-Ic-MJm" id="60i-Q0-ojz"/>
                <outlet property="rileyLabel" destination="DTd-Yu-HXr" id="O0y-JB-gWp"/>
                <outlet property="shaneLabel" destination="Zpb-k3-y7l" id="aQN-6B-s5T"/>
                <outlet property="supportButton" destination="yEi-L6-kQ8" id="Dzo-vd-SnD"/>
                <outlet property="textView" destination="FeG-e5-LJl" id="K0M-lF-I6u"/>
+                <outlet property="twitterButton" destination="hov-Ce-LaM" id="gib-Lt-qtY"/>
            </connections>
-            <point key="canvasLocation" x="138" y="138"/>
+            <point key="canvasLocation" x="147.82608695652175" y="58.258928571428569"/>
        </collectionReusableView>
    </objects>
    <resources>
-        <image name="SideStore" width="180" height="180"/>
+        <image name="SideStore" width="1024" height="1024"/>
        <namedColor name="SettingsHighlighted">
-            <color red="0.23529411764705882" green="0.0" blue="0.40392156862745099" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.38823529411764707" green="0.011764705882352941" blue="0.58823529411764708" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
        </namedColor>
    </resources>
 </document>
--- a/AltStore/Settings/PatreonComponents.swift
+++ b/AltStore/Settings/PatreonComponents.swift
@@ -56,6 +56,8 @@ final class PatronsFooterView: UICollectionReusableView
 final class AboutPatreonHeaderView: UICollectionReusableView
 {
    @IBOutlet var supportButton: UIButton!
+    @IBOutlet var twitterButton: UIButton!
+    @IBOutlet var instagramButton: UIButton!
    @IBOutlet var accountButton: UIButton!
    @IBOutlet var textView: UITextView!
    
@@ -79,12 +81,12 @@ final class AboutPatreonHeaderView: UICollectionReusableView
            imageView.layer.cornerRadius = imageView.bounds.midY
        }
        
-        for button in [self.supportButton, self.accountButton].compactMap({ $0 })
+        for button in [self.supportButton, self.accountButton, self.twitterButton, self.instagramButton].compactMap({ $0 })
        {
            button.clipsToBounds = true
            button.layer.cornerRadius = 16
        }
-    }
+}
    
    override func layoutMarginsDidChange()
    {
--- a/AltStore/Settings/PatreonViewController.swift
+++ b/AltStore/Settings/PatreonViewController.swift
@@ -111,7 +111,9 @@ private extension PatreonViewController
        headerView.layoutMargins = self.view.layoutMargins
        
        headerView.supportButton.addTarget(self, action: #selector(PatreonViewController.openPatreonURL(_:)), for: .primaryActionTriggered)
-        
+        headerView.twitterButton.addTarget(self, action: #selector(PatreonViewController.openTwitterURL(_:)), for: .primaryActionTriggered)
+        headerView.instagramButton.addTarget(self, action: #selector(PatreonViewController.openInstagramURL(_:)), for: .primaryActionTriggered)
+
        let defaultSupportButtonTitle = NSLocalizedString("Become a patron", comment: "")
        let isPatronSupportButtonTitle = NSLocalizedString("View Patreon", comment: "")
        
@@ -180,6 +182,24 @@ private extension PatreonViewController
        self.present(safariViewController, animated: true, completion: nil)
    }
    
+    @objc func openTwitterURL(_ sender: UIButton)
+    {
+        let twitterURL = URL(string: "https://twitter.com/SideStore_io")!
+        
+        let safariViewController = SFSafariViewController(url: twitterURL)
+        safariViewController.preferredControlTintColor = self.view.tintColor
+        self.present(safariViewController, animated: true, completion: nil)
+    }
+    
+    @objc func openInstagramURL(_ sender: UIButton)
+    {
+        let twitterURL = URL(string: "https://instagram.com/sidestore.io")!
+        
+        let safariViewController = SFSafariViewController(url: twitterURL)
+        safariViewController.preferredControlTintColor = self.view.tintColor
+        self.present(safariViewController, animated: true, completion: nil)
+    }
+    
    @IBAction func authenticate(_ sender: UIBarButtonItem)
    {
        PatreonAPI.shared.authenticate { (result) in
--- a/AltStore/Settings/Settings.storyboard
+++ b/AltStore/Settings/Settings.storyboard
@@ -21,7 +21,7 @@
                        <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                        <color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                        <label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
-                            <rect key="frame" x="0.0" y="1194" width="375" height="25"/>
+                            <rect key="frame" x="0.0" y="1245" width="375" height="25"/>
                            <autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
                            <fontDescription key="fontDescription" type="system" pointSize="17"/>
                            <color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -167,8 +167,8 @@
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Join the beta" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="3Il-5a-5Zp">
-                                                    <rect key="frame" x="30" y="15.5" width="106" height="20.5"/>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Support the team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="3Il-5a-5Zp">
+                                                    <rect key="frame" x="30" y="15.5" width="142.5" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
@@ -359,22 +359,22 @@
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
                                                    <rect key="frame" x="30" y="15.5" width="89" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
                                                </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
+                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
                                                    <rect key="frame" x="198" y="15.5" width="147" height="20.5"/>
                                                    <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
                                                            <rect key="frame" x="0.0" y="0.0" width="115" height="20.5"/>
                                                            <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                            <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                            <nil key="highlightedColor"/>
                                                        </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
                                                            <rect key="frame" x="129" y="0.0" width="18" height="20.5"/>
                                                        </imageView>
                                                    </subviews>
@@ -403,22 +403,22 @@
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Asset Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="fGU-Fp-XgM">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Asset Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="fGU-Fp-XgM">
                                                    <rect key="frame" x="30" y="15.5" width="115.5" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
                                                </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="R8B-DW-7mY">
+                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="R8B-DW-7mY">
                                                    <rect key="frame" x="206" y="15.5" width="139" height="20.5"/>
                                                    <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Chris (LitRitt)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hId-3P-41T">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Chris (LitRitt)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hId-3P-41T">
                                                            <rect key="frame" x="0.0" y="0.0" width="107" height="20.5"/>
                                                            <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                            <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                            <nil key="highlightedColor"/>
                                                        </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="baq-cE-fMY">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="baq-cE-fMY">
                                                            <rect key="frame" x="121" y="0.0" width="18" height="20.5"/>
                                                        </imageView>
                                                    </subviews>
@@ -447,13 +447,13 @@
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Licenses" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="D6b-cd-pVK">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Licenses" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="D6b-cd-pVK">
                                                    <rect key="frame" x="30" y="15.5" width="67.5" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
                                                </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="s79-GQ-khr">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="s79-GQ-khr">
                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                </imageView>
                                            </subviews>
@@ -487,13 +487,13 @@
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Send Feedback" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="pMI-Aj-nQF">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Send Feedback" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="pMI-Aj-nQF">
                                                    <rect key="frame" x="30" y="15.5" width="125.5" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
                                                </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Jyy-x0-Owj">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Jyy-x0-Owj">
                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                </imageView>
                                            </subviews>
@@ -520,13 +520,13 @@
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="View Refresh Attempts" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="sni-07-q0M">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="View Refresh Attempts" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="sni-07-q0M">
                                                    <rect key="frame" x="30" y="15.5" width="187.5" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
                                                </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="4d3-me-Hqc">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="4d3-me-Hqc">
                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                </imageView>
                                            </subviews>
@@ -556,13 +556,13 @@
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="View Error Log" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PWC-OG-5jx">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="View Error Log" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PWC-OG-5jx">
                                                    <rect key="frame" x="30" y="15.5" width="119" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
                                                </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="VfB-c5-5wG">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="VfB-c5-5wG">
                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                </imageView>
                                            </subviews>
@@ -582,23 +582,56 @@
                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                        </userDefinedRuntimeAttributes>
                                        <connections>
-                                            <segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="SSW-vL-86I"/>
+                                            <segue destination="g8a-Rf-zWa" kind="show" id="vFC-Id-Ww6"/>
                                        </connections>
                                    </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="eZ3-BT-q4D" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
                                        <rect key="frame" x="0.0" y="1023" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="eZ3-BT-q4D" id="17m-VV-hzf">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Clear Cache" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="IbH-V1-ce3">
+                                                    <rect key="frame" x="30" y="15.5" width="98.5" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="FZe-BJ-fOm">
+                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
+                                                </imageView>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="FZe-BJ-fOm" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="bGv-Np-5aO"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="FZe-BJ-fOm" secondAttribute="trailing" id="ccb-JP-Eqi"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="iQJ-gN-sRF"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="leading" secondItem="17m-VV-hzf" secondAttribute="leadingMargin" id="m1g-Y6-aT5"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VNn-u4-cN8" id="4bh-qe-l2N">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Reset Pairing File" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ysS-9s-dXm">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Reset Pairing File" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ysS-9s-dXm">
                                                    <rect key="frame" x="30" y="15.5" width="140" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
                                                </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="r09-mH-pOD">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="r09-mH-pOD">
                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                </imageView>
                                            </subviews>
@@ -619,19 +652,19 @@
                                        </userDefinedRuntimeAttributes>
                                    </tableViewCell>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="e7s-hL-kv9" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="e7s-hL-kv9" id="yjL-Mu-HTk">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Reset adi.pb" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="eds-Dj-36y">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Reset adi.pb" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="eds-Dj-36y">
                                                    <rect key="frame" x="30" y="15.5" width="102" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
                                                </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="0dh-yd-7i9">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="0dh-yd-7i9">
                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                </imageView>
                                            </subviews>
@@ -652,19 +685,19 @@
                                        </userDefinedRuntimeAttributes>
                                    </tableViewCell>
                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1176" width="375" height="51"/>
                                        <autoresizingMask key="autoresizingMask"/>
                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                            <autoresizingMask key="autoresizingMask"/>
                                            <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Advanced Settings" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="OcM-OM-uDE">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Advanced Settings" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="OcM-OM-uDE">
                                                    <rect key="frame" x="30" y="15.5" width="154" height="20.5"/>
                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                    <nil key="highlightedColor"/>
                                                </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Pcu-Sy-yfZ">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Pcu-Sy-yfZ">
                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                </imageView>
                                            </subviews>
@@ -917,7 +950,7 @@ Settings by i cons from the Noun Project</string>
            </objects>
            <point key="canvasLocation" x="1697" y="313"/>
        </scene>
-        <!--Patreon-->
+        <!--Support us-->
        <scene sceneID="Lnh-9P-HnL">
            <objects>
                <collectionViewController id="dp8-8j-vt9" customClass="PatreonViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
@@ -964,7 +997,7 @@ Settings by i cons from the Noun Project</string>
                            <outlet property="delegate" destination="dp8-8j-vt9" id="790-Kr-6l7"/>
                        </connections>
                    </collectionView>
-                    <navigationItem key="navigationItem" title="Patreon" largeTitleDisplayMode="always" id="uUV-1f-xEq"/>
+                    <navigationItem key="navigationItem" title="Support us" largeTitleDisplayMode="always" id="uUV-1f-xEq"/>
                </collectionViewController>
                <placeholder placeholderIdentifier="IBFirstResponder" id="qq3-Hj-S9f" userLabel="First Responder" sceneMemberID="firstResponder"/>
            </objects>
--- a/AltStore/Settings/SettingsViewController.swift
+++ b/AltStore/Settings/SettingsViewController.swift
@@ -53,9 +53,11 @@ extension SettingsViewController
        case sendFeedback
        case refreshAttempts
        case errorLog
+        case clearCache
        case resetPairingFile
        case resetAdiPb
        case advancedSettings
+    
    }
 }

@@ -178,11 +180,11 @@ private extension SettingsViewController
        case .patreon:
            if isHeader
            {
-                settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("PATREON", comment: "")
+                settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("SUPPORT US", comment: "")
            }
            else
            {
-                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Support the SideStore Team by becoming a patron!", comment: "")
+                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Support the SideStore Team by following our socials or becoming a patron!", comment: "")
            }

        case .account:
@@ -291,6 +293,39 @@ private extension SettingsViewController
        self.present(viewController, animated: true, completion: nil)
    }
    
+    func clearCache()
+    {
+        let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to clear SideStore's cache?", comment: ""),
+                                                message: NSLocalizedString("This will remove all temporary files as well as backups for uninstalled apps.", comment: ""),
+                                                preferredStyle: .actionSheet)
+        alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { [weak self] _ in
+            self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+        })
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Clear Cache", comment: ""), style: .destructive) { [weak self] _ in
+            AppManager.shared.clearAppCache { result in
+                DispatchQueue.main.async {
+                    self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+                    
+                    switch result
+                    {
+                    case .success: break
+                    case .failure(let error):
+                        let alertController = UIAlertController(title: NSLocalizedString("Unable to Clear Cache", comment: ""), message: error.localizedDescription, preferredStyle: .alert)
+                        alertController.addAction(.ok)
+                        self?.present(alertController, animated: true)
+                    }
+                }
+            }
+        })
+        
+        if let popoverController = alertController.popoverPresentationController {
+            popoverController.sourceView = self.view
+            popoverController.sourceRect = CGRect(x: self.view.bounds.midX, y: self.view.bounds.midY, width: 0, height: 0)
+        }
+        
+        self.present(alertController, animated: true)
+    }
+    
    @IBAction func handleDebugModeGesture(_ gestureRecognizer: UISwipeGestureRecognizer)
    {
        self.debugGestureCounter += 1
@@ -470,6 +505,7 @@ extension SettingsViewController
                self.addRefreshAppsShortcut()
            }
            
+            
        case .credits:
            let row = CreditsRow.allCases[indexPath.row]
            switch row
@@ -507,6 +543,9 @@ extension SettingsViewController
                    let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
                    toastView.show(in: self)
                }
+                
+            case .clearCache: self.clearCache()
+
            case .resetPairingFile:
                let filename = "ALTPairingFile.mobiledevicepairing"
                let fm = FileManager.default
@@ -559,6 +598,7 @@ extension SettingsViewController
                    ELOG("UIApplication.openSettingsURLString invalid")
                }
            case .refreshAttempts, .errorLog: break
+
            }
            
        default: break
--- a/AltStoreCore/Model/InstalledApp.swift
+++ b/AltStoreCore/Model/InstalledApp.swift
@@ -192,7 +192,7 @@ public extension InstalledApp
    
    class func fetchAppsForRefreshingAll(in context: NSManagedObjectContext) -> [InstalledApp]
    {
-        var predicate = NSPredicate(format: "%K == YES AND %K != %@", #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
+        let predicate = NSPredicate(format: "%K == YES AND %K != %@", #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
        print("Fetch Apps for Refreshing All 'AltStore' predicate: \(String(describing: predicate))")
        
 //        if let patreonAccount = DatabaseManager.shared.patreonAccount(in: context), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
@@ -223,7 +223,7 @@ public extension InstalledApp
        // Date 6 hours before now.
        let date = Date().addingTimeInterval(-1 * 6 * 60 * 60)
        
-        var predicate = NSPredicate(format: "(%K == YES) AND (%K < %@) AND (%K != %@)",
+        let predicate = NSPredicate(format: "(%K == YES) AND (%K < %@) AND (%K != %@)",
                                    #keyPath(InstalledApp.isActive),
                                    #keyPath(InstalledApp.refreshedDate), date as NSDate,
                                    #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
--- a/AltWidget/Assets.xcassets/AltStore.imageset/1024.png
+++ b/AltWidget/Assets.xcassets/AltStore.imageset/1024.png
--- a/AltWidget/Assets.xcassets/AltStore.imageset/Contents.json
+++ b/AltWidget/Assets.xcassets/AltStore.imageset/Contents.json
@@ -5,12 +5,12 @@
      "scale" : "1x"
    },
    {
-      "filename" : "Group 23_120.png",
+      "filename" : "1024.png",
      "idiom" : "universal",
      "scale" : "2x"
    },
    {
-      "filename" : "Group 23_180.png",
+      "filename" : "1024.png",
      "idiom" : "universal",
      "scale" : "3x"
    }
--- a/AltWidget/Assets.xcassets/AltStore.imageset/Group
+++ b/AltWidget/Assets.xcassets/AltStore.imageset/Group
--- a/AltWidget/Assets.xcassets/AltStore.imageset/Group
+++ b/AltWidget/Assets.xcassets/AltStore.imageset/Group
--- a/AltWidget/Assets.xcassets/Badge.imageset/Contents.json
+++ b/AltWidget/Assets.xcassets/Badge.imageset/Contents.json
@@ -1,7 +1,7 @@
 {
  "images" : [
    {
-      "filename" : "group16Copy2.pdf",
+      "filename" : "sidestore-logo.svg",
      "idiom" : "universal"
    }
  ],
--- a/AltWidget/Assets.xcassets/Badge.imageset/group16Copy2.pdf
+++ b/AltWidget/Assets.xcassets/Badge.imageset/group16Copy2.pdf
--- a/AltWidget/Assets.xcassets/Badge.imageset/sidestore-logo.svg
+++ b/AltWidget/Assets.xcassets/Badge.imageset/sidestore-logo.svg
@@ -0,0 +1,17 @@
+<svg version="1.2" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 100 100" width="100" height="100">
+	<title>sidestore-logo-svg</title>
+	<style>
+		.s0 { fill: none } 
+		.s1 { fill: #bebbb4 } 
+	</style>
+	<g id="Layer">
+		<g id="Layer">
+			<path id="Main" class="s0" />
+			<g id="Main1">
+				<g id="Layer">
+					<path id="Layer" fill-rule="evenodd" class="s1" d="m86 50c0 2.3-1.9 4.2-4.2 4.2h-50.9c-2.3 0-4.2-1.9-4.2-4.2 0-2.3 1.9-4.2 4.2-4.2h50.9c2.3 0 4.2 1.9 4.2 4.2zm-31.8-23.3v2.1c0 3.4-1.3 6.6-3.7 9-2.4 2.4-5.6 3.7-9 3.7h-10.6c-2.2 0-4.4 0.9-5.9 2.5-1.6 1.6-2.5 3.8-2.5 6 0 2.2 0.9 4.4 2.5 6 1.5 1.6 3.7 2.5 5.9 2.5h10.6c3.4 0 6.6 1.3 9 3.7 2.4 2.4 3.7 5.6 3.7 9v10.8c0 1.1-0.4 2.1-1.1 2.8-0.8 0.8-1.8 1.2-2.9 1.2h-0.4c-1.1 0-2.1-0.4-2.9-1.2-0.7-0.7-1.1-1.7-1.1-2.8v-10.8c0-1.1-0.5-2.2-1.3-3-0.8-0.8-1.8-1.3-3-1.3h-10.6c-4.5 0-8.8-1.7-11.9-4.9-3.2-3.2-5-7.5-5-12 0-4.5 1.8-8.8 5-12 3.1-3.2 7.4-4.9 11.9-4.9h10.6c1.2 0 2.2-0.5 3-1.3 0.8-0.8 1.3-1.9 1.3-3v-2.1h-4.3l8.5-12.7 8.5 12.7zm12.7 55.3c0 2.2-1.8 4-4 4h-0.5c-2.2 0-4-1.8-4-4v-19.5c0-2.2 1.8-4 4-4h0.5c2.2 0 4 1.8 4 4z"/>
+				</g>
+			</g>
+		</g>
+	</g>
+</svg>
--- a/AltWidget/Assets.xcassets/SmallIcon.imageset/Contents.json
+++ b/AltWidget/Assets.xcassets/SmallIcon.imageset/Contents.json
@@ -1,7 +1,7 @@
 {
  "images" : [
    {
-      "filename" : "altminicon.pdf",
+      "filename" : "cir.svg",
      "idiom" : "universal"
    }
  ],
--- a/AltWidget/Assets.xcassets/SmallIcon.imageset/altminicon.pdf
+++ b/AltWidget/Assets.xcassets/SmallIcon.imageset/altminicon.pdf
--- a/AltWidget/Assets.xcassets/SmallIcon.imageset/cir.svg
+++ b/AltWidget/Assets.xcassets/SmallIcon.imageset/cir.svg
@@ -0,0 +1,3 @@
+<svg width="100" height="100" version="1.1" viewBox="0 0 100 100" xmlns="http://www.w3.org/2000/svg">
+ <circle cx="50" cy="50" r="50" fill="#fff" stroke-width=".265"/>
+</svg>
--- a/AltWidget/Resources/ReleaseEntitlements.plist
+++ b/AltWidget/Resources/ReleaseEntitlements.plist
@@ -0,0 +1,16 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>application-identifier</key>
+	<string>XYZ0123456.com.SideStore.SideStore.AltWidget</string>
+	<key>com.apple.developer.team-identifier</key>
+	<string>XYZ0123456</string>
+	<key>com.apple.security.application-groups</key>
+	<array>
+		<string>group.com.SideStore.SideStore</string>
+	</array>
+	<key>get-task-allow</key>
+	<true/>
+</dict>
+</plist>
--- a/Build.xcconfig
+++ b/Build.xcconfig
@@ -1,8 +1,8 @@
 // Configuration settings file format documentation can be found at:
 // https://help.apple.com/xcode/#/dev745c5c974

-MARKETING_VERSION = 0.4.0
-CURRENT_PROJECT_VERSION = 4000
+MARKETING_VERSION = 0.5.3
+CURRENT_PROJECT_VERSION = 5030

 // Vars to be overwritten by `CodeSigning.xcconfig` if exists
 DEVELOPMENT_TEAM = S32Z3HMYVQ
--- a/CONTRIBUTING.md
+++ b/CONTRIBUTING.md
@@ -7,7 +7,7 @@ There are many ways to contribute to SideStore, so if you aren't a developer, th
 -   [Writing documentation](https://github.com/SideStore/SideStore-Docs)
 -   [Submitting detailed bug reports and suggesting new features](https://github.com/SideStore/SideStore/issues/new/choose)
 -   Helping out with support
-    -   [Discord](https://discord.gg/RgpFBX3Q3k)
+    -   [Discord](https://discord.gg/sidestore-949183273383395328)
    -   [GitHub Discussions](https://github.com/SideStore/SideStore/discussions)

 However, this guide will focus on the development side of things. For now, we will only have setup information here, but you can [join our Discord](https://discord.gg/RgpFBX3Q3k) if you need help
--- a/Dependencies/Roxas
+++ b/Dependencies/Roxas
--- a/Dependencies/libfragmentzip
+++ b/Dependencies/libfragmentzip
--- a/Dependencies/libimobiledevice
+++ b/Dependencies/libimobiledevice
--- a/Dependencies/libimobiledevice-glue
+++ b/Dependencies/libimobiledevice-glue
--- a/Dependencies/libplist
+++ b/Dependencies/libplist
--- a/Dependencies/libusbmuxd
+++ b/Dependencies/libusbmuxd
--- a/1
+++ b/1
@@ -171,6 +171,7 @@ build:
 fakesign:
 	rm -rf archive.xcarchive/Products/Applications/SideStore.app/Frameworks/AltStoreCore.framework/Frameworks/
 	ldid -SAltStore/Resources/ReleaseEntitlements.plist archive.xcarchive/Products/Applications/SideStore.app/SideStore
+	ldid -SAltWidget/Resources/ReleaseEntitlements.plist archive.xcarchive/Products/Applications/SideStore.app/PlugIns/AltWidgetExtension.appex/AltWidgetExtension

 ipa:
 	mkdir Payload
--- a/README.md
+++ b/README.md
@@ -9,7 +9,7 @@

 ![Alt](https://repobeats.axiom.co/api/embed/3a329ce95955690b9a9366f8d5598626a847d96c.svg "Repobeats analytics image")

-SideStore is an iOS application that allows you to sideload apps onto your iOS device with just your Apple ID. SideStore resigns apps with your personal development certificate, and then uses a [specially designed VPN](https://github.com/jkcoxson/Secret-Tunnel) in order to trick iOS into installing them. SideStore will periodically "refresh" your apps in the background, to keep their normal 7-day development period from expiring.
+SideStore is an iOS application that allows you to sideload apps onto your iOS device with just your Apple ID. SideStore resigns apps with your personal development certificate, and then uses a [specially designed VPN](https://github.com/jkcoxson/em_proxy) in order to trick iOS into installing them. SideStore will periodically "refresh" your apps in the background, to keep their normal 7-day development period from expiring.

 SideStore's goal is to provide an untethered sideloading experience. It's a community driven fork of [AltStore](https://github.com/rileytestut/AltStore), and has already implemented some of the community's most-requested features.

--- a/Shared/Extensions/Bundle+AltStore.swift
+++ b/Shared/Extensions/Bundle+AltStore.swift
@@ -56,7 +56,7 @@ public extension Bundle
 public extension Bundle
 {
    static var baseAltStoreAppGroupID = "group." + Bundle.Info.appbundleIdentifier
-    
+
    var appGroups: [String] {
        return self.infoDictionary?[Bundle.Info.appGroups] as? [String] ?? []
    }
--- a/SideStore.conf
+++ b/SideStore.conf
@@ -0,0 +1,9 @@
+[Interface]
+PrivateKey = AIIeeUDvk3NeAFJ9BWCQvPJize/9WZibMnGJ/0rt5k4=
+Address = 10.7.0.10/24
+
+[Peer]
+PublicKey = kHDoekeYhBvfW9a9UQ+UCmpbG423eejTjcjW+DT+JF0=
+AllowedIPs = 10.7.0.1/32
+Endpoint = 127.0.0.1:51820
+PersistentKeepalive = 25
--- a/trustedapps.json
+++ b/trustedapps.json
@@ -32,9 +32,17 @@
      "identifier": "eu.pokemmo.altstore",
      "sourceURL": "https://pokemmo.eu/altstore/"
    },
+    {
+      "identifier": "dev.theodyssey.sidestore",
+      "sourceURL": "https://theodyssey.dev/altstore/odysseysource.json"
+    },
    {
      "identifier": "stream.yattee",
      "sourceURL": "https://repos.yattee.stream/alt/apps.json"
+    },
+    {
+      "identifier": "com.litritt.litsource",
+      "sourceURL": "https://altstore.ignitedemulator.com/"
    }
  ]
 }
Author	SHA1	Message	Date
nythepegasus	502b89d890	[skip ci] Add other project maintainers to CODEOWNERS Signed-off-by: nythepegasus <nythepegasus84@gmail.com>	2023-11-27 09:37:25 -05:00
junepark678	5f0015fad0	chore(Clear Cache): do proper error handling	2023-11-27 09:31:36 -05:00
June Park	c81236957b	bugfix(settings): fix rounding issues on clear cache button (#536 )	2023-11-27 09:31:36 -05:00
Spidy123222	970ab38b27	move debug row	2023-11-27 09:31:36 -05:00
Spidy123222	8a5c31b81d	make button function again	2023-11-27 09:31:36 -05:00
Spidy123222	8508fe79b5	change order of settings debug section	2023-11-27 09:31:36 -05:00
Spidy123222	3859e98801	Add button to storyboard 🙄	2023-11-27 09:31:36 -05:00
Spidy123222	a759c7be9e	please fix to show button	2023-11-27 09:31:36 -05:00
Spidy123222	12fc6cf6e2	attempt fix settings	2023-11-27 09:31:36 -05:00
Spidy123222	580db6530e	fix the mighty error	2023-11-27 09:31:36 -05:00
Spidy123222	9c67c237ee	get rest of batcherror	2023-11-27 09:31:36 -05:00
Spidy123222	357d85a72e	please o riley build	2023-11-27 09:31:36 -05:00
Spidy123222	88ad828ce0	hopefully fix error code build error	2023-11-27 09:31:36 -05:00
Riley Testut	a95625a34a	Adds “Clear Cache” description to Techy Things section footer (cherry picked from commit `913db5131b`)	2023-11-27 09:31:36 -05:00
Riley Testut	95e00d81f5	Adds “Clear Cache” button to remove temporary files and uninstalled app backups (cherry picked from commit `3adfc9db6d`)	2023-11-27 09:31:36 -05:00
junepark678	c2e386a5c5	chore(App IDs, My Apps): change back to full	2023-11-27 09:22:19 -05:00
junepark678	a76aade4ff	chore(App IDs, My Apps): change to use `DateComponentsFormatter.UnitsStyle.abbreviated`	2023-11-27 09:22:19 -05:00
junepark678	65c9986103	bugfix(App IDs, My Apps): fix date display	2023-11-27 09:22:19 -05:00
junepark678	9e2b9b6639	bugfix(App IDs, My Apps): display only necessary information	2023-11-27 09:22:19 -05:00
junepark678	cf373634d7	bugfix(App IDs, My Apps): calculate in correct direction in time (we aren't time travelers)	2023-11-27 09:22:19 -05:00
junepark678	b3d5d976b4	feat(My Apps): make expiration dates more specific	2023-11-27 09:22:19 -05:00
junepark678	c3c31995ce	chore(App IDs): localize Unknown string	2023-11-27 09:22:19 -05:00
junepark678	7e92e17429	feat(App IDs): make expiration dates more specific	2023-11-27 09:22:19 -05:00
junepark678	88ab8fa8d7	feat: remove reliance on Info.plist for getting udid	2023-11-27 09:21:54 -05:00
nythepegasus	2e613e6d15	[skip ci] Update Ignited source URL	2023-11-06 09:02:49 -05:00
Spidy123222	35ee92db12	Change pairing file link with new wiki link Signed-off-by: Spidy123222 <64176728+Spidy123222@users.noreply.github.com>	2023-10-23 13:12:23 -07:00
nythepegasus	04d9f760ad	Fix AltWidget App Group issue	2023-10-23 10:12:09 -04:00
naturecodevoid	4f52743be8	Revert most of xcodeproj changes	2023-10-21 20:44:49 -07:00
naturecodevoid	32cae7a5b2	Revert "Attempt to fix submodule dependencies for GH runner" This reverts commit `5cff914ff3`.	2023-10-21 20:30:32 -07:00
naturecodevoid	c2c0e3b790	Use forked libplist	2023-10-21 20:30:23 -07:00
nythepegasus	6d36a30787	[skip ci] Bump nightly to 0.5.3 Signed-off-by: nythepegasus <nythepegasus84@gmail.com>	2023-10-21 21:02:41 -04:00
nythepegasus	48a86ec6de	Update Roxas	2023-10-21 20:35:32 -04:00
nythepegasus	5cff914ff3	Attempt to fix submodule dependencies for GH runner	2023-10-21 20:34:44 -04:00
nythepegasus	70ea725ce3	Update limd/libplist submodules	2023-10-20 22:04:47 -04:00
nythepegasus	78f12e45f9	Add iOS 17 JIT error notice with other errors	2023-10-20 21:51:24 -04:00
nythepegasus	e5061acc20	Hardcode SideStore's URL scheme for now	2023-10-20 21:51:24 -04:00
nythepegasus	2d7bc51d30	Revert this change	2023-10-20 21:51:24 -04:00
nythepegasus	9128b67ee8	Add newly compiled AltBackup	2023-10-20 21:51:24 -04:00
Bogdan Seniuc	551c004476	Use provisioning profile details instead of guessing active app limit	2023-10-20 21:50:50 -04:00
Spidy123222	ed6a8d1379	[skip ci] Remove emuthreeds from trusted sources	2023-10-18 21:44:55 -07:00
nythepegasus	766fb89e0b	Change this to be hardcoded SideStore search	2023-10-17 17:38:09 -04:00
nythepegasus	c5b8cb4459	Remove buggy retry code finally	2023-10-17 17:37:29 -04:00
naturecodevoid	0deae92829	Bump version to 0.5.2 so nightly builds have a higher SemVer version than stable	2023-09-18 16:18:05 -07:00
naturecodevoid	cc5d2f1813	Build nightly with latest minimuxer changes to attempt to fix plist_from_memory crash	2023-09-18 16:17:14 -07:00
naturecodevoid	41151d0d49	0.5.1	2023-09-17 14:01:13 -07:00
Spidy123222	52702264a3	Change version to 0.5.2	2023-09-17 12:36:44 -07:00
naturecodevoid	6e297e1278	Update Swift Packages and submodules (#469 ) * Update Swift Packages * Update submodules * make sure it builds --------- Signed-off-by: naturecodevoid <44983869+naturecodevoid@users.noreply.github.com>	2023-09-17 10:45:55 -07:00
naturecodevoid	e3bb9b425f	[skip ci] Add more information to staging errors (#468 ) * Point to my forks and attempt to add more information to staging errors * Improve error message a bit * Revert fetch-prebuilt.sh changes * Undo some whitespace changes * missed one * oops * [skip ci] * [skip ci] * [skip ci] remove staging directory from install app error Signed-off-by: naturecodevoid <44983869+naturecodevoid@users.noreply.github.com> --------- Signed-off-by: naturecodevoid <44983869+naturecodevoid@users.noreply.github.com> Co-authored-by: Dadoum <dadoum@protonmail.com>	2023-09-17 10:37:49 -07:00
Spidy123222	79255be79c	Update Altsign (August 6) (#467 ) This changes the git commit or be our latest altsign version.	2023-09-16 01:51:35 -07:00
nythepegasus	7c836f5ba1	Update emuplace source Signed-off-by: nythepegasus <nythepegasus84@gmail.com>	2023-08-13 11:54:00 -04:00
Spidy123222	938bcd14ad	Add ignited source Signed-off-by: Spidy123222 <64176728+Spidy123222@users.noreply.github.com>	2023-08-06 14:15:51 -07:00
Joelle Stickney	229d79fc05	Removed Quantum Source Signed-off-by: Joelle Stickney <joellestickney+commit@gmail.com>	2023-08-06 16:26:24 -04:00
Joelle Stickney	2d3dac2e1d	Added Quantum Source to trusted sources Signed-off-by: Joelle Stickney <joellestickney+commit@gmail.com>	2023-08-06 15:30:21 -04:00
nythepegasus	e23f5e7894	[skip ci] Change Discord custom invite to static website invite Signed-off-by: nythepegasus <nythepegasus84@gmail.com>	2023-08-04 13:17:02 -04:00
Spidy123222	571d27c814	Fix message and put in proper spot. Signed-off-by: Spidy123222 <64176728+Spidy123222@users.noreply.github.com>	2023-07-27 23:42:32 -07:00
Spidy123222	dde6bd4fe3	Make Notification explanation smaller for refresh Signed-off-by: Spidy123222 <64176728+Spidy123222@users.noreply.github.com>	2023-07-27 23:17:58 -07:00
Nythepegasus	6e6dbd9329	Bump version to 0.5.0	2023-07-27 06:56:51 -04:00
Nythepegasus	258268f5ef	Update default anisette server	2023-07-27 06:55:31 -04:00
Nythepegasus	9ae49977fb	Fix going to the home screen	2023-07-27 06:23:26 -04:00
Nythepegasus	d61c54fa60	Reintroduce notification/pop-up	2023-07-27 06:23:26 -04:00
Nythepegasus	980699af6f	Remove extra returns and make sure to decrement	2023-07-27 06:23:26 -04:00
Nythepegasus	cc5c280882	Finally fix retries for minimuxer calls	2023-07-27 06:23:26 -04:00
nythepegasus	090456bba1	[skip ci] Merge pull request #419 from Nythepegasus/chore/up-fixes [Chore] Pull upstream changes from AltStore	2023-07-27 06:22:54 -04:00
nythepegasus	5354d4eb76	Merge pull request #414 from SideStore/patch/fix-widget [Patch] Change Widget entitlements to search hardcoded group first	2023-07-27 06:11:48 -04:00
Riley Testut	b986fae611	Enforces 77x31 minimum size for PillButton	2023-07-27 04:47:44 -04:00
Riley Testut	cfcfc3e928	Fixes incorrect cell height for some News items We need to take layoutMargins into account when calculating the height of the prototype cell.	2023-07-27 04:47:44 -04:00
Riley Testut	f97548fc3a	Fixes UIDocumentPickerViewController deprecation warnings	2023-07-27 04:47:44 -04:00
Riley Testut	36913b425c	Fixes “variable mutated after capture by sendable closure” warning	2023-07-27 04:47:44 -04:00
Riley Testut	822ea08d89	Fixes AppViewController deprecation warnings	2023-07-27 04:47:43 -04:00
Riley Testut	98dd6f3fe7	Fixes CollapsingTextView “TextKit 1 compatibility mode” runtime warning	2023-07-27 04:47:38 -04:00
Nythepegasus	b3f0dbb155	Change circle and logo to just be circle for now	2023-07-27 02:59:30 -04:00
nythepegasus	6904d931c3	Change the lock screen icon to be legible Signed-off-by: nythepegasus <me@nythepegas.us>	2023-07-27 02:25:09 -04:00
Nythepegasus	529466a9f7	Merge branch 'develop' into patch/fix-widget	2023-07-24 09:29:03 -04:00
Nythepegasus	77dc695ba1	Revert the retries here as these seem buggier	2023-07-24 09:22:34 -04:00
Nythepegasus	e17776f651	Remove unused Riley and Shane images from bundle	2023-07-24 07:54:20 -04:00
Nythepegasus	0d2f355a74	Update AltWidget assets	2023-07-24 07:18:42 -04:00
Nythepegasus	2ce1576016	Move the first app group to be known shared group	2023-07-24 05:49:36 -04:00
Nythepegasus	0f3be3c494	Update AltWidget/ReleaseEntitlements.plist Signed-off-by: Nythepegasus <me@nythepegas.us>	2023-07-24 05:40:51 -04:00
Nythepegasus	8c1ca8503a	Fix Actions builds for AltWidget	2023-07-24 05:28:26 -04:00
Wes Bryie	32a59c17f4	[skip ci] em_proxy link update (#412 ) Signed-off-by: Wes Bryie <wes@wesbryie.tech>	2023-07-21 20:04:44 -07:00
Riley Testut	b4b4ceab0b	Fixes updating apps with manually-removed app extensions (e.g. uYou+)	2023-07-17 12:15:04 -04:00
Nythepegasus	be1f27bb9e	Revert "Fix building on Xcode 15" This reverts commit `3de24dcfce`.	2023-07-11 02:00:49 -04:00
Nythepegasus	ed10ddb1cb	Go to home screen instead of Safari/notif combo	2023-07-11 01:45:14 -04:00
Nythepegasus	dbdb4b0f32	Add various retries to the minimuxer calls	2023-07-11 01:44:11 -04:00
Nythepegasus	59e537362e	Xcode 15 keeps adding imobiledevice.swift	2023-07-10 14:33:53 -04:00
Nythepegasus	6d96bf414f	These vars don't change, let's use let keyword	2023-07-10 14:32:41 -04:00
Nythepegasus	e7ba778a5f	Update AltSign and OpenSSL packages	2023-07-09 14:00:02 -04:00
Nythepegasus	933d349cd5	Fix libfragmentzip's search path	2023-07-09 14:00:02 -04:00
Nythepegasus	3de24dcfce	Fix building on Xcode 15	2023-07-09 13:59:55 -04:00
Spidy123222	3275d16b8b	[skip ci] use odyssey team unified source Signed-off-by: Spidy123222 <64176728+Spidy123222@users.noreply.github.com>	2023-07-08 23:53:53 -07:00
Spidy123222	5bb4cd1dad	[skip ci] Add Taurine Signed-off-by: Spidy123222 <64176728+Spidy123222@users.noreply.github.com>	2023-07-08 23:32:41 -07:00
Nythepegasus	16b14441fa	Update Macley omnisette server IP Signed-off-by: Nythepegasus <nythepegasus84@gmail.com>	2023-07-03 10:47:54 -04:00
Joshua Laymon	93a6272d30	Merge pull request #387 from bogotesr/develop Fix up patreon screen and add socials	2023-06-21 21:58:04 -07:00
Spidy123222	0dc526f778	Replace old servers with macley v3 ansiette	2023-06-14 13:56:12 -07:00
bogotesr	183e185812	Change Patreon screen again Refresh to "support us" and include social media.	2023-06-13 23:14:01 -07:00
Stern	e02453598c	Update pr.yml Signed-off-by: Stern <xsternent@gmail.com>	2023-06-13 20:31:37 -04:00
Stern	24af1b5b5f	Update pr.yml Signed-off-by: Stern <xsternent@gmail.com>	2023-06-13 20:30:41 -04:00
Spidy123222	5864c283f6	Add EmuPalace Source	2023-06-12 20:35:36 -07:00
Spidy123222	be78fa4b91	Upload config (#383 ) Signed-off-by: Spidy123222 <64176728+Spidy123222@users.noreply.github.com>	2023-06-12 09:39:20 -07:00