[skip ci] Add other project maintainers to CODEOWNERS

Signed-off-by: nythepegasus <nythepegasus84@gmail.com>

.github/CODEOWNERS

@@ -1 +1 @@
-*       @JoeMatt @lonkelle
+*       @JoeMatt @lonkelle @nythepegasus @Spidy123222 @SternXD

.github/ISSUE_TEMPLATE/bug_report.yml

@@ -10,7 +10,7 @@ body:
       value: |
         Thanks for taking the time to fill out this bug report! Before you continue filling out the report, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the bug you are experiencing** in case it has already been reported.
         
-        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+        **Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
   - type: textarea
     id: description
     attributes:

.github/ISSUE_TEMPLATE/config.yml

@@ -3,7 +3,7 @@ blank_issues_enabled: false
 
 contact_links:
   - name: Discord
-    url: https://discord.gg/RgpFBX3Q3k
+    url: https://discord.gg/sidestore-949183273383395328
     about: If you need support, please go here first instead of making an issue!
   - name: GitHub Discussions
     url: https://github.com/SideStore/SideStore/discussions

.github/ISSUE_TEMPLATE/feature_request.yml

@@ -10,7 +10,7 @@ body:
       value: |
         Thanks for taking the time to fill out this feature request! Before you continue filling out the form, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the feature you are suggestion** in case it has already been suggested.
         
-        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+        **Please use [Discord](https://discord.gg/sidestore-949183273383395328) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
   - type: textarea
     id: description
     attributes:

.github/workflows/beta.yml

@@ -27,6 +27,13 @@ jobs:
       - name: Change version to tag
         run: sed -e '/MARKETING_VERSION = .*/s/= .*/= ${{ github.ref_name }}/' -i '' Build.xcconfig
 
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Echo version
+        run: echo "${{ steps.version.outputs.version }}"
+
       - name: Setup Xcode
         uses: maxim-lobanov/setup-xcode@v1.4.1
         with:
@@ -41,16 +48,6 @@ jobs:
       - name: Convert to IPA
         run: make ipa
 
-      - name: Upload Artifact
-        uses: actions/upload-artifact@v3.1.0
-        with:
-          name: SideStore.ipa
-          path: SideStore.ipa
-
-      - name: Get version
-        id: version
-        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
-
       - name: Get current date
         id: date
         run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
@@ -82,3 +79,18 @@ jobs:
             Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
             Commit SHA: `${{ github.sha }}`
             Version: `${{ steps.version.outputs.version }}`
+
+      - name: Add version to IPA file name
+        run: mv SideStore.ipa SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload SideStore.ipa Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore-${{ steps.version.outputs.version }}.ipa
+          path: SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload *.dSYM Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore-${{ steps.version.outputs.version }}-dSYM
+          path: ./*.dSYM/

.github/workflows/increase-nightly-build-num.sh

@@ -7,7 +7,7 @@ DATE=`date -u +'%Y.%m.%d'`
 BUILD_NUM=1
 
 write() {
-    sed -e "/MARKETING_VERSION = .*/s/$/-nightly.$DATE.$BUILD_NUM/" -i '' Build.xcconfig
+    sed -e "/MARKETING_VERSION = .*/s/$/-nightly.$DATE.$BUILD_NUM+$(git rev-parse --short HEAD)/" -i '' Build.xcconfig
     echo "$DATE,$BUILD_NUM" > .nightly-build-num
 }
 

.github/workflows/nightly.yml

@@ -36,6 +36,13 @@ jobs:
       - name: Increase nightly build number and set as version
         run: bash .github/workflows/increase-nightly-build-num.sh
 
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Echo version
+        run: echo "${{ steps.version.outputs.version }}"
+
       - name: Setup Xcode
         uses: maxim-lobanov/setup-xcode@v1.4.1
         with:
@@ -50,16 +57,6 @@ jobs:
       - name: Convert to IPA
         run: make ipa
 
-      - name: Upload Artifact
-        uses: actions/upload-artifact@v3.1.0
-        with:
-          name: SideStore.ipa
-          path: SideStore.ipa
-
-      - name: Get version
-        id: version
-        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
-
       - name: Get current date
         id: date
         run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
@@ -90,5 +87,20 @@ jobs:
             Commit SHA: `${{ github.sha }}`
             Version: `${{ steps.version.outputs.version }}`
 
+      - name: Add version to IPA file name
+        run: mv SideStore.ipa SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload SideStore.ipa Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore-${{ steps.version.outputs.version }}.ipa
+          path: SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload *.dSYM Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore-${{ steps.version.outputs.version }}-dSYM
+          path: ./*.dSYM/
+
       - name: Reset cache for apps.sidestore.io/nightly
         run: sleep 10 && curl https://apps.sidestore.io/reset-cache/nightly/${{ secrets.SIDESOURCE_KEY }}

.github/workflows/pr.yml

@@ -23,7 +23,16 @@ jobs:
         run: brew install ldid
 
       - name: Add PR suffix to version
-        run: sed -e '/MARKETING_VERSION = .*/s/$/-pr.${{ github.event.pull_request.number }}/' -i '' Build.xcconfig
+        run: sed -e "/MARKETING_VERSION = .*/s/\$/-pr.${{ github.event.pull_request.number }}+$(git rev-parse --short ${COMMIT:-HEAD})/" -i '' Build.xcconfig
+        env:
+          COMMIT: ${{ github.event.pull_request.head.sha }}
+
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Echo version
+        run: echo "${{ steps.version.outputs.version }}"
 
       - name: Setup Xcode
         uses: maxim-lobanov/setup-xcode@v1.4.1
@@ -39,8 +48,17 @@ jobs:
       - name: Convert to IPA
         run: make ipa
 
-      - name: Upload Artifact
+      - name: Add version to IPA file name
+        run: mv SideStore.ipa SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload SideStore.ipa Artifact
         uses: actions/upload-artifact@v3.1.0
         with:
-          name: SideStore.ipa
+          name: SideStore-${{ steps.version.outputs.version }}.ipa
-          path: SideStore.ipa
+          path: SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload *.dSYM Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore-${{ steps.version.outputs.version }}-dSYM
+          path: ./*.dSYM/

.github/workflows/stable.yml

@@ -27,6 +27,13 @@ jobs:
       - name: Change version to tag
         run: sed -e '/MARKETING_VERSION = .*/s/= .*/= ${{ github.ref_name }}/' -i '' Build.xcconfig
 
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Echo version
+        run: echo "${{ steps.version.outputs.version }}"
+
       - name: Setup Xcode
         uses: maxim-lobanov/setup-xcode@v1.4.1
         with:
@@ -41,16 +48,6 @@ jobs:
       - name: Convert to IPA
         run: make ipa
 
-      - name: Upload Artifact
-        uses: actions/upload-artifact@v3.1.0
-        with:
-          name: SideStore.ipa
-          path: SideStore.ipa
-
-      - name: Get version
-        id: version
-        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
-
       - name: Get current date
         id: date
         run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
@@ -79,3 +76,18 @@ jobs:
             Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
             Commit SHA: `${{ github.sha }}`
             Version: `${{ steps.version.outputs.version }}`
+
+      - name: Add version to IPA file name
+        run: mv SideStore.ipa SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload SideStore.ipa Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore-${{ steps.version.outputs.version }}.ipa
+          path: SideStore-${{ steps.version.outputs.version }}.ipa
+
+      - name: Upload *.dSYM Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore-${{ steps.version.outputs.version }}-dSYM
+          path: ./*.dSYM/

.gitignore

@@ -37,6 +37,8 @@ xcuserdata
 
 Payload/
 SideStore.ipa
+*.dSYM
+
 Dependencies/.*-prebuilt-fetch-*
 Dependencies/minimuxer/*
 Dependencies/em_proxy/*

.gitmodules

@@ -9,7 +9,7 @@
 	url = https://github.com/libimobiledevice/libusbmuxd.git
 [submodule "Dependencies/libplist"]
 	path = Dependencies/libplist
-	url = https://github.com/libimobiledevice/libplist.git
+	url = https://github.com/SideStore/libplist.git
 [submodule "Dependencies/MarkdownAttributedString"]
 	path = Dependencies/MarkdownAttributedString
 	url = https://github.com/chockenberry/MarkdownAttributedString.git

AltBackup/Assets.xcassets/Background.colorset/Contents.json

@@ -5,9 +5,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "0.518",
+          "blue" : "175",
-          "green" : "0.502",
+          "green" : "4",
-          "red" : "0.004"
+          "red" : "115"
         }
       },
       "idiom" : "universal"
@@ -23,9 +23,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "0.404",
+          "blue" : "150",
-          "green" : "0.322",
+          "green" : "3",
-          "red" : "0.008"
+          "red" : "99"
         }
       },
       "idiom" : "universal"

AltStore.xcconfig

@@ -1,3 +1,3 @@
 #include "Build.xcconfig"
 
-PRODUCT_BUNDLE_IDENTIFIER = $(ORG_PREFIX).$(PRODUCT_NAME)
+PRODUCT_BUNDLE_IDENTIFIER = $(PRODUCT_BUNDLE_IDENTIFIER)

AltStore.xcodeproj/project.pbxproj

@@ -8,22 +8,49 @@
 
 /* Begin PBXBuildFile section */
 		03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E314122A05D4C00370A3C /* Bundle+AltStore.swift */; };
+		0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0E1A1F902AE36A9600364CAD /* bytearray.c */; };
+		0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = 0E764E162ADFF5740043DD4E /* AltBackup.ipa */; };
+		0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166472ADFE0D1003015C1 /* out-limd.c */; };
+		0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166522ADFE0D2003015C1 /* out-default.c */; };
+		0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166552ADFE0D2003015C1 /* out-plutil.c */; };
+		0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166562ADFE0D2003015C1 /* oplist.c */; };
+		0EA166682ADFE122003015C1 /* jsmn.h in Headers */ = {isa = PBXBuildFile; fileRef = 0EA166632ADFE122003015C1 /* jsmn.h */; };
+		0EA166692ADFE140003015C1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166452ADFE0D1003015C1 /* Array.cpp */; };
+		0EA1666A2ADFE140003015C1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166492ADFE0D1003015C1 /* String.cpp */; };
+		0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */; };
+		0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166532ADFE0D2003015C1 /* Integer.cpp */; };
+		0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166432ADFE0D1003015C1 /* Data.cpp */; };
+		0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166512ADFE0D2003015C1 /* ptrarray.c */; };
+		0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664F2ADFE0D1003015C1 /* hashtable.c */; };
+		0EA166702ADFE140003015C1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166502ADFE0D2003015C1 /* Node.cpp */; };
+		0EA166712ADFE140003015C1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166582ADFE0D2003015C1 /* Key.cpp */; };
+		0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166462ADFE0D1003015C1 /* Dictionary.cpp */; };
+		0EA166742ADFE140003015C1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166422ADFE0D1003015C1 /* Date.cpp */; };
+		0EA166752ADFE140003015C1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166542ADFE0D2003015C1 /* Real.cpp */; };
+		0EA166762ADFE140003015C1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664A2ADFE0D1003015C1 /* base64.c */; };
+		0EA166772ADFE140003015C1 /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166412ADFE0D1003015C1 /* jplist.c */; };
+		0EA166782ADFE140003015C1 /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166572ADFE0D2003015C1 /* jsmn.c */; };
+		0EA166792ADFE140003015C1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166442ADFE0D1003015C1 /* bplist.c */; };
+		0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664B2ADFE0D1003015C1 /* Uid.cpp */; };
+		0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1665A2ADFE0D2003015C1 /* Structure.cpp */; };
+		0EA1667D2ADFE140003015C1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA166592ADFE0D2003015C1 /* xplist.c */; };
+		0EA1667E2ADFE140003015C1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA1664C2ADFE0D1003015C1 /* time64.c */; };
+		0EA4B9BC2AE4A414009209CE /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = 0EA4B9BB2AE4A3F6009209CE /* plist.c */; };
 		19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */ = {isa = PBXBuildFile; fileRef = BF45872B2298D31600BD7491 /* libimobiledevice.a */; };
 		19104DB52909C06D00C49C7B /* EmotionalDamage.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19104DB42909C06D00C49C7B /* EmotionalDamage.swift */; };
 		19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DB22909C06C00C49C7B /* libEmotionalDamage.a */; };
-		191E5FAE290A5D92001A3B7C /* minimuxer.swift in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FAD290A5D92001A3B7C /* minimuxer.swift */; };
 		191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FAB290A5D92001A3B7C /* libminimuxer.a */; };
 		191E5FDC290AFA5C001A3B7C /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 191E5FDB290AFA5C001A3B7C /* OpenSSL */; };
-		191E607D290B2EA5001A3B7C /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FD0290A651D001A3B7C /* jsmn.c */; };
-		191E607E290B2EA7001A3B7C /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FCF290A651D001A3B7C /* jplist.c */; };
-		191E6087290C7B50001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FB5290A5E1F001A3B7C /* libminimuxer.a */; };
 		1920B04F2924AC8300744F60 /* Settings.bundle in Resources */ = {isa = PBXBuildFile; fileRef = 1920B04E2924AC8300744F60 /* Settings.bundle */; };
 		19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */; };
 		4879A95F2861046500FC1BBD /* AltSign in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A95E2861046500FC1BBD /* AltSign */; };
 		4879A9622861049C00FC1BBD /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A9612861049C00FC1BBD /* OpenSSL */; };
+		9922FFEC29B501C50020F868 /* Starscream in Frameworks */ = {isa = PBXBuildFile; productRef = 9922FFEB29B501C50020F868 /* Starscream */; };
 		99C4EF4D2979132100CB538D /* SemanticVersion in Frameworks */ = {isa = PBXBuildFile; productRef = 99C4EF4C2979132100CB538D /* SemanticVersion */; };
+		99F87D0529D8B4E200B40039 /* minimuxer-helpers.swift in Sources */ = {isa = PBXBuildFile; fileRef = 9961EC2D29BE9F2E00AF2C6F /* minimuxer-helpers.swift */; };
+		99F87D1829D8E4C900B40039 /* SwiftBridgeCore.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1629D8E4C900B40039 /* SwiftBridgeCore.swift */; };
+		99F87D1929D8E4C900B40039 /* minimuxer.swift in Sources */ = {isa = PBXBuildFile; fileRef = 99F87D1729D8E4C900B40039 /* minimuxer.swift */; };
 		B3146ED2284F581E00BBC3FD /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; };
-		B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; settings = {ATTRIBUTES = (CodeSignOnCopy, RemoveHeadersOnCopy, ); }; };
 		B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F894295F7F9B002B1159 /* libfragmentzip.a */; };
 		B33FFBAA295F8F78002259E6 /* preboard.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBA9295F8F78002259E6 /* preboard.c */; };
 		B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBAB295F8F98002259E6 /* companion_proxy.c */; };
@@ -72,7 +99,6 @@
 		BF41B808233433C100C593A3 /* LoadingState.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF41B807233433C100C593A3 /* LoadingState.swift */; };
 		BF42345A25101C35006D1EB2 /* WidgetView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF42345825101C1D006D1EB2 /* WidgetView.swift */; };
 		BF44EEF0246B08BA002A52F2 /* BackupController.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEEF246B08BA002A52F2 /* BackupController.swift */; };
-		BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */ = {isa = PBXBuildFile; fileRef = BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */; };
 		BF44EEFC246B4550002A52F2 /* RemoveAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */; };
 		BF4587F82298D3AB00BD7491 /* service.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4587C82298D3A800BD7491 /* service.h */; };
 		BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587C92298D3A800BD7491 /* diagnostics_relay.c */; };
@@ -252,34 +278,6 @@
 		BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = BFD247782284B9A700981D42 /* LaunchScreen.storyboard */; };
 		BFD2478C2284C4C300981D42 /* AppIconImageView.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478B2284C4C300981D42 /* AppIconImageView.swift */; };
 		BFD2478F2284C8F900981D42 /* Button.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFD2478E2284C8F900981D42 /* Button.swift */; };
-		BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */; };
-		BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE622A1A9CA000B7ED1 /* base64.c */; };
-		BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE722A1A9CA000B7ED1 /* hashtable.c */; };
-		BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */; };
-		BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */; };
-		BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEA22A1A9CA000B7ED1 /* bplist.c */; };
-		BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEB22A1A9CA000B7ED1 /* String.cpp */; };
-		BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEC22A1A9CA000B7ED1 /* time64.c */; };
-		BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BED22A1A9CA000B7ED1 /* plist.h */; };
-		BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BEE22A1A9CA000B7ED1 /* plist.c */; };
-		BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */; };
-		BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF022A1A9CA000B7ED1 /* Date.cpp */; };
-		BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */; };
-		BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */; };
-		BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF322A1A9CA000B7ED1 /* Real.cpp */; };
-		BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF422A1A9CA000B7ED1 /* strbuf.h */; };
-		BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF522A1A9CA000B7ED1 /* bytearray.c */; };
-		BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BF622A1A9CA000B7ED1 /* base64.h */; };
-		BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF722A1A9CA000B7ED1 /* Data.cpp */; };
-		BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF822A1A9CB000B7ED1 /* Array.cpp */; };
-		BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BF922A1A9CB000B7ED1 /* Node.cpp */; };
-		BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */; };
-		BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */; };
-		BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */; };
-		BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */ = {isa = PBXBuildFile; fileRef = BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */; };
-		BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */; };
-		BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */ = {isa = PBXBuildFile; fileRef = BFD52BFF22A1A9CB000B7ED1 /* time64.h */; };
-		BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C0022A1A9CB000B7ED1 /* xplist.c */; };
 		BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1D22A1A9EC000B7ED1 /* node.c */; };
 		BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1E22A1A9EC000B7ED1 /* node_list.c */; };
 		BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */ = {isa = PBXBuildFile; fileRef = BFD52C1F22A1A9EC000B7ED1 /* cnary.c */; };
@@ -334,6 +332,7 @@
 		D57FE84428C7DB7100216002 /* ErrorLogViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */; };
 		D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = D58916FD28C7C55C00E39C8B /* LoggedError.swift */; };
 		D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D593F1932717749A006E82DE /* PatchAppOperation.swift */; };
+		D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */; };
 		D5CA0C4B280E141900469595 /* ManagedPatron.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4A280E141900469595 /* ManagedPatron.swift */; };
 		D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */; };
 		D5DAE0942804B0B80034D8D4 /* ScreenshotProcessor.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5DAE0932804B0B80034D8D4 /* ScreenshotProcessor.swift */; };
@@ -480,7 +479,6 @@
 			dstPath = "";
 			dstSubfolderSpec = 10;
 			files = (
-				B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */,
 				BF1614F2250822F100767AEA /* Roxas.framework in Embed Frameworks */,
 				BF66EE862501AE50007EE018 /* AltStoreCore.framework in Embed Frameworks */,
 			);
@@ -501,16 +499,50 @@
 /* End PBXCopyFilesBuildPhase section */
 
 /* Begin PBXFileReference section */
+		0E1A1F902AE36A9600364CAD /* bytearray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = src/bytearray.c; sourceTree = "<group>"; };
+		0E764E162ADFF5740043DD4E /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; name = AltBackup.ipa; path = AltStore/Resources/AltBackup.ipa; sourceTree = SOURCE_ROOT; };
+		0EA166412ADFE0D1003015C1 /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166422ADFE0D1003015C1 /* Date.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166432ADFE0D1003015C1 /* Data.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166442ADFE0D1003015C1 /* bplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166452ADFE0D1003015C1 /* Array.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166462ADFE0D1003015C1 /* Dictionary.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166472ADFE0D1003015C1 /* out-limd.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-limd.c"; path = "Dependencies/libplist/src/out-limd.c"; sourceTree = SOURCE_ROOT; };
+		0EA166492ADFE0D1003015C1 /* String.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664A2ADFE0D1003015C1 /* base64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
+		0EA1664B2ADFE0D1003015C1 /* Uid.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664C2ADFE0D1003015C1 /* time64.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
+		0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1664F2ADFE0D1003015C1 /* hashtable.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
+		0EA166502ADFE0D2003015C1 /* Node.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166512ADFE0D2003015C1 /* ptrarray.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
+		0EA166522ADFE0D2003015C1 /* out-default.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-default.c"; path = "Dependencies/libplist/src/out-default.c"; sourceTree = SOURCE_ROOT; };
+		0EA166532ADFE0D2003015C1 /* Integer.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166542ADFE0D2003015C1 /* Real.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166552ADFE0D2003015C1 /* out-plutil.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = "out-plutil.c"; path = "Dependencies/libplist/src/out-plutil.c"; sourceTree = SOURCE_ROOT; };
+		0EA166562ADFE0D2003015C1 /* oplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = oplist.c; path = Dependencies/libplist/src/oplist.c; sourceTree = SOURCE_ROOT; };
+		0EA166572ADFE0D2003015C1 /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
+		0EA166582ADFE0D2003015C1 /* Key.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
+		0EA166592ADFE0D2003015C1 /* xplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
+		0EA1665A2ADFE0D2003015C1 /* Structure.cpp */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
+		0EA1665F2ADFE122003015C1 /* time64_limits.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
+		0EA166602ADFE122003015C1 /* time64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
+		0EA166612ADFE122003015C1 /* bytearray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
+		0EA166622ADFE122003015C1 /* ptrarray.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
+		0EA166632ADFE122003015C1 /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
+		0EA166642ADFE122003015C1 /* plist.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
+		0EA166652ADFE122003015C1 /* hashtable.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
+		0EA166662ADFE122003015C1 /* base64.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
+		0EA166672ADFE122003015C1 /* strbuf.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
+		0EA4B9BB2AE4A3F6009209CE /* plist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
 		19104DB22909C06C00C49C7B /* libEmotionalDamage.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libEmotionalDamage.a; sourceTree = BUILT_PRODUCTS_DIR; };
 		19104DB42909C06D00C49C7B /* EmotionalDamage.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EmotionalDamage.swift; sourceTree = "<group>"; };
 		191E5FAB290A5D92001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer.a; sourceTree = BUILT_PRODUCTS_DIR; };
-		191E5FAD290A5D92001A3B7C /* minimuxer.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = minimuxer.swift; sourceTree = "<group>"; };
-		191E5FB5290A5E1F001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; lastKnownFileType = archive.ar; name = libminimuxer.a; path = "Dependencies/minimuxer/target/aarch64-apple-ios/debug/libminimuxer.a"; sourceTree = "<group>"; };
-		191E5FCF290A651D001A3B7C /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
-		191E5FD0290A651D001A3B7C /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
-		191E5FD1290A651D001A3B7C /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
 		1920B04E2924AC8300744F60 /* Settings.bundle */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.plug-in"; path = Settings.bundle; sourceTree = "<group>"; };
 		19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SelectTeamViewController.swift; sourceTree = "<group>"; };
+		9961EC2D29BE9F2E00AF2C6F /* minimuxer-helpers.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; name = "minimuxer-helpers.swift"; path = "Dependencies/minimuxer/minimuxer-helpers.swift"; sourceTree = SOURCE_ROOT; };
+		99F87D1629D8E4C900B40039 /* SwiftBridgeCore.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; name = SwiftBridgeCore.swift; path = Dependencies/minimuxer/SwiftBridgeCore.swift; sourceTree = SOURCE_ROOT; };
+		99F87D1729D8E4C900B40039 /* minimuxer.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; name = minimuxer.swift; path = Dependencies/minimuxer/minimuxer.swift; sourceTree = SOURCE_ROOT; };
 		B3146EC6284F580500BBC3FD /* Roxas.xcodeproj */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.pb-project"; name = Roxas.xcodeproj; path = Dependencies/Roxas/Roxas.xcodeproj; sourceTree = "<group>"; };
 		B33FFBA9295F8F78002259E6 /* preboard.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = preboard.c; path = src/preboard.c; sourceTree = "<group>"; };
 		B33FFBAB295F8F98002259E6 /* companion_proxy.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = companion_proxy.c; path = src/companion_proxy.c; sourceTree = "<group>"; };
@@ -570,7 +602,6 @@
 		BF41B807233433C100C593A3 /* LoadingState.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoadingState.swift; sourceTree = "<group>"; };
 		BF42345825101C1D006D1EB2 /* WidgetView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = WidgetView.swift; sourceTree = "<group>"; };
 		BF44EEEF246B08BA002A52F2 /* BackupController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = BackupController.swift; sourceTree = "<group>"; };
-		BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */ = {isa = PBXFileReference; lastKnownFileType = file; path = AltBackup.ipa; sourceTree = "<group>"; };
 		BF44EEFB246B4550002A52F2 /* RemoveAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RemoveAppOperation.swift; sourceTree = "<group>"; };
 		BF45872B2298D31600BD7491 /* libimobiledevice.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libimobiledevice.a; sourceTree = BUILT_PRODUCTS_DIR; };
 		BF4587C82298D3A800BD7491 /* service.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = service.h; path = Dependencies/libimobiledevice/src/service.h; sourceTree = SOURCE_ROOT; };
@@ -727,7 +758,6 @@
 		BF9ABA4A22DD137F008935CF /* NavigationBar.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; path = NavigationBar.swift; sourceTree = "<group>"; };
 		BF9ABA4C22DD16DE008935CF /* PillButton.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PillButton.swift; sourceTree = "<group>"; };
 		BFA8172A23C5633D001B5953 /* FetchAnisetteDataOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = FetchAnisetteDataOperation.swift; sourceTree = "<group>"; };
-		BFB1169C22932DB100BB457C /* apps.json */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.json; path = apps.json; sourceTree = "<group>"; };
 		BFB39B5B252BC10E00D1BE50 /* Managed.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = Managed.swift; sourceTree = "<group>"; };
 		BFB4323E22DE852000B7F8BC /* UpdateCollectionViewCell.xib */ = {isa = PBXFileReference; lastKnownFileType = file.xib; path = UpdateCollectionViewCell.xib; sourceTree = "<group>"; };
 		BFB6B21D231870160022A802 /* NewsViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = NewsViewController.swift; sourceTree = "<group>"; };
@@ -757,34 +787,6 @@
 		BFD2479E2284FBD000981D42 /* UIColor+AltStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "UIColor+AltStore.swift"; sourceTree = "<group>"; };
 		BFD44605241188C300EAB90A /* CodableServerError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = CodableServerError.swift; sourceTree = "<group>"; };
 		BFD52BD222A06EFB000B7ED1 /* ALTConstants.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTConstants.h; sourceTree = "<group>"; };
-		BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = ptrarray.c; path = Dependencies/libplist/src/ptrarray.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE622A1A9CA000B7ED1 /* base64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = base64.c; path = Dependencies/libplist/src/base64.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE722A1A9CA000B7ED1 /* hashtable.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = hashtable.c; path = Dependencies/libplist/src/hashtable.c; sourceTree = SOURCE_ROOT; };
-		BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Dictionary.cpp; path = Dependencies/libplist/src/Dictionary.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = ptrarray.h; path = Dependencies/libplist/src/ptrarray.h; sourceTree = SOURCE_ROOT; };
-		BFD52BEA22A1A9CA000B7ED1 /* bplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bplist.c; path = Dependencies/libplist/src/bplist.c; sourceTree = SOURCE_ROOT; };
-		BFD52BEB22A1A9CA000B7ED1 /* String.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = String.cpp; path = Dependencies/libplist/src/String.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BEC22A1A9CA000B7ED1 /* time64.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = time64.c; path = Dependencies/libplist/src/time64.c; sourceTree = SOURCE_ROOT; };
-		BFD52BED22A1A9CA000B7ED1 /* plist.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = plist.h; path = Dependencies/libplist/src/plist.h; sourceTree = SOURCE_ROOT; };
-		BFD52BEE22A1A9CA000B7ED1 /* plist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = plist.c; path = Dependencies/libplist/src/plist.c; sourceTree = SOURCE_ROOT; };
-		BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = hashtable.h; path = Dependencies/libplist/src/hashtable.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF022A1A9CA000B7ED1 /* Date.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Date.cpp; path = Dependencies/libplist/src/Date.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Uid.cpp; path = Dependencies/libplist/src/Uid.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Boolean.cpp; path = Dependencies/libplist/src/Boolean.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF322A1A9CA000B7ED1 /* Real.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Real.cpp; path = Dependencies/libplist/src/Real.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF422A1A9CA000B7ED1 /* strbuf.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = strbuf.h; path = Dependencies/libplist/src/strbuf.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF522A1A9CA000B7ED1 /* bytearray.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = bytearray.c; path = Dependencies/libplist/src/bytearray.c; sourceTree = SOURCE_ROOT; };
-		BFD52BF622A1A9CA000B7ED1 /* base64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = base64.h; path = Dependencies/libplist/src/base64.h; sourceTree = SOURCE_ROOT; };
-		BFD52BF722A1A9CA000B7ED1 /* Data.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Data.cpp; path = Dependencies/libplist/src/Data.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF822A1A9CB000B7ED1 /* Array.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Array.cpp; path = Dependencies/libplist/src/Array.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BF922A1A9CB000B7ED1 /* Node.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Node.cpp; path = Dependencies/libplist/src/Node.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = bytearray.h; path = Dependencies/libplist/src/bytearray.h; sourceTree = SOURCE_ROOT; };
-		BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Key.cpp; path = Dependencies/libplist/src/Key.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Integer.cpp; path = Dependencies/libplist/src/Integer.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = Structure.cpp; path = Dependencies/libplist/src/Structure.cpp; sourceTree = SOURCE_ROOT; };
-		BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64_limits.h; path = Dependencies/libplist/src/time64_limits.h; sourceTree = SOURCE_ROOT; };
-		BFD52BFF22A1A9CB000B7ED1 /* time64.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = time64.h; path = Dependencies/libplist/src/time64.h; sourceTree = SOURCE_ROOT; };
-		BFD52C0022A1A9CB000B7ED1 /* xplist.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = xplist.c; path = Dependencies/libplist/src/xplist.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1D22A1A9EC000B7ED1 /* node.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node.c; path = Dependencies/libplist/libcnary/node.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1E22A1A9EC000B7ED1 /* node_list.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = node_list.c; path = Dependencies/libplist/libcnary/node_list.c; sourceTree = SOURCE_ROOT; };
 		BFD52C1F22A1A9EC000B7ED1 /* cnary.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = cnary.c; path = Dependencies/libplist/libcnary/cnary.c; sourceTree = SOURCE_ROOT; };
@@ -838,6 +840,7 @@
 		D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorLogViewController.swift; sourceTree = "<group>"; };
 		D58916FD28C7C55C00E39C8B /* LoggedError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoggedError.swift; sourceTree = "<group>"; };
 		D593F1932717749A006E82DE /* PatchAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchAppOperation.swift; sourceTree = "<group>"; };
+		D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ClearAppCacheOperation.swift; sourceTree = "<group>"; };
 		D5CA0C4A280E141900469595 /* ManagedPatron.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ManagedPatron.swift; sourceTree = "<group>"; };
 		D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 10.xcdatamodel"; sourceTree = "<group>"; };
 		D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcmappingmodel; path = AltStore9ToAltStore10.xcmappingmodel; sourceTree = "<group>"; };
@@ -914,13 +917,13 @@
 			buildActionMask = 2147483647;
 			files = (
 				B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */,
-				191E6087290C7B50001A3B7C /* libminimuxer.a in Frameworks */,
 				191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */,
 				19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */,
 				19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */,
 				B3146ED2284F581E00BBC3FD /* Roxas.framework in Frameworks */,
 				D533E8B72727841800A9B5DD /* libAppleArchive.tbd in Frameworks */,
 				B3C395F9284F362400DA9E2F /* AppCenterCrashes in Frameworks */,
+				9922FFEC29B501C50020F868 /* Starscream in Frameworks */,
 				D533E8BE2727BBF800A9B5DD /* libcurl.a in Frameworks */,
 				4879A9622861049C00FC1BBD /* OpenSSL in Frameworks */,
 				B3C395F4284F35DD00DA9E2F /* Nuke in Frameworks */,
@@ -945,8 +948,9 @@
 		191E5FAC290A5D92001A3B7C /* minimuxer */ = {
 			isa = PBXGroup;
 			children = (
+				9961EC2D29BE9F2E00AF2C6F /* minimuxer-helpers.swift */,
+				99F87D1429D8E3F100B40039 /* Generated */,
 				B343F847295F6321002B1159 /* minimuxer.xcodeproj */,
-				191E5FAD290A5D92001A3B7C /* minimuxer.swift */,
 			);
 			path = minimuxer;
 			sourceTree = "<group>";
@@ -968,6 +972,15 @@
 			path = "libimobiledevice-glue/src";
 			sourceTree = "<group>";
 		};
+		99F87D1429D8E3F100B40039 /* Generated */ = {
+			isa = PBXGroup;
+			children = (
+				99F87D1629D8E4C900B40039 /* SwiftBridgeCore.swift */,
+				99F87D1729D8E4C900B40039 /* minimuxer.swift */,
+			);
+			name = Generated;
+			sourceTree = "<group>";
+		};
 		B3146EC7284F580500BBC3FD /* Products */ = {
 			isa = PBXGroup;
 			children = (
@@ -1180,37 +1193,41 @@
 		BF4588562298DC6D00BD7491 /* libplist */ = {
 			isa = PBXGroup;
 			children = (
-				BFD52BE622A1A9CA000B7ED1 /* base64.c */,
+				0EA166462ADFE0D1003015C1 /* Dictionary.cpp */,
-				BFD52BEA22A1A9CA000B7ED1 /* bplist.c */,
+				0E1A1F902AE36A9600364CAD /* bytearray.c */,
-				BFD52BF522A1A9CA000B7ED1 /* bytearray.c */,
+				0EA166442ADFE0D1003015C1 /* bplist.c */,
-				BFD52BE722A1A9CA000B7ED1 /* hashtable.c */,
+				0EA166432ADFE0D1003015C1 /* Data.cpp */,
-				191E5FCF290A651D001A3B7C /* jplist.c */,
+				0EA166422ADFE0D1003015C1 /* Date.cpp */,
-				191E5FD0290A651D001A3B7C /* jsmn.c */,
+				0EA1664F2ADFE0D1003015C1 /* hashtable.c */,
-				BFD52BEE22A1A9CA000B7ED1 /* plist.c */,
+				0EA166532ADFE0D2003015C1 /* Integer.cpp */,
-				BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */,
+				0EA166562ADFE0D2003015C1 /* oplist.c */,
-				BFD52BEC22A1A9CA000B7ED1 /* time64.c */,
+				0EA166522ADFE0D2003015C1 /* out-default.c */,
-				BFD52C0022A1A9CB000B7ED1 /* xplist.c */,
+				0EA166472ADFE0D1003015C1 /* out-limd.c */,
-				BFD52BF822A1A9CB000B7ED1 /* Array.cpp */,
+				0EA166552ADFE0D2003015C1 /* out-plutil.c */,
-				BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */,
+				0EA166492ADFE0D1003015C1 /* String.cpp */,
-				BFD52BF722A1A9CA000B7ED1 /* Data.cpp */,
+				0EA1665A2ADFE0D2003015C1 /* Structure.cpp */,
-				BFD52BF022A1A9CA000B7ED1 /* Date.cpp */,
+				0EA166452ADFE0D1003015C1 /* Array.cpp */,
-				BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */,
+				0EA1664A2ADFE0D1003015C1 /* base64.c */,
-				BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */,
+				0EA166572ADFE0D2003015C1 /* jsmn.c */,
-				BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */,
+				0EA1664E2ADFE0D1003015C1 /* Boolean.cpp */,
-				BFD52BF922A1A9CB000B7ED1 /* Node.cpp */,
+				0EA4B9BB2AE4A3F6009209CE /* plist.c */,
-				BFD52BF322A1A9CA000B7ED1 /* Real.cpp */,
+				0EA166412ADFE0D1003015C1 /* jplist.c */,
-				BFD52BEB22A1A9CA000B7ED1 /* String.cpp */,
+				0EA166582ADFE0D2003015C1 /* Key.cpp */,
-				BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */,
+				0EA166512ADFE0D2003015C1 /* ptrarray.c */,
-				BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */,
+				0EA1664C2ADFE0D1003015C1 /* time64.c */,
-				BFD52BF622A1A9CA000B7ED1 /* base64.h */,
+				0EA166502ADFE0D2003015C1 /* Node.cpp */,
-				BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */,
+				0EA166542ADFE0D2003015C1 /* Real.cpp */,
-				BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */,
+				0EA1664B2ADFE0D1003015C1 /* Uid.cpp */,
-				191E5FD1290A651D001A3B7C /* jsmn.h */,
+				0EA166592ADFE0D2003015C1 /* xplist.c */,
-				BFD52BED22A1A9CA000B7ED1 /* plist.h */,
+				0EA166662ADFE122003015C1 /* base64.h */,
-				BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */,
+				0EA166652ADFE122003015C1 /* hashtable.h */,
-				BFD52BF422A1A9CA000B7ED1 /* strbuf.h */,
+				0EA166632ADFE122003015C1 /* jsmn.h */,
-				BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */,
+				0EA166642ADFE122003015C1 /* plist.h */,
-				BFD52BFF22A1A9CB000B7ED1 /* time64.h */,
+				0EA166612ADFE122003015C1 /* bytearray.h */,
+				0EA166622ADFE122003015C1 /* ptrarray.h */,
+				0EA166672ADFE122003015C1 /* strbuf.h */,
+				0EA1665F2ADFE122003015C1 /* time64_limits.h */,
+				0EA166602ADFE122003015C1 /* time64.h */,
 				BF4588892298DDEA00BD7491 /* libcnary */,
 			);
 			path = libplist;
@@ -1567,7 +1584,6 @@
 			isa = PBXGroup;
 			children = (
 				B343F86C295F759E002B1159 /* libresolv.tbd */,
-				191E5FB5290A5E1F001A3B7C /* libminimuxer.a */,
 				B39575F4284F29E20080B4FF /* Roxas.framework */,
 				D533E8B62727841800A9B5DD /* libAppleArchive.tbd */,
 				BF580497246A3D19008AE704 /* UIKit.framework */,
@@ -1608,8 +1624,7 @@
 		BFD247962284D7C100981D42 /* Resources */ = {
 			isa = PBXGroup;
 			children = (
-				BF44EEF2246B3A17002A52F2 /* AltBackup.ipa */,
+				0E764E162ADFF5740043DD4E /* AltBackup.ipa */,
-				BFB1169C22932DB100BB457C /* apps.json */,
 				BFD247762284B9A700981D42 /* Assets.xcassets */,
 				BF770E6822BD57DD002A40FE /* Silence.m4a */,
 			);
@@ -1684,6 +1699,7 @@
 				D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */,
 				D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */,
 				D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */,
+				D5ACE84428E3B8450021CAB9 /* ClearAppCacheOperation.swift */,
 				BF7B44062725A4B8005288A4 /* Patch App */,
 			);
 			path = Operations;
@@ -1766,43 +1782,30 @@
 /* End PBXGroup section */
 
 /* Begin PBXHeadersBuildPhase section */
-		191E5FD4290A6EE0001A3B7C /* Headers */ = {
-			isa = PBXHeadersBuildPhase;
-			buildActionMask = 2147483647;
-			files = (
-			);
-			runOnlyForDeploymentPostprocessing = 0;
-		};
 		BF4587272298D31600BD7491 /* Headers */ = {
 			isa = PBXHeadersBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				0EA166682ADFE122003015C1 /* jsmn.h in Headers */,
 				BF4588112298D3AB00BD7491 /* misagent.h in Headers */,
 				BF4588042298D3AB00BD7491 /* lockdown.h in Headers */,
 				BF45880B2298D3AB00BD7491 /* mobilesync.h in Headers */,
 				BF4588002298D3AB00BD7491 /* restore.h in Headers */,
 				BF4588152298D3AB00BD7491 /* mobilebackup.h in Headers */,
 				BF4588182298D3AB00BD7491 /* syslog_relay.h in Headers */,
-				BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */,
 				BF45881D2298D3AB00BD7491 /* file_relay.h in Headers */,
-				BFD52C0922A1A9CB000B7ED1 /* plist.h in Headers */,
 				BF4587FD2298D3AB00BD7491 /* sbservices.h in Headers */,
 				BF4588362298D3C100BD7491 /* debug.h in Headers */,
 				BF4588202298D3AB00BD7491 /* mobile_image_mounter.h in Headers */,
 				BF4588122298D3AB00BD7491 /* house_arrest.h in Headers */,
 				BF45881F2298D3AB00BD7491 /* device_link_service.h in Headers */,
-				BFD52C1A22A1A9CB000B7ED1 /* time64_limits.h in Headers */,
 				BF45880E2298D3AB00BD7491 /* debugserver.h in Headers */,
 				BF4588102298D3AB00BD7491 /* heartbeat.h in Headers */,
 				BF4587FA2298D3AB00BD7491 /* diagnostics_relay.h in Headers */,
-				BFD52C1622A1A9CB000B7ED1 /* bytearray.h in Headers */,
-				BFD52C1222A1A9CB000B7ED1 /* base64.h in Headers */,
 				BF4588192298D3AB00BD7491 /* webinspector.h in Headers */,
 				BF4588342298D3C100BD7491 /* userpref.h in Headers */,
 				BF45880A2298D3AB00BD7491 /* screenshotr.h in Headers */,
-				BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */,
 				BF4587FE2298D3AB00BD7491 /* mobilebackup2.h in Headers */,
-				BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */,
 				BF45881C2298D3AB00BD7491 /* afc.h in Headers */,
 				BF45881A2298D3AB00BD7491 /* mobileactivation.h in Headers */,
 				BF4588052298D3AB00BD7491 /* idevice.h in Headers */,
@@ -1810,7 +1813,6 @@
 				BF4587F82298D3AB00BD7491 /* service.h in Headers */,
 				BF4588252298D3AB00BD7491 /* property_list_service.h in Headers */,
 				BF4588132298D3AB00BD7491 /* notification_proxy.h in Headers */,
-				BFD52C1B22A1A9CB000B7ED1 /* time64.h in Headers */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -1853,7 +1855,6 @@
 			isa = PBXNativeTarget;
 			buildConfigurationList = 191E5FAF290A5D92001A3B7C /* Build configuration list for PBXNativeTarget "minimuxer" */;
 			buildPhases = (
-				191E5FD4290A6EE0001A3B7C /* Headers */,
 				191E5FA7290A5D92001A3B7C /* Sources */,
 				191E5FA8290A5D92001A3B7C /* Frameworks */,
 			);
@@ -1969,6 +1970,7 @@
 			isa = PBXNativeTarget;
 			buildConfigurationList = BFD2477E2284B9A700981D42 /* Build configuration list for PBXNativeTarget "SideStore" */;
 			buildPhases = (
+				99F87D0629D8B51400B40039 /* ShellScript */,
 				BFD247662284B9A500981D42 /* Sources */,
 				BFD247672284B9A500981D42 /* Frameworks */,
 				BFD247682284B9A500981D42 /* Resources */,
@@ -1990,6 +1992,7 @@
 				B3C395F6284F362400DA9E2F /* AppCenterAnalytics */,
 				B3C395F8284F362400DA9E2F /* AppCenterCrashes */,
 				4879A9612861049C00FC1BBD /* OpenSSL */,
+				9922FFEB29B501C50020F868 /* Starscream */,
 			);
 			productName = AltStore;
 			productReference = BFD2476A2284B9A500981D42 /* SideStore.app */;
@@ -2061,6 +2064,7 @@
 				4879A95D2861046500FC1BBD /* XCRemoteSwiftPackageReference "AltSign" */,
 				4879A9602861049C00FC1BBD /* XCRemoteSwiftPackageReference "OpenSSL" */,
 				99C4EF472978D52400CB538D /* XCRemoteSwiftPackageReference "SemanticVersion" */,
+				9922FFEA29B501C50020F868 /* XCRemoteSwiftPackageReference "Starscream" */,
 			);
 			productRefGroup = BFD2476B2284B9A500981D42 /* Products */;
 			projectDirPath = "";
@@ -2204,7 +2208,6 @@
 				BFE60738231ADF49002B0E8E /* Settings.storyboard in Resources */,
 				D57DF638271E32F000677701 /* PatchApp.storyboard in Resources */,
 				BFD2477A2284B9A700981D42 /* LaunchScreen.storyboard in Resources */,
-				BF44EEF3246B3A17002A52F2 /* AltBackup.ipa in Resources */,
 				BF770E6922BD57DD002A40FE /* Silence.m4a in Resources */,
 				BFD247772284B9A700981D42 /* Assets.xcassets in Resources */,
 				1920B04F2924AC8300744F60 /* Settings.bundle in Resources */,
@@ -2212,6 +2215,7 @@
 				BFB6B22423187A3D0022A802 /* NewsCollectionViewCell.xib in Resources */,
 				BFD247752284B9A500981D42 /* Main.storyboard in Resources */,
 				BFDB5B2622EFBBEA00F74113 /* BrowseCollectionViewCell.xib in Resources */,
+				0E764E172ADFF5740043DD4E /* AltBackup.ipa in Resources */,
 				BFE6073C231AE1E7002B0E8E /* SettingsHeaderFooterView.xib in Resources */,
 				BF29012F2318F6B100D88A45 /* AppBannerView.xib in Resources */,
 				BFE6325A22A83BEB00F30809 /* Authentication.storyboard in Resources */,
@@ -2220,6 +2224,27 @@
 		};
 /* End PBXResourcesBuildPhase section */
 
+/* Begin PBXShellScriptBuildPhase section */
+		99F87D0629D8B51400B40039 /* ShellScript */ = {
+			isa = PBXShellScriptBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			inputFileListPaths = (
+			);
+			inputPaths = (
+			);
+			outputFileListPaths = (
+			);
+			outputPaths = (
+				"./Dependencies/minimuxer/minimuxer-helpers.swift",
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+			shellPath = /bin/sh;
+			shellScript = "bash ./Dependencies/fetch-prebuilt.sh minimuxer\n";
+		};
+/* End PBXShellScriptBuildPhase section */
+
 /* Begin PBXSourcesBuildPhase section */
 		19104DAE2909C06C00C49C7B /* Sources */ = {
 			isa = PBXSourcesBuildPhase;
@@ -2233,7 +2258,8 @@
 			isa = PBXSourcesBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
-				191E5FAE290A5D92001A3B7C /* minimuxer.swift in Sources */,
+				99F87D1929D8E4C900B40039 /* minimuxer.swift in Sources */,
+				99F87D1829D8E4C900B40039 /* SwiftBridgeCore.swift in Sources */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -2265,69 +2291,73 @@
 			isa = PBXSourcesBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				0E1A1F912AE36A9700364CAD /* bytearray.c in Sources */,
+				0EA1666E2ADFE140003015C1 /* ptrarray.c in Sources */,
+				0EA1665B2ADFE0D2003015C1 /* out-limd.c in Sources */,
+				0EA166742ADFE140003015C1 /* Date.cpp in Sources */,
+				0EA166712ADFE140003015C1 /* Key.cpp in Sources */,
+				0EA1665C2ADFE0D2003015C1 /* out-default.c in Sources */,
+				0EA1666A2ADFE140003015C1 /* String.cpp in Sources */,
+				0EA166732ADFE140003015C1 /* Dictionary.cpp in Sources */,
+				0EA1665D2ADFE0D2003015C1 /* out-plutil.c in Sources */,
+				0EA1665E2ADFE0D2003015C1 /* oplist.c in Sources */,
+				0EA166702ADFE140003015C1 /* Node.cpp in Sources */,
+				0EA166752ADFE140003015C1 /* Real.cpp in Sources */,
+				0EA166762ADFE140003015C1 /* base64.c in Sources */,
+				0EA1666D2ADFE140003015C1 /* Data.cpp in Sources */,
 				BF45881B2298D3AB00BD7491 /* house_arrest.c in Sources */,
-				BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */,
+				0EA1666F2ADFE140003015C1 /* hashtable.c in Sources */,
 				BF4588232298D3AB00BD7491 /* mobilesync.c in Sources */,
 				BF4588072298D3AB00BD7491 /* afc.c in Sources */,
-				191E607D290B2EA5001A3B7C /* jsmn.c in Sources */,
-				191E607E290B2EA7001A3B7C /* jplist.c in Sources */,
 				BF4588082298D3AB00BD7491 /* mobile_image_mounter.c in Sources */,
-				BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */,
 				BF4588022298D3AB00BD7491 /* file_relay.c in Sources */,
 				BF45880F2298D3AB00BD7491 /* debugserver.c in Sources */,
+				0EA166792ADFE140003015C1 /* bplist.c in Sources */,
+				0EA166772ADFE140003015C1 /* jplist.c in Sources */,
 				BF4588162298D3AB00BD7491 /* restore.c in Sources */,
-				BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */,
-				BFD52C0222A1A9CB000B7ED1 /* base64.c in Sources */,
 				BFD52C2022A1A9EC000B7ED1 /* node.c in Sources */,
 				BF4588092298D3AB00BD7491 /* installation_proxy.c in Sources */,
+				0EA1666B2ADFE140003015C1 /* Boolean.cpp in Sources */,
+				0EA1667E2ADFE140003015C1 /* time64.c in Sources */,
 				BF4587FF2298D3AB00BD7491 /* heartbeat.c in Sources */,
 				BF4588222298D3AB00BD7491 /* mobileactivation.c in Sources */,
-				BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */,
 				BF4588212298D3AB00BD7491 /* idevice.c in Sources */,
 				B343F885295F7C5D002B1159 /* tlv.c in Sources */,
-				BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */,
 				BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */,
 				B343F87D295F7C5D002B1159 /* cbuf.c in Sources */,
 				BF4588062298D3AB00BD7491 /* webinspector.c in Sources */,
-				BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */,
 				B343F883295F7C5D002B1159 /* thread.c in Sources */,
 				BF45880D2298D3AB00BD7491 /* mobilebackup.c in Sources */,
-				BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */,
-				BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */,
-				BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */,
 				BF45883A2298D3C100BD7491 /* debug.c in Sources */,
 				B343F881295F7C5D002B1159 /* termcolors.c in Sources */,
+				0EA1667D2ADFE140003015C1 /* xplist.c in Sources */,
 				B343F87E295F7C5D002B1159 /* collection.c in Sources */,
-				BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */,
 				B33FFBAA295F8F78002259E6 /* preboard.c in Sources */,
 				B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */,
 				BF4587FB2298D3AB00BD7491 /* notification_proxy.c in Sources */,
 				BF4588352298D3C100BD7491 /* userpref.c in Sources */,
-				BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */,
+				0EA1667A2ADFE140003015C1 /* Uid.cpp in Sources */,
 				B343F87C295F7C5D002B1159 /* opack.c in Sources */,
-				BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */,
-				BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */,
 				B343F884295F7C5D002B1159 /* utils.c in Sources */,
 				BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */,
 				B343F87F295F7C5D002B1159 /* glue.c in Sources */,
-				BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */,
 				BF4588242298D3AB00BD7491 /* property_list_service.c in Sources */,
 				BF45881E2298D3AB00BD7491 /* misagent.c in Sources */,
+				0EA166692ADFE140003015C1 /* Array.cpp in Sources */,
 				B343F880295F7C5D002B1159 /* socket.c in Sources */,
 				BF4587FC2298D3AB00BD7491 /* sbservices.c in Sources */,
-				BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */,
+				0EA166782ADFE140003015C1 /* jsmn.c in Sources */,
 				BF4588142298D3AB00BD7491 /* device_link_service.c in Sources */,
 				BF4588172298D3AB00BD7491 /* screenshotr.c in Sources */,
-				BFD52C0D22A1A9CB000B7ED1 /* Uid.cpp in Sources */,
-				BFD52C0322A1A9CB000B7ED1 /* hashtable.c in Sources */,
 				BF4588432298D40000BD7491 /* libusbmuxd.c in Sources */,
+				0EA1667B2ADFE140003015C1 /* Structure.cpp in Sources */,
+				0EA1666C2ADFE140003015C1 /* Integer.cpp in Sources */,
 				BF4588032298D3AB00BD7491 /* syslog_relay.c in Sources */,
 				BF4588272298D3AB00BD7491 /* service.c in Sources */,
-				BFD52C0722A1A9CB000B7ED1 /* String.cpp in Sources */,
 				BF4588262298D3AB00BD7491 /* lockdown.c in Sources */,
 				BFD52C2222A1A9EC000B7ED1 /* cnary.c in Sources */,
 				BF45880C2298D3AB00BD7491 /* mobilebackup2.c in Sources */,
-				BFD52C1922A1A9CB000B7ED1 /* Structure.cpp in Sources */,
+				0EA4B9BC2AE4A414009209CE /* plist.c in Sources */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -2477,6 +2507,7 @@
 				BFD6B03322DFF20800B86064 /* MyAppsComponents.swift in Sources */,
 				BF41B808233433C100C593A3 /* LoadingState.swift in Sources */,
 				BFF0B69A2322D7D0007A79E1 /* UIScreen+CompactHeight.swift in Sources */,
+				D5ACE84528E3B8450021CAB9 /* ClearAppCacheOperation.swift in Sources */,
 				D5F2F6A92720B7C20081CCF5 /* PatchViewController.swift in Sources */,
 				B39F16132918D7C5002E9404 /* Consts.swift in Sources */,
 				BF8F69C222E659F700049BA1 /* AppContentViewController.swift in Sources */,
@@ -2484,6 +2515,7 @@
 				BFB39B5C252BC10E00D1BE50 /* Managed.swift in Sources */,
 				BF770E5822BC3D0F002A40FE /* RefreshGroup.swift in Sources */,
 				19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */,
+				99F87D0529D8B4E200B40039 /* minimuxer-helpers.swift in Sources */,
 				BF18B0F122E25DF9005C4CF5 /* ToastView.swift in Sources */,
 				BF3D649F22E7B24C00E9056B /* CollapsingTextView.swift in Sources */,
 				BF02419622F2199300129732 /* RefreshAttemptsViewController.swift in Sources */,
@@ -2673,7 +2705,7 @@
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SKIP_INSTALL = YES;
 				SWIFT_ACTIVE_COMPILATION_CONDITIONS = DEBUG;
-				SWIFT_OBJC_BRIDGING_HEADER = Dependencies/minimuxer/minimuxer.h;
+				SWIFT_OBJC_BRIDGING_HEADER = "Dependencies/minimuxer/minimuxer-Bridging-Header.h";
 				SWIFT_VERSION = 5.0;
 				TARGETED_DEVICE_FAMILY = "1,2";
 			};
@@ -2695,7 +2727,7 @@
 				OTHER_LDFLAGS = "-ObjC";
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SKIP_INSTALL = YES;
-				SWIFT_OBJC_BRIDGING_HEADER = Dependencies/minimuxer/minimuxer.h;
+				SWIFT_OBJC_BRIDGING_HEADER = "Dependencies/minimuxer/minimuxer-Bridging-Header.h";
 				SWIFT_VERSION = 5.0;
 				TARGETED_DEVICE_FAMILY = "1,2";
 			};
@@ -3193,9 +3225,10 @@
 				);
 				LIBRARY_SEARCH_PATHS = (
 					"$(inherited)",
-					"$(PROJECT_DIR)/Dependencies/fragmentzip",
+					"$(PROJECT_DIR)/Dependencies/libfragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
 				);
+				OTHER_LDFLAGS = "";
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
@@ -3227,9 +3260,10 @@
 				);
 				LIBRARY_SEARCH_PATHS = (
 					"$(inherited)",
-					"$(PROJECT_DIR)/Dependencies/fragmentzip",
+					"$(PROJECT_DIR)/Dependencies/libfragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
 				);
+				OTHER_LDFLAGS = "";
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
@@ -3343,6 +3377,14 @@
 				minimumVersion = 1.1.180;
 			};
 		};
+		9922FFEA29B501C50020F868 /* XCRemoteSwiftPackageReference "Starscream" */ = {
+			isa = XCRemoteSwiftPackageReference;
+			repositoryURL = "https://github.com/daltoniam/Starscream.git";
+			requirement = {
+				kind = upToNextMajorVersion;
+				minimumVersion = 4.0.0;
+			};
+		};
 		99C4EF472978D52400CB538D /* XCRemoteSwiftPackageReference "SemanticVersion" */ = {
 			isa = XCRemoteSwiftPackageReference;
 			repositoryURL = "https://github.com/SwiftPackageIndex/SemanticVersion.git";
@@ -3422,6 +3464,11 @@
 			package = 4879A9602861049C00FC1BBD /* XCRemoteSwiftPackageReference "OpenSSL" */;
 			productName = OpenSSL;
 		};
+		9922FFEB29B501C50020F868 /* Starscream */ = {
+			isa = XCSwiftPackageProductDependency;
+			package = 9922FFEA29B501C50020F868 /* XCRemoteSwiftPackageReference "Starscream" */;
+			productName = Starscream;
+		};
 		99C4EF4C2979132100CB538D /* SemanticVersion */ = {
 			isa = XCSwiftPackageProductDependency;
 			package = 99C4EF472978D52400CB538D /* XCRemoteSwiftPackageReference "SemanticVersion" */;

AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved

@@ -6,7 +6,7 @@
       "location" : "https://github.com/SideStore/AltSign",
       "state" : {
         "branch" : "master",
-        "revision" : "7e0e7edcf8fbc44ac1e35da3e9030a297aa18b84"
+        "revision" : "cc6189f0f7cd8e5bd24943af9322e0ff9420e9f4"
       }
     },
     {
@@ -14,8 +14,17 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/microsoft/appcenter-sdk-apple.git",
       "state" : {
-        "revision" : "8354a50fe01a7e54e196d3b5493b5ab53dd5866a",
+        "revision" : "b2dc99cfedead0bad4e6573d86c5228c89cff332",
-        "version" : "4.4.2"
+        "version" : "4.4.3"
+      }
+    },
+    {
+      "identity" : "imobiledevice.swift",
+      "kind" : "remoteSourceControl",
+      "location" : "https://github.com/SideStore/iMobileDevice.swift",
+      "state" : {
+        "revision" : "74e481106dd155c0cd21bca6795fd9fe5f751654",
+        "version" : "1.0.5"
       }
     },
     {
@@ -50,8 +59,8 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/krzyzanowskim/OpenSSL",
       "state" : {
-        "revision" : "033fcb41dac96b1b6effa945ca1f9ade002370b2",
+        "revision" : "0faf71a188bcfdf0245cab42886b9b240ca71c52",
-        "version" : "1.1.1501"
+        "version" : "1.1.2200"
       }
     },
     {
@@ -59,8 +68,8 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/microsoft/PLCrashReporter.git",
       "state" : {
-        "revision" : "6b27393cad517c067dceea85fadf050e70c4ceaa",
+        "revision" : "81cdec2b3827feb03286cb297f4c501a8eb98df1",
-        "version" : "1.10.1"
+        "version" : "1.10.2"
       }
     },
     {
@@ -68,8 +77,8 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/SwiftPackageIndex/SemanticVersion.git",
       "state" : {
-        "revision" : "fc670910dc0903cc269b3d0b776cda5703979c4e",
+        "revision" : "a70840d5fca686ae3bd2fcf8aecc5ded0bd4f125",
-        "version" : "0.3.5"
+        "version" : "0.3.6"
       }
     },
     {
@@ -77,8 +86,17 @@
       "kind" : "remoteSourceControl",
       "location" : "https://github.com/sparkle-project/Sparkle.git",
       "state" : {
-        "revision" : "286edd1fa22505a9e54d170e9fd07d775ea233f2",
+        "revision" : "f0ceaf5cc9f3f23daa0ccb6dcebd79fc96ccc7d9",
-        "version" : "2.1.0"
+        "version" : "2.5.0"
+      }
+    },
+    {
+      "identity" : "starscream",
+      "kind" : "remoteSourceControl",
+      "location" : "https://github.com/daltoniam/Starscream.git",
+      "state" : {
+        "revision" : "ac6c0fc9da221873e01bd1a0d4818498a71eef33",
+        "version" : "4.0.6"
       }
     },
     {

AltStore/App Detail/AppViewController.swift

@@ -217,8 +217,8 @@ final class AppViewController: UIViewController
                         
             self._shouldResetLayout = false
         }
-        
+                
-        let statusBarHeight = UIApplication.shared.statusBarFrame.height
+        let statusBarHeight = self.view.window?.windowScene?.statusBarManager?.statusBarFrame.height ?? 0
         let cornerRadius = self.contentViewControllerShadowView.layer.cornerRadius
         
         let inset = 12 as CGFloat
@@ -323,7 +323,7 @@ final class AppViewController: UIViewController
         
         self.backButtonContainerView.layer.cornerRadius = self.backButtonContainerView.bounds.midY
         
-        self.scrollView.scrollIndicatorInsets.top = statusBarHeight
+        self.scrollView.verticalScrollIndicatorInsets.top = statusBarHeight
         
         // Adjust content offset + size.
         let contentOffset = self.scrollView.contentOffset

AltStore/App IDs/AppIDsViewController.swift

@@ -91,13 +91,18 @@ private extension AppIDsViewController
                 
                 cell.bannerView.buttonLabel.isHidden = false
                 
-                let currentDate = Date()
+                let formatter = DateComponentsFormatter()
+                formatter.unitsStyle = .full
+                formatter.includesApproximationPhrase = false
+                formatter.includesTimeRemainingPhrase = false
+                formatter.allowedUnits = [.minute, .hour, .day]
+                formatter.maximumUnitCount = 1
                 
-                let numberOfDays = expirationDate.numberOfCalendarDays(since: currentDate)
+                cell.bannerView.button.setTitle(formatter.string(from: Date(), to: expirationDate)?.uppercased(), for: .normal)
-                let numberOfDaysText = (numberOfDays == 1) ? NSLocalizedString("1 day", comment: "") : String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
-                cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
                 
-                attributedAccessibilityLabel.mutableString.append(String(format: NSLocalizedString("Expires in %@.", comment: ""), numberOfDaysText) + " ")
+                formatter.includesTimeRemainingPhrase = true
+                
+                attributedAccessibilityLabel.mutableString.append((formatter.string(from: Date(), to: expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " ")
             }
             else
             {
@@ -206,7 +211,7 @@ extension AppIDsViewController: UICollectionViewDelegateFlowLayout
                 **App IDs can't be deleted**, but they do expire after one week. SideStore will automatically renew App IDs for all active apps once they've expired.
                 """, comment: "")
                 
-                let attributedText = NSAttributedString(markdownRepresentation: text, attributes: [.font: headerView.textLabel.font as Any])
+                let attributedText = NSAttributedString(markdownRepresentation: text)
                 headerView.textLabel.attributedText = attributedText
             }
             else

AltStore/Browse/BrowseViewController.swift

@@ -8,6 +8,7 @@
 
 import UIKit
 
+import minimuxer
 import AltStoreCore
 import Roxas
 
@@ -264,7 +265,13 @@ private extension BrowseViewController
             previousProgress?.cancel()
             return
         }
-        
+
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         _ = AppManager.shared.install(app, presentingViewController: self) { (result) in
             DispatchQueue.main.async {
                 switch result

AltStore/Components/CollapsingTextView.swift

@@ -22,7 +22,7 @@ final class CollapsingTextView: UITextView
         }
     }
     
-    var lineSpacing: CGFloat = 2 {
+    var lineSpacing: Double = 2 {
         didSet {
             self.setNeedsLayout()
         }
@@ -34,7 +34,19 @@ final class CollapsingTextView: UITextView
     {
         super.awakeFromNib()
         
-        self.layoutManager.delegate = self
+        self.initialize()
+    }
+    
+    private func initialize()
+    {
+        if #available(iOS 16, *)
+        {
+            self.updateText()
+        }
+        else
+        {
+            self.layoutManager.delegate = self
+        }
         
         self.textContainerInset = .zero
         self.textContainer.lineFragmentPadding = 0
@@ -108,6 +120,25 @@ private extension CollapsingTextView
     {
         self.isCollapsed.toggle()
     }
+    
+    @available(iOS 16, *)
+    func updateText()
+    {
+        do
+        {
+            let style = NSMutableParagraphStyle()
+            style.lineSpacing = self.lineSpacing
+            
+            var attributedText = try AttributedString(self.attributedText, including: \.uiKit)
+            attributedText[AttributeScopes.UIKitAttributes.ParagraphStyleAttribute.self] = style
+            
+            self.attributedText = NSAttributedString(attributedText)
+        }
+        catch
+        {
+            print("[ALTLog] Failed to update CollapsingTextView line spacing:", error)
+        }
+    }
 }
 
 extension CollapsingTextView: NSLayoutManagerDelegate

AltStore/Components/PillButton.swift

@@ -8,6 +8,12 @@
 
 import UIKit
 
+extension PillButton
+{
+    static let minimumSize = CGSize(width: 77, height: 31)
+    static let contentInsets = NSDirectionalEdgeInsets(top: 7, leading: 13, bottom: 7, trailing: 13)
+}
+
 final class PillButton: UIButton
 {
     override var accessibilityValue: String? {
@@ -70,9 +76,7 @@ final class PillButton: UIButton
     }()
     
     override var intrinsicContentSize: CGSize {
-        var size = super.intrinsicContentSize
+        let size = self.sizeThatFits(CGSize(width: Double.infinity, height: .infinity))
-        size.width += 26
-        size.height += 3
         return size
     }
     
@@ -88,6 +92,8 @@ final class PillButton: UIButton
         self.layer.masksToBounds = true
         self.accessibilityTraits.formUnion([.updatesFrequently, .button])
         
+        self.contentEdgeInsets = UIEdgeInsets(top: Self.contentInsets.top, left: Self.contentInsets.leading, bottom: Self.contentInsets.bottom, right: Self.contentInsets.trailing)
+        
         self.activityIndicatorView.style = .medium
         self.activityIndicatorView.isUserInteractionEnabled = false
         
@@ -119,6 +125,15 @@ final class PillButton: UIButton
         
         self.update()
     }
+    
+    override func sizeThatFits(_ size: CGSize) -> CGSize
+    {
+        var size = super.sizeThatFits(size)
+        size.width = max(size.width, PillButton.minimumSize.width)
+        size.height = max(size.height, PillButton.minimumSize.height)
+        
+        return size
+    }
 }
 
 private extension PillButton

AltStore/Info.plist

@@ -14,7 +14,7 @@
 	<key>ALTPairingFile</key>
 	<string>&lt;insert pairing file here&gt;</string>
 	<key>ALTAnisetteURL</key>
-	<string>https://sideloadly.io/anisette/irGb3Quww8zrhgqnzmrx</string>
+	<string>https://ani.sidestore.io</string>
 	<key>CFBundleDevelopmentRegion</key>
 	<string>$(DEVELOPMENT_LANGUAGE)</string>
 	<key>CFBundleDocumentTypes</key>

AltStore/LaunchViewController.swift

@@ -14,6 +14,8 @@ import minimuxer
 import AltStoreCore
 import UniformTypeIdentifiers
 
+let pairingFileName = "ALTPairingFile.mobiledevicepairing"
+
 final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
 {
     private var didFinishLaunching = false
@@ -79,7 +81,7 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
         } else {
             // Show an alert explaining the pairing file
             // Create new Alert
-            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/install#pairing-process", preferredStyle: .alert)
+            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/getting-started/#pairing-file", preferredStyle: .alert)
             
             // Create OK button with action handler
             let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
@@ -125,14 +127,11 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
             }
             
             // Save to a file for next launch
-            let filename = "ALTPairingFile.mobiledevicepairing"
+            let pairingFile = FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)")
-            let fm = FileManager.default
+            try pairing_string?.write(to: pairingFile, atomically: true, encoding: String.Encoding.utf8)
-            let documentsPath = fm.documentsDirectory.appendingPathComponent("/\(filename)")
-            try pairing_string?.write(to: documentsPath, atomically: true, encoding: String.Encoding.utf8)
             
             // Start minimuxer now that we have a file
             start_minimuxer_threads(pairing_string!)
-            
         } catch {
             displayError("Unable to read pairing file")
         }
@@ -148,22 +147,20 @@ final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDeleg
     }
     
     func start_minimuxer_threads(_ pairing_file: String) {
-        set_usbmuxd_socket()
+        target_minimuxer_address()
-        #if false // Retries
+        let documentsDirectory = FileManager.default.documentsDirectory.absoluteString
-        var res = start_minimuxer(pairing_file: pairing_file)
+        do {
-        var attempts = 10
+            try start(pairing_file, documentsDirectory)
-        while (attempts != 0 && res != 0) {
+        } catch {
-            print("start_minimuxer `res` != 0, retry #\(attempts)")
+            try! FileManager.default.removeItem(at: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)"))
-            res = start_minimuxer(pairing_file: pairing_file)
+            displayError("minimuxer failed to start, please restart SideStore. \((error as? LocalizedError)?.failureReason ?? "UNKNOWN ERROR!!!!!! REPORT TO GITHUB ISSUES!")")
-            attempts -= 1
         }
-        #else
+        if #available(iOS 17, *) {
-        let res = start_minimuxer(pairing_file: pairing_file)
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
-        #endif
+        }
-        if res != 0 {
+        else {
-            displayError("minimuxer failed to start. Incorrect arguments were passed.")
+            start_auto_mounter(documentsDirectory)
         }
-        auto_mount_dev_image()
     }
 }
 

AltStore/Managing Apps/AppManager.swift

@@ -307,6 +307,16 @@ extension AppManager
             presentingViewController.present(alertController, animated: true, completion: nil)
         }
     }
+    
+    func clearAppCache(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let clearAppCacheOperation = ClearAppCacheOperation()
+        clearAppCacheOperation.resultHandler = { result in
+            completion(result)
+        }
+        
+        self.run([clearAppCacheOperation], context: nil)
+    }
 }
 
 extension AppManager
@@ -754,6 +764,12 @@ extension AppManager
         let progress = self.refreshProgress[app.bundleIdentifier]
         return progress
     }
+    
+    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
+    {
+        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
+        return isActivelyManaging
+    }
 }
 
 extension AppManager
@@ -808,12 +824,6 @@ private extension AppManager
         }
     }
     
-    func isActivelyManagingApp(withBundleID bundleID: String) -> Bool
-    {
-        let isActivelyManaging = self.installationProgress.keys.contains(bundleID) || self.refreshProgress.keys.contains(bundleID)
-        return isActivelyManaging
-    }
-    
     @discardableResult
     private func perform(_ operations: [AppOperation], presentingViewController: UIViewController?, group: RefreshGroup) -> RefreshGroup
     {
@@ -876,7 +886,9 @@ private extension AppManager
 
                     if app.certificateSerialNumber != group.context.certificate?.serialNumber ||
                         uti != nil ||
-                        app.needsResign
+                        app.needsResign ||
+                        // We need to reinstall ourselves on refresh to ensure the new provisioning profile is used
+                        app.bundleIdentifier == StoreApp.altstoreAppID
                     {
                         // Resign app instead of just refreshing profiles because either:
                         // * Refreshing using different certificate
@@ -1025,6 +1037,32 @@ private extension AppManager
         verifyOperation.addDependency(downloadOperation)
         
         
+        /* Refresh Anisette Data */
+        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
+        refreshAnisetteDataOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
+            }
+        }
+        refreshAnisetteDataOperation.addDependency(verifyOperation)
+
+
+        /* Fetch Provisioning Profiles */
+        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
+        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
+        fetchProvisioningProfilesOperation.resultHandler = { (result) in
+            switch result
+            {
+            case .failure(let error): context.error = error
+            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
+            }
+        }
+        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
+        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
+
+
         /* Deactivate Apps (if necessary) */
         let deactivateAppsOperation = RSTAsyncBlockOperation { [weak self] (operation) in
             do
@@ -1040,6 +1078,12 @@ private extension AppManager
                 {
                     throw error
                 }
+                
+                guard let profiles = context.provisioningProfiles else { throw OperationError.invalidParameters }
+                if !profiles.contains(where: { $1.isFreeProvisioningProfile == true }) {
+                    operation.finish()
+                    return
+                }
                                 
                 guard let app = context.app, let presentingViewController = context.authenticatedContext.presentingViewController else { throw OperationError.invalidParameters }
                 
@@ -1059,7 +1103,7 @@ private extension AppManager
                 operation.finish()
             }
         }
-        deactivateAppsOperation.addDependency(verifyOperation)
+        deactivateAppsOperation.addDependency(fetchProvisioningProfilesOperation)
         
         
         /* Patch App */
@@ -1134,32 +1178,6 @@ private extension AppManager
         patchAppOperation.addDependency(deactivateAppsOperation)
         
         
-        /* Refresh Anisette Data */
-        let refreshAnisetteDataOperation = FetchAnisetteDataOperation(context: group.context)
-        refreshAnisetteDataOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let anisetteData): group.context.session?.anisetteData = anisetteData
-            }
-        }
-        refreshAnisetteDataOperation.addDependency(patchAppOperation)
-        
-        
-        /* Fetch Provisioning Profiles */
-        let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
-        fetchProvisioningProfilesOperation.additionalEntitlements = additionalEntitlements
-        fetchProvisioningProfilesOperation.resultHandler = { (result) in
-            switch result
-            {
-            case .failure(let error): context.error = error
-            case .success(let provisioningProfiles): context.provisioningProfiles = provisioningProfiles
-            }
-        }
-        fetchProvisioningProfilesOperation.addDependency(refreshAnisetteDataOperation)
-        progress.addChild(fetchProvisioningProfilesOperation.progress, withPendingUnitCount: 5)
-        
-        
         /* Resign */
         let resignAppOperation = ResignAppOperation(context: context)
         resignAppOperation.resultHandler = { (result) in
@@ -1169,7 +1187,7 @@ private extension AppManager
             case .success(let resignedApp): context.resignedApp = resignedApp
             }
         }
-        resignAppOperation.addDependency(fetchProvisioningProfilesOperation)
+        resignAppOperation.addDependency(patchAppOperation)
         progress.addChild(resignAppOperation.progress, withPendingUnitCount: 20)
         
         
@@ -1212,7 +1230,7 @@ private extension AppManager
         progress.addChild(installOperation.progress, withPendingUnitCount: 30)
         installOperation.addDependency(sendAppOperation)
         
-        let operations = [downloadOperation, verifyOperation, deactivateAppsOperation, patchAppOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, resignAppOperation, sendAppOperation, installOperation]
+        let operations = [downloadOperation, verifyOperation, refreshAnisetteDataOperation, fetchProvisioningProfilesOperation, deactivateAppsOperation, patchAppOperation, resignAppOperation, sendAppOperation, installOperation]
         group.add(operations)
         self.run(operations, context: group.context)
         

AltStore/My Apps/MyAppsViewController.swift

@@ -10,10 +10,12 @@ import UIKit
 import MobileCoreServices
 import Intents
 import Combine
+import UniformTypeIdentifiers
 
 import AltStoreCore
 import AltSign
 import Roxas
+import minimuxer
 
 import Nuke
 
@@ -327,21 +329,25 @@ private extension MyAppsViewController
             let currentDate = Date()
             
             let numberOfDays = installedApp.expirationDate.numberOfCalendarDays(since: currentDate)
-            let numberOfDaysText: String
             
-            if numberOfDays == 1
+            let formatter = DateComponentsFormatter()
-            {
+            formatter.unitsStyle = .full
-                numberOfDaysText = NSLocalizedString("1 day", comment: "")
+            formatter.includesApproximationPhrase = false
-            }
+            formatter.includesTimeRemainingPhrase = false
-            else
+            
-            {
+            formatter.allowedUnits = [.day, .hour, .minute]
-                numberOfDaysText = String(format: NSLocalizedString("%@ days", comment: ""), NSNumber(value: numberOfDays))
+            
-            }
+            formatter.maximumUnitCount = 1
+            
+            
+            
+            cell.bannerView.button.setTitle(formatter.string(from: currentDate, to: installedApp.expirationDate)?.uppercased(), for: .normal)
             
-            cell.bannerView.button.setTitle(numberOfDaysText.uppercased(), for: .normal)
             cell.bannerView.button.accessibilityLabel = String(format: NSLocalizedString("Refresh %@", comment: ""), installedApp.name)
-            
+
-            cell.bannerView.accessibilityLabel? += ". " + String(format: NSLocalizedString("Expires in %@", comment: ""), numberOfDaysText)
+            formatter.includesTimeRemainingPhrase = true
+
+            cell.bannerView.accessibilityLabel? += ". " + (formatter.string(from: currentDate, to: installedApp.expirationDate) ?? NSLocalizedString("Unknown", comment: "")) + " "
             
             // Make sure refresh button is correct size.
             cell.layoutIfNeeded()
@@ -639,6 +645,12 @@ private extension MyAppsViewController
     
     @IBAction func refreshAllApps(_ sender: UIBarButtonItem)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         self.isRefreshingAllApps = true
         self.collectionView.collectionViewLayout.invalidateLayout()
 
@@ -701,18 +713,15 @@ private extension MyAppsViewController
     
     @IBAction func sideloadApp(_ sender: UIBarButtonItem)
     {
-        let supportedTypes: [String]
+        if !minimuxer.ready() {
-        
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
-        if let types = UTTypeCreateAllIdentifiersForTag(kUTTagClassFilenameExtension, "ipa" as CFString, nil)?.takeRetainedValue()
+            toastView.show(in: self)
-        {
+            return
-            supportedTypes = (types as NSArray).map { $0 as! String }
-        }
-        else
-        {
-            supportedTypes = ["com.apple.itunes.ipa"] // Declared by the system.
         }
+
+        let supportedTypes = UTType.types(tag: "ipa", tagClass: .filenameExtension, conformingTo: nil)
         
-        let documentPickerViewController = UIDocumentPickerViewController(documentTypes: supportedTypes, in: .import)
+        let documentPickerViewController = UIDocumentPickerViewController(forOpeningContentTypes: supportedTypes, asCopy: true)
         documentPickerViewController.delegate = self
         self.present(documentPickerViewController, animated: true, completion: nil)
     }
@@ -1014,6 +1023,12 @@ private extension MyAppsViewController
     
     func refresh(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         let previousProgress = AppManager.shared.refreshProgress(for: installedApp)
         guard previousProgress == nil else {
             previousProgress?.cancel()
@@ -1035,6 +1050,12 @@ private extension MyAppsViewController
     
     func activate(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
+
         func finish(_ result: Result<InstalledApp, Error>)
         {
             do
@@ -1111,6 +1132,11 @@ private extension MyAppsViewController
     func deactivate(_ installedApp: InstalledApp, completionHandler: ((Result<InstalledApp, Error>) -> Void)? = nil)
     {
         guard installedApp.isActive else { return }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         installedApp.isActive = false
         
         AppManager.shared.deactivate(installedApp, presentingViewController: self) { (result) in
@@ -1172,6 +1198,11 @@ private extension MyAppsViewController
     
     func backup(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         let title = NSLocalizedString("Start Backup?", comment: "")
         let message = NSLocalizedString("This will replace any previous backups. Please leave SideStore open until the backup is complete.", comment: "")
 
@@ -1211,6 +1242,11 @@ private extension MyAppsViewController
     
     func restore(_ installedApp: InstalledApp)
     {
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         let message = String(format: NSLocalizedString("This will replace all data you currently have in %@.", comment: ""), installedApp.name)
         let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to restore this backup?", comment: ""), message: message, preferredStyle: .actionSheet)
         alertController.addAction(.cancel)
@@ -1246,8 +1282,11 @@ private extension MyAppsViewController
     {
         guard let backupURL = FileManager.default.backupDirectoryURL(for: installedApp) else { return }
         
-        let documentPicker = UIDocumentPickerViewController(url: backupURL, in: .exportToService)
+        let documentPicker = UIDocumentPickerViewController(forExporting: [backupURL], asCopy: true)
-        documentPicker.delegate = self
+        
+        // Don't set delegate to avoid conflicting with import callbacks.
+        // documentPicker.delegate = self
+        
         self.present(documentPicker, animated: true, completion: nil)
     }
     
@@ -1311,6 +1350,16 @@ private extension MyAppsViewController
     @available(iOS 14, *)
     func enableJIT(for installedApp: InstalledApp)
     {
+        if #available(iOS 17, *) {
+            let toastView = ToastView(error: OperationError.tooNewError)
+            toastView.show(in: self)
+            return
+        }
+        if !minimuxer.ready() {
+            let toastView = ToastView(error: MinimuxerError.NoConnection)
+            toastView.show(in: self)
+            return
+        }
         AppManager.shared.enableJIT(for: installedApp) { result in
             DispatchQueue.main.async {
                 switch result
@@ -1318,7 +1367,7 @@ private extension MyAppsViewController
                 case .success: break
                 case .failure(let error):
                     let toastView = ToastView(error: error)
-                    toastView.show(in: self)
+                    toastView.show(in: self.navigationController?.view ?? self.view, duration: 5)
                 }
             }
         }
@@ -1465,7 +1514,7 @@ extension MyAppsViewController
                 let registeredAppIDs = team.appIDs.count
                 
                 let maximumAppIDCount = 10
-                let remainingAppIDs = max(maximumAppIDCount - registeredAppIDs, 0)
+                let remainingAppIDs = maximumAppIDCount - registeredAppIDs
                 
                 if remainingAppIDs == 1
                 {
@@ -1476,7 +1525,7 @@ extension MyAppsViewController
                     footerView.textLabel.text = String(format: NSLocalizedString("%@ App IDs Remaining", comment: ""), NSNumber(value: remainingAppIDs))
                 }
                 
-                footerView.textLabel.isHidden = false
+                footerView.textLabel.isHidden = remainingAppIDs < 0
                 
             case .individual, .organization, .unknown: footerView.textLabel.isHidden = true
             @unknown default: break
@@ -2050,15 +2099,8 @@ extension MyAppsViewController: UIDocumentPickerDelegate
     {
         guard let fileURL = urls.first else { return }
         
-        switch controller.documentPickerMode
+        self.sideloadApp(at: fileURL) { (result) in
-        {
+            print("Sideloaded app at \(fileURL) with result:", result)
-        case .import, .open:
-            self.sideloadApp(at: fileURL) { (result) in
-                print("Sideloaded app at \(fileURL) with result:", result)
-            }
-        
-        case .exportToService, .moveToService: break
-        @unknown default: break
         }
     }
 }

AltStore/News/NewsViewController.swift

@@ -426,6 +426,10 @@ extension NewsViewController: UICollectionViewDelegateFlowLayout
             return previousSize
         }
         
+        // Take layout margins into account.
+        self.prototypeCell.layoutMargins.left = self.view.layoutMargins.left
+        self.prototypeCell.layoutMargins.right = self.view.layoutMargins.right
+        
         let widthConstraint = self.prototypeCell.contentView.widthAnchor.constraint(equalToConstant: collectionView.bounds.width)
         NSLayoutConstraint.activate([widthConstraint])
         defer { NSLayoutConstraint.deactivate([widthConstraint]) }

AltStore/Operations/AuthenticationOperation.swift

@@ -12,6 +12,7 @@ import Network
 
 import AltStoreCore
 import AltSign
+import minimuxer
 
 enum AuthenticationError: LocalizedError
 {
@@ -593,7 +594,7 @@ private extension AuthenticationOperation
     
     func registerCurrentDevice(for team: ALTTeam, session: ALTAppleAPISession, completionHandler: @escaping (Result<ALTDevice, Error>) -> Void)
     {
-        guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else {
+        guard let udid = fetch_udid()?.toString() else {
             return completionHandler(.failure(OperationError.unknownUDID))
         }
         

AltStore/Operations/BackgroundRefreshAppsOperation.swift

@@ -11,6 +11,7 @@ import CoreData
 
 import AltStoreCore
 import EmotionalDamage
+import minimuxer
 
 enum RefreshError: LocalizedError
 {
@@ -97,7 +98,20 @@ final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<Inst
             return
         }
         start_em_proxy(bind_addr: Consts.Proxy.serverURL)
-        
+        target_minimuxer_address()
+        let documentsDirectory = FileManager.default.documentsDirectory.absoluteString
+        do {
+            try minimuxer.start(try String(contentsOf: FileManager.default.documentsDirectory.appendingPathComponent("\(pairingFileName)")), documentsDirectory)
+        } catch {
+            self.finish(.failure(error))
+        }
+        if #available(iOS 17, *) {
+            // TODO: iOS 17 and above have a new JIT implementation that is completely broken in SideStore :(
+        }
+        else {
+            start_auto_mounter(documentsDirectory)
+        }
+
         self.managedObjectContext.perform {
             print("Apps to refresh:", self.installedApps.map(\.bundleIdentifier))
             

AltStore/Operations/BackupAppOperation.swift

@@ -29,6 +29,9 @@ class BackupAppOperation: ResultOperation<Void>
     private var appName: String?
     private var timeoutTimer: Timer?
     
+    private weak var applicationWillReturnObserver: NSObjectProtocol?
+    private weak var backupResponseObserver: NSObjectProtocol?
+    
     init(action: Action, context: InstallAppOperationContext)
     {
         self.action = action
@@ -43,10 +46,7 @@ class BackupAppOperation: ResultOperation<Void>
         
         do
         {
-            if let error = self.context.error
+            if let error = self.context.error { throw error }
-            {
-                throw error
-            }
             
             guard let installedApp = self.context.installedApp, let context = installedApp.managedObjectContext else { throw OperationError.invalidParameters }
             context.perform {
@@ -55,9 +55,8 @@ class BackupAppOperation: ResultOperation<Void>
                     let appName = installedApp.name
                     self.appName = appName
                     
-                    guard let altstoreApp = InstalledApp.fetchAltStore(in: context) else { throw OperationError.appNotFound }
+                    let altstoreOpenURL = URL(string: "sidestore://")!
-                    let altstoreOpenURL = altstoreApp.openAppURL
+
-                    
                     var returnURLComponents = URLComponents(url: altstoreOpenURL, resolvingAgainstBaseURL: false)
                     returnURLComponents?.host = "appBackupResponse"
                     guard let returnURL = returnURLComponents?.url else { throw OperationError.openAppFailed(name: appName) }
@@ -153,8 +152,11 @@ private extension BackupAppOperation
 {
     func registerObservers()
     {
-        var applicationWillReturnObserver: NSObjectProtocol!
+        self.applicationWillReturnObserver = NotificationCenter.default.addObserver(forName: UIApplication.willEnterForegroundNotification, object: nil, queue: .main) { [weak self] (notification) in
-        applicationWillReturnObserver = NotificationCenter.default.addObserver(forName: UIApplication.willEnterForegroundNotification, object: nil, queue: .main) { [weak self] (notification) in
+            defer {
+                self?.applicationWillReturnObserver.map { NotificationCenter.default.removeObserver($0) }
+            }
+
             guard let self = self, !self.isFinished else { return }
             
             self.timeoutTimer = Timer.scheduledTimer(withTimeInterval: 5, repeats: false) { [weak self] (timer) in
@@ -166,18 +168,17 @@ private extension BackupAppOperation
                     self.finish(.failure(OperationError.timedOut))
                 }
             }
-            
-            NotificationCenter.default.removeObserver(applicationWillReturnObserver!)
         }
         
-        var backupResponseObserver: NSObjectProtocol!
+        self.backupResponseObserver = NotificationCenter.default.addObserver(forName: AppDelegate.appBackupDidFinish, object: nil, queue: nil) { [weak self] (notification) in
-        backupResponseObserver = NotificationCenter.default.addObserver(forName: AppDelegate.appBackupDidFinish, object: nil, queue: nil) { [weak self] (notification) in
+            defer {
+                self?.backupResponseObserver.map { NotificationCenter.default.removeObserver($0) }
+            }
+            
             self?.timeoutTimer?.invalidate()
             
             let result = notification.userInfo?[AppDelegate.appBackupResultKey] as? Result<Void, Error> ?? .failure(OperationError.unknownResult)
             self?.finish(result)
-            
-            NotificationCenter.default.removeObserver(backupResponseObserver!)
         }
     }
 }

AltStore/Operations/ClearAppCacheOperation.swift

@@ -0,0 +1,208 @@
+//
+//  ClearAppCacheOperation.swift
+//  AltStore
+//
+//  Created by Riley Testut on 9/27/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import Foundation
+import AltStoreCore
+/*
+struct BatchError: ALTLocalizedError
+{
+
+    enum Code: Int, ALTErrorCode
+    {
+        typealias Error = BatchError
+        
+        case batchError
+    }
+
+    var code: Code = .batchError
+    var underlyingErrors: [Error]
+    
+    var errorTitle: String?
+    var errorFailure: String?
+    
+    init(errors: [Error])
+    {
+        self.underlyingErrors = errors
+    }
+    
+    var errorFailureReason: String {
+        guard !self.underlyingErrors.isEmpty else { return NSLocalizedString("An unknown error occured.", comment: "") }
+        
+        let errorMessages = self.underlyingErrors.map { $0.localizedDescription }
+        
+        let message = errorMessages.joined(separator: "\n\n")
+        return message
+    }
+}
+*/
+@objc(ClearAppCacheOperation)
+class ClearAppCacheOperation: ResultOperation<Void>
+{
+    private let coordinator = NSFileCoordinator()
+    private let coordinatorQueue = OperationQueue()
+    
+    override init()
+    {
+        self.coordinatorQueue.name = "AltStore - ClearAppCacheOperation Queue"
+    }
+    
+    override func main()
+    {
+        super.main()
+        
+        var allErrors = [Error]()
+        
+        self.clearTemporaryDirectory { result in
+            switch result
+            {
+            //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+            case .failure(let error): allErrors.append(error)
+            case .success: break
+            }
+            
+            self.removeUninstalledAppBackupDirectories { result in
+                switch result
+                {
+                //case .failure(let batchError as BatchError): allErrors.append(contentsOf: batchError.underlyingErrors)
+                case .failure(let error): allErrors.append(error)
+                case .success: break
+                }
+                
+                if allErrors.isEmpty
+                {
+                    self.finish(.success(()))
+                }
+                else
+                {
+                    self.finish(.failure(OperationError.cacheClearError(errors: allErrors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+            }
+        }
+    }
+}
+
+private extension ClearAppCacheOperation
+{
+    func clearTemporaryDirectory(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        let intent = NSFileAccessIntent.writingIntent(with: FileManager.default.temporaryDirectory, options: [.forDeleting])
+        self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+            do
+            {
+                if let error
+                {
+                    throw error
+                }
+                
+                let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                           includingPropertiesForKeys: [],
+                                                                           options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                var errors = [Error]()
+                
+                for fileURL in fileURLs
+                {
+                    do
+                    {
+                        print("[ALTLog] Removing item from temporary directory:", fileURL.lastPathComponent)
+                        try FileManager.default.removeItem(at: fileURL)
+                    }
+                    catch
+                    {
+                        print("[ALTLog] Failed to remove \(fileURL.lastPathComponent) from temporary directory.", error)
+                        errors.append(error)
+                    }
+                }
+                
+                if !errors.isEmpty
+                {
+                    completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                        return error.localizedDescription
+                    }))))
+                }
+                else
+                {
+                    completion(.success(()))
+                }
+            }
+            catch
+            {
+                completion(.failure(error))
+            }
+        }
+    }
+    
+    func removeUninstalledAppBackupDirectories(completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        guard let backupsDirectory = FileManager.default.appBackupsDirectory else { return completion(.failure(OperationError.missingAppGroup)) }
+        
+        DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
+            let installedAppBundleIDs = Set(InstalledApp.all(in: context).map { $0.bundleIdentifier })
+            
+            let intent = NSFileAccessIntent.writingIntent(with: backupsDirectory, options: [.forDeleting])
+            self.coordinator.coordinate(with: [intent], queue: self.coordinatorQueue) { (error) in
+                do
+                {
+                    if let error
+                    {
+                        throw error
+                    }
+                    
+                    var isDirectory: ObjCBool = false
+                    guard FileManager.default.fileExists(atPath: intent.url.path, isDirectory: &isDirectory), isDirectory.boolValue else {
+                        completion(.success(()))
+                        return
+                    }
+                    
+                    let fileURLs = try FileManager.default.contentsOfDirectory(at: intent.url,
+                                                                               includingPropertiesForKeys: [.isDirectoryKey, .nameKey],
+                                                                               options: [.skipsSubdirectoryDescendants, .skipsHiddenFiles])
+                    var errors = [Error]()
+                    
+                    
+                    for backupDirectory in fileURLs
+                    {
+                        do
+                        {
+                            let resourceValues = try backupDirectory.resourceValues(forKeys: [.isDirectoryKey, .nameKey])
+                            guard let isDirectory = resourceValues.isDirectory, let bundleID = resourceValues.name else { continue }
+
+                            if isDirectory && !installedAppBundleIDs.contains(bundleID) && !AppManager.shared.isActivelyManagingApp(withBundleID: bundleID)
+                            {
+                                print("[ALTLog] Removing backup directory for uninstalled app:", bundleID)
+                                try FileManager.default.removeItem(at: backupDirectory)
+                            }
+                        }
+                        catch
+                        {
+                            print("[ALTLog] Failed to remove app backup directory:", error)
+                            errors.append(error)
+                        }
+                    }
+                    
+                    if !errors.isEmpty
+                    {
+                        completion(.failure(OperationError.cacheClearError(errors: errors.map({ error in
+                            return error.localizedDescription
+                        }))))
+                    }
+                    else
+                    {
+                        completion(.success(()))
+                    }
+                }
+                catch
+                {
+                    print("[ALTLog] Failed to remove app backup directory:", error)
+                    completion(.failure(error))
+                }
+            }
+        }
+    }
+}

AltStore/Operations/DeactivateAppOperation.swift

@@ -31,11 +31,7 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
     {
         super.main()
         
-        if let error = self.context.error
+        if let error = self.context.error { return self.finish(.failure(error)) }
-        {
-            self.finish(.failure(error))
-            return
-        }
         
         DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
             let installedApp = context.object(with: self.app.objectID) as! InstalledApp
@@ -44,20 +40,15 @@ final class DeactivateAppOperation: ResultOperation<InstalledApp>
             
             for profile in allIdentifiers {
                 do {
-                    let res = try remove_provisioning_profile(id: profile)
+                    try remove_provisioning_profile(profile)
-                    if case Uhoh.Bad(let code) = res {
+                    self.progress.completedUnitCount += 1
-                        self.finish(.failure(minimuxer_to_operation(code: code)))
+                    installedApp.isActive = false
-                    }
+                    self.finish(.success(installedApp))
-                } catch Uhoh.Bad(let code) {
+                    break
-                    self.finish(.failure(minimuxer_to_operation(code: code)))
                 } catch {
-                    self.finish(.failure(ALTServerError(.unknownResponse)))
+                    self.finish(.failure(error))
                 }
             }
-            
-            self.progress.completedUnitCount += 1
-            installedApp.isActive = false
-            self.finish(.success(installedApp))
         }
     }
 }

AltStore/Operations/EnableJITOperation.swift

@@ -45,23 +45,19 @@ final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
         guard let installedApp = self.context.installedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
         
         installedApp.managedObjectContext?.perform {
-            let v = minimuxer_to_operation(code: 1)
+            var retries = 3
-                        
+            while (retries > 0){
-            do {
+                do {
-                var x = try debug_app(app_id: installedApp.resignedBundleIdentifier)
+                    try debug_app(installedApp.resignedBundleIdentifier)
-                switch x {
-                case .Good:
                     self.finish(.success(()))
-                case .Bad(let code):
+                    retries = 0
-                    self.finish(.failure(minimuxer_to_operation(code: code)))
+                } catch {
+                    retries -= 1
+                    if (retries <= 0){
+                        self.finish(.failure(error))
+                    }
                 }
-            } catch Uhoh.Bad(let code) {
-                self.finish(.failure(minimuxer_to_operation(code: code)))
-            } catch {
-                self.finish(.failure(OperationError.unknown))
             }
-            
-            
         }
     }
 }

AltStore/Operations/FetchAnisetteDataOperation.swift

@@ -7,15 +7,28 @@
 //
 
 import Foundation
+import CommonCrypto
+import Starscream
 
 import AltStoreCore
 import AltSign
 import Roxas
 
 @objc(FetchAnisetteDataOperation)
-final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>
+final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>, WebSocketDelegate
 {
     let context: OperationContext
+    var socket: WebSocket!
+    
+    var url: URL?
+    var startProvisioningURL: URL?
+    var endProvisioningURL: URL?
+    
+    var clientInfo: String?
+    var userAgent: String?
+    
+    var mdLu: String?
+    var deviceId: String?
     
     init(context: OperationContext)
     {
@@ -32,32 +45,412 @@ final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>
             return
         }
         
-        let url = AnisetteManager.currentURL
+        self.url = AnisetteManager.currentURL
-        DLOG("Anisette URL: %@", url.absoluteString)
+        print("Anisette URL: \(self.url!.absoluteString)")
         
-        let task = URLSession.shared.dataTask(with: url) { data, response, error in
+        if let identifier = Keychain.shared.identifier,
-            guard let data = data, error == nil else { return }
+           let adiPb = Keychain.shared.adiPb {
-            
+            fetchAnisetteV3(identifier, adiPb)
-            do {
+        } else {
-                // make sure this JSON is in the format we expect
+            provision()
-                // convert data to json
+        }
-                if let json = try JSONSerialization.jsonObject(with: data, options: []) as? [String: String] {
+    }
-                    // try to read out a dictionary
+    
-                    //for some reason serial number isn't needed but it doesn't work unless it has a value
+    // MARK: - COMMON
-                    let formattedJSON: [String: String] = ["machineID": json["X-Apple-I-MD-M"]!, "oneTimePassword": json["X-Apple-I-MD"]!, "localUserID": json["X-Apple-I-MD-LU"]!, "routingInfo": json["X-Apple-I-MD-RINFO"]!, "deviceUniqueIdentifier": json["X-Mme-Device-Id"]!, "deviceDescription": json["X-MMe-Client-Info"]!, "date": json["X-Apple-I-Client-Time"]!, "locale": json["X-Apple-Locale"]!, "timeZone": json["X-Apple-I-TimeZone"]!, "deviceSerialNumber": "1"]
+    
-                    
+    func extractAnisetteData(_ data: Data, _ response: HTTPURLResponse?, v3: Bool) throws {
-                    if let anisette = ALTAnisetteData(json: formattedJSON) {
+        // make sure this JSON is in the format we expect
-                        DLOG("Anisette used: %@", formattedJSON)
+        // convert data to json
-                        self.finish(.success(anisette))
+        if let json = try JSONSerialization.jsonObject(with: data, options: []) as? [String: String] {
-                    }
+            if v3 {
+                if json["result"] == "GetHeadersError" {
+                    let message = json["message"]
+                    print("Error getting V3 headers: \(message ?? "no message")")
+                    if let message = message,
+                       message.contains("-45061") {
+                        print("Error message contains -45061 (not provisioned), resetting adi.pb and retrying")
+                        Keychain.shared.adiPb = nil
+                        return provision()
+                    } else { throw OperationError.anisetteV3Error(message: message ?? "Unknown error") }
                 }
+            }
+            
+            // try to read out a dictionary
+            // for some reason serial number isn't needed but it doesn't work unless it has a value
+            var formattedJSON: [String: String] = ["deviceSerialNumber": "0"]
+            if let machineID = json["X-Apple-I-MD-M"] { formattedJSON["machineID"] = machineID }
+            if let oneTimePassword = json["X-Apple-I-MD"] { formattedJSON["oneTimePassword"] = oneTimePassword }
+            if let routingInfo = json["X-Apple-I-MD-RINFO"] { formattedJSON["routingInfo"] = routingInfo }
+            
+            if v3 {
+                formattedJSON["deviceDescription"] = self.clientInfo!
+                formattedJSON["localUserID"] = self.mdLu!
+                formattedJSON["deviceUniqueIdentifier"] = self.deviceId!
+                
+                // Generate date stuff on client
+                let formatter = DateFormatter()
+                formatter.locale = Locale(identifier: "en_US_POSIX")
+                formatter.calendar = Calendar(identifier: .gregorian)
+                formatter.timeZone = TimeZone.current
+                formatter.dateFormat = "yyyy-MM-dd'T'HH:mm:ss'Z'"
+                let dateString = formatter.string(from: Date())
+                formattedJSON["date"] = dateString
+                formattedJSON["locale"] = Locale.current.identifier
+                formattedJSON["timeZone"] = TimeZone.current.abbreviation()
+            } else {
+                if let deviceDescription = json["X-MMe-Client-Info"] { formattedJSON["deviceDescription"] = deviceDescription }
+                if let localUserID = json["X-Apple-I-MD-LU"] { formattedJSON["localUserID"] = localUserID }
+                if let deviceUniqueIdentifier = json["X-Mme-Device-Id"] { formattedJSON["deviceUniqueIdentifier"] = deviceUniqueIdentifier }
+                
+                if let date = json["X-Apple-I-Client-Time"] { formattedJSON["date"] = date }
+                if let locale = json["X-Apple-Locale"] { formattedJSON["locale"] = locale }
+                if let timeZone = json["X-Apple-I-TimeZone"] { formattedJSON["timeZone"] = timeZone }
+            }
+            
+            if let response = response,
+               let version = response.value(forHTTPHeaderField: "Implementation-Version") {
+                print("Implementation-Version: \(version)")
+            } else { print("No Implementation-Version header") }
+            
+            print("Anisette used: \(formattedJSON)")
+            print("Original JSON: \(json)")
+            if let anisette = ALTAnisetteData(json: formattedJSON) {
+                print("Anisette is valid!")
+                self.finish(.success(anisette))
+            } else {
+                print("Anisette is invalid!!!!")
+                if v3 {
+                    throw OperationError.anisetteV3Error(message: "Invalid anisette (the returned data may not have all the required fields)")
+                } else {
+                    throw OperationError.anisetteV1Error(message: "Invalid anisette (the returned data may not have all the required fields)")
+                }
+            }
+        } else {
+            if v3 {
+                throw OperationError.anisetteV3Error(message: "Invalid anisette (the returned data may not be in JSON)")
+            } else {
+                throw OperationError.anisetteV1Error(message: "Invalid anisette (the returned data may not be in JSON)")
+            }
+        }
+    }
+    
+    // MARK: - V1
+    
+    func handleV1() {
+        print("Server is V1")
+        
+        if UserDefaults.shared.trustedServerURL == AnisetteManager.currentURLString {
+            print("Server has already been trusted, fetching anisette")
+            return self.fetchAnisetteV1()
+        }
+        
+        print("Alerting user about outdated server")
+        let alert = UIAlertController(title: "WARNING: Outdated anisette server", message: "We've detected you are using an older anisette server. Using this server has a higher likelihood of locking your account and causing other issues. Are you sure you want to continue?", preferredStyle: UIAlertController.Style.alert)
+        alert.addAction(UIAlertAction(title: "Continue", style: UIAlertAction.Style.destructive, handler: { action in
+            print("Fetching anisette via V1")
+            UserDefaults.shared.trustedServerURL = AnisetteManager.currentURLString
+            self.fetchAnisetteV1()
+        }))
+        alert.addAction(UIAlertAction(title: "Cancel", style: UIAlertAction.Style.cancel, handler: { action in
+            print("Cancelled anisette operation")
+            self.finish(.failure(OperationError.cancelled))
+        }))
+
+        let keyWindow = UIApplication.shared.windows.filter { $0.isKeyWindow }.first
+
+        DispatchQueue.main.async {
+            if let presentingController = keyWindow?.rootViewController?.presentedViewController {
+                presentingController.present(alert, animated: true)
+            } else {
+                keyWindow?.rootViewController?.present(alert, animated: true)
+            }
+        }
+    }
+    
+    func fetchAnisetteV1() {
+        print("Fetching anisette V1")
+        URLSession.shared.dataTask(with: self.url!) { data, response, error in
+            do {
+                guard let data = data, error == nil else { throw OperationError.anisetteV1Error(message: "Unable to fetch data\(error != nil ? " (\(error!.localizedDescription))" : "")") }
+                
+                try self.extractAnisetteData(data, response as? HTTPURLResponse, v3: false)
             } catch let error as NSError {
                 print("Failed to load: \(error.localizedDescription)")
                 self.finish(.failure(error))
             }
-            
+        }.resume()
+    }
+    
+    // MARK: - V3: PROVISIONING
+    
+    func provision() {
+        fetchClientInfo {
+            print("Getting provisioning URLs")
+            var request = self.buildAppleRequest(url: URL(string: "https://gsa.apple.com/grandslam/GsService2/lookup")!)
+            request.httpMethod = "GET"
+            URLSession.shared.dataTask(with: request) { data, response, error in
+                if let data = data,
+                   let plist = try? PropertyListSerialization.propertyList(from: data, format: nil) as? Dictionary<String, Dictionary<String, Any>>,
+                   let startProvisioningString = plist["urls"]?["midStartProvisioning"] as? String,
+                   let startProvisioningURL = URL(string: startProvisioningString),
+                   let endProvisioningString = plist["urls"]?["midFinishProvisioning"] as? String,
+                   let endProvisioningURL = URL(string: endProvisioningString) {
+                    self.startProvisioningURL = startProvisioningURL
+                    self.endProvisioningURL = endProvisioningURL
+                    print("startProvisioningURL: \(self.startProvisioningURL!.absoluteString)")
+                    print("endProvisioningURL: \(self.endProvisioningURL!.absoluteString)")
+                    print("Starting a provisioning session")
+                    self.startProvisioningSession()
+                } else {
+                    print("Apple didn't give valid URLs! Got response: \(String(data: data ?? Data("nothing".utf8), encoding: .utf8) ?? "not utf8")")
+                    self.finish(.failure(OperationError.provisioningError(result: "Apple didn't give valid URLs. Please try again later", message: nil)))
+                }
+            }.resume()
+        }
+    }
+    
+    func startProvisioningSession() {
+        let provisioningSessionURL = self.url!.appendingPathComponent("v3").appendingPathComponent("provisioning_session")
+        var wsRequest = URLRequest(url: provisioningSessionURL)
+        wsRequest.timeoutInterval = 5
+        self.socket = WebSocket(request: wsRequest)
+        self.socket.delegate = self
+        self.socket.connect()
+    }
+    
+    func didReceive(event: WebSocketEvent, client: WebSocketClient) {
+        switch event {
+        case .text(let string):
+            do {
+                if let json = try JSONSerialization.jsonObject(with: string.data(using: .utf8)!, options: []) as? [String: Any] {
+                    guard let result = json["result"] as? String else {
+                        print("The server didn't give us a result")
+                        client.disconnect(closeCode: 0)
+                        self.finish(.failure(OperationError.provisioningError(result: "The server didn't give us a result", message: nil)))
+                        return
+                    }
+                    print("Received result: \(result)")
+                    switch result {
+                    case "GiveIdentifier":
+                        print("Giving identifier")
+                        client.json(["identifier": Keychain.shared.identifier!])
+                        
+                    case "GiveStartProvisioningData":
+                        print("Getting start provisioning data")
+                        let body = [
+                            "Header": [String: Any](),
+                            "Request": [String: Any](),
+                        ]
+                        var request = self.buildAppleRequest(url: self.startProvisioningURL!)
+                        request.httpMethod = "POST"
+                        request.httpBody = try! PropertyListSerialization.data(fromPropertyList: body, format: .xml, options: 0)
+                        URLSession.shared.dataTask(with: request) { data, response, error in
+                            if let data = data,
+                               let plist = try? PropertyListSerialization.propertyList(from: data, format: nil) as? Dictionary<String, Dictionary<String, Any>>,
+                               let spim = plist["Response"]?["spim"] as? String {
+                                print("Giving start provisioning data")
+                                client.json(["spim": spim])
+                            } else {
+                                print("Apple didn't give valid start provisioning data! Got response: \(String(data: data ?? Data("nothing".utf8), encoding: .utf8) ?? "not utf8")")
+                                client.disconnect(closeCode: 0)
+                                self.finish(.failure(OperationError.provisioningError(result: "Apple didn't give valid start provisioning data. Please try again later", message: nil)))
+                            }
+                        }.resume()
+                        
+                    case "GiveEndProvisioningData":
+                        print("Getting end provisioning data")
+                        guard let cpim = json["cpim"] as? String else {
+                            print("The server didn't give us a cpim")
+                            client.disconnect(closeCode: 0)
+                            self.finish(.failure(OperationError.provisioningError(result: "The server didn't give us a cpim", message: nil)))
+                            return
+                        }
+                        let body = [
+                            "Header": [String: Any](),
+                            "Request": [
+                                "cpim": cpim,
+                            ],
+                        ]
+                        var request = self.buildAppleRequest(url: self.endProvisioningURL!)
+                        request.httpMethod = "POST"
+                        request.httpBody = try! PropertyListSerialization.data(fromPropertyList: body, format: .xml, options: 0)
+                        URLSession.shared.dataTask(with: request) { data, response, error in
+                            if let data = data,
+                               let plist = try? PropertyListSerialization.propertyList(from: data, format: nil) as? Dictionary<String, Dictionary<String, Any>>,
+                               let ptm = plist["Response"]?["ptm"] as? String,
+                               let tk = plist["Response"]?["tk"] as? String {
+                                print("Giving end provisioning data")
+                                client.json(["ptm": ptm, "tk": tk])
+                            } else {
+                                print("Apple didn't give valid end provisioning data! Got response: \(String(data: data ?? Data("nothing".utf8), encoding: .utf8) ?? "not utf8")")
+                                client.disconnect(closeCode: 0)
+                                self.finish(.failure(OperationError.provisioningError(result: "Apple didn't give valid end provisioning data. Please try again later", message: nil)))
+                            }
+                        }.resume()
+                        
+                    case "ProvisioningSuccess":
+                        print("Provisioning succeeded!")
+                        client.disconnect(closeCode: 0)
+                        guard let adiPb = json["adi_pb"] as? String else {
+                            print("The server didn't give us an adi.pb file")
+                            self.finish(.failure(OperationError.provisioningError(result: "The server didn't give us an adi.pb file", message: nil)))
+                            return
+                        }
+                        Keychain.shared.adiPb = adiPb
+                        self.fetchAnisetteV3(Keychain.shared.identifier!, Keychain.shared.adiPb!)
+                        
+                    default:
+                        if result.contains("Error") || result.contains("Invalid") || result == "ClosingPerRequest" || result == "Timeout" || result == "TextOnly" {
+                            print("Failing because of \(result)")
+                            self.finish(.failure(OperationError.provisioningError(result: result, message: json["message"] as? String)))
+                        }
+                    }
+                }
+            } catch let error as NSError {
+                print("Failed to handle text: \(error.localizedDescription)")
+                self.finish(.failure(OperationError.provisioningError(result: error.localizedDescription, message: nil)))
+            }
+            
+        case .connected:
+            print("Connected")
+            
+        case .disconnected(let string, let code):
+            print("Disconnected: \(code); \(string)")
+            
+        case .error(let error):
+            print("Got error: \(String(describing: error))")
+            
+        default:
+            print("Unknown event: \(event)")
+        }
+    }
+    
+    func buildAppleRequest(url: URL) -> URLRequest {
+        var request = URLRequest(url: url)
+        request.setValue(self.clientInfo!, forHTTPHeaderField: "X-Mme-Client-Info")
+        request.setValue(self.userAgent!, forHTTPHeaderField: "User-Agent")
+        request.setValue("text/x-xml-plist", forHTTPHeaderField: "Content-Type")
+        request.setValue("*/*", forHTTPHeaderField: "Accept")
+
+        request.setValue(self.mdLu!, forHTTPHeaderField: "X-Apple-I-MD-LU")
+        request.setValue(self.deviceId!, forHTTPHeaderField: "X-Mme-Device-Id")
+
+        let formatter = DateFormatter()
+        formatter.locale = Locale(identifier: "en_US_POSIX")
+        formatter.calendar = Calendar(identifier: .gregorian)
+        formatter.timeZone = TimeZone(identifier: "UTC")
+        formatter.dateFormat = "yyyy-MM-dd'T'HH:mm:ss'Z'"
+        let dateString = formatter.string(from: Date())
+        request.setValue(dateString, forHTTPHeaderField: "X-Apple-I-Client-Time")
+        request.setValue(Locale.current.identifier, forHTTPHeaderField: "X-Apple-Locale")
+        request.setValue(TimeZone.current.abbreviation(), forHTTPHeaderField: "X-Apple-I-TimeZone")
+        return request
+    }
+    
+    // MARK: - V3: FETCHING
+    
+    func fetchClientInfo(_ callback: @escaping () -> Void) {
+        if  self.clientInfo != nil &&
+                self.userAgent != nil &&
+                self.mdLu != nil &&
+                self.deviceId != nil &&
+                Keychain.shared.identifier != nil {
+            print("Skipping client_info fetch since all the properties we need aren't nil")
+            return callback()
+        }
+        print("Trying to get client_info")
+        let clientInfoURL = self.url!.appendingPathComponent("v3").appendingPathComponent("client_info")
+        URLSession.shared.dataTask(with: clientInfoURL) { data, response, error in
+            do {
+                guard let data = data, error == nil else {
+                    return self.finish(.failure(OperationError.anisetteV3Error(message: "Couldn't fetch client info. The server may be down\(error != nil ? " (\(error!.localizedDescription))" : "")")))
+                }
+                
+                if let json = try JSONSerialization.jsonObject(with: data, options: []) as? [String: String] {
+                    if let clientInfo = json["client_info"] {
+                        print("Server is V3")
+                        
+                        self.clientInfo = clientInfo
+                        self.userAgent = json["user_agent"]!
+                        print("Client-Info: \(self.clientInfo!)")
+                        print("User-Agent: \(self.userAgent!)")
+                        
+                        if Keychain.shared.identifier == nil {
+                            print("Generating identifier")
+                            var bytes = [Int8](repeating: 0, count: 16)
+                            let status = SecRandomCopyBytes(kSecRandomDefault, bytes.count, &bytes)
+                            
+                            if status != errSecSuccess {
+                                print("ERROR GENERATING IDENTIFIER!!! \(status)")
+                                return self.finish(.failure(OperationError.provisioningError(result: "Couldn't generate identifier", message: nil)))
+                            }
+                            
+                            Keychain.shared.identifier = Data(bytes: &bytes, count: bytes.count).base64EncodedString()
+                        }
+                        
+                        let decoded = Data(base64Encoded: Keychain.shared.identifier!)!
+                        self.mdLu = decoded.sha256().hexEncodedString()
+                        print("X-Apple-I-MD-LU: \(self.mdLu!)")
+                        let uuid: UUID = decoded.object()
+                        self.deviceId = uuid.uuidString.uppercased()
+                        print("X-Mme-Device-Id: \(self.deviceId!)")
+                        
+                        callback()
+                    } else { self.handleV1() }
+                } else { self.finish(.failure(OperationError.anisetteV3Error(message: "Couldn't fetch client info. The returned data may not be in JSON"))) }
+            } catch let error as NSError {
+                print("Failed to load: \(error.localizedDescription)")
+                self.handleV1()
+            }
+        }.resume()
+    }
+    
+    func fetchAnisetteV3(_ identifier: String, _ adiPb: String) {
+        fetchClientInfo {
+            print("Fetching anisette V3")
+            var request = URLRequest(url: self.url!.appendingPathComponent("v3").appendingPathComponent("get_headers"))
+            request.httpMethod = "POST"
+            request.httpBody = try! JSONSerialization.data(withJSONObject: [
+                "identifier": identifier,
+                "adi_pb": adiPb
+            ], options: [])
+            request.setValue("application/json", forHTTPHeaderField: "Content-Type")
+            URLSession.shared.dataTask(with: request) { data, response, error in
+                do {
+                    guard let data = data, error == nil else { throw OperationError.anisetteV3Error(message: "Couldn't fetch anisette") }
+                    
+                    try self.extractAnisetteData(data, response as? HTTPURLResponse, v3: true)
+                } catch let error as NSError {
+                    print("Failed to load: \(error.localizedDescription)")
+                    self.finish(.failure(error))
+                }
+            }.resume()
         }
-        
-        task.resume()
     }
 }
+
+extension WebSocketClient {
+    func json(_ dictionary: [String: String]) {
+        let data = try! JSONSerialization.data(withJSONObject: dictionary, options: [])
+        self.write(string: String(data: data, encoding: .utf8)!)
+    }
+}
+
+extension Data {
+    // https://stackoverflow.com/a/25391020
+    func sha256() -> Data {
+        var hash = [UInt8](repeating: 0,  count: Int(CC_SHA256_DIGEST_LENGTH))
+        self.withUnsafeBytes {
+            _ = CC_SHA256($0.baseAddress, CC_LONG(self.count), &hash)
+        }
+        return Data(hash)
+    }
+    
+    // https://stackoverflow.com/a/40089462
+    func hexEncodedString() -> String {
+        return self.map { String(format: "%02hhX", $0) }.joined()
+    }
+    
+    // https://stackoverflow.com/a/59127761
+    func object<T>() -> T { self.withUnsafeBytes { $0.load(as: T.self) } }
+}

AltStore/Operations/FetchProvisioningProfilesOperation.swift

@@ -262,14 +262,19 @@ extension FetchProvisioningProfilesOperation
                             {
                                 throw OperationError.maximumAppIDLimitReached(application: application, requiredAppIDs: requiredAppIDs, availableAppIDs: availableAppIDs, nextExpirationDate: expirationDate)
                             }
-                            else
-                            {
-                                throw ALTAppleAPIError(.maximumAppIDLimitReached)
-                            }
                         }
                     }
+                    //App ID name must be ascii. If the name is not ascii, using bundleID instead
+                    let appIDName: String
+                    if !name.allSatisfy({ $0.isASCII }) {
+                        //Contains non ASCII (Such as Chinese/Japanese...), using bundleID
+                        appIDName = bundleIdentifier
+                    }else {
+                        //ASCII text, keep going as usual
+                        appIDName = name
+                    }
                     
-                    ALTAppleAPI.shared.addAppID(withName: name, bundleIdentifier: bundleIdentifier, team: team, session: session) { (appID, error) in
+                    ALTAppleAPI.shared.addAppID(withName: appIDName, bundleIdentifier: bundleIdentifier, team: team, session: session) { (appID, error) in
                         do
                         {
                             do
@@ -384,19 +389,39 @@ extension FetchProvisioningProfilesOperation
         
         if app.isAltStoreApp
         {
+            print("Application groups before modifying for SideStore: \(applicationGroups)")
+            
+            // Remove app groups that contain AltStore since they can be problematic (cause SideStore to expire early)
+            for (index, group) in applicationGroups.enumerated() {
+                if group.contains("AltStore") {
+                    print("Removing application group: \(group)")
+                    applicationGroups.remove(at: index)
+                }
+            }
+            
+            // Make sure we add .AltWidget for the widget
+            var altStoreAppGroupID = Bundle.baseAltStoreAppGroupID
+            for (_, group) in applicationGroups.enumerated() {
+                if group.contains("AltWidget") {
+                    altStoreAppGroupID += ".AltWidget"
+                    break
+                }
+            }
+            
             // Potentially updating app groups for this specific AltStore.
             // Find the (unique) AltStore app group, then replace it
             // with the correct "base" app group ID.
             // Otherwise, we may append a duplicate team identifier to the end.
             if let index = applicationGroups.firstIndex(where: { $0.contains(Bundle.baseAltStoreAppGroupID) })
             {
-                applicationGroups[index] = Bundle.baseAltStoreAppGroupID
+                applicationGroups[index] = altStoreAppGroupID
             }
             else
             {
-                applicationGroups.append(Bundle.baseAltStoreAppGroupID)
+                applicationGroups.append(altStoreAppGroupID)
             }
         }
+        print("Application groups: \(applicationGroups)")
         
         // Dispatch onto global queue to prevent appGroupsLock deadlock.
         DispatchQueue.global().async {
@@ -478,10 +503,13 @@ extension FetchProvisioningProfilesOperation
                 ALTAppleAPI.shared.delete(profile, for: team, session: session) { (success, error) in
                     switch Result(success, error)
                     {
-                    case .failure(let error): completionHandler(.failure(error))
+                    case .failure:
-                    case .success:
+                        // As of March 20, 2023, the free provisioning profile is re-generated each fetch, and you can no longer delete it.
+                        // So instead, we just return the fetched profile from above.
+                        completionHandler(.success(profile))
                         
-                        // Fetch new provisiong profile
+                    case .success:
+                        // Fetch new provisioning profile
                         ALTAppleAPI.shared.fetchProvisioningProfile(for: appID, deviceType: .iphone, team: team, session: session) { (profile, error) in
                             completionHandler(Result(profile, error))
                         }

AltStore/Operations/InstallAppOperation.swift

@@ -11,6 +11,7 @@ import Network
 import AltStoreCore
 import AltSign
 import Roxas
+import minimuxer
 
 @objc(InstallAppOperation)
 final class InstallAppOperation: ResultOperation<InstalledApp>
@@ -40,7 +41,8 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
         
         guard
             let certificate = self.context.certificate,
-            let resignedApp = self.context.resignedApp
+            let resignedApp = self.context.resignedApp,
+            let provisioningProfiles = self.context.provisioningProfiles
         else { return self.finish(.failure(OperationError.invalidParameters)) }
         
         let backgroundContext = DatabaseManager.shared.persistentContainer.newBackgroundContext()
@@ -115,8 +117,7 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
             // Temporary directory and resigned .ipa no longer needed, so delete them now to ensure AltStore doesn't quit before we get the chance to.
             self.cleanUp()
             
-            var activeProfiles: Set<String>?
+            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit, provisioningProfiles.contains(where: { $1.isFreeProvisioningProfile == true })
-            if let sideloadedAppsLimit = UserDefaults.standard.activeAppsLimit
             {
                 // When installing these new profiles, AltServer will remove all non-active profiles to ensure we remain under limit.
                 
@@ -141,23 +142,70 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
                         installedApp.isActive = false
                     }
                 }
-
+            }
-                activeProfiles = Set(activeApps.flatMap { (installedApp) -> [String] in
+            else
-                    let appExtensionProfiles = installedApp.appExtensions.map { $0.resignedBundleIdentifier }
+            {
-                    return [installedApp.resignedBundleIdentifier] + appExtensionProfiles
+                installedApp.isActive = true
-                })
             }
             
-            let ns_bundle = NSString(string: installedApp.bundleIdentifier)
+            var installing = true
-            let ns_bundle_ptr = UnsafeMutablePointer<CChar>(mutating: ns_bundle.utf8String)
+            if installedApp.storeApp?.bundleIdentifier.range(of: Bundle.Info.appbundleIdentifier) != nil {
+                // Reinstalling ourself will hang until we leave the app, so we need to exit it without force closing
+                DispatchQueue.main.asyncAfter(deadline: .now() + 3) {
+                    if UIApplication.shared.applicationState != .active {
+                        print("We are not in the foreground, let's not do anything")
+                        return
+                    }
+                    if !installing {
+                        print("Installing finished")
+                        return
+                    }
+                    print("We are still installing after 3 seconds")
+                    UNUserNotificationCenter.current().getNotificationSettings { settings in
+                        switch (settings.authorizationStatus) {
+                        case .authorized, .ephemeral, .provisional:
+                            print("Notifications are enabled")
+
+                            let content = UNMutableNotificationContent()
+                            content.title = "Refreshing..."
+                            content.body = "SideStore will automatically move to the homescreen to finish refreshing!"
+                            let notification = UNNotificationRequest(identifier: Bundle.Info.appbundleIdentifier + ".FinishRefreshNotification", content: content, trigger: UNTimeIntervalNotificationTrigger(timeInterval: 2, repeats: false))
+                            UNUserNotificationCenter.current().add(notification)
+                            break
+                        default:
+                            print("Notifications are not enabled")
+
+                            let alert = UIAlertController(title: "Finish Refresh", message: "Please reopen SideStore after the process is finished.To finish refreshing, SideStore must be moved to the background. To do this, you can either go to the Home Screen manually or by hitting Continue. Please reopen SideStore after doing this.", preferredStyle: .alert)
+                            alert.addAction(UIAlertAction(title: NSLocalizedString("Continue", comment: ""), style: .default, handler: { _ in
+                                print("Going home")
+                                UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
+                            }))
+
+                            DispatchQueue.main.async {
+                                let keyWindow = UIApplication.shared.windows.filter { $0.isKeyWindow }.first
+                                if var topController = keyWindow?.rootViewController {
+                                    while let presentedViewController = topController.presentedViewController {
+                                        topController = presentedViewController
+                                    }
+                                    topController.present(alert, animated: true)
+                                } else {
+                                    print("No key window? Let's just go home")
+                                }
+                            }
+                        }
+                    }
+                    UIApplication.shared.perform(#selector(NSXPCConnection.suspend))
+                }
+            }
             
-            let res = minimuxer_install_ipa(ns_bundle_ptr)
+            do {
-            if res == 0 {
+                try install_ipa(installedApp.bundleIdentifier)
+                installing = false
                 installedApp.refreshedDate = Date()
                 self.finish(.success(installedApp))
-
+            } catch let error {
-            } else {
+                installing = false
-                self.finish(.failure(minimuxer_to_operation(code: res)))
+                self.finish(.failure(error))
             }
         }
     }
@@ -174,10 +222,11 @@ final class InstallAppOperation: ResultOperation<InstalledApp>
             do
             {
                 try FileManager.default.removeItem(at: fileURL)
+                print("Removed refreshed IPA")
             }
             catch
             {
-                print("Failed to remove refreshed .ipa:", error)
+                print("Failed to remove refreshed .ipa: \(error)")
             }
         }
         

AltStore/Operations/OperationError.swift

@@ -8,6 +8,7 @@
 
 import Foundation
 import AltSign
+import minimuxer
 
 enum OperationError: LocalizedError
 {
@@ -33,18 +34,13 @@ enum OperationError: LocalizedError
     case openAppFailed(name: String)
     case missingAppGroup
     
-    case noDevice
+    case noWiFi
-    case createService(name: String)
+    case tooNewError
-    case getFromDevice(name: String)
+    case anisetteV1Error(message: String)
-    case setArgument(name: String)
+    case provisioningError(result: String, message: String?)
-    case afc
+    case anisetteV3Error(message: String)
-    case install
+    
-    case uninstall
+    case cacheClearError(errors: [String])
-    case lookupApps
-    case detach
-    case functionArguments
-    case profileInstall
-    case noConnection
     
     var failureReason: String? {
         switch self {
@@ -61,18 +57,12 @@ enum OperationError: LocalizedError
         case .openAppFailed(let name): return String(format: NSLocalizedString("SideStore was denied permission to launch %@.", comment: ""), name)
         case .missingAppGroup: return NSLocalizedString("SideStore's shared app group could not be found.", comment: "")
         case .maximumAppIDLimitReached: return NSLocalizedString("Cannot register more than 10 App IDs.", comment: "")
-        case .noDevice: return NSLocalizedString("Cannot fetch the device from the muxer", comment: "")
+        case .noWiFi: return NSLocalizedString("You do not appear to be connected to WiFi!\nSideStore will never be able to install or refresh applications without WiFi.", comment: "")
-        case .createService(let name): return String(format: NSLocalizedString("Cannot start a %@ server on the device.", comment: ""), name)
+        case .tooNewError: return NSLocalizedString("iOS 17 has changed how JIT is enabled therefore SideStore cannot enable it at this time, sorry for any inconvenience.\nWe will let everyone know once we have a solution!", comment: "")
-        case .getFromDevice(let name): return String(format: NSLocalizedString("Cannot fetch %@ from the device.", comment: ""), name)
+        case .anisetteV1Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V1 server: %@. Try using another anisette server.", comment: ""), message)
-        case .setArgument(let name): return String(format: NSLocalizedString("Cannot set %@ on the device.", comment: ""), name)
+        case .provisioningError(let result, let message): return String(format: NSLocalizedString("An error occurred when provisioning: %@%@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), result, message != nil ? (" (" + message! + ")") : "")
-        case .afc: return NSLocalizedString("AFC was unable to manage files on the device", comment: "")
+        case .anisetteV3Error(let message): return String(format: NSLocalizedString("An error occurred when getting anisette data from a V3 server: %@. Please try again. If the issue persists, report it on GitHub Issues!", comment: ""), message)
-        case .install: return NSLocalizedString("Unable to install the app from the staging directory", comment: "")
+        case .cacheClearError(let errors): return String(format: NSLocalizedString("An error occurred while clearing cache: %@", comment: ""), errors.joined(separator: "\n"))
-        case .uninstall: return NSLocalizedString("Unable to uninstall the app", comment: "")
-        case .lookupApps: return NSLocalizedString("Unable to fetch apps from the device", comment: "")
-        case .detach: return NSLocalizedString("Unable to detach from the app's process", comment: "")
-        case .functionArguments: return NSLocalizedString("A function was passed invalid arguments", comment: "")
-        case .profileInstall: return NSLocalizedString("Unable to manage profiles on the device", comment: "")
-        case .noConnection: return NSLocalizedString("Unable to connect to the device, make sure Wireguard is enabled and you're connected to WiFi", comment: "")
         }
     }
     
@@ -118,49 +108,66 @@ enum OperationError: LocalizedError
     }
 }
 
-func minimuxer_to_operation(code: Int32) -> OperationError {
+extension MinimuxerError: LocalizedError {
-    switch code {
+    public var failureReason: String? {
-    case -1:
+        switch self {
-        return OperationError.noDevice
+        case .NoDevice:
-    case -2:
+            return NSLocalizedString("Cannot fetch the device from the muxer", comment: "")
-        return OperationError.createService(name: "debug")
+        case .NoConnection:
-    case -3:
+            return NSLocalizedString("Unable to connect to the device, make sure Wireguard is enabled and you're connected to WiFi", comment: "")
-        return OperationError.createService(name: "instproxy")
+        case .PairingFile:
-    case -4:
+            return NSLocalizedString("Invalid pairing file. Your pairing file either didn't have a UDID, or it wasn't a valid plist. Please use jitterbugpair to generate it", comment: "")
-        return OperationError.getFromDevice(name: "installed apps")
+            
-    case -5:
+        case .CreateDebug:
-        return OperationError.getFromDevice(name: "path to the app")
+            return self.createService(name: "debug")
-    case -6:
+        case .LookupApps:
-        return OperationError.getFromDevice(name: "bundle path")
+            return self.getFromDevice(name: "installed apps")
-    case -7:
+        case .FindApp:
-        return OperationError.setArgument(name: "max packet")
+            return self.getFromDevice(name: "path to the app")
-    case -8:
+        case .BundlePath:
-        return OperationError.setArgument(name: "working directory")
+            return self.getFromDevice(name: "bundle path")
-    case -9:
+        case .MaxPacket:
-        return OperationError.setArgument(name: "argv")
+            return self.setArgument(name: "max packet")
-    case -10:
+        case .WorkingDirectory:
-        return OperationError.getFromDevice(name: "launch success")
+            return self.setArgument(name: "working directory")
-    case -11:
+        case .Argv:
-        return OperationError.detach
+            return self.setArgument(name: "argv")
-    case -12:
+        case .LaunchSuccess:
-        return OperationError.functionArguments
+            return self.getFromDevice(name: "launch success")
-    case -13:
+        case .Detach:
-        return OperationError.createService(name: "AFC")
+            return NSLocalizedString("Unable to detach from the app's process", comment: "")
-    case -14:
+        case .Attach:
-        return OperationError.afc
+            return NSLocalizedString("Unable to attach to the app's process", comment: "")
-    case -15:
+            
-        return OperationError.install
+        case .CreateInstproxy:
-    case -16:
+            return self.createService(name: "instproxy")
-        return OperationError.uninstall
+        case .CreateAfc:
-    case -17:
+            return self.createService(name: "AFC")
-        return OperationError.createService(name: "misagent")
+        case .RwAfc:
-    case -18:
+            return NSLocalizedString("AFC was unable to manage files on the device", comment: "")
-        return OperationError.profileInstall
+        case .InstallApp(let message):
-    case -19:
+            return NSLocalizedString("Unable to install the app: \(message.toString())", comment: "")
-        return OperationError.profileInstall
+        case .UninstallApp:
-    case -20:
+            return NSLocalizedString("Unable to uninstall the app", comment: "")
-        return OperationError.noConnection
+
-    default:
+        case .CreateMisagent:
-        return OperationError.unknown
+            return self.createService(name: "misagent")
+        case .ProfileInstall:
+            return NSLocalizedString("Unable to manage profiles on the device", comment: "")
+        case .ProfileRemove:
+            return NSLocalizedString("Unable to manage profiles on the device", comment: "")
+        }
+    }
+    
+    fileprivate func createService(name: String) -> String {
+        return String(format: NSLocalizedString("Cannot start a %@ server on the device.", comment: ""), name)
+    }
+    
+    fileprivate func getFromDevice(name: String) -> String {
+        return String(format: NSLocalizedString("Cannot fetch %@ from the device.", comment: ""), name)
+    }
+    
+    fileprivate func setArgument(name: String) -> String {
+        return String(format: NSLocalizedString("Cannot set %@ on the device.", comment: ""), name)
     }
 }

AltStore/Operations/RefreshAppOperation.swift

@@ -35,34 +35,28 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
         
         do
         {
-            if let error = self.context.error
+            if let error = self.context.error { return self.finish(.failure(error)) }
-            {
-                throw error
-            }
             
-            guard let profiles = self.context.provisioningProfiles else { throw OperationError.invalidParameters }
+            guard let profiles = self.context.provisioningProfiles else { return self.finish(.failure(OperationError.invalidParameters)) }
+            guard let app = self.context.app else { return self.finish(.failure(OperationError.appNotFound)) }
             
-            guard let app = self.context.app else { throw OperationError.appNotFound }
+            for p in profiles {
-            
+                do {
-            DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
+                    let bytes = p.value.data.toRustByteSlice()
-                print("Sending refresh app request...")
+                    try install_provisioning_profile(bytes.forRust())
+                } catch {
+                    self.finish(.failure(MinimuxerError.ProfileInstall))
+                }
 
-                for p in profiles {
+                DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
-                    do {
+                print("Sending refresh app request...")
-                        let x = try install_provisioning_profile(plist: p.value.data)
+                    
-                        if case .Bad(let code) = x {
-                            self.finish(.failure(minimuxer_to_operation(code: code)))
-                        }
-                    } catch Uhoh.Bad(let code) {
-                        self.finish(.failure(minimuxer_to_operation(code: code)))
-                    } catch {
-                        self.finish(.failure(OperationError.unknown))
-                    }
                     self.progress.completedUnitCount += 1
                     
                     let predicate = NSPredicate(format: "%K == %@", #keyPath(InstalledApp.bundleIdentifier), app.bundleIdentifier)
                     self.managedObjectContext.perform {
                         guard let installedApp = InstalledApp.first(satisfying: predicate, in: self.managedObjectContext) else {
+                            self.finish(.failure(OperationError.appNotFound))
                             return
                         }
                         installedApp.update(provisioningProfile: p.value)
@@ -75,9 +69,5 @@ final class RefreshAppOperation: ResultOperation<InstalledApp>
                 }
             }
         }
-        catch
-        {
-            self.finish(.failure(error))
-        }
     }
 }

AltStore/Operations/RemoveAppOperation.swift

@@ -39,15 +39,11 @@ final class RemoveAppOperation: ResultOperation<InstalledApp>
             let resignedBundleIdentifier = installedApp.resignedBundleIdentifier
             
             do {
-                let res = try remove_app(app_id: resignedBundleIdentifier)
+                try remove_app(resignedBundleIdentifier)
-                if case Uhoh.Bad(let code) = res {
-                    self.finish(.failure(minimuxer_to_operation(code: code)))
-                }
-            } catch Uhoh.Bad(let code) {
-                self.finish(.failure(minimuxer_to_operation(code: code)))
             } catch {
-                self.finish(.failure(ALTServerError(.appDeletionFailed)))
+                return self.finish(.failure(error))
             }
+            
             DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
                 self.progress.completedUnitCount += 1
                 

AltStore/Operations/ResignAppOperation.swift

@@ -11,6 +11,7 @@ import Roxas
 
 import AltStoreCore
 import AltSign
+import minimuxer
 
 @objc(ResignAppOperation)
 final class ResignAppOperation: ResultOperation<ALTApplication>
@@ -61,6 +62,7 @@ final class ResignAppOperation: ResultOperation<ALTApplication>
                 {
                     let destinationURL = InstalledApp.refreshedIPAURL(for: app)
                     try FileManager.default.copyItem(at: resignedURL, to: destinationURL, shouldReplace: true)
+                    print("Successfully resigned app to \(destinationURL.absoluteString)")
                     
                     // Use appBundleURL since we need an app bundle, not .ipa.
                     guard let resignedApplication = ALTApplication(fileURL: appBundleURL) else { throw OperationError.invalidApp }
@@ -147,6 +149,14 @@ private extension ResignAppOperation
             infoDictionary[Bundle.Info.exportedUTIs] = exportedUTIs
             
             try (infoDictionary as NSDictionary).write(to: bundle.infoPlistURL)
+            
+            // Remove _CodeSignature folder (if it exists) because it will be added when resigning and it may have files that aren't overwritten when resigning
+            // These files might be the cause of some ApplicationVerificationFailed errors
+            let codeSignaturePath = bundle.bundleURL.appendingPathComponent("_CodeSignature").absoluteString.replacingOccurrences(of: "file://", with: "")
+            if FileManager.default.fileExists(atPath: codeSignaturePath) {
+                try FileManager.default.removeItem(atPath: codeSignaturePath)
+                print("Removed _CodeSignature folder at \(codeSignaturePath)")
+            }
         }
         
         DispatchQueue.global().async {
@@ -172,7 +182,7 @@ private extension ResignAppOperation
 
                 if app.isAltStoreApp
                 {
-                    guard let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String else { throw OperationError.unknownUDID }
+                    guard let udid = fetch_udid()?.toString() as? String else { throw OperationError.unknownUDID }
                     guard let pairingFileString = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.devicePairingString) as? String else { throw OperationError.unknownUDID }                    
                     additionalValues[Bundle.Info.devicePairingString] = pairingFileString
                     additionalValues[Bundle.Info.deviceID] = udid
@@ -193,7 +203,7 @@ private extension ResignAppOperation
                         // The embedded certificate + certificate identifier are already in app bundle, no need to update them.
                     }
                 }
-                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.deviceID) as? String
+                else if infoDictionary.keys.contains(Bundle.Info.deviceID), let udid = fetch_udid()?.toString() as? String
                 {
                     // There is an ALTDeviceID entry, so assume the app is using AltKit and replace it with the device's UDID.
                     additionalValues[Bundle.Info.deviceID] = udid
@@ -218,6 +228,7 @@ private extension ResignAppOperation
                 
                 // Prepare app
                 try prepare(appBundle, additionalInfoDictionaryValues: additionalValues)
+                try self.removeMissingAppExtensionReferences(from: appBundle)
                 
                 if let directory = appBundle.builtInPlugInsURL, let enumerator = FileManager.default.enumerator(at: directory, includingPropertiesForKeys: nil, options: [.skipsSubdirectoryDescendants])
                 {
@@ -258,4 +269,28 @@ private extension ResignAppOperation
         
         return progress
     }
+    
+    func removeMissingAppExtensionReferences(from bundle: Bundle) throws
+    {
+        // If app extensions have been removed from an app (either by AltStore or the developer),
+        // we must remove all references to them from SC_Info/Manifest.plist (if it exists).
+        
+        let scInfoURL = bundle.bundleURL.appendingPathComponent("SC_Info")
+        let manifestPlistURL = scInfoURL.appendingPathComponent("Manifest.plist")
+        
+        guard let manifestPlist = NSMutableDictionary(contentsOf: manifestPlistURL), let sinfReplicationPaths = manifestPlist["SinfReplicationPaths"] as? [String] else { return }
+        
+        // Remove references to missing files.
+        let filteredReplicationPaths = sinfReplicationPaths.filter { path in
+            guard let fileURL = URL(string: path, relativeTo: bundle.bundleURL) else { return false }
+            
+            let fileExists = FileManager.default.fileExists(atPath: fileURL.path)
+            return fileExists
+        }
+        
+        manifestPlist["SinfReplicationPaths"] = filteredReplicationPaths
+        
+        // Save updated Manifest.plist to disk.
+        try manifestPlist.write(to: manifestPlistURL)
+    }
 }

AltStore/Operations/SendAppOperation.swift

@@ -9,6 +9,7 @@ import Foundation
 import Network
 
 import AltStoreCore
+import minimuxer
 
 @objc(SendAppOperation)
 final class SendAppOperation: ResultOperation<()>
@@ -32,8 +33,7 @@ final class SendAppOperation: ResultOperation<()>
         
         if let error = self.context.error
         {
-            self.finish(.failure(error))
+            return self.finish(.failure(error))
-            return
         }
         
         guard let resignedApp = self.context.resignedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
@@ -44,25 +44,20 @@ final class SendAppOperation: ResultOperation<()>
         
         print("AFC App `fileURL`: \(fileURL.absoluteString)")
         
-        let ns_bundle = NSString(string: app.bundleIdentifier)
-        let ns_bundle_ptr = UnsafeMutablePointer<CChar>(mutating: ns_bundle.utf8String)
-
         if let data = NSData(contentsOf: fileURL) {
-            let pls = UnsafeMutablePointer<UInt8>.allocate(capacity: data.length)
+            do {
-            for (index, data) in data.enumerated() {
+                let bytes = Data(data).toRustByteSlice()
-                pls[index] = data
+                try yeet_app_afc(app.bundleIdentifier, bytes.forRust())
-            }
+                self.progress.completedUnitCount += 1
-            let res = minimuxer_yeet_app_afc(ns_bundle_ptr, pls, UInt(data.length))
+                self.finish(.success(()))
-            if res == 0 {
+            } catch {
-                print("minimuxer_yeet_app_afc `res` == \(res)")
+                self.finish(.failure(MinimuxerError.RwAfc))
                 self.progress.completedUnitCount += 1
                 self.finish(.success(()))
-            } else {
-                self.finish(.failure(minimuxer_to_operation(code: res)))
             }
-            
         } else {
-            self.finish(.failure(ALTServerError(.underlyingError)))
+            print("IPA doesn't exist????")
+            self.finish(.failure(OperationError.appNotFound))
         }
     }
 }

AltStore/Resources/Assets.xcassets/AppIcon.appiconset/Contents.json

@@ -1 +1,158 @@
-{"images":[{"size":"60x60","expected-size":"180","filename":"180.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"40x40","expected-size":"80","filename":"80.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"40x40","expected-size":"120","filename":"120.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"60x60","expected-size":"120","filename":"120.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"57x57","expected-size":"57","filename":"57.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"1x"},{"size":"29x29","expected-size":"58","filename":"58.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"29x29","expected-size":"29","filename":"29.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"1x"},{"size":"29x29","expected-size":"87","filename":"87.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"57x57","expected-size":"114","filename":"114.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"20x20","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"2x"},{"size":"20x20","expected-size":"60","filename":"60.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"iphone","scale":"3x"},{"size":"1024x1024","filename":"1024.png","expected-size":"1024","idiom":"ios-marketing","folder":"Assets.xcassets/AppIcon.appiconset/","scale":"1x"},{"size":"40x40","expected-size":"80","filename":"80.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"72x72","expected-size":"72","filename":"72.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"76x76","expected-size":"152","filename":"152.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"50x50","expected-size":"100","filename":"100.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"29x29","expected-size":"58","filename":"58.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"76x76","expected-size":"76","filename":"76.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"29x29","expected-size":"29","filename":"29.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"50x50","expected-size":"50","filename":"50.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"72x72","expected-size":"144","filename":"144.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"40x40","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"83.5x83.5","expected-size":"167","filename":"167.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"},{"size":"20x20","expected-size":"20","filename":"20.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"1x"},{"size":"20x20","expected-size":"40","filename":"40.png","folder":"Assets.xcassets/AppIcon.appiconset/","idiom":"ipad","scale":"2x"}]}
+{
+  "images" : [
+    {
+      "filename" : "40.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "60.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "29.png",
+      "idiom" : "iphone",
+      "scale" : "1x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "58.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "87.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "80.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "120.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "57.png",
+      "idiom" : "iphone",
+      "scale" : "1x",
+      "size" : "57x57"
+    },
+    {
+      "filename" : "114.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "57x57"
+    },
+    {
+      "filename" : "120.png",
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "60x60"
+    },
+    {
+      "filename" : "180.png",
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "60x60"
+    },
+    {
+      "filename" : "20.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "40.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "20x20"
+    },
+    {
+      "filename" : "29.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "58.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "29x29"
+    },
+    {
+      "filename" : "40.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "80.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "40x40"
+    },
+    {
+      "filename" : "50.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "50x50"
+    },
+    {
+      "filename" : "100.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "50x50"
+    },
+    {
+      "filename" : "72.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "72x72"
+    },
+    {
+      "filename" : "144.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "72x72"
+    },
+    {
+      "filename" : "76.png",
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "76x76"
+    },
+    {
+      "filename" : "152.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "76x76"
+    },
+    {
+      "filename" : "167.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "83.5x83.5"
+    },
+    {
+      "filename" : "1024.png",
+      "idiom" : "ios-marketing",
+      "scale" : "1x",
+      "size" : "1024x1024"
+    }
+  ],
+  "info" : {
+    "author" : "xcode",
+    "version" : 1
+  }
+}

AltStore/Resources/Assets.xcassets/Riley.imageset/Contents.json

@@ -1,12 +0,0 @@
-{
-  "images" : [
-    {
-      "filename" : "riley.jpg",
-      "idiom" : "universal"
-    }
-  ],
-  "info" : {
-    "author" : "xcode",
-    "version" : 1
-  }
-}

AltStore/Resources/Assets.xcassets/Shane.imageset/Contents.json

@@ -1,12 +0,0 @@
-{
-  "images" : [
-    {
-      "filename" : "shane.jpeg",
-      "idiom" : "universal"
-    }
-  ],
-  "info" : {
-    "author" : "xcode",
-    "version" : 1
-  }
-}

AltStore/Resources/Assets.xcassets/SideStore.imageset/Contents.json

@@ -0,0 +1,21 @@
+{
+  "images" : [
+    {
+      "filename" : "1024.png",
+      "idiom" : "universal",
+      "scale" : "1x"
+    },
+    {
+      "idiom" : "universal",
+      "scale" : "2x"
+    },
+    {
+      "idiom" : "universal",
+      "scale" : "3x"
+    }
+  ],
+  "info" : {
+    "author" : "xcode",
+    "version" : 1
+  }
+}

AltStore/Resources/ReleaseEntitlements.plist

@@ -3,18 +3,18 @@
 <plist version="1.0">
 <dict>
 	<key>application-identifier</key>
-	<string>A72ZC8AJ5X.com.SideStore.AltStore</string>
+	<string>XYZ0123456.com.SideStore.SideStore</string>
 	<key>aps-environment</key>
 	<string>development</string>
 	<key>com.apple.developer.siri</key>
 	<true/>
 	<key>com.apple.developer.team-identifier</key>
-	<string>A72ZC8AJ5X</string>
+	<string>XYZ0123456</string>
 	<key>com.apple.security.application-groups</key>
 	<array>
-		<string>group.com.SideStore.AltStore</string>
+		<string>group.com.SideStore.SideStore</string>
 	</array>
 	<key>get-task-allow</key>
 	<true/>
 </dict>
-</plist>
+</plist>

AltStore/Resources/apps.json

@@ -1,269 +0,0 @@
-{
-  "name": "AltStore",
-  "identifier": "com.rileytestut.AltStore",
-  "sourceURL": "https://cdn.altstore.io/file/altstore/apps.json",
-  "apps": [
-    {
-      "name": "AltStore",
-      "bundleIdentifier": "com.rileytestut.AltStore",
-      "developerName": "Riley Testut",
-      "version": "1.5.1",
-      "versionDate": "2022-07-14T12:00:00-05:00",
-      "versionDescription": "This update fixes the following issues:\n\n• Using Apple IDs that contain capital letters\n• Using Apple IDs with 2FA enabled without any trusted devices\n• Repeatedly asking some users to sign in every refresh\n• \"Incorrect Apple ID or password\" error after changing Apple ID email address\n• “Application is missing application-identifier” error when sideloading or (de-)activating certain apps\n• Potential crash when receiving unknown error codes from AltServer",
-      "downloadURL": "https://cdn.altstore.io/file/altstore/apps/altstore/1_5_1.ipa",
-      "localizedDescription": "AltStore is an alternative app store for non-jailbroken devices. \n\nThis version of AltStore allows you to install Delta, an all-in-one emulator for iOS, as well as sideload other .ipa files from the Files app.",
-      "iconURL": "https://user-images.githubusercontent.com/705880/65270980-1eb96f80-dad1-11e9-9367-78ccd25ceb02.png",
-      "tintColor": "018084",
-      "size": 5465976,
-      "screenshotURLs": [
-        "https://user-images.githubusercontent.com/705880/78942028-acf54300-7a6d-11ea-821c-5bb7a9b3e73a.PNG",
-        "https://user-images.githubusercontent.com/705880/78942222-0fe6da00-7a6e-11ea-9f2a-dda16157583c.PNG",
-        "https://user-images.githubusercontent.com/705880/65605577-332cba80-df5e-11e9-9f00-b369ce974f71.PNG"
-      ],
-      "permissions": [
-        {
-          "type": "background-fetch",
-          "usageDescription": "AltStore periodically refreshes apps in the background to prevent them from expiring."
-        },
-        {
-          "type": "background-audio",
-          "usageDescription": "Allows AltStore to run longer than 30 seconds when refreshing apps in background."
-        }
-      ]
-    },
-    {
-      "name": "AltStore",
-      "bundleIdentifier": "com.rileytestut.AltStore.Beta",
-      "developerName": "Riley Testut",
-      "subtitle": "An alternative App Store for iOS.",
-      "version": "1.6b2",
-      "versionDate": "2022-09-21T13:00:00-05:00",
-      "versionDescription": "• Fixed “error migrating persistent store” issue on launch\n\nPREVIOUS VERSION\n\nLock Screen Widget (iOS 16+)\n• Counts down days until AltStore expires\n• Comes in 2 different styles: “icon” and “text”\n\nError Log\n• View past errors in more detail\n• Tap an error to copy the error message or error code\n• Search for error code directly in AltStore FAQ",
-      "downloadURL": "https://cdn.altstore.io/file/altstore/apps/altstore/1_6_b2.ipa",
-      "localizedDescription": "AltStore is an alternative app store for non-jailbroken devices. \n\nThis beta release of AltStore adds support for 3rd party sources, allowing you to download apps from other developers directly through AltStore.",
-      "iconURL": "https://user-images.githubusercontent.com/705880/65270980-1eb96f80-dad1-11e9-9367-78ccd25ceb02.png",
-      "tintColor": "018084",
-      "size": 5465933,
-      "beta": true,
-      "screenshotURLs": [
-        "https://user-images.githubusercontent.com/705880/78942028-acf54300-7a6d-11ea-821c-5bb7a9b3e73a.PNG",
-        "https://user-images.githubusercontent.com/705880/78942222-0fe6da00-7a6e-11ea-9f2a-dda16157583c.PNG",
-        "https://user-images.githubusercontent.com/705880/65605577-332cba80-df5e-11e9-9f00-b369ce974f71.PNG"
-      ],
-      "permissions": [
-        {
-          "type": "background-fetch",
-          "usageDescription": "AltStore periodically refreshes apps in the background to prevent them from expiring."
-        },
-        {
-          "type": "background-audio",
-          "usageDescription": "Allows AltStore to run longer than 30 seconds when refreshing apps in background."
-        }
-      ]
-    },
-    {
-      "name": "Delta",
-      "bundleIdentifier": "com.rileytestut.Delta",
-      "developerName": "Riley Testut",
-      "subtitle": "Classic games in your pocket.",
-      "version": "1.3.1",
-      "versionDate": "2021-12-02T13:30:00-08:00",
-      "versionDescription": "• Fixes game artwork not loading\n• Fixes using deprecated DeSmuME core over melonDS core for some users",
-      "downloadURL": "https://cdn.altstore.io/file/altstore/apps/delta/1_3_1.ipa",
-      "localizedDescription": "Delta is an all-in-one emulator for iOS. Delta builds upon the strengths of its predecessor, GBA4iOS, while expanding to include support for more game systems such as NES, SNES, and N64.\n\nFEATURES\n\nSupported Game Systems\n• Nintendo Entertainment System\n• Super Nintendo Entertainment System\n• Nintendo 64\n• Game Boy (Color)\n• Game Boy Advance\n• Nintendo DS\n• And plenty more to come!\n\nController Support\n• Supports PS4, PS5, Xbox One S, Xbox Series X, and MFi game controllers.\n• Supports bluetooth (and wired) keyboards, as well as the Apple Smart Keyboard.\n• Completely customize button mappings on a per-system, per-controller basis.\n• Map buttons to special “Quick Save”, “Quick Load,” and “Fast Forward” actions.\n\nSave States\n• Save and load save states for any game from the pause menu.\n• Lock save states to prevent them from being accidentally overwritten.\n• Automatically makes backup save states to ensure you never lose your progress.\n• Support for “Quick Saves,” save states that can be quickly saved/loaded with a single button press (requires external controller).\n\nCheats\n• Supports various types of cheat codes for each supported system:\n• NES: Game Genie\n• SNES: Game Genie, Pro Action Replay\n• N64: GameShark\n• GBC: Game Genie, GameShark\n• GBA: Action Replay, Code Breaker, GameShark\n• DS: Action Replay\n\nDelta Sync\n• Sync your games, game saves, save states, cheats, controller skins, and controller mappings between devices.\n• View version histories of everything you sync and optionally restore them to earlier versions.\n• Supports both Google Drive and Dropbox.\n\nCustom Controller Skins\n• Beautiful built-in controller skins for all systems.\n• Import controller skins made by others, or even make your own to share with the world!\n\nHold Button\n• Choose buttons for Delta to hold down on your behalf, freeing up your thumbs to press other buttons instead.\n• Perfect for games that typically require one button be held down constantly (ex: run button in Mario games, or the A button in Mario Kart).\n\nFast Forward\n• Speed through slower parts of games by running the game much faster than normal.\n• Easily enable or disable from the pause menu, or optionally with a mapped button on an external controller.\n\n3D/Haptic Touch\n• Use 3D or Haptic Touch to “peek” at games, save states, and cheat codes.\n• App icon shortcuts allow quick access to your most recently played games, or optionally customize the shortcuts to always include certain games.\n\nGame Artwork\n• Automatically displays appropriate box art for imported games.\n• Change a game’s artwork to anything you want, or select from the built-in game artwork database.\n\nMisc.\n• Gyroscope support (WarioWare: Twisted! only)\n• Microphone support (DS only)\n• Support for delta:// URL scheme to jump directly into a specific game.\n\n**Delta and AltStore LLC are in no way affiliated with Nintendo. The name \"Nintendo\" and all associated game console names are registered trademarks of Nintendo Co., Ltd.**",
-      "iconURL": "https://user-images.githubusercontent.com/705880/63391976-4d311700-c37a-11e9-91a8-4fb0c454413d.png",
-      "tintColor": "8A28F7",
-      "size": 19739373,
-      "permissions": [
-        {
-          "type": "photos",
-          "usageDescription": "Allows Delta to use images from your Photo Library as game artwork."
-        }
-      ],
-      "screenshotURLs": [
-        "https://user-images.githubusercontent.com/705880/65600448-f7d9be00-df54-11e9-9e3e-d4c31296da94.PNG",
-        "https://user-images.githubusercontent.com/705880/65813009-f2ae8600-e183-11e9-9eb7-704effc11173.png",
-        "https://user-images.githubusercontent.com/705880/65601117-58b5c600-df56-11e9-9c19-9a5ba5da54cf.PNG",
-        "https://user-images.githubusercontent.com/705880/65601125-5b182000-df56-11e9-9e7e-261480e893c0.PNG"
-      ]
-    },
-    {
-      "name": "Delta",
-      "bundleIdentifier": "com.rileytestut.Delta.Beta",
-      "developerName": "Riley Testut",
-      "subtitle": "Classic games in your pocket.",
-      "version": "1.4b2",
-      "versionDate": "2022-08-16T08:00:00-05:00",
-      "versionDescription": "NEW\n• Supports Split View and Stage Manager multitasking on iPad\n• Automatically pauses + resumes emulation when switching between foreground apps with Stage Manager\n• Optimized full screen-width controller skins when using Split View, Slide Over, or Stage Manager\n• Supports controller skins with new `placement` parameter\n• Supports controller skins with custom screens that don’t have explicit `outputFrame`\n\nFIXED\n• Fixed not detecting keyboard presses when remapping inputs\n• Fixed potential crash rendering game screen after changing EAGLContext\n• Fixed incorrect game screen frame when software keyboard appears on iOS 16\n• Fixed software keyboard sometimes appearing when not emulating anything",
-      "downloadURL": "https://cdn.altstore.io/file/altstore/apps/delta/1_4_b2.ipa",
-      "localizedDescription": "The next consoles for Delta are coming: this beta version of Delta brings support for playing Nintendo DS and Sega Genesis games!\n\nPlease report any issues you find to support@altstore.io. Thanks!",
-      "iconURL": "https://user-images.githubusercontent.com/705880/63391976-4d311700-c37a-11e9-91a8-4fb0c454413d.png",
-      "tintColor": "8A28F7",
-      "size": 42968657,
-      "beta": true,
-      "permissions": [
-        {
-          "type": "photos",
-          "usageDescription": "Allows Delta to use images from your Photo Library as game artwork."
-        }
-      ],
-      "screenshotURLs": [
-        "https://user-images.githubusercontent.com/705880/65600448-f7d9be00-df54-11e9-9e3e-d4c31296da94.PNG",
-        "https://user-images.githubusercontent.com/705880/65601942-e5ad4f00-df57-11e9-9255-1463e0296e46.PNG",
-        "https://user-images.githubusercontent.com/705880/65813009-f2ae8600-e183-11e9-9eb7-704effc11173.png",
-        "https://user-images.githubusercontent.com/705880/65601117-58b5c600-df56-11e9-9c19-9a5ba5da54cf.PNG"
-      ]
-    },
-    {
-      "name": "Clip",
-      "bundleIdentifier": "com.rileytestut.Clip",
-      "subtitle": "Manage your clipboard history with ease.",
-      "developerName": "Riley Testut",
-      "version": "1.0",
-      "versionDate": "2020-06-17T12:30:00-07:00",
-      "versionDescription": "Initial version 🎉",
-      "downloadURL": "https://f000.backblazeb2.com/file/altstore/apps/clip/1_0.ipa",
-      "localizedDescription": "Clip is a simple clipboard manager for iOS. \n\nUnlike other clipboard managers, Clip can continue monitoring your clipboard while in the background. No longer do you need to remember to manually open or share to an app to save your clipboard; just copy and paste as you would normally do, and Clip will have your back.\n\nIn addition to background monitoring, Clip also has these features:\n\n• Save text, URLs, and images copied to the clipboard.\n• Copy, delete, or share any clippings saved to Clip.\n• Customizable history limit.\n\nDownload Clip today, and never worry about losing your clipboard again!",
-      "iconURL": "https://user-images.githubusercontent.com/705880/63391981-5326f800-c37a-11e9-99d8-760fd06bb601.png",
-      "tintColor": "EC008C",
-      "size": 445056,
-      "permissions": [
-        {
-          "type": "background-audio",
-          "usageDescription": "Allows Clip to continuously monitor your clipboard in the background."
-        }
-      ],
-      "screenshotURLs": [
-        "https://user-images.githubusercontent.com/705880/63391950-34286600-c37a-11e9-965f-832efe3da507.png",
-        "https://user-images.githubusercontent.com/705880/70830209-8e738980-1da4-11ea-8b3b-6e5fbc78adff.png"
-      ]
-    },
-    {
-      "name": "Clip",
-      "bundleIdentifier": "com.rileytestut.Clip.Beta",
-      "subtitle": "Manage your clipboard history with ease.",
-      "developerName": "Riley Testut",
-      "version": "1.1b1",
-      "versionDate": "2020-06-17T12:30:00-07:00",
-      "versionDescription": "This update adds a Custom Keyboard app extension for quick access to clippings when editing text.\n\nTo enable the keyboard, go to Settings > General > Keyboard > Keyboards > Add New Keyboard... and add \"ClipBoard\". Once added, make sure to then enable \"Allow Full Access\" for ClipBoard so it can access your clippings.",
-      "downloadURL": "https://f000.backblazeb2.com/file/altstore/apps/clip/1_1_b1.ipa",
-      "localizedDescription": "Clip is a simple clipboard manager for iOS. \n\nUnlike other clipboard managers, Clip can continue monitoring your clipboard while in the background. No longer do you need to remember to manually open or share to an app to save your clipboard; just copy and paste as you would normally do, and Clip will have your back.\n\nIn addition to background monitoring, Clip also has these features:\n\n• Save text, URLs, and images copied to the clipboard.\n• Copy, delete, or share any clippings saved to Clip.\n• Customizable history limit.\n\nDownload Clip today, and never worry about losing your clipboard again!",
-      "iconURL": "https://user-images.githubusercontent.com/705880/63391981-5326f800-c37a-11e9-99d8-760fd06bb601.png",
-      "tintColor": "EC008C",
-      "size": 462771,
-      "beta": true,
-      "permissions": [
-        {
-          "type": "background-audio",
-          "usageDescription": "Allows Clip to continuously monitor your clipboard in the background."
-        }
-      ],
-      "screenshotURLs": [
-        "https://user-images.githubusercontent.com/705880/63391950-34286600-c37a-11e9-965f-832efe3da507.png",
-        "https://user-images.githubusercontent.com/705880/70830209-8e738980-1da4-11ea-8b3b-6e5fbc78adff.png",
-        "https://user-images.githubusercontent.com/705880/84842227-70a80b00-aff9-11ea-8b04-bedb1f49c4a7.PNG",
-        "https://user-images.githubusercontent.com/705880/84842231-7271ce80-aff9-11ea-9272-e128aeceb95b.PNG"
-      ]
-    }
-  ],
-  "news": [
-    {
-      "title": "Delta Gaining DS Support",
-      "identifier": "delta-ds-support",
-      "caption": "Available this Saturday for patrons, coming soon for everyone else.",
-      "tintColor": "8A28F7",
-      "imageURL": "https://user-images.githubusercontent.com/705880/65603159-0676a400-df5a-11e9-882e-dc5566f4d50a.png",
-      "date": "2019-09-25",
-      "notify": false
-    },
-    {
-      "title": "Delta Now Available",
-      "identifier": "delta-now-available",
-      "caption": "Finally, relive your favorite NES, SNES, GB(C), GBA, and N64 games.",
-      "tintColor": "8A28F7",
-      "imageURL": "https://user-images.githubusercontent.com/705880/65604130-c1ec0800-df5b-11e9-8150-7657c474e3c3.png",
-      "appID": "com.rileytestut.Delta",
-      "date": "2019-09-28",
-      "notify": true
-    },
-    {
-      "title": "Sideloading is Here!",
-      "identifier": "sideloading-is-here",
-      "caption": "Update to AltStore 1.3 to install any app directly from Files.",
-      "tintColor": "018084",
-      "imageURL": "https://user-images.githubusercontent.com/705880/79022069-02932380-7b32-11ea-8bad-49907cb97ece.png",
-      "date": "2020-04-10T13:00:00-07:00",
-      "notify": true
-    },
-    {
-      "title": "iOS 13.4 Fixes App Crashes",
-      "identifier": "ios-13-4-now-available",
-      "caption": "Update to iOS 13.4 to fix some sideloaded apps crashing on launch.",
-      "tintColor": "34C759",
-      "date": "2020-04-10T13:30:00-07:00",
-      "notify": false
-    },
-    {
-      "title": "Clip Now Available!",
-      "identifier": "clip-now-available",
-      "caption": "Finally, a clipboard manager that can run in the background — no jailbreak required.",
-      "tintColor": "EC008C",
-      "imageURL": "https://user-images.githubusercontent.com/705880/65606598-04afdf00-df60-11e9-8f93-af6345d39557.png",
-      "appID": "com.rileytestut.Clip",
-      "date": "2020-06-17",
-      "notify": true
-    },
-    {
-      "title": "Delta, Meet Nintendo DS",
-      "identifier": "delta-meet-ds",
-      "caption": "Update to Delta 1.3 to relive all your favorite Nintendo DS games.",
-      "tintColor": "8A28F7",
-      "imageURL": "https://user-images.githubusercontent.com/705880/115617602-6ce2b600-a2a6-11eb-984e-2197a30c71e2.png",
-      "appID": "com.rileytestut.Delta",
-      "date": "2021-04-21",
-      "notify": true
-    },
-    {
-      "title": "#StandWithUkraine",
-      "identifier": "support-ukraine",
-      "caption": "Find out how you can help support those impacted by the Russian invasion.",
-      "tintColor": "003e80",
-      "imageURL": "https://user-images.githubusercontent.com/705880/156053447-a158cac7-df5f-4497-8025-15c3c2e10b48.png",
-      "url": "https://linktr.ee/razomforukraine",
-      "date": "2022-03-01",
-      "notify": false
-    },
-    {
-      "title": "The Biggest AltServer Update Yet!",
-      "identifier": "altserver-1-5",
-      "caption": "Update to AltServer 1.5 to use AltJIT and other exciting new features.",
-      "tintColor": "018084",
-      "imageURL": "https://user-images.githubusercontent.com/705880/166509576-744be578-6868-4b7d-b4fd-b9418c084327.png",
-      "url": "https://faq.altstore.io/release-notes/altserver",
-      "date": "2022-05-03",
-      "notify": true
-    },
-    {
-      "title": "More Apps in AltStore!",
-      "identifier": "trusted-sources",
-      "caption": "Update to AltStore 1.5 to easily download some of our favorite apps.",
-      "tintColor": "00CAB3",
-      "imageURL": "https://user-images.githubusercontent.com/705880/167026375-ddcb004f-7160-405c-b3e3-87a6795d2f43.png",
-      "url": "https://faq.altstore.io/release-notes/altstore",
-      "date": "2022-05-05",
-      "notify": true
-    },
-    {
-      "title": "New to AltStore?",
-      "identifier": "updated-faq",
-      "caption": "Check out our updated guide to learn how to sideload apps!",
-      "tintColor": "018084",
-      "url": "https://faq.altstore.io",
-      "date": "2022-07-28",
-      "notify": false
-    }
-  ],
-  "userInfo": {
-    "patreonAccessToken": "uqoDoTxH8dY1ImE8tK76wxrzKk67gjyjBAcK8sD3RLU"
-  }
-}

AltStore/Settings.bundle/Root.plist

@@ -16,15 +16,13 @@
 			<key>Key</key>
 			<string>customAnisetteURL</string>
 			<key>DefaultValue</key>
-			<string>http://ani.sidestore.io</string>
+			<string>https://ani.sidestore.io</string>
 			<key>Titles</key>
 			<array>
 				<string>SideStore</string>
 				<string>Macley (US)</string>
 				<string>Macley (DE)</string>
 				<string>DrPudding</string>
-				<string>jkcoxson (AltServer)</string>
-				<string>jkcoxson (Provision)</string>
 				<string>Sideloadly</string>
 				<string>Nick</string>
 				<string>Jawshoeadan</string>
@@ -32,12 +30,10 @@
 			</array>
 			<key>Values</key>
 			<array>
-				<string>http://ani.sidestore.io</string>
+				<string>https://ani.sidestore.io</string>
-				<string>http://us1.sternserv.tech</string>
+				<string>http://5.249.163.88:6969/</string>
-				<string>http://de1.sternserv.tech</string>
+				<string>http://45.132.246.138:6969/</string>
 				<string>https://sign.rheaa.xyz</string>
-				<string>http://jkcoxson.com:2095</string>
-				<string>http://jkcoxson.com:2052</string>
 				<string>https://sideloadly.io/anisette/irGb3Quww8zrhgqnzmrx</string>
 				<string>http://45.33.29.114</string>
 				<string>https://anisette.jawshoeadan.me</string>

AltStore/Settings/AboutPatreonHeaderView.xib

@@ -1,27 +1,27 @@
 <?xml version="1.0" encoding="UTF-8"?>
-<document type="com.apple.InterfaceBuilder3.CocoaTouch.XIB" version="3.0" toolsVersion="21225" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
+<document type="com.apple.InterfaceBuilder3.CocoaTouch.XIB" version="3.0" toolsVersion="21507" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES">
     <device id="retina6_1" orientation="portrait" appearance="light"/>
     <dependencies>
         <deployment identifier="iOS"/>
-        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21207"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21505"/>
         <capability name="Named colors" minToolsVersion="9.0"/>
         <capability name="documents saved in the Xcode 8 format" minToolsVersion="8.0"/>
     </dependencies>
     <objects>
         <placeholder placeholderIdentifier="IBFilesOwner" id="-1" userLabel="File's Owner"/>
         <placeholder placeholderIdentifier="IBFirstResponder" id="-2" customClass="UIResponder"/>
-        <collectionReusableView opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" insetsLayoutMarginsFromSafeArea="NO" reuseIdentifier="AboutHeader" id="xq2-Pl-zaG" customClass="AboutPatreonHeaderView" customModule="AltStore" customModuleProvider="target">
+        <collectionReusableView opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" insetsLayoutMarginsFromSafeArea="NO" reuseIdentifier="AboutHeader" id="xq2-Pl-zaG" customClass="AboutPatreonHeaderView" customModule="SideStore" customModuleProvider="target">
-            <rect key="frame" x="0.0" y="0.0" width="375" height="445"/>
+            <rect key="frame" x="0.0" y="0.0" width="390" height="682"/>
             <autoresizingMask key="autoresizingMask"/>
             <subviews>
                 <stackView opaque="NO" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" axis="vertical" spacing="25" translatesAutoresizingMaskIntoConstraints="NO" id="XiA-Jf-XMp">
-                    <rect key="frame" x="16" y="2" width="343" height="393"/>
+                    <rect key="frame" x="16" y="2" width="358" height="630"/>
                     <subviews>
                         <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="5Ol-zN-wYv">
-                            <rect key="frame" x="0.0" y="0.0" width="343" height="317"/>
+                            <rect key="frame" x="0.0" y="0.0" width="358" height="426"/>
                             <subviews>
                                 <stackView opaque="NO" contentMode="scaleToFill" alignment="center" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="f7H-EV-7Sx">
-                                    <rect key="frame" x="0.0" y="0.0" width="343" height="55"/>
+                                    <rect key="frame" x="0.0" y="0.0" width="358" height="55"/>
                                     <subviews>
                                         <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="SideStore" translatesAutoresizingMaskIntoConstraints="NO" id="pn6-Ic-MJm">
                                             <rect key="frame" x="0.0" y="0.0" width="55" height="55"/>
@@ -31,7 +31,7 @@
                                             </constraints>
                                         </imageView>
                                         <stackView opaque="NO" contentMode="scaleToFill" distribution="equalSpacing" spacing="10" translatesAutoresizingMaskIntoConstraints="NO" id="si2-MA-3RH">
-                                            <rect key="frame" x="65" y="0.0" width="278" height="55"/>
+                                            <rect key="frame" x="65" y="0.0" width="293" height="55"/>
                                             <subviews>
                                                 <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="2" translatesAutoresizingMaskIntoConstraints="NO" id="hkS-oz-wiT">
                                                     <rect key="frame" x="0.0" y="0.0" width="83" height="55"/>
@@ -51,7 +51,7 @@
                                                     </subviews>
                                                 </stackView>
                                                 <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="2" translatesAutoresizingMaskIntoConstraints="NO" id="TFB-qo-cbh">
-                                                    <rect key="frame" x="195" y="0.0" width="83" height="55"/>
+                                                    <rect key="frame" x="210" y="0.0" width="83" height="55"/>
                                                     <subviews>
                                                         <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="Zpb-k3-y7l">
                                                             <rect key="frame" x="0.0" y="0.0" width="83" height="50"/>
@@ -75,11 +75,13 @@
                                     </constraints>
                                 </stackView>
                                 <textView clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="scaleToFill" scrollEnabled="NO" editable="NO" textAlignment="natural" selectable="NO" translatesAutoresizingMaskIntoConstraints="NO" id="FeG-e5-LJl">
-                                    <rect key="frame" x="0.0" y="65" width="343" height="252"/>
+                                    <rect key="frame" x="0.0" y="65" width="358" height="361"/>
                                     <color key="backgroundColor" white="1" alpha="0.13" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
-                                    <string key="text">Hello, thank you for using SideStore!
+                                    <string key="text">Thank you for using SideStore!
         
-If you would subscribe to the patreon that would support us and make sure we can continue developing SideStore for you.
+Subscribing to the patreon supports us and makes sure we can continue developing SideStore for you.
+    
+Following us on social media allows us to give quick updates and spread the word about sideloading!
         
 -SideTeam</string>
                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -89,10 +91,10 @@ If you would subscribe to the patreon that would support us and make sure we can
                             </subviews>
                         </stackView>
                         <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="13" translatesAutoresizingMaskIntoConstraints="NO" id="QS9-vO-bj8">
-                            <rect key="frame" x="0.0" y="342" width="343" height="51"/>
+                            <rect key="frame" x="0.0" y="451" width="358" height="179"/>
                             <subviews>
                                 <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="yEi-L6-kQ8">
-                                    <rect key="frame" x="0.0" y="0.0" width="343" height="51"/>
+                                    <rect key="frame" x="0.0" y="0.0" width="358" height="51"/>
                                     <color key="backgroundColor" name="SettingsHighlighted"/>
                                     <constraints>
                                         <constraint firstAttribute="height" constant="51" id="l4o-vb-cMy"/>
@@ -102,6 +104,28 @@ If you would subscribe to the patreon that would support us and make sure we can
                                         <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                     </state>
                                 </button>
+                                <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="hov-Ce-LaM" userLabel="Twitter Button">
+                                    <rect key="frame" x="0.0" y="64" width="358" height="51"/>
+                                    <color key="backgroundColor" name="SettingsHighlighted"/>
+                                    <constraints>
+                                        <constraint firstAttribute="height" constant="51" id="m0M-GX-KKG"/>
+                                    </constraints>
+                                    <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="19"/>
+                                    <state key="normal" title="Follow us on Twitter!">
+                                        <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                    </state>
+                                </button>
+                                <button opaque="NO" contentMode="scaleToFill" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="VdY-7Q-amF" userLabel="Twitter Button">
+                                    <rect key="frame" x="0.0" y="128" width="358" height="51"/>
+                                    <color key="backgroundColor" name="SettingsHighlighted"/>
+                                    <constraints>
+                                        <constraint firstAttribute="height" constant="51" id="kDo-b8-6tZ"/>
+                                    </constraints>
+                                    <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="19"/>
+                                    <state key="normal" title="Follow us on Instagram!">
+                                        <color key="titleColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                    </state>
+                                </button>
                             </subviews>
                         </stackView>
                     </subviews>
@@ -114,19 +138,21 @@ If you would subscribe to the patreon that would support us and make sure we can
                 <constraint firstItem="XiA-Jf-XMp" firstAttribute="top" secondItem="xq2-Pl-zaG" secondAttribute="top" constant="2" id="j8p-JX-Dcz"/>
             </constraints>
             <connections>
+                <outlet property="instagramButton" destination="VdY-7Q-amF" id="5kj-9x-k4F"/>
                 <outlet property="rileyImageView" destination="pn6-Ic-MJm" id="60i-Q0-ojz"/>
                 <outlet property="rileyLabel" destination="DTd-Yu-HXr" id="O0y-JB-gWp"/>
                 <outlet property="shaneLabel" destination="Zpb-k3-y7l" id="aQN-6B-s5T"/>
                 <outlet property="supportButton" destination="yEi-L6-kQ8" id="Dzo-vd-SnD"/>
                 <outlet property="textView" destination="FeG-e5-LJl" id="K0M-lF-I6u"/>
+                <outlet property="twitterButton" destination="hov-Ce-LaM" id="gib-Lt-qtY"/>
             </connections>
-            <point key="canvasLocation" x="138" y="138"/>
+            <point key="canvasLocation" x="147.82608695652175" y="58.258928571428569"/>
         </collectionReusableView>
     </objects>
     <resources>
-        <image name="SideStore" width="180" height="180"/>
+        <image name="SideStore" width="1024" height="1024"/>
         <namedColor name="SettingsHighlighted">
-            <color red="0.23529411764705882" green="0.0" blue="0.40392156862745099" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.38823529411764707" green="0.011764705882352941" blue="0.58823529411764708" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
     </resources>
 </document>

AltStore/Settings/PatreonComponents.swift

@@ -56,6 +56,8 @@ final class PatronsFooterView: UICollectionReusableView
 final class AboutPatreonHeaderView: UICollectionReusableView
 {
     @IBOutlet var supportButton: UIButton!
+    @IBOutlet var twitterButton: UIButton!
+    @IBOutlet var instagramButton: UIButton!
     @IBOutlet var accountButton: UIButton!
     @IBOutlet var textView: UITextView!
     
@@ -79,12 +81,12 @@ final class AboutPatreonHeaderView: UICollectionReusableView
             imageView.layer.cornerRadius = imageView.bounds.midY
         }
         
-        for button in [self.supportButton, self.accountButton].compactMap({ $0 })
+        for button in [self.supportButton, self.accountButton, self.twitterButton, self.instagramButton].compactMap({ $0 })
         {
             button.clipsToBounds = true
             button.layer.cornerRadius = 16
         }
-    }
+}
     
     override func layoutMarginsDidChange()
     {

AltStore/Settings/PatreonViewController.swift

@@ -111,7 +111,9 @@ private extension PatreonViewController
         headerView.layoutMargins = self.view.layoutMargins
         
         headerView.supportButton.addTarget(self, action: #selector(PatreonViewController.openPatreonURL(_:)), for: .primaryActionTriggered)
-        
+        headerView.twitterButton.addTarget(self, action: #selector(PatreonViewController.openTwitterURL(_:)), for: .primaryActionTriggered)
+        headerView.instagramButton.addTarget(self, action: #selector(PatreonViewController.openInstagramURL(_:)), for: .primaryActionTriggered)
+
         let defaultSupportButtonTitle = NSLocalizedString("Become a patron", comment: "")
         let isPatronSupportButtonTitle = NSLocalizedString("View Patreon", comment: "")
         
@@ -180,6 +182,24 @@ private extension PatreonViewController
         self.present(safariViewController, animated: true, completion: nil)
     }
     
+    @objc func openTwitterURL(_ sender: UIButton)
+    {
+        let twitterURL = URL(string: "https://twitter.com/SideStore_io")!
+        
+        let safariViewController = SFSafariViewController(url: twitterURL)
+        safariViewController.preferredControlTintColor = self.view.tintColor
+        self.present(safariViewController, animated: true, completion: nil)
+    }
+    
+    @objc func openInstagramURL(_ sender: UIButton)
+    {
+        let twitterURL = URL(string: "https://instagram.com/sidestore.io")!
+        
+        let safariViewController = SFSafariViewController(url: twitterURL)
+        safariViewController.preferredControlTintColor = self.view.tintColor
+        self.present(safariViewController, animated: true, completion: nil)
+    }
+    
     @IBAction func authenticate(_ sender: UIBarButtonItem)
     {
         PatreonAPI.shared.authenticate { (result) in

AltStore/Settings/Settings.storyboard

@@ -21,7 +21,7 @@
                         <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
-                            <rect key="frame" x="0.0" y="1082" width="375" height="25"/>
+                            <rect key="frame" x="0.0" y="1245" width="375" height="25"/>
                             <autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
                             <fontDescription key="fontDescription" type="system" pointSize="17"/>
                             <color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -167,8 +167,8 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Join the beta" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="3Il-5a-5Zp">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Support the team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="3Il-5a-5Zp">
-                                                    <rect key="frame" x="30" y="15.5" width="106" height="20.5"/>
+                                                    <rect key="frame" x="30" y="15.5" width="142.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
@@ -359,22 +359,22 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
                                                     <rect key="frame" x="30" y="15.5" width="89" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
+                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
                                                     <rect key="frame" x="198" y="15.5" width="147" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
                                                             <rect key="frame" x="0.0" y="0.0" width="115" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
                                                             <rect key="frame" x="129" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
@@ -403,22 +403,22 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Asset Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="fGU-Fp-XgM">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Asset Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="fGU-Fp-XgM">
                                                     <rect key="frame" x="30" y="15.5" width="115.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="R8B-DW-7mY">
+                                                <stackView opaque="NO" contentMode="scaleToFill" ambiguous="YES" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="R8B-DW-7mY">
                                                     <rect key="frame" x="206" y="15.5" width="139" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Chris (LitRitt)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hId-3P-41T">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Chris (LitRitt)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hId-3P-41T">
                                                             <rect key="frame" x="0.0" y="0.0" width="107" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
-                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="baq-cE-fMY">
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="baq-cE-fMY">
                                                             <rect key="frame" x="121" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
@@ -447,13 +447,13 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Licenses" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="D6b-cd-pVK">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Licenses" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="D6b-cd-pVK">
                                                     <rect key="frame" x="30" y="15.5" width="67.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="s79-GQ-khr">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="s79-GQ-khr">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -487,13 +487,13 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Send Feedback" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="pMI-Aj-nQF">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Send Feedback" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="pMI-Aj-nQF">
                                                     <rect key="frame" x="30" y="15.5" width="125.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Jyy-x0-Owj">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Jyy-x0-Owj">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -520,13 +520,13 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="View Refresh Attempts" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="sni-07-q0M">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="View Refresh Attempts" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="sni-07-q0M">
                                                     <rect key="frame" x="30" y="15.5" width="187.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="4d3-me-Hqc">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="4d3-me-Hqc">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -556,13 +556,13 @@
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="View Error Log" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PWC-OG-5jx">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="View Error Log" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PWC-OG-5jx">
                                                     <rect key="frame" x="30" y="15.5" width="119" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="VfB-c5-5wG">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="VfB-c5-5wG">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -582,23 +582,56 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                         </userDefinedRuntimeAttributes>
                                         <connections>
-                                            <segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="SSW-vL-86I"/>
+                                            <segue destination="g8a-Rf-zWa" kind="show" id="vFC-Id-Ww6"/>
                                         </connections>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="eZ3-BT-q4D" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
                                         <rect key="frame" x="0.0" y="1023" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="eZ3-BT-q4D" id="17m-VV-hzf">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Clear Cache" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="IbH-V1-ce3">
+                                                    <rect key="frame" x="30" y="15.5" width="98.5" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="FZe-BJ-fOm">
+                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
+                                                </imageView>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="FZe-BJ-fOm" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="bGv-Np-5aO"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="FZe-BJ-fOm" secondAttribute="trailing" id="ccb-JP-Eqi"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="centerY" secondItem="17m-VV-hzf" secondAttribute="centerY" id="iQJ-gN-sRF"/>
+                                                <constraint firstItem="IbH-V1-ce3" firstAttribute="leading" secondItem="17m-VV-hzf" secondAttribute="leadingMargin" id="m1g-Y6-aT5"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="VNn-u4-cN8" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="VNn-u4-cN8" id="4bh-qe-l2N">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251"  text="Reset Pairing File" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ysS-9s-dXm">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Reset Pairing File" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ysS-9s-dXm">
                                                     <rect key="frame" x="30" y="15.5" width="140" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="r09-mH-pOD">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="r09-mH-pOD">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -618,20 +651,53 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="e7s-hL-kv9" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="1125" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="e7s-hL-kv9" id="yjL-Mu-HTk">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Reset adi.pb" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="eds-Dj-36y">
+                                                    <rect key="frame" x="30" y="15.5" width="102" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="0dh-yd-7i9">
+                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
+                                                </imageView>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="0dh-yd-7i9" firstAttribute="centerY" secondItem="yjL-Mu-HTk" secondAttribute="centerY" id="8OI-PI-weT"/>
+                                                <constraint firstItem="eds-Dj-36y" firstAttribute="leading" secondItem="yjL-Mu-HTk" secondAttribute="leadingMargin" id="BqG-Ef-xQo"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="0dh-yd-7i9" secondAttribute="trailing" id="TFW-nu-jo4"/>
+                                                <constraint firstItem="eds-Dj-36y" firstAttribute="centerY" secondItem="yjL-Mu-HTk" secondAttribute="centerY" id="YiJ-OF-FXE"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="2"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
                                     <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="1074" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="1176" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Advanced Settings" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="OcM-OM-uDE">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" text="Advanced Settings" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="OcM-OM-uDE">
                                                     <rect key="frame" x="30" y="15.5" width="154" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Pcu-Sy-yfZ">
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" ambiguous="YES" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Pcu-Sy-yfZ">
                                                     <rect key="frame" x="327" y="16.5" width="18" height="18"/>
                                                 </imageView>
                                             </subviews>
@@ -884,7 +950,7 @@ Settings by i cons from the Noun Project</string>
             </objects>
             <point key="canvasLocation" x="1697" y="313"/>
         </scene>
-        <!--Patreon-->
+        <!--Support us-->
         <scene sceneID="Lnh-9P-HnL">
             <objects>
                 <collectionViewController id="dp8-8j-vt9" customClass="PatreonViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
@@ -931,7 +997,7 @@ Settings by i cons from the Noun Project</string>
                             <outlet property="delegate" destination="dp8-8j-vt9" id="790-Kr-6l7"/>
                         </connections>
                     </collectionView>
-                    <navigationItem key="navigationItem" title="Patreon" largeTitleDisplayMode="always" id="uUV-1f-xEq"/>
+                    <navigationItem key="navigationItem" title="Support us" largeTitleDisplayMode="always" id="uUV-1f-xEq"/>
                 </collectionViewController>
                 <placeholder placeholderIdentifier="IBFirstResponder" id="qq3-Hj-S9f" userLabel="First Responder" sceneMemberID="firstResponder"/>
             </objects>

AltStore/Settings/SettingsViewController.swift

@@ -53,8 +53,11 @@ extension SettingsViewController
         case sendFeedback
         case refreshAttempts
         case errorLog
+        case clearCache
         case resetPairingFile
+        case resetAdiPb
         case advancedSettings
+    
     }
 }
 
@@ -177,11 +180,11 @@ private extension SettingsViewController
         case .patreon:
             if isHeader
             {
-                settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("PATREON", comment: "")
+                settingsHeaderFooterView.primaryLabel.text = NSLocalizedString("SUPPORT US", comment: "")
             }
             else
             {
-                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Support the SideStore Team by becoming a patron!", comment: "")
+                settingsHeaderFooterView.secondaryLabel.text = NSLocalizedString("Support the SideStore Team by following our socials or becoming a patron!", comment: "")
             }
 
         case .account:
@@ -290,6 +293,39 @@ private extension SettingsViewController
         self.present(viewController, animated: true, completion: nil)
     }
     
+    func clearCache()
+    {
+        let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to clear SideStore's cache?", comment: ""),
+                                                message: NSLocalizedString("This will remove all temporary files as well as backups for uninstalled apps.", comment: ""),
+                                                preferredStyle: .actionSheet)
+        alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { [weak self] _ in
+            self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+        })
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Clear Cache", comment: ""), style: .destructive) { [weak self] _ in
+            AppManager.shared.clearAppCache { result in
+                DispatchQueue.main.async {
+                    self?.tableView.indexPathForSelectedRow.map { self?.tableView.deselectRow(at: $0, animated: true) }
+                    
+                    switch result
+                    {
+                    case .success: break
+                    case .failure(let error):
+                        let alertController = UIAlertController(title: NSLocalizedString("Unable to Clear Cache", comment: ""), message: error.localizedDescription, preferredStyle: .alert)
+                        alertController.addAction(.ok)
+                        self?.present(alertController, animated: true)
+                    }
+                }
+            }
+        })
+        
+        if let popoverController = alertController.popoverPresentationController {
+            popoverController.sourceView = self.view
+            popoverController.sourceRect = CGRect(x: self.view.bounds.midX, y: self.view.bounds.midY, width: 0, height: 0)
+        }
+        
+        self.present(alertController, animated: true)
+    }
+    
     @IBAction func handleDebugModeGesture(_ gestureRecognizer: UISwipeGestureRecognizer)
     {
         self.debugGestureCounter += 1
@@ -469,6 +505,7 @@ extension SettingsViewController
                 self.addRefreshAppsShortcut()
             }
             
+            
         case .credits:
             let row = CreditsRow.allCases[indexPath.row]
             switch row
@@ -506,6 +543,9 @@ extension SettingsViewController
                     let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
                     toastView.show(in: self)
                 }
+                
+            case .clearCache: self.clearCache()
+
             case .resetPairingFile:
                 let filename = "ALTPairingFile.mobiledevicepairing"
                 let fm = FileManager.default
@@ -530,6 +570,25 @@ extension SettingsViewController
                 alertController.popoverPresentationController?.sourceRect = self.tableView.rectForRow(at: indexPath)
                 self.present(alertController, animated: true)
                 self.tableView.deselectRow(at: indexPath, animated: true)
+            case .resetAdiPb:
+                let alertController = UIAlertController(
+                    title: NSLocalizedString("Are you sure you want to reset the adi.pb file?", comment: ""),
+                    message: NSLocalizedString("The adi.pb file is used to generate anisette data, which is required to log into an Apple ID. If you are having issues with account related things, you can try this. However, you will be required to do 2FA again. This will do nothing if you are using an older anisette server.", comment: ""),
+                    preferredStyle: UIAlertController.Style.actionSheet)
+                
+                alertController.addAction(UIAlertAction(title: NSLocalizedString("Reset adi.pb", comment: ""), style: .destructive){ _ in
+                    if Keychain.shared.adiPb != nil {
+                        Keychain.shared.adiPb = nil
+                        print("Cleared adi.pb from keychain")
+                    }
+                    self.tableView.deselectRow(at: indexPath, animated: true)
+                })
+                alertController.addAction(.cancel)
+                //Fix crash on iPad
+                alertController.popoverPresentationController?.sourceView = self.tableView
+                alertController.popoverPresentationController?.sourceRect = self.tableView.rectForRow(at: indexPath)
+                self.present(alertController, animated: true)
+                self.tableView.deselectRow(at: indexPath, animated: true)
             case .advancedSettings:
                 // Create the URL that deep links to your app's custom settings.
                 if let url = URL(string: UIApplication.openSettingsURLString) {
@@ -539,6 +598,7 @@ extension SettingsViewController
                     ELOG("UIApplication.openSettingsURLString invalid")
                 }
             case .refreshAttempts, .errorLog: break
+
             }
             
         default: break

AltStoreCore/Components/Keychain.swift

@@ -77,6 +77,12 @@ public class Keychain
     @KeychainItem(key: "patreonAccountID")
     public var patreonAccountID: String?
     
+    @KeychainItem(key: "identifier")
+    public var identifier: String?
+    
+    @KeychainItem(key: "adiPb")
+    public var adiPb: String?
+    
     private init()
     {
     }

AltStoreCore/Extensions/UserDefaults+AltStore.swift

@@ -42,6 +42,7 @@ public extension UserDefaults
     @NSManaged var patronsRefreshID: String?
     
     @NSManaged var trustedSourceIDs: [String]?
+    @NSManaged var trustedServerURL: String?
     
     var activeAppsLimit: Int? {
         get {

AltStoreCore/Model/InstalledApp.swift

@@ -192,7 +192,7 @@ public extension InstalledApp
     
     class func fetchAppsForRefreshingAll(in context: NSManagedObjectContext) -> [InstalledApp]
     {
-        var predicate = NSPredicate(format: "%K == YES AND %K != %@", #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
+        let predicate = NSPredicate(format: "%K == YES AND %K != %@", #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
         print("Fetch Apps for Refreshing All 'AltStore' predicate: \(String(describing: predicate))")
         
 //        if let patreonAccount = DatabaseManager.shared.patreonAccount(in: context), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
@@ -223,7 +223,7 @@ public extension InstalledApp
         // Date 6 hours before now.
         let date = Date().addingTimeInterval(-1 * 6 * 60 * 60)
         
-        var predicate = NSPredicate(format: "(%K == YES) AND (%K < %@) AND (%K != %@)",
+        let predicate = NSPredicate(format: "(%K == YES) AND (%K < %@) AND (%K != %@)",
                                     #keyPath(InstalledApp.isActive),
                                     #keyPath(InstalledApp.refreshedDate), date as NSDate,
                                     #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)

AltWidget/Assets.xcassets/AltStore.imageset/Contents.json

@@ -5,12 +5,12 @@
       "scale" : "1x"
     },
     {
-      "filename" : "Group 23_120.png",
+      "filename" : "1024.png",
       "idiom" : "universal",
       "scale" : "2x"
     },
     {
-      "filename" : "Group 23_180.png",
+      "filename" : "1024.png",
       "idiom" : "universal",
       "scale" : "3x"
     }

AltWidget/Assets.xcassets/Badge.imageset/Contents.json

@@ -1,7 +1,7 @@
 {
   "images" : [
     {
-      "filename" : "group16Copy2.pdf",
+      "filename" : "sidestore-logo.svg",
       "idiom" : "universal"
     }
   ],

AltWidget/Assets.xcassets/Badge.imageset/sidestore-logo.svg

@@ -0,0 +1,17 @@
+<svg version="1.2" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 100 100" width="100" height="100">
+	<title>sidestore-logo-svg</title>
+	<style>
+		.s0 { fill: none } 
+		.s1 { fill: #bebbb4 } 
+	</style>
+	<g id="Layer">
+		<g id="Layer">
+			<path id="Main" class="s0" />
+			<g id="Main1">
+				<g id="Layer">
+					<path id="Layer" fill-rule="evenodd" class="s1" d="m86 50c0 2.3-1.9 4.2-4.2 4.2h-50.9c-2.3 0-4.2-1.9-4.2-4.2 0-2.3 1.9-4.2 4.2-4.2h50.9c2.3 0 4.2 1.9 4.2 4.2zm-31.8-23.3v2.1c0 3.4-1.3 6.6-3.7 9-2.4 2.4-5.6 3.7-9 3.7h-10.6c-2.2 0-4.4 0.9-5.9 2.5-1.6 1.6-2.5 3.8-2.5 6 0 2.2 0.9 4.4 2.5 6 1.5 1.6 3.7 2.5 5.9 2.5h10.6c3.4 0 6.6 1.3 9 3.7 2.4 2.4 3.7 5.6 3.7 9v10.8c0 1.1-0.4 2.1-1.1 2.8-0.8 0.8-1.8 1.2-2.9 1.2h-0.4c-1.1 0-2.1-0.4-2.9-1.2-0.7-0.7-1.1-1.7-1.1-2.8v-10.8c0-1.1-0.5-2.2-1.3-3-0.8-0.8-1.8-1.3-3-1.3h-10.6c-4.5 0-8.8-1.7-11.9-4.9-3.2-3.2-5-7.5-5-12 0-4.5 1.8-8.8 5-12 3.1-3.2 7.4-4.9 11.9-4.9h10.6c1.2 0 2.2-0.5 3-1.3 0.8-0.8 1.3-1.9 1.3-3v-2.1h-4.3l8.5-12.7 8.5 12.7zm12.7 55.3c0 2.2-1.8 4-4 4h-0.5c-2.2 0-4-1.8-4-4v-19.5c0-2.2 1.8-4 4-4h0.5c2.2 0 4 1.8 4 4z"/>
+				</g>
+			</g>
+		</g>
+	</g>
+</svg>

AltWidget/Assets.xcassets/SmallIcon.imageset/Contents.json

@@ -1,7 +1,7 @@
 {
   "images" : [
     {
-      "filename" : "altminicon.pdf",
+      "filename" : "cir.svg",
       "idiom" : "universal"
     }
   ],

AltWidget/Assets.xcassets/SmallIcon.imageset/cir.svg

@@ -0,0 +1,3 @@
+<svg width="100" height="100" version="1.1" viewBox="0 0 100 100" xmlns="http://www.w3.org/2000/svg">
+ <circle cx="50" cy="50" r="50" fill="#fff" stroke-width=".265"/>
+</svg>

AltWidget/Resources/ReleaseEntitlements.plist

@@ -0,0 +1,16 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
+<plist version="1.0">
+<dict>
+	<key>application-identifier</key>
+	<string>XYZ0123456.com.SideStore.SideStore.AltWidget</string>
+	<key>com.apple.developer.team-identifier</key>
+	<string>XYZ0123456</string>
+	<key>com.apple.security.application-groups</key>
+	<array>
+		<string>group.com.SideStore.SideStore</string>
+	</array>
+	<key>get-task-allow</key>
+	<true/>
+</dict>
+</plist>

Build.xcconfig

@@ -1,8 +1,8 @@
 // Configuration settings file format documentation can be found at:
 // https://help.apple.com/xcode/#/dev745c5c974
 
-MARKETING_VERSION = 0.3.1
+MARKETING_VERSION = 0.5.3
-CURRENT_PROJECT_VERSION = 3021
+CURRENT_PROJECT_VERSION = 5030
 
 // Vars to be overwritten by `CodeSigning.xcconfig` if exists
 DEVELOPMENT_TEAM = S32Z3HMYVQ
@@ -14,11 +14,14 @@ ORG_IDENTIFIER = com.SideStore
 ORG_PREFIX = $(ORG_IDENTIFIER)
 
 PRODUCT_NAME = SideStore
-EXTENSION_PREFIX = $(ORG_PREFIX).SideStore
 //PRODUCT_NAME[configuration=Debug] = Prov Debug
 
 PRODUCT_BUNDLE_IDENTIFIER   = $(ORG_PREFIX).SideStore
-//PRODUCT_BUNDLE_IDENTIFIER[configuration=Debug] = $(ORG_PREFIX).$(PROJECT_NAME:lower)-debug
+// add team ID to bundle ID for debug builds since these will most likely be installed via Xcode
+// SideStore will expect the team ID to be at the end of the bundle ID, but this doesn't happen when we install via Xcode
+// we don't want to do this for release since those builds will most likely be installed via SideServer, which adds the team ID
+PRODUCT_BUNDLE_IDENTIFIER[config=Debug] = $(ORG_PREFIX).SideStore.$(DEVELOPMENT_TEAM)
 
-APP_GROUP_IDENTIFIER        = $(ORG_PREFIX).SideStore
+EXTENSION_PREFIX            = $(PRODUCT_BUNDLE_IDENTIFIER)
+APP_GROUP_IDENTIFIER        = $(PRODUCT_BUNDLE_IDENTIFIER)
 ICLOUD_CONTAINER_IDENTIFIER = iCloud.$(ORG_PREFIX).$(PROJECT_NAME)

CONTRIBUTING.md

@@ -7,7 +7,7 @@ There are many ways to contribute to SideStore, so if you aren't a developer, th
 -   [Writing documentation](https://github.com/SideStore/SideStore-Docs)
 -   [Submitting detailed bug reports and suggesting new features](https://github.com/SideStore/SideStore/issues/new/choose)
 -   Helping out with support
-    -   [Discord](https://discord.gg/RgpFBX3Q3k)
+    -   [Discord](https://discord.gg/sidestore-949183273383395328)
     -   [GitHub Discussions](https://github.com/SideStore/SideStore/discussions)
 
 However, this guide will focus on the development side of things. For now, we will only have setup information here, but you can [join our Discord](https://discord.gg/RgpFBX3Q3k) if you need help

Dependencies/fetch-prebuilt.sh

@@ -16,8 +16,8 @@ check_for_update() {
     LAST_FETCH=`cat .last-prebuilt-fetch-$1 | perl -n -e '/([0-9]*),([^ ]*)$/ && print $1'`
     LAST_COMMIT=`cat .last-prebuilt-fetch-$1 | perl -n -e '/([0-9]*),([^ ]*)$/ && print $2'`
 
-    # fetch if last fetch was over 6 hours ago
+    # fetch if last fetch was over 1 hour ago
-    if [[ $LAST_FETCH -lt $(expr $(date +%s) - 21600) ]] || [[ "$2" == "force" ]]; then
+    if [[ $LAST_FETCH -lt $(expr $(date +%s) - 3600) ]] || [[ "$2" == "force" ]]; then
         echo "Checking $1 for update"
         echo
         LATEST_COMMIT=`curl https://api.github.com/repos/SideStore/$1/releases/latest | perl -n -e '/Commit: https:\\/\\/github\\.com\\/[^\\/]*\\/[^\\/]*\\/commit\\/([^"]*)/ && print $1'`
@@ -27,16 +27,30 @@ check_for_update() {
         if [[ "$LAST_COMMIT" != "$LATEST_COMMIT" ]]; then
             echo "Found update, downloading binaries"
             echo
-            wget -O "$1/lib$1.a" "https://github.com/SideStore/$1/releases/latest/download/lib$1.a"
             wget -O "$1/lib$1-sim.a" "https://github.com/SideStore/$1/releases/latest/download/lib$1-sim.a"
-            wget -O "$1/$1.h" "https://github.com/SideStore/$1/releases/latest/download/$1.h"
+            if [[ "$1" != "minimuxer" ]]; then
-            echo
+                wget -O "$1/lib$1.a" "https://github.com/SideStore/$1/releases/latest/download/lib$1.a"
+                wget -O "$1/$1.h" "https://github.com/SideStore/$1/releases/latest/download/$1.h"
+                echo
+            else
+                wget -O "$1/lib$1-ios.a" "https://github.com/SideStore/$1/releases/latest/download/lib$1-ios.a"
+                wget -O "$1/generated.zip" "https://github.com/SideStore/$1/releases/latest/download/generated.zip"
+                echo
+                echo "Unzipping generated.zip"
+                cd "$1"
+                unzip ./generated.zip
+                mv -v generated/* .
+                rm generated.zip
+                rmdir generated/
+                cd ..
+                echo "Done"
+            fi
         else
             echo "Up-to-date"
         fi
         echo "$(date +%s),$LATEST_COMMIT" > ".last-prebuilt-fetch-$1"
     else
-        echo "It hasn't been 6 hours and force was not specified, skipping update check for $1"
+        echo "It hasn't been 1 hour and force was not specified, skipping update check for $1"
     fi
 }
 

Dependencies/minimuxer.xcodeproj/project.pbxproj

@@ -7,6 +7,7 @@
 	objects = {
 
 /* Begin PBXBuildFile section */
+		9961EC2829BE9C2000AF2C6F /* SwiftBridgeCore.h in Sources */ = {isa = PBXBuildFile; fileRef = 9961EC2729BE9C1200AF2C6F /* SwiftBridgeCore.h */; };
 		9987603329A454B500818586 /* minimuxer.h in Sources */ = {isa = PBXBuildFile; fileRef = 9987603229A454B500818586 /* minimuxer.h */; };
 /* End PBXBuildFile section */
 
@@ -28,12 +29,22 @@
 /* End PBXBuildRule section */
 
 /* Begin PBXFileReference section */
+		9961EC2729BE9C1200AF2C6F /* SwiftBridgeCore.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = SwiftBridgeCore.h; path = minimuxer/SwiftBridgeCore.h; sourceTree = "<group>"; };
 		9987603229A454B500818586 /* minimuxer.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = minimuxer.h; path = minimuxer/minimuxer.h; sourceTree = "<group>"; };
 		ADDEDBA66A6E1 /* libresolv.tbd */ = {isa = PBXFileReference; lastKnownFileType = "sourcecode.text-based-dylib-definition"; name = libresolv.tbd; path = usr/lib/libresolv.tbd; sourceTree = SDKROOT; };
 		CA609C732349C7AAD9FA67C4 /* libminimuxer_static.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer_static.a; sourceTree = BUILT_PRODUCTS_DIR; };
 /* End PBXFileReference section */
 
 /* Begin PBXGroup section */
+		99F87D1529D8E41100B40039 /* Generated */ = {
+			isa = PBXGroup;
+			children = (
+				9961EC2729BE9C1200AF2C6F /* SwiftBridgeCore.h */,
+				9987603229A454B500818586 /* minimuxer.h */,
+			);
+			name = Generated;
+			sourceTree = "<group>";
+		};
 		ADDEDBA66A6E2 /* Required for static linking */ = {
 			isa = PBXGroup;
 			children = (
@@ -61,7 +72,7 @@
 		CA6012A875F9D65BC3C892A8 = {
 			isa = PBXGroup;
 			children = (
-				9987603229A454B500818586 /* minimuxer.h */,
+				99F87D1529D8E41100B40039 /* Generated */,
 				CA6012A875F922869D176AE5 /* Products */,
 				CA6012A875F998AF0B5890DB /* Frameworks */,
 			);
@@ -74,7 +85,7 @@
 			isa = PBXNativeTarget;
 			buildConfigurationList = CA600589A243A560B9642892 /* Build configuration list for PBXNativeTarget "minimuxer-staticlib" */;
 			buildPhases = (
-				9987603629A4611D00818586 /* ShellScript */,
+				9987603629A4611D00818586 /* Run Script */,
 				CA600F638141A560B9642892 /* Sources */,
 				CA6012A875F9AF6EBB7F357C /* Universal Binary lipo */,
 			);
@@ -121,7 +132,7 @@
 /* End PBXProject section */
 
 /* Begin PBXShellScriptBuildPhase section */
-		9987603629A4611D00818586 /* ShellScript */ = {
+		9987603629A4611D00818586 /* Run Script */ = {
 			isa = PBXShellScriptBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
@@ -130,10 +141,15 @@
 			);
 			inputPaths = (
 			);
+			name = "Run Script";
 			outputFileListPaths = (
 			);
 			outputPaths = (
 				./minimuxer/minimuxer.h,
+				./minimuxer/SwiftBridgeCore.h,
+				./minimuxer/minimuxer.swift,
+				./minimuxer/SwiftBridgeCore.swift,
+				"./minimuxer/minimuxer-Bridging-Header.h",
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 			shellPath = /bin/sh;
@@ -166,6 +182,7 @@
 			isa = PBXSourcesBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				9961EC2829BE9C2000AF2C6F /* SwiftBridgeCore.h in Sources */,
 				9987603329A454B500818586 /* minimuxer.h in Sources */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
@@ -182,7 +199,7 @@
 				INSTALL_MODE_FLAG = "";
 				INSTALL_OWNER = "";
 				LIB_FILE_NAME = "";
-				"LIB_FILE_NAME[sdk=iphoneos*]" = libminimuxer;
+				"LIB_FILE_NAME[sdk=iphoneos*]" = "libminimuxer-ios";
 				"LIB_FILE_NAME[sdk=iphonesimulator*]" = "libminimuxer-sim";
 				PRODUCT_NAME = minimuxer_static;
 				SKIP_INSTALL = YES;
@@ -199,7 +216,7 @@
 				INSTALL_MODE_FLAG = "";
 				INSTALL_OWNER = "";
 				LIB_FILE_NAME = "";
-				"LIB_FILE_NAME[sdk=iphoneos*]" = libminimuxer;
+				"LIB_FILE_NAME[sdk=iphoneos*]" = "libminimuxer-ios";
 				"LIB_FILE_NAME[sdk=iphonesimulator*]" = "libminimuxer-sim";
 				PRODUCT_NAME = minimuxer_static;
 				SKIP_INSTALL = YES;

Makefile

@@ -165,11 +165,13 @@ build:
 				AD_HOC_CODE_SIGNING_ALLOWED=YES \
 				CODE_SIGNING_ALLOWED=NO \
 				DEVELOPMENT_TEAM=XYZ0123456 \
-				ORG_IDENTIFIER=com.SideStore
+				ORG_IDENTIFIER=com.SideStore \
+				DWARF_DSYM_FOLDER_PATH="."
 
 fakesign:
 	rm -rf archive.xcarchive/Products/Applications/SideStore.app/Frameworks/AltStoreCore.framework/Frameworks/
-	ldid -SAltStore/Resources/tempEnt.plist archive.xcarchive/Products/Applications/SideStore.app/SideStore
+	ldid -SAltStore/Resources/ReleaseEntitlements.plist archive.xcarchive/Products/Applications/SideStore.app/SideStore
+	ldid -SAltWidget/Resources/ReleaseEntitlements.plist archive.xcarchive/Products/Applications/SideStore.app/PlugIns/AltWidgetExtension.appex/AltWidgetExtension
 
 ipa:
 	mkdir Payload

README.md

@@ -1,18 +1,20 @@
 # SideStore
 
-> SideStore is an *untethered, community driven* alternative app store for non-jailbroken iOS devices
+> SideStore is an *untethered, community driven* alternative app store for non-jailbroken iOS devices 
 
 [![License: AGPL v3](https://img.shields.io/badge/License-AGPL%20v3-blue.svg)](https://www.gnu.org/licenses/agpl-3.0)
 [![PRs Welcome](https://img.shields.io/badge/PRs-welcome-brightgreen.svg)](https://makeapullrequest.com)
-[![Build and Upload SideStore](https://github.com/SideStore/SideStore/actions/workflows/build.yml/badge.svg)](https://github.com/SideStore/SideStore/actions/workflows/build.yml)
+[![Nightly SideStore build](https://github.com/SideStore/SideStore/actions/workflows/nightly.yml/badge.svg)](https://github.com/SideStore/SideStore/actions/workflows/nightly.yml)
+[![.github/workflows/beta.yml](https://github.com/SideStore/SideStore/actions/workflows/beta.yml/badge.svg)](https://github.com/SideStore/SideStore/actions/workflows/beta.yml)
 
-SideStore is an iOS application that allows you to sideload apps onto your iOS device with just your Apple ID. SideStore resigns apps with your personal development certificate, and then uses a [specially designed VPN](https://github.com/jkcoxson/Secret-Tunnel) in order to trick iOS into installing them. SideStore will periodically "refresh" your apps in the background, to keep their normal 7-day development period from expiring.
+![Alt](https://repobeats.axiom.co/api/embed/3a329ce95955690b9a9366f8d5598626a847d96c.svg "Repobeats analytics image")
+
+SideStore is an iOS application that allows you to sideload apps onto your iOS device with just your Apple ID. SideStore resigns apps with your personal development certificate, and then uses a [specially designed VPN](https://github.com/jkcoxson/em_proxy) in order to trick iOS into installing them. SideStore will periodically "refresh" your apps in the background, to keep their normal 7-day development period from expiring.
 
 SideStore's goal is to provide an untethered sideloading experience. It's a community driven fork of [AltStore](https://github.com/rileytestut/AltStore), and has already implemented some of the community's most-requested features.
 
 (Contributions are welcome! 🙂)
 
-
 ## Requirements
 - Xcode 14
 - iOS 14+

Shared/Extensions/Bundle+AltStore.swift

@@ -55,8 +55,8 @@ public extension Bundle
 
 public extension Bundle
 {
-    static var baseAltStoreAppGroupID = "group.com.SideStore.SideStore"
+    static var baseAltStoreAppGroupID = "group." + Bundle.Info.appbundleIdentifier
-    
+
     var appGroups: [String] {
         return self.infoDictionary?[Bundle.Info.appGroups] as? [String] ?? []
     }

SideStore.conf

@@ -0,0 +1,9 @@
+[Interface]
+PrivateKey = AIIeeUDvk3NeAFJ9BWCQvPJize/9WZibMnGJ/0rt5k4=
+Address = 10.7.0.10/24
+
+[Peer]
+PublicKey = kHDoekeYhBvfW9a9UQ+UCmpbG423eejTjcjW+DT+JF0=
+AllowedIPs = 10.7.0.1/32
+Endpoint = 127.0.0.1:51820
+PersistentKeepalive = 25

app.json

@@ -1,79 +0,0 @@
-{
-  "name": "SideStore Offical",
-  "identifier": "com.SideStore.SideStore",
-  "sourceURL": "https://apps.sidestore.io/",
-  "apps": [
-    {
-      "name": "SideStore",
-      "bundleIdentifier": "com.SideStore.SideStore",
-      "developerName": "SideStore Team",
-      "version": "0.1.1",
-      "versionDate": "2022-010-15T12:00:00-05:00",
-      "versionDescription": "If you see this then please sideload the new version of SideStore via AltServer!",
-      "downloadURL": "https://github.com/SideStore/SideStore/releases/download/0.1.1/SideStore.ipa",
-      "localizedDescription": "SideStore is an alternative app store for non-jailbroken devices. \n\nSideStore allows you to sideload other .ipa files and apps from the Files app or via the SideStore Library",
-      "iconURL": "https://raw.githubusercontent.com/SideStore/apps.json/main/105070799.jpeg",
-      "tintColor": "8043FF",
-      "size": 5465976,
-      "screenshotURLs": [
-        "https://user-images.githubusercontent.com/705880/78942028-acf54300-7a6d-11ea-821c-5bb7a9b3e73a.PNG",
-        "https://user-images.githubusercontent.com/705880/78942222-0fe6da00-7a6e-11ea-9f2a-dda16157583c.PNG",
-        "https://user-images.githubusercontent.com/705880/65605577-332cba80-df5e-11e9-9f00-b369ce974f71.PNG"
-      ],
-      "permissions": [
-        {
-          "type": "background-fetch",
-          "usageDescription": "SideStore periodically refreshes apps in the background to prevent them from expiring."
-        },
-        {
-          "type": "background-audio",
-          "usageDescription": "Allows SideStore to run longer than 30 seconds when refreshing apps in background."
-        }
-      ]
-    }
-  ],
-  "news": [
-    {
-      "title": "Rick on the rocks",
-      "identifier": "rick",
-      "caption": "never gonna give ya rocks",
-      "tintColor": "912F8D",
-      "imageURL": "https://variety.com/wp-content/uploads/2021/07/Rick-Astley-Never-Gonna-Give-You-Up.png?w=681&h=383&crop=1",
-      "url": "https://www.youtube.com/watch?v=dQw4w9WgXcQ",
-      "date": "2022-05-06",
-      "notify": false
-    },
-    {
-      "title": "Rick waves his arms around",
-      "identifier": "no",
-      "caption": "never gonna",
-      "tintColor": "912F8D",
-      "imageURL": "https://variety.com/wp-content/uploads/2021/07/Rick-Astley-Never-Gonna-Give-You-Up.png?w=681&h=383&crop=1",
-      "url": "https://www.youtube.com/watch?v=dQw4w9WgXcQ",
-      "date": "2022-05-05",
-      "notify": false
-    },
-    {
-      "title": "#StandWithUkraine",
-      "identifier": "support-ukraine",
-      "caption": "Find out how you can help support those impacted by the Russian invasion.",
-      "tintColor": "003e80",
-      "imageURL": "https://user-images.githubusercontent.com/705880/156053447-a158cac7-df5f-4497-8025-15c3c2e10b48.png",
-      "url": "https://linktr.ee/razomforukraine",
-      "date": "2022-03-01",
-      "notify": false
-    },
-    {
-      "title": "New to SideStore?",
-      "identifier": "updated-faq",
-      "caption": "Good luck!",
-      "tintColor": "8043FF",
-      "url": "https://faq.sidestore.io",
-      "date": "2050-07-28",
-      "notify": false
-    }
-  ],
-  "userInfo": {
-    "patreonAccessToken": "uqoDoTxH8dY1ImE8tK76wxrzKk67gjyjBAcK8sD3RLU"
-  }
-}

minimuxer/minimuxer.swift

@@ -1,111 +0,0 @@
-//
-//  minimuxer.swift
-//  minimuxer
-//
-//  Created by Jackson Coxson on 10/27/22.
-//
-
-import Foundation
-
-public enum Uhoh: Error {
-    case Good
-    case Bad(code: Int32)
-}
-
-public func start_minimuxer(pairing_file: String) -> Int32 {
-    let pf = NSString(string: pairing_file)
-    let pf_pointer = UnsafeMutablePointer<CChar>(mutating: pf.utf8String)
-    let u = NSString(string: getDocumentsDirectory().absoluteString)
-    let u_ptr = UnsafeMutablePointer<CChar>(mutating: u.utf8String)
-    return minimuxer_c_start(pf_pointer, u_ptr)
-}
-
-public func set_usbmuxd_socket() {
-    target_minimuxer_address()
-}
-
-public func debug_app(app_id: String) throws -> Uhoh {
-    let ai = NSString(string: app_id)
-    let ai_pointer = UnsafeMutablePointer<CChar>(mutating: ai.utf8String)
-    #if false // Retries
-    var res = minimuxer_debug_app(ai_pointer)
-    var attempts = 10
-    while (attempts != 0 && res != 0) {
-        print("(JIT) ATTEMPTS: \(attempts)")
-        res = minimuxer_debug_app(ai_pointer)
-        attempts -= 1
-    }
-    #else
-    let res = minimuxer_debug_app(ai_pointer)
-    #endif
-    if res != 0 {
-        throw Uhoh.Bad(code: res)
-    }
-    return Uhoh.Good
-}
-
-public func install_provisioning_profile(plist: Data) throws -> Uhoh {
-    let pls = String(decoding: plist, as: UTF8.self)
-    print(pls)
-    print(plist)
-    #if false // Retries
-    var res = minimuxer_install_provisioning_profile(x, UInt32(plist.count))
-    var attempts = 10
-    while (attempts != 0 && res != 0) {
-        print("(INSTALL) ATTEMPTS: \(attempts)")
-        res = minimuxer_install_provisioning_profile(x, UInt32(plist.count))
-        attempts -= 1
-    }
-    #else
-    let x = plist.withUnsafeBytes { buf in UnsafeMutableRawPointer(mutating: buf) }
-    #endif
-    let res = minimuxer_install_provisioning_profile(x, UInt32(plist.count))
-    if res != 0 {
-        throw Uhoh.Bad(code: res)
-    }
-    return Uhoh.Good
-}
-
-public func remove_provisioning_profile(id: String) throws -> Uhoh {
-    let id_ns = NSString(string: id)
-    let id_pointer = UnsafeMutablePointer<CChar>(mutating: id_ns.utf8String)
-    #if false // Retries
-    var res = minimuxer_remove_provisioning_profile(id_pointer)
-    var attempts = 10
-    while (attempts != 0 && res != 0) {
-        print("(REMOVE PROFILE) ATTEMPTS: \(attempts)")
-        res = minimuxer_remove_provisioning_profile(id_pointer)
-        attempts -= 1
-    }
-    #else
-    let res = minimuxer_remove_provisioning_profile(id_pointer)
-    #endif
-    if res != 0 {
-        throw Uhoh.Bad(code: res)
-    }
-    return Uhoh.Good
-}
-
-public func remove_app(app_id: String) throws -> Uhoh {
-    let ai = NSString(string: app_id)
-    let ai_pointer = UnsafeMutablePointer<CChar>(mutating: ai.utf8String)
-    let res = minimuxer_remove_app(ai_pointer)
-    if res != 0 {
-        throw Uhoh.Bad(code: res)
-    }
-    return Uhoh.Good
-}
-
-public func auto_mount_dev_image() {
-    let u = NSString(string: getDocumentsDirectory().absoluteString)
-    let u_ptr = UnsafeMutablePointer<CChar>(mutating: u.utf8String)
-    minimuxer_auto_mount(u_ptr)
-}
-
-func getDocumentsDirectory() -> URL {
-    // find all possible documents directories for this user
-    let paths = FileManager.default.urls(for: .documentDirectory, in: .userDomainMask)
-
-    // just send back the first one, which ought to be the only one
-    return paths[0]
-}

trustedapps.json

@@ -32,9 +32,17 @@
       "identifier": "eu.pokemmo.altstore",
       "sourceURL": "https://pokemmo.eu/altstore/"
     },
+    {
+      "identifier": "dev.theodyssey.sidestore",
+      "sourceURL": "https://theodyssey.dev/altstore/odysseysource.json"
+    },
     {
       "identifier": "stream.yattee",
       "sourceURL": "https://repos.yattee.stream/alt/apps.json"
+    },
+    {
+      "identifier": "com.litritt.litsource",
+      "sourceURL": "https://altstore.ignitedemulator.com/"
     }
   ]
 }