[skip ci] Add other project maintainers to CODEOWNERS

Signed-off-by: nythepegasus <nythepegasus84@gmail.com>

.github/CODEOWNERS

@@ -1 +1 @@
-*       @JoeMatt @lonkelle
+*       @JoeMatt @lonkelle @nythepegasus @Spidy123222 @SternXD

.github/ISSUE_TEMPLATE/bug_report.yml

@@ -10,7 +10,7 @@ body:
       value: |
         Thanks for taking the time to fill out this bug report! Before you continue filling out the report, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the bug you are experiencing** in case it has already been reported.
         
-        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+        **Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
   - type: textarea
     id: description
     attributes:

.github/ISSUE_TEMPLATE/config.yml

@@ -3,7 +3,7 @@ blank_issues_enabled: false
 
 contact_links:
   - name: Discord
-    url: https://discord.gg/RgpFBX3Q3k
+    url: https://discord.gg/sidestore-949183273383395328
     about: If you need support, please go here first instead of making an issue!
   - name: GitHub Discussions
     url: https://github.com/SideStore/SideStore/discussions

.github/ISSUE_TEMPLATE/feature_request.yml

@@ -10,7 +10,7 @@ body:
       value: |
         Thanks for taking the time to fill out this feature request! Before you continue filling out the form, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the feature you are suggestion** in case it has already been suggested.
         
-        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+        **Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
   - type: textarea
     id: description
     attributes:

.gitmodules

@@ -9,7 +9,7 @@
 	url = https://github.com/libimobiledevice/libusbmuxd.git
 [submodule "Dependencies/libplist"]
 	path = Dependencies/libplist
-	url = https://github.com/libimobiledevice/libplist.git
+	url = https://github.com/SideStore/libplist.git
 [submodule "Dependencies/MarkdownAttributedString"]
 	path = Dependencies/MarkdownAttributedString
 	url = https://github.com/chockenberry/MarkdownAttributedString.git

AltBackup/Assets.xcassets/Background.colorset/Contents.json

@@ -5,9 +5,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "0.518",
+          "blue" : "175",
-          "green" : "0.502",
+          "green" : "4",
-          "red" : "0.004"
+          "red" : "115"
         }
       },
       "idiom" : "universal"
@@ -23,9 +23,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "0.404",
+          "blue" : "150",
-          "green" : "0.322",
+          "green" : "3",
-          "red" : "0.008"
+          "red" : "99"
         }
       },
       "idiom" : "universal"

AltStore.xcodeproj/project.pbxproj

@@ -8,13 +8,39 @@
 
 /* Begin PBXBuildFile section */
 		03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E314122A05D4C00370A3C /* Bundle+AltStore.swift */; };
+		0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0E1A1F902AE36A9600364CAD /* bytearray.c */; };
+		0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = 0E764E162ADFF5740043DD4E /* AltBackup.ipa */; };
+		0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166472ADFE0D1003015C1 /* out-limd.c */; };
+		0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166522ADFE0D2003015C1 /* out-default.c */; };
+		0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166552ADFE0D2003015C1 /* out-plutil.c */; };
+		0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166562ADFE0D2003015C1 /* oplist.c */; };
+		0EA166682ADFE122003015C1 /* jsmn.h in Headers */ = {isa = PBXBuildFile; fileRef = 0EA166632ADFE122003015C1 /* jsmn.h */; };
+		0EA166692ADFE140003015C1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166452ADFE0D1003015C1 /* Array.cpp */; };
+		0EA1666A2ADFE140003015C1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166492ADFE0D1003015C1 /* String.cpp */; };
+		0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */; };
+		0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166532ADFE0D2003015C1 /* Integer.cpp */; };
+		0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166432ADFE0D1003015C1 /* Data.cpp */; };
+		0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166512ADFE0D2003015C1 /* ptrarray.c */; };
+		0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664F2ADFE0D1003015C1 /* hashtable.c */; };
+		0EA166702ADFE140003015C1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166502ADFE0D2003015C1 /* Node.cpp */; };
+		0EA166712ADFE140003015C1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166582ADFE0D2003015C1 /* Key.cpp */; };
+		0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166462ADFE0D1003015C1 /* Dictionary.cpp */; };
+		0EA166742ADFE140003015C1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166422ADFE0D1003015C1 /* Date.cpp */; };
+		0EA166752ADFE140003015C1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166542ADFE0D2003015C1 /* Real.cpp */; };
+		0EA166762ADFE140003015C1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664A2ADFE0D1003015C1 /* base64.c */; };
+		0EA166772ADFE140003015C1 /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166412ADFE0D1003015C1 /* jplist.c */; };
+		0EA166782ADFE140003015C1 /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166572ADFE0D2003015C1 /* jsmn.c */; };
+		0EA166792ADFE140003015C1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166442ADFE0D1003015C1 /* bplist.c */; };
+		0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664B2ADFE0D1003015C1 /* Uid.cpp */; };
+		0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1665A2ADFE0D2003015C1 /* Structure.cpp */; };
+		0EA1667D2ADFE140003015C1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166592ADFE0D2003015C1 /* xplist.c */; };
+		0EA1667E2ADFE140003015C1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664C2ADFE0D1003015C1 /* time64.c */; };
+		0EA4B9BC2AE4A414009209CE /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA4B9BB2AE4A3F6009209CE /* plist.c */; };
 		19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */ = {isa = PBXBuildFile; fileRef = BF45872B2298D31600BD7491 /* libimobiledevice.a */; };
 		19104DB52909C06D00C49C7B /* EmotionalDamage.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19104DB42909C06D00C49C7B /* EmotionalDamage.swift */; };
 		19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DB22909C06C00C49C7B /* libEmotionalDamage.a */; };
 		191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FAB290A5D92001A3B7C /* libminimuxer.a */; };
 		191E5FDC290AFA5C001A3B7C /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 191E5FDB290AFA5C001A3B7C /* OpenSSL */; };
-		191E607D290B2EA5001A3B7C /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FD0290A651D001A3B7C /* jsmn.c */; };
-		191E607E290B2EA7001A3B7C /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FCF290A651D001A3B7C /* jplist.c */; };
 		1920B04F2924AC8300744F60 /* Settings.bundle in Resources */ = {isa = PBXBuildFile; fileRef = 1920B04E2924AC8300744F60 /* Settings.bundle */; };
 		19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */; };
 		4879A95F2861046500FC1BBD /* AltSign in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A95E2861046500FC1BBD /* AltSign */; };
@@ -25,7 +51,6 @@
 		99F87D1829D8E4C900B40039 /* SwiftBridgeCore.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1629D8E4C900B40039 /* SwiftBridgeCore.swift */; };
 		99F87D1929D8E4C900B40039 /* minimuxer.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1729D8E4C900B40039 /* minimuxer.swift */; };
 		B3146ED2284F581E00BBC3FD /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; };
-		B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; settings = {ATTRIBUTES = (CodeSignOnCopy, RemoveHeadersOnCopy, ); }; };
 		B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F894295F7F9B002B1159 /* libfragmentzip.a */; };
 		B33FFBAA295F8F78002259E6 /* preboard.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBA9295F8F78002259E6 /* preboard.c */; };
 		B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBAB295F8F98002259E6 /* companion_proxy.c */; };
@@ -74,7 +99,6 @@
 		BF41B808233433C100C593A3 /* LoadingState.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF41B807233433C100C593A3 /* LoadingState.swift */; };
 		BF42345A25101C35006D1EB2 /* WidgetView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF42345825101C1D006D1EB2 /* WidgetView.swift */; };
 		BF44EEF0246B08BA002A52F2 /* BackupController.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEEF246B08BA002A52F2 /* BackupController.swift */; };
-		BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */; };
 		BF44EEFC246B4550002A52F2 /* RemoveAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */; };
 		BF4587F82298D3AB00BD7491 /* service.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4587C82298D3A800BD7491 /* service.h */; };
 		BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587C92298D3A800BD7491 /* diagnostics_relay.c */; };
@@ -254,34 +278,6 @@
 		BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = BFD247782284B9A700981D42 /* LaunchScreen.storyboard */; };
 		BFD2478C2284C4C300981D42 /* AppIconImageView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478B2284C4C300981D42 /* AppIconImageView.swift */; };
 		BFD2478F2284C8F900981D42 /* Button.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478E2284C8F900981D42 /* Button.swift */; };
-		BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */; };
-		BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE622A1A9CA000B7ED1 /* base64.c */; };
-		BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE722A1A9CA000B7ED1 /* hashtable.c */; };
-		BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */; };
-		BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */; };
-		BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEA22A1A9CA000B7ED1 /* bplist.c */; };
-		BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEB22A1A9CA000B7ED1 /* String.cpp */; };
-		BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEC22A1A9CA000B7ED1 /* time64.c */; };
-		BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BED22A1A9CA000B7ED1 /* plist.h */; };
-		BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEE22A1A9CA000B7ED1 /* plist.c */; };
-		BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */; };
-		BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF022A1A9CA000B7ED1 /* Date.cpp */; };
-		BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */; };
-		BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */; };
-		BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF322A1A9CA000B7ED1 /* Real.cpp */; };
-		BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF422A1A9CA000B7ED1 /* strbuf.h */; };
-		BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF522A1A9CA000B7ED1 /* bytearray.c */; };
-		BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF622A1A9CA000B7ED1 /* base64.h */; };
-		BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF722A1A9CA000B7ED1 /* Data.cpp */; };
-		BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF822A1A9CB000B7ED1 /* Array.cpp */; };
-		BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF922A1A9CB000B7ED1 /* Node.cpp */; };
-		BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */; };
-		BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */; };
-		BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */; };
-		BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */; };
-		BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */; };
-		BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFF22A1A9CB000B7ED1 /* time64.h */; };
-		BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C0022A1A9CB000B7ED1 /* xplist.c */; };
 		BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1D22A1A9EC000B7ED1 /* node.c */; };
 		BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1E22A1A9EC000B7ED1 /* node_list.c */; };
 		BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1F22A1A9EC000B7ED1 /* cnary.c */; };
@@ -336,6 +332,7 @@
 		D57FE84428C7DB7100216002 /* ErrorLogViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */; };
 		D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = D58916FD28C7C55C00E39C8B /* LoggedError.swift */; };
 		D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D593F1932717749A006E82DE /* PatchAppOperation.swift */; };
+		D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */; };
 		D5CA0C4B280E141900469595 /* ManagedPatron.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4A280E141900469595 /* ManagedPatron.swift */; };
 		D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */; };
 		D5DAE0942804B0B80034D8D4 /* ScreenshotProcessor.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5DAE0932804B0B80034D8D4 /* ScreenshotProcessor.swift */; };
@@ -482,7 +479,6 @@
 			dstPath = "";
 			dstSubfolderSpec = 10;
 			files = (
-				B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */,
 				BF1614F2250822F100767AEA /* Roxas.framework in Embed Frameworks */,
 				BF66EE862501AE50007EE018 /* AltStoreCore.framework in Embed Frameworks */,
 			);
@@ -503,12 +499,45 @@
 /* End PBXCopyFilesBuildPhase section */
 
 /* Begin PBXFileReference section */
+		0E1A1F902AE36A9600364CAD /* bytearray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = src/bytearray.c; sourceTree = "<group>"; };
+		0E764E162ADFF5740043DD4E /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; name = AltBackup.ipa; path = AltStore/Resources/AltBackup.ipa; sourceTree = SOURCE_ROOT; };
+		0EA166412ADFE0D1003015C1 /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166422ADFE0D1003015C1 /* Date.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166432ADFE0D1003015C1 /* Data.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166442ADFE0D1003015C1 /* bplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166452ADFE0D1003015C1 /* Array.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166462ADFE0D1003015C1 /* Dictionary.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166472ADFE0D1003015C1 /* out-limd.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-limd.c"; path = "Dependencies/libplist/src/out-limd.c"; sourceTree = SOURCE_ROOT; };
+		0EA166492ADFE0D1003015C1 /* String.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664A2ADFE0D1003015C1 /* base64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
+		0EA1664B2ADFE0D1003015C1 /* Uid.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664C2ADFE0D1003015C1 /* time64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
+		0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664F2ADFE0D1003015C1 /* hashtable.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
+		0EA166502ADFE0D2003015C1 /* Node.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166512ADFE0D2003015C1 /* ptrarray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
+		0EA166522ADFE0D2003015C1 /* out-default.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-default.c"; path = "Dependencies/libplist/src/out-default.c"; sourceTree = SOURCE_ROOT; };
+		0EA166532ADFE0D2003015C1 /* Integer.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166542ADFE0D2003015C1 /* Real.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166552ADFE0D2003015C1 /* out-plutil.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-plutil.c"; path = "Dependencies/libplist/src/out-plutil.c"; sourceTree = SOURCE_ROOT; };
+		0EA166562ADFE0D2003015C1 /* oplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = oplist.c; path = Dependencies/libplist/src/oplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166572ADFE0D2003015C1 /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
+		0EA166582ADFE0D2003015C1 /* Key.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166592ADFE0D2003015C1 /* xplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
+		0EA1665A2ADFE0D2003015C1 /* Structure.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1665F2ADFE122003015C1 /* time64_limits.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
+		0EA166602ADFE122003015C1 /* time64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
+		0EA166612ADFE122003015C1 /* bytearray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
+		0EA166622ADFE122003015C1 /* ptrarray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
+		0EA166632ADFE122003015C1 /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
+		0EA166642ADFE122003015C1 /* plist.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
+		0EA166652ADFE122003015C1 /* hashtable.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
+		0EA166662ADFE122003015C1 /* base64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
+		0EA166672ADFE122003015C1 /* strbuf.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
+		0EA4B9BB2AE4A3F6009209CE /* plist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
 		19104DB22909C06C00C49C7B /* libEmotionalDamage.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libEmotionalDamage.a; sourceTree = BUILT_PRODUCTS_DIR; };
 		19104DB42909C06D00C49C7B /* EmotionalDamage.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EmotionalDamage.swift; sourceTree = "<group>"; };
 		191E5FAB290A5D92001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer.a; sourceTree = BUILT_PRODUCTS_DIR; };
-		191E5FCF290A651D001A3B7C /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
-		191E5FD0290A651D001A3B7C /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
-		191E5FD1290A651D001A3B7C /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
 		1920B04E2924AC8300744F60 /* Settings.bundle */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.plug-in"; path = Settings.bundle; sourceTree = "<group>"; };
 		19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SelectTeamViewController.swift; sourceTree = "<group>"; };
 		9961EC2D29BE9F2E00AF2C6F /* minimuxer-helpers.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; name = "minimuxer-helpers.swift"; path = "Dependencies/minimuxer/minimuxer-helpers.swift"; sourceTree = SOURCE_ROOT; };
@@ -573,7 +602,6 @@
 		BF41B807233433C100C593A3 /* LoadingState.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoadingState.swift; sourceTree = "<group>"; };
 		BF42345825101C1D006D1EB2 /* WidgetView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = WidgetView.swift; sourceTree = "<group>"; };
 		BF44EEEF246B08BA002A52F2 /* BackupController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = BackupController.swift; sourceTree = "<group>"; };
-		BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; path = AltBackup.ipa; sourceTree = "<group>"; };
 		BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RemoveAppOperation.swift; sourceTree = "<group>"; };
 		BF45872B2298D31600BD7491 /* libimobiledevice.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libimobiledevice.a; sourceTree = BUILT_PRODUCTS_DIR; };
 		BF4587C82298D3A800BD7491 /* service.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = service.h; path = Dependencies/libimobiledevice/src/service.h; sourceTree = SOURCE_ROOT; };
@@ -759,34 +787,6 @@
 		BFD2479E2284FBD000981D42 /* UIColor+AltStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "UIColor+AltStore.swift"; sourceTree = "<group>"; };
 		BFD44605241188C300EAB90A /* CodableServerError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = CodableServerError.swift; sourceTree = "<group>"; };
 		BFD52BD222A06EFB000B7ED1 /* ALTConstants.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTConstants.h; sourceTree = "<group>"; };
-		BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE622A1A9CA000B7ED1 /* base64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE722A1A9CA000B7ED1 /* hashtable.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
-		BFD52BEA22A1A9CA000B7ED1 /* bplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
-		BFD52BEB22A1A9CA000B7ED1 /* String.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BEC22A1A9CA000B7ED1 /* time64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
-		BFD52BED22A1A9CA000B7ED1 /* plist.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
-		BFD52BEE22A1A9CA000B7ED1 /* plist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
-		BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF022A1A9CA000B7ED1 /* Date.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF322A1A9CA000B7ED1 /* Real.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF422A1A9CA000B7ED1 /* strbuf.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF522A1A9CA000B7ED1 /* bytearray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = Dependencies/libplist/src/bytearray.c; sourceTree = SOURCE_ROOT; };
-		BFD52BF622A1A9CA000B7ED1 /* base64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF722A1A9CA000B7ED1 /* Data.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF822A1A9CB000B7ED1 /* Array.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF922A1A9CB000B7ED1 /* Node.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
-		BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
-		BFD52BFF22A1A9CB000B7ED1 /* time64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
-		BFD52C0022A1A9CB000B7ED1 /* xplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1D22A1A9EC000B7ED1 /* node.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node.c; path = Dependencies/libplist/libcnary/node.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1E22A1A9EC000B7ED1 /* node_list.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node_list.c; path = Dependencies/libplist/libcnary/node_list.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1F22A1A9EC000B7ED1 /* cnary.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = cnary.c; path = Dependencies/libplist/libcnary/cnary.c; sourceTree = SOURCE_ROOT; };
@@ -840,6 +840,7 @@
 		D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorLogViewController.swift; sourceTree = "<group>"; };
 		D58916FD28C7C55C00E39C8B /* LoggedError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoggedError.swift; sourceTree = "<group>"; };
 		D593F1932717749A006E82DE /* PatchAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchAppOperation.swift; sourceTree = "<group>"; };
+		D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ClearAppCacheOperation.swift; sourceTree = "<group>"; };
 		D5CA0C4A280E141900469595 /* ManagedPatron.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ManagedPatron.swift; sourceTree = "<group>"; };
 		D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 10.xcdatamodel"; sourceTree = "<group>"; };
 		D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcmappingmodel; path = AltStore9ToAltStore10.xcmappingmodel; sourceTree = "<group>"; };
@@ -1192,37 +1193,41 @@
 		BF4588562298DC6D00BD7491 /* libplist */ = {
 			isa = PBXGroup;
 			children = (
-				BFD52BE622A1A9CA000B7ED1 /* base64.c */,
+				0EA166462ADFE0D1003015C1 /* Dictionary.cpp */,
-				BFD52BEA22A1A9CA000B7ED1 /* bplist.c */,
+				0E1A1F902AE36A9600364CAD /* bytearray.c */,
-				BFD52BF522A1A9CA000B7ED1 /* bytearray.c */,
+				0EA166442ADFE0D1003015C1 /* bplist.c */,
-				BFD52BE722A1A9CA000B7ED1 /* hashtable.c */,
+				0EA166432ADFE0D1003015C1 /* Data.cpp */,
-				191E5FCF290A651D001A3B7C /* jplist.c */,
+				0EA166422ADFE0D1003015C1 /* Date.cpp */,
-				191E5FD0290A651D001A3B7C /* jsmn.c */,
+				0EA1664F2ADFE0D1003015C1 /* hashtable.c */,
-				BFD52BEE22A1A9CA000B7ED1 /* plist.c */,
+				0EA166532ADFE0D2003015C1 /* Integer.cpp */,
-				BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */,
+				0EA166562ADFE0D2003015C1 /* oplist.c */,
-				BFD52BEC22A1A9CA000B7ED1 /* time64.c */,
+				0EA166522ADFE0D2003015C1 /* out-default.c */,
-				BFD52C0022A1A9CB000B7ED1 /* xplist.c */,
+				0EA166472ADFE0D1003015C1 /* out-limd.c */,
-				BFD52BF822A1A9CB000B7ED1 /* Array.cpp */,
+				0EA166552ADFE0D2003015C1 /* out-plutil.c */,
-				BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */,
+				0EA166492ADFE0D1003015C1 /* String.cpp */,
-				BFD52BF722A1A9CA000B7ED1 /* Data.cpp */,
+				0EA1665A2ADFE0D2003015C1 /* Structure.cpp */,
-				BFD52BF022A1A9CA000B7ED1 /* Date.cpp */,
+				0EA166452ADFE0D1003015C1 /* Array.cpp */,
-				BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */,
+				0EA1664A2ADFE0D1003015C1 /* base64.c */,
-				BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */,
+				0EA166572ADFE0D2003015C1 /* jsmn.c */,
-				BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */,
+				0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */,
-				BFD52BF922A1A9CB000B7ED1 /* Node.cpp */,
+				0EA4B9BB2AE4A3F6009209CE /* plist.c */,
-				BFD52BF322A1A9CA000B7ED1 /* Real.cpp */,
+				0EA166412ADFE0D1003015C1 /* jplist.c */,
-				BFD52BEB22A1A9CA000B7ED1 /* String.cpp */,
+				0EA166582ADFE0D2003015C1 /* Key.cpp */,
-				BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */,
+				0EA166512ADFE0D2003015C1 /* ptrarray.c */,
-				BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */,
+				0EA1664C2ADFE0D1003015C1 /* time64.c */,
-				BFD52BF622A1A9CA000B7ED1 /* base64.h */,
+				0EA166502ADFE0D2003015C1 /* Node.cpp */,
-				BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */,
+				0EA166542ADFE0D2003015C1 /* Real.cpp */,
-				BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */,
+				0EA1664B2ADFE0D1003015C1 /* Uid.cpp */,
-				191E5FD1290A651D001A3B7C /* jsmn.h */,
+				0EA166592ADFE0D2003015C1 /* xplist.c */,
-				BFD52BED22A1A9CA000B7ED1 /* plist.h */,
+				0EA166662ADFE122003015C1 /* base64.h */,
-				BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */,
+				0EA166652ADFE122003015C1 /* hashtable.h */,
-				BFD52BF422A1A9CA000B7ED1 /* strbuf.h */,
+				0EA166632ADFE122003015C1 /* jsmn.h */,
-				BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */,
+				0EA166642ADFE122003015C1 /* plist.h */,
-				BFD52BFF22A1A9CB000B7ED1 /* time64.h */,
+				0EA166612ADFE122003015C1 /* bytearray.h */,
+				0EA166622ADFE122003015C1 /* ptrarray.h */,
+				0EA166672ADFE122003015C1 /* strbuf.h */,
+				0EA1665F2ADFE122003015C1 /* time64_limits.h */,
+				0EA166602ADFE122003015C1 /* time64.h */,
 				BF4588892298DDEA00BD7491 /* libcnary */,
 			);
 			path = libplist;
@@ -1619,7 +1624,7 @@
 		BFD247962284D7C100981D42 /* Resources */ = {
 			isa = PBXGroup;
 			children = (
-				BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */,
+				0E764E162ADFF5740043DD4E /* AltBackup.ipa */,
 				BFD247762284B9A700981D42 /* Assets.xcassets */,
 				BF770E6822BD57DD002A40FE /* Silence.m4a */,
 			);
@@ -1694,6 +1699,7 @@
 				D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */,
 				D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */,
 				D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */,
+				D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */,
 				BF7B44062725A4B8005288A4 /* Patch App */,
 			);
 			path = Operations;
@@ -1780,32 +1786,26 @@
 			isa = PBXHeadersBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				0EA166682ADFE122003015C1 /* jsmn.h in Headers */,
 				BF4588112298D3AB00BD7491 /* misagent.h in Headers */,
 				BF4588042298D3AB00BD7491 /* lockdown.h in Headers */,
 				BF45880B2298D3AB00BD7491 /* mobilesync.h in Headers */,
 				BF4588002298D3AB00BD7491 /* restore.h in Headers */,
 				BF4588152298D3AB00BD7491 /* mobilebackup.h in Headers */,
 				BF4588182298D3AB00BD7491 /* syslog_relay.h in Headers */,
-				BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */,
 				BF45881D2298D3AB00BD7491 /* file_relay.h in Headers */,
-				BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */,
 				BF4587FD2298D3AB00BD7491 /* sbservices.h in Headers */,
 				BF4588362298D3C100BD7491 /* debug.h in Headers */,
 				BF4588202298D3AB00BD7491 /* mobile_image_mounter.h in Headers */,
 				BF4588122298D3AB00BD7491 /* house_arrest.h in Headers */,
 				BF45881F2298D3AB00BD7491 /* device_link_service.h in Headers */,
-				BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */,
 				BF45880E2298D3AB00BD7491 /* debugserver.h in Headers */,
 				BF4588102298D3AB00BD7491 /* heartbeat.h in Headers */,
 				BF4587FA2298D3AB00BD7491 /* diagnostics_relay.h in Headers */,
-				BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */,
-				BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */,
 				BF4588192298D3AB00BD7491 /* webinspector.h in Headers */,
 				BF4588342298D3C100BD7491 /* userpref.h in Headers */,
 				BF45880A2298D3AB00BD7491 /* screenshotr.h in Headers */,
-				BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */,
 				BF4587FE2298D3AB00BD7491 /* mobilebackup2.h in Headers */,
-				BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */,
 				BF45881C2298D3AB00BD7491 /* afc.h in Headers */,
 				BF45881A2298D3AB00BD7491 /* mobileactivation.h in Headers */,
 				BF4588052298D3AB00BD7491 /* idevice.h in Headers */,
@@ -1813,7 +1813,6 @@
 				BF4587F82298D3AB00BD7491 /* service.h in Headers */,
 				BF4588252298D3AB00BD7491 /* property_list_service.h in Headers */,
 				BF4588132298D3AB00BD7491 /* notification_proxy.h in Headers */,
-				BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -2209,7 +2208,6 @@
 				BFE60738231ADF49002B0E8E /* Settings.storyboard in Resources */,
 				D57DF638271E32F000677701 /* PatchApp.storyboard in Resources */,
 				BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */,
-				BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */,
 				BF770E6922BD57DD002A40FE /* Silence.m4a in Resources */,
 				BFD247772284B9A700981D42 /* Assets.xcassets in Resources */,
 				1920B04F2924AC8300744F60 /* Settings.bundle in Resources */,
@@ -2217,6 +2215,7 @@
 				BFB6B22423187A3D0022A802 /* NewsCollectionViewCell.xib in Resources */,
 				BFD247752284B9A500981D42 /* Main.storyboard in Resources */,
 				BFDB5B2622EFBBEA00F74113 /* BrowseCollectionViewCell.xib in Resources */,
+				0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */,
 				BFE6073C231AE1E7002B0E8E /* SettingsHeaderFooterView.xib in Resources */,
 				BF29012F2318F6B100D88A45 /* AppBannerView.xib in Resources */,
 				BFE6325A22A83BEB00F30809 /* Authentication.storyboard in Resources */,
@@ -2292,69 +2291,73 @@
 			isa = PBXSourcesBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */,
+				0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */,
+				0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */,
+				0EA166742ADFE140003015C1 /* Date.cpp in Sources */,
+				0EA166712ADFE140003015C1 /* Key.cpp in Sources */,
+				0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */,
+				0EA1666A2ADFE140003015C1 /* String.cpp in Sources */,
+				0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */,
+				0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */,
+				0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */,
+				0EA166702ADFE140003015C1 /* Node.cpp in Sources */,
+				0EA166752ADFE140003015C1 /* Real.cpp in Sources */,
+				0EA166762ADFE140003015C1 /* base64.c in Sources */,
+				0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */,
 				BF45881B2298D3AB00BD7491 /* house_arrest.c in Sources */,
-				BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */,
+				0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */,
 				BF4588232298D3AB00BD7491 /* mobilesync.c in Sources */,
 				BF4588072298D3AB00BD7491 /* afc.c in Sources */,
-				191E607D290B2EA5001A3B7C /* jsmn.c in Sources */,
-				191E607E290B2EA7001A3B7C /* jplist.c in Sources */,
 				BF4588082298D3AB00BD7491 /* mobile_image_mounter.c in Sources */,
-				BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */,
 				BF4588022298D3AB00BD7491 /* file_relay.c in Sources */,
 				BF45880F2298D3AB00BD7491 /* debugserver.c in Sources */,
+				0EA166792ADFE140003015C1 /* bplist.c in Sources */,
+				0EA166772ADFE140003015C1 /* jplist.c in Sources */,
 				BF4588162298D3AB00BD7491 /* restore.c in Sources */,
-				BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */,
-				BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */,
 				BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */,
 				BF4588092298D3AB00BD7491 /* installation_proxy.c in Sources */,
+				0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */,
+				0EA1667E2ADFE140003015C1 /* time64.c in Sources */,
 				BF4587FF2298D3AB00BD7491 /* heartbeat.c in Sources */,
 				BF4588222298D3AB00BD7491 /* mobileactivation.c in Sources */,
-				BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */,
 				BF4588212298D3AB00BD7491 /* idevice.c in Sources */,
 				B343F885295F7C5D002B1159 /* tlv.c in Sources */,
-				BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */,
 				BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */,
 				B343F87D295F7C5D002B1159 /* cbuf.c in Sources */,
 				BF4588062298D3AB00BD7491 /* webinspector.c in Sources */,
-				BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */,
 				B343F883295F7C5D002B1159 /* thread.c in Sources */,
 				BF45880D2298D3AB00BD7491 /* mobilebackup.c in Sources */,
-				BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */,
-				BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */,
-				BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */,
 				BF45883A2298D3C100BD7491 /* debug.c in Sources */,
 				B343F881295F7C5D002B1159 /* termcolors.c in Sources */,
+				0EA1667D2ADFE140003015C1 /* xplist.c in Sources */,
 				B343F87E295F7C5D002B1159 /* collection.c in Sources */,
-				BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */,
 				B33FFBAA295F8F78002259E6 /* preboard.c in Sources */,
 				B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */,
 				BF4587FB2298D3AB00BD7491 /* notification_proxy.c in Sources */,
 				BF4588352298D3C100BD7491 /* userpref.c in Sources */,
-				BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */,
+				0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */,
 				B343F87C295F7C5D002B1159 /* opack.c in Sources */,
-				BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */,
-				BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */,
 				B343F884295F7C5D002B1159 /* utils.c in Sources */,
 				BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */,
 				B343F87F295F7C5D002B1159 /* glue.c in Sources */,
-				BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */,
 				BF4588242298D3AB00BD7491 /* property_list_service.c in Sources */,
 				BF45881E2298D3AB00BD7491 /* misagent.c in Sources */,
+				0EA166692ADFE140003015C1 /* Array.cpp in Sources */,
 				B343F880295F7C5D002B1159 /* socket.c in Sources */,
 				BF4587FC2298D3AB00BD7491 /* sbservices.c in Sources */,
-				BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */,
+				0EA166782ADFE140003015C1 /* jsmn.c in Sources */,
 				BF4588142298D3AB00BD7491 /* device_link_service.c in Sources */,
 				BF4588172298D3AB00BD7491 /* screenshotr.c in Sources */,
-				BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */,
-				BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */,
 				BF4588432298D40000BD7491 /* libusbmuxd.c in Sources */,
+				0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */,
+				0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */,
 				BF4588032298D3AB00BD7491 /* syslog_relay.c in Sources */,
 				BF4588272298D3AB00BD7491 /* service.c in Sources */,
-				BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */,
 				BF4588262298D3AB00BD7491 /* lockdown.c in Sources */,
 				BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */,
 				BF45880C2298D3AB00BD7491 /* mobilebackup2.c in Sources */,
-				BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */,
+				0EA4B9BC2AE4A414009209CE /* plist.c in Sources */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -2504,6 +2507,7 @@
 				BFD6B03322DFF20800B86064 /* MyAppsComponents.swift in Sources */,
 				BF41B808233433C100C593A3 /* LoadingState.swift in Sources */,
 				BFF0B69A2322D7D0007A79E1 /* UIScreen+CompactHeight.swift in Sources */,
+				D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */,
 				D5F2F6A92720B7C20081CCF5 /* PatchViewController.swift in Sources */,
 				B39F16132918D7C5002E9404 /* Consts.swift in Sources */,
 				BF8F69C222E659F700049BA1 /* AppContentViewController.swift in Sources */,
@@ -3221,9 +3225,10 @@
 				);
 				LIBRARY_SEARCH_PATHS = (
 					"$(inherited)",
-					"$(PROJECT_DIR)/Dependencies/fragmentzip",
+					"$(PROJECT_DIR)/Dependencies/libfragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
 				);
+				OTHER_LDFLAGS = "";
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
@@ -3255,9 +3260,10 @@
 				);
 				LIBRARY_SEARCH_PATHS = (
 					"$(inherited)",
-					"$(PROJECT_DIR)/Dependencies/fragmentzip",
+					"$(PROJECT_DIR)/Dependencies/libfragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
 				);
+				OTHER_LDFLAGS = "";
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";

AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved

@@ -6,7 +6,7 @@
       "location" : "https://github.com/SideStore/AltSign",
       "state" : {
         "branch" : "master",
-        "revision" : "7e0e7edcf8fbc44ac1e35da3e9030a297aa18b84"
+        "revision" : "cc6189f0f7cd8e5bd24943af9322e0ff9420e9f4"
       }
     },
     {
@@ -14,8 +14,17 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/microsoft/appcenter-sdk-apple.git",
       "state" : {
-        "revision" : "8354a50fe01a7e54e196d3b5493b5ab53dd5866a",
+        "revision" : "b2dc99cfedead0bad4e6573d86c5228c89cff332",
-        "version" : "4.4.2"
+        "version" : "4.4.3"
+      }
+    },
+    {
+      "identity" : "imobiledevice.swift",
+      "kind" : "remoteSourceControl",
+      "location" : "https://github.com/SideStore/iMobileDevice.swift",
+      "state" : {
+        "revision" : "74e481106dd155c0cd21bca6795fd9fe5f751654",
+        "version" : "1.0.5"
       }
     },
     {
@@ -50,8 +59,8 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/krzyzanowskim/OpenSSL",
       "state" : {
-        "revision" : "033fcb41dac96b1b6effa945ca1f9ade002370b2",
+        "revision" : "0faf71a188bcfdf0245cab42886b9b240ca71c52",
-        "version" : "1.1.1501"
+        "version" : "1.1.2200"
       }
     },
     {
@@ -59,8 +68,8 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/microsoft/PLCrashReporter.git",
       "state" : {
-        "revision" : "6b27393cad517c067dceea85fadf050e70c4ceaa",
+        "revision" : "81cdec2b3827feb03286cb297f4c501a8eb98df1",
-        "version" : "1.10.1"
+        "version" : "1.10.2"
       }
     },
     {
@@ -68,8 +77,8 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/SwiftPackageIndex/SemanticVersion.git",
       "state" : {
-        "revision" : "fc670910dc0903cc269b3d0b776cda5703979c4e",
+        "revision" : "a70840d5fca686ae3bd2fcf8aecc5ded0bd4f125",
-        "version" : "0.3.5"
+        "version" : "0.3.6"
       }
     },
     {
@@ -77,8 +86,8 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/sparkle-project/Sparkle.git",
       "state" : {
-        "revision" : "286edd1fa22505a9e54d170e9fd07d775ea233f2",
+        "revision" : "f0ceaf5cc9f3f23daa0ccb6dcebd79fc96ccc7d9",
-        "version" : "2.1.0"
+        "version" : "2.5.0"
       }
     },
     {
@@ -86,8 +95,8 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/daltoniam/Starscream.git",
       "state" : {
-        "revision" : "df8d82047f6654d8e4b655d1b1525c64e1059d21",
+        "revision" : "ac6c0fc9da221873e01bd1a0d4818498a71eef33",
-        "version" : "4.0.4"
+        "version" : "4.0.6"
       }
     },
     {

AltStore/App Detail/AppViewController.swift

@@ -217,8 +217,8 @@ final class AppViewController: UIViewController
                         
             self._shouldResetLayout = false
         }
-        
+                
-        let statusBarHeight = UIApplication.shared.statusBarFrame.height
+        let statusBarHeight = self.view.window?.windowScene?.statusBarManager?.statusBarFrame.height ?? 0
         let cornerRadius = self.contentViewControllerShadowView.layer.cornerRadius
         
         let inset = 12 as CGFloat
@@ -323,7 +323,7 @@ final class AppViewController: UIViewController
         
         self.backButtonContainerView.layer.cornerRadius = self.backButtonContainerView.bounds.midY
         
-        self.scrollView.scrollIndicatorInsets.top = statusBarHeight
+        self.scrollView.verticalScrollIndicatorInsets.top = statusBarHeight
         
         // Adjust content offset + size.
         let contentOffset = self.scrollView.contentOffset

AltStore/App IDs/AppIDsViewController.swift

@@ -91,13 +91,18 @@ private extension AppIDsViewController
                 
                 cell.bannerView.buttonLabel.isHidden = false
                 
-                let currentDate = Date()
+                let formatter = DateComponentsFormatter()
+                formatter.unitsStyle = .full
+                formatter.includesApproximationPhrase = false
+                formatter.includesTimeRemainingPhrase = false
+                formatter.allowedUnits = [.minute, .hour, .day]
+                formatter.maximumUnitCount = 1
                 
-                let numberOfDays = expirationDate.numberOfCalendarDays(since: currentDate)
+                cell.bannerView.button.setTitle(formatter.string(from: Date(), to: expirationDate)?.uppercased(), for: .normal)
-                let numberOfDaysText = (numberOfDays == 1) ? NSLocalizedString("1 day", comment: "") : String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
-                cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
                 
-                attributedAccessibilityLabel.mutableString.append(String(format: NSLocalizedString("Expires in %@.", comment: ""), numberOfDaysText) + " ")
+                formatter.includesTimeRemainingPhrase = true
+                
+                attributedAccessibilityLabel.mutableString.append((formatter.string(from: Date(), to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " ")
             }
             else
             {
@@ -206,7 +211,7 @@ extension AppIDsViewController: UICollectionViewDelegateFlowLayout
                 **App IDs can't be deleted**, but they do expire after one week. SideStore will automatically renew App IDs for all active apps once they've expired.
                 """, comment: "")
                 
-                let attributedText = NSAttributedString(markdownRepresentation: text, attributes: [.font: headerView.textLabel.font as Any])
+                let attributedText = NSAttributedString(markdownRepresentation: text)
                 headerView.textLabel.attributedText = attributedText
             }
             else

AltStore/Browse/BrowseViewController.swift

@@ -8,6 +8,7 @@
 
 import UIKit
 
+import minimuxer
 import AltStoreCore
 import Roxas
 
@@ -264,7 +265,13 @@ private extension BrowseViewController
             previousProgress?.cancel()
             return
         }
-        
+
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         _ = AppManager.shared.install(app, presentingViewController: self) { (result) in
             DispatchQueue.main.async {
                 switch result

AltStore/Components/CollapsingTextView.swift

@@ -22,7 +22,7 @@ final class CollapsingTextView: UITextView
         }
     }
     
-    var lineSpacing: CGFloat = 2 {
+    var lineSpacing: Double = 2 {
         didSet {
             self.setNeedsLayout()
         }
@@ -34,7 +34,19 @@ final class CollapsingTextView: UITextView
     {
         super.awakeFromNib()
         
-        self.layoutManager.delegate = self
+        self.initialize()
+    }
+    
+    private func initialize()
+    {
+        if #available(iOS 16, *)
+        {
+            self.updateText()
+        }
+        else
+        {
+            self.layoutManager.delegate = self
+        }
         
         self.textContainerInset = .zero
         self.textContainer.lineFragmentPadding = 0
@@ -108,6 +120,25 @@ private extension CollapsingTextView
     {
         self.isCollapsed.toggle()
     }
+    
+    @available(iOS 16, *)
+    func updateText()
+    {
+        do
+        {
+            let style = NSMutableParagraphStyle()
+            style.lineSpacing = self.lineSpacing
+            
+            var attributedText = try AttributedString(self.attributedText, including: \.uiKit)
+            attributedText[AttributeScopes.UIKitAttributes.ParagraphStyleAttribute.self] = style
+            
+            self.attributedText = NSAttributedString(attributedText)
+        }
+        catch
+        {
+            print("[ALTLog] Failed to update CollapsingTextView line spacing:", error)
+        }
+    }
 }
 
 extension CollapsingTextView: NSLayoutManagerDelegate

AltStore/Components/PillButton.swift

@@ -8,6 +8,12 @@
 
 import UIKit
 
+extension PillButton
+{
+    static let minimumSize = CGSize(width: 77, height: 31)
+    static let contentInsets = NSDirectionalEdgeInsets(top: 7, leading: 13, bottom: 7, trailing: 13)
+}
+
 final class PillButton: UIButton
 {
     override var accessibilityValue: String? {
@@ -70,9 +76,7 @@ final class PillButton: UIButton
     }()
     
     override var intrinsicContentSize: CGSize {
-        var size = super.intrinsicContentSize
+        let size = self.sizeThatFits(CGSize(width: Double.infinity, height: .infinity))
-        size.width += 26
-        size.height += 3
         return size
     }
     
@@ -88,6 +92,8 @@ final class PillButton: UIButton
         self.layer.masksToBounds = true
         self.accessibilityTraits.formUnion([.updatesFrequently, .button])
         
+        self.contentEdgeInsets = UIEdgeInsets(top: Self.contentInsets.top, left: Self.contentInsets.leading, bottom: Self.contentInsets.bottom, right: Self.contentInsets.trailing)
+        
         self.activityIndicatorView.style = .medium
         self.activityIndicatorView.isUserInteractionEnabled = false
         
@@ -119,6 +125,15 @@ final class PillButton: UIButton
         
         self.update()
     }
+    
+    override func sizeThatFits(_ size: CGSize) -> CGSize
+    {
+        var size = super.sizeThatFits(size)
+        size.width = max(size.width, PillButton.minimumSize.width)
+        size.height = max(size.height, PillButton.minimumSize.height)
+        
+        return size
+    }
 }
 
 private extension PillButton

AltStore/Info.plist

@@ -14,7 +14,7 @@
 	<key>ALTPairingFile</key>
 	<string>&lt;insert pairing file here&gt;</string>
 	<key>ALTAnisetteURL</key>
-	<string>http://ani.sidestore.io:6969</string>
+	<string>https://ani.sidestore.io</string>
 	<key>CFBundleDevelopmentRegion</key>
 	<string>$(DEVELOPMENT_LANGUAGE)</string>
 	<key>CFBundleDocumentTypes</key>

AltStore/LaunchViewController.swift

@@ -81,7 +81,7 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
         } else {
             // Show an alert explaining the pairing file
             // Create new Alert
-            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/install#pairing-process", preferredStyle: .alert)
+            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/getting-started/#pairing-file", preferredStyle: .alert)
             
             // Create OK button with action handler
             let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
@@ -155,7 +155,12 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
             try! FileManager.default.removeItem(at: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)"))
             displayError("minimuxer failed to start, please restart SideStore. \((error as? LocalizedError)?.failureReason ?? "UNKNOWN ERROR!!!!!! REPORT TO GITHUB ISSUES!")")
         }
-        start_auto_mounter(documentsDirectory)
+        if #available(iOS 17, *) {
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
+        }
     }
 }
 

AltStore/Managing Apps/AppManager.swift

@@ -307,6 +307,16 @@ extension AppManager
             presentingViewController.present(alertController, animated: true, completion: nil)
         }
     }
+    
+    func clearAppCache(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let clearAppCacheOperation = ClearAppCacheOperation()
+        clearAppCacheOperation.resultHandler = { result in
+            completion(result)
+        }
+        
+        self.run([clearAppCacheOperation], context: nil)
+    }
 }
 
 extension AppManager
@@ -754,6 +764,12 @@ extension AppManager
         let progress = self.refreshProgress[app.bundleIdentifier]
         return progress
     }
+    
+    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
+    {
+        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
+        return isActivelyManaging
+    }
 }
 
 extension AppManager
@@ -808,12 +824,6 @@ private extension AppManager
         }
     }
     
-    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
-    {
-        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
-        return isActivelyManaging
-    }
-    
     @discardableResult
     private func perform(_ operations: [AppOperation], presentingViewController: UIViewController?, group: RefreshGroup) -> RefreshGroup
     {
@@ -1027,6 +1037,32 @@ private extension AppManager
         verifyOperation.addDependency(downloadOperation)
         
         
+        /* Refresh Anisette Data */
+        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
+        refreshAnisetteDataOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
+            }
+        }
+        refreshAnisetteDataOperation.addDependency(verifyOperation)
+
+
+        /* Fetch Provisioning Profiles */
+        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
+        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
+        fetchProvisioningProfilesOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
+            }
+        }
+        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
+        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
+
+
         /* Deactivate Apps (if necessary) */
         let deactivateAppsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
             do
@@ -1042,6 +1078,12 @@ private extension AppManager
                 {
                     throw error
                 }
+                
+                guard let profiles = context.provisioningProfiles else { throw OperationError.invalidParameters }
+                if !profiles.contains(where: { $1.isFreeProvisioningProfile == true }) {
+                    operation.finish()
+                    return
+                }
                                 
                 guard let app = context.app, let presentingViewController = context.authenticatedContext.presentingViewController else { throw OperationError.invalidParameters }
                 
@@ -1061,7 +1103,7 @@ private extension AppManager
                 operation.finish()
             }
         }
-        deactivateAppsOperation.addDependency(verifyOperation)
+        deactivateAppsOperation.addDependency(fetchProvisioningProfilesOperation)
         
         
         /* Patch App */
@@ -1136,32 +1178,6 @@ private extension AppManager
         patchAppOperation.addDependency(deactivateAppsOperation)
         
         
-        /* Refresh Anisette Data */
-        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
-        refreshAnisetteDataOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
-            }
-        }
-        refreshAnisetteDataOperation.addDependency(patchAppOperation)
-        
-        
-        /* Fetch Provisioning Profiles */
-        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
-        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
-        fetchProvisioningProfilesOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
-            }
-        }
-        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
-        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
-        
-        
         /* Resign */
         let resignAppOperation = ResignAppOperation(context: context)
         resignAppOperation.resultHandler = { (result) in
@@ -1171,7 +1187,7 @@ private extension AppManager
             case .success(let resignedApp): context.resignedApp = resignedApp
             }
         }
-        resignAppOperation.addDependency(fetchProvisioningProfilesOperation)
+        resignAppOperation.addDependency(patchAppOperation)
         progress.addChild(resignAppOperation.progress, withPendingUnitCount: 20)
         
         
@@ -1214,7 +1230,7 @@ private extension AppManager
         progress.addChild(installOperation.progress, withPendingUnitCount: 30)
         installOperation.addDependency(sendAppOperation)
         
-        let operations = [downloadOperation, verifyOperation, deactivateAppsOperation, patchAppOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, resignAppOperation, sendAppOperation, installOperation]
+        let operations = [downloadOperation, verifyOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, deactivateAppsOperation, patchAppOperation, resignAppOperation, sendAppOperation, installOperation]
         group.add(operations)
         self.run(operations, context: group.context)
         

AltStore/My Apps/MyAppsViewController.swift

@@ -10,10 +10,12 @@ import UIKit
 import MobileCoreServices
 import Intents
 import Combine
+import UniformTypeIdentifiers
 
 import AltStoreCore
 import AltSign
 import Roxas
+import minimuxer
 
 import Nuke
 
@@ -327,21 +329,25 @@ private extension MyAppsViewController
             let currentDate = Date()
             
             let numberOfDays = installedApp.expirationDate.numberOfCalendarDays(since: currentDate)
-            let numberOfDaysText: String
             
-            if numberOfDays == 1
+            let formatter = DateComponentsFormatter()
-            {
+            formatter.unitsStyle = .full
-                numberOfDaysText = NSLocalizedString("1 day", comment: "")
+            formatter.includesApproximationPhrase = false
-            }
+            formatter.includesTimeRemainingPhrase = false
-            else
+            
-            {
+            formatter.allowedUnits = [.day, .hour, .minute]
-                numberOfDaysText = String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
+            
-            }
+            formatter.maximumUnitCount = 1
+            
+            
+            
+            cell.bannerView.button.setTitle(formatter.string(from: currentDate, to: installedApp.expirationDate)?.uppercased(), for: .normal)
             
-            cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
             cell.bannerView.button.accessibilityLabel = String(format: NSLocalizedString("Refresh %@", comment: ""), installedApp.name)
-            
+
-            cell.bannerView.accessibilityLabel? += ". " + String(format: NSLocalizedString("Expires in %@", comment: ""), numberOfDaysText)
+            formatter.includesTimeRemainingPhrase = true
+
+            cell.bannerView.accessibilityLabel? += ". " + (formatter.string(from: currentDate, to: installedApp.expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " "
             
             // Make sure refresh button is correct size.
             cell.layoutIfNeeded()
@@ -639,6 +645,12 @@ private extension MyAppsViewController
     
     @IBAction func refreshAllApps(_ sender: UIBarButtonItem)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         self.isRefreshingAllApps = true
         self.collectionView.collectionViewLayout.invalidateLayout()
 
@@ -701,18 +713,15 @@ private extension MyAppsViewController
     
     @IBAction func sideloadApp(_ sender: UIBarButtonItem)
     {
-        let supportedTypes: [String]
+        if !minimuxer.ready() {
-        
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
-        if let types = UTTypeCreateAllIdentifiersForTag(kUTTagClassFilenameExtension, "ipa" as CFString, nil)?.takeRetainedValue()
+            toastView.show(in: self)
-        {
+            return
-            supportedTypes = (types as NSArray).map { $0 as! String }
-        }
-        else
-        {
-            supportedTypes = ["com.apple.itunes.ipa"] // Declared by the system.
         }
+
+        let supportedTypes = UTType.types(tag: "ipa", tagClass: .filenameExtension, conformingTo: nil)
         
-        let documentPickerViewController = UIDocumentPickerViewController(documentTypes: supportedTypes, in: .import)
+        let documentPickerViewController = UIDocumentPickerViewController(forOpeningContentTypes: supportedTypes, asCopy: true)
         documentPickerViewController.delegate = self
         self.present(documentPickerViewController, animated: true, completion: nil)
     }
@@ -1014,6 +1023,12 @@ private extension MyAppsViewController
     
     func refresh(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         let previousProgress = AppManager.shared.refreshProgress(for: installedApp)
         guard previousProgress == nil else {
             previousProgress?.cancel()
@@ -1035,6 +1050,12 @@ private extension MyAppsViewController
     
     func activate(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         func finish(_ result: Result<InstalledApp, Error>)
         {
             do
@@ -1111,6 +1132,11 @@ private extension MyAppsViewController
     func deactivate(_ installedApp: InstalledApp, completionHandler: ((Result<InstalledApp, Error>) -> Void)? = nil)
     {
         guard installedApp.isActive else { return }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         installedApp.isActive = false
         
         AppManager.shared.deactivate(installedApp, presentingViewController: self) { (result) in
@@ -1172,6 +1198,11 @@ private extension MyAppsViewController
     
     func backup(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         let title = NSLocalizedString("Start Backup?", comment: "")
         let message = NSLocalizedString("This will replace any previous backups. Please leave SideStore open until the backup is complete.", comment: "")
 
@@ -1211,6 +1242,11 @@ private extension MyAppsViewController
     
     func restore(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         let message = String(format: NSLocalizedString("This will replace all data you currently have in %@.", comment: ""), installedApp.name)
         let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to restore this backup?", comment: ""), message: message, preferredStyle: .actionSheet)
         alertController.addAction(.cancel)
@@ -1246,8 +1282,11 @@ private extension MyAppsViewController
     {
         guard let backupURL = FileManager.default.backupDirectoryURL(for: installedApp) else { return }
         
-        let documentPicker = UIDocumentPickerViewController(url: backupURL, in: .exportToService)
+        let documentPicker = UIDocumentPickerViewController(forExporting: [backupURL], asCopy: true)
-        documentPicker.delegate = self
+        
+        // Don't set delegate to avoid conflicting with import callbacks.
+        // documentPicker.delegate = self
+        
         self.present(documentPicker, animated: true, completion: nil)
     }
     
@@ -1311,6 +1350,16 @@ private extension MyAppsViewController
     @available(iOS 14, *)
     func enableJIT(for installedApp: InstalledApp)
     {
+        if #available(iOS 17, *) {
+            let toastView = ToastView(error: OperationError.tooNewError)
+            toastView.show(in: self)
+            return
+        }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         AppManager.shared.enableJIT(for: installedApp) { result in
             DispatchQueue.main.async {
                 switch result
@@ -1318,7 +1367,7 @@ private extension MyAppsViewController
                 case .success: break
                 case .failure(let error):
                     let toastView = ToastView(error: error)
-                    toastView.show(in: self)
+                    toastView.show(in: self.navigationController?.view ?? self.view, duration: 5)
                 }
             }
         }
@@ -1465,7 +1514,7 @@ extension MyAppsViewController
                 let registeredAppIDs = team.appIDs.count
                 
                 let maximumAppIDCount = 10
-                let remainingAppIDs = max(maximumAppIDCount - registeredAppIDs, 0)
+                let remainingAppIDs = maximumAppIDCount - registeredAppIDs
                 
                 if remainingAppIDs == 1
                 {
@@ -1476,7 +1525,7 @@ extension MyAppsViewController
                     footerView.textLabel.text = String(format: NSLocalizedString("%@ App IDs Remaining", comment: ""), NSNumber(value: remainingAppIDs))
                 }
                 
-                footerView.textLabel.isHidden = false
+                footerView.textLabel.isHidden = remainingAppIDs < 0
                 
             case .individual, .organization, .unknown: footerView.textLabel.isHidden = true
             @unknown default: break
@@ -2050,15 +2099,8 @@ extension MyAppsViewController: UIDocumentPickerDelegate
     {
         guard let fileURL = urls.first else { return }
         
-        switch controller.documentPickerMode
+        self.sideloadApp(at: fileURL) { (result) in
-        {
+            print("Sideloaded app at \(fileURL) with result:", result)
-        case .import, .open:
-            self.sideloadApp(at: fileURL) { (result) in
-                print("Sideloaded app at \(fileURL) with result:", result)
-            }
-        
-        case .exportToService, .moveToService: break
-        @unknown default: break
         }
     }
 }

AltStore/News/NewsViewController.swift

@@ -426,6 +426,10 @@ extension NewsViewController: UICollectionViewDelegateFlowLayout
             return previousSize
         }
         
+        // Take layout margins into account.
+        self.prototypeCell.layoutMargins.left = self.view.layoutMargins.left
+        self.prototypeCell.layoutMargins.right = self.view.layoutMargins.right
+        
         let widthConstraint = self.prototypeCell.contentView.widthAnchor.constraint(equalToConstant: collectionView.bounds.width)
         NSLayoutConstraint.activate([widthConstraint])
         defer { NSLayoutConstraint.deactivate([widthConstraint]) }

AltStore/Operations/AuthenticationOperation.swift

@@ -12,6 +12,7 @@ import Network
 
 import AltStoreCore
 import AltSign
+import minimuxer
 
 enum AuthenticationError: LocalizedError
 {
@@ -593,7 +594,7 @@ private extension AuthenticationOperation
     
     func registerCurrentDevice(for team: ALTTeam, session: ALTAppleAPISession, completionHandler: @escaping (Result<ALTDevice, Error>) -> Void)
     {
-        guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else {
+        guard let udid = fetch_udid()?.toString() else {
             return completionHandler(.failure(OperationError.unknownUDID))
         }
         

AltStore/Operations/BackgroundRefreshAppsOperation.swift

@@ -105,8 +105,13 @@ final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<Inst
         } catch {
             self.finish(.failure(error))
         }
-        start_auto_mounter(documentsDirectory)
+        if #available(iOS 17, *) {
-        
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
+        }
+
         self.managedObjectContext.perform {
             print("Apps to refresh:", self.installedApps.map(\.bundleIdentifier))
             

AltStore/Operations/BackupAppOperation.swift

@@ -29,6 +29,9 @@ class BackupAppOperation: ResultOperation<Void>
     private var appName: String?
     private var timeoutTimer: Timer?
     
+    private weak var applicationWillReturnObserver: NSObjectProtocol?
+    private weak var backupResponseObserver: NSObjectProtocol?
+    
     init(action: Action, context: InstallAppOperationContext)
     {
         self.action = action
@@ -43,10 +46,7 @@ class BackupAppOperation: ResultOperation<Void>
         
         do
         {
-            if let error = self.context.error
+            if let error = self.context.error { throw error }
-            {
-                throw error
-            }
             
             guard let installedApp = self.context.installedApp, let context = installedApp.managedObjectContext else { throw OperationError.invalidParameters }
             context.perform {
@@ -55,9 +55,8 @@ class BackupAppOperation: ResultOperation<Void>
                     let appName = installedApp.name
                     self.appName = appName
                     
-                    guard let altstoreApp = InstalledApp.fetchAltStore(in: context) else { throw OperationError.appNotFound }
+                    let altstoreOpenURL = URL(string: "sidestore://")!
-                    let altstoreOpenURL = altstoreApp.openAppURL
+
-                    
                     var returnURLComponents = URLComponents(url: altstoreOpenURL, resolvingAgainstBaseURL: false)
                     returnURLComponents?.host = "appBackupResponse"
                     guard let returnURL = returnURLComponents?.url else { throw OperationError.openAppFailed(name: appName) }
@@ -153,8 +152,11 @@ private extension BackupAppOperation
 {
     func registerObservers()
     {
-        var applicationWillReturnObserver: NSObjectProtocol!
+        self.applicationWillReturnObserver = NotificationCenter.default.addObserver(forName: UIApplication.willEnterForegroundNotification, object: nil, queue: .main) { [weak self] (notification) in
-        applicationWillReturnObserver = NotificationCenter.default.addObserver(forName: UIApplication.willEnterForegroundNotification, object: nil, queue: .main) { [weak self] (notification) in
+            defer {
+                self?.applicationWillReturnObserver.map { NotificationCenter.default.removeObserver($0) }
+            }
+
             guard let self = self, !self.isFinished else { return }
             
             self.timeoutTimer = Timer.scheduledTimer(withTimeInterval: 5, repeats: false) { [weak self] (timer) in
@@ -166,18 +168,17 @@ private extension BackupAppOperation
                     self.finish(.failure(OperationError.timedOut))
                 }
             }
-            
-            NotificationCenter.default.removeObserver(applicationWillReturnObserver!)
         }
         
-        var backupResponseObserver: NSObjectProtocol!
+        self.backupResponseObserver = NotificationCenter.default.addObserver(forName: AppDelegate.appBackupDidFinish, object: nil, queue: nil) { [weak self] (notification) in
-        backupResponseObserver = NotificationCenter.default.addObserver(forName: AppDelegate.appBackupDidFinish, object: nil, queue: nil) { [weak self] (notification) in
+            defer {
+                self?.backupResponseObserver.map { NotificationCenter.default.removeObserver($0) }
+            }
+            
             self?.timeoutTimer?.invalidate()
             
             let result = notification.userInfo?[AppDelegate.appBackupResultKey] as? Result<Void, Error> ?? .failure(OperationError.unknownResult)
             self?.finish(result)
-            
-            NotificationCenter.default.removeObserver(backupResponseObserver!)
         }
     }
 }

AltStore/Operations/ClearAppCacheOperation.swift

@@ -0,0 +1,208 @@
+//
+//  ClearAppCacheOperation.swift
+//  AltStore
+//
+//  Created by Riley Testut on 9/27/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import Foundation
+import AltStoreCore
+/*
+struct BatchError: ALTLocalizedError
+{
+
+    enum Code: Int, ALTErrorCode
+    {
+        typealias Error = BatchError
+        
+        case batchError
+    }
+
+    var code: Code = .batchError
+    var underlyingErrors: [Error]
+    
+    var errorTitle: String?
+    var errorFailure: String?
+    
+    init(errors: [Error])
+    {
+        self.underlyingErrors = errors
+    }
+    
+    var errorFailureReason: String {
+        guard !self.underlyingErrors.isEmpty else { return NSLocalizedString("An unknown error occured.", comment: "") }
+        
+        let errorMessages = self.underlyingErrors.map { $0.localizedDescription }
+        
+        let message = errorMessages.joined(separator: "\n\n")
+        return message
+    }
+}
+*/
+@objc(ClearAppCacheOperation)
+class ClearAppCacheOperation: ResultOperation<Void>
+{
+    private let coordinator = NSFileCoordinator()
+    private let coordinatorQueue = OperationQueue()
+    
+    override init()
+    {
+        self.coordinatorQueue.name = "AltStore - ClearAppCacheOperation Queue"
+    }
+    
+    override func main()
+    {
+        super.main()
+        
+        var allErrors = [Error]()
+        
+        self.clearTemporaryDirectory { result in
+            switch result
+            {
+            //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+            case .failure(let error): allErrors.append(error)
+            case .success: break
+            }
+            
+            self.removeUninstalledAppBackupDirectories { result in
+                switch result
+                {
+                //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+                case .failure(let error): allErrors.append(error)
+                case .success: break
+                }
+                
+                if allErrors.isEmpty
+                {
+                    self.finish(.success(()))
+                }
+                else
+                {
+                    self.finish(.failure(OperationError.cacheClearError(errors: allErrors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+            }
+        }
+    }
+}
+
+private extension ClearAppCacheOperation
+{
+    func clearTemporaryDirectory(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let intent = NSFileAccessIntent.writingIntent(with: FileManager.default.temporaryDirectory, options: [.forDeleting])
+        self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+            do
+            {
+                if let error
+                {
+                    throw error
+                }
+                
+                let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                           includingPropertiesForKeys: [],
+                                                                           options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                var errors = [Error]()
+                
+                for fileURL in fileURLs
+                {
+                    do
+                    {
+                        print("[ALTLog] Removing item from temporary directory:", fileURL.lastPathComponent)
+                        try FileManager.default.removeItem(at: fileURL)
+                    }
+                    catch
+                    {
+                        print("[ALTLog] Failed to remove \(fileURL.lastPathComponent) from temporary directory.", error)
+                        errors.append(error)
+                    }
+                }
+                
+                if !errors.isEmpty
+                {
+                    completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+                else
+                {
+                    completion(.success(()))
+                }
+            }
+            catch
+            {
+                completion(.failure(error))
+            }
+        }
+    }
+    
+    func removeUninstalledAppBackupDirectories(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        guard let backupsDirectory = FileManager.default.appBackupsDirectory else { return completion(.failure(OperationError.missingAppGroup)) }
+        
+        DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
+            let installedAppBundleIDs = Set(InstalledApp.all(in: context).map { $0.bundleIdentifier })
+            
+            let intent = NSFileAccessIntent.writingIntent(with: backupsDirectory, options: [.forDeleting])
+            self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+                do
+                {
+                    if let error
+                    {
+                        throw error
+                    }
+                    
+                    var isDirectory: ObjCBool = false
+                    guard FileManager.default.fileExists(atPath: intent.url.path, isDirectory: &isDirectory), isDirectory.boolValue else {
+                        completion(.success(()))
+                        return
+                    }
+                    
+                    let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                               includingPropertiesForKeys: [.isDirectoryKey, .nameKey],
+                                                                               options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                    var errors = [Error]()
+                    
+                    
+                    for backupDirectory in fileURLs
+                    {
+                        do
+                        {
+                            let resourceValues = try backupDirectory.resourceValues(forKeys: [.isDirectoryKey, .nameKey])
+                            guard let isDirectory = resourceValues.isDirectory, let bundleID = resourceValues.name else { continue }
+
+                            if isDirectory && !installedAppBundleIDs.contains(bundleID) && !AppManager.shared.isActivelyManagingApp(withBundleID: bundleID)
+                            {
+                                print("[ALTLog] Removing backup directory for uninstalled app:", bundleID)
+                                try FileManager.default.removeItem(at: backupDirectory)
+                            }
+                        }
+                        catch
+                        {
+                            print("[ALTLog] Failed to remove app backup directory:", error)
+                            errors.append(error)
+                        }
+                    }
+                    
+                    if !errors.isEmpty
+                    {
+                        completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                            return error.localizedDescription
+                        }))))
+                    }
+                    else
+                    {
+                        completion(.success(()))
+                    }
+                }
+                catch
+                {
+                    print("[ALTLog] Failed to remove app backup directory:", error)
+                    completion(.failure(error))
+                }
+            }
+        }
+    }
+}

AltStore/Operations/DeactivateAppOperation.swift

@@ -31,11 +31,7 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
     {
         super.main()
         
-        if let error = self.context.error
+        if let error = self.context.error { return self.finish(.failure(error)) }
-        {
-            self.finish(.failure(error))
-            return
-        }
         
         DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
             let installedApp = context.object(with: self.app.objectID) as! InstalledApp
@@ -45,14 +41,14 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
             for profile in allIdentifiers {
                 do {
                     try remove_provisioning_profile(profile)
+                    self.progress.completedUnitCount += 1
+                    installedApp.isActive = false
+                    self.finish(.success(installedApp))
+                    break
                 } catch {
-                    return self.finish(.failure(error))
+                    self.finish(.failure(error))
                 }
             }
-            
-            self.progress.completedUnitCount += 1
-            installedApp.isActive = false
-            self.finish(.success(installedApp))
         }
     }
 }

AltStore/Operations/EnableJITOperation.swift

@@ -45,13 +45,19 @@ final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
         guard let installedApp = self.context.installedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
         
         installedApp.managedObjectContext?.perform {
-            do {
+            var retries = 3
-                try debug_app(installedApp.resignedBundleIdentifier)
+            while (retries > 0){
-            } catch {
+                do {
-                return self.finish(.failure(error))
+                    try debug_app(installedApp.resignedBundleIdentifier)
+                    self.finish(.success(()))
+                    retries = 0
+                } catch {
+                    retries -= 1
+                    if (retries <= 0){
+                        self.finish(.failure(error))
+                    }
+                }
             }
-            
-            self.finish(.success(()))
         }
     }
 }

AltStore/Operations/FetchAnisetteDataOperation.swift

@@ -218,7 +218,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
         self.socket.connect()
     }
     
-    func didReceive(event: WebSocketEvent, client: WebSocket) {
+    func didReceive(event: WebSocketEvent, client: WebSocketClient) {
         switch event {
         case .text(let string):
             do {
@@ -429,7 +429,7 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSoc
     }
 }
 
-extension WebSocket {
+extension WebSocketClient {
     func json(_ dictionary: [String: String]) {
         let data = try! JSONSerialization.data(withJSONObject: dictionary, options: [])
         self.write(string: String(data: data, encoding: .utf8)!)

AltStore/Operations/FetchProvisioningProfilesOperation.swift

@@ -262,10 +262,6 @@ extension FetchProvisioningProfilesOperation
                             {
                                 throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
                             }
-                            else
-                            {
-                                throw ALTAppleAPIError(.maximumAppIDLimitReached)
-                            }
                         }
                     }
                     //App ID name must be ascii. If the name is not ascii, using bundleID instead

AltStore/Operations/InstallAppOperation.swift

@@ -41,7 +41,8 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
         
         guard
             let certificate = self.context.certificate,
-            let resignedApp = self.context.resignedApp
+            let resignedApp = self.context.resignedApp,
+            let provisioningProfiles = self.context.provisioningProfiles
         else { return self.finish(.failure(OperationError.invalidParameters)) }
         
         let backgroundContext = DatabaseManager.shared.persistentContainer.newBackgroundContext()
@@ -116,8 +117,7 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
             // Temporary directory and resigned .ipa no longer needed, so delete them now to ensure AltStore doesn't quit before we get the chance to.
             self.cleanUp()
             
-            var activeProfiles: Set<String>?
+            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit, provisioningProfiles.contains(where: { $1.isFreeProvisioningProfile == true })
-            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit
             {
                 // When installing these new profiles, AltServer will remove all non-active profiles to ensure we remain under limit.
                 
@@ -142,15 +142,14 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                         installedApp.isActive = false
                     }
                 }
-
+            }
-                activeProfiles = Set(activeApps.flatMap { (installedApp) -> [String] in
+            else
-                    let appExtensionProfiles = installedApp.appExtensions.map { $0.resignedBundleIdentifier }
+            {
-                    return [installedApp.resignedBundleIdentifier] + appExtensionProfiles
+                installedApp.isActive = true
-                })
             }
             
             var installing = true
-            if installedApp.storeApp?.bundleIdentifier == Bundle.Info.appbundleIdentifier {
+            if installedApp.storeApp?.bundleIdentifier.range(of: Bundle.Info.appbundleIdentifier) != nil {
                 // Reinstalling ourself will hang until we leave the app, so we need to exit it without force closing
                 DispatchQueue.main.asyncAfter(deadline: .now() + 3) {
                     if UIApplication.shared.applicationState != .active {
@@ -162,30 +161,26 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                         return
                     }
                     print("We are still installing after 3 seconds")
-                    
                     UNUserNotificationCenter.current().getNotificationSettings { settings in
                         switch (settings.authorizationStatus) {
                         case .authorized, .ephemeral, .provisional:
                             print("Notifications are enabled")
-                            
+
                             let content = UNMutableNotificationContent()
                             content.title = "Refreshing..."
-                            content.body = "To finish refreshing, SideStore must be moved to the background, which it does by opening Safari. Please reopen SideStore after it is done refreshing!"
+                            content.body = "SideStore will automatically move to the homescreen to finish refreshing!"
                             let notification = UNNotificationRequest(identifier: Bundle.Info.appbundleIdentifier + ".FinishRefreshNotification", content: content, trigger: UNTimeIntervalNotificationTrigger(timeInterval: 2, repeats: false))
                             UNUserNotificationCenter.current().add(notification)
-                            
-                            DispatchQueue.main.async { UIApplication.shared.open(URL(string: "x-web-search://")!) }
-                            
                             break
                         default:
                             print("Notifications are not enabled")
-                            
+
-                            let alert = UIAlertController(title: "Finish Refresh", message: "To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen or open Safari by pressing Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
+                            let alert = UIAlertController(title: "Finish Refresh", message: "Please reopen SideStore after the process is finished.To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen manually or by hitting Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
                             alert.addAction(UIAlertAction(title: NSLocalizedString("Continue", comment: ""), style: .default, handler: { _ in
-                                print("Opening Safari")
+                                print("Going home")
-                                DispatchQueue.main.async { UIApplication.shared.open(URL(string: "x-web-search://")!) }
+                                UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
                             }))
-                            
+
                             DispatchQueue.main.async {
                                 let keyWindow = UIApplication.shared.windows.filter { $0.isKeyWindow }.first
                                 if var topController = keyWindow?.rootViewController {
@@ -194,27 +189,24 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                                     }
                                     topController.present(alert, animated: true)
                                 } else {
-                                    print("No key window? Let's just open Safari")
+                                    print("No key window? Let's just go home")
-                                    UIApplication.shared.open(URL(string: "x-web-search://")!)
                                 }
                             }
-                            
-                            break
                         }
                     }
+                    UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
                 }
             }
             
             do {
                 try install_ipa(installedApp.bundleIdentifier)
                 installing = false
-            } catch {
+                installedApp.refreshedDate = Date()
+                self.finish(.success(installedApp))
+            } catch let error {
                 installing = false
-                return self.finish(.failure(error))
+                self.finish(.failure(error))
             }
-            
-            installedApp.refreshedDate = Date()
-            self.finish(.success(installedApp))
         }
     }
     

AltStore/Operations/OperationError.swift

@@ -34,10 +34,14 @@ enum OperationError: LocalizedError
     case openAppFailed(name: String)
     case missingAppGroup
     
+    case noWiFi
+    case tooNewError
     case anisetteV1Error(message: String)
     case provisioningError(result: String, message: String?)
     case anisetteV3Error(message: String)
     
+    case cacheClearError(errors: [String])
+    
     var failureReason: String? {
         switch self {
         case .unknown: return NSLocalizedString("An unknown error occured.", comment: "")
@@ -53,9 +57,12 @@ enum OperationError: LocalizedError
         case .openAppFailed(let name): return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), name)
         case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be found.", comment: "")
         case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs.", comment: "")
+        case .noWiFi: return NSLocalizedString("You do not appear to be connected to WiFi!\nSideStore will never be able to install or refresh applications without WiFi.", comment: "")
+        case .tooNewError: return NSLocalizedString("iOS 17 has changed how JIT is enabled therefore SideStore cannot enable it at this time, sorry for any inconvenience.\nWe will let everyone know once we have a solution!", comment: "")
         case .anisetteV1Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: ""), message)
         case .provisioningError(let result, let message): return String(format: NSLocalizedString("An error occurred when provisioning: %@%@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), result, message != nil ? (" (" + message! + ")") : "")
         case .anisetteV3Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), message)
+        case .cacheClearError(let errors): return String(format: NSLocalizedString("An error occurred while clearing cache: %@", comment: ""), errors.joined(separator: "\n"))
         }
     }
     
@@ -138,8 +145,8 @@ extension MinimuxerError: LocalizedError {
             return self.createService(name: "AFC")
         case .RwAfc:
             return NSLocalizedString("AFC was unable to manage files on the device", comment: "")
-        case .InstallApp:
+        case .InstallApp(let message):
-            return NSLocalizedString("Unable to install the app from the staging directory", comment: "")
+            return NSLocalizedString("Unable to install the app: \(message.toString())", comment: "")
         case .UninstallApp:
             return NSLocalizedString("Unable to uninstall the app", comment: "")
 

AltStore/Operations/RefreshAppOperation.swift

@@ -35,31 +35,28 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
         
         do
         {
-            if let error = self.context.error
+            if let error = self.context.error { return self.finish(.failure(error)) }
-            {
-                throw error
-            }
             
-            guard let profiles = self.context.provisioningProfiles else { throw OperationError.invalidParameters }
+            guard let profiles = self.context.provisioningProfiles else { return self.finish(.failure(OperationError.invalidParameters)) }
+            guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
             
-            guard let app = self.context.app else { throw OperationError.appNotFound }
+            for p in profiles {
-            
+                do {
-            DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
+                    let bytes = p.value.data.toRustByteSlice()
-                print("Sending refresh app request...")
+                    try install_provisioning_profile(bytes.forRust())
+                } catch {
+                    self.finish(.failure(MinimuxerError.ProfileInstall))
+                }
 
-                for p in profiles {
+                DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
-                    do {
+                print("Sending refresh app request...")
-                        let bytes = p.value.data.toRustByteSlice()
-                        try install_provisioning_profile(bytes.forRust())
-                    } catch {
-                        return self.finish(.failure(error))
-                    }
                     
                     self.progress.completedUnitCount += 1
                     
                     let predicate = NSPredicate(format: "%K == %@", #keyPath(InstalledApp.bundleIdentifier), app.bundleIdentifier)
                     self.managedObjectContext.perform {
                         guard let installedApp = InstalledApp.first(satisfying: predicate, in: self.managedObjectContext) else {
+                            self.finish(.failure(OperationError.appNotFound))
                             return
                         }
                         installedApp.update(provisioningProfile: p.value)
@@ -72,9 +69,5 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
                 }
             }
         }
-        catch
-        {
-            self.finish(.failure(error))
-        }
     }
 }

AltStore/Operations/ResignAppOperation.swift

@@ -11,6 +11,7 @@ import Roxas
 
 import AltStoreCore
 import AltSign
+import minimuxer
 
 @objc(ResignAppOperation)
 final class ResignAppOperation: ResultOperation<ALTApplication>
@@ -181,7 +182,7 @@ private extension ResignAppOperation
 
                 if app.isAltStoreApp
                 {
-                    guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else { throw OperationError.unknownUDID }
+                    guard let udid = fetch_udid()?.toString() as? String else { throw OperationError.unknownUDID }
                     guard let pairingFileString = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.devicePairingString) as? String else { throw OperationError.unknownUDID }                    
                     additionalValues[Bundle.Info.devicePairingString] = pairingFileString
                     additionalValues[Bundle.Info.deviceID] = udid
@@ -202,7 +203,7 @@ private extension ResignAppOperation
                         // The embedded certificate + certificate identifier are already in app bundle, no need to update them.
                     }
                 }
-                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String
+                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = fetch_udid()?.toString() as? String
                 {
                     // There is an ALTDeviceID entry, so assume the app is using AltKit and replace it with the device's UDID.
                     additionalValues[Bundle.Info.deviceID] = udid
@@ -227,6 +228,7 @@ private extension ResignAppOperation
                 
                 // Prepare app
                 try prepare(appBundle, additionalInfoDictionaryValues: additionalValues)
+                try self.removeMissingAppExtensionReferences(from: appBundle)
                 
                 if let directory = appBundle.builtInPlugInsURL, let enumerator = FileManager.default.enumerator(at: directory, includingPropertiesForKeys: nil, options: [.skipsSubdirectoryDescendants])
                 {
@@ -267,4 +269,28 @@ private extension ResignAppOperation
         
         return progress
     }
+    
+    func removeMissingAppExtensionReferences(from bundle: Bundle) throws
+    {
+        // If app extensions have been removed from an app (either by AltStore or the developer),
+        // we must remove all references to them from SC_Info/Manifest.plist (if it exists).
+        
+        let scInfoURL = bundle.bundleURL.appendingPathComponent("SC_Info")
+        let manifestPlistURL = scInfoURL.appendingPathComponent("Manifest.plist")
+        
+        guard let manifestPlist = NSMutableDictionary(contentsOf: manifestPlistURL), let sinfReplicationPaths = manifestPlist["SinfReplicationPaths"] as? [String] else { return }
+        
+        // Remove references to missing files.
+        let filteredReplicationPaths = sinfReplicationPaths.filter { path in
+            guard let fileURL = URL(string: path, relativeTo: bundle.bundleURL) else { return false }
+            
+            let fileExists = FileManager.default.fileExists(atPath: fileURL.path)
+            return fileExists
+        }
+        
+        manifestPlist["SinfReplicationPaths"] = filteredReplicationPaths
+        
+        // Save updated Manifest.plist to disk.
+        try manifestPlist.write(to: manifestPlistURL)
+    }
 }

AltStore/Operations/SendAppOperation.swift

@@ -33,8 +33,7 @@ final class SendAppOperation: ResultOperation<()>
         
         if let error = self.context.error
         {
-            self.finish(.failure(error))
+            return self.finish(.failure(error))
-            return
         }
         
         guard let resignedApp = self.context.resignedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
@@ -49,15 +48,16 @@ final class SendAppOperation: ResultOperation<()>
             do {
                 let bytes = Data(data).toRustByteSlice()
                 try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
+                self.progress.completedUnitCount += 1
+                self.finish(.success(()))
             } catch {
-                return self.finish(.failure(error))
+                self.finish(.failure(MinimuxerError.RwAfc))
+                self.progress.completedUnitCount += 1
+                self.finish(.success(()))
             }
-            
-            self.progress.completedUnitCount += 1
-            self.finish(.success(()))
         } else {
             print("IPA doesn't exist????")
-            self.finish(.failure(ALTServerError(.underlyingError)))
+            self.finish(.failure(OperationError.appNotFound))
         }
     }
 }

AltStore/Resources/Assets.xcassets/AppIcon.appiconset/Contents.json

@@ -1 +1,158 @@
-{"images":[{"size":"60x60","expected-size":"180","filename":"180.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"40x40","expected-size":"80","filename":"80.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"40x40","expected-size":"120","filename":"120.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"60x60","expected-size":"120","filename":"120.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"57x57","expected-size":"57","filename":"57.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"1x"},{"size":"29x29","expected-size":"58","filename":"58.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"29x29","expected-size":"29","filename":"29.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"1x"},{"size":"29x29","expected-size":"87","filename":"87.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"57x57","expected-size":"114","filename":"114.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"20x20","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"20x20","expected-size":"60","filename":"60.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"1024x1024","filename":"1024.png","expected-size":"1024","idiom":"ios-marketing","folder":"Assets.xcassets/AppIcon.appiconset/","scale":"1x"},{"size":"40x40","expected-size":"80","filename":"80.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"72x72","expected-size":"72","filename":"72.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"76x76","expected-size":"152","filename":"152.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"50x50","expected-size":"100","filename":"100.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"29x29","expected-size":"58","filename":"58.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"76x76","expected-size":"76","filename":"76.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"29x29","expected-size":"29","filename":"29.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"50x50","expected-size":"50","filename":"50.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"72x72","expected-size":"144","filename":"144.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"40x40","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"83.5x83.5","expected-size":"167","filename":"167.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"20x20","expected-size":"20","filename":"20.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"20x20","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"}]}
+{
+  "images" : [
+    {
+      "filename" : "40.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "60.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "29.png",
+      "idiom" : "iphone",
+      "scale" : "1x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "58.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "87.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "80.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "120.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "57.png",
+      "idiom" : "iphone",
+      "scale" : "1x",
+      "size" : "57x57"
+    },
+    {
+      "filename" : "114.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "57x57"
+    },
+    {
+      "filename" : "120.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "60x60"
+    },
+    {
+      "filename" : "180.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "60x60"
+    },
+    {
+      "filename" : "20.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "40.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "29.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "58.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "40.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "80.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "50.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "50x50"
+    },
+    {
+      "filename" : "100.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "50x50"
+    },
+    {
+      "filename" : "72.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "72x72"
+    },
+    {
+      "filename" : "144.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "72x72"
+    },
+    {
+      "filename" : "76.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "76x76"
+    },
+    {
+      "filename" : "152.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "76x76"
+    },
+    {
+      "filename" : "167.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "83.5x83.5"
+    },
+    {
+      "filename" : "1024.png",
+      "idiom" : "ios-marketing",
+      "scale" : "1x",
+      "size" : "1024x1024"
+    }
+  ],
+  "info" : {
+    "author" : "xcode",
+    "version" : 1
+  }
+}

AltStore/Resources/Assets.xcassets/Riley.imageset/Contents.json

@@ -1,12 +0,0 @@
-{
-  "images" : [
-    {
-      "filename" : "riley.jpg",
-      "idiom" : "universal"
-    }
-  ],
-  "info" : {
-    "author" : "xcode",
-    "version" : 1
-  }
-}

AltStore/Resources/Assets.xcassets/Shane.imageset/Contents.json

@@ -1,12 +0,0 @@
-{
-  "images" : [
-    {
-      "filename" : "shane.jpeg",
-      "idiom" : "universal"
-    }
-  ],
-  "info" : {
-    "author" : "xcode",
-    "version" : 1
-  }
-}

AltStore/Resources/Assets.xcassets/SideStore.imageset/Contents.json

@@ -0,0 +1,21 @@
+{
+  "images" : [
+    {
+      "filename" : "1024.png",
+      "idiom" : "universal",
+      "scale" : "1x"
+    },
+    {
+      "idiom" : "universal",
+      "scale" : "2x"
+    },
+    {
+      "idiom" : "universal",
+      "scale" : "3x"
+    }
+  ],
+  "info" : {
+    "author" : "xcode",
+    "version" : 1
+  }
+}

AltStore/Settings.bundle/Root.plist

@@ -30,9 +30,9 @@
 			</array>
 			<key>Values</key>
 			<array>
-				<string>http://ani.sidestore.io:6969</string>
+				<string>https://ani.sidestore.io</string>
-				<string>http://us1.sternserv.tech</string>
+				<string>http://5.249.163.88:6969/</string>
-				<string>http://de1.sternserv.tech</string>
+				<string>http://45.132.246.138:6969/</string>
 				<string>https://sign.rheaa.xyz</string>
 				<string>https://sideloadly.io/anisette/irGb3Quww8zrhgqnzmrx</string>
 				<string>http://45.33.29.114</string>

AltStore/Settings/AboutPatreonHeaderView.xib

@@ -1,27 +1,27 @@
 <?xml version="1.0" encoding="UTF-8"?>
-<document type="com.apple.InterfaceBuilder3.CocoaTouch.XIB" version="3.0" toolsVersion="21225" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
+<document type="com.apple.InterfaceBuilder3.CocoaTouch.XIB" version="3.0" toolsVersion="21507" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
     <device id="retina6_1" orientation="portrait" appearance="light"/>
     <dependencies>
         <deployment identifier="iOS"/>
-        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21207"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21505"/>
         <capability name="Named colors" minToolsVersion="9.0"/>
         <capability name="documents saved in the Xcode 8 format" minToolsVersion="8.0"/>
     </dependencies>
     <objects>
         <placeholder placeholderIdentifier="IBFilesOwner" id="-1" userLabel="File's Owner"/>
         <placeholder placeholderIdentifier="IBFirstResponder" id="-2" customClass="UIResponder"/>
-        <collectionReusableView opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" insetsLayoutMarginsFromSafeArea="NO" reuseIdentifier="AboutHeader" id="xq2-Pl-zaG" customClass="AboutPatreonHeaderView" customModule="AltStore" customModuleProvider="target">
+        <collectionReusableView opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" insetsLayoutMarginsFromSafeArea="NO" reuseIdentifier="AboutHeader" id="xq2-Pl-zaG" customClass="AboutPatreonHeaderView" customModule="SideStore" customModuleProvider="target">
-            <rect key="frame" x="0.0" y="0.0" width="375" height="445"/>
+            <rect key="frame" x="0.0" y="0.0" width="390" height="682"/>
             <autoresizingMask key="autoresizingMask"/>
             <subviews>
                 <stackView opaque="NO" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" axis="vertical" spacing="25" translatesAutoresizingMaskIntoConstraints="NO" id="XiA-Jf-XMp">
-                    <rect key="frame" x="16" y="2" width="343" height="393"/>
+                    <rect key="frame" x="16" y="2" width="358" height="630"/>
                     <subviews>
                         <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="5Ol-zN-wYv">
-                            <rect key="frame" x="0.0" y="0.0" width="343" height="317"/>
+                            <rect key="frame" x="0.0" y="0.0" width="358" height="426"/>
                             <subviews>
                                 <stackView opaque="NO" contentMode="scaleToFill" alignment="center" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="f7H-EV-7Sx">
-                                    <rect key="frame" x="0.0" y="0.0" width="343" height="55"/>
+                                    <rect key="frame" x="0.0" y="0.0" width="358" height="55"/>
                                     <subviews>
                                         <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="SideStore" translatesAutoresizingMaskIntoConstraints="NO" id="pn6-Ic-MJm">
                                             <rect key="frame" x="0.0" y="0.0" width="55" height="55"/>
@@ -31,7 +31,7 @@
                                             </constraints>
                                         </imageView>
                                         <stackView opaque="NO" contentMode="scaleToFill" distribution="equalSpacing" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="si2-MA-3RH">
-                                            <rect key="frame" x="65" y="0.0" width="278" height="55"/>
+                                            <rect key="frame" x="65" y="0.0" width="293" height="55"/>
                                             <subviews>
                                                 <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="2" translatesAutoresizingMaskIntoConstraints="NO" id="hkS-oz-wiT">
                                                     <rect key="frame" x="0.0" y="0.0" width="83" height="55"/>
@@ -51,7 +51,7 @@
                                                     </subviews>
                                                 </stackView>
                                                 <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="2" translatesAutoresizingMaskIntoConstraints="NO" id="TFB-qo-cbh">
-                                                    <rect key="frame" x="195" y="0.0" width="83" height="55"/>
+                                                    <rect key="frame" x="210" y="0.0" width="83" height="55"/>
                                                     <subviews>
                                                         <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="Zpb-k3-y7l">
                                                             <rect key="frame" x="0.0" y="0.0" width="83" height="50"/>
@@ -75,11 +75,13 @@
                                     </constraints>
                                 </stackView>
                                 <textView clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="scaleToFill" scrollEnabled="NO" editable="NO" textAlignment="natural" selectable="NO" translatesAutoresizingMaskIntoConstraints="NO" id="FeG-e5-LJl">
-                                    <rect key="frame" x="0.0" y="65" width="343" height="252"/>
+                                    <rect key="frame" x="0.0" y="65" width="358" height="361"/>
                                     <color key="backgroundColor" white="1" alpha="0.13" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
-                                    <string key="text">Hello, thank you for using SideStore!
+                                    <string key="text">Thank you for using SideStore!
         
-If you would subscribe to the patreon that would support us and make sure we can continue developing SideStore for you.
+Subscribing to the patreon supports us and makes sure we can continue developing SideStore for you.
+    
+Following us on social media allows us to give quick updates and spread the word about sideloading!
         
 -SideTeam</string>
                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -89,10 +91,10 @@ If you would subscribe to the patreon that would support us and make sure we can
                             </subviews>
                         </stackView>
                         <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="13" translatesAutoresizingMaskIntoConstraints="NO" id="QS9-vO-bj8">
-                            <rect key="frame" x="0.0" y="342" width="343" height="51"/>
+                            <rect key="frame" x="0.0" y="451" width="358" height="179"/>
                             <subviews>
                                 <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="yEi-L6-kQ8">
-                                    <rect key="frame" x="0.0" y="0.0" width="343" height="51"/>
+                                    <rect key="frame" x="0.0" y="0.0" width="358" height="51"/>
                                     <color key="backgroundColor" name="SettingsHighlighted"/>
                                     <constraints>
                                         <constraint firstAttribute="height" constant="51" id="l4o-vb-cMy"/>
@@ -102,6 +104,28 @@ If you would subscribe to the patreon that would support us and make sure we can
                                         <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                     </state>
                                 </button>
+                                <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="hov-Ce-LaM" userLabel="Twitter Button">
+                                    <rect key="frame" x="0.0" y="64" width="358" height="51"/>
+                                    <color key="backgroundColor" name="SettingsHighlighted"/>
+                                    <constraints>
+                                        <constraint firstAttribute="height" constant="51" id="m0M-GX-KKG"/>
+                                    </constraints>
+                                    <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="19"/>
+                                    <state key="normal" title="Follow us on Twitter!">
+                                        <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                    </state>
+                                </button>
+                                <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="VdY-7Q-amF" userLabel="Twitter Button">
+                                    <rect key="frame" x="0.0" y="128" width="358" height="51"/>
+                                    <color key="backgroundColor" name="SettingsHighlighted"/>
+                                    <constraints>
+                                        <constraint firstAttribute="height" constant="51" id="kDo-b8-6tZ"/>
+                                    </constraints>
+                                    <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="19"/>
+                                    <state key="normal" title="Follow us on Instagram!">
+                                        <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                    </state>
+                                </button>
                             </subviews>
                         </stackView>
                     </subviews>
@@ -114,19 +138,21 @@ If you would subscribe to the patreon that would support us and make sure we can
                 <constraint firstItem="XiA-Jf-XMp" firstAttribute="top" secondItem="xq2-Pl-zaG" secondAttribute="top" constant="2" id="j8p-JX-Dcz"/>
             </constraints>
             <connections>
+                <outlet property="instagramButton" destination="VdY-7Q-amF" id="5kj-9x-k4F"/>
                 <outlet property="rileyImageView" destination="pn6-Ic-MJm" id="60i-Q0-ojz"/>
                 <outlet property="rileyLabel" destination="DTd-Yu-HXr" id="O0y-JB-gWp"/>
                 <outlet property="shaneLabel" destination="Zpb-k3-y7l" id="aQN-6B-s5T"/>
                 <outlet property="supportButton" destination="yEi-L6-kQ8" id="Dzo-vd-SnD"/>
                 <outlet property="textView" destination="FeG-e5-LJl" id="K0M-lF-I6u"/>
+                <outlet property="twitterButton" destination="hov-Ce-LaM" id="gib-Lt-qtY"/>
             </connections>
-            <point key="canvasLocation" x="138" y="138"/>
+            <point key="canvasLocation" x="147.82608695652175" y="58.258928571428569"/>
         </collectionReusableView>
     </objects>
     <resources>
-        <image name="SideStore" width="180" height="180"/>
+        <image name="SideStore" width="1024" height="1024"/>
         <namedColor name="SettingsHighlighted">
-            <color red="0.23529411764705882" green="0.0" blue="0.40392156862745099" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.38823529411764707" green="0.011764705882352941" blue="0.58823529411764708" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
     </resources>
 </document>

AltStore/Settings/PatreonComponents.swift

@@ -56,6 +56,8 @@ final class PatronsFooterView: UICollectionReusableView
 final class AboutPatreonHeaderView: UICollectionReusableView
 {
     @IBOutlet var supportButton: UIButton!
+    @IBOutlet var twitterButton: UIButton!
+    @IBOutlet var instagramButton: UIButton!
     @IBOutlet var accountButton: UIButton!
     @IBOutlet var textView: UITextView!
     
@@ -79,12 +81,12 @@ final class AboutPatreonHeaderView: UICollectionReusableView
             imageView.layer.cornerRadius = imageView.bounds.midY
         }
         
-        for button in [self.supportButton, self.accountButton].compactMap({ $0 })
+        for button in [self.supportButton, self.accountButton, self.twitterButton, self.instagramButton].compactMap({ $0 })
         {
             button.clipsToBounds = true
             button.layer.cornerRadius = 16
         }
-    }
+}
     
     override func layoutMarginsDidChange()
     {

AltStore/Settings/PatreonViewController.swift

@@ -111,7 +111,9 @@ private extension PatreonViewController
         headerView.layoutMargins = self.view.layoutMargins
         
         headerView.supportButton.addTarget(self, action: #selector(PatreonViewController.openPatreonURL(_:)), for: .primaryActionTriggered)
-        
+        headerView.twitterButton.addTarget(self, action: #selector(PatreonViewController.openTwitterURL(_:)), for: .primaryActionTriggered)
+        headerView.instagramButton.addTarget(self, action: #selector(PatreonViewController.openInstagramURL(_:)), for: .primaryActionTriggered)
+
         let defaultSupportButtonTitle = NSLocalizedString("Become a patron", comment: "")
         let isPatronSupportButtonTitle = NSLocalizedString("View Patreon", comment: "")
         
@@ -180,6 +182,24 @@ private extension PatreonViewController
         self.present(safariViewController, animated: true, completion: nil)
     }
     
+    @objc func openTwitterURL(_ sender: UIButton)
+    {
+        let twitterURL = URL(string: "https://twitter.com/SideStore_io")!
+        
+        let safariViewController = SFSafariViewController(url: twitterURL)
+        safariViewController.preferredControlTintColor = self.view.tintColor
+        self.present(safariViewController, animated: true, completion: nil)
+    }
+    
+    @objc func openInstagramURL(_ sender: UIButton)
+    {
+        let twitterURL = URL(string: "https://instagram.com/sidestore.io")!
+        
+        let safariViewController = SFSafariViewController(url: twitterURL)
+        safariViewController.preferredControlTintColor = self.view.tintColor
+        self.present(safariViewController, animated: true, completion: nil)
+    }
+    
     @IBAction func authenticate(_ sender: UIBarButtonItem)
     {
         PatreonAPI.shared.authenticate { (result) in

AltStore/Settings/Settings.storyboard

@@ -21,7 +21,7 @@
                         <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
-                            <rect key="frame" x="0.0" y="1194" width="375" height="25"/>
+                            <rect key="frame" x="0.0" y="1245" width="375" height="25"/>
                             <autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
                             <fontDescription key="fontDescription" type="system" pointSize="17"/>
                             <color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -167,8 +167,8 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Join the beta" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="3Il-5a-5Zp">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Support the team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="3Il-5a-5Zp">
-                                                    <rect key="frame" x="30" y="15.5" width="106" height="20.5"/>
+                                                    <rect key="frame" x="30" y="15.5" width="142.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
@@ -359,22 +359,22 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
                                                     <rect key="frame" x="30" y="15.5" width="89" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
+                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
                                                     <rect key="frame" x="198" y="15.5" width="147" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
                                                             <rect key="frame" x="0.0" y="0.0" width="115" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
                                                             <rect key="frame" x="129" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
@@ -403,22 +403,22 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Asset Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="fGU-Fp-XgM">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Asset Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="fGU-Fp-XgM">
                                                     <rect key="frame" x="30" y="15.5" width="115.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="R8B-DW-7mY">
+                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="R8B-DW-7mY">
                                                     <rect key="frame" x="206" y="15.5" width="139" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Chris (LitRitt)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hId-3P-41T">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Chris (LitRitt)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hId-3P-41T">
                                                             <rect key="frame" x="0.0" y="0.0" width="107" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="baq-cE-fMY">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="baq-cE-fMY">
                                                             <rect key="frame" x="121" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
@@ -447,13 +447,13 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Licenses" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="D6b-cd-pVK">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Licenses" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="D6b-cd-pVK">
                                                     <rect key="frame" x="30" y="15.5" width="67.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="s79-GQ-khr">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="s79-GQ-khr">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -487,13 +487,13 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Send Feedback" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="pMI-Aj-nQF">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Send Feedback" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="pMI-Aj-nQF">
                                                     <rect key="frame" x="30" y="15.5" width="125.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Jyy-x0-Owj">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Jyy-x0-Owj">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -520,13 +520,13 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="View Refresh Attempts" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="sni-07-q0M">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="View Refresh Attempts" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="sni-07-q0M">
                                                     <rect key="frame" x="30" y="15.5" width="187.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="4d3-me-Hqc">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="4d3-me-Hqc">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -556,13 +556,13 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="View Error Log" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PWC-OG-5jx">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="View Error Log" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PWC-OG-5jx">
                                                     <rect key="frame" x="30" y="15.5" width="119" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="VfB-c5-5wG">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="VfB-c5-5wG">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -582,23 +582,56 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                         </userDefinedRuntimeAttributes>
                                         <connections>
-                                            <segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="SSW-vL-86I"/>
+                                            <segue destination="g8a-Rf-zWa" kind="show" id="vFC-Id-Ww6"/>
                                         </connections>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="eZ3-BT-q4D" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
                                         <rect key="frame" x="0.0" y="1023" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="eZ3-BT-q4D" id="17m-VV-hzf">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Clear Cache" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="IbH-V1-ce3">
+                                                    <rect key="frame" x="30" y="15.5" width="98.5" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="FZe-BJ-fOm">
+                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
+                                                </imageView>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="FZe-BJ-fOm" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="bGv-Np-5aO"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="FZe-BJ-fOm" secondAttribute="trailing" id="ccb-JP-Eqi"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="iQJ-gN-sRF"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="leading" secondItem="17m-VV-hzf" secondAttribute="leadingMargin" id="m1g-Y6-aT5"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VNn-u4-cN8" id="4bh-qe-l2N">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Reset Pairing File" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ysS-9s-dXm">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Reset Pairing File" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ysS-9s-dXm">
                                                     <rect key="frame" x="30" y="15.5" width="140" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="r09-mH-pOD">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="r09-mH-pOD">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -619,19 +652,19 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="e7s-hL-kv9" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="e7s-hL-kv9" id="yjL-Mu-HTk">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Reset adi.pb" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="eds-Dj-36y">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Reset adi.pb" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="eds-Dj-36y">
                                                     <rect key="frame" x="30" y="15.5" width="102" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="0dh-yd-7i9">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="0dh-yd-7i9">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -652,19 +685,19 @@
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1176" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Advanced Settings" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="OcM-OM-uDE">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Advanced Settings" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="OcM-OM-uDE">
                                                     <rect key="frame" x="30" y="15.5" width="154" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Pcu-Sy-yfZ">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Pcu-Sy-yfZ">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -917,7 +950,7 @@ Settings by i cons from the Noun Project</string>
             </objects>
             <point key="canvasLocation" x="1697" y="313"/>
         </scene>
-        <!--Patreon-->
+        <!--Support us-->
         <scene sceneID="Lnh-9P-HnL">
             <objects>
                 <collectionViewController id="dp8-8j-vt9" customClass="PatreonViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
@@ -964,7 +997,7 @@ Settings by i cons from the Noun Project</string>
                             <outlet property="delegate" destination="dp8-8j-vt9" id="790-Kr-6l7"/>
                         </connections>
                     </collectionView>
-                    <navigationItem key="navigationItem" title="Patreon" largeTitleDisplayMode="always" id="uUV-1f-xEq"/>
+                    <navigationItem key="navigationItem" title="Support us" largeTitleDisplayMode="always" id="uUV-1f-xEq"/>
                 </collectionViewController>
                 <placeholder placeholderIdentifier="IBFirstResponder" id="qq3-Hj-S9f" userLabel="First Responder" sceneMemberID="firstResponder"/>
             </objects>

AltStore/Settings/SettingsViewController.swift

@@ -53,9 +53,11 @@ extension SettingsViewController
         case sendFeedback
         case refreshAttempts
         case errorLog
+        case clearCache
         case resetPairingFile
         case resetAdiPb
         case advancedSettings
+    
     }
 }
 
@@ -178,11 +180,11 @@ private extension SettingsViewController
         case .patreon:
             if isHeader
             {
-                settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("PATREON", comment: "")
+                settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("SUPPORT US", comment: "")
             }
             else
             {
-                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Support the SideStore Team by becoming a patron!", comment: "")
+                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Support the SideStore Team by following our socials or becoming a patron!", comment: "")
             }
 
         case .account:
@@ -291,6 +293,39 @@ private extension SettingsViewController
         self.present(viewController, animated: true, completion: nil)
     }
     
+    func clearCache()
+    {
+        let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to clear SideStore's cache?", comment: ""),
+                                                message: NSLocalizedString("This will remove all temporary files as well as backups for uninstalled apps.", comment: ""),
+                                                preferredStyle: .actionSheet)
+        alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { [weak self] _ in
+            self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+        })
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Clear Cache", comment: ""), style: .destructive) { [weak self] _ in
+            AppManager.shared.clearAppCache { result in
+                DispatchQueue.main.async {
+                    self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+                    
+                    switch result
+                    {
+                    case .success: break
+                    case .failure(let error):
+                        let alertController = UIAlertController(title: NSLocalizedString("Unable to Clear Cache", comment: ""), message: error.localizedDescription, preferredStyle: .alert)
+                        alertController.addAction(.ok)
+                        self?.present(alertController, animated: true)
+                    }
+                }
+            }
+        })
+        
+        if let popoverController = alertController.popoverPresentationController {
+            popoverController.sourceView = self.view
+            popoverController.sourceRect = CGRect(x: self.view.bounds.midX, y: self.view.bounds.midY, width: 0, height: 0)
+        }
+        
+        self.present(alertController, animated: true)
+    }
+    
     @IBAction func handleDebugModeGesture(_ gestureRecognizer: UISwipeGestureRecognizer)
     {
         self.debugGestureCounter += 1
@@ -470,6 +505,7 @@ extension SettingsViewController
                 self.addRefreshAppsShortcut()
             }
             
+            
         case .credits:
             let row = CreditsRow.allCases[indexPath.row]
             switch row
@@ -507,6 +543,9 @@ extension SettingsViewController
                     let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
                     toastView.show(in: self)
                 }
+                
+            case .clearCache: self.clearCache()
+
             case .resetPairingFile:
                 let filename = "ALTPairingFile.mobiledevicepairing"
                 let fm = FileManager.default
@@ -559,6 +598,7 @@ extension SettingsViewController
                     ELOG("UIApplication.openSettingsURLString invalid")
                 }
             case .refreshAttempts, .errorLog: break
+
             }
             
         default: break

AltStoreCore/Model/InstalledApp.swift

@@ -192,7 +192,7 @@ public extension InstalledApp
     
     class func fetchAppsForRefreshingAll(in context: NSManagedObjectContext) -> [InstalledApp]
     {
-        var predicate = NSPredicate(format: "%K == YES AND %K != %@", #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
+        let predicate = NSPredicate(format: "%K == YES AND %K != %@", #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
         print("Fetch Apps for Refreshing All 'AltStore' predicate: \(String(describing: predicate))")
         
 //        if let patreonAccount = DatabaseManager.shared.patreonAccount(in: context), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
@@ -223,7 +223,7 @@ public extension InstalledApp
         // Date 6 hours before now.
         let date = Date().addingTimeInterval(-1 * 6 * 60 * 60)
         
-        var predicate = NSPredicate(format: "(%K == YES) AND (%K < %@) AND (%K != %@)",
+        let predicate = NSPredicate(format: "(%K == YES) AND (%K < %@) AND (%K != %@)",
                                     #keyPath(InstalledApp.isActive),
                                     #keyPath(InstalledApp.refreshedDate), date as NSDate,
                                     #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)

AltWidget/Assets.xcassets/AltStore.imageset/Contents.json

@@ -5,12 +5,12 @@
       "scale" : "1x"
     },
     {
-      "filename" : "Group 23_120.png",
+      "filename" : "1024.png",
       "idiom" : "universal",
       "scale" : "2x"
     },
     {
-      "filename" : "Group 23_180.png",
+      "filename" : "1024.png",
       "idiom" : "universal",
       "scale" : "3x"
     }

AltWidget/Assets.xcassets/Badge.imageset/Contents.json

@@ -1,7 +1,7 @@
 {
   "images" : [
     {
-      "filename" : "group16Copy2.pdf",
+      "filename" : "sidestore-logo.svg",
       "idiom" : "universal"
     }
   ],

AltWidget/Assets.xcassets/Badge.imageset/sidestore-logo.svg

@@ -0,0 +1,17 @@
+<svg version="1.2" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 100 100" width="100" height="100">
+	<title>sidestore-logo-svg</title>
+	<style>
+		.s0 { fill: none } 
+		.s1 { fill: #bebbb4 } 
+	</style>
+	<g id="Layer">
+		<g id="Layer">
+			<path id="Main" class="s0" />
+			<g id="Main1">
+				<g id="Layer">
+					<path id="Layer" fill-rule="evenodd" class="s1" d="m86 50c0 2.3-1.9 4.2-4.2 4.2h-50.9c-2.3 0-4.2-1.9-4.2-4.2 0-2.3 1.9-4.2 4.2-4.2h50.9c2.3 0 4.2 1.9 4.2 4.2zm-31.8-23.3v2.1c0 3.4-1.3 6.6-3.7 9-2.4 2.4-5.6 3.7-9 3.7h-10.6c-2.2 0-4.4 0.9-5.9 2.5-1.6 1.6-2.5 3.8-2.5 6 0 2.2 0.9 4.4 2.5 6 1.5 1.6 3.7 2.5 5.9 2.5h10.6c3.4 0 6.6 1.3 9 3.7 2.4 2.4 3.7 5.6 3.7 9v10.8c0 1.1-0.4 2.1-1.1 2.8-0.8 0.8-1.8 1.2-2.9 1.2h-0.4c-1.1 0-2.1-0.4-2.9-1.2-0.7-0.7-1.1-1.7-1.1-2.8v-10.8c0-1.1-0.5-2.2-1.3-3-0.8-0.8-1.8-1.3-3-1.3h-10.6c-4.5 0-8.8-1.7-11.9-4.9-3.2-3.2-5-7.5-5-12 0-4.5 1.8-8.8 5-12 3.1-3.2 7.4-4.9 11.9-4.9h10.6c1.2 0 2.2-0.5 3-1.3 0.8-0.8 1.3-1.9 1.3-3v-2.1h-4.3l8.5-12.7 8.5 12.7zm12.7 55.3c0 2.2-1.8 4-4 4h-0.5c-2.2 0-4-1.8-4-4v-19.5c0-2.2 1.8-4 4-4h0.5c2.2 0 4 1.8 4 4z"/>
+				</g>
+			</g>
+		</g>
+	</g>
+</svg>

AltWidget/Assets.xcassets/SmallIcon.imageset/Contents.json

@@ -1,7 +1,7 @@
 {
   "images" : [
     {
-      "filename" : "altminicon.pdf",
+      "filename" : "cir.svg",
       "idiom" : "universal"
     }
   ],

AltWidget/Assets.xcassets/SmallIcon.imageset/cir.svg

@@ -0,0 +1,3 @@
+<svg width="100" height="100" version="1.1" viewBox="0 0 100 100" xmlns="http://www.w3.org/2000/svg">
+ <circle cx="50" cy="50" r="50" fill="#fff" stroke-width=".265"/>
+</svg>

AltWidget/Resources/ReleaseEntitlements.plist

@@ -0,0 +1,16 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>application-identifier</key>
+	<string>XYZ0123456.com.SideStore.SideStore.AltWidget</string>
+	<key>com.apple.developer.team-identifier</key>
+	<string>XYZ0123456</string>
+	<key>com.apple.security.application-groups</key>
+	<array>
+		<string>group.com.SideStore.SideStore</string>
+	</array>
+	<key>get-task-allow</key>
+	<true/>
+</dict>
+</plist>

Build.xcconfig

@@ -1,8 +1,8 @@
 // Configuration settings file format documentation can be found at:
 // https://help.apple.com/xcode/#/dev745c5c974
 
-MARKETING_VERSION = 0.4.0
+MARKETING_VERSION = 0.5.3
-CURRENT_PROJECT_VERSION = 4000
+CURRENT_PROJECT_VERSION = 5030
 
 // Vars to be overwritten by `CodeSigning.xcconfig` if exists
 DEVELOPMENT_TEAM = S32Z3HMYVQ

CONTRIBUTING.md

@@ -7,7 +7,7 @@ There are many ways to contribute to SideStore, so if you aren't a developer, th
 -   [Writing documentation](https://github.com/SideStore/SideStore-Docs)
 -   [Submitting detailed bug reports and suggesting new features](https://github.com/SideStore/SideStore/issues/new/choose)
 -   Helping out with support
-    -   [Discord](https://discord.gg/RgpFBX3Q3k)
+    -   [Discord](https://discord.gg/sidestore-949183273383395328)
     -   [GitHub Discussions](https://github.com/SideStore/SideStore/discussions)
 
 However, this guide will focus on the development side of things. For now, we will only have setup information here, but you can [join our Discord](https://discord.gg/RgpFBX3Q3k) if you need help

Makefile

@@ -171,6 +171,7 @@ build:
 fakesign:
 	rm -rf archive.xcarchive/Products/Applications/SideStore.app/Frameworks/AltStoreCore.framework/Frameworks/
 	ldid -SAltStore/Resources/ReleaseEntitlements.plist archive.xcarchive/Products/Applications/SideStore.app/SideStore
+	ldid -SAltWidget/Resources/ReleaseEntitlements.plist archive.xcarchive/Products/Applications/SideStore.app/PlugIns/AltWidgetExtension.appex/AltWidgetExtension
 
 ipa:
 	mkdir Payload

README.md

@@ -9,7 +9,7 @@
 
 ![Alt](https://repobeats.axiom.co/api/embed/3a329ce95955690b9a9366f8d5598626a847d96c.svg "Repobeats analytics image")
 
-SideStore is an iOS application that allows you to sideload apps onto your iOS device with just your Apple ID. SideStore resigns apps with your personal development certificate, and then uses a [specially designed VPN](https://github.com/jkcoxson/Secret-Tunnel) in order to trick iOS into installing them. SideStore will periodically "refresh" your apps in the background, to keep their normal 7-day development period from expiring.
+SideStore is an iOS application that allows you to sideload apps onto your iOS device with just your Apple ID. SideStore resigns apps with your personal development certificate, and then uses a [specially designed VPN](https://github.com/jkcoxson/em_proxy) in order to trick iOS into installing them. SideStore will periodically "refresh" your apps in the background, to keep their normal 7-day development period from expiring.
 
 SideStore's goal is to provide an untethered sideloading experience. It's a community driven fork of [AltStore](https://github.com/rileytestut/AltStore), and has already implemented some of the community's most-requested features.
 

Shared/Extensions/Bundle+AltStore.swift

@@ -56,7 +56,7 @@ public extension Bundle
 public extension Bundle
 {
     static var baseAltStoreAppGroupID = "group." + Bundle.Info.appbundleIdentifier
-    
+
     var appGroups: [String] {
         return self.infoDictionary?[Bundle.Info.appGroups] as? [String] ?? []
     }

SideStore.conf

@@ -0,0 +1,9 @@
+[Interface]
+PrivateKey = AIIeeUDvk3NeAFJ9BWCQvPJize/9WZibMnGJ/0rt5k4=
+Address = 10.7.0.10/24
+
+[Peer]
+PublicKey = kHDoekeYhBvfW9a9UQ+UCmpbG423eejTjcjW+DT+JF0=
+AllowedIPs = 10.7.0.1/32
+Endpoint = 127.0.0.1:51820
+PersistentKeepalive = 25

trustedapps.json

@@ -32,9 +32,17 @@
       "identifier": "eu.pokemmo.altstore",
       "sourceURL": "https://pokemmo.eu/altstore/"
     },
+    {
+      "identifier": "dev.theodyssey.sidestore",
+      "sourceURL": "https://theodyssey.dev/altstore/odysseysource.json"
+    },
     {
       "identifier": "stream.yattee",
       "sourceURL": "https://repos.yattee.stream/alt/apps.json"
+    },
+    {
+      "identifier": "com.litritt.litsource",
+      "sourceURL": "https://altstore.ignitedemulator.com/"
     }
   ]
 }