Compare commits
165 Commits
0.1.1
...
feature/Da
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
e9d3060df7 | ||
|
|
c59043068e | ||
|
|
65c43d683c | ||
|
|
9e6147c860 | ||
|
|
b3074cadf9 | ||
|
|
9c5c597ce6 | ||
|
|
977a452605 | ||
|
|
17640fe6cf | ||
|
|
2e4f6ee420 | ||
|
|
a3768d9221 | ||
|
|
80c3390363 | ||
|
|
a5e3869d8f | ||
|
|
aa7d7c2d02 | ||
|
|
015f205569 | ||
|
|
e59fb15926 | ||
|
|
173c585f2d | ||
|
|
6f8c27793e | ||
|
|
332b81c803 | ||
|
|
4b343b500d | ||
|
|
e87c537642 | ||
|
|
2e6300cce2 | ||
|
|
09514d15a6 | ||
|
|
0de23dcba0 | ||
|
|
bacb153151 | ||
|
|
a01aa299d8 | ||
|
|
44edbddbd8 | ||
|
|
79d677cf3c | ||
|
|
be39b6512f | ||
|
|
fcfeea35da | ||
|
|
7d0eb8c61e | ||
|
|
4d8438a6b6 | ||
|
|
f611244e35 | ||
|
|
546a978d3b | ||
|
|
70b23fb073 | ||
|
|
a56ca597d6 | ||
|
|
679e0228a8 | ||
|
|
e153394323 | ||
|
|
5bd1fcfcfd | ||
|
|
2a392ddc44 | ||
|
|
b5cb8bc0d9 | ||
|
|
fa170bcf98 | ||
|
|
7939d46949 | ||
|
|
ab9df8201a | ||
|
|
4a670ec091 | ||
|
|
10e57e59c4 | ||
|
|
b9ec43ef34 | ||
|
|
42197cd375 | ||
|
|
704852973b | ||
|
|
056b4200df | ||
|
|
250a7d8627 | ||
|
|
1ba51e161e | ||
|
|
32e58af896 | ||
|
|
312fa6fe76 | ||
|
|
afbe0837ba | ||
|
|
36ad2a720f | ||
|
|
901e3b14bb | ||
|
|
588d209f7b | ||
|
|
554c54e6be | ||
|
|
b0fac34ffc | ||
|
|
5ede9f7c6b | ||
|
|
c7254fd23e | ||
|
|
55fcea04af | ||
|
|
c212c0a6b2 | ||
|
|
a31fd6709a | ||
|
|
e367fd2b73 | ||
|
|
1ca67d0241 | ||
|
|
8ffa952ff9 | ||
|
|
da246fa30b | ||
|
|
13f306742e | ||
|
|
f3815dc45e | ||
|
|
d086254012 | ||
|
|
bc4d5ba097 | ||
|
|
c556783fe3 | ||
|
|
5fba4c12aa | ||
|
|
7e0dde3ece | ||
|
|
fc03e83531 | ||
|
|
4c441077c7 | ||
|
|
4a5ca81e9a | ||
|
|
75eebe8f8c | ||
|
|
271a8cdac5 | ||
|
|
25103c1188 | ||
|
|
d81058e606 | ||
|
|
693df54b3b | ||
|
|
ae6ed99dc4 | ||
|
|
14bd58e741 | ||
|
|
6d35a7a4ba | ||
|
|
46b0d1ceac | ||
|
|
67a66d2fcd | ||
|
|
43e90b57ea | ||
|
|
c80740e590 | ||
|
|
54ccb9611e | ||
|
|
8fcb897800 | ||
|
|
699eda5d1b | ||
|
|
d7d0a83550 | ||
|
|
e3c331c911 | ||
|
|
eda4dd6aec | ||
|
|
8ad7be474d | ||
|
|
a64435f155 | ||
|
|
fa160124d2 | ||
|
|
5765cb8330 | ||
|
|
f472b227bb | ||
|
|
d2b419c42e | ||
|
|
09d4de660f | ||
|
|
728dcd8523 | ||
|
|
93cf9bf6a9 | ||
|
|
50841f5e24 | ||
|
|
fc6d92d1fc | ||
|
|
7162a029bb | ||
|
|
d797ddd668 | ||
|
|
989e8c3aa6 | ||
|
|
08b79af242 | ||
|
|
0d2f346a30 | ||
|
|
39f1d5f5fd | ||
|
|
05008bb7f8 | ||
|
|
be90d6fc45 | ||
|
|
a1bcdf9924 | ||
|
|
b0e001393c | ||
|
|
2d08941f6a | ||
|
|
d0fef1f312 | ||
|
|
68342cb0d4 | ||
|
|
2b419212a7 | ||
|
|
b2cbc7e34d | ||
|
|
61247e575b | ||
|
|
31e18266d1 | ||
|
|
df8a8de889 | ||
|
|
8a037d6b29 | ||
|
|
47b555b98c | ||
|
|
0c2dae475e | ||
|
|
dc676d04d8 | ||
|
|
15b54bff50 | ||
|
|
47bd4b4c0b | ||
|
|
3c8b36ddfe | ||
|
|
608df3fddd | ||
|
|
c092c285ee | ||
|
|
93b745e379 | ||
|
|
c18db77ade | ||
|
|
2c0b167e6b | ||
|
|
313254d0c8 | ||
|
|
6f519c97d3 | ||
|
|
17a3e16b1d | ||
|
|
8199358088 | ||
|
|
412928eeaa | ||
|
|
51e1b935bd | ||
|
|
742b51e5e2 | ||
|
|
fdb5e2eebb | ||
|
|
0192f64cd2 | ||
|
|
193298ac87 | ||
|
|
a81cb81799 | ||
|
|
ad8a7fdc9b | ||
|
|
5440afcebe | ||
|
|
715d7e664c | ||
|
|
aa182cfa68 | ||
|
|
f92dd7a872 | ||
|
|
b02b9197d0 | ||
|
|
86d02be70c | ||
|
|
cb990978ee | ||
|
|
a103202c92 | ||
|
|
9d7b133037 | ||
|
|
f727f2a1a9 | ||
|
|
03034768d9 | ||
|
|
aed3e20e08 | ||
|
|
74bac6d986 | ||
|
|
7ebecc353a | ||
|
|
f0302b0d1e | ||
|
|
0b004ad089 |
2
.github/CODEOWNERS
vendored
@@ -1 +1 @@
|
|||||||
* @JoeMatt @lonkelle @jkcoxson
|
* @JoeMatt @lonkelle
|
||||||
|
|||||||
40
.github/ISSUE_TEMPLATE/bug_report.yml
vendored
Normal file
@@ -0,0 +1,40 @@
|
|||||||
|
name: Bug Report
|
||||||
|
description: Report a bug
|
||||||
|
title: "[BUG] "
|
||||||
|
labels: ["bug"]
|
||||||
|
assignees:
|
||||||
|
- naturecodevoid
|
||||||
|
body:
|
||||||
|
- type: markdown
|
||||||
|
attributes:
|
||||||
|
value: |
|
||||||
|
Thanks for taking the time to fill out this bug report! Before you continue filling out the report, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the bug you are experiencing** in case it has already been reported.
|
||||||
|
|
||||||
|
**Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
|
||||||
|
- type: textarea
|
||||||
|
id: description
|
||||||
|
attributes:
|
||||||
|
label: Describe the bug
|
||||||
|
description: What is the bug and how did you discover it?
|
||||||
|
placeholder: Please be clear and concise with your description.
|
||||||
|
validations:
|
||||||
|
required: true
|
||||||
|
- type: textarea
|
||||||
|
id: how-to-reproduce
|
||||||
|
attributes:
|
||||||
|
label: Instructions to reproduce
|
||||||
|
description: Please include clear and consistent instructions for reproducing the bug to make it easier for us to fix it.
|
||||||
|
validations:
|
||||||
|
required: true
|
||||||
|
- type: input
|
||||||
|
id: app-version
|
||||||
|
attributes:
|
||||||
|
label: What version of SideStore are you using?
|
||||||
|
description: To retrieve this, go to `Settings` in the SideStore app and scroll down to the bottom.
|
||||||
|
validations:
|
||||||
|
required: true
|
||||||
|
- type: textarea
|
||||||
|
id: other-info
|
||||||
|
attributes:
|
||||||
|
label: Other info
|
||||||
|
description: If you have any other comments, other info that might be useful, or if you found a workaround, please put it here.
|
||||||
10
.github/ISSUE_TEMPLATE/config.yml
vendored
Normal file
@@ -0,0 +1,10 @@
|
|||||||
|
# force issue template usage
|
||||||
|
blank_issues_enabled: false
|
||||||
|
|
||||||
|
contact_links:
|
||||||
|
- name: Discord
|
||||||
|
url: https://discord.gg/RgpFBX3Q3k
|
||||||
|
about: If you need support, please go here first instead of making an issue!
|
||||||
|
- name: GitHub Discussions
|
||||||
|
url: https://github.com/SideStore/SideStore/discussions
|
||||||
|
about: As an alternative to Discord, you can also make a new GitHub discussion.
|
||||||
33
.github/ISSUE_TEMPLATE/feature_request.yml
vendored
Normal file
@@ -0,0 +1,33 @@
|
|||||||
|
name: Feature Request
|
||||||
|
description: Suggest a feature
|
||||||
|
title: "[FEATURE REQUEST] "
|
||||||
|
labels: ["enhancement"]
|
||||||
|
assignees:
|
||||||
|
- naturecodevoid
|
||||||
|
body:
|
||||||
|
- type: markdown
|
||||||
|
attributes:
|
||||||
|
value: |
|
||||||
|
Thanks for taking the time to fill out this feature request! Before you continue filling out the form, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the feature you are suggestion** in case it has already been suggested.
|
||||||
|
|
||||||
|
**Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
|
||||||
|
- type: textarea
|
||||||
|
id: description
|
||||||
|
attributes:
|
||||||
|
label: Describe the feature
|
||||||
|
description: What is the feature? How would it work?
|
||||||
|
placeholder: Please be clear and concise with your description.
|
||||||
|
validations:
|
||||||
|
required: true
|
||||||
|
- type: textarea
|
||||||
|
id: use-cases
|
||||||
|
attributes:
|
||||||
|
label: Use cases
|
||||||
|
description: Please include multiple use cases where this feature would be useful.
|
||||||
|
validations:
|
||||||
|
required: true
|
||||||
|
- type: textarea
|
||||||
|
id: alternatives
|
||||||
|
attributes:
|
||||||
|
label: Alternatives
|
||||||
|
description: If you have alternative ideas of how this feature could work, you can put them here.
|
||||||
15
.github/pull_request_template.md
vendored
Normal file
@@ -0,0 +1,15 @@
|
|||||||
|
### Changes
|
||||||
|
|
||||||
|
<!-- Fill this list with what your PR changes. Example: -->
|
||||||
|
- Fix bug
|
||||||
|
- Change UI for QOL
|
||||||
|
|
||||||
|
<!-- If your PR is ready to be merged, you can remove this section. -->
|
||||||
|
### Todo before merge
|
||||||
|
|
||||||
|
<!-- Example: -->
|
||||||
|
- [x] Finish UI changes
|
||||||
|
- [ ] Test
|
||||||
|
|
||||||
|
<!-- If your PR doesn't close an issue, you can remove the next line. -->
|
||||||
|
Closes #1234
|
||||||
22
.github/workflows/attach_build_products.yml
vendored
Normal file
@@ -0,0 +1,22 @@
|
|||||||
|
name: Add artifact links to pull request and related issues
|
||||||
|
on:
|
||||||
|
workflow_run:
|
||||||
|
workflows: [Pull Request SideStore build]
|
||||||
|
types: [completed]
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
artifacts-url-comments:
|
||||||
|
name: add artifact links to pull request and related issues job
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
if: ${{ github.event.workflow_run.conclusion == 'success' }}
|
||||||
|
steps:
|
||||||
|
- name: add artifact links to pull request and related issues step
|
||||||
|
uses: tonyhallett/artifacts-url-comments@v1.1.0
|
||||||
|
env:
|
||||||
|
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
|
||||||
|
with:
|
||||||
|
prefix: Builds for this Pull Request are available at
|
||||||
|
suffix: Have a nice day.
|
||||||
|
format: name
|
||||||
|
addTo: pull
|
||||||
|
# addTo: pullandissues
|
||||||
84
.github/workflows/beta.yml
vendored
Normal file
@@ -0,0 +1,84 @@
|
|||||||
|
name: Beta SideStore build
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
tags:
|
||||||
|
- '[0-9]+.[0-9]+.[0-9]+-beta.[0-9]+' # example: 1.0.0-beta.1
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
build:
|
||||||
|
name: Build and upload SideStore Beta
|
||||||
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
|
matrix:
|
||||||
|
include:
|
||||||
|
- os: 'macos-12'
|
||||||
|
version: '14.2'
|
||||||
|
|
||||||
|
runs-on: ${{ matrix.os }}
|
||||||
|
steps:
|
||||||
|
- name: Checkout code
|
||||||
|
uses: actions/checkout@v2
|
||||||
|
with:
|
||||||
|
submodules: recursive
|
||||||
|
|
||||||
|
- name: Install dependencies
|
||||||
|
run: brew install ldid
|
||||||
|
|
||||||
|
- name: Change version to tag
|
||||||
|
run: sed -e '/MARKETING_VERSION = .*/s/= .*/= ${{ github.ref_name }}/' -i '' Build.xcconfig
|
||||||
|
|
||||||
|
- name: Setup Xcode
|
||||||
|
uses: maxim-lobanov/setup-xcode@v1.4.1
|
||||||
|
with:
|
||||||
|
xcode-version: ${{ matrix.version }}
|
||||||
|
|
||||||
|
- name: Build SideStore
|
||||||
|
run: make build | xcpretty && exit ${PIPESTATUS[0]}
|
||||||
|
|
||||||
|
- name: Fakesign app
|
||||||
|
run: make fakesign
|
||||||
|
|
||||||
|
- name: Convert to IPA
|
||||||
|
run: make ipa
|
||||||
|
|
||||||
|
- name: Upload Artifact
|
||||||
|
uses: actions/upload-artifact@v3.1.0
|
||||||
|
with:
|
||||||
|
name: SideStore.ipa
|
||||||
|
path: SideStore.ipa
|
||||||
|
|
||||||
|
- name: Get version
|
||||||
|
id: version
|
||||||
|
run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
|
||||||
|
|
||||||
|
- name: Get current date
|
||||||
|
id: date
|
||||||
|
run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
|
||||||
|
|
||||||
|
- name: Get current date in AltStore date form
|
||||||
|
id: date_altstore
|
||||||
|
run: echo "date=$(date -u +'%Y-%m-%d')" >> $GITHUB_OUTPUT
|
||||||
|
|
||||||
|
- name: Upload to new beta release
|
||||||
|
uses: softprops/action-gh-release@v1
|
||||||
|
with:
|
||||||
|
token: ${{ secrets.GITHUB_TOKEN }}
|
||||||
|
name: ${{ steps.version.outputs.version }}
|
||||||
|
tag_name: ${{ github.ref_name }}
|
||||||
|
draft: true
|
||||||
|
prerelease: true
|
||||||
|
files: SideStore.ipa
|
||||||
|
body: |
|
||||||
|
<!-- NOTE: to reset SideSource cache, go to `https://apps.sidestore.io/reset-cache/nightly/<sidesource key>`. This is not included in the GitHub Action since it makes draft releases so they can be edited and have a changelog. -->
|
||||||
|
Beta builds are hand-picked builds from development commits that will allow you to try out new features earlier than normal. However, **they might contain bugs and other issues. Use at your own risk!**
|
||||||
|
|
||||||
|
## Changelog
|
||||||
|
|
||||||
|
- TODO
|
||||||
|
|
||||||
|
## Build Info
|
||||||
|
|
||||||
|
Built at (UTC): `${{ steps.date.outputs.date }}`
|
||||||
|
Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
|
||||||
|
Commit SHA: `${{ github.sha }}`
|
||||||
|
Version: `${{ steps.version.outputs.version }}`
|
||||||
100
.github/workflows/build.yml
vendored
@@ -1,100 +0,0 @@
|
|||||||
name: Build and Upload SideStore
|
|
||||||
on:
|
|
||||||
push:
|
|
||||||
branches:
|
|
||||||
- master
|
|
||||||
- develop
|
|
||||||
pull_request:
|
|
||||||
|
|
||||||
jobs:
|
|
||||||
build:
|
|
||||||
name: Build and upload SideStore
|
|
||||||
strategy:
|
|
||||||
fail-fast: false
|
|
||||||
matrix:
|
|
||||||
include:
|
|
||||||
- os: 'macos-12'
|
|
||||||
version: '14.0.0'
|
|
||||||
|
|
||||||
runs-on: ${{ matrix.os }}
|
|
||||||
steps:
|
|
||||||
- name: Checkout code
|
|
||||||
uses: actions/checkout@v2
|
|
||||||
with:
|
|
||||||
submodules: recursive
|
|
||||||
|
|
||||||
- name: Cache rust cargo
|
|
||||||
id: cache-rust-cargo
|
|
||||||
uses: actions/cache@v3
|
|
||||||
env:
|
|
||||||
cache-name: cache-rust-cargo
|
|
||||||
with:
|
|
||||||
path: ~/.cargo
|
|
||||||
key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
|
|
||||||
restore-keys: |
|
|
||||||
${{ runner.os }}-build-${{ env.cache-name }}-
|
|
||||||
${{ runner.os }}-build-
|
|
||||||
${{ runner.os }}-
|
|
||||||
|
|
||||||
- name: Cache rust minimuxer
|
|
||||||
id: cache-rust-minimuxer
|
|
||||||
uses: actions/cache@v3
|
|
||||||
env:
|
|
||||||
cache-name: cache-rust-minimuxer
|
|
||||||
with:
|
|
||||||
path: ./Dependencies/minimuxer/target
|
|
||||||
key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
|
|
||||||
restore-keys: |
|
|
||||||
${{ runner.os }}-build-${{ env.cache-name }}-
|
|
||||||
${{ runner.os }}-build-
|
|
||||||
${{ runner.os }}-
|
|
||||||
|
|
||||||
- name: Cache rust em_proxy
|
|
||||||
id: cache-rust-em_proxy
|
|
||||||
uses: actions/cache@v3
|
|
||||||
env:
|
|
||||||
cache-name: cache-rust-em_proxy
|
|
||||||
with:
|
|
||||||
path: ./Dependencies/em_proxy/target
|
|
||||||
key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
|
|
||||||
restore-keys: |
|
|
||||||
${{ runner.os }}-build-${{ env.cache-name }}-
|
|
||||||
${{ runner.os }}-build-
|
|
||||||
${{ runner.os }}-
|
|
||||||
|
|
||||||
- name: Install dependencies
|
|
||||||
run: brew install ldid
|
|
||||||
- name: Install rustup
|
|
||||||
uses: actions-rs/toolchain@v1
|
|
||||||
with:
|
|
||||||
toolchain: stable
|
|
||||||
override: true
|
|
||||||
target: aarch64-apple-ios
|
|
||||||
- name: Create emotional damage
|
|
||||||
run: cd Dependencies/em_proxy && cargo build --release --target aarch64-apple-ios
|
|
||||||
- name: Build minimuxer
|
|
||||||
run: cd Dependencies/minimuxer && cargo build --release --target aarch64-apple-ios
|
|
||||||
- name: Setup Xcode
|
|
||||||
uses: maxim-lobanov/setup-xcode@v1.4.1
|
|
||||||
with:
|
|
||||||
xcode-version: ${{ matrix.version }}
|
|
||||||
- name: Build SideStore
|
|
||||||
run: |
|
|
||||||
rm -rf ~/Library/Developer/Xcode/DerivedData/
|
|
||||||
rm ./AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved
|
|
||||||
xcodebuild -project AltStore.xcodeproj -scheme AltStore -sdk iphoneos archive -archivePath ./archive CODE_SIGNING_REQUIRED=NO AD_HOC_CODE_SIGNING_ALLOWED=YES CODE_SIGNING_ALLOWED=NO DEVELOPMENT_TEAM=XYZ0123456 ORG_IDENTIFIER=com.SideStore | xcpretty && exit ${PIPESTATUS[0]}
|
|
||||||
- name: Fakesign app
|
|
||||||
run: |
|
|
||||||
rm -rf archive.xcarchive/Products/Applications/SideStore.app/Frameworks/AltStoreCore.framework/Frameworks/
|
|
||||||
ldid -SAltStore/Resources/tempEnt.plist archive.xcarchive/Products/Applications/SideStore.app/SideStore
|
|
||||||
- name: Convert to IPA
|
|
||||||
run: |
|
|
||||||
mkdir Payload
|
|
||||||
mkdir Payload/SideStore.app
|
|
||||||
cp -R archive.xcarchive/Products/Applications/SideStore.app/ Payload/SideStore.app/
|
|
||||||
zip -r SideStore.ipa Payload
|
|
||||||
- name: Upload Artifact
|
|
||||||
uses: actions/upload-artifact@v3.1.0
|
|
||||||
with:
|
|
||||||
name: SideStore.ipa
|
|
||||||
path: SideStore.ipa
|
|
||||||
13
.github/workflows/danger.yml
vendored
Normal file
@@ -0,0 +1,13 @@
|
|||||||
|
name: "Danger Swift"
|
||||||
|
on: [pull_request]
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
build:
|
||||||
|
name: Danger JS
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@v1
|
||||||
|
- name: Danger Swift
|
||||||
|
uses: danger/swift@2.0.3
|
||||||
|
env:
|
||||||
|
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
|
||||||
28
.github/workflows/increase-nightly-build-num.sh
vendored
Normal file
@@ -0,0 +1,28 @@
|
|||||||
|
#!/usr/bin/env bash
|
||||||
|
|
||||||
|
# Ensure we are in root directory
|
||||||
|
cd "$(dirname "$0")/../.."
|
||||||
|
|
||||||
|
DATE=`date -u +'%Y.%m.%d'`
|
||||||
|
BUILD_NUM=1
|
||||||
|
|
||||||
|
write() {
|
||||||
|
sed -e "/MARKETING_VERSION = .*/s/$/-nightly.$DATE.$BUILD_NUM/" -i '' Build.xcconfig
|
||||||
|
echo "$DATE,$BUILD_NUM" > .nightly-build-num
|
||||||
|
}
|
||||||
|
|
||||||
|
if [ ! -f ".nightly-build-num" ]; then
|
||||||
|
write
|
||||||
|
exit 0
|
||||||
|
fi
|
||||||
|
|
||||||
|
LAST_DATE=`cat .nightly-build-num | perl -n -e '/([^,]*),([^ ]*)$/ && print $1'`
|
||||||
|
LAST_BUILD_NUM=`cat .nightly-build-num | perl -n -e '/([^,]*),([^ ]*)$/ && print $2'`
|
||||||
|
|
||||||
|
if [[ "$DATE" != "$LAST_DATE" ]]; then
|
||||||
|
write
|
||||||
|
else
|
||||||
|
BUILD_NUM=`expr $LAST_BUILD_NUM + 1`
|
||||||
|
write
|
||||||
|
fi
|
||||||
|
|
||||||
94
.github/workflows/nightly.yml
vendored
Normal file
@@ -0,0 +1,94 @@
|
|||||||
|
name: Nightly SideStore build
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
branches:
|
||||||
|
- develop
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
build:
|
||||||
|
name: Build and upload SideStore Nightly
|
||||||
|
concurrency:
|
||||||
|
group: ${{ github.ref }}
|
||||||
|
cancel-in-progress: true
|
||||||
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
|
matrix:
|
||||||
|
include:
|
||||||
|
- os: 'macos-12'
|
||||||
|
version: '14.2'
|
||||||
|
|
||||||
|
runs-on: ${{ matrix.os }}
|
||||||
|
steps:
|
||||||
|
- name: Checkout code
|
||||||
|
uses: actions/checkout@v2
|
||||||
|
with:
|
||||||
|
submodules: recursive
|
||||||
|
|
||||||
|
- name: Install dependencies
|
||||||
|
run: brew install ldid
|
||||||
|
|
||||||
|
- name: Cache .nightly-build-num
|
||||||
|
uses: actions/cache@v3
|
||||||
|
with:
|
||||||
|
path: .nightly-build-num
|
||||||
|
key: nightly-build-num
|
||||||
|
|
||||||
|
- name: Increase nightly build number and set as version
|
||||||
|
run: bash .github/workflows/increase-nightly-build-num.sh
|
||||||
|
|
||||||
|
- name: Setup Xcode
|
||||||
|
uses: maxim-lobanov/setup-xcode@v1.4.1
|
||||||
|
with:
|
||||||
|
xcode-version: ${{ matrix.version }}
|
||||||
|
|
||||||
|
- name: Build SideStore
|
||||||
|
run: make build | xcpretty && exit ${PIPESTATUS[0]}
|
||||||
|
|
||||||
|
- name: Fakesign app
|
||||||
|
run: make fakesign
|
||||||
|
|
||||||
|
- name: Convert to IPA
|
||||||
|
run: make ipa
|
||||||
|
|
||||||
|
- name: Upload Artifact
|
||||||
|
uses: actions/upload-artifact@v3.1.0
|
||||||
|
with:
|
||||||
|
name: SideStore.ipa
|
||||||
|
path: SideStore.ipa
|
||||||
|
|
||||||
|
- name: Get version
|
||||||
|
id: version
|
||||||
|
run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
|
||||||
|
|
||||||
|
- name: Get current date
|
||||||
|
id: date
|
||||||
|
run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
|
||||||
|
|
||||||
|
- name: Get current date in AltStore date form
|
||||||
|
id: date_altstore
|
||||||
|
run: echo "date=$(date -u +'%Y-%m-%d')" >> $GITHUB_OUTPUT
|
||||||
|
|
||||||
|
- name: Upload to nightly release
|
||||||
|
uses: IsaacShelton/update-existing-release@v1.3.1
|
||||||
|
with:
|
||||||
|
token: ${{ secrets.GITHUB_TOKEN }}
|
||||||
|
release: "Nightly"
|
||||||
|
tag: "nightly"
|
||||||
|
prerelease: true
|
||||||
|
files: SideStore.ipa
|
||||||
|
body: |
|
||||||
|
This is an ⚠️ **EXPERIMENTAL** ⚠️ nightly build for commit [${{ github.sha }}](https://github.com/${{ github.repository }}/commit/${{ github.sha }}).
|
||||||
|
|
||||||
|
Nightly builds are **extremely experimental builds only meant to be used by developers and alpha testers. They often contain bugs and experimental features. Use at your own risk!**
|
||||||
|
|
||||||
|
If you want to try out new features early but want a lower chance of bugs, you can look at [SideStore Beta](https://github.com/${{ github.repository }}/releases?q=beta).
|
||||||
|
|
||||||
|
## Build Info
|
||||||
|
|
||||||
|
Built at (UTC): `${{ steps.date.outputs.date }}`
|
||||||
|
Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
|
||||||
|
Commit SHA: `${{ github.sha }}`
|
||||||
|
Version: `${{ steps.version.outputs.version }}`
|
||||||
|
|
||||||
|
- name: Reset cache for apps.sidestore.io/nightly
|
||||||
|
run: sleep 10 && curl https://apps.sidestore.io/reset-cache/nightly/${{ secrets.SIDESOURCE_KEY }}
|
||||||
46
.github/workflows/pr.yml
vendored
Normal file
@@ -0,0 +1,46 @@
|
|||||||
|
name: Pull Request SideStore build
|
||||||
|
on:
|
||||||
|
pull_request:
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
build:
|
||||||
|
name: Build and upload SideStore
|
||||||
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
|
matrix:
|
||||||
|
include:
|
||||||
|
- os: 'macos-12'
|
||||||
|
version: '14.2'
|
||||||
|
|
||||||
|
runs-on: ${{ matrix.os }}
|
||||||
|
steps:
|
||||||
|
- name: Checkout code
|
||||||
|
uses: actions/checkout@v2
|
||||||
|
with:
|
||||||
|
submodules: recursive
|
||||||
|
|
||||||
|
- name: Install dependencies
|
||||||
|
run: brew install ldid
|
||||||
|
|
||||||
|
- name: Add PR suffix to version
|
||||||
|
run: sed -e '/MARKETING_VERSION = .*/s/$/-pr.${{ github.event.pull_request.number }}/' -i '' Build.xcconfig
|
||||||
|
|
||||||
|
- name: Setup Xcode
|
||||||
|
uses: maxim-lobanov/setup-xcode@v1.4.1
|
||||||
|
with:
|
||||||
|
xcode-version: ${{ matrix.version }}
|
||||||
|
|
||||||
|
- name: Build SideStore
|
||||||
|
run: make build | xcpretty && exit ${PIPESTATUS[0]}
|
||||||
|
|
||||||
|
- name: Fakesign app
|
||||||
|
run: make fakesign
|
||||||
|
|
||||||
|
- name: Convert to IPA
|
||||||
|
run: make ipa
|
||||||
|
|
||||||
|
- name: Upload Artifact
|
||||||
|
uses: actions/upload-artifact@v3.1.0
|
||||||
|
with:
|
||||||
|
name: SideStore.ipa
|
||||||
|
path: SideStore.ipa
|
||||||
81
.github/workflows/stable.yml
vendored
Normal file
@@ -0,0 +1,81 @@
|
|||||||
|
name: Stable SideStore build
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
tags:
|
||||||
|
- '[0-9]+.[0-9]+.[0-9]+' # example: 1.0.0
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
build:
|
||||||
|
name: Build and upload SideStore
|
||||||
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
|
matrix:
|
||||||
|
include:
|
||||||
|
- os: 'macos-12'
|
||||||
|
version: '14.2'
|
||||||
|
|
||||||
|
runs-on: ${{ matrix.os }}
|
||||||
|
steps:
|
||||||
|
- name: Checkout code
|
||||||
|
uses: actions/checkout@v2
|
||||||
|
with:
|
||||||
|
submodules: recursive
|
||||||
|
|
||||||
|
- name: Install dependencies
|
||||||
|
run: brew install ldid
|
||||||
|
|
||||||
|
- name: Change version to tag
|
||||||
|
run: sed -e '/MARKETING_VERSION = .*/s/= .*/= ${{ github.ref_name }}/' -i '' Build.xcconfig
|
||||||
|
|
||||||
|
- name: Setup Xcode
|
||||||
|
uses: maxim-lobanov/setup-xcode@v1.4.1
|
||||||
|
with:
|
||||||
|
xcode-version: ${{ matrix.version }}
|
||||||
|
|
||||||
|
- name: Build SideStore
|
||||||
|
run: make build | xcpretty && exit ${PIPESTATUS[0]}
|
||||||
|
|
||||||
|
- name: Fakesign app
|
||||||
|
run: make fakesign
|
||||||
|
|
||||||
|
- name: Convert to IPA
|
||||||
|
run: make ipa
|
||||||
|
|
||||||
|
- name: Upload Artifact
|
||||||
|
uses: actions/upload-artifact@v3.1.0
|
||||||
|
with:
|
||||||
|
name: SideStore.ipa
|
||||||
|
path: SideStore.ipa
|
||||||
|
|
||||||
|
- name: Get version
|
||||||
|
id: version
|
||||||
|
run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
|
||||||
|
|
||||||
|
- name: Get current date
|
||||||
|
id: date
|
||||||
|
run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
|
||||||
|
|
||||||
|
- name: Get current date in AltStore date form
|
||||||
|
id: date_altstore
|
||||||
|
run: echo "date=$(date -u +'%Y-%m-%d')" >> $GITHUB_OUTPUT
|
||||||
|
|
||||||
|
- name: Upload to new stable release
|
||||||
|
uses: softprops/action-gh-release@v1
|
||||||
|
with:
|
||||||
|
token: ${{ secrets.GITHUB_TOKEN }}
|
||||||
|
name: ${{ steps.version.outputs.version }}
|
||||||
|
tag_name: ${{ github.ref_name }}
|
||||||
|
draft: true
|
||||||
|
files: SideStore.ipa
|
||||||
|
body: |
|
||||||
|
<!-- NOTE: to reset SideSource cache, go to `https://apps.sidestore.io/reset-cache/nightly/<sidesource key>`. This is not included in the GitHub Action since it makes draft releases so they can be edited and have a changelog. -->
|
||||||
|
## Changelog
|
||||||
|
|
||||||
|
- TODO
|
||||||
|
|
||||||
|
## Build Info
|
||||||
|
|
||||||
|
Built at (UTC): `${{ steps.date.outputs.date }}`
|
||||||
|
Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
|
||||||
|
Commit SHA: `${{ github.sha }}`
|
||||||
|
Version: `${{ steps.version.outputs.version }}`
|
||||||
10
.gitignore
vendored
@@ -34,3 +34,13 @@ xcuserdata
|
|||||||
|
|
||||||
## AppCode specific
|
## AppCode specific
|
||||||
.idea/
|
.idea/
|
||||||
|
|
||||||
|
.build
|
||||||
|
|
||||||
|
Payload/
|
||||||
|
SideStore.ipa
|
||||||
|
Dependencies/.*-prebuilt-fetch-*
|
||||||
|
Dependencies/minimuxer/*
|
||||||
|
Dependencies/em_proxy/*
|
||||||
|
!Dependencies/**/.gitkeep
|
||||||
|
.nightly-build-num
|
||||||
|
|||||||
9
.gitmodules
vendored
@@ -13,12 +13,9 @@
|
|||||||
[submodule "Dependencies/MarkdownAttributedString"]
|
[submodule "Dependencies/MarkdownAttributedString"]
|
||||||
path = Dependencies/MarkdownAttributedString
|
path = Dependencies/MarkdownAttributedString
|
||||||
url = https://github.com/chockenberry/MarkdownAttributedString.git
|
url = https://github.com/chockenberry/MarkdownAttributedString.git
|
||||||
[submodule "Dependencies/em_proxy"]
|
|
||||||
path = Dependencies/em_proxy
|
|
||||||
url = https://github.com/jkcoxson/em_proxy
|
|
||||||
[submodule "Dependencies/libimobiledevice-glue"]
|
[submodule "Dependencies/libimobiledevice-glue"]
|
||||||
path = Dependencies/libimobiledevice-glue
|
path = Dependencies/libimobiledevice-glue
|
||||||
url = https://github.com/libimobiledevice/libimobiledevice-glue
|
url = https://github.com/libimobiledevice/libimobiledevice-glue
|
||||||
[submodule "Dependencies/minimuxer"]
|
[submodule "Dependencies/libfragmentzip"]
|
||||||
path = Dependencies/minimuxer
|
path = Dependencies/libfragmentzip
|
||||||
url = https://github.com/jkcoxson/minimuxer
|
url = https://github.com/SideStore/libfragmentzip.git
|
||||||
|
|||||||
@@ -5,7 +5,7 @@
|
|||||||
<key>ALTAppGroups</key>
|
<key>ALTAppGroups</key>
|
||||||
<array>
|
<array>
|
||||||
<string>group.$(APP_GROUP_IDENTIFIER)</string>
|
<string>group.$(APP_GROUP_IDENTIFIER)</string>
|
||||||
<string>group.com.rileytestut.AltStore</string>
|
<string>group.com.SideStore.SideStore</string>
|
||||||
</array>
|
</array>
|
||||||
<key>ALTBundleIdentifier</key>
|
<key>ALTBundleIdentifier</key>
|
||||||
<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>
|
<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>
|
||||||
|
|||||||
@@ -77,7 +77,7 @@ extension XPCConnectionHandler: NSXPCListenerDelegate
|
|||||||
guard
|
guard
|
||||||
let codeSigningInfo = signingInfo as? [String: Any],
|
let codeSigningInfo = signingInfo as? [String: Any],
|
||||||
let bundleIdentifier = codeSigningInfo["identifier"] as? String,
|
let bundleIdentifier = codeSigningInfo["identifier"] as? String,
|
||||||
bundleIdentifier.contains("com.rileytestut.AltStore")
|
bundleIdentifier.contains(Bundle.Info.appbundleIdentifier)
|
||||||
else { return false }
|
else { return false }
|
||||||
|
|
||||||
let connection = XPCConnection(newConnection)
|
let connection = XPCConnection(newConnection)
|
||||||
|
|||||||
@@ -7,25 +7,13 @@
|
|||||||
objects = {
|
objects = {
|
||||||
|
|
||||||
/* Begin PBXBuildFile section */
|
/* Begin PBXBuildFile section */
|
||||||
|
03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E314122A05D4C00370A3C /* Bundle+AltStore.swift */; };
|
||||||
19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */ = {isa = PBXBuildFile; fileRef = BF45872B2298D31600BD7491 /* libimobiledevice.a */; };
|
19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */ = {isa = PBXBuildFile; fileRef = BF45872B2298D31600BD7491 /* libimobiledevice.a */; };
|
||||||
19104DB52909C06D00C49C7B /* EmotionalDamage.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19104DB42909C06D00C49C7B /* EmotionalDamage.swift */; };
|
19104DB52909C06D00C49C7B /* EmotionalDamage.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19104DB42909C06D00C49C7B /* EmotionalDamage.swift */; };
|
||||||
19104DBB2909C11700C49C7B /* libem_proxy.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DA32909BC1000C49C7B /* libem_proxy.a */; };
|
|
||||||
19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DB22909C06C00C49C7B /* libEmotionalDamage.a */; };
|
19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DB22909C06C00C49C7B /* libEmotionalDamage.a */; };
|
||||||
191E5FAE290A5D92001A3B7C /* minimuxer.swift in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FAD290A5D92001A3B7C /* minimuxer.swift */; };
|
191E5FAE290A5D92001A3B7C /* minimuxer.swift in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FAD290A5D92001A3B7C /* minimuxer.swift */; };
|
||||||
191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FAB290A5D92001A3B7C /* libminimuxer.a */; };
|
191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FAB290A5D92001A3B7C /* libminimuxer.a */; };
|
||||||
191E5FB6290A5E1F001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FB5290A5E1F001A3B7C /* libminimuxer.a */; };
|
|
||||||
191E5FDC290AFA5C001A3B7C /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 191E5FDB290AFA5C001A3B7C /* OpenSSL */; };
|
191E5FDC290AFA5C001A3B7C /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 191E5FDB290AFA5C001A3B7C /* OpenSSL */; };
|
||||||
191E6066290B2DB1001A3B7C /* cbuf.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E605E290B2D6B001A3B7C /* cbuf.c */; };
|
|
||||||
191E6067290B2DB3001A3B7C /* collection.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6060290B2D6B001A3B7C /* collection.c */; };
|
|
||||||
191E6068290B2DB5001A3B7C /* glue.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E605D290B2D6B001A3B7C /* glue.c */; };
|
|
||||||
191E6069290B2DB7001A3B7C /* opack.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6061290B2D6B001A3B7C /* opack.c */; };
|
|
||||||
191E606A290B2DC4001A3B7C /* socket.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6064290B2D6B001A3B7C /* socket.c */; };
|
|
||||||
191E606B290B2DC6001A3B7C /* termcolors.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6065290B2D6B001A3B7C /* termcolors.c */; };
|
|
||||||
191E606C290B2DC8001A3B7C /* thread.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6063290B2D6B001A3B7C /* thread.c */; };
|
|
||||||
191E606D290B2DCA001A3B7C /* tlv.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6062290B2D6B001A3B7C /* tlv.c */; };
|
|
||||||
191E606E290B2DCB001A3B7C /* utils.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E605F290B2D6B001A3B7C /* utils.c */; };
|
|
||||||
191E6075290B2E46001A3B7C /* companion_proxy.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6073290B2E02001A3B7C /* companion_proxy.c */; };
|
|
||||||
191E6076290B2E48001A3B7C /* preboard.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6074290B2E02001A3B7C /* preboard.c */; };
|
|
||||||
191E607D290B2EA5001A3B7C /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FD0290A651D001A3B7C /* jsmn.c */; };
|
191E607D290B2EA5001A3B7C /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FD0290A651D001A3B7C /* jsmn.c */; };
|
||||||
191E607E290B2EA7001A3B7C /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FCF290A651D001A3B7C /* jplist.c */; };
|
191E607E290B2EA7001A3B7C /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FCF290A651D001A3B7C /* jplist.c */; };
|
||||||
191E6087290C7B50001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FB5290A5E1F001A3B7C /* libminimuxer.a */; };
|
191E6087290C7B50001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FB5290A5E1F001A3B7C /* libminimuxer.a */; };
|
||||||
@@ -33,10 +21,25 @@
|
|||||||
19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */; };
|
19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */; };
|
||||||
4879A95F2861046500FC1BBD /* AltSign in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A95E2861046500FC1BBD /* AltSign */; };
|
4879A95F2861046500FC1BBD /* AltSign in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A95E2861046500FC1BBD /* AltSign */; };
|
||||||
4879A9622861049C00FC1BBD /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A9612861049C00FC1BBD /* OpenSSL */; };
|
4879A9622861049C00FC1BBD /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A9612861049C00FC1BBD /* OpenSSL */; };
|
||||||
|
99C4EF4D2979132100CB538D /* SemanticVersion in Frameworks */ = {isa = PBXBuildFile; productRef = 99C4EF4C2979132100CB538D /* SemanticVersion */; };
|
||||||
B3146ED2284F581E00BBC3FD /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; };
|
B3146ED2284F581E00BBC3FD /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; };
|
||||||
B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; settings = {ATTRIBUTES = (CodeSignOnCopy, RemoveHeadersOnCopy, ); }; };
|
B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; settings = {ATTRIBUTES = (CodeSignOnCopy, RemoveHeadersOnCopy, ); }; };
|
||||||
|
B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F894295F7F9B002B1159 /* libfragmentzip.a */; };
|
||||||
|
B33FFBAA295F8F78002259E6 /* preboard.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBA9295F8F78002259E6 /* preboard.c */; };
|
||||||
|
B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBAB295F8F98002259E6 /* companion_proxy.c */; };
|
||||||
|
B343F858295F6331002B1159 /* libminimuxer_static.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F84C295F6321002B1159 /* libminimuxer_static.a */; };
|
||||||
|
B343F859295F6335002B1159 /* libem_proxy_static.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F853295F6323002B1159 /* libem_proxy_static.a */; };
|
||||||
|
B343F86D295F759E002B1159 /* libresolv.tbd in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F86C295F759E002B1159 /* libresolv.tbd */; };
|
||||||
|
B343F87C295F7C5D002B1159 /* opack.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F872295F7C5C002B1159 /* opack.c */; };
|
||||||
|
B343F87D295F7C5D002B1159 /* cbuf.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F873295F7C5C002B1159 /* cbuf.c */; };
|
||||||
|
B343F87E295F7C5D002B1159 /* collection.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F874295F7C5D002B1159 /* collection.c */; };
|
||||||
|
B343F87F295F7C5D002B1159 /* glue.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F875295F7C5D002B1159 /* glue.c */; };
|
||||||
|
B343F880295F7C5D002B1159 /* socket.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F876295F7C5D002B1159 /* socket.c */; };
|
||||||
|
B343F881295F7C5D002B1159 /* termcolors.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F877295F7C5D002B1159 /* termcolors.c */; };
|
||||||
|
B343F883295F7C5D002B1159 /* thread.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F879295F7C5D002B1159 /* thread.c */; };
|
||||||
|
B343F884295F7C5D002B1159 /* utils.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F87A295F7C5D002B1159 /* utils.c */; };
|
||||||
|
B343F885295F7C5D002B1159 /* tlv.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F87B295F7C5D002B1159 /* tlv.c */; };
|
||||||
B376FE3E29258C8900E18883 /* OSLog+SideStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = B376FE3D29258C8900E18883 /* OSLog+SideStore.swift */; };
|
B376FE3E29258C8900E18883 /* OSLog+SideStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = B376FE3D29258C8900E18883 /* OSLog+SideStore.swift */; };
|
||||||
B3919A52292DBE5400519575 /* ProgressRing.swift in Sources */ = {isa = PBXBuildFile; fileRef = D504F42528AD72C50014BB5D /* ProgressRing.swift */; };
|
|
||||||
B39575F5284F29E20080B4FF /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B39575F4284F29E20080B4FF /* Roxas.framework */; };
|
B39575F5284F29E20080B4FF /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B39575F4284F29E20080B4FF /* Roxas.framework */; };
|
||||||
B39F16132918D7C5002E9404 /* Consts.swift in Sources */ = {isa = PBXBuildFile; fileRef = B39F16122918D7C5002E9404 /* Consts.swift */; };
|
B39F16132918D7C5002E9404 /* Consts.swift in Sources */ = {isa = PBXBuildFile; fileRef = B39F16122918D7C5002E9404 /* Consts.swift */; };
|
||||||
B39F16152918D7DA002E9404 /* Consts+Proxy.swift in Sources */ = {isa = PBXBuildFile; fileRef = B39F16142918D7DA002E9404 /* Consts+Proxy.swift */; };
|
B39F16152918D7DA002E9404 /* Consts+Proxy.swift in Sources */ = {isa = PBXBuildFile; fileRef = B39F16142918D7DA002E9404 /* Consts+Proxy.swift */; };
|
||||||
@@ -119,13 +122,10 @@
|
|||||||
BF4588252298D3AB00BD7491 /* property_list_service.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4587F52298D3AA00BD7491 /* property_list_service.h */; };
|
BF4588252298D3AB00BD7491 /* property_list_service.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4587F52298D3AA00BD7491 /* property_list_service.h */; };
|
||||||
BF4588262298D3AB00BD7491 /* lockdown.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587F62298D3AB00BD7491 /* lockdown.c */; };
|
BF4588262298D3AB00BD7491 /* lockdown.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587F62298D3AB00BD7491 /* lockdown.c */; };
|
||||||
BF4588272298D3AB00BD7491 /* service.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587F72298D3AB00BD7491 /* service.c */; };
|
BF4588272298D3AB00BD7491 /* service.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587F72298D3AB00BD7491 /* service.c */; };
|
||||||
BF4588332298D3C100BD7491 /* socket.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4588292298D3C000BD7491 /* socket.h */; };
|
|
||||||
BF4588342298D3C100BD7491 /* userpref.h in Headers */ = {isa = PBXBuildFile; fileRef = BF45882A2298D3C000BD7491 /* userpref.h */; };
|
BF4588342298D3C100BD7491 /* userpref.h in Headers */ = {isa = PBXBuildFile; fileRef = BF45882A2298D3C000BD7491 /* userpref.h */; };
|
||||||
BF4588352298D3C100BD7491 /* userpref.c in Sources */ = {isa = PBXBuildFile; fileRef = BF45882B2298D3C000BD7491 /* userpref.c */; };
|
BF4588352298D3C100BD7491 /* userpref.c in Sources */ = {isa = PBXBuildFile; fileRef = BF45882B2298D3C000BD7491 /* userpref.c */; };
|
||||||
BF4588362298D3C100BD7491 /* debug.h in Headers */ = {isa = PBXBuildFile; fileRef = BF45882C2298D3C000BD7491 /* debug.h */; };
|
BF4588362298D3C100BD7491 /* debug.h in Headers */ = {isa = PBXBuildFile; fileRef = BF45882C2298D3C000BD7491 /* debug.h */; };
|
||||||
BF45883A2298D3C100BD7491 /* debug.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4588302298D3C000BD7491 /* debug.c */; };
|
BF45883A2298D3C100BD7491 /* debug.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4588302298D3C000BD7491 /* debug.c */; };
|
||||||
BF45883C2298D3C100BD7491 /* utils.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4588322298D3C100BD7491 /* utils.h */; };
|
|
||||||
BF4588402298D3F800BD7491 /* collection.h in Headers */ = {isa = PBXBuildFile; fileRef = BF45883E2298D3F800BD7491 /* collection.h */; };
|
|
||||||
BF4588432298D40000BD7491 /* libusbmuxd.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4588422298D40000BD7491 /* libusbmuxd.c */; };
|
BF4588432298D40000BD7491 /* libusbmuxd.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4588422298D40000BD7491 /* libusbmuxd.c */; };
|
||||||
BF4B78FE24B3D1DB008AB4AC /* SceneDelegate.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF4B78FD24B3D1DB008AB4AC /* SceneDelegate.swift */; };
|
BF4B78FE24B3D1DB008AB4AC /* SceneDelegate.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF4B78FD24B3D1DB008AB4AC /* SceneDelegate.swift */; };
|
||||||
BF56D2AC23DF8E170006506D /* FetchAppIDsOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF56D2AB23DF8E170006506D /* FetchAppIDsOperation.swift */; };
|
BF56D2AC23DF8E170006506D /* FetchAppIDsOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF56D2AB23DF8E170006506D /* FetchAppIDsOperation.swift */; };
|
||||||
@@ -322,14 +322,17 @@
|
|||||||
BFF0B69A2322D7D0007A79E1 /* UIScreen+CompactHeight.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFF0B6992322D7D0007A79E1 /* UIScreen+CompactHeight.swift */; };
|
BFF0B69A2322D7D0007A79E1 /* UIScreen+CompactHeight.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFF0B6992322D7D0007A79E1 /* UIScreen+CompactHeight.swift */; };
|
||||||
BFF435D8255CBDAB00DD724F /* ALTApplication+AltStoreApp.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFF435D7255CBDAB00DD724F /* ALTApplication+AltStoreApp.swift */; };
|
BFF435D8255CBDAB00DD724F /* ALTApplication+AltStoreApp.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFF435D7255CBDAB00DD724F /* ALTApplication+AltStoreApp.swift */; };
|
||||||
BFF615A82510042B00484D3B /* AltStoreCore.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = BF66EE7E2501AE50007EE018 /* AltStoreCore.framework */; };
|
BFF615A82510042B00484D3B /* AltStoreCore.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = BF66EE7E2501AE50007EE018 /* AltStoreCore.framework */; };
|
||||||
|
D52C08EE28AEC37A006C4AE5 /* AppVersion.swift in Sources */ = {isa = PBXBuildFile; fileRef = D52C08ED28AEC37A006C4AE5 /* AppVersion.swift */; };
|
||||||
D533E8B72727841800A9B5DD /* libAppleArchive.tbd in Frameworks */ = {isa = PBXBuildFile; fileRef = D533E8B62727841800A9B5DD /* libAppleArchive.tbd */; settings = {ATTRIBUTES = (Weak, ); }; };
|
D533E8B72727841800A9B5DD /* libAppleArchive.tbd in Frameworks */ = {isa = PBXBuildFile; fileRef = D533E8B62727841800A9B5DD /* libAppleArchive.tbd */; settings = {ATTRIBUTES = (Weak, ); }; };
|
||||||
D533E8BC2727BBEE00A9B5DD /* libfragmentzip.a in Frameworks */ = {isa = PBXBuildFile; fileRef = D533E8BB2727BBEE00A9B5DD /* libfragmentzip.a */; };
|
|
||||||
D533E8BE2727BBF800A9B5DD /* libcurl.a in Frameworks */ = {isa = PBXBuildFile; fileRef = D533E8BD2727BBF800A9B5DD /* libcurl.a */; };
|
D533E8BE2727BBF800A9B5DD /* libcurl.a in Frameworks */ = {isa = PBXBuildFile; fileRef = D533E8BD2727BBF800A9B5DD /* libcurl.a */; };
|
||||||
|
D54DED1428CBC44B008B27A0 /* ErrorLogTableViewCell.swift in Sources */ = {isa = PBXBuildFile; fileRef = D54DED1328CBC44B008B27A0 /* ErrorLogTableViewCell.swift */; };
|
||||||
D55E163728776CB700A627A1 /* ComplicationView.swift in Sources */ = {isa = PBXBuildFile; fileRef = D55E163528776CB000A627A1 /* ComplicationView.swift */; };
|
D55E163728776CB700A627A1 /* ComplicationView.swift in Sources */ = {isa = PBXBuildFile; fileRef = D55E163528776CB000A627A1 /* ComplicationView.swift */; };
|
||||||
D57DF638271E32F000677701 /* PatchApp.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = D57DF637271E32F000677701 /* PatchApp.storyboard */; };
|
D57DF638271E32F000677701 /* PatchApp.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = D57DF637271E32F000677701 /* PatchApp.storyboard */; };
|
||||||
D57DF63F271E51E400677701 /* ALTAppPatcher.m in Sources */ = {isa = PBXBuildFile; fileRef = D57DF63E271E51E400677701 /* ALTAppPatcher.m */; };
|
D57DF63F271E51E400677701 /* ALTAppPatcher.m in Sources */ = {isa = PBXBuildFile; fileRef = D57DF63E271E51E400677701 /* ALTAppPatcher.m */; };
|
||||||
D57F2C9126E0070200B9FA39 /* EnableJITOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */; };
|
D57F2C9126E0070200B9FA39 /* EnableJITOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */; };
|
||||||
D57F2C9426E01BC700B9FA39 /* UIDevice+Vibration.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57F2C9326E01BC700B9FA39 /* UIDevice+Vibration.swift */; };
|
D57F2C9426E01BC700B9FA39 /* UIDevice+Vibration.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57F2C9326E01BC700B9FA39 /* UIDevice+Vibration.swift */; };
|
||||||
|
D57FE84428C7DB7100216002 /* ErrorLogViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */; };
|
||||||
|
D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = D58916FD28C7C55C00E39C8B /* LoggedError.swift */; };
|
||||||
D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D593F1932717749A006E82DE /* PatchAppOperation.swift */; };
|
D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D593F1932717749A006E82DE /* PatchAppOperation.swift */; };
|
||||||
D5CA0C4B280E141900469595 /* ManagedPatron.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4A280E141900469595 /* ManagedPatron.swift */; };
|
D5CA0C4B280E141900469595 /* ManagedPatron.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4A280E141900469595 /* ManagedPatron.swift */; };
|
||||||
D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */; };
|
D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */; };
|
||||||
@@ -337,6 +340,8 @@
|
|||||||
D5DAE0962804DF430034D8D4 /* UpdatePatronsOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */; };
|
D5DAE0962804DF430034D8D4 /* UpdatePatronsOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */; };
|
||||||
D5E1E7C128077DE90016FC96 /* FetchTrustedSourcesOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */; };
|
D5E1E7C128077DE90016FC96 /* FetchTrustedSourcesOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */; };
|
||||||
D5F2F6A92720B7C20081CCF5 /* PatchViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5F2F6A82720B7C20081CCF5 /* PatchViewController.swift */; };
|
D5F2F6A92720B7C20081CCF5 /* PatchViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5F2F6A82720B7C20081CCF5 /* PatchViewController.swift */; };
|
||||||
|
D5F99A1828D11DB500476A16 /* AltStore10ToAltStore11.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5F99A1728D11DB500476A16 /* AltStore10ToAltStore11.xcmappingmodel */; };
|
||||||
|
D5F99A1A28D12B1400476A16 /* StoreApp10ToStoreApp11Policy.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5F99A1928D12B1400476A16 /* StoreApp10ToStoreApp11Policy.swift */; };
|
||||||
/* End PBXBuildFile section */
|
/* End PBXBuildFile section */
|
||||||
|
|
||||||
/* Begin PBXContainerItemProxy section */
|
/* Begin PBXContainerItemProxy section */
|
||||||
@@ -382,6 +387,69 @@
|
|||||||
remoteGlobalIDString = BFADB00319AE7BB80050CF31;
|
remoteGlobalIDString = BFADB00319AE7BB80050CF31;
|
||||||
remoteInfo = RoxasTests;
|
remoteInfo = RoxasTests;
|
||||||
};
|
};
|
||||||
|
B343F84B295F6321002B1159 /* PBXContainerItemProxy */ = {
|
||||||
|
isa = PBXContainerItemProxy;
|
||||||
|
containerPortal = B343F847295F6321002B1159 /* minimuxer.xcodeproj */;
|
||||||
|
proxyType = 2;
|
||||||
|
remoteGlobalIDString = CA609C732349C7AAD9FA67C4;
|
||||||
|
remoteInfo = "minimuxer-staticlib";
|
||||||
|
};
|
||||||
|
B343F852295F6323002B1159 /* PBXContainerItemProxy */ = {
|
||||||
|
isa = PBXContainerItemProxy;
|
||||||
|
containerPortal = B343F84D295F6323002B1159 /* em_proxy.xcodeproj */;
|
||||||
|
proxyType = 2;
|
||||||
|
remoteGlobalIDString = CA60C44C93D7916DE57E6EBD;
|
||||||
|
remoteInfo = "em_proxy-staticlib";
|
||||||
|
};
|
||||||
|
B343F854295F6323002B1159 /* PBXContainerItemProxy */ = {
|
||||||
|
isa = PBXContainerItemProxy;
|
||||||
|
containerPortal = B343F84D295F6323002B1159 /* em_proxy.xcodeproj */;
|
||||||
|
proxyType = 2;
|
||||||
|
remoteGlobalIDString = CA60058A9FBE4D17AF51A7D5;
|
||||||
|
remoteInfo = "run-bin";
|
||||||
|
};
|
||||||
|
B343F86E295F76FD002B1159 /* PBXContainerItemProxy */ = {
|
||||||
|
isa = PBXContainerItemProxy;
|
||||||
|
containerPortal = B343F847295F6321002B1159 /* minimuxer.xcodeproj */;
|
||||||
|
proxyType = 1;
|
||||||
|
remoteGlobalIDString = CA609C732349A560B9642892;
|
||||||
|
remoteInfo = "minimuxer-staticlib";
|
||||||
|
};
|
||||||
|
B343F870295F7704002B1159 /* PBXContainerItemProxy */ = {
|
||||||
|
isa = PBXContainerItemProxy;
|
||||||
|
containerPortal = B343F84D295F6323002B1159 /* em_proxy.xcodeproj */;
|
||||||
|
proxyType = 1;
|
||||||
|
remoteGlobalIDString = CA60C44C93D7A30E3695DD59;
|
||||||
|
remoteInfo = "em_proxy-staticlib";
|
||||||
|
};
|
||||||
|
B343F88D295F7F9B002B1159 /* PBXContainerItemProxy */ = {
|
||||||
|
isa = PBXContainerItemProxy;
|
||||||
|
containerPortal = B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */;
|
||||||
|
proxyType = 2;
|
||||||
|
remoteGlobalIDString = 87B8C3401E0E9C37002F817D;
|
||||||
|
remoteInfo = "fragmentzip-cli-macOS";
|
||||||
|
};
|
||||||
|
B343F88F295F7F9B002B1159 /* PBXContainerItemProxy */ = {
|
||||||
|
isa = PBXContainerItemProxy;
|
||||||
|
containerPortal = B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */;
|
||||||
|
proxyType = 2;
|
||||||
|
remoteGlobalIDString = B315FDB02866CCF8002E243C;
|
||||||
|
remoteInfo = "fragmentzip-cli-iOS";
|
||||||
|
};
|
||||||
|
B343F891295F7F9B002B1159 /* PBXContainerItemProxy */ = {
|
||||||
|
isa = PBXContainerItemProxy;
|
||||||
|
containerPortal = B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */;
|
||||||
|
proxyType = 2;
|
||||||
|
remoteGlobalIDString = B315FDB52866CD91002E243C;
|
||||||
|
remoteInfo = "fragmentzip-macOS";
|
||||||
|
};
|
||||||
|
B343F893295F7F9B002B1159 /* PBXContainerItemProxy */ = {
|
||||||
|
isa = PBXContainerItemProxy;
|
||||||
|
containerPortal = B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */;
|
||||||
|
proxyType = 2;
|
||||||
|
remoteGlobalIDString = B315FDCE2866CDD3002E243C;
|
||||||
|
remoteInfo = "fragmentzip-iOS";
|
||||||
|
};
|
||||||
BF66EE832501AE50007EE018 /* PBXContainerItemProxy */ = {
|
BF66EE832501AE50007EE018 /* PBXContainerItemProxy */ = {
|
||||||
isa = PBXContainerItemProxy;
|
isa = PBXContainerItemProxy;
|
||||||
containerPortal = BFD247622284B9A500981D42 /* Project object */;
|
containerPortal = BFD247622284B9A500981D42 /* Project object */;
|
||||||
@@ -433,8 +501,6 @@
|
|||||||
/* End PBXCopyFilesBuildPhase section */
|
/* End PBXCopyFilesBuildPhase section */
|
||||||
|
|
||||||
/* Begin PBXFileReference section */
|
/* Begin PBXFileReference section */
|
||||||
19104DA32909BC1000C49C7B /* libem_proxy.a */ = {isa = PBXFileReference; lastKnownFileType = archive.ar; name = libem_proxy.a; path = "Dependencies/em_proxy/target/aarch64-apple-ios/debug/libem_proxy.a"; sourceTree = "<group>"; };
|
|
||||||
19104DA92909BC7100C49C7B /* em_proxy.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = em_proxy.h; sourceTree = "<group>"; };
|
|
||||||
19104DB22909C06C00C49C7B /* libEmotionalDamage.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libEmotionalDamage.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
19104DB22909C06C00C49C7B /* libEmotionalDamage.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libEmotionalDamage.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
||||||
19104DB42909C06D00C49C7B /* EmotionalDamage.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EmotionalDamage.swift; sourceTree = "<group>"; };
|
19104DB42909C06D00C49C7B /* EmotionalDamage.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EmotionalDamage.swift; sourceTree = "<group>"; };
|
||||||
191E5FAB290A5D92001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
191E5FAB290A5D92001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer.a; sourceTree = BUILT_PRODUCTS_DIR; };
|
||||||
@@ -443,21 +509,24 @@
|
|||||||
191E5FCF290A651D001A3B7C /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
|
191E5FCF290A651D001A3B7C /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
|
||||||
191E5FD0290A651D001A3B7C /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
|
191E5FD0290A651D001A3B7C /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
|
||||||
191E5FD1290A651D001A3B7C /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
|
191E5FD1290A651D001A3B7C /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
|
||||||
191E5FD7290A6EFB001A3B7C /* minimuxer.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = minimuxer.h; path = ../Dependencies/minimuxer/minimuxer.h; sourceTree = "<group>"; };
|
|
||||||
191E605D290B2D6B001A3B7C /* glue.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = glue.c; path = "../Dependencies/libimobiledevice-glue/src/glue.c"; sourceTree = "<group>"; };
|
|
||||||
191E605E290B2D6B001A3B7C /* cbuf.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = cbuf.c; path = "../Dependencies/libimobiledevice-glue/src/cbuf.c"; sourceTree = "<group>"; };
|
|
||||||
191E605F290B2D6B001A3B7C /* utils.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = utils.c; path = "../Dependencies/libimobiledevice-glue/src/utils.c"; sourceTree = "<group>"; };
|
|
||||||
191E6060290B2D6B001A3B7C /* collection.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = collection.c; path = "../Dependencies/libimobiledevice-glue/src/collection.c"; sourceTree = "<group>"; };
|
|
||||||
191E6061290B2D6B001A3B7C /* opack.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = opack.c; path = "../Dependencies/libimobiledevice-glue/src/opack.c"; sourceTree = "<group>"; };
|
|
||||||
191E6062290B2D6B001A3B7C /* tlv.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = tlv.c; path = "../Dependencies/libimobiledevice-glue/src/tlv.c"; sourceTree = "<group>"; };
|
|
||||||
191E6063290B2D6B001A3B7C /* thread.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = thread.c; path = "../Dependencies/libimobiledevice-glue/src/thread.c"; sourceTree = "<group>"; };
|
|
||||||
191E6064290B2D6B001A3B7C /* socket.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = socket.c; path = "../Dependencies/libimobiledevice-glue/src/socket.c"; sourceTree = "<group>"; };
|
|
||||||
191E6065290B2D6B001A3B7C /* termcolors.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = termcolors.c; path = "../Dependencies/libimobiledevice-glue/src/termcolors.c"; sourceTree = "<group>"; };
|
|
||||||
191E6073290B2E02001A3B7C /* companion_proxy.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = companion_proxy.c; path = ../Dependencies/libimobiledevice/src/companion_proxy.c; sourceTree = "<group>"; };
|
|
||||||
191E6074290B2E02001A3B7C /* preboard.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = preboard.c; path = ../Dependencies/libimobiledevice/src/preboard.c; sourceTree = "<group>"; };
|
|
||||||
1920B04E2924AC8300744F60 /* Settings.bundle */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.plug-in"; path = Settings.bundle; sourceTree = "<group>"; };
|
1920B04E2924AC8300744F60 /* Settings.bundle */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.plug-in"; path = Settings.bundle; sourceTree = "<group>"; };
|
||||||
19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SelectTeamViewController.swift; sourceTree = "<group>"; };
|
19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SelectTeamViewController.swift; sourceTree = "<group>"; };
|
||||||
B3146EC6284F580500BBC3FD /* Roxas.xcodeproj */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.pb-project"; name = Roxas.xcodeproj; path = Dependencies/Roxas/Roxas.xcodeproj; sourceTree = "<group>"; };
|
B3146EC6284F580500BBC3FD /* Roxas.xcodeproj */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.pb-project"; name = Roxas.xcodeproj; path = Dependencies/Roxas/Roxas.xcodeproj; sourceTree = "<group>"; };
|
||||||
|
B33FFBA9295F8F78002259E6 /* preboard.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = preboard.c; path = src/preboard.c; sourceTree = "<group>"; };
|
||||||
|
B33FFBAB295F8F98002259E6 /* companion_proxy.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = companion_proxy.c; path = src/companion_proxy.c; sourceTree = "<group>"; };
|
||||||
|
B343F847295F6321002B1159 /* minimuxer.xcodeproj */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.pb-project"; name = minimuxer.xcodeproj; path = Dependencies/minimuxer.xcodeproj; sourceTree = SOURCE_ROOT; };
|
||||||
|
B343F84D295F6323002B1159 /* em_proxy.xcodeproj */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.pb-project"; name = em_proxy.xcodeproj; path = Dependencies/em_proxy.xcodeproj; sourceTree = SOURCE_ROOT; };
|
||||||
|
B343F86C295F759E002B1159 /* libresolv.tbd */ = {isa = PBXFileReference; lastKnownFileType = "sourcecode.text-based-dylib-definition"; name = libresolv.tbd; path = Platforms/MacOSX.platform/Developer/SDKs/MacOSX13.1.sdk/usr/lib/libresolv.tbd; sourceTree = DEVELOPER_DIR; };
|
||||||
|
B343F872295F7C5C002B1159 /* opack.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = opack.c; sourceTree = "<group>"; };
|
||||||
|
B343F873295F7C5C002B1159 /* cbuf.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = cbuf.c; sourceTree = "<group>"; };
|
||||||
|
B343F874295F7C5D002B1159 /* collection.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = collection.c; sourceTree = "<group>"; };
|
||||||
|
B343F875295F7C5D002B1159 /* glue.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = glue.c; sourceTree = "<group>"; };
|
||||||
|
B343F876295F7C5D002B1159 /* socket.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = socket.c; sourceTree = "<group>"; };
|
||||||
|
B343F877295F7C5D002B1159 /* termcolors.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = termcolors.c; sourceTree = "<group>"; };
|
||||||
|
B343F879295F7C5D002B1159 /* thread.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = thread.c; sourceTree = "<group>"; };
|
||||||
|
B343F87A295F7C5D002B1159 /* utils.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = utils.c; sourceTree = "<group>"; };
|
||||||
|
B343F87B295F7C5D002B1159 /* tlv.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = tlv.c; sourceTree = "<group>"; };
|
||||||
|
B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.pb-project"; name = libfragmentzip.xcodeproj; path = Dependencies/libfragmentzip/libfragmentzip.xcodeproj; sourceTree = "<group>"; };
|
||||||
B376FE3D29258C8900E18883 /* OSLog+SideStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "OSLog+SideStore.swift"; sourceTree = "<group>"; };
|
B376FE3D29258C8900E18883 /* OSLog+SideStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "OSLog+SideStore.swift"; sourceTree = "<group>"; };
|
||||||
B39575F4284F29E20080B4FF /* Roxas.framework */ = {isa = PBXFileReference; explicitFileType = wrapper.framework; path = Roxas.framework; sourceTree = BUILT_PRODUCTS_DIR; };
|
B39575F4284F29E20080B4FF /* Roxas.framework */ = {isa = PBXFileReference; explicitFileType = wrapper.framework; path = Roxas.framework; sourceTree = BUILT_PRODUCTS_DIR; };
|
||||||
B39F16122918D7C5002E9404 /* Consts.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = Consts.swift; sourceTree = "<group>"; };
|
B39F16122918D7C5002E9404 /* Consts.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = Consts.swift; sourceTree = "<group>"; };
|
||||||
@@ -552,19 +621,11 @@
|
|||||||
BF4587F52298D3AA00BD7491 /* property_list_service.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = property_list_service.h; path = Dependencies/libimobiledevice/src/property_list_service.h; sourceTree = SOURCE_ROOT; };
|
BF4587F52298D3AA00BD7491 /* property_list_service.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = property_list_service.h; path = Dependencies/libimobiledevice/src/property_list_service.h; sourceTree = SOURCE_ROOT; };
|
||||||
BF4587F62298D3AB00BD7491 /* lockdown.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = lockdown.c; path = Dependencies/libimobiledevice/src/lockdown.c; sourceTree = SOURCE_ROOT; };
|
BF4587F62298D3AB00BD7491 /* lockdown.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = lockdown.c; path = Dependencies/libimobiledevice/src/lockdown.c; sourceTree = SOURCE_ROOT; };
|
||||||
BF4587F72298D3AB00BD7491 /* service.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = service.c; path = Dependencies/libimobiledevice/src/service.c; sourceTree = SOURCE_ROOT; };
|
BF4587F72298D3AB00BD7491 /* service.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = service.c; path = Dependencies/libimobiledevice/src/service.c; sourceTree = SOURCE_ROOT; };
|
||||||
BF4588292298D3C000BD7491 /* socket.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = socket.h; path = Dependencies/libimobiledevice/common/socket.h; sourceTree = SOURCE_ROOT; };
|
|
||||||
BF45882A2298D3C000BD7491 /* userpref.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = userpref.h; path = Dependencies/libimobiledevice/common/userpref.h; sourceTree = SOURCE_ROOT; };
|
BF45882A2298D3C000BD7491 /* userpref.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = userpref.h; path = Dependencies/libimobiledevice/common/userpref.h; sourceTree = SOURCE_ROOT; };
|
||||||
BF45882B2298D3C000BD7491 /* userpref.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = userpref.c; path = Dependencies/libimobiledevice/common/userpref.c; sourceTree = SOURCE_ROOT; };
|
BF45882B2298D3C000BD7491 /* userpref.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = userpref.c; path = Dependencies/libimobiledevice/common/userpref.c; sourceTree = SOURCE_ROOT; };
|
||||||
BF45882C2298D3C000BD7491 /* debug.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = debug.h; path = Dependencies/libimobiledevice/common/debug.h; sourceTree = SOURCE_ROOT; };
|
BF45882C2298D3C000BD7491 /* debug.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = debug.h; path = Dependencies/libimobiledevice/common/debug.h; sourceTree = SOURCE_ROOT; };
|
||||||
BF45882D2298D3C000BD7491 /* utils.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = utils.c; path = Dependencies/libimobiledevice/common/utils.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
BF45882F2298D3C000BD7491 /* socket.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = socket.c; path = Dependencies/libimobiledevice/common/socket.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
BF4588302298D3C000BD7491 /* debug.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = debug.c; path = Dependencies/libimobiledevice/common/debug.c; sourceTree = SOURCE_ROOT; };
|
BF4588302298D3C000BD7491 /* debug.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = debug.c; path = Dependencies/libimobiledevice/common/debug.c; sourceTree = SOURCE_ROOT; };
|
||||||
BF4588322298D3C100BD7491 /* utils.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = utils.h; path = Dependencies/libimobiledevice/common/utils.h; sourceTree = SOURCE_ROOT; };
|
|
||||||
BF45883E2298D3F800BD7491 /* collection.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = collection.h; path = Dependencies/libusbmuxd/common/collection.h; sourceTree = SOURCE_ROOT; };
|
|
||||||
BF45883F2298D3F800BD7491 /* collection.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = collection.c; path = Dependencies/libusbmuxd/common/collection.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
BF4588422298D40000BD7491 /* libusbmuxd.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = libusbmuxd.c; path = Dependencies/libusbmuxd/src/libusbmuxd.c; sourceTree = SOURCE_ROOT; };
|
BF4588422298D40000BD7491 /* libusbmuxd.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = libusbmuxd.c; path = Dependencies/libusbmuxd/src/libusbmuxd.c; sourceTree = SOURCE_ROOT; };
|
||||||
BF4588482298D55000BD7491 /* thread.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = thread.c; path = Dependencies/libusbmuxd/common/thread.c; sourceTree = SOURCE_ROOT; };
|
|
||||||
BF4588492298D55000BD7491 /* thread.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = thread.h; path = Dependencies/libusbmuxd/common/thread.h; sourceTree = SOURCE_ROOT; };
|
|
||||||
BF4588872298DD3F00BD7491 /* libxml2.tbd */ = {isa = PBXFileReference; lastKnownFileType = "sourcecode.text-based-dylib-definition"; name = libxml2.tbd; path = Platforms/MacOSX.platform/Developer/SDKs/MacOSX10.14.sdk/usr/lib/libxml2.tbd; sourceTree = DEVELOPER_DIR; };
|
BF4588872298DD3F00BD7491 /* libxml2.tbd */ = {isa = PBXFileReference; lastKnownFileType = "sourcecode.text-based-dylib-definition"; name = libxml2.tbd; path = Platforms/MacOSX.platform/Developer/SDKs/MacOSX10.14.sdk/usr/lib/libxml2.tbd; sourceTree = DEVELOPER_DIR; };
|
||||||
BF4B78FD24B3D1DB008AB4AC /* SceneDelegate.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SceneDelegate.swift; sourceTree = "<group>"; };
|
BF4B78FD24B3D1DB008AB4AC /* SceneDelegate.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SceneDelegate.swift; sourceTree = "<group>"; };
|
||||||
BF56D2AB23DF8E170006506D /* FetchAppIDsOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = FetchAppIDsOperation.swift; sourceTree = "<group>"; };
|
BF56D2AB23DF8E170006506D /* FetchAppIDsOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = FetchAppIDsOperation.swift; sourceTree = "<group>"; };
|
||||||
@@ -761,17 +822,21 @@
|
|||||||
BFF7C906257844C900E55F36 /* AltXPCProtocol.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = AltXPCProtocol.h; sourceTree = "<group>"; };
|
BFF7C906257844C900E55F36 /* AltXPCProtocol.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = AltXPCProtocol.h; sourceTree = "<group>"; };
|
||||||
BFF7EC4C25081E9300BDE521 /* AltStore 8.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 8.xcdatamodel"; sourceTree = "<group>"; };
|
BFF7EC4C25081E9300BDE521 /* AltStore 8.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 8.xcdatamodel"; sourceTree = "<group>"; };
|
||||||
BFFCFA45248835530077BFCE /* AltDaemon.entitlements */ = {isa = PBXFileReference; lastKnownFileType = text.plist.entitlements; path = AltDaemon.entitlements; sourceTree = "<group>"; };
|
BFFCFA45248835530077BFCE /* AltDaemon.entitlements */ = {isa = PBXFileReference; lastKnownFileType = text.plist.entitlements; path = AltDaemon.entitlements; sourceTree = "<group>"; };
|
||||||
D504F42528AD72C50014BB5D /* ProgressRing.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ProgressRing.swift; sourceTree = "<group>"; };
|
D52C08ED28AEC37A006C4AE5 /* AppVersion.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = AppVersion.swift; sourceTree = "<group>"; };
|
||||||
|
D52E988928D002D30032BE6B /* AltStore 11.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 11.xcdatamodel"; sourceTree = "<group>"; };
|
||||||
D533E8B62727841800A9B5DD /* libAppleArchive.tbd */ = {isa = PBXFileReference; lastKnownFileType = "sourcecode.text-based-dylib-definition"; name = libAppleArchive.tbd; path = usr/lib/libAppleArchive.tbd; sourceTree = SDKROOT; };
|
D533E8B62727841800A9B5DD /* libAppleArchive.tbd */ = {isa = PBXFileReference; lastKnownFileType = "sourcecode.text-based-dylib-definition"; name = libAppleArchive.tbd; path = usr/lib/libAppleArchive.tbd; sourceTree = SDKROOT; };
|
||||||
D533E8B82727B61400A9B5DD /* fragmentzip.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = fragmentzip.h; sourceTree = "<group>"; };
|
D533E8B82727B61400A9B5DD /* fragmentzip.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = fragmentzip.h; sourceTree = "<group>"; };
|
||||||
D533E8BB2727BBEE00A9B5DD /* libfragmentzip.a */ = {isa = PBXFileReference; lastKnownFileType = archive.ar; name = libfragmentzip.a; path = Dependencies/fragmentzip/libfragmentzip.a; sourceTree = SOURCE_ROOT; };
|
D533E8BB2727BBEE00A9B5DD /* libfragmentzip.a */ = {isa = PBXFileReference; lastKnownFileType = archive.ar; name = libfragmentzip.a; path = Dependencies/fragmentzip/libfragmentzip.a; sourceTree = SOURCE_ROOT; };
|
||||||
D533E8BD2727BBF800A9B5DD /* libcurl.a */ = {isa = PBXFileReference; lastKnownFileType = archive.ar; name = libcurl.a; path = Dependencies/libcurl/libcurl.a; sourceTree = SOURCE_ROOT; };
|
D533E8BD2727BBF800A9B5DD /* libcurl.a */ = {isa = PBXFileReference; lastKnownFileType = archive.ar; name = libcurl.a; path = Dependencies/libcurl/libcurl.a; sourceTree = SOURCE_ROOT; };
|
||||||
|
D54DED1328CBC44B008B27A0 /* ErrorLogTableViewCell.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorLogTableViewCell.swift; sourceTree = "<group>"; };
|
||||||
D55E163528776CB000A627A1 /* ComplicationView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ComplicationView.swift; sourceTree = "<group>"; };
|
D55E163528776CB000A627A1 /* ComplicationView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ComplicationView.swift; sourceTree = "<group>"; };
|
||||||
D57DF637271E32F000677701 /* PatchApp.storyboard */ = {isa = PBXFileReference; lastKnownFileType = file.storyboard; path = PatchApp.storyboard; sourceTree = "<group>"; };
|
D57DF637271E32F000677701 /* PatchApp.storyboard */ = {isa = PBXFileReference; lastKnownFileType = file.storyboard; path = PatchApp.storyboard; sourceTree = "<group>"; };
|
||||||
D57DF63D271E51E400677701 /* ALTAppPatcher.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTAppPatcher.h; sourceTree = "<group>"; };
|
D57DF63D271E51E400677701 /* ALTAppPatcher.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTAppPatcher.h; sourceTree = "<group>"; };
|
||||||
D57DF63E271E51E400677701 /* ALTAppPatcher.m */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.objc; path = ALTAppPatcher.m; sourceTree = "<group>"; };
|
D57DF63E271E51E400677701 /* ALTAppPatcher.m */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.objc; path = ALTAppPatcher.m; sourceTree = "<group>"; };
|
||||||
D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EnableJITOperation.swift; sourceTree = "<group>"; };
|
D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EnableJITOperation.swift; sourceTree = "<group>"; };
|
||||||
D57F2C9326E01BC700B9FA39 /* UIDevice+Vibration.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; path = "UIDevice+Vibration.swift"; sourceTree = "<group>"; };
|
D57F2C9326E01BC700B9FA39 /* UIDevice+Vibration.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; path = "UIDevice+Vibration.swift"; sourceTree = "<group>"; };
|
||||||
|
D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorLogViewController.swift; sourceTree = "<group>"; };
|
||||||
|
D58916FD28C7C55C00E39C8B /* LoggedError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoggedError.swift; sourceTree = "<group>"; };
|
||||||
D593F1932717749A006E82DE /* PatchAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchAppOperation.swift; sourceTree = "<group>"; };
|
D593F1932717749A006E82DE /* PatchAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchAppOperation.swift; sourceTree = "<group>"; };
|
||||||
D5CA0C4A280E141900469595 /* ManagedPatron.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ManagedPatron.swift; sourceTree = "<group>"; };
|
D5CA0C4A280E141900469595 /* ManagedPatron.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ManagedPatron.swift; sourceTree = "<group>"; };
|
||||||
D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 10.xcdatamodel"; sourceTree = "<group>"; };
|
D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 10.xcdatamodel"; sourceTree = "<group>"; };
|
||||||
@@ -780,6 +845,8 @@
|
|||||||
D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = UpdatePatronsOperation.swift; sourceTree = "<group>"; };
|
D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = UpdatePatronsOperation.swift; sourceTree = "<group>"; };
|
||||||
D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = FetchTrustedSourcesOperation.swift; sourceTree = "<group>"; };
|
D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = FetchTrustedSourcesOperation.swift; sourceTree = "<group>"; };
|
||||||
D5F2F6A82720B7C20081CCF5 /* PatchViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchViewController.swift; sourceTree = "<group>"; };
|
D5F2F6A82720B7C20081CCF5 /* PatchViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchViewController.swift; sourceTree = "<group>"; };
|
||||||
|
D5F99A1728D11DB500476A16 /* AltStore10ToAltStore11.xcmappingmodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcmappingmodel; path = AltStore10ToAltStore11.xcmappingmodel; sourceTree = "<group>"; };
|
||||||
|
D5F99A1928D12B1400476A16 /* StoreApp10ToStoreApp11Policy.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = StoreApp10ToStoreApp11Policy.swift; sourceTree = "<group>"; };
|
||||||
/* End PBXFileReference section */
|
/* End PBXFileReference section */
|
||||||
|
|
||||||
/* Begin PBXFrameworksBuildPhase section */
|
/* Begin PBXFrameworksBuildPhase section */
|
||||||
@@ -787,7 +854,8 @@
|
|||||||
isa = PBXFrameworksBuildPhase;
|
isa = PBXFrameworksBuildPhase;
|
||||||
buildActionMask = 2147483647;
|
buildActionMask = 2147483647;
|
||||||
files = (
|
files = (
|
||||||
19104DBB2909C11700C49C7B /* libem_proxy.a in Frameworks */,
|
B343F86D295F759E002B1159 /* libresolv.tbd in Frameworks */,
|
||||||
|
B343F859295F6335002B1159 /* libem_proxy_static.a in Frameworks */,
|
||||||
);
|
);
|
||||||
runOnlyForDeploymentPostprocessing = 0;
|
runOnlyForDeploymentPostprocessing = 0;
|
||||||
};
|
};
|
||||||
@@ -795,7 +863,7 @@
|
|||||||
isa = PBXFrameworksBuildPhase;
|
isa = PBXFrameworksBuildPhase;
|
||||||
buildActionMask = 2147483647;
|
buildActionMask = 2147483647;
|
||||||
files = (
|
files = (
|
||||||
191E5FB6290A5E1F001A3B7C /* libminimuxer.a in Frameworks */,
|
B343F858295F6331002B1159 /* libminimuxer_static.a in Frameworks */,
|
||||||
);
|
);
|
||||||
runOnlyForDeploymentPostprocessing = 0;
|
runOnlyForDeploymentPostprocessing = 0;
|
||||||
};
|
};
|
||||||
@@ -827,6 +895,7 @@
|
|||||||
buildActionMask = 2147483647;
|
buildActionMask = 2147483647;
|
||||||
files = (
|
files = (
|
||||||
B3C395F1284F2DE700DA9E2F /* KeychainAccess in Frameworks */,
|
B3C395F1284F2DE700DA9E2F /* KeychainAccess in Frameworks */,
|
||||||
|
99C4EF4D2979132100CB538D /* SemanticVersion in Frameworks */,
|
||||||
4879A95F2861046500FC1BBD /* AltSign in Frameworks */,
|
4879A95F2861046500FC1BBD /* AltSign in Frameworks */,
|
||||||
B39575F5284F29E20080B4FF /* Roxas.framework in Frameworks */,
|
B39575F5284F29E20080B4FF /* Roxas.framework in Frameworks */,
|
||||||
);
|
);
|
||||||
@@ -844,6 +913,7 @@
|
|||||||
isa = PBXFrameworksBuildPhase;
|
isa = PBXFrameworksBuildPhase;
|
||||||
buildActionMask = 2147483647;
|
buildActionMask = 2147483647;
|
||||||
files = (
|
files = (
|
||||||
|
B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */,
|
||||||
191E6087290C7B50001A3B7C /* libminimuxer.a in Frameworks */,
|
191E6087290C7B50001A3B7C /* libminimuxer.a in Frameworks */,
|
||||||
191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */,
|
191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */,
|
||||||
19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */,
|
19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */,
|
||||||
@@ -856,7 +926,6 @@
|
|||||||
B3C395F4284F35DD00DA9E2F /* Nuke in Frameworks */,
|
B3C395F4284F35DD00DA9E2F /* Nuke in Frameworks */,
|
||||||
BF1614F1250822F100767AEA /* Roxas.framework in Frameworks */,
|
BF1614F1250822F100767AEA /* Roxas.framework in Frameworks */,
|
||||||
B3C395F7284F362400DA9E2F /* AppCenterAnalytics in Frameworks */,
|
B3C395F7284F362400DA9E2F /* AppCenterAnalytics in Frameworks */,
|
||||||
D533E8BC2727BBEE00A9B5DD /* libfragmentzip.a in Frameworks */,
|
|
||||||
BF66EE852501AE50007EE018 /* AltStoreCore.framework in Frameworks */,
|
BF66EE852501AE50007EE018 /* AltStoreCore.framework in Frameworks */,
|
||||||
);
|
);
|
||||||
runOnlyForDeploymentPostprocessing = 0;
|
runOnlyForDeploymentPostprocessing = 0;
|
||||||
@@ -867,7 +936,7 @@
|
|||||||
19104DB32909C06D00C49C7B /* EmotionalDamage */ = {
|
19104DB32909C06D00C49C7B /* EmotionalDamage */ = {
|
||||||
isa = PBXGroup;
|
isa = PBXGroup;
|
||||||
children = (
|
children = (
|
||||||
19104DA92909BC7100C49C7B /* em_proxy.h */,
|
B343F84D295F6323002B1159 /* em_proxy.xcodeproj */,
|
||||||
19104DB42909C06D00C49C7B /* EmotionalDamage.swift */,
|
19104DB42909C06D00C49C7B /* EmotionalDamage.swift */,
|
||||||
);
|
);
|
||||||
path = EmotionalDamage;
|
path = EmotionalDamage;
|
||||||
@@ -876,7 +945,7 @@
|
|||||||
191E5FAC290A5D92001A3B7C /* minimuxer */ = {
|
191E5FAC290A5D92001A3B7C /* minimuxer */ = {
|
||||||
isa = PBXGroup;
|
isa = PBXGroup;
|
||||||
children = (
|
children = (
|
||||||
191E5FD7290A6EFB001A3B7C /* minimuxer.h */,
|
B343F847295F6321002B1159 /* minimuxer.xcodeproj */,
|
||||||
191E5FAD290A5D92001A3B7C /* minimuxer.swift */,
|
191E5FAD290A5D92001A3B7C /* minimuxer.swift */,
|
||||||
);
|
);
|
||||||
path = minimuxer;
|
path = minimuxer;
|
||||||
@@ -885,17 +954,18 @@
|
|||||||
191E5FF4290B2663001A3B7C /* libimobiledevice-glue */ = {
|
191E5FF4290B2663001A3B7C /* libimobiledevice-glue */ = {
|
||||||
isa = PBXGroup;
|
isa = PBXGroup;
|
||||||
children = (
|
children = (
|
||||||
191E605E290B2D6B001A3B7C /* cbuf.c */,
|
B343F873295F7C5C002B1159 /* cbuf.c */,
|
||||||
191E6060290B2D6B001A3B7C /* collection.c */,
|
B343F874295F7C5D002B1159 /* collection.c */,
|
||||||
191E605D290B2D6B001A3B7C /* glue.c */,
|
B343F875295F7C5D002B1159 /* glue.c */,
|
||||||
191E6061290B2D6B001A3B7C /* opack.c */,
|
B343F872295F7C5C002B1159 /* opack.c */,
|
||||||
191E6064290B2D6B001A3B7C /* socket.c */,
|
B343F876295F7C5D002B1159 /* socket.c */,
|
||||||
191E6065290B2D6B001A3B7C /* termcolors.c */,
|
B343F877295F7C5D002B1159 /* termcolors.c */,
|
||||||
191E6063290B2D6B001A3B7C /* thread.c */,
|
B343F879295F7C5D002B1159 /* thread.c */,
|
||||||
191E6062290B2D6B001A3B7C /* tlv.c */,
|
B343F87B295F7C5D002B1159 /* tlv.c */,
|
||||||
191E605F290B2D6B001A3B7C /* utils.c */,
|
B343F87A295F7C5D002B1159 /* utils.c */,
|
||||||
);
|
);
|
||||||
name = "libimobiledevice-glue";
|
name = "libimobiledevice-glue";
|
||||||
|
path = "libimobiledevice-glue/src";
|
||||||
sourceTree = "<group>";
|
sourceTree = "<group>";
|
||||||
};
|
};
|
||||||
B3146EC7284F580500BBC3FD /* Products */ = {
|
B3146EC7284F580500BBC3FD /* Products */ = {
|
||||||
@@ -908,6 +978,41 @@
|
|||||||
name = Products;
|
name = Products;
|
||||||
sourceTree = "<group>";
|
sourceTree = "<group>";
|
||||||
};
|
};
|
||||||
|
B33FFB8F295F8CF2002259E6 /* Recovered References */ = {
|
||||||
|
isa = PBXGroup;
|
||||||
|
children = (
|
||||||
|
);
|
||||||
|
name = "Recovered References";
|
||||||
|
sourceTree = "<group>";
|
||||||
|
};
|
||||||
|
B343F848295F6321002B1159 /* Products */ = {
|
||||||
|
isa = PBXGroup;
|
||||||
|
children = (
|
||||||
|
B343F84C295F6321002B1159 /* libminimuxer_static.a */,
|
||||||
|
);
|
||||||
|
name = Products;
|
||||||
|
sourceTree = "<group>";
|
||||||
|
};
|
||||||
|
B343F84E295F6323002B1159 /* Products */ = {
|
||||||
|
isa = PBXGroup;
|
||||||
|
children = (
|
||||||
|
B343F853295F6323002B1159 /* libem_proxy_static.a */,
|
||||||
|
B343F855295F6323002B1159 /* run */,
|
||||||
|
);
|
||||||
|
name = Products;
|
||||||
|
sourceTree = "<group>";
|
||||||
|
};
|
||||||
|
B343F887295F7F9B002B1159 /* Products */ = {
|
||||||
|
isa = PBXGroup;
|
||||||
|
children = (
|
||||||
|
B343F88E295F7F9B002B1159 /* libfragmentzip */,
|
||||||
|
B343F890295F7F9B002B1159 /* libfragmentzip */,
|
||||||
|
B343F892295F7F9B002B1159 /* libfragmentzip.a */,
|
||||||
|
B343F894295F7F9B002B1159 /* libfragmentzip.a */,
|
||||||
|
);
|
||||||
|
name = Products;
|
||||||
|
sourceTree = "<group>";
|
||||||
|
};
|
||||||
B39F16112918D7B5002E9404 /* Consts */ = {
|
B39F16112918D7B5002E9404 /* Consts */ = {
|
||||||
isa = PBXGroup;
|
isa = PBXGroup;
|
||||||
children = (
|
children = (
|
||||||
@@ -991,78 +1096,75 @@
|
|||||||
BF4587972298D36400BD7491 /* libimobiledevice */,
|
BF4587972298D36400BD7491 /* libimobiledevice */,
|
||||||
BF45883D2298D3E800BD7491 /* libusbmuxd */,
|
BF45883D2298D3E800BD7491 /* libusbmuxd */,
|
||||||
);
|
);
|
||||||
path = libimobiledevice;
|
name = libimobiledevice;
|
||||||
|
path = Dependencies;
|
||||||
sourceTree = "<group>";
|
sourceTree = "<group>";
|
||||||
};
|
};
|
||||||
BF4587972298D36400BD7491 /* libimobiledevice */ = {
|
BF4587972298D36400BD7491 /* libimobiledevice */ = {
|
||||||
isa = PBXGroup;
|
isa = PBXGroup;
|
||||||
children = (
|
children = (
|
||||||
BF4588282298D3B400BD7491 /* common */,
|
|
||||||
BF4587D72298D3A800BD7491 /* afc.c */,
|
BF4587D72298D3A800BD7491 /* afc.c */,
|
||||||
BF4587EC2298D3AA00BD7491 /* afc.h */,
|
B33FFBAB295F8F98002259E6 /* companion_proxy.c */,
|
||||||
BF4587DF2298D3A900BD7491 /* debugserver.c */,
|
BF4587DF2298D3A900BD7491 /* debugserver.c */,
|
||||||
BF4587DE2298D3A900BD7491 /* debugserver.h */,
|
|
||||||
BF4587E42298D3A900BD7491 /* device_link_service.c */,
|
BF4587E42298D3A900BD7491 /* device_link_service.c */,
|
||||||
191E6073290B2E02001A3B7C /* companion_proxy.c */,
|
|
||||||
191E6074290B2E02001A3B7C /* preboard.c */,
|
|
||||||
BF4587EF2298D3AA00BD7491 /* device_link_service.h */,
|
|
||||||
BF4587C92298D3A800BD7491 /* diagnostics_relay.c */,
|
BF4587C92298D3A800BD7491 /* diagnostics_relay.c */,
|
||||||
BF4587CA2298D3A800BD7491 /* diagnostics_relay.h */,
|
|
||||||
BF4587D22298D3A800BD7491 /* file_relay.c */,
|
BF4587D22298D3A800BD7491 /* file_relay.c */,
|
||||||
BF4587ED2298D3AA00BD7491 /* file_relay.h */,
|
|
||||||
BF4587CF2298D3A800BD7491 /* heartbeat.c */,
|
BF4587CF2298D3A800BD7491 /* heartbeat.c */,
|
||||||
BF4587E02298D3A900BD7491 /* heartbeat.h */,
|
|
||||||
BF4587EB2298D3AA00BD7491 /* house_arrest.c */,
|
BF4587EB2298D3AA00BD7491 /* house_arrest.c */,
|
||||||
BF4587E22298D3A900BD7491 /* house_arrest.h */,
|
|
||||||
BF4587F12298D3AA00BD7491 /* idevice.c */,
|
BF4587F12298D3AA00BD7491 /* idevice.c */,
|
||||||
BF4587D52298D3A800BD7491 /* idevice.h */,
|
|
||||||
BF4587D92298D3A900BD7491 /* installation_proxy.c */,
|
BF4587D92298D3A900BD7491 /* installation_proxy.c */,
|
||||||
BF4587D12298D3A800BD7491 /* installation_proxy.h */,
|
|
||||||
BF4587F62298D3AB00BD7491 /* lockdown.c */,
|
BF4587F62298D3AB00BD7491 /* lockdown.c */,
|
||||||
BF4587D42298D3A800BD7491 /* lockdown.h */,
|
|
||||||
BF4587EE2298D3AA00BD7491 /* misagent.c */,
|
BF4587EE2298D3AA00BD7491 /* misagent.c */,
|
||||||
BF4587E12298D3A900BD7491 /* misagent.h */,
|
|
||||||
BF4587D82298D3A800BD7491 /* mobile_image_mounter.c */,
|
BF4587D82298D3A800BD7491 /* mobile_image_mounter.c */,
|
||||||
BF4587F02298D3AA00BD7491 /* mobile_image_mounter.h */,
|
|
||||||
BF4587F22298D3AA00BD7491 /* mobileactivation.c */,
|
BF4587F22298D3AA00BD7491 /* mobileactivation.c */,
|
||||||
BF4587EA2298D3AA00BD7491 /* mobileactivation.h */,
|
|
||||||
BF4587DD2298D3A900BD7491 /* mobilebackup.c */,
|
BF4587DD2298D3A900BD7491 /* mobilebackup.c */,
|
||||||
BF4587E52298D3A900BD7491 /* mobilebackup.h */,
|
|
||||||
BF4587DC2298D3A900BD7491 /* mobilebackup2.c */,
|
BF4587DC2298D3A900BD7491 /* mobilebackup2.c */,
|
||||||
BF4587CE2298D3A800BD7491 /* mobilebackup2.h */,
|
|
||||||
BF4587F32298D3AA00BD7491 /* mobilesync.c */,
|
BF4587F32298D3AA00BD7491 /* mobilesync.c */,
|
||||||
BF4587DB2298D3A900BD7491 /* mobilesync.h */,
|
|
||||||
BF4587CB2298D3A800BD7491 /* notification_proxy.c */,
|
BF4587CB2298D3A800BD7491 /* notification_proxy.c */,
|
||||||
BF4587E32298D3A900BD7491 /* notification_proxy.h */,
|
B33FFBA9295F8F78002259E6 /* preboard.c */,
|
||||||
BF4587F42298D3AA00BD7491 /* property_list_service.c */,
|
BF4587F42298D3AA00BD7491 /* property_list_service.c */,
|
||||||
BF4587F52298D3AA00BD7491 /* property_list_service.h */,
|
|
||||||
BF4587E62298D3A900BD7491 /* restore.c */,
|
BF4587E62298D3A900BD7491 /* restore.c */,
|
||||||
BF4587D02298D3A800BD7491 /* restore.h */,
|
|
||||||
BF4587CC2298D3A800BD7491 /* sbservices.c */,
|
BF4587CC2298D3A800BD7491 /* sbservices.c */,
|
||||||
BF4587CD2298D3A800BD7491 /* sbservices.h */,
|
|
||||||
BF4587E72298D3A900BD7491 /* screenshotr.c */,
|
BF4587E72298D3A900BD7491 /* screenshotr.c */,
|
||||||
BF4587DA2298D3A900BD7491 /* screenshotr.h */,
|
|
||||||
BF4587F72298D3AB00BD7491 /* service.c */,
|
BF4587F72298D3AB00BD7491 /* service.c */,
|
||||||
BF4587C82298D3A800BD7491 /* service.h */,
|
|
||||||
BF4587D32298D3A800BD7491 /* syslog_relay.c */,
|
BF4587D32298D3A800BD7491 /* syslog_relay.c */,
|
||||||
BF4587E82298D3A900BD7491 /* syslog_relay.h */,
|
|
||||||
BF4587D62298D3A800BD7491 /* webinspector.c */,
|
BF4587D62298D3A800BD7491 /* webinspector.c */,
|
||||||
|
BF4587EC2298D3AA00BD7491 /* afc.h */,
|
||||||
|
BF4587DE2298D3A900BD7491 /* debugserver.h */,
|
||||||
|
BF4587EF2298D3AA00BD7491 /* device_link_service.h */,
|
||||||
|
BF4587CA2298D3A800BD7491 /* diagnostics_relay.h */,
|
||||||
|
BF4587ED2298D3AA00BD7491 /* file_relay.h */,
|
||||||
|
BF4587E02298D3A900BD7491 /* heartbeat.h */,
|
||||||
|
BF4587E22298D3A900BD7491 /* house_arrest.h */,
|
||||||
|
BF4587D52298D3A800BD7491 /* idevice.h */,
|
||||||
|
BF4587D12298D3A800BD7491 /* installation_proxy.h */,
|
||||||
|
BF4587D42298D3A800BD7491 /* lockdown.h */,
|
||||||
|
BF4587E12298D3A900BD7491 /* misagent.h */,
|
||||||
|
BF4587F02298D3AA00BD7491 /* mobile_image_mounter.h */,
|
||||||
|
BF4587EA2298D3AA00BD7491 /* mobileactivation.h */,
|
||||||
|
BF4587E52298D3A900BD7491 /* mobilebackup.h */,
|
||||||
|
BF4587CE2298D3A800BD7491 /* mobilebackup2.h */,
|
||||||
|
BF4587DB2298D3A900BD7491 /* mobilesync.h */,
|
||||||
|
BF4587E32298D3A900BD7491 /* notification_proxy.h */,
|
||||||
|
BF4587F52298D3AA00BD7491 /* property_list_service.h */,
|
||||||
|
BF4587D02298D3A800BD7491 /* restore.h */,
|
||||||
|
BF4587CD2298D3A800BD7491 /* sbservices.h */,
|
||||||
|
BF4587DA2298D3A900BD7491 /* screenshotr.h */,
|
||||||
|
BF4587C82298D3A800BD7491 /* service.h */,
|
||||||
|
BF4587E82298D3A900BD7491 /* syslog_relay.h */,
|
||||||
BF4587E92298D3AA00BD7491 /* webinspector.h */,
|
BF4587E92298D3AA00BD7491 /* webinspector.h */,
|
||||||
|
BF4588282298D3B400BD7491 /* common */,
|
||||||
);
|
);
|
||||||
name = libimobiledevice;
|
path = libimobiledevice;
|
||||||
sourceTree = "<group>";
|
sourceTree = "<group>";
|
||||||
};
|
};
|
||||||
BF4588282298D3B400BD7491 /* common */ = {
|
BF4588282298D3B400BD7491 /* common */ = {
|
||||||
isa = PBXGroup;
|
isa = PBXGroup;
|
||||||
children = (
|
children = (
|
||||||
BF4588302298D3C000BD7491 /* debug.c */,
|
BF4588302298D3C000BD7491 /* debug.c */,
|
||||||
BF45882C2298D3C000BD7491 /* debug.h */,
|
|
||||||
BF45882F2298D3C000BD7491 /* socket.c */,
|
|
||||||
BF4588292298D3C000BD7491 /* socket.h */,
|
|
||||||
BF45882B2298D3C000BD7491 /* userpref.c */,
|
BF45882B2298D3C000BD7491 /* userpref.c */,
|
||||||
|
BF45882C2298D3C000BD7491 /* debug.h */,
|
||||||
BF45882A2298D3C000BD7491 /* userpref.h */,
|
BF45882A2298D3C000BD7491 /* userpref.h */,
|
||||||
BF45882D2298D3C000BD7491 /* utils.c */,
|
|
||||||
BF4588322298D3C100BD7491 /* utils.h */,
|
|
||||||
);
|
);
|
||||||
name = common;
|
name = common;
|
||||||
sourceTree = "<group>";
|
sourceTree = "<group>";
|
||||||
@@ -1071,51 +1173,47 @@
|
|||||||
isa = PBXGroup;
|
isa = PBXGroup;
|
||||||
children = (
|
children = (
|
||||||
BF4588422298D40000BD7491 /* libusbmuxd.c */,
|
BF4588422298D40000BD7491 /* libusbmuxd.c */,
|
||||||
BF45883F2298D3F800BD7491 /* collection.c */,
|
|
||||||
BF45883E2298D3F800BD7491 /* collection.h */,
|
|
||||||
BF4588482298D55000BD7491 /* thread.c */,
|
|
||||||
BF4588492298D55000BD7491 /* thread.h */,
|
|
||||||
);
|
);
|
||||||
name = libusbmuxd;
|
path = libusbmuxd;
|
||||||
sourceTree = "<group>";
|
sourceTree = "<group>";
|
||||||
};
|
};
|
||||||
BF4588562298DC6D00BD7491 /* libplist */ = {
|
BF4588562298DC6D00BD7491 /* libplist */ = {
|
||||||
isa = PBXGroup;
|
isa = PBXGroup;
|
||||||
children = (
|
children = (
|
||||||
BF4588892298DDEA00BD7491 /* libcnary */,
|
|
||||||
BFD52BF822A1A9CB000B7ED1 /* Array.cpp */,
|
|
||||||
BFD52BE622A1A9CA000B7ED1 /* base64.c */,
|
BFD52BE622A1A9CA000B7ED1 /* base64.c */,
|
||||||
BFD52BF622A1A9CA000B7ED1 /* base64.h */,
|
|
||||||
BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */,
|
|
||||||
191E5FD1290A651D001A3B7C /* jsmn.h */,
|
|
||||||
191E5FD0290A651D001A3B7C /* jsmn.c */,
|
|
||||||
191E5FCF290A651D001A3B7C /* jplist.c */,
|
|
||||||
BFD52BEA22A1A9CA000B7ED1 /* bplist.c */,
|
BFD52BEA22A1A9CA000B7ED1 /* bplist.c */,
|
||||||
BFD52BF522A1A9CA000B7ED1 /* bytearray.c */,
|
BFD52BF522A1A9CA000B7ED1 /* bytearray.c */,
|
||||||
BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */,
|
BFD52BE722A1A9CA000B7ED1 /* hashtable.c */,
|
||||||
|
191E5FCF290A651D001A3B7C /* jplist.c */,
|
||||||
|
191E5FD0290A651D001A3B7C /* jsmn.c */,
|
||||||
|
BFD52BEE22A1A9CA000B7ED1 /* plist.c */,
|
||||||
|
BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */,
|
||||||
|
BFD52BEC22A1A9CA000B7ED1 /* time64.c */,
|
||||||
|
BFD52C0022A1A9CB000B7ED1 /* xplist.c */,
|
||||||
|
BFD52BF822A1A9CB000B7ED1 /* Array.cpp */,
|
||||||
|
BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */,
|
||||||
BFD52BF722A1A9CA000B7ED1 /* Data.cpp */,
|
BFD52BF722A1A9CA000B7ED1 /* Data.cpp */,
|
||||||
BFD52BF022A1A9CA000B7ED1 /* Date.cpp */,
|
BFD52BF022A1A9CA000B7ED1 /* Date.cpp */,
|
||||||
BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */,
|
BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */,
|
||||||
BFD52BE722A1A9CA000B7ED1 /* hashtable.c */,
|
|
||||||
BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */,
|
|
||||||
BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */,
|
BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */,
|
||||||
BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */,
|
BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */,
|
||||||
BFD52BF922A1A9CB000B7ED1 /* Node.cpp */,
|
BFD52BF922A1A9CB000B7ED1 /* Node.cpp */,
|
||||||
BFD52BEE22A1A9CA000B7ED1 /* plist.c */,
|
|
||||||
BFD52BED22A1A9CA000B7ED1 /* plist.h */,
|
|
||||||
BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */,
|
|
||||||
BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */,
|
|
||||||
BFD52BF322A1A9CA000B7ED1 /* Real.cpp */,
|
BFD52BF322A1A9CA000B7ED1 /* Real.cpp */,
|
||||||
BFD52BF422A1A9CA000B7ED1 /* strbuf.h */,
|
|
||||||
BFD52BEB22A1A9CA000B7ED1 /* String.cpp */,
|
BFD52BEB22A1A9CA000B7ED1 /* String.cpp */,
|
||||||
BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */,
|
BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */,
|
||||||
BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */,
|
|
||||||
BFD52BEC22A1A9CA000B7ED1 /* time64.c */,
|
|
||||||
BFD52BFF22A1A9CB000B7ED1 /* time64.h */,
|
|
||||||
BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */,
|
BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */,
|
||||||
BFD52C0022A1A9CB000B7ED1 /* xplist.c */,
|
BFD52BF622A1A9CA000B7ED1 /* base64.h */,
|
||||||
|
BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */,
|
||||||
|
BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */,
|
||||||
|
191E5FD1290A651D001A3B7C /* jsmn.h */,
|
||||||
|
BFD52BED22A1A9CA000B7ED1 /* plist.h */,
|
||||||
|
BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */,
|
||||||
|
BFD52BF422A1A9CA000B7ED1 /* strbuf.h */,
|
||||||
|
BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */,
|
||||||
|
BFD52BFF22A1A9CB000B7ED1 /* time64.h */,
|
||||||
|
BF4588892298DDEA00BD7491 /* libcnary */,
|
||||||
);
|
);
|
||||||
name = libplist;
|
path = libplist;
|
||||||
sourceTree = "<group>";
|
sourceTree = "<group>";
|
||||||
};
|
};
|
||||||
BF4588892298DDEA00BD7491 /* libcnary */ = {
|
BF4588892298DDEA00BD7491 /* libcnary */ = {
|
||||||
@@ -1217,9 +1315,11 @@
|
|||||||
BF66EEC92501AECA007EE018 /* Account.swift */,
|
BF66EEC92501AECA007EE018 /* Account.swift */,
|
||||||
BF66EEC72501AECA007EE018 /* AppID.swift */,
|
BF66EEC72501AECA007EE018 /* AppID.swift */,
|
||||||
BF66EEC62501AECA007EE018 /* AppPermission.swift */,
|
BF66EEC62501AECA007EE018 /* AppPermission.swift */,
|
||||||
|
D52C08ED28AEC37A006C4AE5 /* AppVersion.swift */,
|
||||||
BF66EECA2501AECA007EE018 /* DatabaseManager.swift */,
|
BF66EECA2501AECA007EE018 /* DatabaseManager.swift */,
|
||||||
BF66EEC02501AECA007EE018 /* InstalledApp.swift */,
|
BF66EEC02501AECA007EE018 /* InstalledApp.swift */,
|
||||||
BF66EECB2501AECA007EE018 /* InstalledExtension.swift */,
|
BF66EECB2501AECA007EE018 /* InstalledExtension.swift */,
|
||||||
|
D58916FD28C7C55C00E39C8B /* LoggedError.swift */,
|
||||||
BF66EEC52501AECA007EE018 /* MergePolicy.swift */,
|
BF66EEC52501AECA007EE018 /* MergePolicy.swift */,
|
||||||
BF66EEBF2501AECA007EE018 /* NewsItem.swift */,
|
BF66EEBF2501AECA007EE018 /* NewsItem.swift */,
|
||||||
BF66EEC82501AECA007EE018 /* PatreonAccount.swift */,
|
BF66EEC82501AECA007EE018 /* PatreonAccount.swift */,
|
||||||
@@ -1247,6 +1347,7 @@
|
|||||||
isa = PBXGroup;
|
isa = PBXGroup;
|
||||||
children = (
|
children = (
|
||||||
BF66EEAE2501AECA007EE018 /* StoreAppPolicy.swift */,
|
BF66EEAE2501AECA007EE018 /* StoreAppPolicy.swift */,
|
||||||
|
D5F99A1928D12B1400476A16 /* StoreApp10ToStoreApp11Policy.swift */,
|
||||||
BF66EEAF2501AECA007EE018 /* InstalledAppPolicy.swift */,
|
BF66EEAF2501AECA007EE018 /* InstalledAppPolicy.swift */,
|
||||||
);
|
);
|
||||||
path = Policies;
|
path = Policies;
|
||||||
@@ -1263,6 +1364,7 @@
|
|||||||
BF66EEB62501AECA007EE018 /* AltStore5ToAltStore6.xcmappingmodel */,
|
BF66EEB62501AECA007EE018 /* AltStore5ToAltStore6.xcmappingmodel */,
|
||||||
BFBF331A2526762200B7B8C9 /* AltStore8ToAltStore9.xcmappingmodel */,
|
BFBF331A2526762200B7B8C9 /* AltStore8ToAltStore9.xcmappingmodel */,
|
||||||
D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */,
|
D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */,
|
||||||
|
D5F99A1728D11DB500476A16 /* AltStore10ToAltStore11.xcmappingmodel */,
|
||||||
);
|
);
|
||||||
path = "Mapping Models";
|
path = "Mapping Models";
|
||||||
sourceTree = "<group>";
|
sourceTree = "<group>";
|
||||||
@@ -1321,7 +1423,6 @@
|
|||||||
BF42345825101C1D006D1EB2 /* WidgetView.swift */,
|
BF42345825101C1D006D1EB2 /* WidgetView.swift */,
|
||||||
BF98917C250AAC4F002ACF50 /* Countdown.swift */,
|
BF98917C250AAC4F002ACF50 /* Countdown.swift */,
|
||||||
D55E163528776CB000A627A1 /* ComplicationView.swift */,
|
D55E163528776CB000A627A1 /* ComplicationView.swift */,
|
||||||
D504F42528AD72C50014BB5D /* ProgressRing.swift */,
|
|
||||||
BF989170250AABF4002ACF50 /* Assets.xcassets */,
|
BF989170250AABF4002ACF50 /* Assets.xcassets */,
|
||||||
BF989172250AABF4002ACF50 /* Info.plist */,
|
BF989172250AABF4002ACF50 /* Info.plist */,
|
||||||
);
|
);
|
||||||
@@ -1406,9 +1507,11 @@
|
|||||||
BF98916C250AABF3002ACF50 /* AltWidget */,
|
BF98916C250AABF3002ACF50 /* AltWidget */,
|
||||||
19104DB32909C06D00C49C7B /* EmotionalDamage */,
|
19104DB32909C06D00C49C7B /* EmotionalDamage */,
|
||||||
191E5FAC290A5D92001A3B7C /* minimuxer */,
|
191E5FAC290A5D92001A3B7C /* minimuxer */,
|
||||||
|
B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */,
|
||||||
BFD247852284BB3300981D42 /* Frameworks */,
|
BFD247852284BB3300981D42 /* Frameworks */,
|
||||||
B3146EC6284F580500BBC3FD /* Roxas.xcodeproj */,
|
B3146EC6284F580500BBC3FD /* Roxas.xcodeproj */,
|
||||||
BFD2476B2284B9A500981D42 /* Products */,
|
BFD2476B2284B9A500981D42 /* Products */,
|
||||||
|
B33FFB8F295F8CF2002259E6 /* Recovered References */,
|
||||||
);
|
);
|
||||||
sourceTree = "<group>";
|
sourceTree = "<group>";
|
||||||
};
|
};
|
||||||
@@ -1463,8 +1566,8 @@
|
|||||||
BFD247852284BB3300981D42 /* Frameworks */ = {
|
BFD247852284BB3300981D42 /* Frameworks */ = {
|
||||||
isa = PBXGroup;
|
isa = PBXGroup;
|
||||||
children = (
|
children = (
|
||||||
|
B343F86C295F759E002B1159 /* libresolv.tbd */,
|
||||||
191E5FB5290A5E1F001A3B7C /* libminimuxer.a */,
|
191E5FB5290A5E1F001A3B7C /* libminimuxer.a */,
|
||||||
19104DA32909BC1000C49C7B /* libem_proxy.a */,
|
|
||||||
B39575F4284F29E20080B4FF /* Roxas.framework */,
|
B39575F4284F29E20080B4FF /* Roxas.framework */,
|
||||||
D533E8B62727841800A9B5DD /* libAppleArchive.tbd */,
|
D533E8B62727841800A9B5DD /* libAppleArchive.tbd */,
|
||||||
BF580497246A3D19008AE704 /* UIKit.framework */,
|
BF580497246A3D19008AE704 /* UIKit.framework */,
|
||||||
@@ -1549,6 +1652,7 @@
|
|||||||
BFF0B68F23219C6D007A79E1 /* PatreonComponents.swift */,
|
BFF0B68F23219C6D007A79E1 /* PatreonComponents.swift */,
|
||||||
BFF0B6912321A305007A79E1 /* AboutPatreonHeaderView.xib */,
|
BFF0B6912321A305007A79E1 /* AboutPatreonHeaderView.xib */,
|
||||||
BFF0B695232242D3007A79E1 /* LicensesViewController.swift */,
|
BFF0B695232242D3007A79E1 /* LicensesViewController.swift */,
|
||||||
|
D589170128C7D93500E39C8B /* Error Log */,
|
||||||
B3EE16B52925E27D00B3B1F5 /* AnisetteManager.swift */,
|
B3EE16B52925E27D00B3B1F5 /* AnisetteManager.swift */,
|
||||||
);
|
);
|
||||||
path = Settings;
|
path = Settings;
|
||||||
@@ -1650,6 +1754,15 @@
|
|||||||
path = XPC;
|
path = XPC;
|
||||||
sourceTree = "<group>";
|
sourceTree = "<group>";
|
||||||
};
|
};
|
||||||
|
D589170128C7D93500E39C8B /* Error Log */ = {
|
||||||
|
isa = PBXGroup;
|
||||||
|
children = (
|
||||||
|
D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */,
|
||||||
|
D54DED1328CBC44B008B27A0 /* ErrorLogTableViewCell.swift */,
|
||||||
|
);
|
||||||
|
path = "Error Log";
|
||||||
|
sourceTree = "<group>";
|
||||||
|
};
|
||||||
/* End PBXGroup section */
|
/* End PBXGroup section */
|
||||||
|
|
||||||
/* Begin PBXHeadersBuildPhase section */
|
/* Begin PBXHeadersBuildPhase section */
|
||||||
@@ -1666,10 +1779,8 @@
|
|||||||
files = (
|
files = (
|
||||||
BF4588112298D3AB00BD7491 /* misagent.h in Headers */,
|
BF4588112298D3AB00BD7491 /* misagent.h in Headers */,
|
||||||
BF4588042298D3AB00BD7491 /* lockdown.h in Headers */,
|
BF4588042298D3AB00BD7491 /* lockdown.h in Headers */,
|
||||||
BF4588402298D3F800BD7491 /* collection.h in Headers */,
|
|
||||||
BF45880B2298D3AB00BD7491 /* mobilesync.h in Headers */,
|
BF45880B2298D3AB00BD7491 /* mobilesync.h in Headers */,
|
||||||
BF4588002298D3AB00BD7491 /* restore.h in Headers */,
|
BF4588002298D3AB00BD7491 /* restore.h in Headers */,
|
||||||
BF4588332298D3C100BD7491 /* socket.h in Headers */,
|
|
||||||
BF4588152298D3AB00BD7491 /* mobilebackup.h in Headers */,
|
BF4588152298D3AB00BD7491 /* mobilebackup.h in Headers */,
|
||||||
BF4588182298D3AB00BD7491 /* syslog_relay.h in Headers */,
|
BF4588182298D3AB00BD7491 /* syslog_relay.h in Headers */,
|
||||||
BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */,
|
BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */,
|
||||||
@@ -1689,7 +1800,6 @@
|
|||||||
BF4588192298D3AB00BD7491 /* webinspector.h in Headers */,
|
BF4588192298D3AB00BD7491 /* webinspector.h in Headers */,
|
||||||
BF4588342298D3C100BD7491 /* userpref.h in Headers */,
|
BF4588342298D3C100BD7491 /* userpref.h in Headers */,
|
||||||
BF45880A2298D3AB00BD7491 /* screenshotr.h in Headers */,
|
BF45880A2298D3AB00BD7491 /* screenshotr.h in Headers */,
|
||||||
BF45883C2298D3C100BD7491 /* utils.h in Headers */,
|
|
||||||
BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */,
|
BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */,
|
||||||
BF4587FE2298D3AB00BD7491 /* mobilebackup2.h in Headers */,
|
BF4587FE2298D3AB00BD7491 /* mobilebackup2.h in Headers */,
|
||||||
BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */,
|
BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */,
|
||||||
@@ -1732,6 +1842,7 @@
|
|||||||
buildRules = (
|
buildRules = (
|
||||||
);
|
);
|
||||||
dependencies = (
|
dependencies = (
|
||||||
|
B343F871295F7704002B1159 /* PBXTargetDependency */,
|
||||||
);
|
);
|
||||||
name = EmotionalDamage;
|
name = EmotionalDamage;
|
||||||
productName = EmotionalDamage;
|
productName = EmotionalDamage;
|
||||||
@@ -1749,6 +1860,7 @@
|
|||||||
buildRules = (
|
buildRules = (
|
||||||
);
|
);
|
||||||
dependencies = (
|
dependencies = (
|
||||||
|
B343F86F295F76FD002B1159 /* PBXTargetDependency */,
|
||||||
);
|
);
|
||||||
name = minimuxer;
|
name = minimuxer;
|
||||||
productName = minimuxer;
|
productName = minimuxer;
|
||||||
@@ -1823,11 +1935,13 @@
|
|||||||
buildRules = (
|
buildRules = (
|
||||||
);
|
);
|
||||||
dependencies = (
|
dependencies = (
|
||||||
|
99C4EF51297994E200CB538D /* PBXTargetDependency */,
|
||||||
);
|
);
|
||||||
name = AltStoreCore;
|
name = AltStoreCore;
|
||||||
packageProductDependencies = (
|
packageProductDependencies = (
|
||||||
B3C395F0284F2DE700DA9E2F /* KeychainAccess */,
|
B3C395F0284F2DE700DA9E2F /* KeychainAccess */,
|
||||||
4879A95E2861046500FC1BBD /* AltSign */,
|
4879A95E2861046500FC1BBD /* AltSign */,
|
||||||
|
99C4EF4C2979132100CB538D /* SemanticVersion */,
|
||||||
);
|
);
|
||||||
productName = AltStoreCore;
|
productName = AltStoreCore;
|
||||||
productReference = BF66EE7E2501AE50007EE018 /* AltStoreCore.framework */;
|
productReference = BF66EE7E2501AE50007EE018 /* AltStoreCore.framework */;
|
||||||
@@ -1946,10 +2060,23 @@
|
|||||||
B3C395FD284F3C0900DA9E2F /* XCRemoteSwiftPackageReference "STPrivilegedTask" */,
|
B3C395FD284F3C0900DA9E2F /* XCRemoteSwiftPackageReference "STPrivilegedTask" */,
|
||||||
4879A95D2861046500FC1BBD /* XCRemoteSwiftPackageReference "AltSign" */,
|
4879A95D2861046500FC1BBD /* XCRemoteSwiftPackageReference "AltSign" */,
|
||||||
4879A9602861049C00FC1BBD /* XCRemoteSwiftPackageReference "OpenSSL" */,
|
4879A9602861049C00FC1BBD /* XCRemoteSwiftPackageReference "OpenSSL" */,
|
||||||
|
99C4EF472978D52400CB538D /* XCRemoteSwiftPackageReference "SemanticVersion" */,
|
||||||
);
|
);
|
||||||
productRefGroup = BFD2476B2284B9A500981D42 /* Products */;
|
productRefGroup = BFD2476B2284B9A500981D42 /* Products */;
|
||||||
projectDirPath = "";
|
projectDirPath = "";
|
||||||
projectReferences = (
|
projectReferences = (
|
||||||
|
{
|
||||||
|
ProductGroup = B343F84E295F6323002B1159 /* Products */;
|
||||||
|
ProjectRef = B343F84D295F6323002B1159 /* em_proxy.xcodeproj */;
|
||||||
|
},
|
||||||
|
{
|
||||||
|
ProductGroup = B343F887295F7F9B002B1159 /* Products */;
|
||||||
|
ProjectRef = B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */;
|
||||||
|
},
|
||||||
|
{
|
||||||
|
ProductGroup = B343F848295F6321002B1159 /* Products */;
|
||||||
|
ProjectRef = B343F847295F6321002B1159 /* minimuxer.xcodeproj */;
|
||||||
|
},
|
||||||
{
|
{
|
||||||
ProductGroup = B3146EC7284F580500BBC3FD /* Products */;
|
ProductGroup = B3146EC7284F580500BBC3FD /* Products */;
|
||||||
ProjectRef = B3146EC6284F580500BBC3FD /* Roxas.xcodeproj */;
|
ProjectRef = B3146EC6284F580500BBC3FD /* Roxas.xcodeproj */;
|
||||||
@@ -1991,6 +2118,55 @@
|
|||||||
remoteRef = B3146ED0284F580500BBC3FD /* PBXContainerItemProxy */;
|
remoteRef = B3146ED0284F580500BBC3FD /* PBXContainerItemProxy */;
|
||||||
sourceTree = BUILT_PRODUCTS_DIR;
|
sourceTree = BUILT_PRODUCTS_DIR;
|
||||||
};
|
};
|
||||||
|
B343F84C295F6321002B1159 /* libminimuxer_static.a */ = {
|
||||||
|
isa = PBXReferenceProxy;
|
||||||
|
fileType = archive.ar;
|
||||||
|
path = libminimuxer_static.a;
|
||||||
|
remoteRef = B343F84B295F6321002B1159 /* PBXContainerItemProxy */;
|
||||||
|
sourceTree = BUILT_PRODUCTS_DIR;
|
||||||
|
};
|
||||||
|
B343F853295F6323002B1159 /* libem_proxy_static.a */ = {
|
||||||
|
isa = PBXReferenceProxy;
|
||||||
|
fileType = archive.ar;
|
||||||
|
path = libem_proxy_static.a;
|
||||||
|
remoteRef = B343F852295F6323002B1159 /* PBXContainerItemProxy */;
|
||||||
|
sourceTree = BUILT_PRODUCTS_DIR;
|
||||||
|
};
|
||||||
|
B343F855295F6323002B1159 /* run */ = {
|
||||||
|
isa = PBXReferenceProxy;
|
||||||
|
fileType = "compiled.mach-o.executable";
|
||||||
|
path = run;
|
||||||
|
remoteRef = B343F854295F6323002B1159 /* PBXContainerItemProxy */;
|
||||||
|
sourceTree = BUILT_PRODUCTS_DIR;
|
||||||
|
};
|
||||||
|
B343F88E295F7F9B002B1159 /* libfragmentzip */ = {
|
||||||
|
isa = PBXReferenceProxy;
|
||||||
|
fileType = "compiled.mach-o.executable";
|
||||||
|
path = libfragmentzip;
|
||||||
|
remoteRef = B343F88D295F7F9B002B1159 /* PBXContainerItemProxy */;
|
||||||
|
sourceTree = BUILT_PRODUCTS_DIR;
|
||||||
|
};
|
||||||
|
B343F890295F7F9B002B1159 /* libfragmentzip */ = {
|
||||||
|
isa = PBXReferenceProxy;
|
||||||
|
fileType = "compiled.mach-o.executable";
|
||||||
|
path = libfragmentzip;
|
||||||
|
remoteRef = B343F88F295F7F9B002B1159 /* PBXContainerItemProxy */;
|
||||||
|
sourceTree = BUILT_PRODUCTS_DIR;
|
||||||
|
};
|
||||||
|
B343F892295F7F9B002B1159 /* libfragmentzip.a */ = {
|
||||||
|
isa = PBXReferenceProxy;
|
||||||
|
fileType = archive.ar;
|
||||||
|
path = libfragmentzip.a;
|
||||||
|
remoteRef = B343F891295F7F9B002B1159 /* PBXContainerItemProxy */;
|
||||||
|
sourceTree = BUILT_PRODUCTS_DIR;
|
||||||
|
};
|
||||||
|
B343F894295F7F9B002B1159 /* libfragmentzip.a */ = {
|
||||||
|
isa = PBXReferenceProxy;
|
||||||
|
fileType = archive.ar;
|
||||||
|
path = libfragmentzip.a;
|
||||||
|
remoteRef = B343F893295F7F9B002B1159 /* PBXContainerItemProxy */;
|
||||||
|
sourceTree = BUILT_PRODUCTS_DIR;
|
||||||
|
};
|
||||||
/* End PBXReferenceProxy section */
|
/* End PBXReferenceProxy section */
|
||||||
|
|
||||||
/* Begin PBXResourcesBuildPhase section */
|
/* Begin PBXResourcesBuildPhase section */
|
||||||
@@ -2093,22 +2269,11 @@
|
|||||||
BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */,
|
BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */,
|
||||||
BF4588232298D3AB00BD7491 /* mobilesync.c in Sources */,
|
BF4588232298D3AB00BD7491 /* mobilesync.c in Sources */,
|
||||||
BF4588072298D3AB00BD7491 /* afc.c in Sources */,
|
BF4588072298D3AB00BD7491 /* afc.c in Sources */,
|
||||||
191E6066290B2DB1001A3B7C /* cbuf.c in Sources */,
|
|
||||||
191E607D290B2EA5001A3B7C /* jsmn.c in Sources */,
|
191E607D290B2EA5001A3B7C /* jsmn.c in Sources */,
|
||||||
191E6067290B2DB3001A3B7C /* collection.c in Sources */,
|
|
||||||
191E6075290B2E46001A3B7C /* companion_proxy.c in Sources */,
|
|
||||||
191E607E290B2EA7001A3B7C /* jplist.c in Sources */,
|
191E607E290B2EA7001A3B7C /* jplist.c in Sources */,
|
||||||
191E6076290B2E48001A3B7C /* preboard.c in Sources */,
|
|
||||||
BF4588082298D3AB00BD7491 /* mobile_image_mounter.c in Sources */,
|
BF4588082298D3AB00BD7491 /* mobile_image_mounter.c in Sources */,
|
||||||
191E6068290B2DB5001A3B7C /* glue.c in Sources */,
|
|
||||||
BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */,
|
BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */,
|
||||||
BF4588022298D3AB00BD7491 /* file_relay.c in Sources */,
|
BF4588022298D3AB00BD7491 /* file_relay.c in Sources */,
|
||||||
191E6069290B2DB7001A3B7C /* opack.c in Sources */,
|
|
||||||
191E606A290B2DC4001A3B7C /* socket.c in Sources */,
|
|
||||||
191E606E290B2DCB001A3B7C /* utils.c in Sources */,
|
|
||||||
191E606B290B2DC6001A3B7C /* termcolors.c in Sources */,
|
|
||||||
191E606C290B2DC8001A3B7C /* thread.c in Sources */,
|
|
||||||
191E606D290B2DCA001A3B7C /* tlv.c in Sources */,
|
|
||||||
BF45880F2298D3AB00BD7491 /* debugserver.c in Sources */,
|
BF45880F2298D3AB00BD7491 /* debugserver.c in Sources */,
|
||||||
BF4588162298D3AB00BD7491 /* restore.c in Sources */,
|
BF4588162298D3AB00BD7491 /* restore.c in Sources */,
|
||||||
BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */,
|
BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */,
|
||||||
@@ -2119,25 +2284,36 @@
|
|||||||
BF4588222298D3AB00BD7491 /* mobileactivation.c in Sources */,
|
BF4588222298D3AB00BD7491 /* mobileactivation.c in Sources */,
|
||||||
BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */,
|
BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */,
|
||||||
BF4588212298D3AB00BD7491 /* idevice.c in Sources */,
|
BF4588212298D3AB00BD7491 /* idevice.c in Sources */,
|
||||||
|
B343F885295F7C5D002B1159 /* tlv.c in Sources */,
|
||||||
BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */,
|
BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */,
|
||||||
BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */,
|
BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */,
|
||||||
|
B343F87D295F7C5D002B1159 /* cbuf.c in Sources */,
|
||||||
BF4588062298D3AB00BD7491 /* webinspector.c in Sources */,
|
BF4588062298D3AB00BD7491 /* webinspector.c in Sources */,
|
||||||
BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */,
|
BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */,
|
||||||
|
B343F883295F7C5D002B1159 /* thread.c in Sources */,
|
||||||
BF45880D2298D3AB00BD7491 /* mobilebackup.c in Sources */,
|
BF45880D2298D3AB00BD7491 /* mobilebackup.c in Sources */,
|
||||||
BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */,
|
BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */,
|
||||||
BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */,
|
BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */,
|
||||||
BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */,
|
BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */,
|
||||||
BF45883A2298D3C100BD7491 /* debug.c in Sources */,
|
BF45883A2298D3C100BD7491 /* debug.c in Sources */,
|
||||||
|
B343F881295F7C5D002B1159 /* termcolors.c in Sources */,
|
||||||
|
B343F87E295F7C5D002B1159 /* collection.c in Sources */,
|
||||||
BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */,
|
BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */,
|
||||||
|
B33FFBAA295F8F78002259E6 /* preboard.c in Sources */,
|
||||||
|
B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */,
|
||||||
BF4587FB2298D3AB00BD7491 /* notification_proxy.c in Sources */,
|
BF4587FB2298D3AB00BD7491 /* notification_proxy.c in Sources */,
|
||||||
BF4588352298D3C100BD7491 /* userpref.c in Sources */,
|
BF4588352298D3C100BD7491 /* userpref.c in Sources */,
|
||||||
BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */,
|
BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */,
|
||||||
|
B343F87C295F7C5D002B1159 /* opack.c in Sources */,
|
||||||
BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */,
|
BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */,
|
||||||
BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */,
|
BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */,
|
||||||
|
B343F884295F7C5D002B1159 /* utils.c in Sources */,
|
||||||
BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */,
|
BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */,
|
||||||
|
B343F87F295F7C5D002B1159 /* glue.c in Sources */,
|
||||||
BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */,
|
BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */,
|
||||||
BF4588242298D3AB00BD7491 /* property_list_service.c in Sources */,
|
BF4588242298D3AB00BD7491 /* property_list_service.c in Sources */,
|
||||||
BF45881E2298D3AB00BD7491 /* misagent.c in Sources */,
|
BF45881E2298D3AB00BD7491 /* misagent.c in Sources */,
|
||||||
|
B343F880295F7C5D002B1159 /* socket.c in Sources */,
|
||||||
BF4587FC2298D3AB00BD7491 /* sbservices.c in Sources */,
|
BF4587FC2298D3AB00BD7491 /* sbservices.c in Sources */,
|
||||||
BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */,
|
BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */,
|
||||||
BF4588142298D3AB00BD7491 /* device_link_service.c in Sources */,
|
BF4588142298D3AB00BD7491 /* device_link_service.c in Sources */,
|
||||||
@@ -2162,6 +2338,7 @@
|
|||||||
BF580496246A3CB5008AE704 /* UIColor+AltBackup.swift in Sources */,
|
BF580496246A3CB5008AE704 /* UIColor+AltBackup.swift in Sources */,
|
||||||
BF580482246A28F7008AE704 /* ViewController.swift in Sources */,
|
BF580482246A28F7008AE704 /* ViewController.swift in Sources */,
|
||||||
BF44EEF0246B08BA002A52F2 /* BackupController.swift in Sources */,
|
BF44EEF0246B08BA002A52F2 /* BackupController.swift in Sources */,
|
||||||
|
03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */,
|
||||||
BF58049B246A432D008AE704 /* NSError+AltStore.swift in Sources */,
|
BF58049B246A432D008AE704 /* NSError+AltStore.swift in Sources */,
|
||||||
BF58047E246A28F7008AE704 /* AppDelegate.swift in Sources */,
|
BF58047E246A28F7008AE704 /* AppDelegate.swift in Sources */,
|
||||||
);
|
);
|
||||||
@@ -2197,11 +2374,13 @@
|
|||||||
BF66EECF2501AECA007EE018 /* AltStoreToAltStore2.xcmappingmodel in Sources */,
|
BF66EECF2501AECA007EE018 /* AltStoreToAltStore2.xcmappingmodel in Sources */,
|
||||||
BF66EEA82501AEC5007EE018 /* Patron.swift in Sources */,
|
BF66EEA82501AEC5007EE018 /* Patron.swift in Sources */,
|
||||||
BF66EEDD2501AECA007EE018 /* AppPermission.swift in Sources */,
|
BF66EEDD2501AECA007EE018 /* AppPermission.swift in Sources */,
|
||||||
|
D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */,
|
||||||
BFBF331B2526762200B7B8C9 /* AltStore8ToAltStore9.xcmappingmodel in Sources */,
|
BFBF331B2526762200B7B8C9 /* AltStore8ToAltStore9.xcmappingmodel in Sources */,
|
||||||
D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */,
|
D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */,
|
||||||
BF989184250AACFC002ACF50 /* Date+RelativeDate.swift in Sources */,
|
BF989184250AACFC002ACF50 /* Date+RelativeDate.swift in Sources */,
|
||||||
BF66EE962501AEBC007EE018 /* ALTPatreonBenefitType.m in Sources */,
|
BF66EE962501AEBC007EE018 /* ALTPatreonBenefitType.m in Sources */,
|
||||||
BFAECC5A2501B0A400528F27 /* NetworkConnection.swift in Sources */,
|
BFAECC5A2501B0A400528F27 /* NetworkConnection.swift in Sources */,
|
||||||
|
D5F99A1828D11DB500476A16 /* AltStore10ToAltStore11.xcmappingmodel in Sources */,
|
||||||
BF66EEE92501AED0007EE018 /* JSONDecoder+Properties.swift in Sources */,
|
BF66EEE92501AED0007EE018 /* JSONDecoder+Properties.swift in Sources */,
|
||||||
BF66EEEB2501AED0007EE018 /* UIApplication+AppExtension.swift in Sources */,
|
BF66EEEB2501AED0007EE018 /* UIApplication+AppExtension.swift in Sources */,
|
||||||
BF66EED92501AECA007EE018 /* Team.swift in Sources */,
|
BF66EED92501AECA007EE018 /* Team.swift in Sources */,
|
||||||
@@ -2212,10 +2391,12 @@
|
|||||||
BF66EEE02501AECA007EE018 /* Account.swift in Sources */,
|
BF66EEE02501AECA007EE018 /* Account.swift in Sources */,
|
||||||
BF66EED52501AECA007EE018 /* AltStore.xcdatamodeld in Sources */,
|
BF66EED52501AECA007EE018 /* AltStore.xcdatamodeld in Sources */,
|
||||||
BFAECC582501B0A400528F27 /* ALTConstants.m in Sources */,
|
BFAECC582501B0A400528F27 /* ALTConstants.m in Sources */,
|
||||||
|
D5F99A1A28D12B1400476A16 /* StoreApp10ToStoreApp11Policy.swift in Sources */,
|
||||||
BFAECC562501B0A400528F27 /* ALTServerError+Conveniences.swift in Sources */,
|
BFAECC562501B0A400528F27 /* ALTServerError+Conveniences.swift in Sources */,
|
||||||
BFAECC592501B0A400528F27 /* Result+Conveniences.swift in Sources */,
|
BFAECC592501B0A400528F27 /* Result+Conveniences.swift in Sources */,
|
||||||
BFAECC542501B0A400528F27 /* NSError+ALTServerError.m in Sources */,
|
BFAECC542501B0A400528F27 /* NSError+ALTServerError.m in Sources */,
|
||||||
BF66EEE12501AECA007EE018 /* DatabaseManager.swift in Sources */,
|
BF66EEE12501AECA007EE018 /* DatabaseManager.swift in Sources */,
|
||||||
|
D52C08EE28AEC37A006C4AE5 /* AppVersion.swift in Sources */,
|
||||||
BF66EEEA2501AED0007EE018 /* UIColor+Hex.swift in Sources */,
|
BF66EEEA2501AED0007EE018 /* UIColor+Hex.swift in Sources */,
|
||||||
BF66EECC2501AECA007EE018 /* Source.swift in Sources */,
|
BF66EECC2501AECA007EE018 /* Source.swift in Sources */,
|
||||||
BF66EED72501AECA007EE018 /* InstalledApp.swift in Sources */,
|
BF66EED72501AECA007EE018 /* InstalledApp.swift in Sources */,
|
||||||
@@ -2240,7 +2421,6 @@
|
|||||||
BF42345A25101C35006D1EB2 /* WidgetView.swift in Sources */,
|
BF42345A25101C35006D1EB2 /* WidgetView.swift in Sources */,
|
||||||
D55E163728776CB700A627A1 /* ComplicationView.swift in Sources */,
|
D55E163728776CB700A627A1 /* ComplicationView.swift in Sources */,
|
||||||
BF98917F250AAC4F002ACF50 /* AltWidget.swift in Sources */,
|
BF98917F250AAC4F002ACF50 /* AltWidget.swift in Sources */,
|
||||||
B3919A52292DBE5400519575 /* ProgressRing.swift in Sources */,
|
|
||||||
);
|
);
|
||||||
runOnlyForDeploymentPostprocessing = 0;
|
runOnlyForDeploymentPostprocessing = 0;
|
||||||
};
|
};
|
||||||
@@ -2261,6 +2441,7 @@
|
|||||||
BF8CAE4E248AEABA004D6CCE /* UIDevice+Jailbreak.swift in Sources */,
|
BF8CAE4E248AEABA004D6CCE /* UIDevice+Jailbreak.swift in Sources */,
|
||||||
D5E1E7C128077DE90016FC96 /* FetchTrustedSourcesOperation.swift in Sources */,
|
D5E1E7C128077DE90016FC96 /* FetchTrustedSourcesOperation.swift in Sources */,
|
||||||
BFE338DF22F0EADB002E24B9 /* FetchSourceOperation.swift in Sources */,
|
BFE338DF22F0EADB002E24B9 /* FetchSourceOperation.swift in Sources */,
|
||||||
|
D54DED1428CBC44B008B27A0 /* ErrorLogTableViewCell.swift in Sources */,
|
||||||
BFB6B21E231870160022A802 /* NewsViewController.swift in Sources */,
|
BFB6B21E231870160022A802 /* NewsViewController.swift in Sources */,
|
||||||
BFC57A652416C72400EB891E /* DeactivateAppOperation.swift in Sources */,
|
BFC57A652416C72400EB891E /* DeactivateAppOperation.swift in Sources */,
|
||||||
BF3BEFC124086A1E00DE7D55 /* RefreshAppOperation.swift in Sources */,
|
BF3BEFC124086A1E00DE7D55 /* RefreshAppOperation.swift in Sources */,
|
||||||
@@ -2310,6 +2491,7 @@
|
|||||||
BF08858322DE795100DE9F1E /* MyAppsViewController.swift in Sources */,
|
BF08858322DE795100DE9F1E /* MyAppsViewController.swift in Sources */,
|
||||||
BFC84A4D2421A19100853474 /* SourcesViewController.swift in Sources */,
|
BFC84A4D2421A19100853474 /* SourcesViewController.swift in Sources */,
|
||||||
BFF0B696232242D3007A79E1 /* LicensesViewController.swift in Sources */,
|
BFF0B696232242D3007A79E1 /* LicensesViewController.swift in Sources */,
|
||||||
|
D57FE84428C7DB7100216002 /* ErrorLogViewController.swift in Sources */,
|
||||||
BFBE0007250AD0E70080826E /* ViewAppIntentHandler.swift in Sources */,
|
BFBE0007250AD0E70080826E /* ViewAppIntentHandler.swift in Sources */,
|
||||||
BFDB6A0822AAED73007EA6D6 /* ResignAppOperation.swift in Sources */,
|
BFDB6A0822AAED73007EA6D6 /* ResignAppOperation.swift in Sources */,
|
||||||
D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */,
|
D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */,
|
||||||
@@ -2362,6 +2544,20 @@
|
|||||||
isa = PBXTargetDependency;
|
isa = PBXTargetDependency;
|
||||||
productRef = 191E5FD9290AFA49001A3B7C /* OpenSSL */;
|
productRef = 191E5FD9290AFA49001A3B7C /* OpenSSL */;
|
||||||
};
|
};
|
||||||
|
99C4EF51297994E200CB538D /* PBXTargetDependency */ = {
|
||||||
|
isa = PBXTargetDependency;
|
||||||
|
productRef = 99C4EF50297994E200CB538D /* SemanticVersion */;
|
||||||
|
};
|
||||||
|
B343F86F295F76FD002B1159 /* PBXTargetDependency */ = {
|
||||||
|
isa = PBXTargetDependency;
|
||||||
|
name = "minimuxer-staticlib";
|
||||||
|
targetProxy = B343F86E295F76FD002B1159 /* PBXContainerItemProxy */;
|
||||||
|
};
|
||||||
|
B343F871295F7704002B1159 /* PBXTargetDependency */ = {
|
||||||
|
isa = PBXTargetDependency;
|
||||||
|
name = "em_proxy-staticlib";
|
||||||
|
targetProxy = B343F870295F7704002B1159 /* PBXContainerItemProxy */;
|
||||||
|
};
|
||||||
BF66EE842501AE50007EE018 /* PBXTargetDependency */ = {
|
BF66EE842501AE50007EE018 /* PBXTargetDependency */ = {
|
||||||
isa = PBXTargetDependency;
|
isa = PBXTargetDependency;
|
||||||
target = BF66EE7D2501AE50007EE018 /* AltStoreCore */;
|
target = BF66EE7D2501AE50007EE018 /* AltStoreCore */;
|
||||||
@@ -2419,8 +2615,7 @@
|
|||||||
IPHONEOS_DEPLOYMENT_TARGET = 14.0;
|
IPHONEOS_DEPLOYMENT_TARGET = 14.0;
|
||||||
LIBRARY_SEARCH_PATHS = (
|
LIBRARY_SEARCH_PATHS = (
|
||||||
"$(inherited)",
|
"$(inherited)",
|
||||||
"$(PROJECT_DIR)/Dependencies/em_proxy/target/aarch64-apple-ios/release",
|
"$(PROJECT_DIR)/Dependencies/em_proxy",
|
||||||
"$(PROJECT_DIR)/Dependencies/em_proxy/target/aarch64-apple-ios/debug",
|
|
||||||
);
|
);
|
||||||
MACOSX_DEPLOYMENT_TARGET = "$(RECOMMENDED_MACOSX_DEPLOYMENT_TARGET)";
|
MACOSX_DEPLOYMENT_TARGET = "$(RECOMMENDED_MACOSX_DEPLOYMENT_TARGET)";
|
||||||
OTHER_LDFLAGS = "-ObjC";
|
OTHER_LDFLAGS = "-ObjC";
|
||||||
@@ -2446,8 +2641,7 @@
|
|||||||
IPHONEOS_DEPLOYMENT_TARGET = 14.0;
|
IPHONEOS_DEPLOYMENT_TARGET = 14.0;
|
||||||
LIBRARY_SEARCH_PATHS = (
|
LIBRARY_SEARCH_PATHS = (
|
||||||
"$(inherited)",
|
"$(inherited)",
|
||||||
"$(PROJECT_DIR)/Dependencies/em_proxy/target/aarch64-apple-ios/release",
|
"$(PROJECT_DIR)/Dependencies/em_proxy",
|
||||||
"$(PROJECT_DIR)/Dependencies/em_proxy/target/aarch64-apple-ios/debug",
|
|
||||||
);
|
);
|
||||||
MACOSX_DEPLOYMENT_TARGET = "$(RECOMMENDED_MACOSX_DEPLOYMENT_TARGET)";
|
MACOSX_DEPLOYMENT_TARGET = "$(RECOMMENDED_MACOSX_DEPLOYMENT_TARGET)";
|
||||||
OTHER_LDFLAGS = "-ObjC";
|
OTHER_LDFLAGS = "-ObjC";
|
||||||
@@ -2473,8 +2667,7 @@
|
|||||||
IPHONEOS_DEPLOYMENT_TARGET = 14.0;
|
IPHONEOS_DEPLOYMENT_TARGET = 14.0;
|
||||||
LIBRARY_SEARCH_PATHS = (
|
LIBRARY_SEARCH_PATHS = (
|
||||||
"$(inherited)",
|
"$(inherited)",
|
||||||
"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/release",
|
"$(PROJECT_DIR)/Dependencies/minimuxer",
|
||||||
"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/debug",
|
|
||||||
);
|
);
|
||||||
OTHER_LDFLAGS = "-ObjC";
|
OTHER_LDFLAGS = "-ObjC";
|
||||||
PRODUCT_NAME = "$(TARGET_NAME)";
|
PRODUCT_NAME = "$(TARGET_NAME)";
|
||||||
@@ -2497,8 +2690,7 @@
|
|||||||
IPHONEOS_DEPLOYMENT_TARGET = 14.0;
|
IPHONEOS_DEPLOYMENT_TARGET = 14.0;
|
||||||
LIBRARY_SEARCH_PATHS = (
|
LIBRARY_SEARCH_PATHS = (
|
||||||
"$(inherited)",
|
"$(inherited)",
|
||||||
"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/release",
|
"$(PROJECT_DIR)/Dependencies/minimuxer",
|
||||||
"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/debug",
|
|
||||||
);
|
);
|
||||||
OTHER_LDFLAGS = "-ObjC";
|
OTHER_LDFLAGS = "-ObjC";
|
||||||
PRODUCT_NAME = "$(TARGET_NAME)";
|
PRODUCT_NAME = "$(TARGET_NAME)";
|
||||||
@@ -2735,7 +2927,7 @@
|
|||||||
DYLIB_INSTALL_NAME_BASE = "@rpath";
|
DYLIB_INSTALL_NAME_BASE = "@rpath";
|
||||||
INFOPLIST_FILE = AltStoreCore/Info.plist;
|
INFOPLIST_FILE = AltStoreCore/Info.plist;
|
||||||
INSTALL_PATH = "$(LOCAL_LIBRARY_DIR)/Frameworks";
|
INSTALL_PATH = "$(LOCAL_LIBRARY_DIR)/Frameworks";
|
||||||
IPHONEOS_DEPLOYMENT_TARGET = 12.2;
|
IPHONEOS_DEPLOYMENT_TARGET = 14.0;
|
||||||
LD_RUNPATH_SEARCH_PATHS = (
|
LD_RUNPATH_SEARCH_PATHS = (
|
||||||
"$(inherited)",
|
"$(inherited)",
|
||||||
"@executable_path/Frameworks",
|
"@executable_path/Frameworks",
|
||||||
@@ -2771,7 +2963,7 @@
|
|||||||
DYLIB_INSTALL_NAME_BASE = "@rpath";
|
DYLIB_INSTALL_NAME_BASE = "@rpath";
|
||||||
INFOPLIST_FILE = AltStoreCore/Info.plist;
|
INFOPLIST_FILE = AltStoreCore/Info.plist;
|
||||||
INSTALL_PATH = "$(LOCAL_LIBRARY_DIR)/Frameworks";
|
INSTALL_PATH = "$(LOCAL_LIBRARY_DIR)/Frameworks";
|
||||||
IPHONEOS_DEPLOYMENT_TARGET = 12.2;
|
IPHONEOS_DEPLOYMENT_TARGET = 14.0;
|
||||||
LD_RUNPATH_SEARCH_PATHS = (
|
LD_RUNPATH_SEARCH_PATHS = (
|
||||||
"$(inherited)",
|
"$(inherited)",
|
||||||
"@executable_path/Frameworks",
|
"@executable_path/Frameworks",
|
||||||
@@ -3003,8 +3195,6 @@
|
|||||||
"$(inherited)",
|
"$(inherited)",
|
||||||
"$(PROJECT_DIR)/Dependencies/fragmentzip",
|
"$(PROJECT_DIR)/Dependencies/fragmentzip",
|
||||||
"$(PROJECT_DIR)/Dependencies/libcurl",
|
"$(PROJECT_DIR)/Dependencies/libcurl",
|
||||||
"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/debug",
|
|
||||||
"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/release",
|
|
||||||
);
|
);
|
||||||
PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
|
PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
|
||||||
PRODUCT_NAME = "$(TARGET_NAME)";
|
PRODUCT_NAME = "$(TARGET_NAME)";
|
||||||
@@ -3039,8 +3229,6 @@
|
|||||||
"$(inherited)",
|
"$(inherited)",
|
||||||
"$(PROJECT_DIR)/Dependencies/fragmentzip",
|
"$(PROJECT_DIR)/Dependencies/fragmentzip",
|
||||||
"$(PROJECT_DIR)/Dependencies/libcurl",
|
"$(PROJECT_DIR)/Dependencies/libcurl",
|
||||||
"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/debug",
|
|
||||||
"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/release",
|
|
||||||
);
|
);
|
||||||
PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
|
PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
|
||||||
PRODUCT_NAME = "$(TARGET_NAME)";
|
PRODUCT_NAME = "$(TARGET_NAME)";
|
||||||
@@ -3155,6 +3343,14 @@
|
|||||||
minimumVersion = 1.1.180;
|
minimumVersion = 1.1.180;
|
||||||
};
|
};
|
||||||
};
|
};
|
||||||
|
99C4EF472978D52400CB538D /* XCRemoteSwiftPackageReference "SemanticVersion" */ = {
|
||||||
|
isa = XCRemoteSwiftPackageReference;
|
||||||
|
repositoryURL = "https://github.com/SwiftPackageIndex/SemanticVersion.git";
|
||||||
|
requirement = {
|
||||||
|
kind = upToNextMajorVersion;
|
||||||
|
minimumVersion = 0.3.5;
|
||||||
|
};
|
||||||
|
};
|
||||||
B3C395EF284F2DE700DA9E2F /* XCRemoteSwiftPackageReference "KeychainAccess" */ = {
|
B3C395EF284F2DE700DA9E2F /* XCRemoteSwiftPackageReference "KeychainAccess" */ = {
|
||||||
isa = XCRemoteSwiftPackageReference;
|
isa = XCRemoteSwiftPackageReference;
|
||||||
repositoryURL = "https://github.com/kishikawakatsumi/KeychainAccess.git";
|
repositoryURL = "https://github.com/kishikawakatsumi/KeychainAccess.git";
|
||||||
@@ -3226,6 +3422,16 @@
|
|||||||
package = 4879A9602861049C00FC1BBD /* XCRemoteSwiftPackageReference "OpenSSL" */;
|
package = 4879A9602861049C00FC1BBD /* XCRemoteSwiftPackageReference "OpenSSL" */;
|
||||||
productName = OpenSSL;
|
productName = OpenSSL;
|
||||||
};
|
};
|
||||||
|
99C4EF4C2979132100CB538D /* SemanticVersion */ = {
|
||||||
|
isa = XCSwiftPackageProductDependency;
|
||||||
|
package = 99C4EF472978D52400CB538D /* XCRemoteSwiftPackageReference "SemanticVersion" */;
|
||||||
|
productName = SemanticVersion;
|
||||||
|
};
|
||||||
|
99C4EF50297994E200CB538D /* SemanticVersion */ = {
|
||||||
|
isa = XCSwiftPackageProductDependency;
|
||||||
|
package = 99C4EF472978D52400CB538D /* XCRemoteSwiftPackageReference "SemanticVersion" */;
|
||||||
|
productName = SemanticVersion;
|
||||||
|
};
|
||||||
B3C395F0284F2DE700DA9E2F /* KeychainAccess */ = {
|
B3C395F0284F2DE700DA9E2F /* KeychainAccess */ = {
|
||||||
isa = XCSwiftPackageProductDependency;
|
isa = XCSwiftPackageProductDependency;
|
||||||
package = B3C395EF284F2DE700DA9E2F /* XCRemoteSwiftPackageReference "KeychainAccess" */;
|
package = B3C395EF284F2DE700DA9E2F /* XCRemoteSwiftPackageReference "KeychainAccess" */;
|
||||||
@@ -3252,6 +3458,7 @@
|
|||||||
BF66EEB72501AECA007EE018 /* AltStore.xcdatamodeld */ = {
|
BF66EEB72501AECA007EE018 /* AltStore.xcdatamodeld */ = {
|
||||||
isa = XCVersionGroup;
|
isa = XCVersionGroup;
|
||||||
children = (
|
children = (
|
||||||
|
D52E988928D002D30032BE6B /* AltStore 11.xcdatamodel */,
|
||||||
D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */,
|
D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */,
|
||||||
BFBF33142526754700B7B8C9 /* AltStore 9.xcdatamodel */,
|
BFBF33142526754700B7B8C9 /* AltStore 9.xcdatamodel */,
|
||||||
BFF7EC4C25081E9300BDE521 /* AltStore 8.xcdatamodel */,
|
BFF7EC4C25081E9300BDE521 /* AltStore 8.xcdatamodel */,
|
||||||
@@ -3263,7 +3470,7 @@
|
|||||||
BF66EEBD2501AECA007EE018 /* AltStore 2.xcdatamodel */,
|
BF66EEBD2501AECA007EE018 /* AltStore 2.xcdatamodel */,
|
||||||
BF66EEBE2501AECA007EE018 /* AltStore 4.xcdatamodel */,
|
BF66EEBE2501AECA007EE018 /* AltStore 4.xcdatamodel */,
|
||||||
);
|
);
|
||||||
currentVersion = D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */;
|
currentVersion = D52E988928D002D30032BE6B /* AltStore 11.xcdatamodel */;
|
||||||
path = AltStore.xcdatamodeld;
|
path = AltStore.xcdatamodeld;
|
||||||
sourceTree = "<group>";
|
sourceTree = "<group>";
|
||||||
versionGroupType = wrapper.xcdatamodel;
|
versionGroupType = wrapper.xcdatamodel;
|
||||||
|
|||||||
@@ -63,6 +63,15 @@
|
|||||||
"version" : "1.10.1"
|
"version" : "1.10.1"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
{
|
||||||
|
"identity" : "semanticversion",
|
||||||
|
"kind" : "remoteSourceControl",
|
||||||
|
"location" : "https://github.com/SwiftPackageIndex/SemanticVersion.git",
|
||||||
|
"state" : {
|
||||||
|
"revision" : "fc670910dc0903cc269b3d0b776cda5703979c4e",
|
||||||
|
"version" : "0.3.5"
|
||||||
|
}
|
||||||
|
},
|
||||||
{
|
{
|
||||||
"identity" : "sparkle",
|
"identity" : "sparkle",
|
||||||
"kind" : "remoteSourceControl",
|
"kind" : "remoteSourceControl",
|
||||||
|
|||||||
@@ -0,0 +1,84 @@
|
|||||||
|
<?xml version="1.0" encoding="UTF-8"?>
|
||||||
|
<Scheme
|
||||||
|
LastUpgradeVersion = "1020"
|
||||||
|
version = "1.3">
|
||||||
|
<BuildAction
|
||||||
|
parallelizeBuildables = "YES"
|
||||||
|
buildImplicitDependencies = "YES">
|
||||||
|
<BuildActionEntries>
|
||||||
|
<BuildActionEntry
|
||||||
|
buildForTesting = "YES"
|
||||||
|
buildForRunning = "YES"
|
||||||
|
buildForProfiling = "YES"
|
||||||
|
buildForArchiving = "YES"
|
||||||
|
buildForAnalyzing = "YES">
|
||||||
|
<BuildableReference
|
||||||
|
BuildableIdentifier = "primary"
|
||||||
|
BlueprintIdentifier = "BFD247692284B9A500981D42"
|
||||||
|
BuildableName = "SideStore.app"
|
||||||
|
BlueprintName = "SideStore"
|
||||||
|
ReferencedContainer = "container:AltStore.xcodeproj">
|
||||||
|
</BuildableReference>
|
||||||
|
</BuildActionEntry>
|
||||||
|
</BuildActionEntries>
|
||||||
|
</BuildAction>
|
||||||
|
<TestAction
|
||||||
|
buildConfiguration = "Release"
|
||||||
|
selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
|
||||||
|
selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
|
||||||
|
shouldUseLaunchSchemeArgsEnv = "YES">
|
||||||
|
<Testables>
|
||||||
|
</Testables>
|
||||||
|
</TestAction>
|
||||||
|
<LaunchAction
|
||||||
|
buildConfiguration = "Release"
|
||||||
|
selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
|
||||||
|
selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
|
||||||
|
launchStyle = "0"
|
||||||
|
useCustomWorkingDirectory = "NO"
|
||||||
|
ignoresPersistentStateOnLaunch = "NO"
|
||||||
|
debugDocumentVersioning = "YES"
|
||||||
|
debugServiceExtension = "internal"
|
||||||
|
allowLocationSimulation = "YES">
|
||||||
|
<BuildableProductRunnable
|
||||||
|
runnableDebuggingMode = "0">
|
||||||
|
<BuildableReference
|
||||||
|
BuildableIdentifier = "primary"
|
||||||
|
BlueprintIdentifier = "BFD247692284B9A500981D42"
|
||||||
|
BuildableName = "SideStore.app"
|
||||||
|
BlueprintName = "SideStore"
|
||||||
|
ReferencedContainer = "container:AltStore.xcodeproj">
|
||||||
|
</BuildableReference>
|
||||||
|
</BuildableProductRunnable>
|
||||||
|
<CommandLineArguments>
|
||||||
|
<CommandLineArgument
|
||||||
|
argument = "-com.apple.CoreData.ConcurrencyDebug 1"
|
||||||
|
isEnabled = "YES">
|
||||||
|
</CommandLineArgument>
|
||||||
|
</CommandLineArguments>
|
||||||
|
</LaunchAction>
|
||||||
|
<ProfileAction
|
||||||
|
buildConfiguration = "Release"
|
||||||
|
shouldUseLaunchSchemeArgsEnv = "YES"
|
||||||
|
savedToolIdentifier = ""
|
||||||
|
useCustomWorkingDirectory = "NO"
|
||||||
|
debugDocumentVersioning = "YES">
|
||||||
|
<BuildableProductRunnable
|
||||||
|
runnableDebuggingMode = "0">
|
||||||
|
<BuildableReference
|
||||||
|
BuildableIdentifier = "primary"
|
||||||
|
BlueprintIdentifier = "BFD247692284B9A500981D42"
|
||||||
|
BuildableName = "SideStore.app"
|
||||||
|
BlueprintName = "SideStore"
|
||||||
|
ReferencedContainer = "container:AltStore.xcodeproj">
|
||||||
|
</BuildableReference>
|
||||||
|
</BuildableProductRunnable>
|
||||||
|
</ProfileAction>
|
||||||
|
<AnalyzeAction
|
||||||
|
buildConfiguration = "Release">
|
||||||
|
</AnalyzeAction>
|
||||||
|
<ArchiveAction
|
||||||
|
buildConfiguration = "Release"
|
||||||
|
revealArchiveInOrganizer = "YES">
|
||||||
|
</ArchiveAction>
|
||||||
|
</Scheme>
|
||||||
@@ -14,13 +14,7 @@ import AppCenter
|
|||||||
import AppCenterAnalytics
|
import AppCenterAnalytics
|
||||||
import AppCenterCrashes
|
import AppCenterCrashes
|
||||||
|
|
||||||
#if DEBUG
|
private let appCenterAppSecret = "73532d3e-e573-4693-99a4-9f85840bbb44"
|
||||||
private let appCenterAppSecret = "bb08e9bb-c126-408d-bf3f-324c8473fd40"
|
|
||||||
#elseif RELEASE
|
|
||||||
private let appCenterAppSecret = "b6718932-294a-432b-81f2-be1e17ff85c5"
|
|
||||||
#else
|
|
||||||
private let appCenterAppSecret = "e873f6ca-75eb-4685-818f-801e0e375d60"
|
|
||||||
#endif
|
|
||||||
|
|
||||||
extension AnalyticsManager
|
extension AnalyticsManager
|
||||||
{
|
{
|
||||||
@@ -77,7 +71,7 @@ extension AnalyticsManager
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
class AnalyticsManager
|
final class AnalyticsManager
|
||||||
{
|
{
|
||||||
static let shared = AnalyticsManager()
|
static let shared = AnalyticsManager()
|
||||||
|
|
||||||
|
|||||||
@@ -25,7 +25,7 @@ extension AppContentViewController
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
class AppContentViewController: UITableViewController
|
final class AppContentViewController: UITableViewController
|
||||||
{
|
{
|
||||||
var app: StoreApp!
|
var app: StoreApp!
|
||||||
|
|
||||||
@@ -80,10 +80,21 @@ class AppContentViewController: UITableViewController
|
|||||||
|
|
||||||
self.subtitleLabel.text = self.app.subtitle
|
self.subtitleLabel.text = self.app.subtitle
|
||||||
self.descriptionTextView.text = self.app.localizedDescription
|
self.descriptionTextView.text = self.app.localizedDescription
|
||||||
self.versionDescriptionTextView.text = self.app.versionDescription
|
|
||||||
self.versionLabel.text = String(format: NSLocalizedString("Version %@", comment: ""), self.app.version)
|
if let version = self.app.latestVersion
|
||||||
self.versionDateLabel.text = Date().relativeDateString(since: self.app.versionDate, dateFormatter: self.dateFormatter)
|
{
|
||||||
self.sizeLabel.text = self.byteCountFormatter.string(fromByteCount: Int64(self.app.size))
|
self.versionDescriptionTextView.text = version.localizedDescription
|
||||||
|
self.versionLabel.text = String(format: NSLocalizedString("Version %@", comment: ""), version.version)
|
||||||
|
self.versionDateLabel.text = Date().relativeDateString(since: version.date, dateFormatter: self.dateFormatter)
|
||||||
|
self.sizeLabel.text = self.byteCountFormatter.string(fromByteCount: version.size)
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
self.versionDescriptionTextView.text = nil
|
||||||
|
self.versionLabel.text = nil
|
||||||
|
self.versionDateLabel.text = nil
|
||||||
|
self.sizeLabel.text = self.byteCountFormatter.string(fromByteCount: 0)
|
||||||
|
}
|
||||||
|
|
||||||
self.descriptionTextView.maximumNumberOfLines = 5
|
self.descriptionTextView.maximumNumberOfLines = 5
|
||||||
self.descriptionTextView.moreButton.addTarget(self, action: #selector(AppContentViewController.toggleCollapsingSection(_:)), for: .primaryActionTriggered)
|
self.descriptionTextView.moreButton.addTarget(self, action: #selector(AppContentViewController.toggleCollapsingSection(_:)), for: .primaryActionTriggered)
|
||||||
@@ -173,7 +184,8 @@ private extension AppContentViewController
|
|||||||
dataSource.cellConfigurationHandler = { (cell, permission, indexPath) in
|
dataSource.cellConfigurationHandler = { (cell, permission, indexPath) in
|
||||||
let cell = cell as! PermissionCollectionViewCell
|
let cell = cell as! PermissionCollectionViewCell
|
||||||
cell.button.setImage(permission.type.icon, for: .normal)
|
cell.button.setImage(permission.type.icon, for: .normal)
|
||||||
cell.textLabel.text = permission.type.localizedShortName
|
cell.button.tintColor = .label
|
||||||
|
cell.textLabel.text = permission.type.localizedShortName ?? permission.type.localizedName
|
||||||
}
|
}
|
||||||
|
|
||||||
return dataSource
|
return dataSource
|
||||||
|
|||||||
@@ -8,7 +8,7 @@
|
|||||||
|
|
||||||
import UIKit
|
import UIKit
|
||||||
|
|
||||||
class PermissionCollectionViewCell: UICollectionViewCell
|
final class PermissionCollectionViewCell: UICollectionViewCell
|
||||||
{
|
{
|
||||||
@IBOutlet var button: UIButton!
|
@IBOutlet var button: UIButton!
|
||||||
@IBOutlet var textLabel: UILabel!
|
@IBOutlet var textLabel: UILabel!
|
||||||
@@ -29,7 +29,7 @@ class PermissionCollectionViewCell: UICollectionViewCell
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
class AppContentTableViewCell: UITableViewCell
|
final class AppContentTableViewCell: UITableViewCell
|
||||||
{
|
{
|
||||||
override func systemLayoutSizeFitting(_ targetSize: CGSize, withHorizontalFittingPriority horizontalFittingPriority: UILayoutPriority, verticalFittingPriority: UILayoutPriority) -> CGSize
|
override func systemLayoutSizeFitting(_ targetSize: CGSize, withHorizontalFittingPriority horizontalFittingPriority: UILayoutPriority, verticalFittingPriority: UILayoutPriority) -> CGSize
|
||||||
{
|
{
|
||||||
|
|||||||
@@ -13,7 +13,7 @@ import Roxas
|
|||||||
|
|
||||||
import Nuke
|
import Nuke
|
||||||
|
|
||||||
class AppViewController: UIViewController
|
final class AppViewController: UIViewController
|
||||||
{
|
{
|
||||||
var app: StoreApp!
|
var app: StoreApp!
|
||||||
|
|
||||||
@@ -352,7 +352,7 @@ class AppViewController: UIViewController
|
|||||||
|
|
||||||
extension AppViewController
|
extension AppViewController
|
||||||
{
|
{
|
||||||
class func makeAppViewController(app: StoreApp) -> AppViewController
|
final class func makeAppViewController(app: StoreApp) -> AppViewController
|
||||||
{
|
{
|
||||||
let storyboard = UIStoryboard(name: "Main", bundle: nil)
|
let storyboard = UIStoryboard(name: "Main", bundle: nil)
|
||||||
|
|
||||||
@@ -384,10 +384,10 @@ private extension AppViewController
|
|||||||
button.progress = progress
|
button.progress = progress
|
||||||
}
|
}
|
||||||
|
|
||||||
if Date() < self.app.versionDate
|
if let versionDate = self.app.latestVersion?.date, versionDate > Date()
|
||||||
{
|
{
|
||||||
self.bannerView.button.countdownDate = self.app.versionDate
|
self.bannerView.button.countdownDate = versionDate
|
||||||
self.navigationBarDownloadButton.countdownDate = self.app.versionDate
|
self.navigationBarDownloadButton.countdownDate = versionDate
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
|||||||
@@ -10,7 +10,7 @@ import UIKit
|
|||||||
|
|
||||||
import AltStoreCore
|
import AltStoreCore
|
||||||
|
|
||||||
class PermissionPopoverViewController: UIViewController
|
final class PermissionPopoverViewController: UIViewController
|
||||||
{
|
{
|
||||||
var permission: AppPermission!
|
var permission: AppPermission!
|
||||||
|
|
||||||
|
|||||||
@@ -11,7 +11,7 @@ import UIKit
|
|||||||
import AltStoreCore
|
import AltStoreCore
|
||||||
import Roxas
|
import Roxas
|
||||||
|
|
||||||
class AppIDsViewController: UICollectionViewController
|
final class AppIDsViewController: UICollectionViewController
|
||||||
{
|
{
|
||||||
private lazy var dataSource = self.makeDataSource()
|
private lazy var dataSource = self.makeDataSource()
|
||||||
|
|
||||||
|
|||||||
@@ -18,11 +18,11 @@ import EmotionalDamage
|
|||||||
|
|
||||||
extension AppDelegate
|
extension AppDelegate
|
||||||
{
|
{
|
||||||
static let openPatreonSettingsDeepLinkNotification = Notification.Name("com.rileytestut.AltStore.OpenPatreonSettingsDeepLinkNotification")
|
static let openPatreonSettingsDeepLinkNotification = Notification.Name(Bundle.Info.appbundleIdentifier + ".OpenPatreonSettingsDeepLinkNotification")
|
||||||
static let importAppDeepLinkNotification = Notification.Name("com.rileytestut.AltStore.ImportAppDeepLinkNotification")
|
static let importAppDeepLinkNotification = Notification.Name(Bundle.Info.appbundleIdentifier + ".ImportAppDeepLinkNotification")
|
||||||
static let addSourceDeepLinkNotification = Notification.Name("com.rileytestut.AltStore.AddSourceDeepLinkNotification")
|
static let addSourceDeepLinkNotification = Notification.Name(Bundle.Info.appbundleIdentifier + ".AddSourceDeepLinkNotification")
|
||||||
|
|
||||||
static let appBackupDidFinish = Notification.Name("com.rileytestut.AltStore.AppBackupDidFinish")
|
static let appBackupDidFinish = Notification.Name(Bundle.Info.appbundleIdentifier + ".AppBackupDidFinish")
|
||||||
|
|
||||||
static let importAppDeepLinkURLKey = "fileURL"
|
static let importAppDeepLinkURLKey = "fileURL"
|
||||||
static let appBackupResultKey = "result"
|
static let appBackupResultKey = "result"
|
||||||
@@ -30,7 +30,7 @@ extension AppDelegate
|
|||||||
}
|
}
|
||||||
|
|
||||||
@UIApplicationMain
|
@UIApplicationMain
|
||||||
class AppDelegate: UIResponder, UIApplicationDelegate {
|
final class AppDelegate: UIResponder, UIApplicationDelegate {
|
||||||
|
|
||||||
var window: UIWindow?
|
var window: UIWindow?
|
||||||
|
|
||||||
@@ -96,9 +96,21 @@ class AppDelegate: UIResponder, UIApplicationDelegate {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func applicationDidEnterBackground(_ application: UIApplication)
|
func applicationDidEnterBackground(_ application: UIApplication)
|
||||||
{
|
{
|
||||||
|
// Make sure to update SceneDelegate.sceneDidEnterBackground() as well.
|
||||||
|
|
||||||
}
|
guard let oneMonthAgo = Calendar.current.date(byAdding: .month, value: -1, to: Date()) else { return }
|
||||||
|
|
||||||
|
let midnightOneMonthAgo = Calendar.current.startOfDay(for: oneMonthAgo)
|
||||||
|
DatabaseManager.shared.purgeLoggedErrors(before: midnightOneMonthAgo) { result in
|
||||||
|
switch result
|
||||||
|
{
|
||||||
|
case .success: break
|
||||||
|
case .failure(let error): print("[ALTLog] Failed to purge logged errors before \(midnightOneMonthAgo).", error)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
func applicationWillEnterForeground(_ application: UIApplication)
|
func applicationWillEnterForeground(_ application: UIApplication)
|
||||||
{
|
{
|
||||||
@@ -368,11 +380,11 @@ private extension AppDelegate
|
|||||||
for update in updates
|
for update in updates
|
||||||
{
|
{
|
||||||
guard !previousUpdates.contains(where: { $0[#keyPath(InstalledApp.bundleIdentifier)] == update.bundleIdentifier }) else { continue }
|
guard !previousUpdates.contains(where: { $0[#keyPath(InstalledApp.bundleIdentifier)] == update.bundleIdentifier }) else { continue }
|
||||||
guard let storeApp = update.storeApp else { continue }
|
guard let storeApp = update.storeApp, let version = storeApp.version else { continue }
|
||||||
|
|
||||||
let content = UNMutableNotificationContent()
|
let content = UNMutableNotificationContent()
|
||||||
content.title = NSLocalizedString("New Update Available", comment: "")
|
content.title = NSLocalizedString("New Update Available", comment: "")
|
||||||
content.body = String(format: NSLocalizedString("%@ %@ is now available for download.", comment: ""), update.name, storeApp.version)
|
content.body = String(format: NSLocalizedString("%@ %@ is now available for download.", comment: ""), update.name, version)
|
||||||
content.sound = .default
|
content.sound = .default
|
||||||
|
|
||||||
let request = UNNotificationRequest(identifier: UUID().uuidString, content: content, trigger: nil)
|
let request = UNNotificationRequest(identifier: UUID().uuidString, content: content, trigger: nil)
|
||||||
|
|||||||
@@ -10,7 +10,7 @@ import UIKit
|
|||||||
|
|
||||||
import AltSign
|
import AltSign
|
||||||
|
|
||||||
class AuthenticationViewController: UIViewController
|
final class AuthenticationViewController: UIViewController
|
||||||
{
|
{
|
||||||
var authenticationHandler: ((String, String, @escaping (Result<(ALTAccount, ALTAppleAPISession), Error>) -> Void) -> Void)?
|
var authenticationHandler: ((String, String, @escaping (Result<(ALTAccount, ALTAppleAPISession), Error>) -> Void) -> Void)?
|
||||||
var completionHandler: (((ALTAccount, ALTAppleAPISession, String)?) -> Void)?
|
var completionHandler: (((ALTAccount, ALTAppleAPISession, String)?) -> Void)?
|
||||||
@@ -31,7 +31,7 @@ class AuthenticationViewController: UIViewController
|
|||||||
{
|
{
|
||||||
super.viewDidLoad()
|
super.viewDidLoad()
|
||||||
|
|
||||||
self.signInButton.activityIndicatorView.style = .white
|
self.signInButton.activityIndicatorView.style = .medium
|
||||||
|
|
||||||
for view in [self.appleIDBackgroundView!, self.passwordBackgroundView!, self.signInButton!]
|
for view in [self.appleIDBackgroundView!, self.passwordBackgroundView!, self.signInButton!]
|
||||||
{
|
{
|
||||||
|
|||||||
@@ -8,7 +8,7 @@
|
|||||||
|
|
||||||
import UIKit
|
import UIKit
|
||||||
|
|
||||||
class InstructionsViewController: UIViewController
|
final class InstructionsViewController: UIViewController
|
||||||
{
|
{
|
||||||
var completionHandler: (() -> Void)?
|
var completionHandler: (() -> Void)?
|
||||||
|
|
||||||
|
|||||||
@@ -12,7 +12,7 @@ import AltStoreCore
|
|||||||
import AltSign
|
import AltSign
|
||||||
import Roxas
|
import Roxas
|
||||||
|
|
||||||
class RefreshAltStoreViewController: UIViewController
|
final class RefreshAltStoreViewController: UIViewController
|
||||||
{
|
{
|
||||||
var context: AuthenticatedOperationContext!
|
var context: AuthenticatedOperationContext!
|
||||||
|
|
||||||
|
|||||||
@@ -14,7 +14,7 @@ import IntentsUI
|
|||||||
|
|
||||||
import AltSign
|
import AltSign
|
||||||
|
|
||||||
class SelectTeamViewController: UITableViewController
|
final class SelectTeamViewController: UITableViewController
|
||||||
{
|
{
|
||||||
public var teams: [ALTTeam]?
|
public var teams: [ALTTeam]?
|
||||||
public var completionHandler: ((Result<ALTTeam, Swift.Error>) -> Void)?
|
public var completionHandler: ((Result<ALTTeam, Swift.Error>) -> Void)?
|
||||||
|
|||||||
@@ -1095,13 +1095,13 @@ World</string>
|
|||||||
<image name="News" width="19" height="20"/>
|
<image name="News" width="19" height="20"/>
|
||||||
<image name="Settings" width="20" height="20"/>
|
<image name="Settings" width="20" height="20"/>
|
||||||
<namedColor name="Background">
|
<namedColor name="Background">
|
||||||
<color red="1" green="1" blue="1" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
|
<color red="0.6431" green="0.0196" blue="0.9804" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
|
||||||
</namedColor>
|
</namedColor>
|
||||||
<namedColor name="BlurTint">
|
<namedColor name="BlurTint">
|
||||||
<color red="1" green="1" blue="1" alpha="0.30000001192092896" colorSpace="custom" customColorSpace="sRGB"/>
|
<color red="1" green="1" blue="1" alpha="0.3" colorSpace="custom" customColorSpace="sRGB"/>
|
||||||
</namedColor>
|
</namedColor>
|
||||||
<namedColor name="Primary">
|
<namedColor name="Primary">
|
||||||
<color red="0.50196078431372548" green="0.2627450980392157" blue="1" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
|
<color red="0.6431" green="0.0196" blue="0.9804" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
|
||||||
</namedColor>
|
</namedColor>
|
||||||
<systemColor name="systemBackgroundColor">
|
<systemColor name="systemBackgroundColor">
|
||||||
<color white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
<color white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
|
||||||
|
|||||||
@@ -12,7 +12,7 @@ import Roxas
|
|||||||
|
|
||||||
import Nuke
|
import Nuke
|
||||||
|
|
||||||
@objc class BrowseCollectionViewCell: UICollectionViewCell
|
@objc final class BrowseCollectionViewCell: UICollectionViewCell
|
||||||
{
|
{
|
||||||
var imageURLs: [URL] = [] {
|
var imageURLs: [URL] = [] {
|
||||||
didSet {
|
didSet {
|
||||||
|
|||||||
@@ -94,7 +94,7 @@ private extension BrowseViewController
|
|||||||
cell.bannerView.iconImageView.isIndicatingActivity = true
|
cell.bannerView.iconImageView.isIndicatingActivity = true
|
||||||
|
|
||||||
cell.bannerView.button.addTarget(self, action: #selector(BrowseViewController.performAppAction(_:)), for: .primaryActionTriggered)
|
cell.bannerView.button.addTarget(self, action: #selector(BrowseViewController.performAppAction(_:)), for: .primaryActionTriggered)
|
||||||
cell.bannerView.button.activityIndicatorView.style = .white
|
cell.bannerView.button.activityIndicatorView.style = .medium
|
||||||
|
|
||||||
// Explicitly set to false to ensure we're starting from a non-activity indicating state.
|
// Explicitly set to false to ensure we're starting from a non-activity indicating state.
|
||||||
// Otherwise, cell reuse can mess up some cached values.
|
// Otherwise, cell reuse can mess up some cached values.
|
||||||
@@ -113,7 +113,7 @@ private extension BrowseViewController
|
|||||||
let progress = AppManager.shared.installationProgress(for: app)
|
let progress = AppManager.shared.installationProgress(for: app)
|
||||||
cell.bannerView.button.progress = progress
|
cell.bannerView.button.progress = progress
|
||||||
|
|
||||||
if Date() < app.versionDate
|
if let versionDate = app.latestVersion?.date, versionDate > Date()
|
||||||
{
|
{
|
||||||
cell.bannerView.button.countdownDate = app.versionDate
|
cell.bannerView.button.countdownDate = app.versionDate
|
||||||
}
|
}
|
||||||
@@ -167,14 +167,7 @@ private extension BrowseViewController
|
|||||||
|
|
||||||
func updateDataSource()
|
func updateDataSource()
|
||||||
{
|
{
|
||||||
if let patreonAccount = DatabaseManager.shared.patreonAccount(), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
|
|
||||||
{
|
|
||||||
self.dataSource.predicate = nil
|
self.dataSource.predicate = nil
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
self.dataSource.predicate = NSPredicate(format: "%K == NO", #keyPath(StoreApp.isBeta))
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
func fetchSource()
|
func fetchSource()
|
||||||
|
|||||||
@@ -8,7 +8,7 @@
|
|||||||
|
|
||||||
import UIKit
|
import UIKit
|
||||||
|
|
||||||
class AppIconImageView: UIImageView
|
final class AppIconImageView: UIImageView
|
||||||
{
|
{
|
||||||
override func awakeFromNib()
|
override func awakeFromNib()
|
||||||
{
|
{
|
||||||
|
|||||||
@@ -8,7 +8,7 @@
|
|||||||
|
|
||||||
import AVFoundation
|
import AVFoundation
|
||||||
|
|
||||||
class BackgroundTaskManager
|
final class BackgroundTaskManager
|
||||||
{
|
{
|
||||||
static let shared = BackgroundTaskManager()
|
static let shared = BackgroundTaskManager()
|
||||||
|
|
||||||
|
|||||||
@@ -8,7 +8,7 @@
|
|||||||
|
|
||||||
import UIKit
|
import UIKit
|
||||||
|
|
||||||
class BannerCollectionViewCell: UICollectionViewCell
|
final class BannerCollectionViewCell: UICollectionViewCell
|
||||||
{
|
{
|
||||||
private(set) var errorBadge: UIView?
|
private(set) var errorBadge: UIView?
|
||||||
@IBOutlet private(set) var bannerView: AppBannerView!
|
@IBOutlet private(set) var bannerView: AppBannerView!
|
||||||
|
|||||||
@@ -8,7 +8,7 @@
|
|||||||
|
|
||||||
import UIKit
|
import UIKit
|
||||||
|
|
||||||
class Button: UIButton
|
final class Button: UIButton
|
||||||
{
|
{
|
||||||
override var intrinsicContentSize: CGSize {
|
override var intrinsicContentSize: CGSize {
|
||||||
var size = super.intrinsicContentSize
|
var size = super.intrinsicContentSize
|
||||||
|
|||||||
@@ -8,7 +8,7 @@
|
|||||||
|
|
||||||
import UIKit
|
import UIKit
|
||||||
|
|
||||||
class CollapsingTextView: UITextView
|
final class CollapsingTextView: UITextView
|
||||||
{
|
{
|
||||||
var isCollapsed = true {
|
var isCollapsed = true {
|
||||||
didSet {
|
didSet {
|
||||||
@@ -71,8 +71,10 @@ class CollapsingTextView: UITextView
|
|||||||
{
|
{
|
||||||
self.textContainer.maximumNumberOfLines = self.maximumNumberOfLines
|
self.textContainer.maximumNumberOfLines = self.maximumNumberOfLines
|
||||||
|
|
||||||
let maximumCollapsedHeight = font.lineHeight * CGFloat(self.maximumNumberOfLines)
|
let boundingSize = self.attributedText.boundingRect(with: CGSize(width: self.textContainer.size.width, height: .infinity), options: [.usesLineFragmentOrigin, .usesFontLeading], context: nil)
|
||||||
if self.intrinsicContentSize.height > maximumCollapsedHeight
|
let maximumCollapsedHeight = font.lineHeight * Double(self.maximumNumberOfLines)
|
||||||
|
|
||||||
|
if boundingSize.height.rounded() > maximumCollapsedHeight.rounded()
|
||||||
{
|
{
|
||||||
var exclusionFrame = moreButtonFrame
|
var exclusionFrame = moreButtonFrame
|
||||||
exclusionFrame.origin.y += self.moreButton.bounds.midY
|
exclusionFrame.origin.y += self.moreButton.bounds.midY
|
||||||
|
|||||||
@@ -8,7 +8,7 @@
|
|||||||
|
|
||||||
import UIKit
|
import UIKit
|
||||||
|
|
||||||
class ForwardingNavigationController: UINavigationController
|
final class ForwardingNavigationController: UINavigationController
|
||||||
{
|
{
|
||||||
override var childForStatusBarStyle: UIViewController? {
|
override var childForStatusBarStyle: UIViewController? {
|
||||||
return self.topViewController
|
return self.topViewController
|
||||||
|
|||||||
@@ -10,7 +10,7 @@ import UIKit
|
|||||||
|
|
||||||
import Roxas
|
import Roxas
|
||||||
|
|
||||||
class NavigationBar: UINavigationBar
|
final class NavigationBar: UINavigationBar
|
||||||
{
|
{
|
||||||
@IBInspectable var automaticallyAdjustsItemPositions: Bool = true
|
@IBInspectable var automaticallyAdjustsItemPositions: Bool = true
|
||||||
|
|
||||||
|
|||||||
@@ -8,7 +8,7 @@
|
|||||||
|
|
||||||
import UIKit
|
import UIKit
|
||||||
|
|
||||||
class PillButton: UIButton
|
final class PillButton: UIButton
|
||||||
{
|
{
|
||||||
override var accessibilityValue: String? {
|
override var accessibilityValue: String? {
|
||||||
get {
|
get {
|
||||||
@@ -88,7 +88,7 @@ class PillButton: UIButton
|
|||||||
self.layer.masksToBounds = true
|
self.layer.masksToBounds = true
|
||||||
self.accessibilityTraits.formUnion([.updatesFrequently, .button])
|
self.accessibilityTraits.formUnion([.updatesFrequently, .button])
|
||||||
|
|
||||||
self.activityIndicatorView.style = .white
|
self.activityIndicatorView.style = .medium
|
||||||
self.activityIndicatorView.isUserInteractionEnabled = false
|
self.activityIndicatorView.isUserInteractionEnabled = false
|
||||||
|
|
||||||
self.progressView.progress = 0
|
self.progressView.progress = 0
|
||||||
|
|||||||
@@ -16,7 +16,7 @@ extension TimeInterval
|
|||||||
static let longToastViewDuration = 8.0
|
static let longToastViewDuration = 8.0
|
||||||
}
|
}
|
||||||
|
|
||||||
class ToastView: RSTToastView
|
final class ToastView: RSTToastView
|
||||||
{
|
{
|
||||||
var preferredDuration: TimeInterval
|
var preferredDuration: TimeInterval
|
||||||
|
|
||||||
|
|||||||
@@ -9,7 +9,7 @@
|
|||||||
import Foundation
|
import Foundation
|
||||||
import OSLog
|
import OSLog
|
||||||
|
|
||||||
let customLog = OSLog(subsystem: "org.sidestore.sidestore",
|
public let customLog = OSLog(subsystem: "org.sidestore.sidestore",
|
||||||
category: "ios")
|
category: "ios")
|
||||||
|
|
||||||
|
|
||||||
@@ -18,6 +18,7 @@ public extension OSLog {
|
|||||||
/// - Parameters:
|
/// - Parameters:
|
||||||
/// - message: String or format string
|
/// - message: String or format string
|
||||||
/// - args: optional args for format string
|
/// - args: optional args for format string
|
||||||
|
@inlinable
|
||||||
static func error(_ message: StaticString, _ args: CVarArg...) {
|
static func error(_ message: StaticString, _ args: CVarArg...) {
|
||||||
os_log(message, log: customLog, type: .error, args)
|
os_log(message, log: customLog, type: .error, args)
|
||||||
}
|
}
|
||||||
@@ -26,6 +27,7 @@ public extension OSLog {
|
|||||||
/// - Parameters:
|
/// - Parameters:
|
||||||
/// - message: String or format string
|
/// - message: String or format string
|
||||||
/// - args: optional args for format string
|
/// - args: optional args for format string
|
||||||
|
@inlinable
|
||||||
static func info(_ message: StaticString, _ args: CVarArg...) {
|
static func info(_ message: StaticString, _ args: CVarArg...) {
|
||||||
os_log(message, log: customLog, type: .info, args)
|
os_log(message, log: customLog, type: .info, args)
|
||||||
}
|
}
|
||||||
@@ -34,6 +36,7 @@ public extension OSLog {
|
|||||||
/// - Parameters:
|
/// - Parameters:
|
||||||
/// - message: String or format string
|
/// - message: String or format string
|
||||||
/// - args: optional args for format string
|
/// - args: optional args for format string
|
||||||
|
@inlinable
|
||||||
static func debug(_ message: StaticString, _ args: CVarArg...) {
|
static func debug(_ message: StaticString, _ args: CVarArg...) {
|
||||||
os_log(message, log: customLog, type: .debug, args)
|
os_log(message, log: customLog, type: .debug, args)
|
||||||
}
|
}
|
||||||
@@ -45,6 +48,7 @@ public extension OSLog {
|
|||||||
/// - Parameters:
|
/// - Parameters:
|
||||||
/// - message: String or format string
|
/// - message: String or format string
|
||||||
/// - args: optional args for format string
|
/// - args: optional args for format string
|
||||||
|
@inlinable
|
||||||
public func ELOG(_ message: StaticString, file: StaticString = #file, function: StaticString = #function, line: UInt = #line, _ args: CVarArg...) {
|
public func ELOG(_ message: StaticString, file: StaticString = #file, function: StaticString = #function, line: UInt = #line, _ args: CVarArg...) {
|
||||||
OSLog.error(message, args)
|
OSLog.error(message, args)
|
||||||
}
|
}
|
||||||
@@ -53,6 +57,7 @@ public func ELOG(_ message: StaticString, file: StaticString = #file, function:
|
|||||||
/// - Parameters:
|
/// - Parameters:
|
||||||
/// - message: String or format string
|
/// - message: String or format string
|
||||||
/// - args: optional args for format string
|
/// - args: optional args for format string
|
||||||
|
@inlinable
|
||||||
public func ILOG(_ message: StaticString, file: StaticString = #file, function: StaticString = #function, line: UInt = #line, _ args: CVarArg...) {
|
public func ILOG(_ message: StaticString, file: StaticString = #file, function: StaticString = #function, line: UInt = #line, _ args: CVarArg...) {
|
||||||
OSLog.info(message, args)
|
OSLog.info(message, args)
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -5,7 +5,7 @@
|
|||||||
<key>ALTAppGroups</key>
|
<key>ALTAppGroups</key>
|
||||||
<array>
|
<array>
|
||||||
<string>group.$(APP_GROUP_IDENTIFIER)</string>
|
<string>group.$(APP_GROUP_IDENTIFIER)</string>
|
||||||
<string>group.com.rileytestut.AltStore</string>
|
<string>group.com.SideStore.SideStore</string>
|
||||||
</array>
|
</array>
|
||||||
<key>ALTDeviceID</key>
|
<key>ALTDeviceID</key>
|
||||||
<string>00008101-000129D63698001E</string>
|
<string>00008101-000129D63698001E</string>
|
||||||
@@ -44,6 +44,8 @@
|
|||||||
<string>$(PRODUCT_NAME)</string>
|
<string>$(PRODUCT_NAME)</string>
|
||||||
<key>CFBundlePackageType</key>
|
<key>CFBundlePackageType</key>
|
||||||
<string>APPL</string>
|
<string>APPL</string>
|
||||||
|
<key>LSSupportsOpeningDocumentsInPlace</key>
|
||||||
|
<true/>
|
||||||
<key>CFBundleShortVersionString</key>
|
<key>CFBundleShortVersionString</key>
|
||||||
<string>$(MARKETING_VERSION)</string>
|
<string>$(MARKETING_VERSION)</string>
|
||||||
<key>CFBundleURLTypes</key>
|
<key>CFBundleURLTypes</key>
|
||||||
@@ -56,6 +58,7 @@
|
|||||||
<key>CFBundleURLSchemes</key>
|
<key>CFBundleURLSchemes</key>
|
||||||
<array>
|
<array>
|
||||||
<string>altstore</string>
|
<string>altstore</string>
|
||||||
|
<string>sidestore</string>
|
||||||
</array>
|
</array>
|
||||||
</dict>
|
</dict>
|
||||||
<dict>
|
<dict>
|
||||||
@@ -66,6 +69,7 @@
|
|||||||
<key>CFBundleURLSchemes</key>
|
<key>CFBundleURLSchemes</key>
|
||||||
<array>
|
<array>
|
||||||
<string>altstore-com.rileytestut.AltStore</string>
|
<string>altstore-com.rileytestut.AltStore</string>
|
||||||
|
<string>sidestore-com.SideStore.SideStore</string>
|
||||||
</array>
|
</array>
|
||||||
</dict>
|
</dict>
|
||||||
</array>
|
</array>
|
||||||
@@ -200,5 +204,7 @@
|
|||||||
</dict>
|
</dict>
|
||||||
</dict>
|
</dict>
|
||||||
</array>
|
</array>
|
||||||
|
<key>UIFileSharingEnabled</key>
|
||||||
|
<true/>
|
||||||
</dict>
|
</dict>
|
||||||
</plist>
|
</plist>
|
||||||
|
|||||||
@@ -11,7 +11,7 @@ import Foundation
|
|||||||
import AltStoreCore
|
import AltStoreCore
|
||||||
|
|
||||||
@available(iOS 14, *)
|
@available(iOS 14, *)
|
||||||
class IntentHandler: NSObject, RefreshAllIntentHandling
|
final class IntentHandler: NSObject, RefreshAllIntentHandling
|
||||||
{
|
{
|
||||||
private let queue = DispatchQueue(label: "io.altstore.IntentHandler")
|
private let queue = DispatchQueue(label: "io.altstore.IntentHandler")
|
||||||
|
|
||||||
|
|||||||
@@ -14,7 +14,7 @@ import minimuxer
|
|||||||
import AltStoreCore
|
import AltStoreCore
|
||||||
import UniformTypeIdentifiers
|
import UniformTypeIdentifiers
|
||||||
|
|
||||||
class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
|
final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
|
||||||
{
|
{
|
||||||
private var didFinishLaunching = false
|
private var didFinishLaunching = false
|
||||||
|
|
||||||
@@ -47,6 +47,7 @@ class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
|
|||||||
|
|
||||||
override func viewDidAppear(_ animated: Bool) {
|
override func viewDidAppear(_ animated: Bool) {
|
||||||
super.viewDidAppear(true)
|
super.viewDidAppear(true)
|
||||||
|
#if !targetEnvironment(simulator)
|
||||||
start_em_proxy(bind_addr: Consts.Proxy.serverURL)
|
start_em_proxy(bind_addr: Consts.Proxy.serverURL)
|
||||||
|
|
||||||
guard let pf = fetchPairingFile() else {
|
guard let pf = fetchPairingFile() else {
|
||||||
@@ -54,6 +55,7 @@ class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
|
|||||||
return
|
return
|
||||||
}
|
}
|
||||||
start_minimuxer_threads(pf)
|
start_minimuxer_threads(pf)
|
||||||
|
#endif
|
||||||
}
|
}
|
||||||
|
|
||||||
func fetchPairingFile() -> String? {
|
func fetchPairingFile() -> String? {
|
||||||
@@ -77,14 +79,16 @@ class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
|
|||||||
} else {
|
} else {
|
||||||
// Show an alert explaining the pairing file
|
// Show an alert explaining the pairing file
|
||||||
// Create new Alert
|
// Create new Alert
|
||||||
let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://youtu.be/dQw4w9WgXcQ", preferredStyle: .alert)
|
let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/install#pairing-process", preferredStyle: .alert)
|
||||||
|
|
||||||
// Create OK button with action handler
|
// Create OK button with action handler
|
||||||
let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
|
let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
|
||||||
// Try to load it from a file picker
|
// Try to load it from a file picker
|
||||||
var types = UTType.types(tag: "plist", tagClass: UTTagClass.filenameExtension, conformingTo: nil)
|
var types = UTType.types(tag: "plist", tagClass: UTTagClass.filenameExtension, conformingTo: nil)
|
||||||
types.append(contentsOf: UTType.types(tag: "mobiledevicepairing", tagClass: UTTagClass.filenameExtension, conformingTo: nil))
|
types.append(contentsOf: UTType.types(tag: "mobiledevicepairing", tagClass: UTTagClass.filenameExtension, conformingTo: UTType.data))
|
||||||
|
types.append(.xml)
|
||||||
let documentPickerController = UIDocumentPickerViewController(forOpeningContentTypes: types)
|
let documentPickerController = UIDocumentPickerViewController(forOpeningContentTypes: types)
|
||||||
|
documentPickerController.shouldShowFileExtensions = true
|
||||||
documentPickerController.delegate = self
|
documentPickerController.delegate = self
|
||||||
self.present(documentPickerController, animated: true, completion: nil)
|
self.present(documentPickerController, animated: true, completion: nil)
|
||||||
})
|
})
|
||||||
@@ -140,12 +144,22 @@ class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
|
|||||||
}
|
}
|
||||||
|
|
||||||
func documentPickerWasCancelled(_ controller: UIDocumentPickerViewController) {
|
func documentPickerWasCancelled(_ controller: UIDocumentPickerViewController) {
|
||||||
displayError("Choosing a pairing file was cancelled")
|
displayError("Choosing a pairing file was cancelled. Please re-open the app and try again.")
|
||||||
}
|
}
|
||||||
|
|
||||||
func start_minimuxer_threads(_ pairing_file: String) {
|
func start_minimuxer_threads(_ pairing_file: String) {
|
||||||
set_usbmuxd_socket()
|
set_usbmuxd_socket()
|
||||||
|
#if false // Retries
|
||||||
|
var res = start_minimuxer(pairing_file: pairing_file)
|
||||||
|
var attempts = 10
|
||||||
|
while (attempts != 0 && res != 0) {
|
||||||
|
print("start_minimuxer `res` != 0, retry #\(attempts)")
|
||||||
|
res = start_minimuxer(pairing_file: pairing_file)
|
||||||
|
attempts -= 1
|
||||||
|
}
|
||||||
|
#else
|
||||||
let res = start_minimuxer(pairing_file: pairing_file)
|
let res = start_minimuxer(pairing_file: pairing_file)
|
||||||
|
#endif
|
||||||
if res != 0 {
|
if res != 0 {
|
||||||
displayError("minimuxer failed to start. Incorrect arguments were passed.")
|
displayError("minimuxer failed to start. Incorrect arguments were passed.")
|
||||||
}
|
}
|
||||||
@@ -165,7 +179,19 @@ extension LaunchViewController
|
|||||||
{
|
{
|
||||||
let title = error.userInfo[NSLocalizedFailureErrorKey] as? String ?? NSLocalizedString("Unable to Launch SideStore", comment: "")
|
let title = error.userInfo[NSLocalizedFailureErrorKey] as? String ?? NSLocalizedString("Unable to Launch SideStore", comment: "")
|
||||||
|
|
||||||
let alertController = UIAlertController(title: title, message: error.localizedDescription, preferredStyle: .alert)
|
let errorDescription: String
|
||||||
|
|
||||||
|
if #available(iOS 14.5, *)
|
||||||
|
{
|
||||||
|
let errorMessages = [error.debugDescription] + error.underlyingErrors.map { ($0 as NSError).debugDescription }
|
||||||
|
errorDescription = errorMessages.joined(separator: "\n\n")
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
errorDescription = error.debugDescription
|
||||||
|
}
|
||||||
|
|
||||||
|
let alertController = UIAlertController(title: title, message: errorDescription, preferredStyle: .alert)
|
||||||
alertController.addAction(UIAlertAction(title: NSLocalizedString("Retry", comment: ""), style: .default, handler: { (action) in
|
alertController.addAction(UIAlertAction(title: NSLocalizedString("Retry", comment: ""), style: .default, handler: { (action) in
|
||||||
self.handleLaunchConditions()
|
self.handleLaunchConditions()
|
||||||
}))
|
}))
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ extension AppManager
|
|||||||
}
|
}
|
||||||
|
|
||||||
@available(iOS 13, *)
|
@available(iOS 13, *)
|
||||||
class AppManagerPublisher: ObservableObject
|
final class AppManagerPublisher: ObservableObject
|
||||||
{
|
{
|
||||||
@Published
|
@Published
|
||||||
fileprivate(set) var installationProgress = [String: Progress]()
|
fileprivate(set) var installationProgress = [String: Progress]()
|
||||||
@@ -42,7 +42,7 @@ private func ==(lhs: OperatingSystemVersion, rhs: OperatingSystemVersion) -> Boo
|
|||||||
return (lhs.majorVersion == rhs.majorVersion && lhs.minorVersion == rhs.minorVersion && lhs.patchVersion == rhs.patchVersion)
|
return (lhs.majorVersion == rhs.majorVersion && lhs.minorVersion == rhs.minorVersion && lhs.patchVersion == rhs.patchVersion)
|
||||||
}
|
}
|
||||||
|
|
||||||
class AppManager
|
final class AppManager
|
||||||
{
|
{
|
||||||
static let shared = AppManager()
|
static let shared = AppManager()
|
||||||
|
|
||||||
@@ -392,7 +392,8 @@ extension AppManager
|
|||||||
func fetchAppIDs(completionHandler: @escaping (Result<([AppID], NSManagedObjectContext), Error>) -> Void)
|
func fetchAppIDs(completionHandler: @escaping (Result<([AppID], NSManagedObjectContext), Error>) -> Void)
|
||||||
{
|
{
|
||||||
let authenticationOperation = self.authenticate(presentingViewController: nil) { (result) in
|
let authenticationOperation = self.authenticate(presentingViewController: nil) { (result) in
|
||||||
print("Authenticated for fetching App IDs with result:", result)
|
// result contains name, email, auth token, OTP and other possibly personal/account specific info. we don't want this logged
|
||||||
|
//print("Authenticated for fetching App IDs with result:", result)
|
||||||
}
|
}
|
||||||
|
|
||||||
let fetchAppIDsOperation = FetchAppIDsOperation(context: authenticationOperation.context)
|
let fetchAppIDsOperation = FetchAppIDsOperation(context: authenticationOperation.context)
|
||||||
@@ -664,7 +665,7 @@ extension AppManager
|
|||||||
@available(iOS 14, *)
|
@available(iOS 14, *)
|
||||||
func enableJIT(for installedApp: InstalledApp, completionHandler: @escaping (Result<Void, Error>) -> Void)
|
func enableJIT(for installedApp: InstalledApp, completionHandler: @escaping (Result<Void, Error>) -> Void)
|
||||||
{
|
{
|
||||||
class Context: OperationContext, EnableJITContext
|
final class Context: OperationContext, EnableJITContext
|
||||||
{
|
{
|
||||||
var installedApp: InstalledApp?
|
var installedApp: InstalledApp?
|
||||||
}
|
}
|
||||||
@@ -684,7 +685,7 @@ extension AppManager
|
|||||||
@available(iOS 14.0, *)
|
@available(iOS 14.0, *)
|
||||||
func patch(resignedApp: ALTApplication, presentingViewController: UIViewController, context authContext: AuthenticatedOperationContext, completionHandler: @escaping (Result<InstalledApp, Error>) -> Void) -> PatchAppOperation
|
func patch(resignedApp: ALTApplication, presentingViewController: UIViewController, context authContext: AuthenticatedOperationContext, completionHandler: @escaping (Result<InstalledApp, Error>) -> Void) -> PatchAppOperation
|
||||||
{
|
{
|
||||||
class Context: InstallAppOperationContext, PatchAppContext
|
final class Context: InstallAppOperationContext, PatchAppContext
|
||||||
{
|
{
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -758,7 +759,7 @@ extension AppManager
|
|||||||
extension AppManager
|
extension AppManager
|
||||||
{
|
{
|
||||||
@discardableResult
|
@discardableResult
|
||||||
func backgroundRefresh(_ installedApps: [InstalledApp], presentsNotifications: Bool = true, completionHandler: @escaping (Result<[String: Result<InstalledApp, Error>], Error>) -> Void) -> BackgroundRefreshAppsOperation
|
func backgroundRefresh(_ installedApps: [InstalledApp], presentsNotifications: Bool = false, completionHandler: @escaping (Result<[String: Result<InstalledApp, Error>], Error>) -> Void) -> BackgroundRefreshAppsOperation
|
||||||
{
|
{
|
||||||
let backgroundRefreshAppsOperation = BackgroundRefreshAppsOperation(installedApps: installedApps)
|
let backgroundRefreshAppsOperation = BackgroundRefreshAppsOperation(installedApps: installedApps)
|
||||||
backgroundRefreshAppsOperation.resultHandler = completionHandler
|
backgroundRefreshAppsOperation.resultHandler = completionHandler
|
||||||
@@ -1223,7 +1224,7 @@ private extension AppManager
|
|||||||
let progress = Progress.discreteProgress(totalUnitCount: 100)
|
let progress = Progress.discreteProgress(totalUnitCount: 100)
|
||||||
|
|
||||||
let context = AppOperationContext(bundleIdentifier: app.bundleIdentifier, authenticatedContext: group.context)
|
let context = AppOperationContext(bundleIdentifier: app.bundleIdentifier, authenticatedContext: group.context)
|
||||||
context.app = ALTApplication(fileURL: app.url)
|
context.app = ALTApplication(fileURL: app.fileURL)
|
||||||
|
|
||||||
/* Fetch Provisioning Profiles */
|
/* Fetch Provisioning Profiles */
|
||||||
let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
|
let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
|
||||||
@@ -1663,12 +1664,7 @@ private extension AppManager
|
|||||||
|
|
||||||
if #available(iOS 14, *)
|
if #available(iOS 14, *)
|
||||||
{
|
{
|
||||||
WidgetCenter.shared.getCurrentConfigurations { (result) in
|
WidgetCenter.shared.reloadAllTimelines()
|
||||||
guard case .success(let widgets) = result else { return }
|
|
||||||
|
|
||||||
guard let widget = widgets.first(where: { $0.configuration is ViewAppIntent }) else { return }
|
|
||||||
WidgetCenter.shared.reloadTimelines(ofKind: widget.kind)
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
do { try installedApp.managedObjectContext?.save() }
|
do { try installedApp.managedObjectContext?.save() }
|
||||||
@@ -1677,6 +1673,8 @@ private extension AppManager
|
|||||||
catch
|
catch
|
||||||
{
|
{
|
||||||
group.set(.failure(error), forAppWithBundleIdentifier: operation.bundleIdentifier)
|
group.set(.failure(error), forAppWithBundleIdentifier: operation.bundleIdentifier)
|
||||||
|
|
||||||
|
self.log(error, for: operation)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -1701,6 +1699,43 @@ private extension AppManager
|
|||||||
UNUserNotificationCenter.current().add(request)
|
UNUserNotificationCenter.current().add(request)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func log(_ error: Error, for operation: AppOperation)
|
||||||
|
{
|
||||||
|
// Sanitize NSError on same thread before performing background task.
|
||||||
|
let sanitizedError = (error as NSError).sanitizedForCoreData()
|
||||||
|
|
||||||
|
let loggedErrorOperation: LoggedError.Operation = {
|
||||||
|
switch operation
|
||||||
|
{
|
||||||
|
case .install: return .install
|
||||||
|
case .update: return .update
|
||||||
|
case .refresh: return .refresh
|
||||||
|
case .activate: return .activate
|
||||||
|
case .deactivate: return .deactivate
|
||||||
|
case .backup: return .backup
|
||||||
|
case .restore: return .restore
|
||||||
|
}
|
||||||
|
}()
|
||||||
|
|
||||||
|
DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
|
||||||
|
var app = operation.app
|
||||||
|
if let managedApp = app as? NSManagedObject, let tempApp = context.object(with: managedApp.objectID) as? AppProtocol
|
||||||
|
{
|
||||||
|
app = tempApp
|
||||||
|
}
|
||||||
|
|
||||||
|
do
|
||||||
|
{
|
||||||
|
_ = LoggedError(error: sanitizedError, app: app, operation: loggedErrorOperation, context: context)
|
||||||
|
try context.save()
|
||||||
|
}
|
||||||
|
catch let saveError
|
||||||
|
{
|
||||||
|
print("[ALTLog] Failed to log error \(sanitizedError.domain) code \(sanitizedError.code) for \(app.bundleIdentifier):", saveError)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
func run(_ operations: [Foundation.Operation], context: OperationContext?, requiresSerialQueue: Bool = false)
|
func run(_ operations: [Foundation.Operation], context: OperationContext?, requiresSerialQueue: Bool = false)
|
||||||
{
|
{
|
||||||
// Find "Install AltStore" operation if it already exists in `context`
|
// Find "Install AltStore" operation if it already exists in `context`
|
||||||
|
|||||||
@@ -8,7 +8,7 @@
|
|||||||
|
|
||||||
import UIKit
|
import UIKit
|
||||||
|
|
||||||
class InstalledAppsCollectionHeaderView: UICollectionReusableView
|
final class InstalledAppsCollectionHeaderView: UICollectionReusableView
|
||||||
{
|
{
|
||||||
let textLabel: UILabel
|
let textLabel: UILabel
|
||||||
let button: UIButton
|
let button: UIButton
|
||||||
|
|||||||
@@ -9,7 +9,7 @@
|
|||||||
import UIKit
|
import UIKit
|
||||||
import Roxas
|
import Roxas
|
||||||
|
|
||||||
class InstalledAppCollectionViewCell: UICollectionViewCell
|
final class InstalledAppCollectionViewCell: UICollectionViewCell
|
||||||
{
|
{
|
||||||
private(set) var deactivateBadge: UIView?
|
private(set) var deactivateBadge: UIView?
|
||||||
|
|
||||||
@@ -55,13 +55,13 @@ class InstalledAppCollectionViewCell: UICollectionViewCell
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
class InstalledAppsCollectionFooterView: UICollectionReusableView
|
final class InstalledAppsCollectionFooterView: UICollectionReusableView
|
||||||
{
|
{
|
||||||
@IBOutlet var textLabel: UILabel!
|
@IBOutlet var textLabel: UILabel!
|
||||||
@IBOutlet var button: UIButton!
|
@IBOutlet var button: UIButton!
|
||||||
}
|
}
|
||||||
|
|
||||||
class NoUpdatesCollectionViewCell: UICollectionViewCell
|
final class NoUpdatesCollectionViewCell: UICollectionViewCell
|
||||||
{
|
{
|
||||||
@IBOutlet var blurView: UIVisualEffectView!
|
@IBOutlet var blurView: UIVisualEffectView!
|
||||||
|
|
||||||
@@ -73,7 +73,7 @@ class NoUpdatesCollectionViewCell: UICollectionViewCell
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
class UpdatesCollectionHeaderView: UICollectionReusableView
|
final class UpdatesCollectionHeaderView: UICollectionReusableView
|
||||||
{
|
{
|
||||||
let button = PillButton(type: .system)
|
let button = PillButton(type: .system)
|
||||||
|
|
||||||
|
|||||||
@@ -30,7 +30,7 @@ extension MyAppsViewController
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
class MyAppsViewController: UICollectionViewController
|
final class MyAppsViewController: UICollectionViewController
|
||||||
{
|
{
|
||||||
private let coordinator = NSFileCoordinator()
|
private let coordinator = NSFileCoordinator()
|
||||||
private let operationQueue = OperationQueue()
|
private let operationQueue = OperationQueue()
|
||||||
@@ -186,7 +186,7 @@ private extension MyAppsViewController
|
|||||||
func makeUpdatesDataSource() -> RSTFetchedResultsCollectionViewPrefetchingDataSource<InstalledApp, UIImage>
|
func makeUpdatesDataSource() -> RSTFetchedResultsCollectionViewPrefetchingDataSource<InstalledApp, UIImage>
|
||||||
{
|
{
|
||||||
let fetchRequest = InstalledApp.updatesFetchRequest()
|
let fetchRequest = InstalledApp.updatesFetchRequest()
|
||||||
fetchRequest.sortDescriptors = [NSSortDescriptor(keyPath: \InstalledApp.storeApp?.versionDate, ascending: true),
|
fetchRequest.sortDescriptors = [NSSortDescriptor(keyPath: \InstalledApp.storeApp?.latestVersion?.date, ascending: true),
|
||||||
NSSortDescriptor(keyPath: \InstalledApp.name, ascending: true)]
|
NSSortDescriptor(keyPath: \InstalledApp.name, ascending: true)]
|
||||||
fetchRequest.returnsObjectsAsFaults = false
|
fetchRequest.returnsObjectsAsFaults = false
|
||||||
|
|
||||||
@@ -195,7 +195,7 @@ private extension MyAppsViewController
|
|||||||
dataSource.cellIdentifierHandler = { _ in "UpdateCell" }
|
dataSource.cellIdentifierHandler = { _ in "UpdateCell" }
|
||||||
dataSource.cellConfigurationHandler = { [weak self] (cell, installedApp, indexPath) in
|
dataSource.cellConfigurationHandler = { [weak self] (cell, installedApp, indexPath) in
|
||||||
guard let self = self else { return }
|
guard let self = self else { return }
|
||||||
guard let app = installedApp.storeApp else { return }
|
guard let app = installedApp.storeApp, let latestVersion = app.latestVersion else { return }
|
||||||
|
|
||||||
let cell = cell as! UpdateCollectionViewCell
|
let cell = cell as! UpdateCollectionViewCell
|
||||||
cell.layoutMargins.left = self.view.layoutMargins.left
|
cell.layoutMargins.left = self.view.layoutMargins.left
|
||||||
@@ -209,7 +209,7 @@ private extension MyAppsViewController
|
|||||||
|
|
||||||
cell.bannerView.configure(for: app)
|
cell.bannerView.configure(for: app)
|
||||||
|
|
||||||
let versionDate = Date().relativeDateString(since: app.versionDate, dateFormatter: self.dateFormatter)
|
let versionDate = Date().relativeDateString(since: latestVersion.date, dateFormatter: self.dateFormatter)
|
||||||
cell.bannerView.subtitleLabel.text = versionDate
|
cell.bannerView.subtitleLabel.text = versionDate
|
||||||
|
|
||||||
let appName: String
|
let appName: String
|
||||||
@@ -223,7 +223,7 @@ private extension MyAppsViewController
|
|||||||
appName = app.name
|
appName = app.name
|
||||||
}
|
}
|
||||||
|
|
||||||
cell.bannerView.accessibilityLabel = String(format: NSLocalizedString("%@ %@ update. Released on %@.", comment: ""), appName, app.version, versionDate)
|
cell.bannerView.accessibilityLabel = String(format: NSLocalizedString("%@ %@ update. Released on %@.", comment: ""), appName, latestVersion.version, versionDate)
|
||||||
|
|
||||||
cell.bannerView.button.isIndicatingActivity = false
|
cell.bannerView.button.isIndicatingActivity = false
|
||||||
cell.bannerView.button.addTarget(self, action: #selector(MyAppsViewController.updateApp(_:)), for: .primaryActionTriggered)
|
cell.bannerView.button.addTarget(self, action: #selector(MyAppsViewController.updateApp(_:)), for: .primaryActionTriggered)
|
||||||
@@ -461,17 +461,10 @@ private extension MyAppsViewController
|
|||||||
|
|
||||||
func updateDataSource()
|
func updateDataSource()
|
||||||
{
|
{
|
||||||
if let patreonAccount = DatabaseManager.shared.patreonAccount(), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
|
|
||||||
{
|
|
||||||
self.dataSource.predicate = nil
|
self.dataSource.predicate = nil
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
self.dataSource.predicate = NSPredicate(format: "%K == nil OR %K == NO OR %K == %@",
|
|
||||||
#keyPath(InstalledApp.storeApp),
|
|
||||||
#keyPath(InstalledApp.storeApp.isBeta),
|
|
||||||
#keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -17,7 +17,7 @@ extension UpdateCollectionViewCell
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@objc class UpdateCollectionViewCell: UICollectionViewCell
|
@objc final class UpdateCollectionViewCell: UICollectionViewCell
|
||||||
{
|
{
|
||||||
var mode: Mode = .expanded {
|
var mode: Mode = .expanded {
|
||||||
didSet {
|
didSet {
|
||||||
|
|||||||
@@ -8,7 +8,7 @@
|
|||||||
|
|
||||||
import UIKit
|
import UIKit
|
||||||
|
|
||||||
class NewsCollectionViewCell: UICollectionViewCell
|
final class NewsCollectionViewCell: UICollectionViewCell
|
||||||
{
|
{
|
||||||
@IBOutlet var titleLabel: UILabel!
|
@IBOutlet var titleLabel: UILabel!
|
||||||
@IBOutlet var captionLabel: UILabel!
|
@IBOutlet var captionLabel: UILabel!
|
||||||
|
|||||||
@@ -14,7 +14,7 @@ import Roxas
|
|||||||
|
|
||||||
import Nuke
|
import Nuke
|
||||||
|
|
||||||
private class AppBannerFooterView: UICollectionReusableView
|
private final class AppBannerFooterView: UICollectionReusableView
|
||||||
{
|
{
|
||||||
let bannerView = AppBannerView(frame: .zero)
|
let bannerView = AppBannerView(frame: .zero)
|
||||||
let tapGestureRecognizer = UITapGestureRecognizer(target: nil, action: nil)
|
let tapGestureRecognizer = UITapGestureRecognizer(target: nil, action: nil)
|
||||||
@@ -41,7 +41,7 @@ private class AppBannerFooterView: UICollectionReusableView
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
class NewsViewController: UICollectionViewController
|
final class NewsViewController: UICollectionViewController
|
||||||
{
|
{
|
||||||
private lazy var dataSource = self.makeDataSource()
|
private lazy var dataSource = self.makeDataSource()
|
||||||
private lazy var placeholderView = RSTPlaceholderView(frame: .zero)
|
private lazy var placeholderView = RSTPlaceholderView(frame: .zero)
|
||||||
@@ -391,7 +391,7 @@ extension NewsViewController
|
|||||||
let progress = AppManager.shared.installationProgress(for: storeApp)
|
let progress = AppManager.shared.installationProgress(for: storeApp)
|
||||||
footerView.bannerView.button.progress = progress
|
footerView.bannerView.button.progress = progress
|
||||||
|
|
||||||
if Date() < storeApp.versionDate
|
if let versionDate = storeApp.latestVersion?.date, versionDate > Date()
|
||||||
{
|
{
|
||||||
footerView.bannerView.button.countdownDate = storeApp.versionDate
|
footerView.bannerView.button.countdownDate = storeApp.versionDate
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -34,7 +34,7 @@ enum AuthenticationError: LocalizedError
|
|||||||
}
|
}
|
||||||
|
|
||||||
@objc(AuthenticationOperation)
|
@objc(AuthenticationOperation)
|
||||||
class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, ALTAppleAPISession)>
|
final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, ALTAppleAPISession)>
|
||||||
{
|
{
|
||||||
let context: AuthenticatedOperationContext
|
let context: AuthenticatedOperationContext
|
||||||
|
|
||||||
|
|||||||
@@ -51,12 +51,12 @@ private let ReceivedApplicationState: @convention(c) (CFNotificationCenter?, Uns
|
|||||||
}
|
}
|
||||||
|
|
||||||
@objc(BackgroundRefreshAppsOperation)
|
@objc(BackgroundRefreshAppsOperation)
|
||||||
class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<InstalledApp, Error>]>
|
final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<InstalledApp, Error>]>
|
||||||
{
|
{
|
||||||
let installedApps: [InstalledApp]
|
let installedApps: [InstalledApp]
|
||||||
private let managedObjectContext: NSManagedObjectContext
|
private let managedObjectContext: NSManagedObjectContext
|
||||||
|
|
||||||
var presentsFinishedNotification: Bool = true
|
var presentsFinishedNotification: Bool = false
|
||||||
|
|
||||||
private let refreshIdentifier: String = UUID().uuidString
|
private let refreshIdentifier: String = UUID().uuidString
|
||||||
private var runningApplications: Set<String> = []
|
private var runningApplications: Set<String> = []
|
||||||
@@ -189,12 +189,12 @@ private extension BackgroundRefreshAppsOperation
|
|||||||
|
|
||||||
let content = UNMutableNotificationContent()
|
let content = UNMutableNotificationContent()
|
||||||
|
|
||||||
var shouldPresentAlert = true
|
var shouldPresentAlert = false
|
||||||
|
|
||||||
do
|
do
|
||||||
{
|
{
|
||||||
let results = try result.get()
|
let results = try result.get()
|
||||||
shouldPresentAlert = !results.isEmpty
|
shouldPresentAlert = false
|
||||||
|
|
||||||
for (_, result) in results
|
for (_, result) in results
|
||||||
{
|
{
|
||||||
@@ -216,7 +216,7 @@ private extension BackgroundRefreshAppsOperation
|
|||||||
content.title = NSLocalizedString("Failed to Refresh Apps", comment: "")
|
content.title = NSLocalizedString("Failed to Refresh Apps", comment: "")
|
||||||
content.body = error.localizedDescription
|
content.body = error.localizedDescription
|
||||||
|
|
||||||
shouldPresentAlert = true
|
shouldPresentAlert = false
|
||||||
}
|
}
|
||||||
|
|
||||||
if shouldPresentAlert
|
if shouldPresentAlert
|
||||||
|
|||||||
@@ -14,7 +14,7 @@ import Roxas
|
|||||||
import minimuxer
|
import minimuxer
|
||||||
|
|
||||||
@objc(DeactivateAppOperation)
|
@objc(DeactivateAppOperation)
|
||||||
class DeactivateAppOperation: ResultOperation<InstalledApp>
|
final class DeactivateAppOperation: ResultOperation<InstalledApp>
|
||||||
{
|
{
|
||||||
let app: InstalledApp
|
let app: InstalledApp
|
||||||
let context: OperationContext
|
let context: OperationContext
|
||||||
|
|||||||
@@ -30,13 +30,13 @@ private extension DownloadAppOperation
|
|||||||
}
|
}
|
||||||
|
|
||||||
@objc(DownloadAppOperation)
|
@objc(DownloadAppOperation)
|
||||||
class DownloadAppOperation: ResultOperation<ALTApplication>
|
final class DownloadAppOperation: ResultOperation<ALTApplication>
|
||||||
{
|
{
|
||||||
let app: AppProtocol
|
let app: AppProtocol
|
||||||
let context: AppOperationContext
|
let context: AppOperationContext
|
||||||
|
|
||||||
private let bundleIdentifier: String
|
private let bundleIdentifier: String
|
||||||
private let sourceURL: URL
|
private var sourceURL: URL?
|
||||||
private let destinationURL: URL
|
private let destinationURL: URL
|
||||||
|
|
||||||
private let session = URLSession(configuration: .default)
|
private let session = URLSession(configuration: .default)
|
||||||
@@ -69,7 +69,9 @@ class DownloadAppOperation: ResultOperation<ALTApplication>
|
|||||||
|
|
||||||
print("Downloading App:", self.bundleIdentifier)
|
print("Downloading App:", self.bundleIdentifier)
|
||||||
|
|
||||||
self.downloadApp(from: self.sourceURL) { result in
|
guard let sourceURL = self.sourceURL else { return self.finish(.failure(OperationError.appNotFound)) }
|
||||||
|
|
||||||
|
self.downloadApp(from: sourceURL) { result in
|
||||||
do
|
do
|
||||||
{
|
{
|
||||||
let application = try result.get()
|
let application = try result.get()
|
||||||
@@ -165,7 +167,7 @@ private extension DownloadAppOperation
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
if self.sourceURL.isFileURL
|
if sourceURL.isFileURL
|
||||||
{
|
{
|
||||||
finishOperation(.success(sourceURL))
|
finishOperation(.success(sourceURL))
|
||||||
|
|
||||||
|
|||||||
@@ -21,7 +21,7 @@ protocol EnableJITContext
|
|||||||
}
|
}
|
||||||
|
|
||||||
@available(iOS 14, *)
|
@available(iOS 14, *)
|
||||||
class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
|
final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
|
||||||
{
|
{
|
||||||
let context: Context
|
let context: Context
|
||||||
|
|
||||||
|
|||||||
@@ -13,7 +13,7 @@ import AltSign
|
|||||||
import Roxas
|
import Roxas
|
||||||
|
|
||||||
@objc(FetchAnisetteDataOperation)
|
@objc(FetchAnisetteDataOperation)
|
||||||
class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>
|
final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>
|
||||||
{
|
{
|
||||||
let context: OperationContext
|
let context: OperationContext
|
||||||
|
|
||||||
@@ -47,6 +47,7 @@ class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>
|
|||||||
let formattedJSON: [String: String] = ["machineID": json["X-Apple-I-MD-M"]!, "oneTimePassword": json["X-Apple-I-MD"]!, "localUserID": json["X-Apple-I-MD-LU"]!, "routingInfo": json["X-Apple-I-MD-RINFO"]!, "deviceUniqueIdentifier": json["X-Mme-Device-Id"]!, "deviceDescription": json["X-MMe-Client-Info"]!, "date": json["X-Apple-I-Client-Time"]!, "locale": json["X-Apple-Locale"]!, "timeZone": json["X-Apple-I-TimeZone"]!, "deviceSerialNumber": "1"]
|
let formattedJSON: [String: String] = ["machineID": json["X-Apple-I-MD-M"]!, "oneTimePassword": json["X-Apple-I-MD"]!, "localUserID": json["X-Apple-I-MD-LU"]!, "routingInfo": json["X-Apple-I-MD-RINFO"]!, "deviceUniqueIdentifier": json["X-Mme-Device-Id"]!, "deviceDescription": json["X-MMe-Client-Info"]!, "date": json["X-Apple-I-Client-Time"]!, "locale": json["X-Apple-Locale"]!, "timeZone": json["X-Apple-I-TimeZone"]!, "deviceSerialNumber": "1"]
|
||||||
|
|
||||||
if let anisette = ALTAnisetteData(json: formattedJSON) {
|
if let anisette = ALTAnisetteData(json: formattedJSON) {
|
||||||
|
DLOG("Anisette used: %@", formattedJSON)
|
||||||
self.finish(.success(anisette))
|
self.finish(.success(anisette))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -13,7 +13,7 @@ import AltSign
|
|||||||
import Roxas
|
import Roxas
|
||||||
|
|
||||||
@objc(FetchAppIDsOperation)
|
@objc(FetchAppIDsOperation)
|
||||||
class FetchAppIDsOperation: ResultOperation<([AppID], NSManagedObjectContext)>
|
final class FetchAppIDsOperation: ResultOperation<([AppID], NSManagedObjectContext)>
|
||||||
{
|
{
|
||||||
let context: AuthenticatedOperationContext
|
let context: AuthenticatedOperationContext
|
||||||
let managedObjectContext: NSManagedObjectContext
|
let managedObjectContext: NSManagedObjectContext
|
||||||
|
|||||||
@@ -13,7 +13,7 @@ import AltSign
|
|||||||
import Roxas
|
import Roxas
|
||||||
|
|
||||||
@objc(FetchProvisioningProfilesOperation)
|
@objc(FetchProvisioningProfilesOperation)
|
||||||
class FetchProvisioningProfilesOperation: ResultOperation<[String: ALTProvisioningProfile]>
|
final class FetchProvisioningProfilesOperation: ResultOperation<[String: ALTProvisioningProfile]>
|
||||||
{
|
{
|
||||||
let context: AppOperationContext
|
let context: AppOperationContext
|
||||||
|
|
||||||
@@ -131,19 +131,19 @@ extension FetchProvisioningProfilesOperation
|
|||||||
// or if installedApp.team is nil but resignedBundleIdentifier contains the team's identifier.
|
// or if installedApp.team is nil but resignedBundleIdentifier contains the team's identifier.
|
||||||
let teamsMatch = installedApp.team?.identifier == team.identifier || (installedApp.team == nil && installedApp.resignedBundleIdentifier.contains(team.identifier))
|
let teamsMatch = installedApp.team?.identifier == team.identifier || (installedApp.team == nil && installedApp.resignedBundleIdentifier.contains(team.identifier))
|
||||||
|
|
||||||
#if DEBUG
|
// #if DEBUG
|
||||||
|
//
|
||||||
if app.isAltStoreApp
|
// if app.isAltStoreApp
|
||||||
{
|
// {
|
||||||
// Use legacy bundle ID format for AltStore.
|
// // Use legacy bundle ID format for AltStore.
|
||||||
preferredBundleID = teamsMatch ? installedApp.resignedBundleIdentifier : nil
|
// preferredBundleID = teamsMatch ? installedApp.resignedBundleIdentifier : nil
|
||||||
}
|
// }
|
||||||
else
|
// else
|
||||||
{
|
// {
|
||||||
preferredBundleID = teamsMatch ? installedApp.resignedBundleIdentifier : nil
|
// preferredBundleID = teamsMatch ? installedApp.resignedBundleIdentifier : nil
|
||||||
}
|
// }
|
||||||
|
//
|
||||||
#else
|
// #else
|
||||||
|
|
||||||
if teamsMatch
|
if teamsMatch
|
||||||
{
|
{
|
||||||
@@ -157,7 +157,7 @@ extension FetchProvisioningProfilesOperation
|
|||||||
preferredBundleID = nil
|
preferredBundleID = nil
|
||||||
}
|
}
|
||||||
|
|
||||||
#endif
|
// #endif
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
|||||||
@@ -13,7 +13,7 @@ import AltStoreCore
|
|||||||
import Roxas
|
import Roxas
|
||||||
|
|
||||||
@objc(FetchSourceOperation)
|
@objc(FetchSourceOperation)
|
||||||
class FetchSourceOperation: ResultOperation<Source>
|
final class FetchSourceOperation: ResultOperation<Source>
|
||||||
{
|
{
|
||||||
let sourceURL: URL
|
let sourceURL: URL
|
||||||
let managedObjectContext: NSManagedObjectContext
|
let managedObjectContext: NSManagedObjectContext
|
||||||
|
|||||||
@@ -32,7 +32,7 @@ extension FetchTrustedSourcesOperation
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
class FetchTrustedSourcesOperation: ResultOperation<[FetchTrustedSourcesOperation.TrustedSource]>
|
final class FetchTrustedSourcesOperation: ResultOperation<[FetchTrustedSourcesOperation.TrustedSource]>
|
||||||
{
|
{
|
||||||
override func main()
|
override func main()
|
||||||
{
|
{
|
||||||
|
|||||||
@@ -13,7 +13,7 @@ import AltSign
|
|||||||
import Roxas
|
import Roxas
|
||||||
|
|
||||||
@objc(InstallAppOperation)
|
@objc(InstallAppOperation)
|
||||||
class InstallAppOperation: ResultOperation<InstalledApp>
|
final class InstallAppOperation: ResultOperation<InstalledApp>
|
||||||
{
|
{
|
||||||
let context: InstallAppOperationContext
|
let context: InstallAppOperationContext
|
||||||
|
|
||||||
@@ -86,6 +86,11 @@ class InstallAppOperation: ResultOperation<InstalledApp>
|
|||||||
let resignedBundleID = appExtension.bundleIdentifier
|
let resignedBundleID = appExtension.bundleIdentifier
|
||||||
let originalBundleID = resignedBundleID.replacingOccurrences(of: resignedParentBundleID, with: parentBundleID)
|
let originalBundleID = resignedBundleID.replacingOccurrences(of: resignedParentBundleID, with: parentBundleID)
|
||||||
|
|
||||||
|
print("`parentBundleID`: \(parentBundleID)")
|
||||||
|
print("`resignedParentBundleID`: \(resignedParentBundleID)")
|
||||||
|
print("`resignedBundleID`: \(resignedBundleID)")
|
||||||
|
print("`originalBundleID`: \(originalBundleID)")
|
||||||
|
|
||||||
let installedExtension: InstalledExtension
|
let installedExtension: InstalledExtension
|
||||||
|
|
||||||
if let appExtension = installedApp.appExtensions.first(where: { $0.bundleIdentifier == originalBundleID })
|
if let appExtension = installedApp.appExtensions.first(where: { $0.bundleIdentifier == originalBundleID })
|
||||||
|
|||||||
@@ -38,7 +38,7 @@ class OperationContext
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
class AuthenticatedOperationContext: OperationContext
|
final class AuthenticatedOperationContext: OperationContext
|
||||||
{
|
{
|
||||||
var session: ALTAppleAPISession?
|
var session: ALTAppleAPISession?
|
||||||
|
|
||||||
|
|||||||
@@ -11,6 +11,8 @@ import AltSign
|
|||||||
|
|
||||||
enum OperationError: LocalizedError
|
enum OperationError: LocalizedError
|
||||||
{
|
{
|
||||||
|
static let domain = OperationError.unknown._domain
|
||||||
|
|
||||||
case unknown
|
case unknown
|
||||||
case unknownResult
|
case unknownResult
|
||||||
case cancelled
|
case cancelled
|
||||||
|
|||||||
@@ -52,7 +52,7 @@ private struct OTAUpdate
|
|||||||
}
|
}
|
||||||
|
|
||||||
@available(iOS 14, *)
|
@available(iOS 14, *)
|
||||||
class PatchAppOperation: ResultOperation<Void>
|
final class PatchAppOperation: ResultOperation<Void>
|
||||||
{
|
{
|
||||||
let context: PatchAppContext
|
let context: PatchAppContext
|
||||||
|
|
||||||
|
|||||||
@@ -29,7 +29,7 @@ extension PatchViewController
|
|||||||
}
|
}
|
||||||
|
|
||||||
@available(iOS 14.0, *)
|
@available(iOS 14.0, *)
|
||||||
class PatchViewController: UIViewController
|
final class PatchViewController: UIViewController
|
||||||
{
|
{
|
||||||
var patchApp: AnyApp?
|
var patchApp: AnyApp?
|
||||||
var installedApp: InstalledApp?
|
var installedApp: InstalledApp?
|
||||||
|
|||||||
@@ -14,7 +14,7 @@ import Roxas
|
|||||||
import minimuxer
|
import minimuxer
|
||||||
|
|
||||||
@objc(RefreshAppOperation)
|
@objc(RefreshAppOperation)
|
||||||
class RefreshAppOperation: ResultOperation<InstalledApp>
|
final class RefreshAppOperation: ResultOperation<InstalledApp>
|
||||||
{
|
{
|
||||||
let context: AppOperationContext
|
let context: AppOperationContext
|
||||||
|
|
||||||
|
|||||||
@@ -12,7 +12,7 @@ import CoreData
|
|||||||
import AltStoreCore
|
import AltStoreCore
|
||||||
import AltSign
|
import AltSign
|
||||||
|
|
||||||
class RefreshGroup: NSObject
|
final class RefreshGroup: NSObject
|
||||||
{
|
{
|
||||||
let context: AuthenticatedOperationContext
|
let context: AuthenticatedOperationContext
|
||||||
let progress = Progress.discreteProgress(totalUnitCount: 0)
|
let progress = Progress.discreteProgress(totalUnitCount: 0)
|
||||||
|
|||||||
@@ -9,7 +9,7 @@
|
|||||||
import Foundation
|
import Foundation
|
||||||
|
|
||||||
@objc(RemoveAppBackupOperation)
|
@objc(RemoveAppBackupOperation)
|
||||||
class RemoveAppBackupOperation: ResultOperation<Void>
|
final class RemoveAppBackupOperation: ResultOperation<Void>
|
||||||
{
|
{
|
||||||
let context: InstallAppOperationContext
|
let context: InstallAppOperationContext
|
||||||
|
|
||||||
|
|||||||
@@ -12,7 +12,7 @@ import AltStoreCore
|
|||||||
import minimuxer
|
import minimuxer
|
||||||
|
|
||||||
@objc(RemoveAppOperation)
|
@objc(RemoveAppOperation)
|
||||||
class RemoveAppOperation: ResultOperation<InstalledApp>
|
final class RemoveAppOperation: ResultOperation<InstalledApp>
|
||||||
{
|
{
|
||||||
let context: InstallAppOperationContext
|
let context: InstallAppOperationContext
|
||||||
|
|
||||||
|
|||||||
@@ -13,7 +13,7 @@ import AltStoreCore
|
|||||||
import AltSign
|
import AltSign
|
||||||
|
|
||||||
@objc(ResignAppOperation)
|
@objc(ResignAppOperation)
|
||||||
class ResignAppOperation: ResultOperation<ALTApplication>
|
final class ResignAppOperation: ResultOperation<ALTApplication>
|
||||||
{
|
{
|
||||||
let context: InstallAppOperationContext
|
let context: InstallAppOperationContext
|
||||||
|
|
||||||
|
|||||||
@@ -11,7 +11,7 @@ import Network
|
|||||||
import AltStoreCore
|
import AltStoreCore
|
||||||
|
|
||||||
@objc(SendAppOperation)
|
@objc(SendAppOperation)
|
||||||
class SendAppOperation: ResultOperation<()>
|
final class SendAppOperation: ResultOperation<()>
|
||||||
{
|
{
|
||||||
let context: InstallAppOperationContext
|
let context: InstallAppOperationContext
|
||||||
|
|
||||||
@@ -39,9 +39,10 @@ class SendAppOperation: ResultOperation<()>
|
|||||||
guard let resignedApp = self.context.resignedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
|
guard let resignedApp = self.context.resignedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
|
||||||
|
|
||||||
// self.context.resignedApp.fileURL points to the app bundle, but we want the .ipa.
|
// self.context.resignedApp.fileURL points to the app bundle, but we want the .ipa.
|
||||||
let app = AnyApp(name: resignedApp.name, bundleIdentifier: self.context.bundleIdentifier, url: resignedApp.url)
|
let app = AnyApp(name: resignedApp.name, bundleIdentifier: self.context.bundleIdentifier, url: resignedApp.fileURL)
|
||||||
let fileURL = InstalledApp.refreshedIPAURL(for: app)
|
let fileURL = InstalledApp.refreshedIPAURL(for: app)
|
||||||
|
|
||||||
|
print("AFC App `fileURL`: \(fileURL.absoluteString)")
|
||||||
|
|
||||||
let ns_bundle = NSString(string: app.bundleIdentifier)
|
let ns_bundle = NSString(string: app.bundleIdentifier)
|
||||||
let ns_bundle_ptr = UnsafeMutablePointer<CChar>(mutating: ns_bundle.utf8String)
|
let ns_bundle_ptr = UnsafeMutablePointer<CChar>(mutating: ns_bundle.utf8String)
|
||||||
@@ -53,6 +54,7 @@ class SendAppOperation: ResultOperation<()>
|
|||||||
}
|
}
|
||||||
let res = minimuxer_yeet_app_afc(ns_bundle_ptr, pls, UInt(data.length))
|
let res = minimuxer_yeet_app_afc(ns_bundle_ptr, pls, UInt(data.length))
|
||||||
if res == 0 {
|
if res == 0 {
|
||||||
|
print("minimuxer_yeet_app_afc `res` == \(res)")
|
||||||
self.progress.completedUnitCount += 1
|
self.progress.completedUnitCount += 1
|
||||||
self.finish(.success(()))
|
self.finish(.success(()))
|
||||||
} else {
|
} else {
|
||||||
|
|||||||
@@ -30,7 +30,7 @@ extension UpdatePatronsOperation
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
class UpdatePatronsOperation: ResultOperation<Void>
|
final class UpdatePatronsOperation: ResultOperation<Void>
|
||||||
{
|
{
|
||||||
let context: NSManagedObjectContext
|
let context: NSManagedObjectContext
|
||||||
|
|
||||||
|
|||||||
@@ -55,7 +55,7 @@ enum VerificationError: ALTLocalizedError
|
|||||||
}
|
}
|
||||||
|
|
||||||
@objc(VerifyAppOperation)
|
@objc(VerifyAppOperation)
|
||||||
class VerifyAppOperation: ResultOperation<Void>
|
final class VerifyAppOperation: ResultOperation<Void>
|
||||||
{
|
{
|
||||||
let context: AppOperationContext
|
let context: AppOperationContext
|
||||||
var verificationHandler: ((VerificationError) -> Bool)?
|
var verificationHandler: ((VerificationError) -> Bool)?
|
||||||
|
|||||||
|
Before Width: | Height: | Size: 7.5 KiB After Width: | Height: | Size: 8.4 KiB |
|
Before Width: | Height: | Size: 192 KiB After Width: | Height: | Size: 846 KiB |
|
Before Width: | Height: | Size: 9.2 KiB After Width: | Height: | Size: 10 KiB |
|
Before Width: | Height: | Size: 9.8 KiB After Width: | Height: | Size: 11 KiB |
|
Before Width: | Height: | Size: 12 KiB After Width: | Height: | Size: 15 KiB |
|
Before Width: | Height: | Size: 12 KiB After Width: | Height: | Size: 16 KiB |
|
Before Width: | Height: | Size: 15 KiB After Width: | Height: | Size: 19 KiB |
|
Before Width: | Height: | Size: 17 KiB After Width: | Height: | Size: 22 KiB |
|
Before Width: | Height: | Size: 912 B After Width: | Height: | Size: 997 B |
|
Before Width: | Height: | Size: 1.3 KiB After Width: | Height: | Size: 1.6 KiB |
|
Before Width: | Height: | Size: 2.0 KiB After Width: | Height: | Size: 2.4 KiB |
|
Before Width: | Height: | Size: 2.7 KiB After Width: | Height: | Size: 3.2 KiB |
|
Before Width: | Height: | Size: 3.2 KiB After Width: | Height: | Size: 3.8 KiB |
|
Before Width: | Height: | Size: 3.3 KiB After Width: | Height: | Size: 3.9 KiB |
|
Before Width: | Height: | Size: 3.4 KiB After Width: | Height: | Size: 4.1 KiB |
|
Before Width: | Height: | Size: 4.5 KiB After Width: | Height: | Size: 5.2 KiB |
|
Before Width: | Height: | Size: 5.2 KiB After Width: | Height: | Size: 5.6 KiB |
|
Before Width: | Height: | Size: 5.7 KiB After Width: | Height: | Size: 6.1 KiB |
|
Before Width: | Height: | Size: 6.2 KiB After Width: | Height: | Size: 6.8 KiB |
@@ -5,9 +5,9 @@
|
|||||||
"color-space" : "srgb",
|
"color-space" : "srgb",
|
||||||
"components" : {
|
"components" : {
|
||||||
"alpha" : "1.000",
|
"alpha" : "1.000",
|
||||||
"blue" : "255",
|
"blue" : "175",
|
||||||
"green" : "67",
|
"green" : "4",
|
||||||
"red" : "128"
|
"red" : "115"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
"idiom" : "universal"
|
"idiom" : "universal"
|
||||||
@@ -23,9 +23,9 @@
|
|||||||
"color-space" : "srgb",
|
"color-space" : "srgb",
|
||||||
"components" : {
|
"components" : {
|
||||||
"alpha" : "1.000",
|
"alpha" : "1.000",
|
||||||
"blue" : "103",
|
"blue" : "150",
|
||||||
"green" : "0",
|
"green" : "3",
|
||||||
"red" : "60"
|
"red" : "99"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
"idiom" : "universal"
|
"idiom" : "universal"
|
||||||
|
|||||||
@@ -5,9 +5,9 @@
|
|||||||
"color-space" : "srgb",
|
"color-space" : "srgb",
|
||||||
"components" : {
|
"components" : {
|
||||||
"alpha" : "1.000",
|
"alpha" : "1.000",
|
||||||
"blue" : "103",
|
"blue" : "150",
|
||||||
"green" : "0",
|
"green" : "3",
|
||||||
"red" : "60"
|
"red" : "99"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
"idiom" : "universal"
|
"idiom" : "universal"
|
||||||
@@ -23,9 +23,9 @@
|
|||||||
"color-space" : "srgb",
|
"color-space" : "srgb",
|
||||||
"components" : {
|
"components" : {
|
||||||
"alpha" : "1.000",
|
"alpha" : "1.000",
|
||||||
"blue" : "255",
|
"blue" : "175",
|
||||||
"green" : "67",
|
"green" : "4",
|
||||||
"red" : "128"
|
"red" : "115"
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
"idiom" : "universal"
|
"idiom" : "universal"
|
||||||
|
|||||||
@@ -1,22 +0,0 @@
|
|||||||
{
|
|
||||||
"images" : [
|
|
||||||
{
|
|
||||||
"idiom" : "universal",
|
|
||||||
"scale" : "1x"
|
|
||||||
},
|
|
||||||
{
|
|
||||||
"idiom" : "universal",
|
|
||||||
"filename" : "sound@2x.png",
|
|
||||||
"scale" : "2x"
|
|
||||||
},
|
|
||||||
{
|
|
||||||
"idiom" : "universal",
|
|
||||||
"filename" : "sound@3x.png",
|
|
||||||
"scale" : "3x"
|
|
||||||
}
|
|
||||||
],
|
|
||||||
"info" : {
|
|
||||||
"version" : 1,
|
|
||||||
"author" : "xcode"
|
|
||||||
}
|
|
||||||
}
|
|
||||||