Swift PM switch roxas fork

Signed-off-by: Joseph Mattello <mail@joemattiello.com>

.github/CODEOWNERS

@@ -1 +1 @@
-*       @JoeMatt @lonkelle @jkcoxson
+*       @JoeMatt @lonkelle

.github/ISSUE_TEMPLATE/bug_report.yml

@@ -0,0 +1,40 @@
+name: Bug Report
+description: Report a bug
+title: "[BUG] "
+labels: ["bug"]
+assignees:
+  - naturecodevoid
+body:
+  - type: markdown
+    attributes:
+      value: |
+        Thanks for taking the time to fill out this bug report! Before you continue filling out the report, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the bug you are experiencing** in case it has already been reported.
+        
+        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+  - type: textarea
+    id: description
+    attributes:
+      label: Describe the bug
+      description: What is the bug and how did you discover it?
+      placeholder: Please be clear and concise with your description.
+    validations:
+      required: true
+  - type: textarea
+    id: how-to-reproduce
+    attributes:
+      label: Instructions to reproduce
+      description: Please include clear and consistent instructions for reproducing the bug to make it easier for us to fix it.
+    validations:
+      required: true
+  - type: input
+    id: app-version
+    attributes:
+      label: What version of SideStore are you using?
+      description: To retrieve this, go to `Settings` in the SideStore app and scroll down to the bottom.
+    validations:
+      required: true
+  - type: textarea
+    id: other-info
+    attributes:
+      label: Other info
+      description: If you have any other comments, other info that might be useful, or if you found a workaround, please put it here.

.github/ISSUE_TEMPLATE/config.yml

@@ -0,0 +1,10 @@
+# force issue template usage
+blank_issues_enabled: false
+
+contact_links:
+  - name: Discord
+    url: https://discord.gg/RgpFBX3Q3k
+    about: If you need support, please go here first instead of making an issue!
+  - name: GitHub Discussions
+    url: https://github.com/SideStore/SideStore/discussions
+    about: As an alternative to Discord, you can also make a new GitHub discussion.

.github/ISSUE_TEMPLATE/feature_request.yml

@@ -0,0 +1,33 @@
+name: Feature Request
+description: Suggest a feature
+title: "[FEATURE REQUEST] "
+labels: ["enhancement"]
+assignees:
+  - naturecodevoid
+body:
+  - type: markdown
+    attributes:
+      value: |
+        Thanks for taking the time to fill out this feature request! Before you continue filling out the form, please **[search in GitHub Issues](https://github.com/SideStore/SideStore/issues?q=is%3Aissue+is%3Aopen) for the feature you are suggestion** in case it has already been suggested.
+        
+        **Please use [Discord](https://discord.gg/RgpFBX3Q3k) or [GitHub Discussions](https://github.com/SideStore/SideStore/discussions) for support.**
+  - type: textarea
+    id: description
+    attributes:
+      label: Describe the feature
+      description: What is the feature? How would it work?
+      placeholder: Please be clear and concise with your description.
+    validations:
+      required: true
+  - type: textarea
+    id: use-cases
+    attributes:
+      label: Use cases
+      description: Please include multiple use cases where this feature would be useful.
+    validations:
+      required: true
+  - type: textarea
+    id: alternatives
+    attributes:
+      label: Alternatives
+      description: If you have alternative ideas of how this feature could work, you can put them here.

.github/pull_request_template.md

@@ -0,0 +1,15 @@
+### Changes
+
+<!-- Fill this list with what your PR changes. Example: -->
+- Fix bug
+- Change UI for QOL
+
+<!-- If your PR is ready to be merged, you can remove this section. -->
+### Todo before merge
+
+<!-- Example: -->
+- [x] Finish UI changes
+- [ ] Test
+
+<!-- If your PR doesn't close an issue, you can remove the next line. -->
+Closes #1234

.github/workflows/attach_build_products.yml

@@ -0,0 +1,22 @@
+name: Add artifact links to pull request and related issues
+on:
+  workflow_run:
+    workflows: [Pull Request SideStore build]
+    types: [completed]
+
+jobs:
+  artifacts-url-comments:
+    name: add artifact links to pull request and related issues job
+    runs-on: ubuntu-latest
+    if: ${{ github.event.workflow_run.conclusion == 'success' }}
+    steps:
+      - name: add artifact links to pull request and related issues step
+        uses: tonyhallett/artifacts-url-comments@v1.1.0
+        env:
+            GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+        with:
+            prefix: Builds for this Pull Request are available at
+            suffix: Have a nice day.
+            format: name
+            addTo: pull
+            # addTo: pullandissues

.github/workflows/beta.yml

@@ -0,0 +1,84 @@
+name: Beta SideStore build
+on:
+  push:
+    tags:
+      - '[0-9]+.[0-9]+.[0-9]+-beta.[0-9]+' # example: 1.0.0-beta.1
+
+jobs:
+  build:
+    name: Build and upload SideStore Beta
+    strategy:
+      fail-fast: false
+      matrix:
+        include:
+          - os: 'macos-12'
+            version: '14.2'
+
+    runs-on: ${{ matrix.os }}
+    steps:
+      - name: Checkout code
+        uses: actions/checkout@v2
+        with:
+          submodules: recursive
+
+      - name: Install dependencies
+        run: brew install ldid
+
+      - name: Change version to tag
+        run: sed -e '/MARKETING_VERSION = .*/s/= .*/= ${{ github.ref_name }}/' -i '' Build.xcconfig
+
+      - name: Setup Xcode
+        uses: maxim-lobanov/setup-xcode@v1.4.1
+        with:
+          xcode-version: ${{ matrix.version }}
+
+      - name: Build SideStore
+        run: make build | xcpretty && exit ${PIPESTATUS[0]}
+
+      - name: Fakesign app
+        run: make fakesign
+
+      - name: Convert to IPA
+        run: make ipa
+
+      - name: Upload Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore.ipa
+          path: SideStore.ipa
+
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Get current date
+        id: date
+        run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
+
+      - name: Get current date in AltStore date form
+        id: date_altstore
+        run: echo "date=$(date -u +'%Y-%m-%d')" >> $GITHUB_OUTPUT
+
+      - name: Upload to new beta release
+        uses: softprops/action-gh-release@v1
+        with:
+          token: ${{ secrets.GITHUB_TOKEN }}
+          name: ${{ steps.version.outputs.version }}
+          tag_name: ${{ github.ref_name }}
+          draft: true
+          prerelease: true
+          files: SideStore.ipa
+          body: |
+            <!-- NOTE: to reset SideSource cache, go to `https://apps.sidestore.io/reset-cache/nightly/<sidesource key>`. This is not included in the GitHub Action since it makes draft releases so they can be edited and have a changelog. -->
+            Beta builds are hand-picked builds from development commits that will allow you to try out new features earlier than normal. However, **they might contain bugs and other issues. Use at your own risk!**
+
+            ## Changelog
+            
+            - TODO
+            
+            ## Build Info
+            
+            Built at (UTC): `${{ steps.date.outputs.date }}`
+            Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
+            Commit SHA: `${{ github.sha }}`
+            Version: `${{ steps.version.outputs.version }}`

.github/workflows/build.yml

@@ -1,100 +0,0 @@
-name: Build and Upload SideStore
-on: 
-  push:
-    branches:
-      - master
-      - develop
-  pull_request:
-  
-jobs:
-  build:
-    name: Build and upload SideStore
-    strategy:
-      fail-fast: false
-      matrix:
-        include:
-          - os: 'macos-12'
-            version: '14.0.0'
-    
-    runs-on: ${{ matrix.os }}
-    steps:
-      - name: Checkout code
-        uses: actions/checkout@v2
-        with:
-          submodules: recursive
-
-      - name: Cache rust cargo
-        id: cache-rust-cargo
-        uses: actions/cache@v3
-        env:
-          cache-name: cache-rust-cargo
-        with:
-          path: ~/.cargo
-          key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
-          restore-keys: |
-            ${{ runner.os }}-build-${{ env.cache-name }}-
-            ${{ runner.os }}-build-
-            ${{ runner.os }}-
-
-      - name: Cache rust minimuxer
-        id: cache-rust-minimuxer
-        uses: actions/cache@v3
-        env:
-          cache-name: cache-rust-minimuxer
-        with:
-          path: ./Dependencies/minimuxer/target
-          key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
-          restore-keys: |
-            ${{ runner.os }}-build-${{ env.cache-name }}-
-            ${{ runner.os }}-build-
-            ${{ runner.os }}-
-
-      - name: Cache rust em_proxy
-        id: cache-rust-em_proxy
-        uses: actions/cache@v3
-        env:
-          cache-name: cache-rust-em_proxy
-        with:
-          path: ./Dependencies/em_proxy/target
-          key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
-          restore-keys: |
-            ${{ runner.os }}-build-${{ env.cache-name }}-
-            ${{ runner.os }}-build-
-            ${{ runner.os }}-
-
-      - name: Install dependencies
-        run: brew install ldid
-      - name: Install rustup
-        uses: actions-rs/toolchain@v1
-        with:
-          toolchain: stable
-          override: true
-          target: aarch64-apple-ios
-      - name: Create emotional damage
-        run: cd Dependencies/em_proxy && cargo build --release --target aarch64-apple-ios
-      - name: Build minimuxer
-        run: cd Dependencies/minimuxer && cargo build --release --target aarch64-apple-ios
-      - name: Setup Xcode
-        uses: maxim-lobanov/setup-xcode@v1.4.1
-        with:
-          xcode-version: ${{ matrix.version }}
-      - name: Build SideStore
-        run: |
-          rm -rf ~/Library/Developer/Xcode/DerivedData/
-          rm ./AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved 
-          xcodebuild -project AltStore.xcodeproj -scheme AltStore -sdk iphoneos archive -archivePath ./archive CODE_SIGNING_REQUIRED=NO AD_HOC_CODE_SIGNING_ALLOWED=YES CODE_SIGNING_ALLOWED=NO DEVELOPMENT_TEAM=XYZ0123456 ORG_IDENTIFIER=com.SideStore | xcpretty && exit ${PIPESTATUS[0]}
-      - name: Fakesign app
-        run: | 
-          rm -rf archive.xcarchive/Products/Applications/SideStore.app/Frameworks/AltStoreCore.framework/Frameworks/
-          ldid -SAltStore/Resources/tempEnt.plist archive.xcarchive/Products/Applications/SideStore.app/SideStore
-      - name: Convert to IPA
-        run: | 
-          mkdir Payload
-          mkdir Payload/SideStore.app
-          cp -R archive.xcarchive/Products/Applications/SideStore.app/ Payload/SideStore.app/
-          zip -r SideStore.ipa Payload
-      - name: Upload Artifact
-        uses: actions/upload-artifact@v3.1.0
-        with:
-          name: SideStore.ipa
-          path: SideStore.ipa

.github/workflows/danger.yml

@@ -0,0 +1,13 @@
+name: "Danger Swift"
+on: [pull_request]
+
+jobs:
+  build:
+    name: Danger JS
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v1
+      - name: Danger Swift
+        uses: danger/swift@2.0.3
+    env:
+      GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}

.github/workflows/increase-nightly-build-num.sh

@@ -0,0 +1,28 @@
+#!/usr/bin/env bash
+
+# Ensure we are in root directory
+cd "$(dirname "$0")/../.."
+
+DATE=`date -u +'%Y.%m.%d'`
+BUILD_NUM=1
+
+write() {
+    sed -e "/MARKETING_VERSION = .*/s/$/-nightly.$DATE.$BUILD_NUM/" -i '' Build.xcconfig
+    echo "$DATE,$BUILD_NUM" > .nightly-build-num
+}
+
+if [ ! -f ".nightly-build-num" ]; then
+    write
+    exit 0
+fi
+
+LAST_DATE=`cat .nightly-build-num | perl -n -e '/([^,]*),([^ ]*)$/ && print $1'`
+LAST_BUILD_NUM=`cat .nightly-build-num | perl -n -e '/([^,]*),([^ ]*)$/ && print $2'`
+
+if [[ "$DATE" != "$LAST_DATE" ]]; then
+    write
+else
+    BUILD_NUM=`expr $LAST_BUILD_NUM + 1`
+    write
+fi
+

.github/workflows/nightly.yml

@@ -0,0 +1,94 @@
+name: Nightly SideStore build
+on:
+  push:
+    branches:
+      - develop
+
+jobs:
+  build:
+    name: Build and upload SideStore Nightly
+    concurrency:
+      group: ${{ github.ref }}
+      cancel-in-progress: true
+    strategy:
+      fail-fast: false
+      matrix:
+        include:
+          - os: 'macos-12'
+            version: '14.2'
+
+    runs-on: ${{ matrix.os }}
+    steps:
+      - name: Checkout code
+        uses: actions/checkout@v2
+        with:
+          submodules: recursive
+
+      - name: Install dependencies
+        run: brew install ldid
+
+      - name: Cache .nightly-build-num
+        uses: actions/cache@v3
+        with:
+          path: .nightly-build-num
+          key: nightly-build-num
+
+      - name: Increase nightly build number and set as version
+        run: bash .github/workflows/increase-nightly-build-num.sh
+
+      - name: Setup Xcode
+        uses: maxim-lobanov/setup-xcode@v1.4.1
+        with:
+          xcode-version: ${{ matrix.version }}
+
+      - name: Build SideStore
+        run: make build | xcpretty && exit ${PIPESTATUS[0]}
+
+      - name: Fakesign app
+        run: make fakesign
+
+      - name: Convert to IPA
+        run: make ipa
+
+      - name: Upload Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore.ipa
+          path: SideStore.ipa
+
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Get current date
+        id: date
+        run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
+
+      - name: Get current date in AltStore date form
+        id: date_altstore
+        run: echo "date=$(date -u +'%Y-%m-%d')" >> $GITHUB_OUTPUT
+
+      - name: Upload to nightly release
+        uses: IsaacShelton/update-existing-release@v1.3.1
+        with:
+          token: ${{ secrets.GITHUB_TOKEN }}
+          release: "Nightly"
+          tag: "nightly"
+          prerelease: true
+          files: SideStore.ipa
+          body: |
+            This is an ⚠️ **EXPERIMENTAL** ⚠️ nightly build for commit [${{ github.sha }}](https://github.com/${{ github.repository }}/commit/${{ github.sha }}).
+            
+            Nightly builds are **extremely experimental builds only meant to be used by developers and alpha testers. They often contain bugs and experimental features. Use at your own risk!**
+            
+            If you want to try out new features early but want a lower chance of bugs, you can look at [SideStore Beta](https://github.com/${{ github.repository }}/releases?q=beta).
+            
+            ## Build Info
+            
+            Built at (UTC): `${{ steps.date.outputs.date }}`
+            Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
+            Commit SHA: `${{ github.sha }}`
+            Version: `${{ steps.version.outputs.version }}`
+
+      - name: Reset cache for apps.sidestore.io/nightly
+        run: sleep 10 && curl https://apps.sidestore.io/reset-cache/nightly/${{ secrets.SIDESOURCE_KEY }}

.github/workflows/pr.yml

@@ -0,0 +1,46 @@
+name: Pull Request SideStore build
+on:
+  pull_request:
+
+jobs:
+  build:
+    name: Build and upload SideStore
+    strategy:
+      fail-fast: false
+      matrix:
+        include:
+          - os: 'macos-12'
+            version: '14.2'
+
+    runs-on: ${{ matrix.os }}
+    steps:
+      - name: Checkout code
+        uses: actions/checkout@v2
+        with:
+          submodules: recursive
+
+      - name: Install dependencies
+        run: brew install ldid
+
+      - name: Add PR suffix to version
+        run: sed -e '/MARKETING_VERSION = .*/s/$/-pr.${{ github.event.pull_request.number }}/' -i '' Build.xcconfig
+
+      - name: Setup Xcode
+        uses: maxim-lobanov/setup-xcode@v1.4.1
+        with:
+          xcode-version: ${{ matrix.version }}
+
+      - name: Build SideStore
+        run: make build | xcpretty && exit ${PIPESTATUS[0]}
+
+      - name: Fakesign app
+        run: make fakesign
+
+      - name: Convert to IPA
+        run: make ipa
+
+      - name: Upload Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore.ipa
+          path: SideStore.ipa

.github/workflows/stable.yml

@@ -0,0 +1,81 @@
+name: Stable SideStore build
+on:
+  push:
+    tags:
+      - '[0-9]+.[0-9]+.[0-9]+' # example: 1.0.0
+
+jobs:
+  build:
+    name: Build and upload SideStore
+    strategy:
+      fail-fast: false
+      matrix:
+        include:
+          - os: 'macos-12'
+            version: '14.2'
+
+    runs-on: ${{ matrix.os }}
+    steps:
+      - name: Checkout code
+        uses: actions/checkout@v2
+        with:
+          submodules: recursive
+
+      - name: Install dependencies
+        run: brew install ldid
+
+      - name: Change version to tag
+        run: sed -e '/MARKETING_VERSION = .*/s/= .*/= ${{ github.ref_name }}/' -i '' Build.xcconfig
+
+      - name: Setup Xcode
+        uses: maxim-lobanov/setup-xcode@v1.4.1
+        with:
+          xcode-version: ${{ matrix.version }}
+
+      - name: Build SideStore
+        run: make build | xcpretty && exit ${PIPESTATUS[0]}
+
+      - name: Fakesign app
+        run: make fakesign
+
+      - name: Convert to IPA
+        run: make ipa
+
+      - name: Upload Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore.ipa
+          path: SideStore.ipa
+
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Get current date
+        id: date
+        run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
+
+      - name: Get current date in AltStore date form
+        id: date_altstore
+        run: echo "date=$(date -u +'%Y-%m-%d')" >> $GITHUB_OUTPUT
+
+      - name: Upload to new stable release
+        uses: softprops/action-gh-release@v1
+        with:
+          token: ${{ secrets.GITHUB_TOKEN }}
+          name: ${{ steps.version.outputs.version }}
+          tag_name: ${{ github.ref_name }}
+          draft: true
+          files: SideStore.ipa
+          body: |
+            <!-- NOTE: to reset SideSource cache, go to `https://apps.sidestore.io/reset-cache/nightly/<sidesource key>`. This is not included in the GitHub Action since it makes draft releases so they can be edited and have a changelog. -->
+            ## Changelog
+            
+            - TODO
+            
+            ## Build Info
+            
+            Built at (UTC): `${{ steps.date.outputs.date }}`
+            Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
+            Commit SHA: `${{ github.sha }}`
+            Version: `${{ steps.version.outputs.version }}`

.gitignore

@@ -33,4 +33,14 @@ xcuserdata
 /.vscode
 
 ## AppCode specific
-.idea/
+.idea/
+
+.build
+
+Payload/
+SideStore.ipa
+Dependencies/.*-prebuilt-fetch-*
+Dependencies/minimuxer/*
+Dependencies/em_proxy/*
+!Dependencies/**/.gitkeep
+.nightly-build-num

.gitmodules

@@ -13,12 +13,9 @@
 [submodule "Dependencies/MarkdownAttributedString"]
 	path = Dependencies/MarkdownAttributedString
 	url = https://github.com/chockenberry/MarkdownAttributedString.git
-[submodule "Dependencies/em_proxy"]
-	path = Dependencies/em_proxy
-	url = https://github.com/jkcoxson/em_proxy
 [submodule "Dependencies/libimobiledevice-glue"]
 	path = Dependencies/libimobiledevice-glue
 	url = https://github.com/libimobiledevice/libimobiledevice-glue
-[submodule "Dependencies/minimuxer"]
-	path = Dependencies/minimuxer
-	url = https://github.com/jkcoxson/minimuxer
+[submodule "Dependencies/libfragmentzip"]
+	path = Dependencies/libfragmentzip
+	url = https://github.com/SideStore/libfragmentzip.git

AltBackup/Info.plist

@@ -5,7 +5,7 @@
 	<key>ALTAppGroups</key>
 	<array>
 		<string>group.$(APP_GROUP_IDENTIFIER)</string>
-		<string>group.com.rileytestut.AltStore</string>
+		<string>group.com.SideStore.SideStore</string>
 	</array>
 	<key>ALTBundleIdentifier</key>
 	<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>

AltDaemon/XPCConnectionHandler.swift

@@ -77,7 +77,7 @@ extension XPCConnectionHandler: NSXPCListenerDelegate
         guard
             let codeSigningInfo = signingInfo as? [String: Any],
             let bundleIdentifier = codeSigningInfo["identifier"] as? String,
-            bundleIdentifier.contains("com.rileytestut.AltStore")
+            bundleIdentifier.contains(Bundle.Info.appbundleIdentifier)
         else { return false }
         
         let connection = XPCConnection(newConnection)

AltStore.xcodeproj/project.pbxproj

@@ -7,25 +7,13 @@
 	objects = {
 
 /* Begin PBXBuildFile section */
+		03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF1E314122A05D4C00370A3C /* Bundle+AltStore.swift */; };
 		19104D952909BAEA00C49C7B /* libimobiledevice.a in Frameworks */ = {isa = PBXBuildFile; fileRef = BF45872B2298D31600BD7491 /* libimobiledevice.a */; };
 		19104DB52909C06D00C49C7B /* EmotionalDamage.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19104DB42909C06D00C49C7B /* EmotionalDamage.swift */; };
-		19104DBB2909C11700C49C7B /* libem_proxy.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DA32909BC1000C49C7B /* libem_proxy.a */; };
 		19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 19104DB22909C06C00C49C7B /* libEmotionalDamage.a */; };
 		191E5FAE290A5D92001A3B7C /* minimuxer.swift in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FAD290A5D92001A3B7C /* minimuxer.swift */; };
 		191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FAB290A5D92001A3B7C /* libminimuxer.a */; };
-		191E5FB6290A5E1F001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FB5290A5E1F001A3B7C /* libminimuxer.a */; };
 		191E5FDC290AFA5C001A3B7C /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 191E5FDB290AFA5C001A3B7C /* OpenSSL */; };
-		191E6066290B2DB1001A3B7C /* cbuf.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E605E290B2D6B001A3B7C /* cbuf.c */; };
-		191E6067290B2DB3001A3B7C /* collection.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6060290B2D6B001A3B7C /* collection.c */; };
-		191E6068290B2DB5001A3B7C /* glue.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E605D290B2D6B001A3B7C /* glue.c */; };
-		191E6069290B2DB7001A3B7C /* opack.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6061290B2D6B001A3B7C /* opack.c */; };
-		191E606A290B2DC4001A3B7C /* socket.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6064290B2D6B001A3B7C /* socket.c */; };
-		191E606B290B2DC6001A3B7C /* termcolors.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6065290B2D6B001A3B7C /* termcolors.c */; };
-		191E606C290B2DC8001A3B7C /* thread.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6063290B2D6B001A3B7C /* thread.c */; };
-		191E606D290B2DCA001A3B7C /* tlv.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6062290B2D6B001A3B7C /* tlv.c */; };
-		191E606E290B2DCB001A3B7C /* utils.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E605F290B2D6B001A3B7C /* utils.c */; };
-		191E6075290B2E46001A3B7C /* companion_proxy.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6073290B2E02001A3B7C /* companion_proxy.c */; };
-		191E6076290B2E48001A3B7C /* preboard.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E6074290B2E02001A3B7C /* preboard.c */; };
 		191E607D290B2EA5001A3B7C /* jsmn.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FD0290A651D001A3B7C /* jsmn.c */; };
 		191E607E290B2EA7001A3B7C /* jplist.c in Sources */ = {isa = PBXBuildFile; fileRef = 191E5FCF290A651D001A3B7C /* jplist.c */; };
 		191E6087290C7B50001A3B7C /* libminimuxer.a in Frameworks */ = {isa = PBXBuildFile; fileRef = 191E5FB5290A5E1F001A3B7C /* libminimuxer.a */; };
@@ -33,10 +21,25 @@
 		19B9B7452845E6DF0076EF69 /* SelectTeamViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = 19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */; };
 		4879A95F2861046500FC1BBD /* AltSign in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A95E2861046500FC1BBD /* AltSign */; };
 		4879A9622861049C00FC1BBD /* OpenSSL in Frameworks */ = {isa = PBXBuildFile; productRef = 4879A9612861049C00FC1BBD /* OpenSSL */; };
+		99C4EF4D2979132100CB538D /* SemanticVersion in Frameworks */ = {isa = PBXBuildFile; productRef = 99C4EF4C2979132100CB538D /* SemanticVersion */; };
 		B3146ED2284F581E00BBC3FD /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; };
 		B3146ED3284F581E00BBC3FD /* Roxas.framework in Embed Frameworks */ = {isa = PBXBuildFile; fileRef = B3146ECD284F580500BBC3FD /* Roxas.framework */; settings = {ATTRIBUTES = (CodeSignOnCopy, RemoveHeadersOnCopy, ); }; };
+		B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F894295F7F9B002B1159 /* libfragmentzip.a */; };
+		B33FFBAA295F8F78002259E6 /* preboard.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBA9295F8F78002259E6 /* preboard.c */; };
+		B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */ = {isa = PBXBuildFile; fileRef = B33FFBAB295F8F98002259E6 /* companion_proxy.c */; };
+		B343F858295F6331002B1159 /* libminimuxer_static.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F84C295F6321002B1159 /* libminimuxer_static.a */; };
+		B343F859295F6335002B1159 /* libem_proxy_static.a in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F853295F6323002B1159 /* libem_proxy_static.a */; };
+		B343F86D295F759E002B1159 /* libresolv.tbd in Frameworks */ = {isa = PBXBuildFile; fileRef = B343F86C295F759E002B1159 /* libresolv.tbd */; };
+		B343F87C295F7C5D002B1159 /* opack.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F872295F7C5C002B1159 /* opack.c */; };
+		B343F87D295F7C5D002B1159 /* cbuf.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F873295F7C5C002B1159 /* cbuf.c */; };
+		B343F87E295F7C5D002B1159 /* collection.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F874295F7C5D002B1159 /* collection.c */; };
+		B343F87F295F7C5D002B1159 /* glue.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F875295F7C5D002B1159 /* glue.c */; };
+		B343F880295F7C5D002B1159 /* socket.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F876295F7C5D002B1159 /* socket.c */; };
+		B343F881295F7C5D002B1159 /* termcolors.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F877295F7C5D002B1159 /* termcolors.c */; };
+		B343F883295F7C5D002B1159 /* thread.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F879295F7C5D002B1159 /* thread.c */; };
+		B343F884295F7C5D002B1159 /* utils.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F87A295F7C5D002B1159 /* utils.c */; };
+		B343F885295F7C5D002B1159 /* tlv.c in Sources */ = {isa = PBXBuildFile; fileRef = B343F87B295F7C5D002B1159 /* tlv.c */; };
 		B376FE3E29258C8900E18883 /* OSLog+SideStore.swift in Sources */ = {isa = PBXBuildFile; fileRef = B376FE3D29258C8900E18883 /* OSLog+SideStore.swift */; };
-		B3919A52292DBE5400519575 /* ProgressRing.swift in Sources */ = {isa = PBXBuildFile; fileRef = D504F42528AD72C50014BB5D /* ProgressRing.swift */; };
 		B39575F5284F29E20080B4FF /* Roxas.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = B39575F4284F29E20080B4FF /* Roxas.framework */; };
 		B39F16132918D7C5002E9404 /* Consts.swift in Sources */ = {isa = PBXBuildFile; fileRef = B39F16122918D7C5002E9404 /* Consts.swift */; };
 		B39F16152918D7DA002E9404 /* Consts+Proxy.swift in Sources */ = {isa = PBXBuildFile; fileRef = B39F16142918D7DA002E9404 /* Consts+Proxy.swift */; };
@@ -119,13 +122,10 @@
 		BF4588252298D3AB00BD7491 /* property_list_service.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4587F52298D3AA00BD7491 /* property_list_service.h */; };
 		BF4588262298D3AB00BD7491 /* lockdown.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587F62298D3AB00BD7491 /* lockdown.c */; };
 		BF4588272298D3AB00BD7491 /* service.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4587F72298D3AB00BD7491 /* service.c */; };
-		BF4588332298D3C100BD7491 /* socket.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4588292298D3C000BD7491 /* socket.h */; };
 		BF4588342298D3C100BD7491 /* userpref.h in Headers */ = {isa = PBXBuildFile; fileRef = BF45882A2298D3C000BD7491 /* userpref.h */; };
 		BF4588352298D3C100BD7491 /* userpref.c in Sources */ = {isa = PBXBuildFile; fileRef = BF45882B2298D3C000BD7491 /* userpref.c */; };
 		BF4588362298D3C100BD7491 /* debug.h in Headers */ = {isa = PBXBuildFile; fileRef = BF45882C2298D3C000BD7491 /* debug.h */; };
 		BF45883A2298D3C100BD7491 /* debug.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4588302298D3C000BD7491 /* debug.c */; };
-		BF45883C2298D3C100BD7491 /* utils.h in Headers */ = {isa = PBXBuildFile; fileRef = BF4588322298D3C100BD7491 /* utils.h */; };
-		BF4588402298D3F800BD7491 /* collection.h in Headers */ = {isa = PBXBuildFile; fileRef = BF45883E2298D3F800BD7491 /* collection.h */; };
 		BF4588432298D40000BD7491 /* libusbmuxd.c in Sources */ = {isa = PBXBuildFile; fileRef = BF4588422298D40000BD7491 /* libusbmuxd.c */; };
 		BF4B78FE24B3D1DB008AB4AC /* SceneDelegate.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF4B78FD24B3D1DB008AB4AC /* SceneDelegate.swift */; };
 		BF56D2AC23DF8E170006506D /* FetchAppIDsOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = BF56D2AB23DF8E170006506D /* FetchAppIDsOperation.swift */; };
@@ -322,14 +322,17 @@
 		BFF0B69A2322D7D0007A79E1 /* UIScreen+CompactHeight.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFF0B6992322D7D0007A79E1 /* UIScreen+CompactHeight.swift */; };
 		BFF435D8255CBDAB00DD724F /* ALTApplication+AltStoreApp.swift in Sources */ = {isa = PBXBuildFile; fileRef = BFF435D7255CBDAB00DD724F /* ALTApplication+AltStoreApp.swift */; };
 		BFF615A82510042B00484D3B /* AltStoreCore.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = BF66EE7E2501AE50007EE018 /* AltStoreCore.framework */; };
+		D52C08EE28AEC37A006C4AE5 /* AppVersion.swift in Sources */ = {isa = PBXBuildFile; fileRef = D52C08ED28AEC37A006C4AE5 /* AppVersion.swift */; };
 		D533E8B72727841800A9B5DD /* libAppleArchive.tbd in Frameworks */ = {isa = PBXBuildFile; fileRef = D533E8B62727841800A9B5DD /* libAppleArchive.tbd */; settings = {ATTRIBUTES = (Weak, ); }; };
-		D533E8BC2727BBEE00A9B5DD /* libfragmentzip.a in Frameworks */ = {isa = PBXBuildFile; fileRef = D533E8BB2727BBEE00A9B5DD /* libfragmentzip.a */; };
 		D533E8BE2727BBF800A9B5DD /* libcurl.a in Frameworks */ = {isa = PBXBuildFile; fileRef = D533E8BD2727BBF800A9B5DD /* libcurl.a */; };
+		D54DED1428CBC44B008B27A0 /* ErrorLogTableViewCell.swift in Sources */ = {isa = PBXBuildFile; fileRef = D54DED1328CBC44B008B27A0 /* ErrorLogTableViewCell.swift */; };
 		D55E163728776CB700A627A1 /* ComplicationView.swift in Sources */ = {isa = PBXBuildFile; fileRef = D55E163528776CB000A627A1 /* ComplicationView.swift */; };
 		D57DF638271E32F000677701 /* PatchApp.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = D57DF637271E32F000677701 /* PatchApp.storyboard */; };
 		D57DF63F271E51E400677701 /* ALTAppPatcher.m in Sources */ = {isa = PBXBuildFile; fileRef = D57DF63E271E51E400677701 /* ALTAppPatcher.m */; };
 		D57F2C9126E0070200B9FA39 /* EnableJITOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */; };
 		D57F2C9426E01BC700B9FA39 /* UIDevice+Vibration.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57F2C9326E01BC700B9FA39 /* UIDevice+Vibration.swift */; };
+		D57FE84428C7DB7100216002 /* ErrorLogViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */; };
+		D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */ = {isa = PBXBuildFile; fileRef = D58916FD28C7C55C00E39C8B /* LoggedError.swift */; };
 		D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D593F1932717749A006E82DE /* PatchAppOperation.swift */; };
 		D5CA0C4B280E141900469595 /* ManagedPatron.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4A280E141900469595 /* ManagedPatron.swift */; };
 		D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */; };
@@ -337,6 +340,8 @@
 		D5DAE0962804DF430034D8D4 /* UpdatePatronsOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */; };
 		D5E1E7C128077DE90016FC96 /* FetchTrustedSourcesOperation.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */; };
 		D5F2F6A92720B7C20081CCF5 /* PatchViewController.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5F2F6A82720B7C20081CCF5 /* PatchViewController.swift */; };
+		D5F99A1828D11DB500476A16 /* AltStore10ToAltStore11.xcmappingmodel in Sources */ = {isa = PBXBuildFile; fileRef = D5F99A1728D11DB500476A16 /* AltStore10ToAltStore11.xcmappingmodel */; };
+		D5F99A1A28D12B1400476A16 /* StoreApp10ToStoreApp11Policy.swift in Sources */ = {isa = PBXBuildFile; fileRef = D5F99A1928D12B1400476A16 /* StoreApp10ToStoreApp11Policy.swift */; };
 /* End PBXBuildFile section */
 
 /* Begin PBXContainerItemProxy section */
@@ -382,6 +387,69 @@
 			remoteGlobalIDString = BFADB00319AE7BB80050CF31;
 			remoteInfo = RoxasTests;
 		};
+		B343F84B295F6321002B1159 /* PBXContainerItemProxy */ = {
+			isa = PBXContainerItemProxy;
+			containerPortal = B343F847295F6321002B1159 /* minimuxer.xcodeproj */;
+			proxyType = 2;
+			remoteGlobalIDString = CA609C732349C7AAD9FA67C4;
+			remoteInfo = "minimuxer-staticlib";
+		};
+		B343F852295F6323002B1159 /* PBXContainerItemProxy */ = {
+			isa = PBXContainerItemProxy;
+			containerPortal = B343F84D295F6323002B1159 /* em_proxy.xcodeproj */;
+			proxyType = 2;
+			remoteGlobalIDString = CA60C44C93D7916DE57E6EBD;
+			remoteInfo = "em_proxy-staticlib";
+		};
+		B343F854295F6323002B1159 /* PBXContainerItemProxy */ = {
+			isa = PBXContainerItemProxy;
+			containerPortal = B343F84D295F6323002B1159 /* em_proxy.xcodeproj */;
+			proxyType = 2;
+			remoteGlobalIDString = CA60058A9FBE4D17AF51A7D5;
+			remoteInfo = "run-bin";
+		};
+		B343F86E295F76FD002B1159 /* PBXContainerItemProxy */ = {
+			isa = PBXContainerItemProxy;
+			containerPortal = B343F847295F6321002B1159 /* minimuxer.xcodeproj */;
+			proxyType = 1;
+			remoteGlobalIDString = CA609C732349A560B9642892;
+			remoteInfo = "minimuxer-staticlib";
+		};
+		B343F870295F7704002B1159 /* PBXContainerItemProxy */ = {
+			isa = PBXContainerItemProxy;
+			containerPortal = B343F84D295F6323002B1159 /* em_proxy.xcodeproj */;
+			proxyType = 1;
+			remoteGlobalIDString = CA60C44C93D7A30E3695DD59;
+			remoteInfo = "em_proxy-staticlib";
+		};
+		B343F88D295F7F9B002B1159 /* PBXContainerItemProxy */ = {
+			isa = PBXContainerItemProxy;
+			containerPortal = B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */;
+			proxyType = 2;
+			remoteGlobalIDString = 87B8C3401E0E9C37002F817D;
+			remoteInfo = "fragmentzip-cli-macOS";
+		};
+		B343F88F295F7F9B002B1159 /* PBXContainerItemProxy */ = {
+			isa = PBXContainerItemProxy;
+			containerPortal = B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */;
+			proxyType = 2;
+			remoteGlobalIDString = B315FDB02866CCF8002E243C;
+			remoteInfo = "fragmentzip-cli-iOS";
+		};
+		B343F891295F7F9B002B1159 /* PBXContainerItemProxy */ = {
+			isa = PBXContainerItemProxy;
+			containerPortal = B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */;
+			proxyType = 2;
+			remoteGlobalIDString = B315FDB52866CD91002E243C;
+			remoteInfo = "fragmentzip-macOS";
+		};
+		B343F893295F7F9B002B1159 /* PBXContainerItemProxy */ = {
+			isa = PBXContainerItemProxy;
+			containerPortal = B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */;
+			proxyType = 2;
+			remoteGlobalIDString = B315FDCE2866CDD3002E243C;
+			remoteInfo = "fragmentzip-iOS";
+		};
 		BF66EE832501AE50007EE018 /* PBXContainerItemProxy */ = {
 			isa = PBXContainerItemProxy;
 			containerPortal = BFD247622284B9A500981D42 /* Project object */;
@@ -433,8 +501,6 @@
 /* End PBXCopyFilesBuildPhase section */
 
 /* Begin PBXFileReference section */
-		19104DA32909BC1000C49C7B /* libem_proxy.a */ = {isa = PBXFileReference; lastKnownFileType = archive.ar; name = libem_proxy.a; path = "Dependencies/em_proxy/target/aarch64-apple-ios/debug/libem_proxy.a"; sourceTree = "<group>"; };
-		19104DA92909BC7100C49C7B /* em_proxy.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = em_proxy.h; sourceTree = "<group>"; };
 		19104DB22909C06C00C49C7B /* libEmotionalDamage.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libEmotionalDamage.a; sourceTree = BUILT_PRODUCTS_DIR; };
 		19104DB42909C06D00C49C7B /* EmotionalDamage.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EmotionalDamage.swift; sourceTree = "<group>"; };
 		191E5FAB290A5D92001A3B7C /* libminimuxer.a */ = {isa = PBXFileReference; explicitFileType = archive.ar; includeInIndex = 0; path = libminimuxer.a; sourceTree = BUILT_PRODUCTS_DIR; };
@@ -443,21 +509,24 @@
 		191E5FCF290A651D001A3B7C /* jplist.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jplist.c; path = Dependencies/libplist/src/jplist.c; sourceTree = SOURCE_ROOT; };
 		191E5FD0290A651D001A3B7C /* jsmn.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = jsmn.c; path = Dependencies/libplist/src/jsmn.c; sourceTree = SOURCE_ROOT; };
 		191E5FD1290A651D001A3B7C /* jsmn.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = jsmn.h; path = Dependencies/libplist/src/jsmn.h; sourceTree = SOURCE_ROOT; };
-		191E5FD7290A6EFB001A3B7C /* minimuxer.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; name = minimuxer.h; path = ../Dependencies/minimuxer/minimuxer.h; sourceTree = "<group>"; };
-		191E605D290B2D6B001A3B7C /* glue.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = glue.c; path = "../Dependencies/libimobiledevice-glue/src/glue.c"; sourceTree = "<group>"; };
-		191E605E290B2D6B001A3B7C /* cbuf.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = cbuf.c; path = "../Dependencies/libimobiledevice-glue/src/cbuf.c"; sourceTree = "<group>"; };
-		191E605F290B2D6B001A3B7C /* utils.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = utils.c; path = "../Dependencies/libimobiledevice-glue/src/utils.c"; sourceTree = "<group>"; };
-		191E6060290B2D6B001A3B7C /* collection.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = collection.c; path = "../Dependencies/libimobiledevice-glue/src/collection.c"; sourceTree = "<group>"; };
-		191E6061290B2D6B001A3B7C /* opack.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = opack.c; path = "../Dependencies/libimobiledevice-glue/src/opack.c"; sourceTree = "<group>"; };
-		191E6062290B2D6B001A3B7C /* tlv.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = tlv.c; path = "../Dependencies/libimobiledevice-glue/src/tlv.c"; sourceTree = "<group>"; };
-		191E6063290B2D6B001A3B7C /* thread.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = thread.c; path = "../Dependencies/libimobiledevice-glue/src/thread.c"; sourceTree = "<group>"; };
-		191E6064290B2D6B001A3B7C /* socket.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = socket.c; path = "../Dependencies/libimobiledevice-glue/src/socket.c"; sourceTree = "<group>"; };
-		191E6065290B2D6B001A3B7C /* termcolors.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = termcolors.c; path = "../Dependencies/libimobiledevice-glue/src/termcolors.c"; sourceTree = "<group>"; };
-		191E6073290B2E02001A3B7C /* companion_proxy.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = companion_proxy.c; path = ../Dependencies/libimobiledevice/src/companion_proxy.c; sourceTree = "<group>"; };
-		191E6074290B2E02001A3B7C /* preboard.c */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.c; name = preboard.c; path = ../Dependencies/libimobiledevice/src/preboard.c; sourceTree = "<group>"; };
 		1920B04E2924AC8300744F60 /* Settings.bundle */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.plug-in"; path = Settings.bundle; sourceTree = "<group>"; };
 		19B9B7442845E6DF0076EF69 /* SelectTeamViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SelectTeamViewController.swift; sourceTree = "<group>"; };
 		B3146EC6284F580500BBC3FD /* Roxas.xcodeproj */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.pb-project"; name = Roxas.xcodeproj; path = Dependencies/Roxas/Roxas.xcodeproj; sourceTree = "<group>"; };
+		B33FFBA9295F8F78002259E6 /* preboard.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = preboard.c; path = src/preboard.c; sourceTree = "<group>"; };
+		B33FFBAB295F8F98002259E6 /* companion_proxy.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = companion_proxy.c; path = src/companion_proxy.c; sourceTree = "<group>"; };
+		B343F847295F6321002B1159 /* minimuxer.xcodeproj */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.pb-project"; name = minimuxer.xcodeproj; path = Dependencies/minimuxer.xcodeproj; sourceTree = SOURCE_ROOT; };
+		B343F84D295F6323002B1159 /* em_proxy.xcodeproj */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.pb-project"; name = em_proxy.xcodeproj; path = Dependencies/em_proxy.xcodeproj; sourceTree = SOURCE_ROOT; };
+		B343F86C295F759E002B1159 /* libresolv.tbd */ = {isa = PBXFileReference; lastKnownFileType = "sourcecode.text-based-dylib-definition"; name = libresolv.tbd; path = Platforms/MacOSX.platform/Developer/SDKs/MacOSX13.1.sdk/usr/lib/libresolv.tbd; sourceTree = DEVELOPER_DIR; };
+		B343F872295F7C5C002B1159 /* opack.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = opack.c; sourceTree = "<group>"; };
+		B343F873295F7C5C002B1159 /* cbuf.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = cbuf.c; sourceTree = "<group>"; };
+		B343F874295F7C5D002B1159 /* collection.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = collection.c; sourceTree = "<group>"; };
+		B343F875295F7C5D002B1159 /* glue.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = glue.c; sourceTree = "<group>"; };
+		B343F876295F7C5D002B1159 /* socket.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = socket.c; sourceTree = "<group>"; };
+		B343F877295F7C5D002B1159 /* termcolors.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = termcolors.c; sourceTree = "<group>"; };
+		B343F879295F7C5D002B1159 /* thread.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = thread.c; sourceTree = "<group>"; };
+		B343F87A295F7C5D002B1159 /* utils.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = utils.c; sourceTree = "<group>"; };
+		B343F87B295F7C5D002B1159 /* tlv.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; path = tlv.c; sourceTree = "<group>"; };
+		B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */ = {isa = PBXFileReference; lastKnownFileType = "wrapper.pb-project"; name = libfragmentzip.xcodeproj; path = Dependencies/libfragmentzip/libfragmentzip.xcodeproj; sourceTree = "<group>"; };
 		B376FE3D29258C8900E18883 /* OSLog+SideStore.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = "OSLog+SideStore.swift"; sourceTree = "<group>"; };
 		B39575F4284F29E20080B4FF /* Roxas.framework */ = {isa = PBXFileReference; explicitFileType = wrapper.framework; path = Roxas.framework; sourceTree = BUILT_PRODUCTS_DIR; };
 		B39F16122918D7C5002E9404 /* Consts.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = Consts.swift; sourceTree = "<group>"; };
@@ -552,19 +621,11 @@
 		BF4587F52298D3AA00BD7491 /* property_list_service.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = property_list_service.h; path = Dependencies/libimobiledevice/src/property_list_service.h; sourceTree = SOURCE_ROOT; };
 		BF4587F62298D3AB00BD7491 /* lockdown.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = lockdown.c; path = Dependencies/libimobiledevice/src/lockdown.c; sourceTree = SOURCE_ROOT; };
 		BF4587F72298D3AB00BD7491 /* service.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = service.c; path = Dependencies/libimobiledevice/src/service.c; sourceTree = SOURCE_ROOT; };
-		BF4588292298D3C000BD7491 /* socket.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = socket.h; path = Dependencies/libimobiledevice/common/socket.h; sourceTree = SOURCE_ROOT; };
 		BF45882A2298D3C000BD7491 /* userpref.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = userpref.h; path = Dependencies/libimobiledevice/common/userpref.h; sourceTree = SOURCE_ROOT; };
 		BF45882B2298D3C000BD7491 /* userpref.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = userpref.c; path = Dependencies/libimobiledevice/common/userpref.c; sourceTree = SOURCE_ROOT; };
 		BF45882C2298D3C000BD7491 /* debug.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = debug.h; path = Dependencies/libimobiledevice/common/debug.h; sourceTree = SOURCE_ROOT; };
-		BF45882D2298D3C000BD7491 /* utils.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = utils.c; path = Dependencies/libimobiledevice/common/utils.c; sourceTree = SOURCE_ROOT; };
-		BF45882F2298D3C000BD7491 /* socket.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = socket.c; path = Dependencies/libimobiledevice/common/socket.c; sourceTree = SOURCE_ROOT; };
 		BF4588302298D3C000BD7491 /* debug.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = debug.c; path = Dependencies/libimobiledevice/common/debug.c; sourceTree = SOURCE_ROOT; };
-		BF4588322298D3C100BD7491 /* utils.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = utils.h; path = Dependencies/libimobiledevice/common/utils.h; sourceTree = SOURCE_ROOT; };
-		BF45883E2298D3F800BD7491 /* collection.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = collection.h; path = Dependencies/libusbmuxd/common/collection.h; sourceTree = SOURCE_ROOT; };
-		BF45883F2298D3F800BD7491 /* collection.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = collection.c; path = Dependencies/libusbmuxd/common/collection.c; sourceTree = SOURCE_ROOT; };
 		BF4588422298D40000BD7491 /* libusbmuxd.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = libusbmuxd.c; path = Dependencies/libusbmuxd/src/libusbmuxd.c; sourceTree = SOURCE_ROOT; };
-		BF4588482298D55000BD7491 /* thread.c */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.c; name = thread.c; path = Dependencies/libusbmuxd/common/thread.c; sourceTree = SOURCE_ROOT; };
-		BF4588492298D55000BD7491 /* thread.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; name = thread.h; path = Dependencies/libusbmuxd/common/thread.h; sourceTree = SOURCE_ROOT; };
 		BF4588872298DD3F00BD7491 /* libxml2.tbd */ = {isa = PBXFileReference; lastKnownFileType = "sourcecode.text-based-dylib-definition"; name = libxml2.tbd; path = Platforms/MacOSX.platform/Developer/SDKs/MacOSX10.14.sdk/usr/lib/libxml2.tbd; sourceTree = DEVELOPER_DIR; };
 		BF4B78FD24B3D1DB008AB4AC /* SceneDelegate.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = SceneDelegate.swift; sourceTree = "<group>"; };
 		BF56D2AB23DF8E170006506D /* FetchAppIDsOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = FetchAppIDsOperation.swift; sourceTree = "<group>"; };
@@ -761,17 +822,21 @@
 		BFF7C906257844C900E55F36 /* AltXPCProtocol.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = AltXPCProtocol.h; sourceTree = "<group>"; };
 		BFF7EC4C25081E9300BDE521 /* AltStore 8.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 8.xcdatamodel"; sourceTree = "<group>"; };
 		BFFCFA45248835530077BFCE /* AltDaemon.entitlements */ = {isa = PBXFileReference; lastKnownFileType = text.plist.entitlements; path = AltDaemon.entitlements; sourceTree = "<group>"; };
-		D504F42528AD72C50014BB5D /* ProgressRing.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ProgressRing.swift; sourceTree = "<group>"; };
+		D52C08ED28AEC37A006C4AE5 /* AppVersion.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = AppVersion.swift; sourceTree = "<group>"; };
+		D52E988928D002D30032BE6B /* AltStore 11.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 11.xcdatamodel"; sourceTree = "<group>"; };
 		D533E8B62727841800A9B5DD /* libAppleArchive.tbd */ = {isa = PBXFileReference; lastKnownFileType = "sourcecode.text-based-dylib-definition"; name = libAppleArchive.tbd; path = usr/lib/libAppleArchive.tbd; sourceTree = SDKROOT; };
 		D533E8B82727B61400A9B5DD /* fragmentzip.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = fragmentzip.h; sourceTree = "<group>"; };
 		D533E8BB2727BBEE00A9B5DD /* libfragmentzip.a */ = {isa = PBXFileReference; lastKnownFileType = archive.ar; name = libfragmentzip.a; path = Dependencies/fragmentzip/libfragmentzip.a; sourceTree = SOURCE_ROOT; };
 		D533E8BD2727BBF800A9B5DD /* libcurl.a */ = {isa = PBXFileReference; lastKnownFileType = archive.ar; name = libcurl.a; path = Dependencies/libcurl/libcurl.a; sourceTree = SOURCE_ROOT; };
+		D54DED1328CBC44B008B27A0 /* ErrorLogTableViewCell.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorLogTableViewCell.swift; sourceTree = "<group>"; };
 		D55E163528776CB000A627A1 /* ComplicationView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ComplicationView.swift; sourceTree = "<group>"; };
 		D57DF637271E32F000677701 /* PatchApp.storyboard */ = {isa = PBXFileReference; lastKnownFileType = file.storyboard; path = PatchApp.storyboard; sourceTree = "<group>"; };
 		D57DF63D271E51E400677701 /* ALTAppPatcher.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = ALTAppPatcher.h; sourceTree = "<group>"; };
 		D57DF63E271E51E400677701 /* ALTAppPatcher.m */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.objc; path = ALTAppPatcher.m; sourceTree = "<group>"; };
 		D57F2C9026E0070200B9FA39 /* EnableJITOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = EnableJITOperation.swift; sourceTree = "<group>"; };
 		D57F2C9326E01BC700B9FA39 /* UIDevice+Vibration.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; path = "UIDevice+Vibration.swift"; sourceTree = "<group>"; };
+		D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ErrorLogViewController.swift; sourceTree = "<group>"; };
+		D58916FD28C7C55C00E39C8B /* LoggedError.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = LoggedError.swift; sourceTree = "<group>"; };
 		D593F1932717749A006E82DE /* PatchAppOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchAppOperation.swift; sourceTree = "<group>"; };
 		D5CA0C4A280E141900469595 /* ManagedPatron.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ManagedPatron.swift; sourceTree = "<group>"; };
 		D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcdatamodel; path = "AltStore 10.xcdatamodel"; sourceTree = "<group>"; };
@@ -780,6 +845,8 @@
 		D5DAE0952804DF430034D8D4 /* UpdatePatronsOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = UpdatePatronsOperation.swift; sourceTree = "<group>"; };
 		D5E1E7C028077DE90016FC96 /* FetchTrustedSourcesOperation.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = FetchTrustedSourcesOperation.swift; sourceTree = "<group>"; };
 		D5F2F6A82720B7C20081CCF5 /* PatchViewController.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = PatchViewController.swift; sourceTree = "<group>"; };
+		D5F99A1728D11DB500476A16 /* AltStore10ToAltStore11.xcmappingmodel */ = {isa = PBXFileReference; lastKnownFileType = wrapper.xcmappingmodel; path = AltStore10ToAltStore11.xcmappingmodel; sourceTree = "<group>"; };
+		D5F99A1928D12B1400476A16 /* StoreApp10ToStoreApp11Policy.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = StoreApp10ToStoreApp11Policy.swift; sourceTree = "<group>"; };
 /* End PBXFileReference section */
 
 /* Begin PBXFrameworksBuildPhase section */
@@ -787,7 +854,8 @@
 			isa = PBXFrameworksBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
-				19104DBB2909C11700C49C7B /* libem_proxy.a in Frameworks */,
+				B343F86D295F759E002B1159 /* libresolv.tbd in Frameworks */,
+				B343F859295F6335002B1159 /* libem_proxy_static.a in Frameworks */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -795,7 +863,7 @@
 			isa = PBXFrameworksBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
-				191E5FB6290A5E1F001A3B7C /* libminimuxer.a in Frameworks */,
+				B343F858295F6331002B1159 /* libminimuxer_static.a in Frameworks */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -827,6 +895,7 @@
 			buildActionMask = 2147483647;
 			files = (
 				B3C395F1284F2DE700DA9E2F /* KeychainAccess in Frameworks */,
+				99C4EF4D2979132100CB538D /* SemanticVersion in Frameworks */,
 				4879A95F2861046500FC1BBD /* AltSign in Frameworks */,
 				B39575F5284F29E20080B4FF /* Roxas.framework in Frameworks */,
 			);
@@ -844,6 +913,7 @@
 			isa = PBXFrameworksBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				B33FFBA8295F8E98002259E6 /* libfragmentzip.a in Frameworks */,
 				191E6087290C7B50001A3B7C /* libminimuxer.a in Frameworks */,
 				191E5FB4290A5DA0001A3B7C /* libminimuxer.a in Frameworks */,
 				19104DBC2909C4E500C49C7B /* libEmotionalDamage.a in Frameworks */,
@@ -856,7 +926,6 @@
 				B3C395F4284F35DD00DA9E2F /* Nuke in Frameworks */,
 				BF1614F1250822F100767AEA /* Roxas.framework in Frameworks */,
 				B3C395F7284F362400DA9E2F /* AppCenterAnalytics in Frameworks */,
-				D533E8BC2727BBEE00A9B5DD /* libfragmentzip.a in Frameworks */,
 				BF66EE852501AE50007EE018 /* AltStoreCore.framework in Frameworks */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
@@ -867,7 +936,7 @@
 		19104DB32909C06D00C49C7B /* EmotionalDamage */ = {
 			isa = PBXGroup;
 			children = (
-				19104DA92909BC7100C49C7B /* em_proxy.h */,
+				B343F84D295F6323002B1159 /* em_proxy.xcodeproj */,
 				19104DB42909C06D00C49C7B /* EmotionalDamage.swift */,
 			);
 			path = EmotionalDamage;
@@ -876,7 +945,7 @@
 		191E5FAC290A5D92001A3B7C /* minimuxer */ = {
 			isa = PBXGroup;
 			children = (
-				191E5FD7290A6EFB001A3B7C /* minimuxer.h */,
+				B343F847295F6321002B1159 /* minimuxer.xcodeproj */,
 				191E5FAD290A5D92001A3B7C /* minimuxer.swift */,
 			);
 			path = minimuxer;
@@ -885,17 +954,18 @@
 		191E5FF4290B2663001A3B7C /* libimobiledevice-glue */ = {
 			isa = PBXGroup;
 			children = (
-				191E605E290B2D6B001A3B7C /* cbuf.c */,
-				191E6060290B2D6B001A3B7C /* collection.c */,
-				191E605D290B2D6B001A3B7C /* glue.c */,
-				191E6061290B2D6B001A3B7C /* opack.c */,
-				191E6064290B2D6B001A3B7C /* socket.c */,
-				191E6065290B2D6B001A3B7C /* termcolors.c */,
-				191E6063290B2D6B001A3B7C /* thread.c */,
-				191E6062290B2D6B001A3B7C /* tlv.c */,
-				191E605F290B2D6B001A3B7C /* utils.c */,
+				B343F873295F7C5C002B1159 /* cbuf.c */,
+				B343F874295F7C5D002B1159 /* collection.c */,
+				B343F875295F7C5D002B1159 /* glue.c */,
+				B343F872295F7C5C002B1159 /* opack.c */,
+				B343F876295F7C5D002B1159 /* socket.c */,
+				B343F877295F7C5D002B1159 /* termcolors.c */,
+				B343F879295F7C5D002B1159 /* thread.c */,
+				B343F87B295F7C5D002B1159 /* tlv.c */,
+				B343F87A295F7C5D002B1159 /* utils.c */,
 			);
 			name = "libimobiledevice-glue";
+			path = "libimobiledevice-glue/src";
 			sourceTree = "<group>";
 		};
 		B3146EC7284F580500BBC3FD /* Products */ = {
@@ -908,6 +978,41 @@
 			name = Products;
 			sourceTree = "<group>";
 		};
+		B33FFB8F295F8CF2002259E6 /* Recovered References */ = {
+			isa = PBXGroup;
+			children = (
+			);
+			name = "Recovered References";
+			sourceTree = "<group>";
+		};
+		B343F848295F6321002B1159 /* Products */ = {
+			isa = PBXGroup;
+			children = (
+				B343F84C295F6321002B1159 /* libminimuxer_static.a */,
+			);
+			name = Products;
+			sourceTree = "<group>";
+		};
+		B343F84E295F6323002B1159 /* Products */ = {
+			isa = PBXGroup;
+			children = (
+				B343F853295F6323002B1159 /* libem_proxy_static.a */,
+				B343F855295F6323002B1159 /* run */,
+			);
+			name = Products;
+			sourceTree = "<group>";
+		};
+		B343F887295F7F9B002B1159 /* Products */ = {
+			isa = PBXGroup;
+			children = (
+				B343F88E295F7F9B002B1159 /* libfragmentzip */,
+				B343F890295F7F9B002B1159 /* libfragmentzip */,
+				B343F892295F7F9B002B1159 /* libfragmentzip.a */,
+				B343F894295F7F9B002B1159 /* libfragmentzip.a */,
+			);
+			name = Products;
+			sourceTree = "<group>";
+		};
 		B39F16112918D7B5002E9404 /* Consts */ = {
 			isa = PBXGroup;
 			children = (
@@ -991,78 +1096,75 @@
 				BF4587972298D36400BD7491 /* libimobiledevice */,
 				BF45883D2298D3E800BD7491 /* libusbmuxd */,
 			);
-			path = libimobiledevice;
+			name = libimobiledevice;
+			path = Dependencies;
 			sourceTree = "<group>";
 		};
 		BF4587972298D36400BD7491 /* libimobiledevice */ = {
 			isa = PBXGroup;
 			children = (
-				BF4588282298D3B400BD7491 /* common */,
 				BF4587D72298D3A800BD7491 /* afc.c */,
-				BF4587EC2298D3AA00BD7491 /* afc.h */,
+				B33FFBAB295F8F98002259E6 /* companion_proxy.c */,
 				BF4587DF2298D3A900BD7491 /* debugserver.c */,
-				BF4587DE2298D3A900BD7491 /* debugserver.h */,
 				BF4587E42298D3A900BD7491 /* device_link_service.c */,
-				191E6073290B2E02001A3B7C /* companion_proxy.c */,
-				191E6074290B2E02001A3B7C /* preboard.c */,
-				BF4587EF2298D3AA00BD7491 /* device_link_service.h */,
 				BF4587C92298D3A800BD7491 /* diagnostics_relay.c */,
-				BF4587CA2298D3A800BD7491 /* diagnostics_relay.h */,
 				BF4587D22298D3A800BD7491 /* file_relay.c */,
-				BF4587ED2298D3AA00BD7491 /* file_relay.h */,
 				BF4587CF2298D3A800BD7491 /* heartbeat.c */,
-				BF4587E02298D3A900BD7491 /* heartbeat.h */,
 				BF4587EB2298D3AA00BD7491 /* house_arrest.c */,
-				BF4587E22298D3A900BD7491 /* house_arrest.h */,
 				BF4587F12298D3AA00BD7491 /* idevice.c */,
-				BF4587D52298D3A800BD7491 /* idevice.h */,
 				BF4587D92298D3A900BD7491 /* installation_proxy.c */,
-				BF4587D12298D3A800BD7491 /* installation_proxy.h */,
 				BF4587F62298D3AB00BD7491 /* lockdown.c */,
-				BF4587D42298D3A800BD7491 /* lockdown.h */,
 				BF4587EE2298D3AA00BD7491 /* misagent.c */,
-				BF4587E12298D3A900BD7491 /* misagent.h */,
 				BF4587D82298D3A800BD7491 /* mobile_image_mounter.c */,
-				BF4587F02298D3AA00BD7491 /* mobile_image_mounter.h */,
 				BF4587F22298D3AA00BD7491 /* mobileactivation.c */,
-				BF4587EA2298D3AA00BD7491 /* mobileactivation.h */,
 				BF4587DD2298D3A900BD7491 /* mobilebackup.c */,
-				BF4587E52298D3A900BD7491 /* mobilebackup.h */,
 				BF4587DC2298D3A900BD7491 /* mobilebackup2.c */,
-				BF4587CE2298D3A800BD7491 /* mobilebackup2.h */,
 				BF4587F32298D3AA00BD7491 /* mobilesync.c */,
-				BF4587DB2298D3A900BD7491 /* mobilesync.h */,
 				BF4587CB2298D3A800BD7491 /* notification_proxy.c */,
-				BF4587E32298D3A900BD7491 /* notification_proxy.h */,
+				B33FFBA9295F8F78002259E6 /* preboard.c */,
 				BF4587F42298D3AA00BD7491 /* property_list_service.c */,
-				BF4587F52298D3AA00BD7491 /* property_list_service.h */,
 				BF4587E62298D3A900BD7491 /* restore.c */,
-				BF4587D02298D3A800BD7491 /* restore.h */,
 				BF4587CC2298D3A800BD7491 /* sbservices.c */,
-				BF4587CD2298D3A800BD7491 /* sbservices.h */,
 				BF4587E72298D3A900BD7491 /* screenshotr.c */,
-				BF4587DA2298D3A900BD7491 /* screenshotr.h */,
 				BF4587F72298D3AB00BD7491 /* service.c */,
-				BF4587C82298D3A800BD7491 /* service.h */,
 				BF4587D32298D3A800BD7491 /* syslog_relay.c */,
-				BF4587E82298D3A900BD7491 /* syslog_relay.h */,
 				BF4587D62298D3A800BD7491 /* webinspector.c */,
+				BF4587EC2298D3AA00BD7491 /* afc.h */,
+				BF4587DE2298D3A900BD7491 /* debugserver.h */,
+				BF4587EF2298D3AA00BD7491 /* device_link_service.h */,
+				BF4587CA2298D3A800BD7491 /* diagnostics_relay.h */,
+				BF4587ED2298D3AA00BD7491 /* file_relay.h */,
+				BF4587E02298D3A900BD7491 /* heartbeat.h */,
+				BF4587E22298D3A900BD7491 /* house_arrest.h */,
+				BF4587D52298D3A800BD7491 /* idevice.h */,
+				BF4587D12298D3A800BD7491 /* installation_proxy.h */,
+				BF4587D42298D3A800BD7491 /* lockdown.h */,
+				BF4587E12298D3A900BD7491 /* misagent.h */,
+				BF4587F02298D3AA00BD7491 /* mobile_image_mounter.h */,
+				BF4587EA2298D3AA00BD7491 /* mobileactivation.h */,
+				BF4587E52298D3A900BD7491 /* mobilebackup.h */,
+				BF4587CE2298D3A800BD7491 /* mobilebackup2.h */,
+				BF4587DB2298D3A900BD7491 /* mobilesync.h */,
+				BF4587E32298D3A900BD7491 /* notification_proxy.h */,
+				BF4587F52298D3AA00BD7491 /* property_list_service.h */,
+				BF4587D02298D3A800BD7491 /* restore.h */,
+				BF4587CD2298D3A800BD7491 /* sbservices.h */,
+				BF4587DA2298D3A900BD7491 /* screenshotr.h */,
+				BF4587C82298D3A800BD7491 /* service.h */,
+				BF4587E82298D3A900BD7491 /* syslog_relay.h */,
 				BF4587E92298D3AA00BD7491 /* webinspector.h */,
+				BF4588282298D3B400BD7491 /* common */,
 			);
-			name = libimobiledevice;
+			path = libimobiledevice;
 			sourceTree = "<group>";
 		};
 		BF4588282298D3B400BD7491 /* common */ = {
 			isa = PBXGroup;
 			children = (
 				BF4588302298D3C000BD7491 /* debug.c */,
-				BF45882C2298D3C000BD7491 /* debug.h */,
-				BF45882F2298D3C000BD7491 /* socket.c */,
-				BF4588292298D3C000BD7491 /* socket.h */,
 				BF45882B2298D3C000BD7491 /* userpref.c */,
+				BF45882C2298D3C000BD7491 /* debug.h */,
 				BF45882A2298D3C000BD7491 /* userpref.h */,
-				BF45882D2298D3C000BD7491 /* utils.c */,
-				BF4588322298D3C100BD7491 /* utils.h */,
 			);
 			name = common;
 			sourceTree = "<group>";
@@ -1071,51 +1173,47 @@
 			isa = PBXGroup;
 			children = (
 				BF4588422298D40000BD7491 /* libusbmuxd.c */,
-				BF45883F2298D3F800BD7491 /* collection.c */,
-				BF45883E2298D3F800BD7491 /* collection.h */,
-				BF4588482298D55000BD7491 /* thread.c */,
-				BF4588492298D55000BD7491 /* thread.h */,
 			);
-			name = libusbmuxd;
+			path = libusbmuxd;
 			sourceTree = "<group>";
 		};
 		BF4588562298DC6D00BD7491 /* libplist */ = {
 			isa = PBXGroup;
 			children = (
-				BF4588892298DDEA00BD7491 /* libcnary */,
-				BFD52BF822A1A9CB000B7ED1 /* Array.cpp */,
 				BFD52BE622A1A9CA000B7ED1 /* base64.c */,
-				BFD52BF622A1A9CA000B7ED1 /* base64.h */,
-				BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */,
-				191E5FD1290A651D001A3B7C /* jsmn.h */,
-				191E5FD0290A651D001A3B7C /* jsmn.c */,
-				191E5FCF290A651D001A3B7C /* jplist.c */,
 				BFD52BEA22A1A9CA000B7ED1 /* bplist.c */,
 				BFD52BF522A1A9CA000B7ED1 /* bytearray.c */,
-				BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */,
+				BFD52BE722A1A9CA000B7ED1 /* hashtable.c */,
+				191E5FCF290A651D001A3B7C /* jplist.c */,
+				191E5FD0290A651D001A3B7C /* jsmn.c */,
+				BFD52BEE22A1A9CA000B7ED1 /* plist.c */,
+				BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */,
+				BFD52BEC22A1A9CA000B7ED1 /* time64.c */,
+				BFD52C0022A1A9CB000B7ED1 /* xplist.c */,
+				BFD52BF822A1A9CB000B7ED1 /* Array.cpp */,
+				BFD52BF222A1A9CA000B7ED1 /* Boolean.cpp */,
 				BFD52BF722A1A9CA000B7ED1 /* Data.cpp */,
 				BFD52BF022A1A9CA000B7ED1 /* Date.cpp */,
 				BFD52BE822A1A9CA000B7ED1 /* Dictionary.cpp */,
-				BFD52BE722A1A9CA000B7ED1 /* hashtable.c */,
-				BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */,
 				BFD52BFC22A1A9CB000B7ED1 /* Integer.cpp */,
 				BFD52BFB22A1A9CB000B7ED1 /* Key.cpp */,
 				BFD52BF922A1A9CB000B7ED1 /* Node.cpp */,
-				BFD52BEE22A1A9CA000B7ED1 /* plist.c */,
-				BFD52BED22A1A9CA000B7ED1 /* plist.h */,
-				BFD52BE522A1A9CA000B7ED1 /* ptrarray.c */,
-				BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */,
 				BFD52BF322A1A9CA000B7ED1 /* Real.cpp */,
-				BFD52BF422A1A9CA000B7ED1 /* strbuf.h */,
 				BFD52BEB22A1A9CA000B7ED1 /* String.cpp */,
 				BFD52BFD22A1A9CB000B7ED1 /* Structure.cpp */,
-				BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */,
-				BFD52BEC22A1A9CA000B7ED1 /* time64.c */,
-				BFD52BFF22A1A9CB000B7ED1 /* time64.h */,
 				BFD52BF122A1A9CA000B7ED1 /* Uid.cpp */,
-				BFD52C0022A1A9CB000B7ED1 /* xplist.c */,
+				BFD52BF622A1A9CA000B7ED1 /* base64.h */,
+				BFD52BFA22A1A9CB000B7ED1 /* bytearray.h */,
+				BFD52BEF22A1A9CA000B7ED1 /* hashtable.h */,
+				191E5FD1290A651D001A3B7C /* jsmn.h */,
+				BFD52BED22A1A9CA000B7ED1 /* plist.h */,
+				BFD52BE922A1A9CA000B7ED1 /* ptrarray.h */,
+				BFD52BF422A1A9CA000B7ED1 /* strbuf.h */,
+				BFD52BFE22A1A9CB000B7ED1 /* time64_limits.h */,
+				BFD52BFF22A1A9CB000B7ED1 /* time64.h */,
+				BF4588892298DDEA00BD7491 /* libcnary */,
 			);
-			name = libplist;
+			path = libplist;
 			sourceTree = "<group>";
 		};
 		BF4588892298DDEA00BD7491 /* libcnary */ = {
@@ -1217,9 +1315,11 @@
 				BF66EEC92501AECA007EE018 /* Account.swift */,
 				BF66EEC72501AECA007EE018 /* AppID.swift */,
 				BF66EEC62501AECA007EE018 /* AppPermission.swift */,
+				D52C08ED28AEC37A006C4AE5 /* AppVersion.swift */,
 				BF66EECA2501AECA007EE018 /* DatabaseManager.swift */,
 				BF66EEC02501AECA007EE018 /* InstalledApp.swift */,
 				BF66EECB2501AECA007EE018 /* InstalledExtension.swift */,
+				D58916FD28C7C55C00E39C8B /* LoggedError.swift */,
 				BF66EEC52501AECA007EE018 /* MergePolicy.swift */,
 				BF66EEBF2501AECA007EE018 /* NewsItem.swift */,
 				BF66EEC82501AECA007EE018 /* PatreonAccount.swift */,
@@ -1247,6 +1347,7 @@
 			isa = PBXGroup;
 			children = (
 				BF66EEAE2501AECA007EE018 /* StoreAppPolicy.swift */,
+				D5F99A1928D12B1400476A16 /* StoreApp10ToStoreApp11Policy.swift */,
 				BF66EEAF2501AECA007EE018 /* InstalledAppPolicy.swift */,
 			);
 			path = Policies;
@@ -1263,6 +1364,7 @@
 				BF66EEB62501AECA007EE018 /* AltStore5ToAltStore6.xcmappingmodel */,
 				BFBF331A2526762200B7B8C9 /* AltStore8ToAltStore9.xcmappingmodel */,
 				D5CA0C4D280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel */,
+				D5F99A1728D11DB500476A16 /* AltStore10ToAltStore11.xcmappingmodel */,
 			);
 			path = "Mapping Models";
 			sourceTree = "<group>";
@@ -1321,7 +1423,6 @@
 				BF42345825101C1D006D1EB2 /* WidgetView.swift */,
 				BF98917C250AAC4F002ACF50 /* Countdown.swift */,
 				D55E163528776CB000A627A1 /* ComplicationView.swift */,
-				D504F42528AD72C50014BB5D /* ProgressRing.swift */,
 				BF989170250AABF4002ACF50 /* Assets.xcassets */,
 				BF989172250AABF4002ACF50 /* Info.plist */,
 			);
@@ -1406,9 +1507,11 @@
 				BF98916C250AABF3002ACF50 /* AltWidget */,
 				19104DB32909C06D00C49C7B /* EmotionalDamage */,
 				191E5FAC290A5D92001A3B7C /* minimuxer */,
+				B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */,
 				BFD247852284BB3300981D42 /* Frameworks */,
 				B3146EC6284F580500BBC3FD /* Roxas.xcodeproj */,
 				BFD2476B2284B9A500981D42 /* Products */,
+				B33FFB8F295F8CF2002259E6 /* Recovered References */,
 			);
 			sourceTree = "<group>";
 		};
@@ -1463,8 +1566,8 @@
 		BFD247852284BB3300981D42 /* Frameworks */ = {
 			isa = PBXGroup;
 			children = (
+				B343F86C295F759E002B1159 /* libresolv.tbd */,
 				191E5FB5290A5E1F001A3B7C /* libminimuxer.a */,
-				19104DA32909BC1000C49C7B /* libem_proxy.a */,
 				B39575F4284F29E20080B4FF /* Roxas.framework */,
 				D533E8B62727841800A9B5DD /* libAppleArchive.tbd */,
 				BF580497246A3D19008AE704 /* UIKit.framework */,
@@ -1549,6 +1652,7 @@
 				BFF0B68F23219C6D007A79E1 /* PatreonComponents.swift */,
 				BFF0B6912321A305007A79E1 /* AboutPatreonHeaderView.xib */,
 				BFF0B695232242D3007A79E1 /* LicensesViewController.swift */,
+				D589170128C7D93500E39C8B /* Error Log */,
 				B3EE16B52925E27D00B3B1F5 /* AnisetteManager.swift */,
 			);
 			path = Settings;
@@ -1650,6 +1754,15 @@
 			path = XPC;
 			sourceTree = "<group>";
 		};
+		D589170128C7D93500E39C8B /* Error Log */ = {
+			isa = PBXGroup;
+			children = (
+				D57FE84328C7DB7100216002 /* ErrorLogViewController.swift */,
+				D54DED1328CBC44B008B27A0 /* ErrorLogTableViewCell.swift */,
+			);
+			path = "Error Log";
+			sourceTree = "<group>";
+		};
 /* End PBXGroup section */
 
 /* Begin PBXHeadersBuildPhase section */
@@ -1666,10 +1779,8 @@
 			files = (
 				BF4588112298D3AB00BD7491 /* misagent.h in Headers */,
 				BF4588042298D3AB00BD7491 /* lockdown.h in Headers */,
-				BF4588402298D3F800BD7491 /* collection.h in Headers */,
 				BF45880B2298D3AB00BD7491 /* mobilesync.h in Headers */,
 				BF4588002298D3AB00BD7491 /* restore.h in Headers */,
-				BF4588332298D3C100BD7491 /* socket.h in Headers */,
 				BF4588152298D3AB00BD7491 /* mobilebackup.h in Headers */,
 				BF4588182298D3AB00BD7491 /* syslog_relay.h in Headers */,
 				BFD52C1022A1A9CB000B7ED1 /* strbuf.h in Headers */,
@@ -1689,7 +1800,6 @@
 				BF4588192298D3AB00BD7491 /* webinspector.h in Headers */,
 				BF4588342298D3C100BD7491 /* userpref.h in Headers */,
 				BF45880A2298D3AB00BD7491 /* screenshotr.h in Headers */,
-				BF45883C2298D3C100BD7491 /* utils.h in Headers */,
 				BFD52C0B22A1A9CB000B7ED1 /* hashtable.h in Headers */,
 				BF4587FE2298D3AB00BD7491 /* mobilebackup2.h in Headers */,
 				BFD52C0522A1A9CB000B7ED1 /* ptrarray.h in Headers */,
@@ -1732,6 +1842,7 @@
 			buildRules = (
 			);
 			dependencies = (
+				B343F871295F7704002B1159 /* PBXTargetDependency */,
 			);
 			name = EmotionalDamage;
 			productName = EmotionalDamage;
@@ -1749,6 +1860,7 @@
 			buildRules = (
 			);
 			dependencies = (
+				B343F86F295F76FD002B1159 /* PBXTargetDependency */,
 			);
 			name = minimuxer;
 			productName = minimuxer;
@@ -1823,11 +1935,13 @@
 			buildRules = (
 			);
 			dependencies = (
+				99C4EF51297994E200CB538D /* PBXTargetDependency */,
 			);
 			name = AltStoreCore;
 			packageProductDependencies = (
 				B3C395F0284F2DE700DA9E2F /* KeychainAccess */,
 				4879A95E2861046500FC1BBD /* AltSign */,
+				99C4EF4C2979132100CB538D /* SemanticVersion */,
 			);
 			productName = AltStoreCore;
 			productReference = BF66EE7E2501AE50007EE018 /* AltStoreCore.framework */;
@@ -1946,10 +2060,23 @@
 				B3C395FD284F3C0900DA9E2F /* XCRemoteSwiftPackageReference "STPrivilegedTask" */,
 				4879A95D2861046500FC1BBD /* XCRemoteSwiftPackageReference "AltSign" */,
 				4879A9602861049C00FC1BBD /* XCRemoteSwiftPackageReference "OpenSSL" */,
+				99C4EF472978D52400CB538D /* XCRemoteSwiftPackageReference "SemanticVersion" */,
 			);
 			productRefGroup = BFD2476B2284B9A500981D42 /* Products */;
 			projectDirPath = "";
 			projectReferences = (
+				{
+					ProductGroup = B343F84E295F6323002B1159 /* Products */;
+					ProjectRef = B343F84D295F6323002B1159 /* em_proxy.xcodeproj */;
+				},
+				{
+					ProductGroup = B343F887295F7F9B002B1159 /* Products */;
+					ProjectRef = B343F886295F7F9B002B1159 /* libfragmentzip.xcodeproj */;
+				},
+				{
+					ProductGroup = B343F848295F6321002B1159 /* Products */;
+					ProjectRef = B343F847295F6321002B1159 /* minimuxer.xcodeproj */;
+				},
 				{
 					ProductGroup = B3146EC7284F580500BBC3FD /* Products */;
 					ProjectRef = B3146EC6284F580500BBC3FD /* Roxas.xcodeproj */;
@@ -1991,6 +2118,55 @@
 			remoteRef = B3146ED0284F580500BBC3FD /* PBXContainerItemProxy */;
 			sourceTree = BUILT_PRODUCTS_DIR;
 		};
+		B343F84C295F6321002B1159 /* libminimuxer_static.a */ = {
+			isa = PBXReferenceProxy;
+			fileType = archive.ar;
+			path = libminimuxer_static.a;
+			remoteRef = B343F84B295F6321002B1159 /* PBXContainerItemProxy */;
+			sourceTree = BUILT_PRODUCTS_DIR;
+		};
+		B343F853295F6323002B1159 /* libem_proxy_static.a */ = {
+			isa = PBXReferenceProxy;
+			fileType = archive.ar;
+			path = libem_proxy_static.a;
+			remoteRef = B343F852295F6323002B1159 /* PBXContainerItemProxy */;
+			sourceTree = BUILT_PRODUCTS_DIR;
+		};
+		B343F855295F6323002B1159 /* run */ = {
+			isa = PBXReferenceProxy;
+			fileType = "compiled.mach-o.executable";
+			path = run;
+			remoteRef = B343F854295F6323002B1159 /* PBXContainerItemProxy */;
+			sourceTree = BUILT_PRODUCTS_DIR;
+		};
+		B343F88E295F7F9B002B1159 /* libfragmentzip */ = {
+			isa = PBXReferenceProxy;
+			fileType = "compiled.mach-o.executable";
+			path = libfragmentzip;
+			remoteRef = B343F88D295F7F9B002B1159 /* PBXContainerItemProxy */;
+			sourceTree = BUILT_PRODUCTS_DIR;
+		};
+		B343F890295F7F9B002B1159 /* libfragmentzip */ = {
+			isa = PBXReferenceProxy;
+			fileType = "compiled.mach-o.executable";
+			path = libfragmentzip;
+			remoteRef = B343F88F295F7F9B002B1159 /* PBXContainerItemProxy */;
+			sourceTree = BUILT_PRODUCTS_DIR;
+		};
+		B343F892295F7F9B002B1159 /* libfragmentzip.a */ = {
+			isa = PBXReferenceProxy;
+			fileType = archive.ar;
+			path = libfragmentzip.a;
+			remoteRef = B343F891295F7F9B002B1159 /* PBXContainerItemProxy */;
+			sourceTree = BUILT_PRODUCTS_DIR;
+		};
+		B343F894295F7F9B002B1159 /* libfragmentzip.a */ = {
+			isa = PBXReferenceProxy;
+			fileType = archive.ar;
+			path = libfragmentzip.a;
+			remoteRef = B343F893295F7F9B002B1159 /* PBXContainerItemProxy */;
+			sourceTree = BUILT_PRODUCTS_DIR;
+		};
 /* End PBXReferenceProxy section */
 
 /* Begin PBXResourcesBuildPhase section */
@@ -2093,22 +2269,11 @@
 				BFD52C0622A1A9CB000B7ED1 /* bplist.c in Sources */,
 				BF4588232298D3AB00BD7491 /* mobilesync.c in Sources */,
 				BF4588072298D3AB00BD7491 /* afc.c in Sources */,
-				191E6066290B2DB1001A3B7C /* cbuf.c in Sources */,
 				191E607D290B2EA5001A3B7C /* jsmn.c in Sources */,
-				191E6067290B2DB3001A3B7C /* collection.c in Sources */,
-				191E6075290B2E46001A3B7C /* companion_proxy.c in Sources */,
 				191E607E290B2EA7001A3B7C /* jplist.c in Sources */,
-				191E6076290B2E48001A3B7C /* preboard.c in Sources */,
 				BF4588082298D3AB00BD7491 /* mobile_image_mounter.c in Sources */,
-				191E6068290B2DB5001A3B7C /* glue.c in Sources */,
 				BFD52C1122A1A9CB000B7ED1 /* bytearray.c in Sources */,
 				BF4588022298D3AB00BD7491 /* file_relay.c in Sources */,
-				191E6069290B2DB7001A3B7C /* opack.c in Sources */,
-				191E606A290B2DC4001A3B7C /* socket.c in Sources */,
-				191E606E290B2DCB001A3B7C /* utils.c in Sources */,
-				191E606B290B2DC6001A3B7C /* termcolors.c in Sources */,
-				191E606C290B2DC8001A3B7C /* thread.c in Sources */,
-				191E606D290B2DCA001A3B7C /* tlv.c in Sources */,
 				BF45880F2298D3AB00BD7491 /* debugserver.c in Sources */,
 				BF4588162298D3AB00BD7491 /* restore.c in Sources */,
 				BFD52C0422A1A9CB000B7ED1 /* Dictionary.cpp in Sources */,
@@ -2119,25 +2284,36 @@
 				BF4588222298D3AB00BD7491 /* mobileactivation.c in Sources */,
 				BFD52C1822A1A9CB000B7ED1 /* Integer.cpp in Sources */,
 				BF4588212298D3AB00BD7491 /* idevice.c in Sources */,
+				B343F885295F7C5D002B1159 /* tlv.c in Sources */,
 				BFD52C1C22A1A9CB000B7ED1 /* xplist.c in Sources */,
 				BF4587F92298D3AB00BD7491 /* diagnostics_relay.c in Sources */,
+				B343F87D295F7C5D002B1159 /* cbuf.c in Sources */,
 				BF4588062298D3AB00BD7491 /* webinspector.c in Sources */,
 				BFD52C1722A1A9CB000B7ED1 /* Key.cpp in Sources */,
+				B343F883295F7C5D002B1159 /* thread.c in Sources */,
 				BF45880D2298D3AB00BD7491 /* mobilebackup.c in Sources */,
 				BFD52C0C22A1A9CB000B7ED1 /* Date.cpp in Sources */,
 				BFD52C0A22A1A9CB000B7ED1 /* plist.c in Sources */,
 				BFD52C1322A1A9CB000B7ED1 /* Data.cpp in Sources */,
 				BF45883A2298D3C100BD7491 /* debug.c in Sources */,
+				B343F881295F7C5D002B1159 /* termcolors.c in Sources */,
+				B343F87E295F7C5D002B1159 /* collection.c in Sources */,
 				BFD52C0F22A1A9CB000B7ED1 /* Real.cpp in Sources */,
+				B33FFBAA295F8F78002259E6 /* preboard.c in Sources */,
+				B33FFBAC295F8F98002259E6 /* companion_proxy.c in Sources */,
 				BF4587FB2298D3AB00BD7491 /* notification_proxy.c in Sources */,
 				BF4588352298D3C100BD7491 /* userpref.c in Sources */,
 				BFD52C0122A1A9CB000B7ED1 /* ptrarray.c in Sources */,
+				B343F87C295F7C5D002B1159 /* opack.c in Sources */,
 				BFD52C0E22A1A9CB000B7ED1 /* Boolean.cpp in Sources */,
 				BFD52C0822A1A9CB000B7ED1 /* time64.c in Sources */,
+				B343F884295F7C5D002B1159 /* utils.c in Sources */,
 				BFD52C2122A1A9EC000B7ED1 /* node_list.c in Sources */,
+				B343F87F295F7C5D002B1159 /* glue.c in Sources */,
 				BFD52C1422A1A9CB000B7ED1 /* Array.cpp in Sources */,
 				BF4588242298D3AB00BD7491 /* property_list_service.c in Sources */,
 				BF45881E2298D3AB00BD7491 /* misagent.c in Sources */,
+				B343F880295F7C5D002B1159 /* socket.c in Sources */,
 				BF4587FC2298D3AB00BD7491 /* sbservices.c in Sources */,
 				BFD52C1522A1A9CB000B7ED1 /* Node.cpp in Sources */,
 				BF4588142298D3AB00BD7491 /* device_link_service.c in Sources */,
@@ -2162,6 +2338,7 @@
 				BF580496246A3CB5008AE704 /* UIColor+AltBackup.swift in Sources */,
 				BF580482246A28F7008AE704 /* ViewController.swift in Sources */,
 				BF44EEF0246B08BA002A52F2 /* BackupController.swift in Sources */,
+				03F06CD52942C27E001C4D68 /* Bundle+AltStore.swift in Sources */,
 				BF58049B246A432D008AE704 /* NSError+AltStore.swift in Sources */,
 				BF58047E246A28F7008AE704 /* AppDelegate.swift in Sources */,
 			);
@@ -2197,11 +2374,13 @@
 				BF66EECF2501AECA007EE018 /* AltStoreToAltStore2.xcmappingmodel in Sources */,
 				BF66EEA82501AEC5007EE018 /* Patron.swift in Sources */,
 				BF66EEDD2501AECA007EE018 /* AppPermission.swift in Sources */,
+				D58916FE28C7C55C00E39C8B /* LoggedError.swift in Sources */,
 				BFBF331B2526762200B7B8C9 /* AltStore8ToAltStore9.xcmappingmodel in Sources */,
 				D5CA0C4E280E249E00469595 /* AltStore9ToAltStore10.xcmappingmodel in Sources */,
 				BF989184250AACFC002ACF50 /* Date+RelativeDate.swift in Sources */,
 				BF66EE962501AEBC007EE018 /* ALTPatreonBenefitType.m in Sources */,
 				BFAECC5A2501B0A400528F27 /* NetworkConnection.swift in Sources */,
+				D5F99A1828D11DB500476A16 /* AltStore10ToAltStore11.xcmappingmodel in Sources */,
 				BF66EEE92501AED0007EE018 /* JSONDecoder+Properties.swift in Sources */,
 				BF66EEEB2501AED0007EE018 /* UIApplication+AppExtension.swift in Sources */,
 				BF66EED92501AECA007EE018 /* Team.swift in Sources */,
@@ -2212,10 +2391,12 @@
 				BF66EEE02501AECA007EE018 /* Account.swift in Sources */,
 				BF66EED52501AECA007EE018 /* AltStore.xcdatamodeld in Sources */,
 				BFAECC582501B0A400528F27 /* ALTConstants.m in Sources */,
+				D5F99A1A28D12B1400476A16 /* StoreApp10ToStoreApp11Policy.swift in Sources */,
 				BFAECC562501B0A400528F27 /* ALTServerError+Conveniences.swift in Sources */,
 				BFAECC592501B0A400528F27 /* Result+Conveniences.swift in Sources */,
 				BFAECC542501B0A400528F27 /* NSError+ALTServerError.m in Sources */,
 				BF66EEE12501AECA007EE018 /* DatabaseManager.swift in Sources */,
+				D52C08EE28AEC37A006C4AE5 /* AppVersion.swift in Sources */,
 				BF66EEEA2501AED0007EE018 /* UIColor+Hex.swift in Sources */,
 				BF66EECC2501AECA007EE018 /* Source.swift in Sources */,
 				BF66EED72501AECA007EE018 /* InstalledApp.swift in Sources */,
@@ -2240,7 +2421,6 @@
 				BF42345A25101C35006D1EB2 /* WidgetView.swift in Sources */,
 				D55E163728776CB700A627A1 /* ComplicationView.swift in Sources */,
 				BF98917F250AAC4F002ACF50 /* AltWidget.swift in Sources */,
-				B3919A52292DBE5400519575 /* ProgressRing.swift in Sources */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -2261,6 +2441,7 @@
 				BF8CAE4E248AEABA004D6CCE /* UIDevice+Jailbreak.swift in Sources */,
 				D5E1E7C128077DE90016FC96 /* FetchTrustedSourcesOperation.swift in Sources */,
 				BFE338DF22F0EADB002E24B9 /* FetchSourceOperation.swift in Sources */,
+				D54DED1428CBC44B008B27A0 /* ErrorLogTableViewCell.swift in Sources */,
 				BFB6B21E231870160022A802 /* NewsViewController.swift in Sources */,
 				BFC57A652416C72400EB891E /* DeactivateAppOperation.swift in Sources */,
 				BF3BEFC124086A1E00DE7D55 /* RefreshAppOperation.swift in Sources */,
@@ -2310,6 +2491,7 @@
 				BF08858322DE795100DE9F1E /* MyAppsViewController.swift in Sources */,
 				BFC84A4D2421A19100853474 /* SourcesViewController.swift in Sources */,
 				BFF0B696232242D3007A79E1 /* LicensesViewController.swift in Sources */,
+				D57FE84428C7DB7100216002 /* ErrorLogViewController.swift in Sources */,
 				BFBE0007250AD0E70080826E /* ViewAppIntentHandler.swift in Sources */,
 				BFDB6A0822AAED73007EA6D6 /* ResignAppOperation.swift in Sources */,
 				D593F1942717749A006E82DE /* PatchAppOperation.swift in Sources */,
@@ -2362,6 +2544,20 @@
 			isa = PBXTargetDependency;
 			productRef = 191E5FD9290AFA49001A3B7C /* OpenSSL */;
 		};
+		99C4EF51297994E200CB538D /* PBXTargetDependency */ = {
+			isa = PBXTargetDependency;
+			productRef = 99C4EF50297994E200CB538D /* SemanticVersion */;
+		};
+		B343F86F295F76FD002B1159 /* PBXTargetDependency */ = {
+			isa = PBXTargetDependency;
+			name = "minimuxer-staticlib";
+			targetProxy = B343F86E295F76FD002B1159 /* PBXContainerItemProxy */;
+		};
+		B343F871295F7704002B1159 /* PBXTargetDependency */ = {
+			isa = PBXTargetDependency;
+			name = "em_proxy-staticlib";
+			targetProxy = B343F870295F7704002B1159 /* PBXContainerItemProxy */;
+		};
 		BF66EE842501AE50007EE018 /* PBXTargetDependency */ = {
 			isa = PBXTargetDependency;
 			target = BF66EE7D2501AE50007EE018 /* AltStoreCore */;
@@ -2419,8 +2615,7 @@
 				IPHONEOS_DEPLOYMENT_TARGET = 14.0;
 				LIBRARY_SEARCH_PATHS = (
 					"$(inherited)",
-					"$(PROJECT_DIR)/Dependencies/em_proxy/target/aarch64-apple-ios/release",
-					"$(PROJECT_DIR)/Dependencies/em_proxy/target/aarch64-apple-ios/debug",
+					"$(PROJECT_DIR)/Dependencies/em_proxy",
 				);
 				MACOSX_DEPLOYMENT_TARGET = "$(RECOMMENDED_MACOSX_DEPLOYMENT_TARGET)";
 				OTHER_LDFLAGS = "-ObjC";
@@ -2446,8 +2641,7 @@
 				IPHONEOS_DEPLOYMENT_TARGET = 14.0;
 				LIBRARY_SEARCH_PATHS = (
 					"$(inherited)",
-					"$(PROJECT_DIR)/Dependencies/em_proxy/target/aarch64-apple-ios/release",
-					"$(PROJECT_DIR)/Dependencies/em_proxy/target/aarch64-apple-ios/debug",
+					"$(PROJECT_DIR)/Dependencies/em_proxy",
 				);
 				MACOSX_DEPLOYMENT_TARGET = "$(RECOMMENDED_MACOSX_DEPLOYMENT_TARGET)";
 				OTHER_LDFLAGS = "-ObjC";
@@ -2473,8 +2667,7 @@
 				IPHONEOS_DEPLOYMENT_TARGET = 14.0;
 				LIBRARY_SEARCH_PATHS = (
 					"$(inherited)",
-					"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/release",
-					"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/debug",
+					"$(PROJECT_DIR)/Dependencies/minimuxer",
 				);
 				OTHER_LDFLAGS = "-ObjC";
 				PRODUCT_NAME = "$(TARGET_NAME)";
@@ -2497,8 +2690,7 @@
 				IPHONEOS_DEPLOYMENT_TARGET = 14.0;
 				LIBRARY_SEARCH_PATHS = (
 					"$(inherited)",
-					"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/release",
-					"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/debug",
+					"$(PROJECT_DIR)/Dependencies/minimuxer",
 				);
 				OTHER_LDFLAGS = "-ObjC";
 				PRODUCT_NAME = "$(TARGET_NAME)";
@@ -2735,7 +2927,7 @@
 				DYLIB_INSTALL_NAME_BASE = "@rpath";
 				INFOPLIST_FILE = AltStoreCore/Info.plist;
 				INSTALL_PATH = "$(LOCAL_LIBRARY_DIR)/Frameworks";
-				IPHONEOS_DEPLOYMENT_TARGET = 12.2;
+				IPHONEOS_DEPLOYMENT_TARGET = 14.0;
 				LD_RUNPATH_SEARCH_PATHS = (
 					"$(inherited)",
 					"@executable_path/Frameworks",
@@ -2771,7 +2963,7 @@
 				DYLIB_INSTALL_NAME_BASE = "@rpath";
 				INFOPLIST_FILE = AltStoreCore/Info.plist;
 				INSTALL_PATH = "$(LOCAL_LIBRARY_DIR)/Frameworks";
-				IPHONEOS_DEPLOYMENT_TARGET = 12.2;
+				IPHONEOS_DEPLOYMENT_TARGET = 14.0;
 				LD_RUNPATH_SEARCH_PATHS = (
 					"$(inherited)",
 					"@executable_path/Frameworks",
@@ -3003,8 +3195,6 @@
 					"$(inherited)",
 					"$(PROJECT_DIR)/Dependencies/fragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
-					"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/debug",
-					"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/release",
 				);
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
@@ -3039,8 +3229,6 @@
 					"$(inherited)",
 					"$(PROJECT_DIR)/Dependencies/fragmentzip",
 					"$(PROJECT_DIR)/Dependencies/libcurl",
-					"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/debug",
-					"$(PROJECT_DIR)/Dependencies/minimuxer/target/aarch64-apple-ios/release",
 				);
 				PRODUCT_BUNDLE_IDENTIFIER = "$(PRODUCT_BUNDLE_IDENTIFIER)";
 				PRODUCT_NAME = "$(TARGET_NAME)";
@@ -3155,6 +3343,14 @@
 				minimumVersion = 1.1.180;
 			};
 		};
+		99C4EF472978D52400CB538D /* XCRemoteSwiftPackageReference "SemanticVersion" */ = {
+			isa = XCRemoteSwiftPackageReference;
+			repositoryURL = "https://github.com/SwiftPackageIndex/SemanticVersion.git";
+			requirement = {
+				kind = upToNextMajorVersion;
+				minimumVersion = 0.3.5;
+			};
+		};
 		B3C395EF284F2DE700DA9E2F /* XCRemoteSwiftPackageReference "KeychainAccess" */ = {
 			isa = XCRemoteSwiftPackageReference;
 			repositoryURL = "https://github.com/kishikawakatsumi/KeychainAccess.git";
@@ -3226,6 +3422,16 @@
 			package = 4879A9602861049C00FC1BBD /* XCRemoteSwiftPackageReference "OpenSSL" */;
 			productName = OpenSSL;
 		};
+		99C4EF4C2979132100CB538D /* SemanticVersion */ = {
+			isa = XCSwiftPackageProductDependency;
+			package = 99C4EF472978D52400CB538D /* XCRemoteSwiftPackageReference "SemanticVersion" */;
+			productName = SemanticVersion;
+		};
+		99C4EF50297994E200CB538D /* SemanticVersion */ = {
+			isa = XCSwiftPackageProductDependency;
+			package = 99C4EF472978D52400CB538D /* XCRemoteSwiftPackageReference "SemanticVersion" */;
+			productName = SemanticVersion;
+		};
 		B3C395F0284F2DE700DA9E2F /* KeychainAccess */ = {
 			isa = XCSwiftPackageProductDependency;
 			package = B3C395EF284F2DE700DA9E2F /* XCRemoteSwiftPackageReference "KeychainAccess" */;
@@ -3252,6 +3458,7 @@
 		BF66EEB72501AECA007EE018 /* AltStore.xcdatamodeld */ = {
 			isa = XCVersionGroup;
 			children = (
+				D52E988928D002D30032BE6B /* AltStore 11.xcdatamodel */,
 				D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */,
 				BFBF33142526754700B7B8C9 /* AltStore 9.xcdatamodel */,
 				BFF7EC4C25081E9300BDE521 /* AltStore 8.xcdatamodel */,
@@ -3263,7 +3470,7 @@
 				BF66EEBD2501AECA007EE018 /* AltStore 2.xcdatamodel */,
 				BF66EEBE2501AECA007EE018 /* AltStore 4.xcdatamodel */,
 			);
-			currentVersion = D5CA0C4C280E242500469595 /* AltStore 10.xcdatamodel */;
+			currentVersion = D52E988928D002D30032BE6B /* AltStore 11.xcdatamodel */;
 			path = AltStore.xcdatamodeld;
 			sourceTree = "<group>";
 			versionGroupType = wrapper.xcdatamodel;

AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved

@@ -63,6 +63,15 @@
         "version" : "1.10.1"
       }
     },
+    {
+      "identity" : "semanticversion",
+      "kind" : "remoteSourceControl",
+      "location" : "https://github.com/SwiftPackageIndex/SemanticVersion.git",
+      "state" : {
+        "revision" : "fc670910dc0903cc269b3d0b776cda5703979c4e",
+        "version" : "0.3.5"
+      }
+    },
     {
       "identity" : "sparkle",
       "kind" : "remoteSourceControl",

AltStore.xcodeproj/xcshareddata/xcschemes/AltStore - Release.xcscheme

@@ -0,0 +1,84 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Scheme
+   LastUpgradeVersion = "1020"
+   version = "1.3">
+   <BuildAction
+      parallelizeBuildables = "YES"
+      buildImplicitDependencies = "YES">
+      <BuildActionEntries>
+         <BuildActionEntry
+            buildForTesting = "YES"
+            buildForRunning = "YES"
+            buildForProfiling = "YES"
+            buildForArchiving = "YES"
+            buildForAnalyzing = "YES">
+            <BuildableReference
+               BuildableIdentifier = "primary"
+               BlueprintIdentifier = "BFD247692284B9A500981D42"
+               BuildableName = "SideStore.app"
+               BlueprintName = "SideStore"
+               ReferencedContainer = "container:AltStore.xcodeproj">
+            </BuildableReference>
+         </BuildActionEntry>
+      </BuildActionEntries>
+   </BuildAction>
+   <TestAction
+      buildConfiguration = "Release"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      shouldUseLaunchSchemeArgsEnv = "YES">
+      <Testables>
+      </Testables>
+   </TestAction>
+   <LaunchAction
+      buildConfiguration = "Release"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      launchStyle = "0"
+      useCustomWorkingDirectory = "NO"
+      ignoresPersistentStateOnLaunch = "NO"
+      debugDocumentVersioning = "YES"
+      debugServiceExtension = "internal"
+      allowLocationSimulation = "YES">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "BFD247692284B9A500981D42"
+            BuildableName = "SideStore.app"
+            BlueprintName = "SideStore"
+            ReferencedContainer = "container:AltStore.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+      <CommandLineArguments>
+         <CommandLineArgument
+            argument = "-com.apple.CoreData.ConcurrencyDebug 1"
+            isEnabled = "YES">
+         </CommandLineArgument>
+      </CommandLineArguments>
+   </LaunchAction>
+   <ProfileAction
+      buildConfiguration = "Release"
+      shouldUseLaunchSchemeArgsEnv = "YES"
+      savedToolIdentifier = ""
+      useCustomWorkingDirectory = "NO"
+      debugDocumentVersioning = "YES">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "BFD247692284B9A500981D42"
+            BuildableName = "SideStore.app"
+            BlueprintName = "SideStore"
+            ReferencedContainer = "container:AltStore.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+   </ProfileAction>
+   <AnalyzeAction
+      buildConfiguration = "Release">
+   </AnalyzeAction>
+   <ArchiveAction
+      buildConfiguration = "Release"
+      revealArchiveInOrganizer = "YES">
+   </ArchiveAction>
+</Scheme>

AltStore/Analytics/AnalyticsManager.swift

@@ -14,13 +14,7 @@ import AppCenter
 import AppCenterAnalytics
 import AppCenterCrashes
 
-#if DEBUG
-private let appCenterAppSecret = "bb08e9bb-c126-408d-bf3f-324c8473fd40"
-#elseif RELEASE
-private let appCenterAppSecret = "b6718932-294a-432b-81f2-be1e17ff85c5"
-#else
-private let appCenterAppSecret = "e873f6ca-75eb-4685-818f-801e0e375d60"
-#endif
+private let appCenterAppSecret = "73532d3e-e573-4693-99a4-9f85840bbb44"
 
 extension AnalyticsManager
 {
@@ -77,7 +71,7 @@ extension AnalyticsManager
     }
 }
 
-class AnalyticsManager
+final class AnalyticsManager
 {
     static let shared = AnalyticsManager()
     

AltStore/App Detail/AppContentViewController.swift

@@ -25,7 +25,7 @@ extension AppContentViewController
     }
 }
 
-class AppContentViewController: UITableViewController
+final class AppContentViewController: UITableViewController
 {
     var app: StoreApp!
     
@@ -80,10 +80,21 @@ class AppContentViewController: UITableViewController
         
         self.subtitleLabel.text = self.app.subtitle
         self.descriptionTextView.text = self.app.localizedDescription
-        self.versionDescriptionTextView.text = self.app.versionDescription
-        self.versionLabel.text = String(format: NSLocalizedString("Version %@", comment: ""), self.app.version)
-        self.versionDateLabel.text = Date().relativeDateString(since: self.app.versionDate, dateFormatter: self.dateFormatter)
-        self.sizeLabel.text = self.byteCountFormatter.string(fromByteCount: Int64(self.app.size))
+        
+        if let version = self.app.latestVersion
+        {
+            self.versionDescriptionTextView.text = version.localizedDescription
+            self.versionLabel.text = String(format: NSLocalizedString("Version %@", comment: ""), version.version)
+            self.versionDateLabel.text = Date().relativeDateString(since: version.date, dateFormatter: self.dateFormatter)
+            self.sizeLabel.text = self.byteCountFormatter.string(fromByteCount: version.size)
+        }
+        else
+        {
+            self.versionDescriptionTextView.text = nil
+            self.versionLabel.text = nil
+            self.versionDateLabel.text = nil
+            self.sizeLabel.text = self.byteCountFormatter.string(fromByteCount: 0)
+        }
         
         self.descriptionTextView.maximumNumberOfLines = 5
         self.descriptionTextView.moreButton.addTarget(self, action: #selector(AppContentViewController.toggleCollapsingSection(_:)), for: .primaryActionTriggered)
@@ -173,7 +184,8 @@ private extension AppContentViewController
         dataSource.cellConfigurationHandler = { (cell, permission, indexPath) in
             let cell = cell as! PermissionCollectionViewCell
             cell.button.setImage(permission.type.icon, for: .normal)
-            cell.textLabel.text = permission.type.localizedShortName
+            cell.button.tintColor = .label
+            cell.textLabel.text = permission.type.localizedShortName ?? permission.type.localizedName
         }
         
         return dataSource

AltStore/App Detail/AppContentViewControllerCells.swift

@@ -8,7 +8,7 @@
 
 import UIKit
 
-class PermissionCollectionViewCell: UICollectionViewCell
+final class PermissionCollectionViewCell: UICollectionViewCell
 {
     @IBOutlet var button: UIButton!
     @IBOutlet var textLabel: UILabel!
@@ -29,7 +29,7 @@ class PermissionCollectionViewCell: UICollectionViewCell
     }
 }
 
-class AppContentTableViewCell: UITableViewCell
+final class AppContentTableViewCell: UITableViewCell
 {
     override func systemLayoutSizeFitting(_ targetSize: CGSize, withHorizontalFittingPriority horizontalFittingPriority: UILayoutPriority, verticalFittingPriority: UILayoutPriority) -> CGSize
     {

AltStore/App Detail/AppViewController.swift

@@ -13,7 +13,7 @@ import Roxas
 
 import Nuke
 
-class AppViewController: UIViewController
+final class AppViewController: UIViewController
 {
     var app: StoreApp!
     
@@ -352,7 +352,7 @@ class AppViewController: UIViewController
 
 extension AppViewController
 {
-    class func makeAppViewController(app: StoreApp) -> AppViewController
+    final class func makeAppViewController(app: StoreApp) -> AppViewController
     {
         let storyboard = UIStoryboard(name: "Main", bundle: nil)
         
@@ -384,10 +384,10 @@ private extension AppViewController
             button.progress = progress
         }
         
-        if Date() < self.app.versionDate
+        if let versionDate = self.app.latestVersion?.date, versionDate > Date()
         {
-            self.bannerView.button.countdownDate = self.app.versionDate
-            self.navigationBarDownloadButton.countdownDate = self.app.versionDate
+            self.bannerView.button.countdownDate = versionDate
+            self.navigationBarDownloadButton.countdownDate = versionDate
         }
         else
         {

AltStore/App Detail/PermissionPopoverViewController.swift

@@ -10,7 +10,7 @@ import UIKit
 
 import AltStoreCore
 
-class PermissionPopoverViewController: UIViewController
+final class PermissionPopoverViewController: UIViewController
 {
     var permission: AppPermission!
     

AltStore/App IDs/AppIDsViewController.swift

@@ -11,7 +11,7 @@ import UIKit
 import AltStoreCore
 import Roxas
 
-class AppIDsViewController: UICollectionViewController
+final class AppIDsViewController: UICollectionViewController
 {
     private lazy var dataSource = self.makeDataSource()
     

AltStore/AppDelegate.swift

@@ -18,49 +18,49 @@ import EmotionalDamage
 
 extension AppDelegate
 {
-    static let openPatreonSettingsDeepLinkNotification = Notification.Name("com.rileytestut.AltStore.OpenPatreonSettingsDeepLinkNotification")
-    static let importAppDeepLinkNotification = Notification.Name("com.rileytestut.AltStore.ImportAppDeepLinkNotification")
-    static let addSourceDeepLinkNotification = Notification.Name("com.rileytestut.AltStore.AddSourceDeepLinkNotification")
-
-    static let appBackupDidFinish = Notification.Name("com.rileytestut.AltStore.AppBackupDidFinish")
-
+    static let openPatreonSettingsDeepLinkNotification = Notification.Name(Bundle.Info.appbundleIdentifier + ".OpenPatreonSettingsDeepLinkNotification")
+    static let importAppDeepLinkNotification = Notification.Name(Bundle.Info.appbundleIdentifier + ".ImportAppDeepLinkNotification")
+    static let addSourceDeepLinkNotification = Notification.Name(Bundle.Info.appbundleIdentifier + ".AddSourceDeepLinkNotification")
+    
+    static let appBackupDidFinish = Notification.Name(Bundle.Info.appbundleIdentifier + ".AppBackupDidFinish")
+    
     static let importAppDeepLinkURLKey = "fileURL"
     static let appBackupResultKey = "result"
     static let addSourceDeepLinkURLKey = "sourceURL"
 }
 
 @UIApplicationMain
-class AppDelegate: UIResponder, UIApplicationDelegate {
+final class AppDelegate: UIResponder, UIApplicationDelegate {
 
     var window: UIWindow?
-
+    
     @available(iOS 14, *)
     private var intentHandler: IntentHandler {
         get { _intentHandler as! IntentHandler }
         set { _intentHandler = newValue }
     }
-
+    
     @available(iOS 14, *)
     private var viewAppIntentHandler: ViewAppIntentHandler {
         get { _viewAppIntentHandler as! ViewAppIntentHandler }
         set { _viewAppIntentHandler = newValue }
     }
-
+    
     private lazy var _intentHandler: Any = {
         guard #available(iOS 14, *) else { fatalError() }
         return IntentHandler()
     }()
-
+    
     private lazy var _viewAppIntentHandler: Any = {
         guard #available(iOS 14, *) else { fatalError() }
         return ViewAppIntentHandler()
     }()
-
+    
     func application(_ application: UIApplication, didFinishLaunchingWithOptions launchOptions: [UIApplication.LaunchOptionsKey: Any]?) -> Bool
     {
         // Register default settings before doing anything else.
         UserDefaults.registerDefaults()
-
+        
         DatabaseManager.shared.start { (error) in
             if let error = error
             {
@@ -71,50 +71,62 @@ class AppDelegate: UIResponder, UIApplicationDelegate {
                 print("Started DatabaseManager.")
             }
         }
-
+        
         AnalyticsManager.shared.start()
-
+        
         self.setTintColor()
-
-        SecureValueTransformer.register()
-
+        
+        SecureValueTransformer.register()        
+        
         if UserDefaults.standard.firstLaunch == nil
         {
             Keychain.shared.reset()
             UserDefaults.standard.firstLaunch = Date()
         }
-
+        
         UserDefaults.standard.preferredServerID = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.serverID) as? String
-
+        
         #if DEBUG || BETA
         UserDefaults.standard.isDebugModeEnabled = true
         #endif
-
+        
         self.prepareForBackgroundFetch()
-
+        
         return true
     }
     
     func applicationDidEnterBackground(_ application: UIApplication)
-         {
+    {
+        // Make sure to update SceneDelegate.sceneDidEnterBackground() as well.
+                        
+        guard let oneMonthAgo = Calendar.current.date(byAdding: .month, value: -1, to: Date()) else { return }
+        
+        let midnightOneMonthAgo = Calendar.current.startOfDay(for: oneMonthAgo)
+        DatabaseManager.shared.purgeLoggedErrors(before: midnightOneMonthAgo) { result in
+            switch result
+            {
+            case .success: break
+            case .failure(let error): print("[ALTLog] Failed to purge logged errors before \(midnightOneMonthAgo).", error)
+            }
+        }
              
-         }
+    }
 
     func applicationWillEnterForeground(_ application: UIApplication)
     {
         AppManager.shared.update()
         start_em_proxy(bind_addr: Consts.Proxy.serverURL)
     }
-
+    
     func application(_ app: UIApplication, open url: URL, options: [UIApplication.OpenURLOptionsKey : Any]) -> Bool
     {
         return self.open(url)
     }
-
+    
     func application(_ application: UIApplication, handlerFor intent: INIntent) -> Any?
     {
         guard #available(iOS 14, *) else { return nil }
-
+        
         switch intent
         {
         case is RefreshAllIntent: return self.intentHandler
@@ -133,7 +145,7 @@ extension AppDelegate
         // Use this method to select a configuration to create the new scene with.
         return UISceneConfiguration(name: "Default Configuration", sessionRole: connectingSceneSession.role)
     }
-
+    
     func application(_ application: UIApplication, didDiscardSceneSessions sceneSessions: Set<UISceneSession>)
     {
         // Called when the user discards a scene session.
@@ -148,36 +160,36 @@ private extension AppDelegate
     {
         self.window?.tintColor = .altPrimary
     }
-
+    
     func open(_ url: URL) -> Bool
     {
         if url.isFileURL
         {
             guard url.pathExtension.lowercased() == "ipa" else { return false }
-
+            
             DispatchQueue.main.async {
                 NotificationCenter.default.post(name: AppDelegate.importAppDeepLinkNotification, object: nil, userInfo: [AppDelegate.importAppDeepLinkURLKey: url])
             }
-
+            
             return true
         }
         else
         {
             guard let components = URLComponents(url: url, resolvingAgainstBaseURL: false) else { return false }
             guard let host = components.host?.lowercased() else { return false }
-
+            
             switch host
             {
             case "patreon":
                 DispatchQueue.main.async {
                     NotificationCenter.default.post(name: AppDelegate.openPatreonSettingsDeepLinkNotification, object: nil)
                 }
-
+                
                 return true
-
+                
             case "appbackupresponse":
                 let result: Result<Void, Error>
-
+                
                 switch url.path.lowercased()
                 {
                 case "/success": result = .success(())
@@ -188,37 +200,37 @@ private extension AppDelegate
                         let errorCodeString = queryItems["errorCode"], let errorCode = Int(errorCodeString),
                         let errorDescription = queryItems["errorDescription"]
                     else { return false }
-
+                    
                     let error = NSError(domain: errorDomain, code: errorCode, userInfo: [NSLocalizedDescriptionKey: errorDescription])
                     result = .failure(error)
-
+                    
                 default: return false
                 }
-
+                
                 NotificationCenter.default.post(name: AppDelegate.appBackupDidFinish, object: nil, userInfo: [AppDelegate.appBackupResultKey: result])
-
+                
                 return true
-
+                
             case "install":
                 let queryItems = components.queryItems?.reduce(into: [String: String]()) { $0[$1.name.lowercased()] = $1.value } ?? [:]
                 guard let downloadURLString = queryItems["url"], let downloadURL = URL(string: downloadURLString) else { return false }
-
+                
                 DispatchQueue.main.async {
                     NotificationCenter.default.post(name: AppDelegate.importAppDeepLinkNotification, object: nil, userInfo: [AppDelegate.importAppDeepLinkURLKey: downloadURL])
                 }
-
+                
                 return true
-
+            
             case "source":
                 let queryItems = components.queryItems?.reduce(into: [String: String]()) { $0[$1.name.lowercased()] = $1.value } ?? [:]
                 guard let sourceURLString = queryItems["url"], let sourceURL = URL(string: sourceURLString) else { return false }
-
+                
                 DispatchQueue.main.async {
                     NotificationCenter.default.post(name: AppDelegate.addSourceDeepLinkNotification, object: nil, userInfo: [AppDelegate.addSourceDeepLinkURLKey: sourceURL])
                 }
-
+                
                 return true
-
+                
             default: return false
             }
         }
@@ -231,47 +243,47 @@ extension AppDelegate
     {
         // "Fetch" every hour, but then refresh only those that need to be refreshed (so we don't drain the battery).
         UIApplication.shared.setMinimumBackgroundFetchInterval(1 * 60 * 60)
-
+        
         UNUserNotificationCenter.current().requestAuthorization(options: [.alert, .badge, .sound]) { (success, error) in
         }
-
+        
         #if DEBUG
         UIApplication.shared.registerForRemoteNotifications()
         #endif
     }
-
+    
     func application(_ application: UIApplication, didRegisterForRemoteNotificationsWithDeviceToken deviceToken: Data)
     {
         let tokenParts = deviceToken.map { data -> String in
             return String(format: "%02.2hhx", data)
         }
-
+        
         let token = tokenParts.joined()
         print("Push Token:", token)
     }
-
+    
     func application(_ application: UIApplication, didReceiveRemoteNotification userInfo: [AnyHashable : Any], fetchCompletionHandler completionHandler: @escaping (UIBackgroundFetchResult) -> Void)
     {
         self.application(application, performFetchWithCompletionHandler: completionHandler)
     }
-
+    
     func application(_ application: UIApplication, performFetchWithCompletionHandler backgroundFetchCompletionHandler: @escaping (UIBackgroundFetchResult) -> Void)
     {
         if UserDefaults.standard.isBackgroundRefreshEnabled && !UserDefaults.standard.presentedLaunchReminderNotification
         {
             let threeHours: TimeInterval = 3 * 60 * 60
             let trigger = UNTimeIntervalNotificationTrigger(timeInterval: threeHours, repeats: false)
-
+            
             let content = UNMutableNotificationContent()
             content.title = NSLocalizedString("App Refresh Tip", comment: "")
             content.body = NSLocalizedString("The more you open SideStore, the more chances it's given to refresh apps in the background.", comment: "")
-
+            
             let request = UNNotificationRequest(identifier: "background-refresh-reminder5", content: content, trigger: trigger)
             UNUserNotificationCenter.current().add(request)
-
+            
             UserDefaults.standard.presentedLaunchReminderNotification = true
         }
-
+        
         BackgroundTaskManager.shared.performExtendedBackgroundTask { (taskResult, taskCompletionHandler) in
             if let error = taskResult.error
             {
@@ -280,7 +292,7 @@ extension AppDelegate
                 taskCompletionHandler()
                 return
             }
-
+            
             if !DatabaseManager.shared.isStarted
             {
                 DatabaseManager.shared.start() { (error) in
@@ -309,7 +321,7 @@ extension AppDelegate
             }
         }
     }
-
+    
     func performBackgroundFetch(backgroundFetchCompletionHandler: @escaping (UIBackgroundFetchResult) -> Void,
                                 refreshAppsCompletionHandler: @escaping (Result<[String: Result<InstalledApp, Error>], Error>) -> Void)
     {
@@ -319,15 +331,15 @@ extension AppDelegate
             case .failure: backgroundFetchCompletionHandler(.failed)
             case .success: backgroundFetchCompletionHandler(.newData)
             }
-
+            
             if !UserDefaults.standard.isBackgroundRefreshEnabled
             {
                 refreshAppsCompletionHandler(.success([:]))
             }
         }
-
+        
         guard UserDefaults.standard.isBackgroundRefreshEnabled else { return }
-
+        
         DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
             let installedApps = InstalledApp.fetchAppsForBackgroundRefresh(in: context)
             AppManager.shared.backgroundRefresh(installedApps, completionHandler: refreshAppsCompletionHandler)
@@ -343,49 +355,49 @@ private extension AppDelegate
             do
             {
                 let (sources, context) = try result.get()
-
+                
                 let previousUpdatesFetchRequest = InstalledApp.updatesFetchRequest() as! NSFetchRequest<NSFetchRequestResult>
                 previousUpdatesFetchRequest.includesPendingChanges = false
                 previousUpdatesFetchRequest.resultType = .dictionaryResultType
                 previousUpdatesFetchRequest.propertiesToFetch = [#keyPath(InstalledApp.bundleIdentifier)]
-
+                
                 let previousNewsItemsFetchRequest = NewsItem.fetchRequest() as NSFetchRequest<NSFetchRequestResult>
                 previousNewsItemsFetchRequest.includesPendingChanges = false
                 previousNewsItemsFetchRequest.resultType = .dictionaryResultType
                 previousNewsItemsFetchRequest.propertiesToFetch = [#keyPath(NewsItem.identifier)]
-
+                
                 let previousUpdates = try context.fetch(previousUpdatesFetchRequest) as! [[String: String]]
                 let previousNewsItems = try context.fetch(previousNewsItemsFetchRequest) as! [[String: String]]
-
+                
                 try context.save()
-
+                
                 let updatesFetchRequest = InstalledApp.updatesFetchRequest()
                 let newsItemsFetchRequest = NewsItem.fetchRequest() as NSFetchRequest<NewsItem>
-
+                
                 let updates = try context.fetch(updatesFetchRequest)
                 let newsItems = try context.fetch(newsItemsFetchRequest)
-
+                
                 for update in updates
                 {
                     guard !previousUpdates.contains(where: { $0[#keyPath(InstalledApp.bundleIdentifier)] == update.bundleIdentifier }) else { continue }
-                    guard let storeApp = update.storeApp else { continue }
-
+                    guard let storeApp = update.storeApp, let version = storeApp.version else { continue }
+                    
                     let content = UNMutableNotificationContent()
                     content.title = NSLocalizedString("New Update Available", comment: "")
-                    content.body = String(format: NSLocalizedString("%@ %@ is now available for download.", comment: ""), update.name, storeApp.version)
+                    content.body = String(format: NSLocalizedString("%@ %@ is now available for download.", comment: ""), update.name, version)
                     content.sound = .default
-
+                    
                     let request = UNNotificationRequest(identifier: UUID().uuidString, content: content, trigger: nil)
                     UNUserNotificationCenter.current().add(request)
                 }
-
+                
                 for newsItem in newsItems
                 {
                     guard !previousNewsItems.contains(where: { $0[#keyPath(NewsItem.identifier)] == newsItem.identifier }) else { continue }
                     guard !newsItem.isSilent else { continue }
-
+                    
                     let content = UNMutableNotificationContent()
-
+                    
                     if let app = newsItem.storeApp
                     {
                         content.title = String(format: NSLocalizedString("%@ News", comment: ""), app.name)
@@ -394,10 +406,10 @@ private extension AppDelegate
                     {
                         content.title = NSLocalizedString("SideStore News", comment: "")
                     }
-
+                    
                     content.body = newsItem.title
                     content.sound = .default
-
+                    
                     let request = UNNotificationRequest(identifier: UUID().uuidString, content: content, trigger: nil)
                     UNUserNotificationCenter.current().add(request)
                 }
@@ -405,7 +417,7 @@ private extension AppDelegate
                 DispatchQueue.main.async {
                     UIApplication.shared.applicationIconBadgeNumber = updates.count
                 }
-
+                
                 completionHandler(.success(sources))
             }
             catch

AltStore/Authentication/AuthenticationViewController.swift

@@ -10,7 +10,7 @@ import UIKit
 
 import AltSign
 
-class AuthenticationViewController: UIViewController
+final class AuthenticationViewController: UIViewController
 {
     var authenticationHandler: ((String, String, @escaping (Result<(ALTAccount, ALTAppleAPISession), Error>) -> Void) -> Void)?
     var completionHandler: (((ALTAccount, ALTAppleAPISession, String)?) -> Void)?
@@ -31,7 +31,7 @@ class AuthenticationViewController: UIViewController
     {
         super.viewDidLoad()
         
-        self.signInButton.activityIndicatorView.style = .white
+        self.signInButton.activityIndicatorView.style = .medium
         
         for view in [self.appleIDBackgroundView!, self.passwordBackgroundView!, self.signInButton!]
         {

AltStore/Authentication/InstructionsViewController.swift

@@ -8,7 +8,7 @@
 
 import UIKit
 
-class InstructionsViewController: UIViewController
+final class InstructionsViewController: UIViewController
 {
     var completionHandler: (() -> Void)?
     

AltStore/Authentication/RefreshAltStoreViewController.swift

@@ -12,7 +12,7 @@ import AltStoreCore
 import AltSign
 import Roxas
 
-class RefreshAltStoreViewController: UIViewController
+final class RefreshAltStoreViewController: UIViewController
 {
     var context: AuthenticatedOperationContext!
     

AltStore/Authentication/SelectTeamViewController.swift

@@ -14,7 +14,7 @@ import IntentsUI
 
 import AltSign
 
-class SelectTeamViewController: UITableViewController
+final class SelectTeamViewController: UITableViewController
 {
     public var teams: [ALTTeam]?
     public var completionHandler: ((Result<ALTTeam, Swift.Error>)  -> Void)?

AltStore/Base.lproj/Main.storyboard

@@ -1095,13 +1095,13 @@ World</string>
         <image name="News" width="19" height="20"/>
         <image name="Settings" width="20" height="20"/>
         <namedColor name="Background">
-            <color red="1" green="1" blue="1" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.6431" green="0.0196" blue="0.9804" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
         <namedColor name="BlurTint">
-            <color red="1" green="1" blue="1" alpha="0.30000001192092896" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="1" green="1" blue="1" alpha="0.3" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
         <namedColor name="Primary">
-            <color red="0.50196078431372548" green="0.2627450980392157" blue="1" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.6431" green="0.0196" blue="0.9804" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
         <systemColor name="systemBackgroundColor">
             <color white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>

AltStore/Browse/BrowseCollectionViewCell.swift

@@ -12,7 +12,7 @@ import Roxas
 
 import Nuke
 
-@objc class BrowseCollectionViewCell: UICollectionViewCell
+@objc final class BrowseCollectionViewCell: UICollectionViewCell
 {
     var imageURLs: [URL] = [] {
         didSet {

AltStore/Browse/BrowseViewController.swift

@@ -94,7 +94,7 @@ private extension BrowseViewController
             cell.bannerView.iconImageView.isIndicatingActivity = true
             
             cell.bannerView.button.addTarget(self, action: #selector(BrowseViewController.performAppAction(_:)), for: .primaryActionTriggered)
-            cell.bannerView.button.activityIndicatorView.style = .white
+            cell.bannerView.button.activityIndicatorView.style = .medium
             
             // Explicitly set to false to ensure we're starting from a non-activity indicating state.
             // Otherwise, cell reuse can mess up some cached values.
@@ -113,7 +113,7 @@ private extension BrowseViewController
                 let progress = AppManager.shared.installationProgress(for: app)
                 cell.bannerView.button.progress = progress
                 
-                if Date() < app.versionDate
+                if let versionDate = app.latestVersion?.date, versionDate > Date()
                 {
                     cell.bannerView.button.countdownDate = app.versionDate
                 }
@@ -167,14 +167,7 @@ private extension BrowseViewController
     
     func updateDataSource()
     {
-        if let patreonAccount = DatabaseManager.shared.patreonAccount(), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
-        {
             self.dataSource.predicate = nil
-        }
-        else
-        {
-            self.dataSource.predicate = NSPredicate(format: "%K == NO", #keyPath(StoreApp.isBeta))
-        }
     }
     
     func fetchSource()

AltStore/Components/AppIconImageView.swift

@@ -8,7 +8,7 @@
 
 import UIKit
 
-class AppIconImageView: UIImageView
+final class AppIconImageView: UIImageView
 {
     override func awakeFromNib()
     {

AltStore/Components/BackgroundTaskManager.swift

@@ -8,7 +8,7 @@
 
 import AVFoundation
 
-class BackgroundTaskManager
+final class BackgroundTaskManager
 {
     static let shared = BackgroundTaskManager()
     

AltStore/Components/BannerCollectionViewCell.swift

@@ -8,7 +8,7 @@
 
 import UIKit
 
-class BannerCollectionViewCell: UICollectionViewCell
+final class BannerCollectionViewCell: UICollectionViewCell
 {
     private(set) var errorBadge: UIView?
     @IBOutlet private(set) var bannerView: AppBannerView!

AltStore/Components/Button.swift

@@ -8,7 +8,7 @@
 
 import UIKit
 
-class Button: UIButton
+final class Button: UIButton
 {
     override var intrinsicContentSize: CGSize {
         var size = super.intrinsicContentSize

AltStore/Components/CollapsingTextView.swift

@@ -8,7 +8,7 @@
 
 import UIKit
 
-class CollapsingTextView: UITextView
+final class CollapsingTextView: UITextView
 {
     var isCollapsed = true {
         didSet {
@@ -71,8 +71,10 @@ class CollapsingTextView: UITextView
         {
             self.textContainer.maximumNumberOfLines = self.maximumNumberOfLines
             
-            let maximumCollapsedHeight = font.lineHeight * CGFloat(self.maximumNumberOfLines)
-            if self.intrinsicContentSize.height > maximumCollapsedHeight
+            let boundingSize = self.attributedText.boundingRect(with: CGSize(width: self.textContainer.size.width, height: .infinity), options: [.usesLineFragmentOrigin, .usesFontLeading], context: nil)
+            let maximumCollapsedHeight = font.lineHeight * Double(self.maximumNumberOfLines)
+            
+            if boundingSize.height.rounded() > maximumCollapsedHeight.rounded()
             {
                 var exclusionFrame = moreButtonFrame
                 exclusionFrame.origin.y += self.moreButton.bounds.midY

AltStore/Components/ForwardingNavigationController.swift

@@ -8,7 +8,7 @@
 
 import UIKit
 
-class ForwardingNavigationController: UINavigationController
+final class ForwardingNavigationController: UINavigationController
 {
     override var childForStatusBarStyle: UIViewController? {
         return self.topViewController

AltStore/Components/NavigationBar.swift

@@ -10,7 +10,7 @@ import UIKit
 
 import Roxas
 
-class NavigationBar: UINavigationBar
+final class NavigationBar: UINavigationBar
 {
     @IBInspectable var automaticallyAdjustsItemPositions: Bool = true
     

AltStore/Components/PillButton.swift

@@ -8,7 +8,7 @@
 
 import UIKit
 
-class PillButton: UIButton
+final class PillButton: UIButton
 {
     override var accessibilityValue: String? {
         get {
@@ -88,7 +88,7 @@ class PillButton: UIButton
         self.layer.masksToBounds = true
         self.accessibilityTraits.formUnion([.updatesFrequently, .button])
         
-        self.activityIndicatorView.style = .white
+        self.activityIndicatorView.style = .medium
         self.activityIndicatorView.isUserInteractionEnabled = false
         
         self.progressView.progress = 0

AltStore/Components/ToastView.swift

@@ -16,7 +16,7 @@ extension TimeInterval
     static let longToastViewDuration = 8.0
 }
 
-class ToastView: RSTToastView
+final class ToastView: RSTToastView
 {
     var preferredDuration: TimeInterval
     

AltStore/Extensions/OSLog+SideStore.swift

@@ -9,7 +9,7 @@
 import Foundation
 import OSLog
 
-let customLog = OSLog(subsystem: "org.sidestore.sidestore",
+public let customLog = OSLog(subsystem: "org.sidestore.sidestore",
                       category: "ios")
 
 
@@ -18,6 +18,7 @@ public extension OSLog {
     /// - Parameters:
     ///   - message: String or format string
     ///   - args: optional args for format string
+    @inlinable
     static func error(_ message: StaticString, _ args: CVarArg...) {
         os_log(message, log: customLog, type: .error, args)
     }
@@ -26,6 +27,7 @@ public extension OSLog {
     /// - Parameters:
     ///   - message: String or format string
     ///   - args: optional args for format string
+    @inlinable
     static func info(_ message: StaticString, _ args: CVarArg...) {
         os_log(message, log: customLog, type: .info, args)
     }
@@ -34,6 +36,7 @@ public extension OSLog {
     /// - Parameters:
     ///   - message: String or format string
     ///   - args: optional args for format string
+    @inlinable
     static func debug(_ message: StaticString, _ args: CVarArg...) {
         os_log(message, log: customLog, type: .debug, args)
     }
@@ -45,6 +48,7 @@ public extension OSLog {
 /// - Parameters:
 ///   - message: String or format string
 ///   - args: optional args for format string
+@inlinable
 public func ELOG(_ message: StaticString, file: StaticString = #file, function: StaticString = #function, line: UInt = #line, _ args: CVarArg...) {
     OSLog.error(message, args)
 }
@@ -53,6 +57,7 @@ public func ELOG(_ message: StaticString, file: StaticString = #file, function:
 /// - Parameters:
 ///   - message: String or format string
 ///   - args: optional args for format string
+@inlinable
 public func ILOG(_ message: StaticString, file: StaticString = #file, function: StaticString = #function, line: UInt = #line, _ args: CVarArg...) {
     OSLog.info(message, args)
 }

AltStore/Info.plist

@@ -5,7 +5,7 @@
 	<key>ALTAppGroups</key>
 	<array>
 		<string>group.$(APP_GROUP_IDENTIFIER)</string>
-		<string>group.com.rileytestut.AltStore</string>
+		<string>group.com.SideStore.SideStore</string>
 	</array>
 	<key>ALTDeviceID</key>
 	<string>00008101-000129D63698001E</string>
@@ -44,6 +44,8 @@
 	<string>$(PRODUCT_NAME)</string>
 	<key>CFBundlePackageType</key>
 	<string>APPL</string>
+	<key>LSSupportsOpeningDocumentsInPlace</key>
+	<true/>
 	<key>CFBundleShortVersionString</key>
 	<string>$(MARKETING_VERSION)</string>
 	<key>CFBundleURLTypes</key>
@@ -56,6 +58,7 @@
 			<key>CFBundleURLSchemes</key>
 			<array>
 				<string>altstore</string>
+				<string>sidestore</string>
 			</array>
 		</dict>
 		<dict>
@@ -66,6 +69,7 @@
 			<key>CFBundleURLSchemes</key>
 			<array>
 				<string>altstore-com.rileytestut.AltStore</string>
+				<string>sidestore-com.SideStore.SideStore</string>
 			</array>
 		</dict>
 	</array>
@@ -200,5 +204,7 @@
 			</dict>
 		</dict>
 	</array>
+	<key>UIFileSharingEnabled</key>
+	<true/>
 </dict>
 </plist>

AltStore/Intents/IntentHandler.swift

@@ -11,7 +11,7 @@ import Foundation
 import AltStoreCore
 
 @available(iOS 14, *)
-class IntentHandler: NSObject, RefreshAllIntentHandling
+final class IntentHandler: NSObject, RefreshAllIntentHandling
 {
     private let queue = DispatchQueue(label: "io.altstore.IntentHandler")
     

AltStore/LaunchViewController.swift

@@ -14,7 +14,7 @@ import minimuxer
 import AltStoreCore
 import UniformTypeIdentifiers
 
-class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
+final class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
 {
     private var didFinishLaunching = false
     
@@ -47,6 +47,7 @@ class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
     
     override func viewDidAppear(_ animated: Bool) {
         super.viewDidAppear(true)
+        #if !targetEnvironment(simulator)
         start_em_proxy(bind_addr: Consts.Proxy.serverURL)
         
         guard let pf = fetchPairingFile() else {
@@ -54,6 +55,7 @@ class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
             return
         }
         start_minimuxer_threads(pf)
+        #endif
     }
     
     func fetchPairingFile() -> String? {
@@ -77,14 +79,16 @@ class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
         } else {
             // Show an alert explaining the pairing file
             // Create new Alert
-            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://youtu.be/dQw4w9WgXcQ", preferredStyle: .alert)
+            let dialogMessage = UIAlertController(title: "Pairing File", message: "Select the pairing file for your device. For more information, go to https://wiki.sidestore.io/guides/install#pairing-process", preferredStyle: .alert)
             
             // Create OK button with action handler
             let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
                 // Try to load it from a file picker
                 var types = UTType.types(tag: "plist", tagClass: UTTagClass.filenameExtension, conformingTo: nil)
-                types.append(contentsOf: UTType.types(tag: "mobiledevicepairing", tagClass: UTTagClass.filenameExtension, conformingTo: nil))
+                types.append(contentsOf: UTType.types(tag: "mobiledevicepairing", tagClass: UTTagClass.filenameExtension, conformingTo: UTType.data))
+                types.append(.xml)
                 let documentPickerController = UIDocumentPickerViewController(forOpeningContentTypes: types)
+                documentPickerController.shouldShowFileExtensions = true
                 documentPickerController.delegate = self
                 self.present(documentPickerController, animated: true, completion: nil)
              })
@@ -140,12 +144,22 @@ class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
     }
     
     func documentPickerWasCancelled(_ controller: UIDocumentPickerViewController) {
-        displayError("Choosing a pairing file was cancelled")
+        displayError("Choosing a pairing file was cancelled. Please re-open the app and try again.")
     }
     
     func start_minimuxer_threads(_ pairing_file: String) {
         set_usbmuxd_socket()
+        #if false // Retries
+        var res = start_minimuxer(pairing_file: pairing_file)
+        var attempts = 10
+        while (attempts != 0 && res != 0) {
+            print("start_minimuxer `res` != 0, retry #\(attempts)")
+            res = start_minimuxer(pairing_file: pairing_file)
+            attempts -= 1
+        }
+        #else
         let res = start_minimuxer(pairing_file: pairing_file)
+        #endif
         if res != 0 {
             displayError("minimuxer failed to start. Incorrect arguments were passed.")
         }
@@ -165,7 +179,19 @@ extension LaunchViewController
         {
             let title = error.userInfo[NSLocalizedFailureErrorKey] as? String ?? NSLocalizedString("Unable to Launch SideStore", comment: "")
             
-            let alertController = UIAlertController(title: title, message: error.localizedDescription, preferredStyle: .alert)
+            let errorDescription: String
+            
+            if #available(iOS 14.5, *)
+            {
+                let errorMessages = [error.debugDescription] + error.underlyingErrors.map { ($0 as NSError).debugDescription }
+                errorDescription = errorMessages.joined(separator: "\n\n")
+            }
+            else
+            {
+                errorDescription = error.debugDescription
+            }
+            
+            let alertController = UIAlertController(title: title, message: errorDescription, preferredStyle: .alert)
             alertController.addAction(UIAlertAction(title: NSLocalizedString("Retry", comment: ""), style: .default, handler: { (action) in
                 self.handleLaunchConditions()
             }))

AltStore/Managing Apps/AppManager.swift

@@ -28,7 +28,7 @@ extension AppManager
 }
 
 @available(iOS 13, *)
-class AppManagerPublisher: ObservableObject
+final class AppManagerPublisher: ObservableObject
 {
     @Published
     fileprivate(set) var installationProgress = [String: Progress]()
@@ -42,7 +42,7 @@ private func ==(lhs: OperatingSystemVersion, rhs: OperatingSystemVersion) -> Boo
     return (lhs.majorVersion == rhs.majorVersion && lhs.minorVersion == rhs.minorVersion && lhs.patchVersion == rhs.patchVersion)
 }
 
-class AppManager
+final class AppManager
 {
     static let shared = AppManager()
     
@@ -392,7 +392,8 @@ extension AppManager
     func fetchAppIDs(completionHandler: @escaping (Result<([AppID], NSManagedObjectContext), Error>) -> Void)
     {
         let authenticationOperation = self.authenticate(presentingViewController: nil) { (result) in
-            print("Authenticated for fetching App IDs with result:", result)
+            // result contains name, email, auth token, OTP and other possibly personal/account specific info. we don't want this logged
+            //print("Authenticated for fetching App IDs with result:", result)
         }
         
         let fetchAppIDsOperation = FetchAppIDsOperation(context: authenticationOperation.context)
@@ -664,7 +665,7 @@ extension AppManager
     @available(iOS 14, *)
     func enableJIT(for installedApp: InstalledApp, completionHandler: @escaping (Result<Void, Error>) -> Void)
     {
-        class Context: OperationContext, EnableJITContext
+        final class Context: OperationContext, EnableJITContext
         {
             var installedApp: InstalledApp?
         }
@@ -684,7 +685,7 @@ extension AppManager
     @available(iOS 14.0, *)
     func patch(resignedApp: ALTApplication, presentingViewController: UIViewController, context authContext: AuthenticatedOperationContext, completionHandler: @escaping (Result<InstalledApp, Error>) -> Void) -> PatchAppOperation
     {
-        class Context: InstallAppOperationContext, PatchAppContext
+        final class Context: InstallAppOperationContext, PatchAppContext
         {
         }
         
@@ -758,7 +759,7 @@ extension AppManager
 extension AppManager
 {
     @discardableResult
-    func backgroundRefresh(_ installedApps: [InstalledApp], presentsNotifications: Bool = true, completionHandler: @escaping (Result<[String: Result<InstalledApp, Error>], Error>) -> Void) -> BackgroundRefreshAppsOperation
+    func backgroundRefresh(_ installedApps: [InstalledApp], presentsNotifications: Bool = false, completionHandler: @escaping (Result<[String: Result<InstalledApp, Error>], Error>) -> Void) -> BackgroundRefreshAppsOperation
     {
         let backgroundRefreshAppsOperation = BackgroundRefreshAppsOperation(installedApps: installedApps)
         backgroundRefreshAppsOperation.resultHandler = completionHandler
@@ -1121,7 +1122,7 @@ private extension AppManager
                             presentingViewController?.dismiss(animated: true, completion: nil)
                         }
                     }
-                    presentingViewController.present(navigationController, animated: true, completion: nil)
+                    presentingViewController.present(navigationController, animated: true, completion: nil)                    
                 }
             }
             catch
@@ -1223,7 +1224,7 @@ private extension AppManager
         let progress = Progress.discreteProgress(totalUnitCount: 100)
         
         let context = AppOperationContext(bundleIdentifier: app.bundleIdentifier, authenticatedContext: group.context)
-        context.app = ALTApplication(fileURL: app.url)
+        context.app = ALTApplication(fileURL: app.fileURL)
         
         /* Fetch Provisioning Profiles */
         let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
@@ -1662,13 +1663,8 @@ private extension AppManager
             }
             
             if #available(iOS 14, *)
-            {
-                WidgetCenter.shared.getCurrentConfigurations { (result) in
-                    guard case .success(let widgets) = result else { return }
-                    
-                    guard let widget = widgets.first(where: { $0.configuration is ViewAppIntent }) else { return }
-                    WidgetCenter.shared.reloadTimelines(ofKind: widget.kind)
-                }
+            {                
+                WidgetCenter.shared.reloadAllTimelines()
             }
             
             do { try installedApp.managedObjectContext?.save() }
@@ -1677,6 +1673,8 @@ private extension AppManager
         catch
         {
             group.set(.failure(error), forAppWithBundleIdentifier: operation.bundleIdentifier)
+            
+            self.log(error, for: operation)
         }
     }
     
@@ -1701,6 +1699,43 @@ private extension AppManager
         UNUserNotificationCenter.current().add(request)
     }
     
+    func log(_ error: Error, for operation: AppOperation)
+    {
+        // Sanitize NSError on same thread before performing background task.
+        let sanitizedError = (error as NSError).sanitizedForCoreData()
+        
+        let loggedErrorOperation: LoggedError.Operation = {
+            switch operation
+            {
+            case .install: return .install
+            case .update: return .update
+            case .refresh: return .refresh
+            case .activate: return .activate
+            case .deactivate: return .deactivate
+            case .backup: return .backup
+            case .restore: return .restore
+            }
+        }()
+                    
+        DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
+            var app = operation.app
+            if let managedApp = app as? NSManagedObject, let tempApp = context.object(with: managedApp.objectID) as? AppProtocol
+            {
+                app = tempApp
+            }
+            
+            do
+            {
+                _ = LoggedError(error: sanitizedError, app: app, operation: loggedErrorOperation, context: context)
+                try context.save()
+            }
+            catch let saveError
+            {
+                print("[ALTLog] Failed to log error \(sanitizedError.domain) code \(sanitizedError.code) for \(app.bundleIdentifier):", saveError)
+            }
+        }
+    }
+    
     func run(_ operations: [Foundation.Operation], context: OperationContext?, requiresSerialQueue: Bool = false)
     {
         // Find "Install AltStore" operation if it already exists in `context`

AltStore/My Apps/InstalledAppsCollectionHeaderView.swift

@@ -8,7 +8,7 @@
 
 import UIKit
 
-class InstalledAppsCollectionHeaderView: UICollectionReusableView
+final class InstalledAppsCollectionHeaderView: UICollectionReusableView
 {
     let textLabel: UILabel
     let button: UIButton

AltStore/My Apps/MyAppsComponents.swift

@@ -9,7 +9,7 @@
 import UIKit
 import Roxas
 
-class InstalledAppCollectionViewCell: UICollectionViewCell
+final class InstalledAppCollectionViewCell: UICollectionViewCell
 {
     private(set) var deactivateBadge: UIView?
     
@@ -55,13 +55,13 @@ class InstalledAppCollectionViewCell: UICollectionViewCell
     }
 }
 
-class InstalledAppsCollectionFooterView: UICollectionReusableView
+final class InstalledAppsCollectionFooterView: UICollectionReusableView
 {
     @IBOutlet var textLabel: UILabel!
     @IBOutlet var button: UIButton!
 }
 
-class NoUpdatesCollectionViewCell: UICollectionViewCell
+final class NoUpdatesCollectionViewCell: UICollectionViewCell
 {
     @IBOutlet var blurView: UIVisualEffectView!
     
@@ -73,7 +73,7 @@ class NoUpdatesCollectionViewCell: UICollectionViewCell
     }
 }
 
-class UpdatesCollectionHeaderView: UICollectionReusableView
+final class UpdatesCollectionHeaderView: UICollectionReusableView
 {
     let button = PillButton(type: .system)
     

AltStore/My Apps/MyAppsViewController.swift

@@ -30,7 +30,7 @@ extension MyAppsViewController
     }
 }
 
-class MyAppsViewController: UICollectionViewController
+final class MyAppsViewController: UICollectionViewController
 {
     private let coordinator = NSFileCoordinator()
     private let operationQueue = OperationQueue()
@@ -186,7 +186,7 @@ private extension MyAppsViewController
     func makeUpdatesDataSource() -> RSTFetchedResultsCollectionViewPrefetchingDataSource<InstalledApp, UIImage>
     {
         let fetchRequest = InstalledApp.updatesFetchRequest()
-        fetchRequest.sortDescriptors = [NSSortDescriptor(keyPath: \InstalledApp.storeApp?.versionDate, ascending: true),
+        fetchRequest.sortDescriptors = [NSSortDescriptor(keyPath: \InstalledApp.storeApp?.latestVersion?.date, ascending: true),
                                         NSSortDescriptor(keyPath: \InstalledApp.name, ascending: true)]
         fetchRequest.returnsObjectsAsFaults = false
         
@@ -195,7 +195,7 @@ private extension MyAppsViewController
         dataSource.cellIdentifierHandler = { _ in "UpdateCell" }
         dataSource.cellConfigurationHandler = { [weak self] (cell, installedApp, indexPath) in
             guard let self = self else { return }
-            guard let app = installedApp.storeApp else { return }
+            guard let app = installedApp.storeApp, let latestVersion = app.latestVersion else { return }
             
             let cell = cell as! UpdateCollectionViewCell
             cell.layoutMargins.left = self.view.layoutMargins.left
@@ -209,7 +209,7 @@ private extension MyAppsViewController
             
             cell.bannerView.configure(for: app)
             
-            let versionDate = Date().relativeDateString(since: app.versionDate, dateFormatter: self.dateFormatter)
+            let versionDate = Date().relativeDateString(since: latestVersion.date, dateFormatter: self.dateFormatter)
             cell.bannerView.subtitleLabel.text = versionDate
             
             let appName: String
@@ -223,7 +223,7 @@ private extension MyAppsViewController
                 appName = app.name
             }
             
-            cell.bannerView.accessibilityLabel = String(format: NSLocalizedString("%@ %@ update. Released on %@.", comment: ""), appName, app.version, versionDate)
+            cell.bannerView.accessibilityLabel = String(format: NSLocalizedString("%@ %@ update. Released on %@.", comment: ""), appName, latestVersion.version, versionDate)
             
             cell.bannerView.button.isIndicatingActivity = false
             cell.bannerView.button.addTarget(self, action: #selector(MyAppsViewController.updateApp(_:)), for: .primaryActionTriggered)
@@ -461,17 +461,10 @@ private extension MyAppsViewController
     
     func updateDataSource()
     {
-        if let patreonAccount = DatabaseManager.shared.patreonAccount(), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
-        {
+        
             self.dataSource.predicate = nil
-        }
-        else
-        {
-            self.dataSource.predicate = NSPredicate(format: "%K == nil OR %K == NO OR %K == %@",
-                                                    #keyPath(InstalledApp.storeApp),
-                                                    #keyPath(InstalledApp.storeApp.isBeta),
-                                                    #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
-        }
+        
+        
     }
 }
 

AltStore/My Apps/UpdateCollectionViewCell.swift

@@ -17,7 +17,7 @@ extension UpdateCollectionViewCell
     }
 }
 
-@objc class UpdateCollectionViewCell: UICollectionViewCell
+@objc final class UpdateCollectionViewCell: UICollectionViewCell
 {
     var mode: Mode = .expanded {
         didSet {

AltStore/News/NewsCollectionViewCell.swift

@@ -8,7 +8,7 @@
 
 import UIKit
 
-class NewsCollectionViewCell: UICollectionViewCell
+final class NewsCollectionViewCell: UICollectionViewCell
 {
     @IBOutlet var titleLabel: UILabel!
     @IBOutlet var captionLabel: UILabel!

AltStore/News/NewsViewController.swift

@@ -14,7 +14,7 @@ import Roxas
 
 import Nuke
 
-private class AppBannerFooterView: UICollectionReusableView
+private final class AppBannerFooterView: UICollectionReusableView
 {
     let bannerView = AppBannerView(frame: .zero)
     let tapGestureRecognizer = UITapGestureRecognizer(target: nil, action: nil)
@@ -41,7 +41,7 @@ private class AppBannerFooterView: UICollectionReusableView
     }
 }
 
-class NewsViewController: UICollectionViewController
+final class NewsViewController: UICollectionViewController
 {
     private lazy var dataSource = self.makeDataSource()
     private lazy var placeholderView = RSTPlaceholderView(frame: .zero)
@@ -391,7 +391,7 @@ extension NewsViewController
             let progress = AppManager.shared.installationProgress(for: storeApp)
             footerView.bannerView.button.progress = progress
             
-            if Date() < storeApp.versionDate
+            if let versionDate = storeApp.latestVersion?.date, versionDate > Date()
             {
                 footerView.bannerView.button.countdownDate = storeApp.versionDate
             }

AltStore/Operations/AuthenticationOperation.swift

@@ -34,7 +34,7 @@ enum AuthenticationError: LocalizedError
 }
 
 @objc(AuthenticationOperation)
-class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, ALTAppleAPISession)>
+final class AuthenticationOperation: ResultOperation<(ALTTeam, ALTCertificate, ALTAppleAPISession)>
 {
     let context: AuthenticatedOperationContext
     

AltStore/Operations/BackgroundRefreshAppsOperation.swift

@@ -51,12 +51,12 @@ private let ReceivedApplicationState: @convention(c) (CFNotificationCenter?, Uns
 }
 
 @objc(BackgroundRefreshAppsOperation)
-class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<InstalledApp, Error>]>
+final class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<InstalledApp, Error>]>
 {
     let installedApps: [InstalledApp]
     private let managedObjectContext: NSManagedObjectContext
     
-    var presentsFinishedNotification: Bool = true
+    var presentsFinishedNotification: Bool = false
     
     private let refreshIdentifier: String = UUID().uuidString
     private var runningApplications: Set<String> = []
@@ -189,12 +189,12 @@ private extension BackgroundRefreshAppsOperation
             
             let content = UNMutableNotificationContent()
             
-            var shouldPresentAlert = true
+            var shouldPresentAlert = false
             
             do
             {
                 let results = try result.get()
-                shouldPresentAlert = !results.isEmpty
+                shouldPresentAlert = false
                 
                 for (_, result) in results
                 {
@@ -216,7 +216,7 @@ private extension BackgroundRefreshAppsOperation
                 content.title = NSLocalizedString("Failed to Refresh Apps", comment: "")
                 content.body = error.localizedDescription
                 
-                shouldPresentAlert = true
+                shouldPresentAlert = false
             }
             
             if shouldPresentAlert

AltStore/Operations/DeactivateAppOperation.swift

@@ -14,7 +14,7 @@ import Roxas
 import minimuxer
 
 @objc(DeactivateAppOperation)
-class DeactivateAppOperation: ResultOperation<InstalledApp>
+final class DeactivateAppOperation: ResultOperation<InstalledApp>
 {
     let app: InstalledApp
     let context: OperationContext

AltStore/Operations/DownloadAppOperation.swift

@@ -30,13 +30,13 @@ private extension DownloadAppOperation
 }
 
 @objc(DownloadAppOperation)
-class DownloadAppOperation: ResultOperation<ALTApplication>
+final class DownloadAppOperation: ResultOperation<ALTApplication>
 {
     let app: AppProtocol
     let context: AppOperationContext
     
     private let bundleIdentifier: String
-    private let sourceURL: URL
+    private var sourceURL: URL?
     private let destinationURL: URL
     
     private let session = URLSession(configuration: .default)
@@ -69,7 +69,9 @@ class DownloadAppOperation: ResultOperation<ALTApplication>
         
         print("Downloading App:", self.bundleIdentifier)
         
-        self.downloadApp(from: self.sourceURL) { result in
+        guard let sourceURL = self.sourceURL else { return self.finish(.failure(OperationError.appNotFound)) }
+        
+        self.downloadApp(from: sourceURL) { result in
             do
             {
                 let application = try result.get()
@@ -165,7 +167,7 @@ private extension DownloadAppOperation
             }
         }
         
-        if self.sourceURL.isFileURL
+        if sourceURL.isFileURL
         {
             finishOperation(.success(sourceURL))
             

AltStore/Operations/EnableJITOperation.swift

@@ -21,7 +21,7 @@ protocol EnableJITContext
 }
 
 @available(iOS 14, *)
-class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
+final class EnableJITOperation<Context: EnableJITContext>: ResultOperation<Void>
 {
     let context: Context
     

AltStore/Operations/FetchAnisetteDataOperation.swift

@@ -13,7 +13,7 @@ import AltSign
 import Roxas
 
 @objc(FetchAnisetteDataOperation)
-class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>
+final class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>
 {
     let context: OperationContext
     
@@ -47,6 +47,7 @@ class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>
                     let formattedJSON: [String: String] = ["machineID": json["X-Apple-I-MD-M"]!, "oneTimePassword": json["X-Apple-I-MD"]!, "localUserID": json["X-Apple-I-MD-LU"]!, "routingInfo": json["X-Apple-I-MD-RINFO"]!, "deviceUniqueIdentifier": json["X-Mme-Device-Id"]!, "deviceDescription": json["X-MMe-Client-Info"]!, "date": json["X-Apple-I-Client-Time"]!, "locale": json["X-Apple-Locale"]!, "timeZone": json["X-Apple-I-TimeZone"]!, "deviceSerialNumber": "1"]
                     
                     if let anisette = ALTAnisetteData(json: formattedJSON) {
+                        DLOG("Anisette used: %@", formattedJSON)
                         self.finish(.success(anisette))
                     }
                 }

AltStore/Operations/FetchAppIDsOperation.swift

@@ -13,7 +13,7 @@ import AltSign
 import Roxas
 
 @objc(FetchAppIDsOperation)
-class FetchAppIDsOperation: ResultOperation<([AppID], NSManagedObjectContext)>
+final class FetchAppIDsOperation: ResultOperation<([AppID], NSManagedObjectContext)>
 {
     let context: AuthenticatedOperationContext
     let managedObjectContext: NSManagedObjectContext

AltStore/Operations/FetchProvisioningProfilesOperation.swift

@@ -13,7 +13,7 @@ import AltSign
 import Roxas
 
 @objc(FetchProvisioningProfilesOperation)
-class FetchProvisioningProfilesOperation: ResultOperation<[String: ALTProvisioningProfile]>
+final class FetchProvisioningProfilesOperation: ResultOperation<[String: ALTProvisioningProfile]>
 {
     let context: AppOperationContext
     
@@ -131,19 +131,19 @@ extension FetchProvisioningProfilesOperation
                 // or if installedApp.team is nil but resignedBundleIdentifier contains the team's identifier.
                 let teamsMatch = installedApp.team?.identifier == team.identifier || (installedApp.team == nil && installedApp.resignedBundleIdentifier.contains(team.identifier))
                 
-                #if DEBUG
-                
-                if app.isAltStoreApp
-                {
-                    // Use legacy bundle ID format for AltStore.
-                    preferredBundleID = teamsMatch ? installedApp.resignedBundleIdentifier : nil
-                }
-                else
-                {
-                    preferredBundleID = teamsMatch ? installedApp.resignedBundleIdentifier : nil
-                }
-                
-                #else
+//                #if DEBUG
+//
+//                if app.isAltStoreApp
+//                {
+//                    // Use legacy bundle ID format for AltStore.
+//                    preferredBundleID = teamsMatch ? installedApp.resignedBundleIdentifier : nil
+//                }
+//                else
+//                {
+//                    preferredBundleID = teamsMatch ? installedApp.resignedBundleIdentifier : nil
+//                }
+//
+//                #else
                 
                 if teamsMatch
                 {
@@ -157,7 +157,7 @@ extension FetchProvisioningProfilesOperation
                     preferredBundleID = nil
                 }
                 
-                #endif
+               // #endif
             }
             else
             {

AltStore/Operations/FetchSourceOperation.swift

@@ -13,7 +13,7 @@ import AltStoreCore
 import Roxas
 
 @objc(FetchSourceOperation)
-class FetchSourceOperation: ResultOperation<Source>
+final class FetchSourceOperation: ResultOperation<Source>
 {
     let sourceURL: URL
     let managedObjectContext: NSManagedObjectContext

AltStore/Operations/FetchTrustedSourcesOperation.swift

@@ -32,7 +32,7 @@ extension FetchTrustedSourcesOperation
     }
 }
 
-class FetchTrustedSourcesOperation: ResultOperation<[FetchTrustedSourcesOperation.TrustedSource]>
+final class FetchTrustedSourcesOperation: ResultOperation<[FetchTrustedSourcesOperation.TrustedSource]>
 {
     override func main()
     {

AltStore/Operations/InstallAppOperation.swift

@@ -13,7 +13,7 @@ import AltSign
 import Roxas
 
 @objc(InstallAppOperation)
-class InstallAppOperation: ResultOperation<InstalledApp>
+final class InstallAppOperation: ResultOperation<InstalledApp>
 {
     let context: InstallAppOperationContext
     
@@ -86,6 +86,11 @@ class InstallAppOperation: ResultOperation<InstalledApp>
                     let resignedBundleID = appExtension.bundleIdentifier
                     let originalBundleID = resignedBundleID.replacingOccurrences(of: resignedParentBundleID, with: parentBundleID)
                     
+                    print("`parentBundleID`: \(parentBundleID)")
+                    print("`resignedParentBundleID`: \(resignedParentBundleID)")
+                    print("`resignedBundleID`: \(resignedBundleID)")
+                    print("`originalBundleID`: \(originalBundleID)")
+                    
                     let installedExtension: InstalledExtension
                     
                     if let appExtension = installedApp.appExtensions.first(where: { $0.bundleIdentifier == originalBundleID })

AltStore/Operations/OperationContexts.swift

@@ -38,7 +38,7 @@ class OperationContext
     }
 }
 
-class AuthenticatedOperationContext: OperationContext
+final class AuthenticatedOperationContext: OperationContext
 {
     var session: ALTAppleAPISession?
     

AltStore/Operations/OperationError.swift

@@ -11,6 +11,8 @@ import AltSign
 
 enum OperationError: LocalizedError
 {
+    static let domain = OperationError.unknown._domain
+    
     case unknown
     case unknownResult
     case cancelled

AltStore/Operations/Patch App/PatchAppOperation.swift

@@ -52,7 +52,7 @@ private struct OTAUpdate
 }
 
 @available(iOS 14, *)
-class PatchAppOperation: ResultOperation<Void>
+final class PatchAppOperation: ResultOperation<Void>
 {
     let context: PatchAppContext
     

AltStore/Operations/Patch App/PatchViewController.swift

@@ -29,7 +29,7 @@ extension PatchViewController
 }
 
 @available(iOS 14.0, *)
-class PatchViewController: UIViewController
+final class PatchViewController: UIViewController
 {
     var patchApp: AnyApp?
     var installedApp: InstalledApp?

AltStore/Operations/RefreshAppOperation.swift

@@ -14,7 +14,7 @@ import Roxas
 import minimuxer
 
 @objc(RefreshAppOperation)
-class RefreshAppOperation: ResultOperation<InstalledApp>
+final class RefreshAppOperation: ResultOperation<InstalledApp>
 {
     let context: AppOperationContext
     

AltStore/Operations/RefreshGroup.swift

@@ -12,7 +12,7 @@ import CoreData
 import AltStoreCore
 import AltSign
 
-class RefreshGroup: NSObject
+final class RefreshGroup: NSObject
 {
     let context: AuthenticatedOperationContext
     let progress = Progress.discreteProgress(totalUnitCount: 0)

AltStore/Operations/RemoveAppBackupOperation.swift

@@ -9,7 +9,7 @@
 import Foundation
 
 @objc(RemoveAppBackupOperation)
-class RemoveAppBackupOperation: ResultOperation<Void>
+final class RemoveAppBackupOperation: ResultOperation<Void>
 {
     let context: InstallAppOperationContext
     

AltStore/Operations/RemoveAppOperation.swift

@@ -12,7 +12,7 @@ import AltStoreCore
 import minimuxer
 
 @objc(RemoveAppOperation)
-class RemoveAppOperation: ResultOperation<InstalledApp>
+final class RemoveAppOperation: ResultOperation<InstalledApp>
 {
     let context: InstallAppOperationContext
     

AltStore/Operations/ResignAppOperation.swift

@@ -13,7 +13,7 @@ import AltStoreCore
 import AltSign
 
 @objc(ResignAppOperation)
-class ResignAppOperation: ResultOperation<ALTApplication>
+final class ResignAppOperation: ResultOperation<ALTApplication>
 {
     let context: InstallAppOperationContext
     

AltStore/Operations/SendAppOperation.swift

@@ -11,7 +11,7 @@ import Network
 import AltStoreCore
 
 @objc(SendAppOperation)
-class SendAppOperation: ResultOperation<()>
+final class SendAppOperation: ResultOperation<()>
 {
     let context: InstallAppOperationContext
     
@@ -39,9 +39,10 @@ class SendAppOperation: ResultOperation<()>
         guard let resignedApp = self.context.resignedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
         
         // self.context.resignedApp.fileURL points to the app bundle, but we want the .ipa.
-        let app = AnyApp(name: resignedApp.name, bundleIdentifier: self.context.bundleIdentifier, url: resignedApp.url)
+        let app = AnyApp(name: resignedApp.name, bundleIdentifier: self.context.bundleIdentifier, url: resignedApp.fileURL)
         let fileURL = InstalledApp.refreshedIPAURL(for: app)
         
+        print("AFC App `fileURL`: \(fileURL.absoluteString)")
         
         let ns_bundle = NSString(string: app.bundleIdentifier)
         let ns_bundle_ptr = UnsafeMutablePointer<CChar>(mutating: ns_bundle.utf8String)
@@ -53,6 +54,7 @@ class SendAppOperation: ResultOperation<()>
             }
             let res = minimuxer_yeet_app_afc(ns_bundle_ptr, pls, UInt(data.length))
             if res == 0 {
+                print("minimuxer_yeet_app_afc `res` == \(res)")
                 self.progress.completedUnitCount += 1
                 self.finish(.success(()))
             } else {

AltStore/Operations/UpdatePatronsOperation.swift

@@ -30,7 +30,7 @@ extension UpdatePatronsOperation
     }
 }
 
-class UpdatePatronsOperation: ResultOperation<Void>
+final class UpdatePatronsOperation: ResultOperation<Void>
 {
     let context: NSManagedObjectContext
     

AltStore/Operations/VerifyAppOperation.swift

@@ -55,7 +55,7 @@ enum VerificationError: ALTLocalizedError
 }
 
 @objc(VerifyAppOperation)
-class VerifyAppOperation: ResultOperation<Void>
+final class VerifyAppOperation: ResultOperation<Void>
 {
     let context: AppOperationContext
     var verificationHandler: ((VerificationError) -> Bool)?

AltStore/Resources/Assets.xcassets/Colors/SettingsBackground.colorset/Contents.json

@@ -5,9 +5,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "255",
-          "green" : "67",
-          "red" : "128"
+          "blue" : "175",
+          "green" : "4",
+          "red" : "115"
         }
       },
       "idiom" : "universal"
@@ -23,9 +23,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "103",
-          "green" : "0",
-          "red" : "60"
+          "blue" : "150",
+          "green" : "3",
+          "red" : "99"
         }
       },
       "idiom" : "universal"

AltStore/Resources/Assets.xcassets/Colors/SettingsHighlighted.colorset/Contents.json

@@ -5,9 +5,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "103",
-          "green" : "0",
-          "red" : "60"
+          "blue" : "150",
+          "green" : "3",
+          "red" : "99"
         }
       },
       "idiom" : "universal"
@@ -23,9 +23,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "255",
-          "green" : "67",
-          "red" : "128"
+          "blue" : "175",
+          "green" : "4",
+          "red" : "115"
         }
       },
       "idiom" : "universal"

AltStore/Resources/Assets.xcassets/Permissions/BackgroundAudioPermission.imageset/Contents.json

@@ -1,22 +0,0 @@
-{
-  "images" : [
-    {
-      "idiom" : "universal",
-      "scale" : "1x"
-    },
-    {
-      "idiom" : "universal",
-      "filename" : "sound@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "idiom" : "universal",
-      "filename" : "sound@3x.png",
-      "scale" : "3x"
-    }
-  ],
-  "info" : {
-    "version" : 1,
-    "author" : "xcode"
-  }
-}