WireGuard add extra source files

Signed-off-by: Joseph Mattello <mail@joemattiello.com>

.github/CODEOWNERS

@@ -1 +1 @@
-*       @JoeMatt @lonkelle @jkcoxson
+*       @JoeMatt @lonkelle

.github/ISSUE_TEMPLATE/bug_report.md

@@ -0,0 +1,34 @@
+---
+name: Bug report
+about: Create a report to help us improve
+title: "[BUG]"
+labels: bug
+assignees: ''
+
+---
+
+**Describe the bug**
+A clear and concise description of what the bug is.
+
+**To Reproduce**
+Steps to reproduce the behavior:
+1. Go to '...'
+2. Click on '....'
+3. Scroll down to '....'
+4. See error
+
+**Expected behavior**
+A clear and concise description of what you expected to happen.
+
+**Screenshots**
+If applicable, add screenshots to help explain your problem.
+
+**Logs**
+Please send logs generated with [idevicedebug](https://github.com/libimobiledevice/libimobiledevice) or Xcode. We will close the issue if a log is missing.
+
+**iDevice (please complete the following information):**
+ - Device: [e.g. iPhone6]
+ - OS: [e.g. iOS8.1]
+
+**Additional context**
+Add any other context about the problem here.

.github/workflows/beta.yml

@@ -0,0 +1,156 @@
+name: Beta SideStore build
+on:
+  push:
+    branches:
+      - develop
+
+jobs:
+  build:
+    name: Build and upload SideStore Beta
+    if: startsWith(github.event.head_commit.message, '[beta]')
+    concurrency:
+      group: ${{ github.ref }}
+      cancel-in-progress: true
+    strategy:
+      fail-fast: false
+      matrix:
+        include:
+          - os: 'macos-12'
+            version: '14.2'
+
+    runs-on: ${{ matrix.os }}
+    steps:
+      - name: Checkout code
+        uses: actions/checkout@v2
+        with:
+          submodules: recursive
+
+      # - name: Cache rust cargo
+      #   id: cache-rust-cargo
+      #   uses: actions/cache@v3
+      #   env:
+      #     cache-name: cache-rust-cargo
+      #   with:
+      #     path: ~/.cargo
+      #     key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
+      #     restore-keys: |
+      #       ${{ runner.os }}-build-${{ env.cache-name }}-
+      #       ${{ runner.os }}-build-
+      #       ${{ runner.os }}-
+
+      # - name: Cache rust minimuxer
+      #   id: cache-rust-minimuxer
+      #   uses: actions/cache@v3
+      #   env:
+      #     cache-name: cache-rust-minimuxer
+      #   with:
+      #     path: ./Dependencies/minimuxer/target
+      #     key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
+      #     restore-keys: |
+      #       ${{ runner.os }}-build-${{ env.cache-name }}-
+      #       ${{ runner.os }}-build-
+      #       ${{ runner.os }}-
+
+      # - name: Cache rust em_proxy
+      #   id: cache-rust-em_proxy
+      #   uses: actions/cache@v3
+      #   env:
+      #     cache-name: cache-rust-em_proxy
+      #   with:
+      #     path: ./Dependencies/em_proxy/target
+      #     key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
+      #     restore-keys: |
+      #       ${{ runner.os }}-build-${{ env.cache-name }}-
+      #       ${{ runner.os }}-build-
+      #       ${{ runner.os }}-
+
+      - name: Install dependencies
+        run: brew install ldid
+
+      - name: Install rustup
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: stable
+          override: true
+          target: aarch64-apple-ios
+
+      # - name: Create emotional damage
+      #   run: cd Dependencies/em_proxy && cargo build --release --target aarch64-apple-ios
+
+      # - name: Build minimuxer
+      #   run: cd Dependencies/minimuxer && cargo build --release --target aarch64-apple-ios
+
+      - name: Add beta suffix to version
+        run: sed -e '/MARKETING_VERSION = .*/s/$/-beta.${{ github.run_number }}/' -i '' Build.xcconfig
+
+      - name: Setup Xcode
+        uses: maxim-lobanov/setup-xcode@v1.4.1
+        with:
+          xcode-version: ${{ matrix.version }}
+
+      - name: Build SideStore
+        run: |
+          xcodebuild -project AltStore.xcodeproj \
+          -scheme AltStore \
+          -sdk iphoneos \
+          archive -archivePath ./archive \
+          CODE_SIGNING_REQUIRED=NO \
+          AD_HOC_CODE_SIGNING_ALLOWED=YES \
+          CODE_SIGNING_ALLOWED=NO \
+          DEVELOPMENT_TEAM=XYZ0123456 \
+          ORG_IDENTIFIER=com.SideStore \
+          | xcpretty && exit ${PIPESTATUS[0]}
+
+      - name: Fakesign app
+        run: |
+          rm -rf archive.xcarchive/Products/Applications/SideStore.app/Frameworks/AltStoreCore.framework/Frameworks/
+          ldid -SAltStore/Resources/tempEnt.plist archive.xcarchive/Products/Applications/SideStore.app/SideStore
+
+      - name: Convert to IPA
+        run: |
+          mkdir Payload
+          mkdir Payload/SideStore.app
+          cp -R archive.xcarchive/Products/Applications/SideStore.app/ Payload/SideStore.app/
+          zip -r SideStore.ipa Payload
+
+      - name: Upload Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore.ipa
+          path: SideStore.ipa
+
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Get current date
+        id: date
+        run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
+
+      - name: Get current date in AltStore date form
+        id: date_altstore
+        run: echo "date=$(date -u +'%Y-%m-%d')" >> $GITHUB_OUTPUT
+
+      - name: Upload to beta release
+        uses: IsaacShelton/update-existing-release@v1.3.1
+        with:
+          token: ${{ secrets.GITHUB_TOKEN }}
+          release: "Beta"
+          tag: "beta"
+          prerelease: true
+          files: SideStore.ipa
+          body: |
+            This is an ⚠️ **EXPERIMENTAL** ⚠️ beta build for commit [${{ github.sha }}](https://github.com/${{ github.repository }}/commit/${{ github.sha }}).
+            
+            Beta builds are hand-picked builds from development commits that will allow you to try out new features earlier than normal, but with a lower chance of bugs than if you used nightly builds. However, since these changes are newer and less tested, they still have a good chance of bugs, so **use at your own risk**.
+            
+            If you want to be on the bleeding edge and use the latest development builds, you can look at [SideStore Nightly](https://github.com/${{ github.repository }}/releases/tag/nightly). **Please be aware that these builds have a much higher chance of bugs than beta or stable**.
+            
+            If you use the `SideStore (Beta)` app, it will use the latest beta build (make sure to update it in "My Apps").
+            
+            ## Build Info
+            
+            Built at (UTC): `${{ steps.date.outputs.date }}`
+            Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
+            Commit SHA: `${{ github.sha }}`
+            Version: `${{ steps.version.outputs.version }}`

.github/workflows/build.yml

@@ -1,100 +0,0 @@
-name: Build and Upload SideStore
-on: 
-  push:
-    branches:
-      - master
-      - develop
-  pull_request:
-  
-jobs:
-  build:
-    name: Build and upload SideStore
-    strategy:
-      fail-fast: false
-      matrix:
-        include:
-          - os: 'macos-12'
-            version: '14.0.0'
-    
-    runs-on: ${{ matrix.os }}
-    steps:
-      - name: Checkout code
-        uses: actions/checkout@v2
-        with:
-          submodules: recursive
-
-      - name: Cache rust cargo
-        id: cache-rust-cargo
-        uses: actions/cache@v3
-        env:
-          cache-name: cache-rust-cargo
-        with:
-          path: ~/.cargo
-          key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
-          restore-keys: |
-            ${{ runner.os }}-build-${{ env.cache-name }}-
-            ${{ runner.os }}-build-
-            ${{ runner.os }}-
-
-      - name: Cache rust minimuxer
-        id: cache-rust-minimuxer
-        uses: actions/cache@v3
-        env:
-          cache-name: cache-rust-minimuxer
-        with:
-          path: ./Dependencies/minimuxer/target
-          key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
-          restore-keys: |
-            ${{ runner.os }}-build-${{ env.cache-name }}-
-            ${{ runner.os }}-build-
-            ${{ runner.os }}-
-
-      - name: Cache rust em_proxy
-        id: cache-rust-em_proxy
-        uses: actions/cache@v3
-        env:
-          cache-name: cache-rust-em_proxy
-        with:
-          path: ./Dependencies/em_proxy/target
-          key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
-          restore-keys: |
-            ${{ runner.os }}-build-${{ env.cache-name }}-
-            ${{ runner.os }}-build-
-            ${{ runner.os }}-
-
-      - name: Install dependencies
-        run: brew install ldid
-      - name: Install rustup
-        uses: actions-rs/toolchain@v1
-        with:
-          toolchain: stable
-          override: true
-          target: aarch64-apple-ios
-      - name: Create emotional damage
-        run: cd Dependencies/em_proxy && cargo build --release --target aarch64-apple-ios
-      - name: Build minimuxer
-        run: cd Dependencies/minimuxer && cargo build --release --target aarch64-apple-ios
-      - name: Setup Xcode
-        uses: maxim-lobanov/setup-xcode@v1.4.1
-        with:
-          xcode-version: ${{ matrix.version }}
-      - name: Build SideStore
-        run: |
-          rm -rf ~/Library/Developer/Xcode/DerivedData/
-          rm ./AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved 
-          xcodebuild -project AltStore.xcodeproj -scheme AltStore -sdk iphoneos archive -archivePath ./archive CODE_SIGNING_REQUIRED=NO AD_HOC_CODE_SIGNING_ALLOWED=YES CODE_SIGNING_ALLOWED=NO DEVELOPMENT_TEAM=XYZ0123456 ORG_IDENTIFIER=com.SideStore | xcpretty && exit ${PIPESTATUS[0]}
-      - name: Fakesign app
-        run: | 
-          rm -rf archive.xcarchive/Products/Applications/SideStore.app/Frameworks/AltStoreCore.framework/Frameworks/
-          ldid -SAltStore/Resources/tempEnt.plist archive.xcarchive/Products/Applications/SideStore.app/SideStore
-      - name: Convert to IPA
-        run: | 
-          mkdir Payload
-          mkdir Payload/SideStore.app
-          cp -R archive.xcarchive/Products/Applications/SideStore.app/ Payload/SideStore.app/
-          zip -r SideStore.ipa Payload
-      - name: Upload Artifact
-        uses: actions/upload-artifact@v3.1.0
-        with:
-          name: SideStore.ipa
-          path: SideStore.ipa

.github/workflows/nightly.yml

@@ -0,0 +1,155 @@
+name: Nightly SideStore build
+on:
+  push:
+    branches:
+      - develop
+
+jobs:
+  build:
+    name: Build and upload SideStore Nightly
+    concurrency:
+      group: ${{ github.ref }}
+      cancel-in-progress: true
+    strategy:
+      fail-fast: false
+      matrix:
+        include:
+          - os: 'macos-12'
+            version: '14.2'
+
+    runs-on: ${{ matrix.os }}
+    steps:
+      - name: Checkout code
+        uses: actions/checkout@v2
+        with:
+          submodules: recursive
+
+      # - name: Cache rust cargo
+      #   id: cache-rust-cargo
+      #   uses: actions/cache@v3
+      #   env:
+      #     cache-name: cache-rust-cargo
+      #   with:
+      #     path: ~/.cargo
+      #     key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
+      #     restore-keys: |
+      #       ${{ runner.os }}-build-${{ env.cache-name }}-
+      #       ${{ runner.os }}-build-
+      #       ${{ runner.os }}-
+
+      # - name: Cache rust minimuxer
+      #   id: cache-rust-minimuxer
+      #   uses: actions/cache@v3
+      #   env:
+      #     cache-name: cache-rust-minimuxer
+      #   with:
+      #     path: ./Dependencies/minimuxer/target
+      #     key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
+      #     restore-keys: |
+      #       ${{ runner.os }}-build-${{ env.cache-name }}-
+      #       ${{ runner.os }}-build-
+      #       ${{ runner.os }}-
+
+      # - name: Cache rust em_proxy
+      #   id: cache-rust-em_proxy
+      #   uses: actions/cache@v3
+      #   env:
+      #     cache-name: cache-rust-em_proxy
+      #   with:
+      #     path: ./Dependencies/em_proxy/target
+      #     key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
+      #     restore-keys: |
+      #       ${{ runner.os }}-build-${{ env.cache-name }}-
+      #       ${{ runner.os }}-build-
+      #       ${{ runner.os }}-
+
+      - name: Install dependencies
+        run: brew install ldid
+
+      - name: Install rustup
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: stable
+          override: true
+          target: aarch64-apple-ios
+
+      # - name: Create emotional damage
+      #   run: cd Dependencies/em_proxy && cargo build --release --target aarch64-apple-ios
+
+      # - name: Build minimuxer
+      #   run: cd Dependencies/minimuxer && cargo build --release --target aarch64-apple-ios
+
+      - name: Add nightly suffix to version
+        run: sed -e '/MARKETING_VERSION = .*/s/$/-nightly.${{ github.run_number }}/' -i '' Build.xcconfig
+
+      - name: Setup Xcode
+        uses: maxim-lobanov/setup-xcode@v1.4.1
+        with:
+          xcode-version: ${{ matrix.version }}
+
+      - name: Build SideStore
+        run: |
+          xcodebuild -project AltStore.xcodeproj \
+          -scheme AltStore \
+          -sdk iphoneos \
+          archive -archivePath ./archive \
+          CODE_SIGNING_REQUIRED=NO \
+          AD_HOC_CODE_SIGNING_ALLOWED=YES \
+          CODE_SIGNING_ALLOWED=NO \
+          DEVELOPMENT_TEAM=XYZ0123456 \
+          ORG_IDENTIFIER=com.SideStore \
+          | xcpretty && exit ${PIPESTATUS[0]}
+
+      - name: Fakesign app
+        run: |
+          rm -rf archive.xcarchive/Products/Applications/SideStore.app/Frameworks/AltStoreCore.framework/Frameworks/
+          ldid -SAltStore/Resources/tempEnt.plist archive.xcarchive/Products/Applications/SideStore.app/SideStore
+
+      - name: Convert to IPA
+        run: |
+          mkdir Payload
+          mkdir Payload/SideStore.app
+          cp -R archive.xcarchive/Products/Applications/SideStore.app/ Payload/SideStore.app/
+          zip -r SideStore.ipa Payload
+
+      - name: Upload Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore.ipa
+          path: SideStore.ipa
+
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Get current date
+        id: date
+        run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
+
+      - name: Get current date in AltStore date form
+        id: date_altstore
+        run: echo "date=$(date -u +'%Y-%m-%d')" >> $GITHUB_OUTPUT
+
+      - name: Upload to nightly release
+        uses: IsaacShelton/update-existing-release@v1.3.1
+        with:
+          token: ${{ secrets.GITHUB_TOKEN }}
+          release: "Nightly"
+          tag: "nightly"
+          prerelease: true
+          files: SideStore.ipa
+          body: |
+            This is an ⚠️ **EXPERIMENTAL** ⚠️ nightly build for commit [${{ github.sha }}](https://github.com/${{ github.repository }}/commit/${{ github.sha }}).
+            
+            Nightly builds are built from the most recent commit which means you'll be able to try out new features very early. However, since these changes are much newer and less tested, they have a much higher chance of bugs, so **use at your own risk**.
+            
+            If you want to try out new features early but want a lower chance of bugs, you can look at [SideStore Beta](https://github.com/${{ github.repository }}/releases/tag/beta).
+            
+            If you use the `SideStore (Nightly)` app, it will use the latest nightly build (make sure to update it in "My Apps").
+            
+            ## Build Info
+            
+            Built at (UTC): `${{ steps.date.outputs.date }}`
+            Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
+            Commit SHA: `${{ github.sha }}`
+            Version: `${{ steps.version.outputs.version }}`

.github/workflows/pr.yml

@@ -0,0 +1,111 @@
+name: Pull Request SideStore build
+on:
+  pull_request:
+
+jobs:
+  build:
+    name: Build and upload SideStore
+    strategy:
+      fail-fast: false
+      matrix:
+        include:
+          - os: 'macos-12'
+            version: '14.2'
+
+    runs-on: ${{ matrix.os }}
+    steps:
+      - name: Checkout code
+        uses: actions/checkout@v2
+        with:
+          submodules: recursive
+
+      # - name: Cache rust cargo
+      #   id: cache-rust-cargo
+      #   uses: actions/cache@v3
+      #   env:
+      #     cache-name: cache-rust-cargo
+      #   with:
+      #     path: ~/.cargo
+      #     key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
+      #     restore-keys: |
+      #       ${{ runner.os }}-build-${{ env.cache-name }}-
+      #       ${{ runner.os }}-build-
+      #       ${{ runner.os }}-
+
+      # - name: Cache rust minimuxer
+      #   id: cache-rust-minimuxer
+      #   uses: actions/cache@v3
+      #   env:
+      #     cache-name: cache-rust-minimuxer
+      #   with:
+      #     path: ./Dependencies/minimuxer/target
+      #     key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
+      #     restore-keys: |
+      #       ${{ runner.os }}-build-${{ env.cache-name }}-
+      #       ${{ runner.os }}-build-
+      #       ${{ runner.os }}-
+
+      # - name: Cache rust em_proxy
+      #   id: cache-rust-em_proxy
+      #   uses: actions/cache@v3
+      #   env:
+      #     cache-name: cache-rust-em_proxy
+      #   with:
+      #     path: ./Dependencies/em_proxy/target
+      #     key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
+      #     restore-keys: |
+      #       ${{ runner.os }}-build-${{ env.cache-name }}-
+      #       ${{ runner.os }}-build-
+      #       ${{ runner.os }}-
+
+      - name: Install dependencies
+        run: brew install ldid
+
+      - name: Install rustup
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: stable
+          override: true
+          target: aarch64-apple-ios
+
+      # - name: Create emotional damage
+      #   run: cd Dependencies/em_proxy && cargo build --release --target aarch64-apple-ios
+
+      # - name: Build minimuxer
+      #   run: cd Dependencies/minimuxer && cargo build --release --target aarch64-apple-ios
+
+      - name: Setup Xcode
+        uses: maxim-lobanov/setup-xcode@v1.4.1
+        with:
+          xcode-version: ${{ matrix.version }}
+
+      - name: Build SideStore
+        run: |
+          xcodebuild -project AltStore.xcodeproj \
+          -scheme AltStore \
+          -sdk iphoneos \
+          archive -archivePath ./archive \
+          CODE_SIGNING_REQUIRED=NO \
+          AD_HOC_CODE_SIGNING_ALLOWED=YES \
+          CODE_SIGNING_ALLOWED=NO \
+          DEVELOPMENT_TEAM=XYZ0123456 \
+          ORG_IDENTIFIER=com.SideStore \
+          | xcpretty && exit ${PIPESTATUS[0]}
+
+      - name: Fakesign app
+        run: |
+          rm -rf archive.xcarchive/Products/Applications/SideStore.app/Frameworks/AltStoreCore.framework/Frameworks/
+          ldid -SAltStore/Resources/tempEnt.plist archive.xcarchive/Products/Applications/SideStore.app/SideStore
+
+      - name: Convert to IPA
+        run: |
+          mkdir Payload
+          mkdir Payload/SideStore.app
+          cp -R archive.xcarchive/Products/Applications/SideStore.app/ Payload/SideStore.app/
+          zip -r SideStore.ipa Payload
+
+      - name: Upload Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore.ipa
+          path: SideStore.ipa

.github/workflows/stable.yml

@@ -0,0 +1,145 @@
+name: Stable SideStore build
+on:
+  push:
+    tags:
+      - '[0-9]+.[0-9]+.[0-9]+*'
+
+jobs:
+  build:
+    name: Build and upload SideStore
+    strategy:
+      fail-fast: false
+      matrix:
+        include:
+          - os: 'macos-12'
+            version: '14.2'
+
+    runs-on: ${{ matrix.os }}
+    steps:
+      - name: Checkout code
+        uses: actions/checkout@v2
+        with:
+          submodules: recursive
+
+      # - name: Cache rust cargo
+      #   id: cache-rust-cargo
+      #   uses: actions/cache@v3
+      #   env:
+      #     cache-name: cache-rust-cargo
+      #   with:
+      #     path: ~/.cargo
+      #     key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
+      #     restore-keys: |
+      #       ${{ runner.os }}-build-${{ env.cache-name }}-
+      #       ${{ runner.os }}-build-
+      #       ${{ runner.os }}-
+
+      # - name: Cache rust minimuxer
+      #   id: cache-rust-minimuxer
+      #   uses: actions/cache@v3
+      #   env:
+      #     cache-name: cache-rust-minimuxer
+      #   with:
+      #     path: ./Dependencies/minimuxer/target
+      #     key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
+      #     restore-keys: |
+      #       ${{ runner.os }}-build-${{ env.cache-name }}-
+      #       ${{ runner.os }}-build-
+      #       ${{ runner.os }}-
+
+      # - name: Cache rust em_proxy
+      #   id: cache-rust-em_proxy
+      #   uses: actions/cache@v3
+      #   env:
+      #     cache-name: cache-rust-em_proxy
+      #   with:
+      #     path: ./Dependencies/em_proxy/target
+      #     key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('**/package-lock.json') }}
+      #     restore-keys: |
+      #       ${{ runner.os }}-build-${{ env.cache-name }}-
+      #       ${{ runner.os }}-build-
+      #       ${{ runner.os }}-
+
+      - name: Install dependencies
+        run: brew install ldid
+
+      - name: Install rustup
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: stable
+          override: true
+          target: aarch64-apple-ios
+
+      # - name: Create emotional damage
+      #   run: cd Dependencies/em_proxy && cargo build --release --target aarch64-apple-ios
+
+      # - name: Build minimuxer
+      #   run: cd Dependencies/minimuxer && cargo build --release --target aarch64-apple-ios
+
+      - name: Setup Xcode
+        uses: maxim-lobanov/setup-xcode@v1.4.1
+        with:
+          xcode-version: ${{ matrix.version }}
+
+      - name: Build SideStore
+        run: |
+          xcodebuild -project AltStore.xcodeproj \
+          -scheme AltStore \
+          -sdk iphoneos \
+          archive -archivePath ./archive \
+          CODE_SIGNING_REQUIRED=NO \
+          AD_HOC_CODE_SIGNING_ALLOWED=YES \
+          CODE_SIGNING_ALLOWED=NO \
+          DEVELOPMENT_TEAM=XYZ0123456 \
+          ORG_IDENTIFIER=com.SideStore \
+          | xcpretty && exit ${PIPESTATUS[0]}
+
+      - name: Fakesign app
+        run: |
+          rm -rf archive.xcarchive/Products/Applications/SideStore.app/Frameworks/AltStoreCore.framework/Frameworks/
+          ldid -SAltStore/Resources/tempEnt.plist archive.xcarchive/Products/Applications/SideStore.app/SideStore
+
+      - name: Convert to IPA
+        run: |
+          mkdir Payload
+          mkdir Payload/SideStore.app
+          cp -R archive.xcarchive/Products/Applications/SideStore.app/ Payload/SideStore.app/
+          zip -r SideStore.ipa Payload
+
+      - name: Upload Artifact
+        uses: actions/upload-artifact@v3.1.0
+        with:
+          name: SideStore.ipa
+          path: SideStore.ipa
+
+      - name: Get version
+        id: version
+        run: echo "version=$(grep MARKETING_VERSION Build.xcconfig | sed -e "s/MARKETING_VERSION = //g")" >> $GITHUB_OUTPUT
+
+      - name: Get current date
+        id: date
+        run: echo "date=$(date -u +'%c')" >> $GITHUB_OUTPUT
+
+      - name: Get current date in AltStore date form
+        id: date_altstore
+        run: echo "date=$(date -u +'%Y-%m-%d')" >> $GITHUB_OUTPUT
+
+      - name: Upload to new stable release
+        uses: softprops/action-gh-release@v1
+        with:
+          token: ${{ secrets.GITHUB_TOKEN }}
+          name: ${{ steps.version.outputs.version }}
+          tag_name: ${{ github.ref }}
+          draft: true
+          files: SideStore.ipa
+          body: |
+            ## Changelog
+            
+            - TODO
+            
+            ## Build Info
+            
+            Built at (UTC): `${{ steps.date.outputs.date }}`
+            Built at (UTC date): `${{ steps.date_altstore.outputs.date }}`
+            Commit SHA: `${{ github.sha }}`
+            Version: `${{ steps.version.outputs.version }}`

.gitignore

@@ -33,4 +33,5 @@ xcuserdata
 /.vscode
 
 ## AppCode specific
-.idea/
+.idea/
+/.build

.gitmodules

@@ -22,3 +22,6 @@
 [submodule "Dependencies/minimuxer"]
 	path = Dependencies/minimuxer
 	url = https://github.com/jkcoxson/minimuxer
+[submodule "Dependencies/libfragmentzip"]
+	path = Dependencies/libfragmentzip
+	url = https://github.com/SideStore/libfragmentzip.git

AltBackup/Info.plist

@@ -5,7 +5,7 @@
 	<key>ALTAppGroups</key>
 	<array>
 		<string>group.$(APP_GROUP_IDENTIFIER)</string>
-		<string>group.com.rileytestut.AltStore</string>
+		<string>group.com.SideStore.SideStore</string>
 	</array>
 	<key>ALTBundleIdentifier</key>
 	<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>

AltDaemon/XPCConnectionHandler.swift

@@ -77,7 +77,7 @@ extension XPCConnectionHandler: NSXPCListenerDelegate
         guard
             let codeSigningInfo = signingInfo as? [String: Any],
             let bundleIdentifier = codeSigningInfo["identifier"] as? String,
-            bundleIdentifier.contains("com.rileytestut.AltStore")
+            bundleIdentifier.contains(Bundle.Info.appbundleIdentifier)
         else { return false }
         
         let connection = XPCConnection(newConnection)

AltStore.xcodeproj/project.xcworkspace/xcshareddata/swiftpm/Package.resolved

@@ -1,86 +0,0 @@
-{
-  "pins" : [
-    {
-      "identity" : "altsign",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/SideStore/AltSign",
-      "state" : {
-        "branch" : "master",
-        "revision" : "7e0e7edcf8fbc44ac1e35da3e9030a297aa18b84"
-      }
-    },
-    {
-      "identity" : "appcenter-sdk-apple",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/microsoft/appcenter-sdk-apple.git",
-      "state" : {
-        "revision" : "8354a50fe01a7e54e196d3b5493b5ab53dd5866a",
-        "version" : "4.4.2"
-      }
-    },
-    {
-      "identity" : "keychainaccess",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/kishikawakatsumi/KeychainAccess.git",
-      "state" : {
-        "revision" : "84e546727d66f1adc5439debad16270d0fdd04e7",
-        "version" : "4.2.2"
-      }
-    },
-    {
-      "identity" : "launchatlogin",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/sindresorhus/LaunchAtLogin.git",
-      "state" : {
-        "revision" : "e8171b3e38a2816f579f58f3dac1522aa39efe41",
-        "version" : "4.2.0"
-      }
-    },
-    {
-      "identity" : "nuke",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/kean/Nuke.git",
-      "state" : {
-        "revision" : "9318d02a8a6d20af56505c9673261c1fd3b3aebe",
-        "version" : "7.6.3"
-      }
-    },
-    {
-      "identity" : "openssl",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/krzyzanowskim/OpenSSL",
-      "state" : {
-        "revision" : "033fcb41dac96b1b6effa945ca1f9ade002370b2",
-        "version" : "1.1.1501"
-      }
-    },
-    {
-      "identity" : "plcrashreporter",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/microsoft/PLCrashReporter.git",
-      "state" : {
-        "revision" : "6b27393cad517c067dceea85fadf050e70c4ceaa",
-        "version" : "1.10.1"
-      }
-    },
-    {
-      "identity" : "sparkle",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/sparkle-project/Sparkle.git",
-      "state" : {
-        "revision" : "286edd1fa22505a9e54d170e9fd07d775ea233f2",
-        "version" : "2.1.0"
-      }
-    },
-    {
-      "identity" : "stprivilegedtask",
-      "kind" : "remoteSourceControl",
-      "location" : "https://github.com/JoeMatt/STPrivilegedTask.git",
-      "state" : {
-        "branch" : "master",
-        "revision" : "10a9150ef32d444af326beba76356ae9af95a3e7"
-      }
-    }
-  ],
-  "version" : 2
-}

AltStore.xcodeproj/xcshareddata/xcschemes/AltStore - Release.xcscheme

@@ -0,0 +1,84 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Scheme
+   LastUpgradeVersion = "1020"
+   version = "1.3">
+   <BuildAction
+      parallelizeBuildables = "YES"
+      buildImplicitDependencies = "YES">
+      <BuildActionEntries>
+         <BuildActionEntry
+            buildForTesting = "YES"
+            buildForRunning = "YES"
+            buildForProfiling = "YES"
+            buildForArchiving = "YES"
+            buildForAnalyzing = "YES">
+            <BuildableReference
+               BuildableIdentifier = "primary"
+               BlueprintIdentifier = "BFD247692284B9A500981D42"
+               BuildableName = "SideStore.app"
+               BlueprintName = "SideStore"
+               ReferencedContainer = "container:AltStore.xcodeproj">
+            </BuildableReference>
+         </BuildActionEntry>
+      </BuildActionEntries>
+   </BuildAction>
+   <TestAction
+      buildConfiguration = "Release"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      shouldUseLaunchSchemeArgsEnv = "YES">
+      <Testables>
+      </Testables>
+   </TestAction>
+   <LaunchAction
+      buildConfiguration = "Release"
+      selectedDebuggerIdentifier = "Xcode.DebuggerFoundation.Debugger.LLDB"
+      selectedLauncherIdentifier = "Xcode.DebuggerFoundation.Launcher.LLDB"
+      launchStyle = "0"
+      useCustomWorkingDirectory = "NO"
+      ignoresPersistentStateOnLaunch = "NO"
+      debugDocumentVersioning = "YES"
+      debugServiceExtension = "internal"
+      allowLocationSimulation = "YES">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "BFD247692284B9A500981D42"
+            BuildableName = "SideStore.app"
+            BlueprintName = "SideStore"
+            ReferencedContainer = "container:AltStore.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+      <CommandLineArguments>
+         <CommandLineArgument
+            argument = "-com.apple.CoreData.ConcurrencyDebug 1"
+            isEnabled = "YES">
+         </CommandLineArgument>
+      </CommandLineArguments>
+   </LaunchAction>
+   <ProfileAction
+      buildConfiguration = "Release"
+      shouldUseLaunchSchemeArgsEnv = "YES"
+      savedToolIdentifier = ""
+      useCustomWorkingDirectory = "NO"
+      debugDocumentVersioning = "YES">
+      <BuildableProductRunnable
+         runnableDebuggingMode = "0">
+         <BuildableReference
+            BuildableIdentifier = "primary"
+            BlueprintIdentifier = "BFD247692284B9A500981D42"
+            BuildableName = "SideStore.app"
+            BlueprintName = "SideStore"
+            ReferencedContainer = "container:AltStore.xcodeproj">
+         </BuildableReference>
+      </BuildableProductRunnable>
+   </ProfileAction>
+   <AnalyzeAction
+      buildConfiguration = "Release">
+   </AnalyzeAction>
+   <ArchiveAction
+      buildConfiguration = "Release"
+      revealArchiveInOrganizer = "YES">
+   </ArchiveAction>
+</Scheme>

AltStore/AltStore.entitlements

@@ -4,11 +4,35 @@
 <dict>
 	<key>aps-environment</key>
 	<string>development</string>
+	<key>com.apple.developer.associated-domains</key>
+	<array>
+		<string>webcredentials:sidestore.io</string>
+	</array>
+	<key>com.apple.developer.icloud-container-identifiers</key>
+	<array/>
+	<key>com.apple.developer.kernel.increased-memory-limit</key>
+	<true/>
+	<key>com.apple.developer.networking.multipath</key>
+	<true/>
+	<key>com.apple.developer.networking.vpn.api</key>
+	<array>
+		<string>allow-vpn</string>
+	</array>
+	<key>com.apple.developer.networking.wifi-info</key>
+	<true/>
+	<key>com.apple.developer.shared-with-you</key>
+	<true/>
 	<key>com.apple.developer.siri</key>
 	<true/>
+	<key>com.apple.developer.ubiquity-kvstore-identifier</key>
+	<string>$(TeamIdentifierPrefix)$(CFBundleIdentifier)</string>
 	<key>com.apple.security.application-groups</key>
 	<array>
 		<string>group.$(APP_GROUP_IDENTIFIER)</string>
 	</array>
+	<key>keychain-access-groups</key>
+	<array>
+		<string>$(AppIdentifierPrefix)$(PRODUCT_BUNDLE_IDENTIFIER)</string>
+	</array>
 </dict>
 </plist>

AltStore/Analytics/AnalyticsManager.swift

@@ -14,13 +14,7 @@ import AppCenter
 import AppCenterAnalytics
 import AppCenterCrashes
 
-#if DEBUG
+private let appCenterAppSecret = "73532d3e-e573-4693-99a4-9f85840bbb44"
-private let appCenterAppSecret = "bb08e9bb-c126-408d-bf3f-324c8473fd40"
-#elseif RELEASE
-private let appCenterAppSecret = "b6718932-294a-432b-81f2-be1e17ff85c5"
-#else
-private let appCenterAppSecret = "e873f6ca-75eb-4685-818f-801e0e375d60"
-#endif
 
 extension AnalyticsManager
 {

AltStore/App Detail/AppContentViewController.swift

@@ -80,10 +80,21 @@ class AppContentViewController: UITableViewController
         
         self.subtitleLabel.text = self.app.subtitle
         self.descriptionTextView.text = self.app.localizedDescription
-        self.versionDescriptionTextView.text = self.app.versionDescription
+        
-        self.versionLabel.text = String(format: NSLocalizedString("Version %@", comment: ""), self.app.version)
+        if let version = self.app.latestVersion
-        self.versionDateLabel.text = Date().relativeDateString(since: self.app.versionDate, dateFormatter: self.dateFormatter)
+        {
-        self.sizeLabel.text = self.byteCountFormatter.string(fromByteCount: Int64(self.app.size))
+            self.versionDescriptionTextView.text = version.localizedDescription
+            self.versionLabel.text = String(format: NSLocalizedString("Version %@", comment: ""), version.version)
+            self.versionDateLabel.text = Date().relativeDateString(since: version.date, dateFormatter: self.dateFormatter)
+            self.sizeLabel.text = self.byteCountFormatter.string(fromByteCount: version.size)
+        }
+        else
+        {
+            self.versionDescriptionTextView.text = nil
+            self.versionLabel.text = nil
+            self.versionDateLabel.text = nil
+            self.sizeLabel.text = self.byteCountFormatter.string(fromByteCount: 0)
+        }
         
         self.descriptionTextView.maximumNumberOfLines = 5
         self.descriptionTextView.moreButton.addTarget(self, action: #selector(AppContentViewController.toggleCollapsingSection(_:)), for: .primaryActionTriggered)
@@ -173,7 +184,8 @@ private extension AppContentViewController
         dataSource.cellConfigurationHandler = { (cell, permission, indexPath) in
             let cell = cell as! PermissionCollectionViewCell
             cell.button.setImage(permission.type.icon, for: .normal)
-            cell.textLabel.text = permission.type.localizedShortName
+            cell.button.tintColor = .label
+            cell.textLabel.text = permission.type.localizedShortName ?? permission.type.localizedName
         }
         
         return dataSource

AltStore/App Detail/AppViewController.swift

@@ -384,10 +384,10 @@ private extension AppViewController
             button.progress = progress
         }
         
-        if Date() < self.app.versionDate
+        if let versionDate = self.app.latestVersion?.date, versionDate > Date()
         {
-            self.bannerView.button.countdownDate = self.app.versionDate
+            self.bannerView.button.countdownDate = versionDate
-            self.navigationBarDownloadButton.countdownDate = self.app.versionDate
+            self.navigationBarDownloadButton.countdownDate = versionDate
         }
         else
         {

AltStore/AppDelegate.swift

@@ -18,12 +18,12 @@ import EmotionalDamage
 
 extension AppDelegate
 {
-    static let openPatreonSettingsDeepLinkNotification = Notification.Name("com.rileytestut.AltStore.OpenPatreonSettingsDeepLinkNotification")
+    static let openPatreonSettingsDeepLinkNotification = Notification.Name(Bundle.Info.appbundleIdentifier + ".OpenPatreonSettingsDeepLinkNotification")
-    static let importAppDeepLinkNotification = Notification.Name("com.rileytestut.AltStore.ImportAppDeepLinkNotification")
+    static let importAppDeepLinkNotification = Notification.Name(Bundle.Info.appbundleIdentifier + ".ImportAppDeepLinkNotification")
-    static let addSourceDeepLinkNotification = Notification.Name("com.rileytestut.AltStore.AddSourceDeepLinkNotification")
+    static let addSourceDeepLinkNotification = Notification.Name(Bundle.Info.appbundleIdentifier + ".AddSourceDeepLinkNotification")
-
+    
-    static let appBackupDidFinish = Notification.Name("com.rileytestut.AltStore.AppBackupDidFinish")
+    static let appBackupDidFinish = Notification.Name(Bundle.Info.appbundleIdentifier + ".AppBackupDidFinish")
-
+    
     static let importAppDeepLinkURLKey = "fileURL"
     static let appBackupResultKey = "result"
     static let addSourceDeepLinkURLKey = "sourceURL"
@@ -33,34 +33,34 @@ extension AppDelegate
 class AppDelegate: UIResponder, UIApplicationDelegate {
 
     var window: UIWindow?
-
+    
     @available(iOS 14, *)
     private var intentHandler: IntentHandler {
         get { _intentHandler as! IntentHandler }
         set { _intentHandler = newValue }
     }
-
+    
     @available(iOS 14, *)
     private var viewAppIntentHandler: ViewAppIntentHandler {
         get { _viewAppIntentHandler as! ViewAppIntentHandler }
         set { _viewAppIntentHandler = newValue }
     }
-
+    
     private lazy var _intentHandler: Any = {
         guard #available(iOS 14, *) else { fatalError() }
         return IntentHandler()
     }()
-
+    
     private lazy var _viewAppIntentHandler: Any = {
         guard #available(iOS 14, *) else { fatalError() }
         return ViewAppIntentHandler()
     }()
-
+    
     func application(_ application: UIApplication, didFinishLaunchingWithOptions launchOptions: [UIApplication.LaunchOptionsKey: Any]?) -> Bool
     {
         // Register default settings before doing anything else.
         UserDefaults.registerDefaults()
-
+        
         DatabaseManager.shared.start { (error) in
             if let error = error
             {
@@ -71,50 +71,62 @@ class AppDelegate: UIResponder, UIApplicationDelegate {
                 print("Started DatabaseManager.")
             }
         }
-
+        
         AnalyticsManager.shared.start()
-
+        
         self.setTintColor()
-
+        
-        SecureValueTransformer.register()
+        SecureValueTransformer.register()        
-
+        
         if UserDefaults.standard.firstLaunch == nil
         {
             Keychain.shared.reset()
             UserDefaults.standard.firstLaunch = Date()
         }
-
+        
         UserDefaults.standard.preferredServerID = Bundle.main.object(forInfoDictionaryKey: Bundle.Info.serverID) as? String
-
+        
         #if DEBUG || BETA
         UserDefaults.standard.isDebugModeEnabled = true
         #endif
-
+        
         self.prepareForBackgroundFetch()
-
+        
         return true
     }
     
     func applicationDidEnterBackground(_ application: UIApplication)
-         {
+    {
+        // Make sure to update SceneDelegate.sceneDidEnterBackground() as well.
+                        
+        guard let oneMonthAgo = Calendar.current.date(byAdding: .month, value: -1, to: Date()) else { return }
+        
+        let midnightOneMonthAgo = Calendar.current.startOfDay(for: oneMonthAgo)
+        DatabaseManager.shared.purgeLoggedErrors(before: midnightOneMonthAgo) { result in
+            switch result
+            {
+            case .success: break
+            case .failure(let error): print("[ALTLog] Failed to purge logged errors before \(midnightOneMonthAgo).", error)
+            }
+        }
              
-         }
+    }
 
     func applicationWillEnterForeground(_ application: UIApplication)
     {
         AppManager.shared.update()
         start_em_proxy(bind_addr: Consts.Proxy.serverURL)
     }
-
+    
     func application(_ app: UIApplication, open url: URL, options: [UIApplication.OpenURLOptionsKey : Any]) -> Bool
     {
         return self.open(url)
     }
-
+    
     func application(_ application: UIApplication, handlerFor intent: INIntent) -> Any?
     {
         guard #available(iOS 14, *) else { return nil }
-
+        
         switch intent
         {
         case is RefreshAllIntent: return self.intentHandler
@@ -133,7 +145,7 @@ extension AppDelegate
         // Use this method to select a configuration to create the new scene with.
         return UISceneConfiguration(name: "Default Configuration", sessionRole: connectingSceneSession.role)
     }
-
+    
     func application(_ application: UIApplication, didDiscardSceneSessions sceneSessions: Set<UISceneSession>)
     {
         // Called when the user discards a scene session.
@@ -148,36 +160,36 @@ private extension AppDelegate
     {
         self.window?.tintColor = .altPrimary
     }
-
+    
     func open(_ url: URL) -> Bool
     {
         if url.isFileURL
         {
             guard url.pathExtension.lowercased() == "ipa" else { return false }
-
+            
             DispatchQueue.main.async {
                 NotificationCenter.default.post(name: AppDelegate.importAppDeepLinkNotification, object: nil, userInfo: [AppDelegate.importAppDeepLinkURLKey: url])
             }
-
+            
             return true
         }
         else
         {
             guard let components = URLComponents(url: url, resolvingAgainstBaseURL: false) else { return false }
             guard let host = components.host?.lowercased() else { return false }
-
+            
             switch host
             {
             case "patreon":
                 DispatchQueue.main.async {
                     NotificationCenter.default.post(name: AppDelegate.openPatreonSettingsDeepLinkNotification, object: nil)
                 }
-
+                
                 return true
-
+                
             case "appbackupresponse":
                 let result: Result<Void, Error>
-
+                
                 switch url.path.lowercased()
                 {
                 case "/success": result = .success(())
@@ -188,37 +200,37 @@ private extension AppDelegate
                         let errorCodeString = queryItems["errorCode"], let errorCode = Int(errorCodeString),
                         let errorDescription = queryItems["errorDescription"]
                     else { return false }
-
+                    
                     let error = NSError(domain: errorDomain, code: errorCode, userInfo: [NSLocalizedDescriptionKey: errorDescription])
                     result = .failure(error)
-
+                    
                 default: return false
                 }
-
+                
                 NotificationCenter.default.post(name: AppDelegate.appBackupDidFinish, object: nil, userInfo: [AppDelegate.appBackupResultKey: result])
-
+                
                 return true
-
+                
             case "install":
                 let queryItems = components.queryItems?.reduce(into: [String: String]()) { $0[$1.name.lowercased()] = $1.value } ?? [:]
                 guard let downloadURLString = queryItems["url"], let downloadURL = URL(string: downloadURLString) else { return false }
-
+                
                 DispatchQueue.main.async {
                     NotificationCenter.default.post(name: AppDelegate.importAppDeepLinkNotification, object: nil, userInfo: [AppDelegate.importAppDeepLinkURLKey: downloadURL])
                 }
-
+                
                 return true
-
+            
             case "source":
                 let queryItems = components.queryItems?.reduce(into: [String: String]()) { $0[$1.name.lowercased()] = $1.value } ?? [:]
                 guard let sourceURLString = queryItems["url"], let sourceURL = URL(string: sourceURLString) else { return false }
-
+                
                 DispatchQueue.main.async {
                     NotificationCenter.default.post(name: AppDelegate.addSourceDeepLinkNotification, object: nil, userInfo: [AppDelegate.addSourceDeepLinkURLKey: sourceURL])
                 }
-
+                
                 return true
-
+                
             default: return false
             }
         }
@@ -231,47 +243,47 @@ extension AppDelegate
     {
         // "Fetch" every hour, but then refresh only those that need to be refreshed (so we don't drain the battery).
         UIApplication.shared.setMinimumBackgroundFetchInterval(1 * 60 * 60)
-
+        
         UNUserNotificationCenter.current().requestAuthorization(options: [.alert, .badge, .sound]) { (success, error) in
         }
-
+        
         #if DEBUG
         UIApplication.shared.registerForRemoteNotifications()
         #endif
     }
-
+    
     func application(_ application: UIApplication, didRegisterForRemoteNotificationsWithDeviceToken deviceToken: Data)
     {
         let tokenParts = deviceToken.map { data -> String in
             return String(format: "%02.2hhx", data)
         }
-
+        
         let token = tokenParts.joined()
         print("Push Token:", token)
     }
-
+    
     func application(_ application: UIApplication, didReceiveRemoteNotification userInfo: [AnyHashable : Any], fetchCompletionHandler completionHandler: @escaping (UIBackgroundFetchResult) -> Void)
     {
         self.application(application, performFetchWithCompletionHandler: completionHandler)
     }
-
+    
     func application(_ application: UIApplication, performFetchWithCompletionHandler backgroundFetchCompletionHandler: @escaping (UIBackgroundFetchResult) -> Void)
     {
         if UserDefaults.standard.isBackgroundRefreshEnabled && !UserDefaults.standard.presentedLaunchReminderNotification
         {
             let threeHours: TimeInterval = 3 * 60 * 60
             let trigger = UNTimeIntervalNotificationTrigger(timeInterval: threeHours, repeats: false)
-
+            
             let content = UNMutableNotificationContent()
             content.title = NSLocalizedString("App Refresh Tip", comment: "")
             content.body = NSLocalizedString("The more you open SideStore, the more chances it's given to refresh apps in the background.", comment: "")
-
+            
             let request = UNNotificationRequest(identifier: "background-refresh-reminder5", content: content, trigger: trigger)
             UNUserNotificationCenter.current().add(request)
-
+            
             UserDefaults.standard.presentedLaunchReminderNotification = true
         }
-
+        
         BackgroundTaskManager.shared.performExtendedBackgroundTask { (taskResult, taskCompletionHandler) in
             if let error = taskResult.error
             {
@@ -280,7 +292,7 @@ extension AppDelegate
                 taskCompletionHandler()
                 return
             }
-
+            
             if !DatabaseManager.shared.isStarted
             {
                 DatabaseManager.shared.start() { (error) in
@@ -309,7 +321,7 @@ extension AppDelegate
             }
         }
     }
-
+    
     func performBackgroundFetch(backgroundFetchCompletionHandler: @escaping (UIBackgroundFetchResult) -> Void,
                                 refreshAppsCompletionHandler: @escaping (Result<[String: Result<InstalledApp, Error>], Error>) -> Void)
     {
@@ -319,15 +331,15 @@ extension AppDelegate
             case .failure: backgroundFetchCompletionHandler(.failed)
             case .success: backgroundFetchCompletionHandler(.newData)
             }
-
+            
             if !UserDefaults.standard.isBackgroundRefreshEnabled
             {
                 refreshAppsCompletionHandler(.success([:]))
             }
         }
-
+        
         guard UserDefaults.standard.isBackgroundRefreshEnabled else { return }
-
+        
         DatabaseManager.shared.persistentContainer.performBackgroundTask { (context) in
             let installedApps = InstalledApp.fetchAppsForBackgroundRefresh(in: context)
             AppManager.shared.backgroundRefresh(installedApps, completionHandler: refreshAppsCompletionHandler)
@@ -343,49 +355,49 @@ private extension AppDelegate
             do
             {
                 let (sources, context) = try result.get()
-
+                
                 let previousUpdatesFetchRequest = InstalledApp.updatesFetchRequest() as! NSFetchRequest<NSFetchRequestResult>
                 previousUpdatesFetchRequest.includesPendingChanges = false
                 previousUpdatesFetchRequest.resultType = .dictionaryResultType
                 previousUpdatesFetchRequest.propertiesToFetch = [#keyPath(InstalledApp.bundleIdentifier)]
-
+                
                 let previousNewsItemsFetchRequest = NewsItem.fetchRequest() as NSFetchRequest<NSFetchRequestResult>
                 previousNewsItemsFetchRequest.includesPendingChanges = false
                 previousNewsItemsFetchRequest.resultType = .dictionaryResultType
                 previousNewsItemsFetchRequest.propertiesToFetch = [#keyPath(NewsItem.identifier)]
-
+                
                 let previousUpdates = try context.fetch(previousUpdatesFetchRequest) as! [[String: String]]
                 let previousNewsItems = try context.fetch(previousNewsItemsFetchRequest) as! [[String: String]]
-
+                
                 try context.save()
-
+                
                 let updatesFetchRequest = InstalledApp.updatesFetchRequest()
                 let newsItemsFetchRequest = NewsItem.fetchRequest() as NSFetchRequest<NewsItem>
-
+                
                 let updates = try context.fetch(updatesFetchRequest)
                 let newsItems = try context.fetch(newsItemsFetchRequest)
-
+                
                 for update in updates
                 {
                     guard !previousUpdates.contains(where: { $0[#keyPath(InstalledApp.bundleIdentifier)] == update.bundleIdentifier }) else { continue }
-                    guard let storeApp = update.storeApp else { continue }
+                    guard let storeApp = update.storeApp, let version = storeApp.version else { continue }
-
+                    
                     let content = UNMutableNotificationContent()
                     content.title = NSLocalizedString("New Update Available", comment: "")
-                    content.body = String(format: NSLocalizedString("%@ %@ is now available for download.", comment: ""), update.name, storeApp.version)
+                    content.body = String(format: NSLocalizedString("%@ %@ is now available for download.", comment: ""), update.name, version)
                     content.sound = .default
-
+                    
                     let request = UNNotificationRequest(identifier: UUID().uuidString, content: content, trigger: nil)
                     UNUserNotificationCenter.current().add(request)
                 }
-
+                
                 for newsItem in newsItems
                 {
                     guard !previousNewsItems.contains(where: { $0[#keyPath(NewsItem.identifier)] == newsItem.identifier }) else { continue }
                     guard !newsItem.isSilent else { continue }
-
+                    
                     let content = UNMutableNotificationContent()
-
+                    
                     if let app = newsItem.storeApp
                     {
                         content.title = String(format: NSLocalizedString("%@ News", comment: ""), app.name)
@@ -394,10 +406,10 @@ private extension AppDelegate
                     {
                         content.title = NSLocalizedString("SideStore News", comment: "")
                     }
-
+                    
                     content.body = newsItem.title
                     content.sound = .default
-
+                    
                     let request = UNNotificationRequest(identifier: UUID().uuidString, content: content, trigger: nil)
                     UNUserNotificationCenter.current().add(request)
                 }
@@ -405,7 +417,7 @@ private extension AppDelegate
                 DispatchQueue.main.async {
                     UIApplication.shared.applicationIconBadgeNumber = updates.count
                 }
-
+                
                 completionHandler(.success(sources))
             }
             catch

AltStore/Authentication/AuthenticationViewController.swift

@@ -31,7 +31,7 @@ class AuthenticationViewController: UIViewController
     {
         super.viewDidLoad()
         
-        self.signInButton.activityIndicatorView.style = .white
+        self.signInButton.activityIndicatorView.style = .medium
         
         for view in [self.appleIDBackgroundView!, self.passwordBackgroundView!, self.signInButton!]
         {

AltStore/Base.lproj/Main.storyboard

@@ -1095,13 +1095,13 @@ World</string>
         <image name="News" width="19" height="20"/>
         <image name="Settings" width="20" height="20"/>
         <namedColor name="Background">
-            <color red="1" green="1" blue="1" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.6431" green="0.0196" blue="0.9804" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
         <namedColor name="BlurTint">
-            <color red="1" green="1" blue="1" alpha="0.30000001192092896" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="1" green="1" blue="1" alpha="0.3" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
         <namedColor name="Primary">
-            <color red="0.50196078431372548" green="0.2627450980392157" blue="1" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.6431" green="0.0196" blue="0.9804" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
         <systemColor name="systemBackgroundColor">
             <color white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>

AltStore/Browse/BrowseViewController.swift

@@ -94,7 +94,7 @@ private extension BrowseViewController
             cell.bannerView.iconImageView.isIndicatingActivity = true
             
             cell.bannerView.button.addTarget(self, action: #selector(BrowseViewController.performAppAction(_:)), for: .primaryActionTriggered)
-            cell.bannerView.button.activityIndicatorView.style = .white
+            cell.bannerView.button.activityIndicatorView.style = .medium
             
             // Explicitly set to false to ensure we're starting from a non-activity indicating state.
             // Otherwise, cell reuse can mess up some cached values.
@@ -113,7 +113,7 @@ private extension BrowseViewController
                 let progress = AppManager.shared.installationProgress(for: app)
                 cell.bannerView.button.progress = progress
                 
-                if Date() < app.versionDate
+                if let versionDate = app.latestVersion?.date, versionDate > Date()
                 {
                     cell.bannerView.button.countdownDate = app.versionDate
                 }
@@ -167,14 +167,7 @@ private extension BrowseViewController
     
     func updateDataSource()
     {
-        if let patreonAccount = DatabaseManager.shared.patreonAccount(), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
-        {
             self.dataSource.predicate = nil
-        }
-        else
-        {
-            self.dataSource.predicate = NSPredicate(format: "%K == NO", #keyPath(StoreApp.isBeta))
-        }
     }
     
     func fetchSource()

AltStore/Components/CollapsingTextView.swift

@@ -71,8 +71,10 @@ class CollapsingTextView: UITextView
         {
             self.textContainer.maximumNumberOfLines = self.maximumNumberOfLines
             
-            let maximumCollapsedHeight = font.lineHeight * CGFloat(self.maximumNumberOfLines)
+            let boundingSize = self.attributedText.boundingRect(with: CGSize(width: self.textContainer.size.width, height: .infinity), options: [.usesLineFragmentOrigin, .usesFontLeading], context: nil)
-            if self.intrinsicContentSize.height > maximumCollapsedHeight
+            let maximumCollapsedHeight = font.lineHeight * Double(self.maximumNumberOfLines)
+            
+            if boundingSize.height.rounded() > maximumCollapsedHeight.rounded()
             {
                 var exclusionFrame = moreButtonFrame
                 exclusionFrame.origin.y += self.moreButton.bounds.midY

AltStore/Components/PillButton.swift

@@ -88,7 +88,7 @@ class PillButton: UIButton
         self.layer.masksToBounds = true
         self.accessibilityTraits.formUnion([.updatesFrequently, .button])
         
-        self.activityIndicatorView.style = .white
+        self.activityIndicatorView.style = .medium
         self.activityIndicatorView.isUserInteractionEnabled = false
         
         self.progressView.progress = 0

AltStore/Info.plist

@@ -5,7 +5,7 @@
 	<key>ALTAppGroups</key>
 	<array>
 		<string>group.$(APP_GROUP_IDENTIFIER)</string>
-		<string>group.com.rileytestut.AltStore</string>
+		<string>group.com.SideStore.SideStore</string>
 	</array>
 	<key>ALTDeviceID</key>
 	<string>00008101-000129D63698001E</string>
@@ -44,6 +44,8 @@
 	<string>$(PRODUCT_NAME)</string>
 	<key>CFBundlePackageType</key>
 	<string>APPL</string>
+	<key>LSSupportsOpeningDocumentsInPlace</key>
+	<true/>
 	<key>CFBundleShortVersionString</key>
 	<string>$(MARKETING_VERSION)</string>
 	<key>CFBundleURLTypes</key>
@@ -56,6 +58,7 @@
 			<key>CFBundleURLSchemes</key>
 			<array>
 				<string>altstore</string>
+                                <string>sidestore</string>
 			</array>
 		</dict>
 		<dict>
@@ -66,6 +69,7 @@
 			<key>CFBundleURLSchemes</key>
 			<array>
 				<string>altstore-com.rileytestut.AltStore</string>
+        <string>sidestore-com.SideStore.SideStore</string>
 			</array>
 		</dict>
 	</array>
@@ -89,6 +93,40 @@
 	</array>
 	<key>LSRequiresIPhoneOS</key>
 	<true/>
+	<key>NSAppTransportSecurity</key>
+	<dict>
+		<key>NSExceptionDomains</key>
+		<dict>
+			<key>127.0.0.1</key>
+			<dict>
+				<key>NSExceptionAllowsInsecureHTTPLoads</key>
+				<true/>
+				<key>NSIncludesSubdomains</key>
+				<true/>
+			</dict>
+			<key>New Exception Domain 1</key>
+			<dict>
+				<key>NSExceptionAllowsInsecureHTTPLoads</key>
+				<true/>
+				<key>NSIncludesSubdomains</key>
+				<true/>
+			</dict>
+			<key>apps.sidestore.io</key>
+			<dict>
+				<key>NSExceptionAllowsInsecureHTTPLoads</key>
+				<true/>
+				<key>NSIncludesSubdomains</key>
+				<true/>
+			</dict>
+			<key>sidestore.io</key>
+			<dict>
+				<key>NSExceptionAllowsInsecureHTTPLoads</key>
+				<true/>
+				<key>NSIncludesSubdomains</key>
+				<true/>
+			</dict>
+		</dict>
+	</dict>
 	<key>NSBonjourServices</key>
 	<array>
 		<string>_altserver._tcp</string>
@@ -125,6 +163,7 @@
 	<array>
 		<string>audio</string>
 		<string>fetch</string>
+		<string>processing</string>
 		<string>remote-notification</string>
 	</array>
 	<key>UILaunchStoryboardName</key>

AltStore/LaunchViewController.swift

@@ -83,8 +83,10 @@ class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
             let ok = UIAlertAction(title: "OK", style: .default, handler: { (action) -> Void in
                 // Try to load it from a file picker
                 var types = UTType.types(tag: "plist", tagClass: UTTagClass.filenameExtension, conformingTo: nil)
-                types.append(contentsOf: UTType.types(tag: "mobiledevicepairing", tagClass: UTTagClass.filenameExtension, conformingTo: nil))
+                types.append(contentsOf: UTType.types(tag: "mobiledevicepairing", tagClass: UTTagClass.filenameExtension, conformingTo: UTType.data))
+                types.append(.xml)
                 let documentPickerController = UIDocumentPickerViewController(forOpeningContentTypes: types)
+                documentPickerController.shouldShowFileExtensions = true
                 documentPickerController.delegate = self
                 self.present(documentPickerController, animated: true, completion: nil)
              })
@@ -140,7 +142,7 @@ class LaunchViewController: RSTLaunchViewController, UIDocumentPickerDelegate
     }
     
     func documentPickerWasCancelled(_ controller: UIDocumentPickerViewController) {
-        displayError("Choosing a pairing file was cancelled")
+        displayError("Choosing a pairing file was cancelled. Please re-open the app and try again.")
     }
     
     func start_minimuxer_threads(_ pairing_file: String) {
@@ -165,7 +167,19 @@ extension LaunchViewController
         {
             let title = error.userInfo[NSLocalizedFailureErrorKey] as? String ?? NSLocalizedString("Unable to Launch SideStore", comment: "")
             
-            let alertController = UIAlertController(title: title, message: error.localizedDescription, preferredStyle: .alert)
+            let errorDescription: String
+            
+            if #available(iOS 14.5, *)
+            {
+                let errorMessages = [error.debugDescription] + error.underlyingErrors.map { ($0 as NSError).debugDescription }
+                errorDescription = errorMessages.joined(separator: "\n\n")
+            }
+            else
+            {
+                errorDescription = error.debugDescription
+            }
+            
+            let alertController = UIAlertController(title: title, message: errorDescription, preferredStyle: .alert)
             alertController.addAction(UIAlertAction(title: NSLocalizedString("Retry", comment: ""), style: .default, handler: { (action) in
                 self.handleLaunchConditions()
             }))

AltStore/Managing Apps/AppManager.swift

@@ -758,7 +758,7 @@ extension AppManager
 extension AppManager
 {
     @discardableResult
-    func backgroundRefresh(_ installedApps: [InstalledApp], presentsNotifications: Bool = true, completionHandler: @escaping (Result<[String: Result<InstalledApp, Error>], Error>) -> Void) -> BackgroundRefreshAppsOperation
+    func backgroundRefresh(_ installedApps: [InstalledApp], presentsNotifications: Bool = false, completionHandler: @escaping (Result<[String: Result<InstalledApp, Error>], Error>) -> Void) -> BackgroundRefreshAppsOperation
     {
         let backgroundRefreshAppsOperation = BackgroundRefreshAppsOperation(installedApps: installedApps)
         backgroundRefreshAppsOperation.resultHandler = completionHandler
@@ -1121,7 +1121,7 @@ private extension AppManager
                             presentingViewController?.dismiss(animated: true, completion: nil)
                         }
                     }
-                    presentingViewController.present(navigationController, animated: true, completion: nil)
+                    presentingViewController.present(navigationController, animated: true, completion: nil)                    
                 }
             }
             catch
@@ -1223,7 +1223,7 @@ private extension AppManager
         let progress = Progress.discreteProgress(totalUnitCount: 100)
         
         let context = AppOperationContext(bundleIdentifier: app.bundleIdentifier, authenticatedContext: group.context)
-        context.app = ALTApplication(fileURL: app.url)
+        context.app = ALTApplication(fileURL: app.fileURL)
         
         /* Fetch Provisioning Profiles */
         let fetchProvisioningProfilesOperation = FetchProvisioningProfilesOperation(context: context)
@@ -1662,13 +1662,8 @@ private extension AppManager
             }
             
             if #available(iOS 14, *)
-            {
+            {                
-                WidgetCenter.shared.getCurrentConfigurations { (result) in
+                WidgetCenter.shared.reloadAllTimelines()
-                    guard case .success(let widgets) = result else { return }
-                    
-                    guard let widget = widgets.first(where: { $0.configuration is ViewAppIntent }) else { return }
-                    WidgetCenter.shared.reloadTimelines(ofKind: widget.kind)
-                }
             }
             
             do { try installedApp.managedObjectContext?.save() }
@@ -1677,6 +1672,8 @@ private extension AppManager
         catch
         {
             group.set(.failure(error), forAppWithBundleIdentifier: operation.bundleIdentifier)
+            
+            self.log(error, for: operation)
         }
     }
     
@@ -1701,6 +1698,43 @@ private extension AppManager
         UNUserNotificationCenter.current().add(request)
     }
     
+    func log(_ error: Error, for operation: AppOperation)
+    {
+        // Sanitize NSError on same thread before performing background task.
+        let sanitizedError = (error as NSError).sanitizedForCoreData()
+        
+        let loggedErrorOperation: LoggedError.Operation = {
+            switch operation
+            {
+            case .install: return .install
+            case .update: return .update
+            case .refresh: return .refresh
+            case .activate: return .activate
+            case .deactivate: return .deactivate
+            case .backup: return .backup
+            case .restore: return .restore
+            }
+        }()
+                    
+        DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
+            var app = operation.app
+            if let managedApp = app as? NSManagedObject, let tempApp = context.object(with: managedApp.objectID) as? AppProtocol
+            {
+                app = tempApp
+            }
+            
+            do
+            {
+                _ = LoggedError(error: sanitizedError, app: app, operation: loggedErrorOperation, context: context)
+                try context.save()
+            }
+            catch let saveError
+            {
+                print("[ALTLog] Failed to log error \(sanitizedError.domain) code \(sanitizedError.code) for \(app.bundleIdentifier):", saveError)
+            }
+        }
+    }
+    
     func run(_ operations: [Foundation.Operation], context: OperationContext?, requiresSerialQueue: Bool = false)
     {
         // Find "Install AltStore" operation if it already exists in `context`

AltStore/My Apps/MyAppsViewController.swift

@@ -186,7 +186,7 @@ private extension MyAppsViewController
     func makeUpdatesDataSource() -> RSTFetchedResultsCollectionViewPrefetchingDataSource<InstalledApp, UIImage>
     {
         let fetchRequest = InstalledApp.updatesFetchRequest()
-        fetchRequest.sortDescriptors = [NSSortDescriptor(keyPath: \InstalledApp.storeApp?.versionDate, ascending: true),
+        fetchRequest.sortDescriptors = [NSSortDescriptor(keyPath: \InstalledApp.storeApp?.latestVersion?.date, ascending: true),
                                         NSSortDescriptor(keyPath: \InstalledApp.name, ascending: true)]
         fetchRequest.returnsObjectsAsFaults = false
         
@@ -195,7 +195,7 @@ private extension MyAppsViewController
         dataSource.cellIdentifierHandler = { _ in "UpdateCell" }
         dataSource.cellConfigurationHandler = { [weak self] (cell, installedApp, indexPath) in
             guard let self = self else { return }
-            guard let app = installedApp.storeApp else { return }
+            guard let app = installedApp.storeApp, let latestVersion = app.latestVersion else { return }
             
             let cell = cell as! UpdateCollectionViewCell
             cell.layoutMargins.left = self.view.layoutMargins.left
@@ -209,7 +209,7 @@ private extension MyAppsViewController
             
             cell.bannerView.configure(for: app)
             
-            let versionDate = Date().relativeDateString(since: app.versionDate, dateFormatter: self.dateFormatter)
+            let versionDate = Date().relativeDateString(since: latestVersion.date, dateFormatter: self.dateFormatter)
             cell.bannerView.subtitleLabel.text = versionDate
             
             let appName: String
@@ -223,7 +223,7 @@ private extension MyAppsViewController
                 appName = app.name
             }
             
-            cell.bannerView.accessibilityLabel = String(format: NSLocalizedString("%@ %@ update. Released on %@.", comment: ""), appName, app.version, versionDate)
+            cell.bannerView.accessibilityLabel = String(format: NSLocalizedString("%@ %@ update. Released on %@.", comment: ""), appName, latestVersion.version, versionDate)
             
             cell.bannerView.button.isIndicatingActivity = false
             cell.bannerView.button.addTarget(self, action: #selector(MyAppsViewController.updateApp(_:)), for: .primaryActionTriggered)
@@ -461,17 +461,10 @@ private extension MyAppsViewController
     
     func updateDataSource()
     {
-        if let patreonAccount = DatabaseManager.shared.patreonAccount(), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
+        
-        {
             self.dataSource.predicate = nil
-        }
+        
-        else
+        
-        {
-            self.dataSource.predicate = NSPredicate(format: "%K == nil OR %K == NO OR %K == %@",
-                                                    #keyPath(InstalledApp.storeApp),
-                                                    #keyPath(InstalledApp.storeApp.isBeta),
-                                                    #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
-        }
     }
 }
 

AltStore/News/NewsViewController.swift

@@ -391,7 +391,7 @@ extension NewsViewController
             let progress = AppManager.shared.installationProgress(for: storeApp)
             footerView.bannerView.button.progress = progress
             
-            if Date() < storeApp.versionDate
+            if let versionDate = storeApp.latestVersion?.date, versionDate > Date()
             {
                 footerView.bannerView.button.countdownDate = storeApp.versionDate
             }

AltStore/Operations/BackgroundRefreshAppsOperation.swift

@@ -56,7 +56,7 @@ class BackgroundRefreshAppsOperation: ResultOperation<[String: Result<InstalledA
     let installedApps: [InstalledApp]
     private let managedObjectContext: NSManagedObjectContext
     
-    var presentsFinishedNotification: Bool = true
+    var presentsFinishedNotification: Bool = false
     
     private let refreshIdentifier: String = UUID().uuidString
     private var runningApplications: Set<String> = []
@@ -189,12 +189,12 @@ private extension BackgroundRefreshAppsOperation
             
             let content = UNMutableNotificationContent()
             
-            var shouldPresentAlert = true
+            var shouldPresentAlert = false
             
             do
             {
                 let results = try result.get()
-                shouldPresentAlert = !results.isEmpty
+                shouldPresentAlert = false
                 
                 for (_, result) in results
                 {
@@ -216,7 +216,7 @@ private extension BackgroundRefreshAppsOperation
                 content.title = NSLocalizedString("Failed to Refresh Apps", comment: "")
                 content.body = error.localizedDescription
                 
-                shouldPresentAlert = true
+                shouldPresentAlert = false
             }
             
             if shouldPresentAlert

AltStore/Operations/DownloadAppOperation.swift

@@ -36,7 +36,7 @@ class DownloadAppOperation: ResultOperation<ALTApplication>
     let context: AppOperationContext
     
     private let bundleIdentifier: String
-    private let sourceURL: URL
+    private var sourceURL: URL?
     private let destinationURL: URL
     
     private let session = URLSession(configuration: .default)
@@ -69,7 +69,9 @@ class DownloadAppOperation: ResultOperation<ALTApplication>
         
         print("Downloading App:", self.bundleIdentifier)
         
-        self.downloadApp(from: self.sourceURL) { result in
+        guard let sourceURL = self.sourceURL else { return self.finish(.failure(OperationError.appNotFound)) }
+        
+        self.downloadApp(from: sourceURL) { result in
             do
             {
                 let application = try result.get()
@@ -165,7 +167,7 @@ private extension DownloadAppOperation
             }
         }
         
-        if self.sourceURL.isFileURL
+        if sourceURL.isFileURL
         {
             finishOperation(.success(sourceURL))
             

AltStore/Operations/FetchAnisetteDataOperation.swift

@@ -47,6 +47,7 @@ class FetchAnisetteDataOperation: ResultOperation<ALTAnisetteData>
                     let formattedJSON: [String: String] = ["machineID": json["X-Apple-I-MD-M"]!, "oneTimePassword": json["X-Apple-I-MD"]!, "localUserID": json["X-Apple-I-MD-LU"]!, "routingInfo": json["X-Apple-I-MD-RINFO"]!, "deviceUniqueIdentifier": json["X-Mme-Device-Id"]!, "deviceDescription": json["X-MMe-Client-Info"]!, "date": json["X-Apple-I-Client-Time"]!, "locale": json["X-Apple-Locale"]!, "timeZone": json["X-Apple-I-TimeZone"]!, "deviceSerialNumber": "1"]
                     
                     if let anisette = ALTAnisetteData(json: formattedJSON) {
+                        DLOG("Anisette used: %@", formattedJSON)
                         self.finish(.success(anisette))
                     }
                 }

AltStore/Operations/FetchProvisioningProfilesOperation.swift

@@ -131,19 +131,19 @@ extension FetchProvisioningProfilesOperation
                 // or if installedApp.team is nil but resignedBundleIdentifier contains the team's identifier.
                 let teamsMatch = installedApp.team?.identifier == team.identifier || (installedApp.team == nil && installedApp.resignedBundleIdentifier.contains(team.identifier))
                 
-                #if DEBUG
+//                #if DEBUG
-                
+//
-                if app.isAltStoreApp
+//                if app.isAltStoreApp
-                {
+//                {
-                    // Use legacy bundle ID format for AltStore.
+//                    // Use legacy bundle ID format for AltStore.
-                    preferredBundleID = teamsMatch ? installedApp.resignedBundleIdentifier : nil
+//                    preferredBundleID = teamsMatch ? installedApp.resignedBundleIdentifier : nil
-                }
+//                }
-                else
+//                else
-                {
+//                {
-                    preferredBundleID = teamsMatch ? installedApp.resignedBundleIdentifier : nil
+//                    preferredBundleID = teamsMatch ? installedApp.resignedBundleIdentifier : nil
-                }
+//                }
-                
+//
-                #else
+//                #else
                 
                 if teamsMatch
                 {
@@ -157,7 +157,7 @@ extension FetchProvisioningProfilesOperation
                     preferredBundleID = nil
                 }
                 
-                #endif
+               // #endif
             }
             else
             {

AltStore/Operations/InstallAppOperation.swift

@@ -86,6 +86,11 @@ class InstallAppOperation: ResultOperation<InstalledApp>
                     let resignedBundleID = appExtension.bundleIdentifier
                     let originalBundleID = resignedBundleID.replacingOccurrences(of: resignedParentBundleID, with: parentBundleID)
                     
+                    print("`parentBundleID`: \(parentBundleID)")
+                    print("`resignedParentBundleID`: \(resignedParentBundleID)")
+                    print("`resignedBundleID`: \(resignedBundleID)")
+                    print("`originalBundleID`: \(originalBundleID)")
+                    
                     let installedExtension: InstalledExtension
                     
                     if let appExtension = installedApp.appExtensions.first(where: { $0.bundleIdentifier == originalBundleID })

AltStore/Operations/OperationError.swift

@@ -11,6 +11,8 @@ import AltSign
 
 enum OperationError: LocalizedError
 {
+    static let domain = OperationError.unknown._domain
+    
     case unknown
     case unknownResult
     case cancelled

AltStore/Operations/SendAppOperation.swift

@@ -39,9 +39,10 @@ class SendAppOperation: ResultOperation<()>
         guard let resignedApp = self.context.resignedApp else { return self.finish(.failure(OperationError.invalidParameters)) }
         
         // self.context.resignedApp.fileURL points to the app bundle, but we want the .ipa.
-        let app = AnyApp(name: resignedApp.name, bundleIdentifier: self.context.bundleIdentifier, url: resignedApp.url)
+        let app = AnyApp(name: resignedApp.name, bundleIdentifier: self.context.bundleIdentifier, url: resignedApp.fileURL)
         let fileURL = InstalledApp.refreshedIPAURL(for: app)
         
+        print("AFC App `fileURL`: \(fileURL.absoluteString)")
         
         let ns_bundle = NSString(string: app.bundleIdentifier)
         let ns_bundle_ptr = UnsafeMutablePointer<CChar>(mutating: ns_bundle.utf8String)
@@ -53,6 +54,7 @@ class SendAppOperation: ResultOperation<()>
             }
             let res = minimuxer_yeet_app_afc(ns_bundle_ptr, pls, UInt(data.length))
             if res == 0 {
+                print("minimuxer_yeet_app_afc `res` == \(res)")
                 self.progress.completedUnitCount += 1
                 self.finish(.success(()))
             } else {

AltStore/Resources/Assets.xcassets/Colors/SettingsBackground.colorset/Contents.json

@@ -5,9 +5,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "255",
+          "blue" : "175",
-          "green" : "67",
+          "green" : "4",
-          "red" : "128"
+          "red" : "115"
         }
       },
       "idiom" : "universal"
@@ -23,9 +23,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "103",
+          "blue" : "150",
-          "green" : "0",
+          "green" : "3",
-          "red" : "60"
+          "red" : "99"
         }
       },
       "idiom" : "universal"

AltStore/Resources/Assets.xcassets/Colors/SettingsHighlighted.colorset/Contents.json

@@ -5,9 +5,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "103",
+          "blue" : "150",
-          "green" : "0",
+          "green" : "3",
-          "red" : "60"
+          "red" : "99"
         }
       },
       "idiom" : "universal"
@@ -23,9 +23,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "255",
+          "blue" : "175",
-          "green" : "67",
+          "green" : "4",
-          "red" : "128"
+          "red" : "115"
         }
       },
       "idiom" : "universal"

AltStore/Resources/Assets.xcassets/Permissions/BackgroundAudioPermission.imageset/Contents.json

@@ -1,22 +0,0 @@
-{
-  "images" : [
-    {
-      "idiom" : "universal",
-      "scale" : "1x"
-    },
-    {
-      "idiom" : "universal",
-      "filename" : "sound@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "idiom" : "universal",
-      "filename" : "sound@3x.png",
-      "scale" : "3x"
-    }
-  ],
-  "info" : {
-    "version" : 1,
-    "author" : "xcode"
-  }
-}

AltStore/Resources/Assets.xcassets/Permissions/BackgroundFetchPermission.imageset/Contents.json

@@ -1,22 +0,0 @@
-{
-  "images" : [
-    {
-      "idiom" : "universal",
-      "scale" : "1x"
-    },
-    {
-      "idiom" : "universal",
-      "filename" : "fetch@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "idiom" : "universal",
-      "filename" : "fetch@3x.png",
-      "scale" : "3x"
-    }
-  ],
-  "info" : {
-    "version" : 1,
-    "author" : "xcode"
-  }
-}

AltStore/Resources/Assets.xcassets/Permissions/Contents.json

@@ -1,6 +0,0 @@
-{
-  "info" : {
-    "version" : 1,
-    "author" : "xcode"
-  }
-}

AltStore/Resources/Assets.xcassets/Permissions/PhotosPermission.imageset/Contents.json

@@ -1,22 +0,0 @@
-{
-  "images" : [
-    {
-      "idiom" : "universal",
-      "scale" : "1x"
-    },
-    {
-      "idiom" : "universal",
-      "filename" : "photos@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "idiom" : "universal",
-      "filename" : "photos@3x.png",
-      "scale" : "3x"
-    }
-  ],
-  "info" : {
-    "version" : 1,
-    "author" : "xcode"
-  }
-}

AltStore/Resources/apps.json

@@ -36,14 +36,14 @@
       "bundleIdentifier": "com.rileytestut.AltStore.Beta",
       "developerName": "Riley Testut",
       "subtitle": "An alternative App Store for iOS.",
-      "version": "1.5.1b",
+      "version": "1.6b2",
-      "versionDate": "2022-05-27T12:00:00-07:00",
+      "versionDate": "2022-09-21T13:00:00-05:00",
-      "versionDescription": "This beta fixes the following issues:\n\n• Using Apple IDs that contain capital letters\n• Using Apple IDs with 2FA enabled without any trusted devices\n• Repeatedly asking some users to sign in every refresh\n• \"Incorrect Apple ID or password\" error after changing Apple ID email address\n• “Application is missing application-identifier” error when sideloading or (de-)activating certain apps",
+      "versionDescription": "• Fixed “error migrating persistent store” issue on launch\n\nPREVIOUS VERSION\n\nLock Screen Widget (iOS 16+)\n• Counts down days until AltStore expires\n• Comes in 2 different styles: “icon” and “text”\n\nError Log\n• View past errors in more detail\n• Tap an error to copy the error message or error code\n• Search for error code directly in AltStore FAQ",
-      "downloadURL": "https://cdn.altstore.io/file/altstore/apps/altstore/1_5_1_b.ipa",
+      "downloadURL": "https://cdn.altstore.io/file/altstore/apps/altstore/1_6_b2.ipa",
       "localizedDescription": "AltStore is an alternative app store for non-jailbroken devices. \n\nThis beta release of AltStore adds support for 3rd party sources, allowing you to download apps from other developers directly through AltStore.",
       "iconURL": "https://user-images.githubusercontent.com/705880/65270980-1eb96f80-dad1-11e9-9367-78ccd25ceb02.png",
       "tintColor": "018084",
-      "size": 5464776,
+      "size": 5465933,
       "beta": true,
       "screenshotURLs": [
         "https://user-images.githubusercontent.com/705880/78942028-acf54300-7a6d-11ea-821c-5bb7a9b3e73a.PNG",

AltStore/SceneDelegate.swift

@@ -53,6 +53,18 @@ class SceneDelegate: UIResponder, UIWindowSceneDelegate
         
         guard UIApplication.shared.applicationState == .background else { return }
         
+        // Make sure to update AppDelegate.applicationDidEnterBackground() as well.
+                
+        guard let oneMonthAgo = Calendar.current.date(byAdding: .month, value: -1, to: Date()) else { return }
+        
+        let midnightOneMonthAgo = Calendar.current.startOfDay(for: oneMonthAgo)
+        DatabaseManager.shared.purgeLoggedErrors(before: midnightOneMonthAgo) { result in
+            switch result
+            {
+            case .success: break
+            case .failure(let error): print("[ALTLog] Failed to purge logged errors before \(midnightOneMonthAgo).", error)
+            }
+        }
         
     }
     

AltStore/Settings.bundle/Root.plist

@@ -8,15 +8,67 @@
 	<string>group.$(APP_GROUP_IDENTIFIER)</string>
 	<key>PreferenceSpecifiers</key>
 	<array>
+		<dict>
+			<key>Type</key>
+			<string>PSMultiValueSpecifier</string>
+			<key>Title</key>
+			<string>Anisette Server</string>
+			<key>Key</key>
+			<string>customAnisetteURL</string>
+			<key>DefaultValue</key>
+			<string>http://191.101.206.188:6969</string>
+			<key>Titles</key>
+			<array>
+				<string>Macley (US)</string>
+				<string>Macley (DE)</string>
+				<string>DrPudding</string>
+				<string>jkcoxson (AltServer)</string>
+				<string>jkcoxson (Provision)</string>
+				<string>Sideloadly</string>
+				<string>Nick</string>
+				<string>Jawshoeadan</string>
+				<string>crystall1nedev</string>
+			</array>
+			<key>Values</key>
+			<array>
+				<string>http://us1.sternserv.tech</string>
+				<string>http://de1.sternserv.tech</string>
+				<string>https://sign.rheaa.xyz</string>
+				<string>http://jkcoxson.com:2095</string>
+				<string>http://jkcoxson.com:2052</string>
+				<string>https://sideloadly.io/anisette/irGb3Quww8zrhgqnzmrx</string>
+				<string>http://45.33.29.114</string>
+				<string>https://anisette.jawshoeadan.me</string>
+				<string>https://anisette.crystall1ne.software/</string>
+			</array>
+		</dict>
+		<dict>
+			<key>Type</key>
+			<string>PSGroupSpecifier</string>
+			<key>Title</key>
+			<string>Danger Zone</string>
+			<key>FooterText</key>
+			<string>If you disable the toggle then app will use the server you input into the &quot;Anisette URL&quot; box rather than one selected from the above selector.</string>
+		</dict>
+		<dict>
+			<key>Type</key>
+			<string>PSToggleSwitchSpecifier</string>
+			<key>Title</key>
+			<string>Use preferred servers</string>
+			<key>Key</key>
+			<string>textServer</string>
+			<key>DefaultValue</key>
+			<true/>
+			<key>FooterText</key>
+			<string>chicken</string>
+		</dict>
 		<dict>
 			<key>Type</key>
 			<string>PSTextFieldSpecifier</string>
 			<key>Title</key>
 			<string>Anisette URL</string>
 			<key>Key</key>
-			<string>customAnisetteURL</string>
+			<string>textInputAnisetteURL</string>
-			<key>IsSecure</key>
-			<string>Alphabet</string>
 			<key>AutocapitalizationType</key>
 			<string>None</string>
 			<key>AutocorrectionType</key>

AltStore/Settings/AnisetteManager.swift

@@ -12,12 +12,26 @@ public struct AnisetteManager {
     
     /// User defined URL from Settings/UserDefaults
     static var userURL: String? {
-        guard let urlString = UserDefaults.standard.customAnisetteURL, !urlString.isEmpty else { return nil }
+        var urlString: String?
+        
+        if UserDefaults.standard.textServer == false {
+            urlString = UserDefaults.standard.textInputAnisetteURL
+        }
+        else {
+            urlString = UserDefaults.standard.customAnisetteURL
+        }
+            
+        
+        // guard let urlString = UserDefaults.standard.customAnisetteURL, !urlString.isEmpty else { return nil }
+        
         // Test it's a valid URL
-        guard URL(string: urlString) != nil else {
+        
+        if let urlString = urlString {
+            guard URL(string: urlString) != nil else {
             ELOG("UserDefaults has invalid `customAnisetteURL`")
             assertionFailure("UserDefaults has invalid `customAnisetteURL`")
             return nil
+            }
         }
         return urlString
     }

AltStore/Settings/Error Log/ErrorLogTableViewCell.swift

@@ -0,0 +1,52 @@
+//
+//  ErrorLogTableViewCell.swift
+//  AltStore
+//
+//  Created by Riley Testut on 9/9/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import UIKit
+
+@objc(ErrorLogTableViewCell)
+class ErrorLogTableViewCell: UITableViewCell
+{
+    @IBOutlet var appIconImageView: AppIconImageView!
+    
+    @IBOutlet var dateLabel: UILabel!
+    @IBOutlet var errorFailureLabel: UILabel!
+    @IBOutlet var errorCodeLabel: UILabel!
+    @IBOutlet var errorDescriptionTextView: CollapsingTextView!
+    
+    @IBOutlet var menuButton: UIButton!
+    
+    private var didLayoutSubviews = false
+    
+    override func hitTest(_ point: CGPoint, with event: UIEvent?) -> UIView?
+    {
+        let moreButtonFrame = self.convert(self.errorDescriptionTextView.moreButton.frame, from: self.errorDescriptionTextView)
+        guard moreButtonFrame.contains(point) else { return super.hitTest(point, with: event) }
+        
+        // Pass touches through menuButton so user can press moreButton.
+        return self.errorDescriptionTextView.moreButton
+    }
+    
+    override func layoutSubviews()
+    {
+        super.layoutSubviews()
+        
+        self.didLayoutSubviews = true
+    }
+    
+    override func systemLayoutSizeFitting(_ targetSize: CGSize, withHorizontalFittingPriority horizontalFittingPriority: UILayoutPriority, verticalFittingPriority: UILayoutPriority) -> CGSize
+    {
+        if !self.didLayoutSubviews
+        {
+            // Ensure cell is laid out so it will report correct size.
+            self.layoutIfNeeded()
+        }
+        
+        let size = super.systemLayoutSizeFitting(targetSize, withHorizontalFittingPriority: horizontalFittingPriority, verticalFittingPriority: verticalFittingPriority)
+        return size
+    }
+}

AltStore/Settings/Error Log/ErrorLogViewController.swift

@@ -0,0 +1,301 @@
+//
+//  ErrorLogViewController.swift
+//  AltStore
+//
+//  Created by Riley Testut on 9/6/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import UIKit
+import SafariServices
+
+import AltStoreCore
+import Roxas
+
+import Nuke
+
+class ErrorLogViewController: UITableViewController
+{
+    private lazy var dataSource = self.makeDataSource()
+    private var expandedErrorIDs = Set<NSManagedObjectID>()
+    
+    private lazy var timeFormatter: DateFormatter = {
+        let dateFormatter = DateFormatter()
+        dateFormatter.dateStyle = .none
+        dateFormatter.timeStyle = .short
+        return dateFormatter
+    }()
+    
+    override var preferredStatusBarStyle: UIStatusBarStyle {
+        return .lightContent
+    }
+    
+    override func viewDidLoad()
+    {
+        super.viewDidLoad()
+        
+        self.tableView.dataSource = self.dataSource
+        self.tableView.prefetchDataSource = self.dataSource
+    }
+}
+
+private extension ErrorLogViewController
+{
+    func makeDataSource() -> RSTFetchedResultsTableViewPrefetchingDataSource<LoggedError, UIImage>
+    {
+        let fetchRequest = LoggedError.fetchRequest() as NSFetchRequest<LoggedError>
+        fetchRequest.sortDescriptors = [NSSortDescriptor(keyPath: \LoggedError.date, ascending: false)]
+        fetchRequest.returnsObjectsAsFaults = false
+        
+        let fetchedResultsController = NSFetchedResultsController(fetchRequest: fetchRequest, managedObjectContext: DatabaseManager.shared.viewContext, sectionNameKeyPath: #keyPath(LoggedError.localizedDateString), cacheName: nil)
+        
+        let dataSource = RSTFetchedResultsTableViewPrefetchingDataSource<LoggedError, UIImage>(fetchedResultsController: fetchedResultsController)
+        dataSource.proxy = self
+        dataSource.rowAnimation = .fade
+        dataSource.cellConfigurationHandler = { [weak self] (cell, loggedError, indexPath) in
+            guard let self else { return }
+            
+            let cell = cell as! ErrorLogTableViewCell
+            cell.dateLabel.text = self.timeFormatter.string(from: loggedError.date)
+            cell.errorFailureLabel.text = loggedError.localizedFailure ?? NSLocalizedString("Operation Failed", comment: "")
+            
+            switch loggedError.domain
+            {
+            case AltServerErrorDomain: cell.errorCodeLabel?.text = String(format: NSLocalizedString("AltServer Error %@", comment: ""), NSNumber(value: loggedError.code))
+            case OperationError.domain: cell.errorCodeLabel?.text = String(format: NSLocalizedString("AltStore Error %@", comment: ""), NSNumber(value: loggedError.code))
+            default: cell.errorCodeLabel?.text = loggedError.error.localizedErrorCode
+            }
+            
+            let nsError = loggedError.error as NSError
+            let errorDescription = [nsError.localizedDescription, nsError.localizedRecoverySuggestion].compactMap { $0 }.joined(separator: "\n\n")
+            cell.errorDescriptionTextView.text = errorDescription
+            cell.errorDescriptionTextView.maximumNumberOfLines = 5
+            cell.errorDescriptionTextView.isCollapsed = !self.expandedErrorIDs.contains(loggedError.objectID)
+            cell.errorDescriptionTextView.moreButton.addTarget(self, action: #selector(ErrorLogViewController.toggleCollapsingCell(_:)), for: .primaryActionTriggered)
+            
+            cell.appIconImageView.image = nil
+            cell.appIconImageView.isIndicatingActivity = true
+            cell.appIconImageView.layer.borderColor = UIColor.gray.cgColor
+            
+            let displayScale = (self.traitCollection.displayScale == 0.0) ? 1.0 : self.traitCollection.displayScale // 0.0 == "unspecified"
+            cell.appIconImageView.layer.borderWidth = 1.0 / displayScale
+                        
+            if #available(iOS 14, *)
+            {
+                let menu = UIMenu(title: "", children: [
+                    UIAction(title: NSLocalizedString("Copy Error Message", comment: ""), image: UIImage(systemName: "doc.on.doc")) { [weak self] _ in
+                        self?.copyErrorMessage(for: loggedError)
+                    },
+                    UIAction(title: NSLocalizedString("Copy Error Code", comment: ""), image: UIImage(systemName: "doc.on.doc")) { [weak self] _ in
+                        self?.copyErrorCode(for: loggedError)
+                    },
+                    UIAction(title: NSLocalizedString("Search FAQ", comment: ""), image: UIImage(systemName: "magnifyingglass")) { [weak self] _ in
+                        self?.searchFAQ(for: loggedError)
+                    }
+                ])
+
+                cell.menuButton.menu = menu
+            }
+            
+            // Include errorDescriptionTextView's text in cell summary.
+            cell.accessibilityLabel = [cell.errorFailureLabel.text, cell.dateLabel.text, cell.errorCodeLabel.text, cell.errorDescriptionTextView.text].compactMap { $0 }.joined(separator: ". ")
+            
+            // Group all paragraphs together into single accessibility element (otherwise, each paragraph is independently selectable).
+            cell.errorDescriptionTextView.accessibilityLabel = cell.errorDescriptionTextView.text
+        }
+        dataSource.prefetchHandler = { (loggedError, indexPath, completion) in
+            RSTAsyncBlockOperation { (operation) in
+                loggedError.managedObjectContext?.perform {
+                    if let installedApp = loggedError.installedApp
+                    {
+                        installedApp.loadIcon { (result) in
+                            switch result
+                            {
+                            case .failure(let error): completion(nil, error)
+                            case .success(let image): completion(image, nil)
+                            }
+                        }
+                    }
+                    else if let storeApp = loggedError.storeApp
+                    {
+                        ImagePipeline.shared.loadImage(with: storeApp.iconURL, progress: nil) { (response, error) in
+                            guard !operation.isCancelled else { return operation.finish() }
+                            
+                            if let image = response?.image
+                            {
+                                completion(image, nil)
+                            }
+                            else
+                            {
+                                completion(nil, error)
+                            }
+                        }
+                    }
+                    else
+                    {
+                        completion(nil, nil)
+                    }
+                }
+            }
+        }
+        dataSource.prefetchCompletionHandler = { (cell, image, indexPath, error) in
+            let cell = cell as! ErrorLogTableViewCell
+            cell.appIconImageView.image = image
+            cell.appIconImageView.isIndicatingActivity = false
+        }
+        
+        let placeholderView = RSTPlaceholderView()
+        placeholderView.textLabel.text = NSLocalizedString("No Errors", comment: "")
+        placeholderView.detailTextLabel.text = NSLocalizedString("Errors that occur when sideloading or refreshing apps will appear here.", comment: "")
+        dataSource.placeholderView = placeholderView
+        
+        return dataSource
+    }
+}
+
+private extension ErrorLogViewController
+{
+    @IBAction func toggleCollapsingCell(_ sender: UIButton)
+    {
+        let point = self.tableView.convert(sender.center, from: sender.superview)
+        guard let indexPath = self.tableView.indexPathForRow(at: point), let cell = self.tableView.cellForRow(at: indexPath) as? ErrorLogTableViewCell else { return }
+        
+        let loggedError = self.dataSource.item(at: indexPath)
+        
+        if cell.errorDescriptionTextView.isCollapsed
+        {
+            self.expandedErrorIDs.remove(loggedError.objectID)
+        }
+        else
+        {
+            self.expandedErrorIDs.insert(loggedError.objectID)
+        }
+        
+        self.tableView.performBatchUpdates {
+            cell.layoutIfNeeded()
+        }
+    }
+    
+    @IBAction func clearLoggedErrors(_ sender: UIBarButtonItem)
+    {
+        let alertController = UIAlertController(title: NSLocalizedString("Are you sure you want to clear the error log?", comment: ""), message: nil, preferredStyle: .actionSheet)
+        alertController.popoverPresentationController?.barButtonItem = sender
+        alertController.addAction(.cancel)
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Clear Error Log", comment: ""), style: .destructive) { _ in
+            self.clearLoggedErrors()
+        })
+        self.present(alertController, animated: true)
+    }
+    
+    func clearLoggedErrors()
+    {
+        DatabaseManager.shared.purgeLoggedErrors { result in
+            do
+            {
+                try result.get()
+            }
+            catch
+            {
+                DispatchQueue.main.async {
+                    let alertController = UIAlertController(title: NSLocalizedString("Failed to Clear Error Log", comment: ""), message: error.localizedDescription, preferredStyle: .alert)
+                    alertController.addAction(.ok)
+                    self.present(alertController, animated: true)
+                }
+            }
+        }
+    }
+    
+    func copyErrorMessage(for loggedError: LoggedError)
+    {
+        let nsError = loggedError.error as NSError
+        let errorMessage = [nsError.localizedDescription, nsError.localizedRecoverySuggestion].compactMap { $0 }.joined(separator: "\n\n")
+        
+        UIPasteboard.general.string = errorMessage
+    }
+    
+    func copyErrorCode(for loggedError: LoggedError)
+    {
+        let errorCode = loggedError.error.localizedErrorCode
+        UIPasteboard.general.string = errorCode
+    }
+    
+    func searchFAQ(for loggedError: LoggedError)
+    {
+        let baseURL = URL(string: "https://faq.altstore.io/getting-started/troubleshooting-guide")!
+        var components = URLComponents(url: baseURL, resolvingAgainstBaseURL: false)!
+        
+        let query = [loggedError.domain, "\(loggedError.code)"].joined(separator: "+")
+        components.queryItems = [URLQueryItem(name: "q", value: query)]
+        
+        let safariViewController = SFSafariViewController(url: components.url ?? baseURL)
+        safariViewController.preferredControlTintColor = .altPrimary
+        self.present(safariViewController, animated: true)
+    }
+}
+
+extension ErrorLogViewController
+{
+    override func tableView(_ tableView: UITableView, didSelectRowAt indexPath: IndexPath)
+    {
+        let loggedError = self.dataSource.item(at: indexPath)
+        
+        let alertController = UIAlertController(title: nil, message: nil, preferredStyle: .actionSheet)
+        alertController.addAction(UIAlertAction(title: UIAlertAction.cancel.title, style: UIAlertAction.cancel.style) { _ in
+            tableView.deselectRow(at: indexPath, animated: true)
+        })
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Copy Error Message", comment: ""), style: .default) { [weak self] _ in
+            self?.copyErrorMessage(for: loggedError)
+            tableView.deselectRow(at: indexPath, animated: true)
+        })
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Copy Error Code", comment: ""), style: .default) { [weak self] _ in
+            self?.copyErrorCode(for: loggedError)
+            tableView.deselectRow(at: indexPath, animated: true)
+        })
+        alertController.addAction(UIAlertAction(title: NSLocalizedString("Search FAQ", comment: ""), style: .default) { [weak self] _ in
+            self?.searchFAQ(for: loggedError)
+            tableView.deselectRow(at: indexPath, animated: true)
+        })
+        self.present(alertController, animated: true)
+    }
+    
+    override func tableView(_ tableView: UITableView, trailingSwipeActionsConfigurationForRowAt indexPath: IndexPath) -> UISwipeActionsConfiguration?
+    {
+        let deleteAction = UIContextualAction(style: .destructive, title: NSLocalizedString("Delete", comment: "")) { _, _, completion in
+            let loggedError = self.dataSource.item(at: indexPath)
+            DatabaseManager.shared.persistentContainer.performBackgroundTask { context in
+                do
+                {
+                    let loggedError = context.object(with: loggedError.objectID) as! LoggedError
+                    context.delete(loggedError)
+                    
+                    try context.save()
+                    completion(true)
+                }
+                catch
+                {
+                    print("[ALTLog] Failed to delete LoggedError \(loggedError.objectID):", error)
+                    completion(false)
+                }
+            }
+        }
+        
+        let configuration = UISwipeActionsConfiguration(actions: [deleteAction])
+        configuration.performsFirstActionWithFullSwipe = false
+        return configuration
+    }
+    
+    override func tableView(_ tableView: UITableView, titleForHeaderInSection section: Int) -> String?
+    {
+        let indexPath = IndexPath(row: 0, section: section)
+        let loggedError = self.dataSource.item(at: indexPath)
+        
+        if Calendar.current.isDateInToday(loggedError.date)
+        {
+            return NSLocalizedString("Today", comment: "")
+        }
+        else
+        {
+            return loggedError.localizedDateString
+        }
+    }
+}

AltStore/Settings/PatreonComponents.swift

@@ -40,7 +40,7 @@ class PatronsFooterView: UICollectionReusableView
         super.init(frame: frame)
         
         self.button.translatesAutoresizingMaskIntoConstraints = false
-        self.button.activityIndicatorView.style = .white
+        self.button.activityIndicatorView.style = .medium
         self.button.titleLabel?.textColor = .white
         self.addSubview(self.button)
         
@@ -73,13 +73,13 @@ class AboutPatreonHeaderView: UICollectionReusableView
         self.textView.layer.cornerRadius = 20
         self.textView.textContainer.lineFragmentPadding = 0
         
-        for imageView in [self.rileyImageView!, self.shaneImageView!]
+        for imageView in [self.rileyImageView, self.shaneImageView].compactMap({ $0 })
         {
             imageView.clipsToBounds = true
             imageView.layer.cornerRadius = imageView.bounds.midY
         }
         
-        for button in [self.supportButton!, self.accountButton!]
+        for button in [self.supportButton, self.accountButton].compactMap({ $0 })
         {
             button.clipsToBounds = true
             button.layer.cornerRadius = 16

AltStore/Settings/PatreonViewController.swift

@@ -238,7 +238,8 @@ private extension PatreonViewController
     
     @objc func didUpdatePatrons(_ notification: Notification)
     {
-        DispatchQueue.main.async {
+        DispatchQueue.main.asyncAfter(deadline: .now() + 0.5) {
+            // Wait short delay before reloading or else footer won't properly update if it's already visible 🤷‍♂️
             self.collectionView.reloadData()
         }
     }
@@ -270,17 +271,27 @@ extension PatreonViewController
                 footerView.button.isHidden = false
                 //footerView.button.addTarget(self, action: #selector(PatreonViewController.fetchPatrons), for: .primaryActionTriggered)
                 
-                if self.patronsDataSource.itemCount > 0
+                switch AppManager.shared.updatePatronsResult
                 {
-                    footerView.button.isHidden = true
+                case .none: footerView.button.isIndicatingActivity = true
-                }
+                case .success?: footerView.button.isHidden = true
-                else
+                case .failure?:
-                {
+                    #if DEBUG
-                    switch AppManager.shared.updatePatronsResult
+                    let debug = true
+                    #else
+                    let debug = false
+                    #endif
+                    
+                    if self.patronsDataSource.itemCount == 0 || debug
                     {
-                    case .none: footerView.button.isIndicatingActivity = true
+                        // Only show error message if there aren't any cached Patrons (or if this is a debug build).
-                    case .success?: footerView.button.isHidden = true
+                        
-                    case .failure?: footerView.button.setTitle(NSLocalizedString("Error Loading Patrons", comment: ""), for: .normal)
+                        footerView.button.isHidden = false
+                        footerView.button.setTitle(NSLocalizedString("Error Loading Patrons", comment: ""), for: .normal)
+                    }
+                    else
+                    {
+                        footerView.button.isHidden = true
                     }
                 }
                 

AltStore/Settings/Settings.storyboard

@@ -1,18 +1,19 @@
 <?xml version="1.0" encoding="UTF-8"?>
-<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="17503.1" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES" initialViewController="5Rz-4h-jJ8">
+<document type="com.apple.InterfaceBuilder3.CocoaTouch.Storyboard.XIB" version="3.0" toolsVersion="21507" targetRuntime="iOS.CocoaTouch" propertyAccessControl="none" useAutolayout="YES" useTraitCollections="YES" useSafeAreas="YES" colorMatched="YES" initialViewController="5Rz-4h-jJ8">
     <device id="retina4_7" orientation="portrait" appearance="light"/>
     <dependencies>
         <deployment identifier="iOS"/>
-        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="17502"/>
+        <plugIn identifier="com.apple.InterfaceBuilder.IBCocoaTouchPlugin" version="21505"/>
         <capability name="Named colors" minToolsVersion="9.0"/>
         <capability name="Safe area layout guides" minToolsVersion="9.0"/>
+        <capability name="System colors in document resources" minToolsVersion="11.0"/>
         <capability name="documents saved in the Xcode 8 format" minToolsVersion="8.0"/>
     </dependencies>
     <scenes>
         <!--Settings-->
         <scene sceneID="f7E-cU-41o">
             <objects>
-                <tableViewController id="aMk-Xp-UL8" customClass="SettingsViewController" customModule="AltStore" customModuleProvider="target" sceneMemberID="viewController">
+                <tableViewController id="aMk-Xp-UL8" customClass="SettingsViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
                     <tableView key="view" clipsSubviews="YES" contentMode="scaleToFill" alwaysBounceVertical="YES" indicatorStyle="white" dataMode="static" style="grouped" separatorStyle="none" rowHeight="-1" estimatedRowHeight="-1" sectionHeaderHeight="18" sectionFooterHeight="18" id="MuO-1I-cKW">
                         <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                         <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
@@ -20,7 +21,7 @@
                         <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <color key="separatorColor" white="1" alpha="0.25" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <label key="tableFooterView" opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore 1.0" textAlignment="center" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" id="bUR-rp-Nw2">
-                            <rect key="frame" x="0.0" y="1047.5" width="375" height="25"/>
+                            <rect key="frame" x="0.0" y="1092" width="375" height="25"/>
                             <autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
                             <fontDescription key="fontDescription" type="system" pointSize="17"/>
                             <color key="textColor" white="1" alpha="0.69999999999999996" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -29,8 +30,8 @@
                         <sections>
                             <tableViewSection headerTitle="" id="flW-d4-bco">
                                 <cells>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" textLabel="7lu-Yk-87t" rowHeight="51" style="IBUITableViewCellStyleDefault" id="DzJ-TL-jvR" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" textLabel="7lu-Yk-87t" rowHeight="51" style="IBUITableViewCellStyleDefault" id="DzJ-TL-jvR" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="39.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="22" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="DzJ-TL-jvR" id="XnZ-bO-peM">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -59,8 +60,8 @@
                             </tableViewSection>
                             <tableViewSection headerTitle="" id="CAI-9J-8fR">
                                 <cells>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" textLabel="xvY-lN-Toz" detailTextLabel="CnN-M1-AYK" rowHeight="51" style="IBUITableViewCellStyleValue1" id="kCH-yh-bMk" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" textLabel="xvY-lN-Toz" detailTextLabel="CnN-M1-AYK" rowHeight="51" style="IBUITableViewCellStyleValue1" id="kCH-yh-bMk" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="130.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="113" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="kCH-yh-bMk" id="MQ9-Qn-bWg">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -74,7 +75,7 @@
                                                     <nil key="highlightedColor"/>
                                                 </label>
                                                 <label opaque="NO" multipleTouchEnabled="YES" contentMode="left" insetsLayoutMarginsFromSafeArea="NO" text="Side Team" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" id="CnN-M1-AYK">
-                                                    <rect key="frame" x="252.5" y="16" width="92.5" height="20.5"/>
+                                                    <rect key="frame" x="262.5" y="16" width="82.5" height="20.5"/>
                                                     <autoresizingMask key="autoresizingMask"/>
                                                     <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -91,8 +92,8 @@
                                             </userDefinedRuntimeAttribute>
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" textLabel="rAc-lQ-B1k" detailTextLabel="0uP-Cd-tNX" rowHeight="51" style="IBUITableViewCellStyleValue1" id="q11-3k-oIm" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" textLabel="rAc-lQ-B1k" detailTextLabel="0uP-Cd-tNX" rowHeight="51" style="IBUITableViewCellStyleValue1" id="q11-3k-oIm" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="181.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="164" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="q11-3k-oIm" id="QCY-a8-Lhx">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -106,7 +107,7 @@
                                                     <nil key="highlightedColor"/>
                                                 </label>
                                                 <label opaque="NO" multipleTouchEnabled="YES" contentMode="left" insetsLayoutMarginsFromSafeArea="NO" text="SideTeam@SideStore.io" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" id="0uP-Cd-tNX">
-                                                    <rect key="frame" x="215.5" y="16" width="129.5" height="20.5"/>
+                                                    <rect key="frame" x="156" y="16" width="189" height="20.5"/>
                                                     <autoresizingMask key="autoresizingMask"/>
                                                     <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -123,8 +124,8 @@
                                             </userDefinedRuntimeAttribute>
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" textLabel="Sge-cM-Fw9" detailTextLabel="434-MW-Den" rowHeight="51" style="IBUITableViewCellStyleValue1" id="vuc-eX-w3f" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" textLabel="Sge-cM-Fw9" detailTextLabel="434-MW-Den" rowHeight="51" style="IBUITableViewCellStyleValue1" id="vuc-eX-w3f" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="232.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="215" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="vuc-eX-w3f" id="wpD-YB-mrf">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
@@ -137,8 +138,8 @@
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
-                                                <label opaque="NO" multipleTouchEnabled="YES" contentMode="left" insetsLayoutMarginsFromSafeArea="NO" text="Developer" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" id="434-MW-Den">
+                                                <label opaque="NO" multipleTouchEnabled="YES" contentMode="left" insetsLayoutMarginsFromSafeArea="NO" text="Developers" textAlignment="right" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" id="434-MW-Den">
-                                                    <rect key="frame" x="264" y="16" width="81" height="20.5"/>
+                                                    <rect key="frame" x="255" y="16" width="90" height="20.5"/>
                                                     <autoresizingMask key="autoresizingMask"/>
                                                     <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -159,15 +160,15 @@
                             </tableViewSection>
                             <tableViewSection id="YHi-gR-wed">
                                 <cells>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="R1C-Gr-xD4" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="R1C-Gr-xD4" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="319.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="302" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="R1C-Gr-xD4" id="Ojx-7f-z7E">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
                                                 <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Join the beta" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="3Il-5a-5Zp">
-                                                    <rect key="frame" x="30" y="15" width="106" height="21"/>
+                                                    <rect key="frame" x="30" y="15.5" width="106" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
@@ -199,15 +200,15 @@
                             </tableViewSection>
                             <tableViewSection headerTitle="" id="2dM-lg-cRI">
                                 <cells>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="Rra-U5-kCd" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="Rra-U5-kCd" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="410.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="393" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="Rra-U5-kCd" id="8gV-kx-lGe">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
                                                 <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Background Refresh" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="EbG-HB-IOn">
-                                                    <rect key="frame" x="30" y="15" width="166" height="21"/>
+                                                    <rect key="frame" x="30" y="15.5" width="166" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
@@ -235,15 +236,15 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="NO"/>
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="amC-sE-8O0" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="461.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="444" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="amC-sE-8O0" id="GEO-2e-E4k">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
                                                 <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Add to Siri…" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="c6K-fI-CVr">
-                                                    <rect key="frame" x="30" y="15" width="101" height="21"/>
+                                                    <rect key="frame" x="30" y="15.5" width="100.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
@@ -267,15 +268,15 @@
                             </tableViewSection>
                             <tableViewSection headerTitle="" id="eHy-qI-w5w">
                                 <cells>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="30h-59-88f" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="30h-59-88f" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="643.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="535" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="30h-59-88f" id="7qD-DW-Jls">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
                                                 <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="How it works" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="2CC-iw-3bd">
-                                                    <rect key="frame" x="30" y="15" width="105" height="21"/>
+                                                    <rect key="frame" x="30" y="15.5" width="105" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
@@ -307,30 +308,30 @@
                             </tableViewSection>
                             <tableViewSection headerTitle="" id="J90-vn-u2O">
                                 <cells>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="i4T-2q-jF3" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="i4T-2q-jF3" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="734.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="626" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="i4T-2q-jF3" id="VTQ-H4-aCM">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Developer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hRA-OK-Vjw">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Developers" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hRA-OK-Vjw">
-                                                    <rect key="frame" x="30" y="15.5" width="78" height="20.5"/>
+                                                    <rect key="frame" x="30" y="15.5" width="86" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
                                                 <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="lx9-35-OSk">
-                                                    <rect key="frame" x="220.5" y="15.5" width="124.5" height="20.5"/>
+                                                    <rect key="frame" x="187.5" y="15.5" width="157.5" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Side Team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="JAA-iZ-VGb">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="SideStore Team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="JAA-iZ-VGb">
-                                                            <rect key="frame" x="0.0" y="0.0" width="92.5" height="20.5"/>
+                                                            <rect key="frame" x="0.0" y="0.0" width="125.5" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
                                                         <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Mmj-3V-fTb">
-                                                            <rect key="frame" x="106.5" y="0.0" width="18" height="20.5"/>
+                                                            <rect key="frame" x="139.5" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
                                                 </stackView>
@@ -351,30 +352,30 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="oHX-oR-nwJ" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="oHX-oR-nwJ" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="654.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="677" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="oHX-oR-nwJ" id="hN4-i5-igu">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Operations" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="UI Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="oqY-wY-1Vf">
-                                                    <rect key="frame" x="30" y="15.5" width="84" height="20.5"/>
+                                                    <rect key="frame" x="30" y="15.5" width="89" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
                                                 <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="gUq-6Q-t5X">
-                                                    <rect key="frame" x="233.5" y="15.5" width="111.5" height="20.5"/>
+                                                    <rect key="frame" x="198" y="15.5" width="147" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Side Team" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Fabian (thdev)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="ylE-VL-7Fq">
-                                                            <rect key="frame" x="0.0" y="0.0" width="79.5" height="20.5"/>
+                                                            <rect key="frame" x="0.0" y="0.0" width="115" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
                                                         <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="e3L-vR-Jae">
-                                                            <rect key="frame" x="93.5" y="0.0" width="18" height="20.5"/>
+                                                            <rect key="frame" x="129" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
                                                 </stackView>
@@ -395,30 +396,30 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="0MT-ht-Sit" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="0MT-ht-Sit" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="785.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="728" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="0MT-ht-Sit" id="OZp-WM-5H7">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
-                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="fGU-Fp-XgM">
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Asset Designer" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="fGU-Fp-XgM">
-                                                    <rect key="frame" x="30" y="15.5" width="68.5" height="20.5"/>
+                                                    <rect key="frame" x="30" y="15.5" width="115.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
                                                 </label>
                                                 <stackView opaque="NO" contentMode="scaleToFill" spacing="14" translatesAutoresizingMaskIntoConstraints="NO" id="R8B-DW-7mY">
-                                                    <rect key="frame" x="192.5" y="15.5" width="152.5" height="20.5"/>
+                                                    <rect key="frame" x="206" y="15.5" width="139" height="20.5"/>
                                                     <subviews>
-                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Caroline Moore" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hId-3P-41T">
+                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Chris (LitRitt)" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="hId-3P-41T">
-                                                            <rect key="frame" x="0.0" y="0.0" width="120.5" height="20.5"/>
+                                                            <rect key="frame" x="0.0" y="0.0" width="107" height="20.5"/>
                                                             <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="17"/>
                                                             <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                             <nil key="highlightedColor"/>
                                                         </label>
                                                         <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="baq-cE-fMY">
-                                                            <rect key="frame" x="134.5" y="0.0" width="18" height="20.5"/>
+                                                            <rect key="frame" x="121" y="0.0" width="18" height="20.5"/>
                                                         </imageView>
                                                     </subviews>
                                                 </stackView>
@@ -439,15 +440,15 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="O5R-Al-lGj" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="O5R-Al-lGj" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="836.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="779" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="O5R-Al-lGj" id="CrG-Mr-xQq">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
                                                 <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Licenses" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="D6b-cd-pVK">
-                                                    <rect key="frame" x="30" y="15" width="67.5" height="21"/>
+                                                    <rect key="frame" x="30" y="15.5" width="67.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="system" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="0.80000000000000004" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
@@ -479,15 +480,15 @@
                             </tableViewSection>
                             <tableViewSection headerTitle="" id="OMa-EK-hRI">
                                 <cells>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="FMZ-as-Ljo" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="FMZ-as-Ljo" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="927.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="870" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="FMZ-as-Ljo" id="JzL-Of-A3T">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
                                                 <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Send Feedback" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="pMI-Aj-nQF">
-                                                    <rect key="frame" x="30" y="15" width="126" height="21"/>
+                                                    <rect key="frame" x="30" y="15.5" width="125.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
@@ -512,15 +513,15 @@
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                         </userDefinedRuntimeAttributes>
                                     </tableViewCell>
-                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="Qca-pU-sJh" customClass="InsetGroupTableViewCell" customModule="AltStore" customModuleProvider="target">
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="Qca-pU-sJh" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
-                                        <rect key="frame" x="0.0" y="978.5" width="375" height="51"/>
+                                        <rect key="frame" x="0.0" y="921" width="375" height="51"/>
                                         <autoresizingMask key="autoresizingMask"/>
                                         <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="Qca-pU-sJh" id="QtU-8J-VQN">
                                             <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
                                             <autoresizingMask key="autoresizingMask"/>
                                             <subviews>
                                                 <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="View Refresh Attempts" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="sni-07-q0M">
-                                                    <rect key="frame" x="30" y="15" width="187.5" height="21"/>
+                                                    <rect key="frame" x="30" y="15.5" width="187.5" height="20.5"/>
                                                     <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
                                                     <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                                                     <nil key="highlightedColor"/>
@@ -540,7 +541,7 @@
                                         <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
                                         <userDefinedRuntimeAttributes>
                                             <userDefinedRuntimeAttribute type="number" keyPath="style">
-                                                <integer key="value" value="3"/>
+                                                <integer key="value" value="2"/>
                                             </userDefinedRuntimeAttribute>
                                             <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
                                         </userDefinedRuntimeAttributes>
@@ -548,6 +549,75 @@
                                             <segue destination="GBh-rB-juy" kind="show" identifier="showRefreshAttempts" id="K2i-nF-6qa"/>
                                         </connections>
                                     </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="rE2-P4-OaE" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="972" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="rE2-P4-OaE" id="qIT-rz-ZUb">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="View Error Log" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="PWC-OG-5jx">
+                                                    <rect key="frame" x="30" y="15.5" width="119" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="VfB-c5-5wG">
+                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
+                                                </imageView>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstItem="PWC-OG-5jx" firstAttribute="leading" secondItem="qIT-rz-ZUb" secondAttribute="leadingMargin" id="BQr-Nx-fIq"/>
+                                                <constraint firstItem="PWC-OG-5jx" firstAttribute="centerY" secondItem="qIT-rz-ZUb" secondAttribute="centerY" id="IDa-ov-tmK"/>
+                                                <constraint firstAttribute="trailingMargin" secondItem="VfB-c5-5wG" secondAttribute="trailing" id="Q6c-iP-6bi"/>
+                                                <constraint firstItem="VfB-c5-5wG" firstAttribute="centerY" secondItem="qIT-rz-ZUb" secondAttribute="centerY" id="WuL-ax-fFw"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="3"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                        <connections>
+                                            <segue destination="g8a-Rf-zWa" kind="show" identifier="showErrorLog" id="SSW-vL-86I"/>
+                                        </connections>
+                                    </tableViewCell>
+                                    <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" rowHeight="51" id="fj2-EJ-Z98" customClass="InsetGroupTableViewCell" customModule="SideStore" customModuleProvider="target">
+                                        <rect key="frame" x="0.0" y="1023" width="375" height="51"/>
+                                        <autoresizingMask key="autoresizingMask"/>
+                                        <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="fj2-EJ-Z98" id="BcT-Fs-KNg">
+                                            <rect key="frame" x="0.0" y="0.0" width="375" height="51"/>
+                                            <autoresizingMask key="autoresizingMask"/>
+                                            <subviews>
+                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Advanced Settings" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="OcM-OM-uDE">
+                                                    <rect key="frame" x="30" y="15.5" width="154" height="20.5"/>
+                                                    <fontDescription key="fontDescription" type="boldSystem" pointSize="17"/>
+                                                    <color key="textColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                    <nil key="highlightedColor"/>
+                                                </label>
+                                                <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" image="Next" translatesAutoresizingMaskIntoConstraints="NO" id="Pcu-Sy-yfZ">
+                                                    <rect key="frame" x="327" y="16.5" width="18" height="18"/>
+                                                </imageView>
+                                            </subviews>
+                                            <constraints>
+                                                <constraint firstAttribute="trailingMargin" secondItem="Pcu-Sy-yfZ" secondAttribute="trailing" id="CFy-IO-4eb"/>
+                                                <constraint firstItem="OcM-OM-uDE" firstAttribute="centerY" secondItem="BcT-Fs-KNg" secondAttribute="centerY" id="OGl-h4-FPx"/>
+                                                <constraint firstItem="Pcu-Sy-yfZ" firstAttribute="centerY" secondItem="BcT-Fs-KNg" secondAttribute="centerY" id="R7L-4O-lTn"/>
+                                                <constraint firstItem="OcM-OM-uDE" firstAttribute="leading" secondItem="BcT-Fs-KNg" secondAttribute="leadingMargin" id="yoh-C6-UC5"/>
+                                            </constraints>
+                                        </tableViewCellContentView>
+                                        <color key="backgroundColor" white="1" alpha="0.14999999999999999" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                        <edgeInsets key="layoutMargins" top="8" left="30" bottom="8" right="30"/>
+                                        <userDefinedRuntimeAttributes>
+                                            <userDefinedRuntimeAttribute type="number" keyPath="style">
+                                                <integer key="value" value="3"/>
+                                            </userDefinedRuntimeAttribute>
+                                            <userDefinedRuntimeAttribute type="boolean" keyPath="isSelectable" value="YES"/>
+                                        </userDefinedRuntimeAttributes>
+                                    </tableViewCell>
                                 </cells>
                             </tableViewSection>
                         </sections>
@@ -572,11 +642,11 @@
         <!--Settings-->
         <scene sceneID="L0E-XA-SxK">
             <objects>
-                <navigationController automaticallyAdjustsScrollViewInsets="NO" id="5Rz-4h-jJ8" customClass="ForwardingNavigationController" customModule="AltStore" customModuleProvider="target" sceneMemberID="viewController">
+                <navigationController automaticallyAdjustsScrollViewInsets="NO" id="5Rz-4h-jJ8" customClass="ForwardingNavigationController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
                     <tabBarItem key="tabBarItem" title="Settings" image="Settings" id="LP8-gK-WC2"/>
                     <toolbarItems/>
                     <simulatedTabBarMetrics key="simulatedBottomBarMetrics"/>
-                    <navigationBar key="navigationBar" contentMode="scaleToFill" insetsLayoutMarginsFromSafeArea="NO" barStyle="black" largeTitles="YES" id="Jtn-cs-Tvp" customClass="NavigationBar" customModule="AltStore" customModuleProvider="target">
+                    <navigationBar key="navigationBar" contentMode="scaleToFill" insetsLayoutMarginsFromSafeArea="NO" barStyle="black" largeTitles="YES" id="Jtn-cs-Tvp" customClass="NavigationBar" customModule="SideStore" customModuleProvider="target">
                         <rect key="frame" x="0.0" y="0.0" width="375" height="96"/>
                         <autoresizingMask key="autoresizingMask"/>
                         <color key="tintColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
@@ -603,14 +673,14 @@
         <!--Refresh Attempts-->
         <scene sceneID="mm0-Eb-bBO">
             <objects>
-                <tableViewController id="GBh-rB-juy" customClass="RefreshAttemptsViewController" customModule="AltStore" customModuleProvider="target" sceneMemberID="viewController">
+                <tableViewController id="GBh-rB-juy" customClass="RefreshAttemptsViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
                     <tableView key="view" clipsSubviews="YES" contentMode="scaleToFill" alwaysBounceVertical="YES" dataMode="prototypes" style="plain" separatorStyle="default" rowHeight="-1" estimatedRowHeight="-1" sectionHeaderHeight="28" sectionFooterHeight="28" id="sPX-D2-9uY">
                         <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                         <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
                         <color key="backgroundColor" white="1" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
                         <prototypes>
                             <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" reuseIdentifier="Cell" id="8Xf-RE-QJx" customClass="RefreshAttemptTableViewCell">
-                                <rect key="frame" x="0.0" y="28" width="375" height="65"/>
+                                <rect key="frame" x="0.0" y="50" width="375" height="65"/>
                                 <autoresizingMask key="autoresizingMask"/>
                                 <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="8Xf-RE-QJx" id="r3G-oh-AyQ">
                                     <rect key="frame" x="0.0" y="0.0" width="375" height="65"/>
@@ -672,7 +742,7 @@
         <!--Software Licenses-->
         <scene sceneID="YJd-UT-xxE">
             <objects>
-                <viewController id="m4j-ch-w9Y" customClass="LicensesViewController" customModule="AltStore" customModuleProvider="target" sceneMemberID="viewController">
+                <viewController id="m4j-ch-w9Y" customClass="LicensesViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
                     <view key="view" contentMode="scaleToFill" id="5un-bm-kB5">
                         <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                         <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
@@ -784,7 +854,7 @@ Settings by i cons from the Noun Project</string>
         <!--Patreon-->
         <scene sceneID="Lnh-9P-HnL">
             <objects>
-                <collectionViewController id="dp8-8j-vt9" customClass="PatreonViewController" customModule="AltStore" customModuleProvider="target" sceneMemberID="viewController">
+                <collectionViewController id="dp8-8j-vt9" customClass="PatreonViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
                     <collectionView key="view" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="scaleToFill" alwaysBounceVertical="YES" indicatorStyle="white" dataMode="prototypes" id="OTF-Qv-Z5w">
                         <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
                         <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
@@ -797,7 +867,7 @@ Settings by i cons from the Noun Project</string>
                             <inset key="sectionInset" minX="20" minY="8" maxX="20" maxY="0.0"/>
                         </collectionViewFlowLayout>
                         <cells>
-                            <collectionViewCell opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" reuseIdentifier="Cell" id="T6v-Rq-ntX" customClass="PatronCollectionViewCell" customModule="AltStore" customModuleProvider="target">
+                            <collectionViewCell opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" reuseIdentifier="Cell" id="T6v-Rq-ntX" customClass="PatronCollectionViewCell" customModule="SideStore" customModuleProvider="target">
                                 <rect key="frame" x="20" y="8" width="157" height="20"/>
                                 <autoresizingMask key="autoresizingMask" flexibleMaxX="YES" flexibleMaxY="YES"/>
                                 <view key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" insetsLayoutMarginsFromSafeArea="NO">
@@ -842,15 +912,135 @@ Settings by i cons from the Noun Project</string>
             </objects>
             <point key="canvasLocation" x="1697" y="-199"/>
         </scene>
+        <!--Error Log-->
+        <scene sceneID="Htu-2V-dbE">
+            <objects>
+                <tableViewController id="g8a-Rf-zWa" customClass="ErrorLogViewController" customModule="SideStore" customModuleProvider="target" sceneMemberID="viewController">
+                    <tableView key="view" clipsSubviews="YES" contentMode="scaleToFill" alwaysBounceVertical="YES" dataMode="prototypes" style="insetGrouped" separatorStyle="default" rowHeight="-1" estimatedRowHeight="-1" sectionHeaderHeight="18" sectionFooterHeight="18" id="BBn-tI-e0e">
+                        <rect key="frame" x="0.0" y="0.0" width="375" height="667"/>
+                        <autoresizingMask key="autoresizingMask" widthSizable="YES" heightSizable="YES"/>
+                        <prototypes>
+                            <tableViewCell clipsSubviews="YES" contentMode="scaleToFill" preservesSuperviewLayoutMargins="YES" selectionStyle="default" indentationWidth="10" reuseIdentifier="Cell" id="HAm-mA-O78" customClass="ErrorLogTableViewCell">
+                                <rect key="frame" x="16" y="55.5" width="343" height="107.5"/>
+                                <autoresizingMask key="autoresizingMask"/>
+                                <tableViewCellContentView key="contentView" opaque="NO" clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="center" preservesSuperviewLayoutMargins="YES" insetsLayoutMarginsFromSafeArea="NO" tableViewCell="HAm-mA-O78" id="swa-et-rfA">
+                                    <rect key="frame" x="0.0" y="0.0" width="343" height="107.5"/>
+                                    <autoresizingMask key="autoresizingMask"/>
+                                    <subviews>
+                                        <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" spacing="8" translatesAutoresizingMaskIntoConstraints="NO" id="mtw-JM-T70">
+                                            <rect key="frame" x="16" y="11" width="311" height="85.5"/>
+                                            <subviews>
+                                                <stackView opaque="NO" contentMode="scaleToFill" alignment="top" spacing="8" translatesAutoresizingMaskIntoConstraints="NO" id="bjU-TX-4lm" userLabel="Compact">
+                                                    <rect key="frame" x="0.0" y="0.0" width="311" height="43.5"/>
+                                                    <subviews>
+                                                        <imageView clipsSubviews="YES" userInteractionEnabled="NO" contentMode="scaleAspectFit" horizontalHuggingPriority="251" verticalHuggingPriority="251" translatesAutoresizingMaskIntoConstraints="NO" id="sDZ-ZN-NT1" customClass="AppIconImageView" customModule="SideStore" customModuleProvider="target">
+                                                            <rect key="frame" x="0.0" y="0.0" width="43" height="43"/>
+                                                            <constraints>
+                                                                <constraint firstAttribute="width" secondItem="sDZ-ZN-NT1" secondAttribute="height" multiplier="1:1" id="M8a-Wh-6wd"/>
+                                                                <constraint firstAttribute="width" constant="43" id="dgV-jc-GET"/>
+                                                            </constraints>
+                                                        </imageView>
+                                                        <stackView opaque="NO" contentMode="scaleToFill" axis="vertical" distribution="equalSpacing" spacing="4" translatesAutoresizingMaskIntoConstraints="NO" id="82d-v0-RCp">
+                                                            <rect key="frame" x="51" y="0.0" width="260" height="39"/>
+                                                            <subviews>
+                                                                <stackView opaque="NO" contentMode="scaleToFill" distribution="equalSpacing" spacing="8" translatesAutoresizingMaskIntoConstraints="NO" id="Q2j-Tc-bp2">
+                                                                    <rect key="frame" x="0.0" y="0.0" width="260" height="18"/>
+                                                                    <subviews>
+                                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Success" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="Na7-uj-XYZ">
+                                                                            <rect key="frame" x="0.0" y="0.0" width="60" height="18"/>
+                                                                            <fontDescription key="fontDescription" type="system" weight="semibold" pointSize="15"/>
+                                                                            <nil key="textColor"/>
+                                                                            <nil key="highlightedColor"/>
+                                                                        </label>
+                                                                        <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" horizontalCompressionResistancePriority="751" text="Date" textAlignment="natural" lineBreakMode="tailTruncation" baselineAdjustment="alignBaselines" adjustsFontSizeToFit="NO" translatesAutoresizingMaskIntoConstraints="NO" id="SGf-pP-RL0">
+                                                                            <rect key="frame" x="229.5" y="0.0" width="30.5" height="18"/>
+                                                                            <fontDescription key="fontDescription" type="system" pointSize="14"/>
+                                                                            <color key="textColor" white="0.66666666669999997" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                                            <nil key="highlightedColor"/>
+                                                                        </label>
+                                                                    </subviews>
+                                                                </stackView>
+                                                                <label opaque="NO" userInteractionEnabled="NO" contentMode="left" horizontalHuggingPriority="251" verticalHuggingPriority="251" text="Error Code" textAlignment="natural" lineBreakMode="headTruncation" baselineAdjustment="alignBaselines" minimumScaleFactor="0.5" translatesAutoresizingMaskIntoConstraints="NO" id="R5a-wv-xHd">
+                                                                    <rect key="frame" x="0.0" y="22" width="260" height="17"/>
+                                                                    <fontDescription key="fontDescription" type="system" pointSize="14"/>
+                                                                    <color key="textColor" white="0.66666666669999997" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
+                                                                    <nil key="highlightedColor"/>
+                                                                </label>
+                                                            </subviews>
+                                                        </stackView>
+                                                    </subviews>
+                                                </stackView>
+                                                <textView clipsSubviews="YES" multipleTouchEnabled="YES" contentMode="scaleToFill" scrollEnabled="NO" editable="NO" text="Error Description" textAlignment="natural" selectable="NO" translatesAutoresizingMaskIntoConstraints="NO" id="1df-ri-hKN" customClass="CollapsingTextView" customModule="SideStore" customModuleProvider="target">
+                                                    <rect key="frame" x="0.0" y="51.5" width="311" height="34"/>
+                                                    <accessibility key="accessibilityConfiguration">
+                                                        <accessibilityTraits key="traits" staticText="YES"/>
+                                                        <bool key="isElement" value="NO"/>
+                                                    </accessibility>
+                                                    <color key="textColor" systemColor="labelColor"/>
+                                                    <fontDescription key="fontDescription" type="system" pointSize="15"/>
+                                                    <textInputTraits key="textInputTraits" autocapitalizationType="sentences"/>
+                                                </textView>
+                                            </subviews>
+                                        </stackView>
+                                        <button opaque="NO" contentMode="scaleToFill" showsMenuAsPrimaryAction="YES" contentHorizontalAlignment="center" contentVerticalAlignment="center" buttonType="system" lineBreakMode="middleTruncation" translatesAutoresizingMaskIntoConstraints="NO" id="ba2-EY-tf5">
+                                            <rect key="frame" x="0.0" y="0.0" width="343" height="107.5"/>
+                                            <accessibility key="accessibilityConfiguration">
+                                                <bool key="isElement" value="NO"/>
+                                            </accessibility>
+                                            <state key="normal" title="Button"/>
+                                            <buttonConfiguration key="configuration" style="plain" title=" "/>
+                                        </button>
+                                    </subviews>
+                                    <constraints>
+                                        <constraint firstItem="ba2-EY-tf5" firstAttribute="leading" secondItem="swa-et-rfA" secondAttribute="leading" id="70b-ce-vg1"/>
+                                        <constraint firstItem="ba2-EY-tf5" firstAttribute="top" secondItem="swa-et-rfA" secondAttribute="top" id="98S-pF-R8J"/>
+                                        <constraint firstAttribute="bottomMargin" secondItem="mtw-JM-T70" secondAttribute="bottom" id="fmH-Tj-9iY"/>
+                                        <constraint firstAttribute="trailingMargin" secondItem="mtw-JM-T70" secondAttribute="trailing" id="fu1-uu-mXb"/>
+                                        <constraint firstAttribute="bottom" secondItem="ba2-EY-tf5" secondAttribute="bottom" id="kvX-B0-v1x"/>
+                                        <constraint firstAttribute="leadingMargin" secondItem="mtw-JM-T70" secondAttribute="leading" id="mIY-lM-64i"/>
+                                        <constraint firstAttribute="trailing" secondItem="ba2-EY-tf5" secondAttribute="trailing" id="qnx-qR-VAH"/>
+                                        <constraint firstAttribute="topMargin" secondItem="mtw-JM-T70" secondAttribute="top" id="wOS-QI-w47"/>
+                                    </constraints>
+                                </tableViewCellContentView>
+                                <connections>
+                                    <outlet property="appIconImageView" destination="sDZ-ZN-NT1" id="5Fb-6X-vNV"/>
+                                    <outlet property="dateLabel" destination="SGf-pP-RL0" id="jCW-Ib-QGv"/>
+                                    <outlet property="errorCodeLabel" destination="R5a-wv-xHd" id="AeF-Yh-OVe"/>
+                                    <outlet property="errorDescriptionTextView" destination="1df-ri-hKN" id="s4Z-Id-iS8"/>
+                                    <outlet property="errorFailureLabel" destination="Na7-uj-XYZ" id="c6r-XP-oIL"/>
+                                    <outlet property="menuButton" destination="ba2-EY-tf5" id="GjL-NZ-KuX"/>
+                                </connections>
+                            </tableViewCell>
+                        </prototypes>
+                        <connections>
+                            <outlet property="dataSource" destination="g8a-Rf-zWa" id="3Tb-tm-jjW"/>
+                            <outlet property="delegate" destination="g8a-Rf-zWa" id="mbI-k7-Dqq"/>
+                        </connections>
+                    </tableView>
+                    <navigationItem key="navigationItem" title="Error Log" largeTitleDisplayMode="never" id="a1p-3W-bSi">
+                        <barButtonItem key="rightBarButtonItem" systemItem="trash" id="BnQ-Eh-1gC">
+                            <connections>
+                                <action selector="clearLoggedErrors:" destination="g8a-Rf-zWa" id="faq-89-H5j"/>
+                            </connections>
+                        </barButtonItem>
+                    </navigationItem>
+                </tableViewController>
+                <placeholder placeholderIdentifier="IBFirstResponder" id="rU1-TZ-TD8" userLabel="First Responder" sceneMemberID="firstResponder"/>
+            </objects>
+            <point key="canvasLocation" x="1697" y="1774"/>
+        </scene>
     </scenes>
     <resources>
         <image name="Next" width="18" height="18"/>
         <image name="Settings" width="20" height="20"/>
         <namedColor name="SettingsBackground">
-            <color red="0.0039215686274509803" green="0.50196078431372548" blue="0.51764705882352946" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+            <color red="0.45098039215686275" green="0.015686274509803921" blue="0.68627450980392157" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
         </namedColor>
         <systemColor name="darkTextColor">
             <color white="0.0" alpha="1" colorSpace="custom" customColorSpace="genericGamma22GrayColorSpace"/>
         </systemColor>
+        <systemColor name="labelColor">
+            <color red="0.0" green="0.0" blue="0.0" alpha="1" colorSpace="custom" customColorSpace="sRGB"/>
+        </systemColor>
     </resources>
 </document>

AltStore/Settings/SettingsViewController.swift

@@ -52,6 +52,8 @@ extension SettingsViewController
     {
         case sendFeedback
         case refreshAttempts
+        case errorLog
+        case advancedSettings
     }
 }
 
@@ -470,7 +472,7 @@ extension SettingsViewController
             {
             case .developer: self.openTwitter(username: "sidestore_io")
             case .operations: self.openTwitter(username: "sidestore_io")
-            case .designer: self.openTwitter(username: "1carolinemoore")
+            case .designer: self.openTwitter(username: "lit_ritt")
             case .softwareLicenses: break
             }
             
@@ -501,8 +503,15 @@ extension SettingsViewController
                     let toastView = ToastView(text: NSLocalizedString("Cannot Send Mail", comment: ""), detailText: nil)
                     toastView.show(in: self)
                 }
-                
+            case .advancedSettings:
-            case .refreshAttempts: break
+                // Create the URL that deep links to your app's custom settings.
+                if let url = URL(string: UIApplication.openSettingsURLString) {
+                    // Ask the system to open that URL.
+                    UIApplication.shared.open(url)
+                } else {
+                    ELOG("UIApplication.openSettingsURLString invalid")
+                }
+            case .refreshAttempts, .errorLog: break
             }
             
         default: break

AltStoreCore/Components/Keychain.swift

@@ -45,7 +45,7 @@ public class Keychain
 {
     public static let shared = Keychain()
     
-    fileprivate let keychain = KeychainAccess.Keychain(service: "com.rileytestut.AltStore").accessibility(.afterFirstUnlock).synchronizable(true)
+    fileprivate let keychain = KeychainAccess.Keychain(service: Bundle.Info.appbundleIdentifier).accessibility(.afterFirstUnlock).synchronizable(true)
     
     @KeychainItem(key: "appleIDEmailAddress")
     public var appleIDEmailAddress: String?

AltStoreCore/Extensions/UserDefaults+AltStore.swift

@@ -21,6 +21,8 @@ public extension UserDefaults
     
     @NSManaged var firstLaunch: Date?
     @NSManaged var requiresAppGroupMigration: Bool
+    @NSManaged var textServer: Bool
+    @NSManaged var textInputAnisetteURL: String?
     @NSManaged var customAnisetteURL: String?
     @NSManaged var preferredServerID: String?
     

AltStoreCore/Model/AltStore.xcdatamodeld/.xccurrentversion

@@ -3,6 +3,6 @@
 <plist version="1.0">
 <dict>
 	<key>_XCCurrentVersionName</key>
-	<string>AltStore 10.xcdatamodel</string>
+	<string>AltStore 11.xcdatamodel</string>
 </dict>
 </plist>

AltStoreCore/Model/AltStore.xcdatamodeld/AltStore 11.xcdatamodel/contents

@@ -0,0 +1,208 @@
+<?xml version="1.0" encoding="UTF-8" standalone="yes"?>
+<model type="com.apple.IDECoreDataModeler.DataModel" documentVersion="1.0" lastSavedToolsVersion="21279" systemVersion="21G83" minimumToolsVersion="Automatic" sourceLanguage="Swift" userDefinedModelVersionIdentifier="">
+    <entity name="Account" representedClassName="Account" syncable="YES">
+        <attribute name="appleID" attributeType="String"/>
+        <attribute name="firstName" attributeType="String"/>
+        <attribute name="identifier" attributeType="String"/>
+        <attribute name="isActiveAccount" attributeType="Boolean" defaultValueString="NO" usesScalarValueType="YES"/>
+        <attribute name="lastName" attributeType="String"/>
+        <relationship name="teams" toMany="YES" deletionRule="Cascade" destinationEntity="Team" inverseName="account" inverseEntity="Team"/>
+        <uniquenessConstraints>
+            <uniquenessConstraint>
+                <constraint value="identifier"/>
+            </uniquenessConstraint>
+        </uniquenessConstraints>
+    </entity>
+    <entity name="AppID" representedClassName="AppID" syncable="YES">
+        <attribute name="bundleIdentifier" attributeType="String"/>
+        <attribute name="expirationDate" optional="YES" attributeType="Date" usesScalarValueType="NO"/>
+        <attribute name="features" attributeType="Transformable"/>
+        <attribute name="identifier" attributeType="String"/>
+        <attribute name="name" attributeType="String"/>
+        <relationship name="team" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="Team" inverseName="appIDs" inverseEntity="Team"/>
+        <uniquenessConstraints>
+            <uniquenessConstraint>
+                <constraint value="identifier"/>
+            </uniquenessConstraint>
+        </uniquenessConstraints>
+    </entity>
+    <entity name="AppPermission" representedClassName="AppPermission" syncable="YES">
+        <attribute name="type" attributeType="String"/>
+        <attribute name="usageDescription" attributeType="String"/>
+        <relationship name="app" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="StoreApp" inverseName="permissions" inverseEntity="StoreApp"/>
+    </entity>
+    <entity name="AppVersion" representedClassName="AppVersion" syncable="YES">
+        <attribute name="appBundleID" attributeType="String"/>
+        <attribute name="date" attributeType="Date" usesScalarValueType="NO"/>
+        <attribute name="downloadURL" attributeType="URI"/>
+        <attribute name="localizedDescription" optional="YES" attributeType="String"/>
+        <attribute name="maxOSVersion" optional="YES" attributeType="String"/>
+        <attribute name="minOSVersion" optional="YES" attributeType="String"/>
+        <attribute name="size" attributeType="Integer 64" defaultValueString="0" usesScalarValueType="YES"/>
+        <attribute name="sourceID" optional="YES" attributeType="String"/>
+        <attribute name="version" attributeType="String"/>
+        <relationship name="app" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="StoreApp" inverseName="versions" inverseEntity="StoreApp"/>
+        <relationship name="latestVersionApp" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="StoreApp" inverseName="latestVersion" inverseEntity="StoreApp"/>
+        <uniquenessConstraints>
+            <uniquenessConstraint>
+                <constraint value="appBundleID"/>
+                <constraint value="version"/>
+                <constraint value="sourceID"/>
+            </uniquenessConstraint>
+        </uniquenessConstraints>
+    </entity>
+    <entity name="InstalledApp" representedClassName="InstalledApp" syncable="YES">
+        <attribute name="bundleIdentifier" attributeType="String"/>
+        <attribute name="certificateSerialNumber" optional="YES" attributeType="String"/>
+        <attribute name="expirationDate" attributeType="Date" usesScalarValueType="NO"/>
+        <attribute name="hasAlternateIcon" attributeType="Boolean" defaultValueString="NO" usesScalarValueType="YES"/>
+        <attribute name="installedDate" attributeType="Date" usesScalarValueType="NO"/>
+        <attribute name="isActive" attributeType="Boolean" defaultValueString="YES" usesScalarValueType="YES"/>
+        <attribute name="isRefreshing" transient="YES" attributeType="Boolean" defaultValueString="NO" usesScalarValueType="YES"/>
+        <attribute name="name" attributeType="String"/>
+        <attribute name="needsResign" attributeType="Boolean" defaultValueString="NO" usesScalarValueType="YES"/>
+        <attribute name="refreshedDate" attributeType="Date" usesScalarValueType="NO"/>
+        <attribute name="resignedBundleIdentifier" attributeType="String"/>
+        <attribute name="version" attributeType="String"/>
+        <relationship name="appExtensions" toMany="YES" deletionRule="Cascade" destinationEntity="InstalledExtension" inverseName="parentApp" inverseEntity="InstalledExtension"/>
+        <relationship name="loggedErrors" toMany="YES" deletionRule="Nullify" destinationEntity="LoggedError" inverseName="installedApp" inverseEntity="LoggedError"/>
+        <relationship name="storeApp" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="StoreApp" inverseName="installedApp" inverseEntity="StoreApp"/>
+        <relationship name="team" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="Team" inverseName="installedApps" inverseEntity="Team"/>
+        <uniquenessConstraints>
+            <uniquenessConstraint>
+                <constraint value="bundleIdentifier"/>
+            </uniquenessConstraint>
+        </uniquenessConstraints>
+    </entity>
+    <entity name="InstalledExtension" representedClassName="InstalledExtension" syncable="YES">
+        <attribute name="bundleIdentifier" attributeType="String"/>
+        <attribute name="expirationDate" attributeType="Date" usesScalarValueType="NO"/>
+        <attribute name="installedDate" attributeType="Date" usesScalarValueType="NO"/>
+        <attribute name="name" attributeType="String"/>
+        <attribute name="refreshedDate" attributeType="Date" usesScalarValueType="NO"/>
+        <attribute name="resignedBundleIdentifier" attributeType="String"/>
+        <attribute name="version" attributeType="String"/>
+        <relationship name="parentApp" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="InstalledApp" inverseName="appExtensions" inverseEntity="InstalledApp"/>
+    </entity>
+    <entity name="LoggedError" representedClassName="LoggedError" syncable="YES">
+        <attribute name="appBundleID" attributeType="String"/>
+        <attribute name="appName" attributeType="String"/>
+        <attribute name="code" attributeType="Integer 32" defaultValueString="0" usesScalarValueType="YES"/>
+        <attribute name="date" attributeType="Date" usesScalarValueType="NO"/>
+        <attribute name="domain" attributeType="String"/>
+        <attribute name="operation" optional="YES" attributeType="String"/>
+        <attribute name="userInfo" attributeType="Transformable" valueTransformerName="ALTSecureValueTransformer"/>
+        <relationship name="installedApp" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="InstalledApp" inverseName="loggedErrors" inverseEntity="InstalledApp"/>
+        <relationship name="storeApp" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="StoreApp" inverseName="loggedErrors" inverseEntity="StoreApp"/>
+    </entity>
+    <entity name="NewsItem" representedClassName="NewsItem" syncable="YES">
+        <attribute name="appID" optional="YES" attributeType="String"/>
+        <attribute name="caption" attributeType="String"/>
+        <attribute name="date" attributeType="Date" usesScalarValueType="NO"/>
+        <attribute name="externalURL" optional="YES" attributeType="URI"/>
+        <attribute name="identifier" attributeType="String"/>
+        <attribute name="imageURL" optional="YES" attributeType="URI"/>
+        <attribute name="isSilent" attributeType="Boolean" defaultValueString="YES" usesScalarValueType="YES"/>
+        <attribute name="sortIndex" attributeType="Integer 32" defaultValueString="0" usesScalarValueType="YES"/>
+        <attribute name="sourceIdentifier" optional="YES" attributeType="String"/>
+        <attribute name="tintColor" optional="YES" attributeType="Transformable"/>
+        <attribute name="title" attributeType="String"/>
+        <relationship name="source" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="Source" inverseName="newsItems" inverseEntity="Source"/>
+        <relationship name="storeApp" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="StoreApp" inverseName="newsItems" inverseEntity="StoreApp"/>
+        <uniquenessConstraints>
+            <uniquenessConstraint>
+                <constraint value="identifier"/>
+                <constraint value="sourceIdentifier"/>
+            </uniquenessConstraint>
+        </uniquenessConstraints>
+    </entity>
+    <entity name="PatreonAccount" representedClassName="PatreonAccount" syncable="YES">
+        <attribute name="firstName" optional="YES" attributeType="String"/>
+        <attribute name="identifier" attributeType="String"/>
+        <attribute name="isPatron" attributeType="Boolean" defaultValueString="NO" usesScalarValueType="YES"/>
+        <attribute name="name" attributeType="String"/>
+        <uniquenessConstraints>
+            <uniquenessConstraint>
+                <constraint value="identifier"/>
+            </uniquenessConstraint>
+        </uniquenessConstraints>
+    </entity>
+    <entity name="Patron" representedClassName="ManagedPatron" syncable="YES">
+        <attribute name="identifier" attributeType="String"/>
+        <attribute name="name" attributeType="String"/>
+        <uniquenessConstraints>
+            <uniquenessConstraint>
+                <constraint value="identifier"/>
+            </uniquenessConstraint>
+        </uniquenessConstraints>
+    </entity>
+    <entity name="RefreshAttempt" representedClassName="RefreshAttempt" syncable="YES">
+        <attribute name="date" attributeType="Date" usesScalarValueType="NO"/>
+        <attribute name="errorDescription" optional="YES" attributeType="String"/>
+        <attribute name="identifier" attributeType="String"/>
+        <attribute name="isSuccess" attributeType="Boolean" defaultValueString="YES" usesScalarValueType="YES"/>
+        <uniquenessConstraints>
+            <uniquenessConstraint>
+                <constraint value="identifier"/>
+            </uniquenessConstraint>
+        </uniquenessConstraints>
+    </entity>
+    <entity name="Source" representedClassName="Source" syncable="YES">
+        <attribute name="error" optional="YES" attributeType="Transformable" valueTransformerName="ALTSecureValueTransformer"/>
+        <attribute name="identifier" attributeType="String"/>
+        <attribute name="name" attributeType="String"/>
+        <attribute name="sourceURL" attributeType="URI"/>
+        <relationship name="apps" toMany="YES" deletionRule="Cascade" ordered="YES" destinationEntity="StoreApp" inverseName="source" inverseEntity="StoreApp"/>
+        <relationship name="newsItems" toMany="YES" deletionRule="Cascade" ordered="YES" destinationEntity="NewsItem" inverseName="source" inverseEntity="NewsItem"/>
+        <uniquenessConstraints>
+            <uniquenessConstraint>
+                <constraint value="identifier"/>
+            </uniquenessConstraint>
+        </uniquenessConstraints>
+    </entity>
+    <entity name="StoreApp" representedClassName="StoreApp" syncable="YES">
+        <attribute name="bundleIdentifier" attributeType="String"/>
+        <attribute name="developerName" attributeType="String"/>
+        <attribute name="downloadURL" attributeType="URI"/>
+        <attribute name="iconURL" attributeType="URI"/>
+        <attribute name="isBeta" attributeType="Boolean" defaultValueString="NO" usesScalarValueType="YES"/>
+        <attribute name="localizedDescription" attributeType="String"/>
+        <attribute name="name" attributeType="String"/>
+        <attribute name="screenshotURLs" attributeType="Transformable"/>
+        <attribute name="size" attributeType="Integer 32" defaultValueString="0" usesScalarValueType="YES"/>
+        <attribute name="sortIndex" attributeType="Integer 32" defaultValueString="0" usesScalarValueType="YES"/>
+        <attribute name="sourceIdentifier" optional="YES" attributeType="String"/>
+        <attribute name="subtitle" optional="YES" attributeType="String"/>
+        <attribute name="tintColor" optional="YES" attributeType="Transformable"/>
+        <attribute name="version" attributeType="String"/>
+        <attribute name="versionDate" attributeType="Date" usesScalarValueType="NO"/>
+        <attribute name="versionDescription" optional="YES" attributeType="String"/>
+        <relationship name="installedApp" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="InstalledApp" inverseName="storeApp" inverseEntity="InstalledApp"/>
+        <relationship name="latestVersion" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="AppVersion" inverseName="latestVersionApp" inverseEntity="AppVersion"/>
+        <relationship name="loggedErrors" toMany="YES" deletionRule="Nullify" destinationEntity="LoggedError" inverseName="storeApp" inverseEntity="LoggedError"/>
+        <relationship name="newsItems" toMany="YES" deletionRule="Nullify" destinationEntity="NewsItem" inverseName="storeApp" inverseEntity="NewsItem"/>
+        <relationship name="permissions" toMany="YES" deletionRule="Cascade" ordered="YES" destinationEntity="AppPermission" inverseName="app" inverseEntity="AppPermission"/>
+        <relationship name="source" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="Source" inverseName="apps" inverseEntity="Source"/>
+        <relationship name="versions" toMany="YES" deletionRule="Cascade" ordered="YES" destinationEntity="AppVersion" inverseName="app" inverseEntity="AppVersion"/>
+        <uniquenessConstraints>
+            <uniquenessConstraint>
+                <constraint value="sourceIdentifier"/>
+                <constraint value="bundleIdentifier"/>
+            </uniquenessConstraint>
+        </uniquenessConstraints>
+    </entity>
+    <entity name="Team" representedClassName="Team" syncable="YES">
+        <attribute name="identifier" attributeType="String"/>
+        <attribute name="isActiveTeam" attributeType="Boolean" defaultValueString="NO" usesScalarValueType="YES"/>
+        <attribute name="name" attributeType="String"/>
+        <attribute name="type" attributeType="Integer 16" defaultValueString="0" usesScalarValueType="YES"/>
+        <relationship name="account" optional="YES" maxCount="1" deletionRule="Nullify" destinationEntity="Account" inverseName="teams" inverseEntity="Account"/>
+        <relationship name="appIDs" toMany="YES" deletionRule="Cascade" destinationEntity="AppID" inverseName="team" inverseEntity="AppID"/>
+        <relationship name="installedApps" toMany="YES" deletionRule="Nullify" destinationEntity="InstalledApp" inverseName="team" inverseEntity="InstalledApp"/>
+        <uniquenessConstraints>
+            <uniquenessConstraint>
+                <constraint value="identifier"/>
+            </uniquenessConstraint>
+        </uniquenessConstraints>
+    </entity>
+</model>

AltStoreCore/Model/AppPermission.swift

@@ -25,8 +25,22 @@ public extension ALTAppPermissionType
         switch self
         {
         case .photos: return NSLocalizedString("Photos", comment: "")
+        case .camera: return NSLocalizedString("Camera", comment: "")
+        case .location: return NSLocalizedString("Location", comment: "")
+        case .contacts: return NSLocalizedString("Contacts", comment: "")
+        case .reminders: return NSLocalizedString("Reminders", comment: "")
+        case .appleMusic: return NSLocalizedString("Apple Music", comment: "")
+        case .microphone: return NSLocalizedString("Microphone", comment: "")
+        case .speechRecognition: return NSLocalizedString("Speech Recognition", comment: "")
         case .backgroundAudio: return NSLocalizedString("Background Audio", comment: "")
         case .backgroundFetch: return NSLocalizedString("Background Fetch", comment: "")
+        case .bluetooth: return NSLocalizedString("Bluetooth", comment: "")
+        case .network: return NSLocalizedString("Network", comment: "")
+        case .calendars: return NSLocalizedString("Calendars", comment: "")
+        case .touchID: return NSLocalizedString("Touch ID", comment: "")
+        case .faceID: return NSLocalizedString("Face ID", comment: "")
+        case .siri: return NSLocalizedString("Siri", comment: "")
+        case .motion: return NSLocalizedString("Motion", comment: "")
         default: return nil
         }
     }
@@ -34,10 +48,25 @@ public extension ALTAppPermissionType
     var icon: UIImage? {
         switch self
         {
-        case .photos: return UIImage(named: "PhotosPermission")
+        case .photos: return UIImage(systemName: "photo.on.rectangle.angled")
-        case .backgroundAudio: return UIImage(named: "BackgroundAudioPermission")
+        case .camera: return UIImage(systemName: "camera.fill")
-        case .backgroundFetch: return UIImage(named: "BackgroundFetchPermission")
+        case .location: return UIImage(systemName: "location.fill")
-        default: return nil
+        case .contacts: return UIImage(systemName: "person.2.fill")
+        case .reminders: return UIImage(systemName: "checklist")
+        case .appleMusic: return UIImage(systemName: "music.note")
+        case .microphone: return UIImage(systemName: "mic.fill")
+        case .speechRecognition: return UIImage(systemName: "waveform.and.mic")
+        case .backgroundAudio: return UIImage(systemName: "speaker.fill")
+        case .backgroundFetch: return UIImage(systemName: "square.and.arrow.down")
+        case .bluetooth: return UIImage(systemName: "wave.3.right")
+        case .network: return UIImage(systemName: "network")
+        case .calendars: return UIImage(systemName: "calendar")
+        case .touchID: return UIImage(systemName: "touchid")
+        case .faceID: return UIImage(systemName: "faceid")
+        case .siri: return UIImage(systemName: "mic.and.signal.meter.fill")
+        case .motion: return UIImage(systemName: "figure.walk.motion")
+        default:
+            return nil
         }
     }
 }

AltStoreCore/Model/AppVersion.swift

@@ -0,0 +1,116 @@
+//
+//  AppVersion.swift
+//  AltStoreCore
+//
+//  Created by Riley Testut on 8/18/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import CoreData
+
+@objc(AppVersion)
+public class AppVersion: NSManagedObject, Decodable, Fetchable
+{
+    /* Properties */
+    @NSManaged public var version: String
+    @NSManaged public var date: Date
+    @NSManaged public var localizedDescription: String?
+    
+    @NSManaged public var downloadURL: URL
+    @NSManaged public var size: Int64
+    
+    @nonobjc public var minOSVersion: OperatingSystemVersion? {
+        guard let osVersionString = self._minOSVersion else { return nil }
+        
+        let osVersion = OperatingSystemVersion(string: osVersionString)
+        return osVersion
+    }
+    @NSManaged @objc(minOSVersion) private var _minOSVersion: String?
+    
+    @nonobjc public var maxOSVersion: OperatingSystemVersion? {
+        guard let osVersionString = self._maxOSVersion else { return nil }
+        
+        let osVersion = OperatingSystemVersion(string: osVersionString)
+        return osVersion
+    }
+    @NSManaged @objc(maxOSVersion) private var _maxOSVersion: String?
+    
+    @NSManaged public var appBundleID: String
+    @NSManaged public var sourceID: String?
+    
+    /* Relationships */
+    @NSManaged public private(set) var app: StoreApp?
+    @NSManaged public private(set) var latestVersionApp: StoreApp?
+    
+    private override init(entity: NSEntityDescription, insertInto context: NSManagedObjectContext?)
+    {
+        super.init(entity: entity, insertInto: context)
+    }
+    
+    private enum CodingKeys: String, CodingKey
+    {
+        case version
+        case date
+        case localizedDescription
+        case downloadURL
+        case size
+    }
+    
+    public required init(from decoder: Decoder) throws
+    {
+        guard let context = decoder.managedObjectContext else { preconditionFailure("Decoder must have non-nil NSManagedObjectContext.") }
+        
+        super.init(entity: AppVersion.entity(), insertInto: context)
+        
+        do
+        {
+            let container = try decoder.container(keyedBy: CodingKeys.self)
+            
+            self.version = try container.decode(String.self, forKey: .version)
+            self.date = try container.decode(Date.self, forKey: .date)
+            self.localizedDescription = try container.decodeIfPresent(String.self, forKey: .localizedDescription)
+            
+            self.downloadURL = try container.decode(URL.self, forKey: .downloadURL)
+            self.size = try container.decode(Int64.self, forKey: .size)
+        }
+        catch
+        {
+            if let context = self.managedObjectContext
+            {
+                context.delete(self)
+            }
+            
+            throw error
+        }
+    }
+}
+
+public extension AppVersion
+{
+    @nonobjc class func fetchRequest() -> NSFetchRequest<AppVersion>
+    {
+        return NSFetchRequest<AppVersion>(entityName: "AppVersion")
+    }
+    
+    class func makeAppVersion(
+        version: String,
+        date: Date,
+        localizedDescription: String? = nil,
+        downloadURL: URL,
+        size: Int64,
+        appBundleID: String,
+        sourceID: String? = nil,
+        in context: NSManagedObjectContext) -> AppVersion
+    {
+        let appVersion = AppVersion(context: context)
+        appVersion.version = version
+        appVersion.date = date
+        appVersion.localizedDescription = localizedDescription
+        appVersion.downloadURL = downloadURL
+        appVersion.size = size
+        appVersion.appBundleID = appBundleID
+        appVersion.sourceID = sourceID
+
+        return appVersion
+    }
+}

AltStoreCore/Model/DatabaseManager.swift

@@ -11,6 +11,15 @@ import CoreData
 import AltSign
 import Roxas
 
+extension CFNotificationName
+{
+    fileprivate static let willAccessDatabase = CFNotificationName("com.rileytestut.AltStore.WillAccessDatabase" as CFString)
+}
+
+private let ReceivedWillAccessDatabaseNotification: @convention(c) (CFNotificationCenter?, UnsafeMutableRawPointer?, CFNotificationName?, UnsafeRawPointer?, CFDictionary?) -> Void = { (center, observer, name, object, userInfo) in
+    DatabaseManager.shared.receivedWillAccessDatabaseNotification()
+}
+
 fileprivate class PersistentContainer: RSTPersistentContainer
 {
     override class func defaultDirectoryURL() -> URL
@@ -43,10 +52,15 @@ public class DatabaseManager
     private let coordinator = NSFileCoordinator()
     private let coordinatorQueue = OperationQueue()
     
+    private var ignoreWillAccessDatabaseNotification = false
+    
     private init()
     {
         self.persistentContainer = PersistentContainer(name: "AltStore", bundle: Bundle(for: DatabaseManager.self))
         self.persistentContainer.preferredMergePolicy = MergePolicy()
+        
+        let observer = Unmanaged.passUnretained(self).toOpaque()
+        CFNotificationCenterAddObserver(CFNotificationCenterGetDarwinNotifyCenter(), observer, ReceivedWillAccessDatabaseNotification, CFNotificationName.willAccessDatabase.rawValue, nil, .deliverImmediately)
     }
 }
 
@@ -73,6 +87,10 @@ public extension DatabaseManager
             
             guard !self.isStarted else { return finish(nil) }
             
+            // Quit any other running AltStore processes to prevent concurrent database access during and after migration.
+            self.ignoreWillAccessDatabaseNotification = true
+            CFNotificationCenterPostNotification(CFNotificationCenterGetDarwinNotifyCenter(), .willAccessDatabase, nil, nil, true)
+            
             self.migrateDatabaseToAppGroupIfNeeded { (result) in
                 switch result
                 {
@@ -122,6 +140,27 @@ public extension DatabaseManager
             }
         }
     }
+    
+    func purgeLoggedErrors(before date: Date? = nil, completion: @escaping (Result<Void, Error>) -> Void)
+    {
+        self.persistentContainer.performBackgroundTask { context in
+            do
+            {
+                let predicate = date.map { NSPredicate(format: "%K <= %@", #keyPath(LoggedError.date), $0 as NSDate) }
+                
+                let loggedErrors = LoggedError.all(satisfying: predicate, in: context, requestProperties: [\.returnsObjectsAsFaults: true])
+                loggedErrors.forEach { context.delete($0) }
+                
+                try context.save()
+                
+                completion(.success(()))
+            }
+            catch
+            {
+                completion(.failure(error))
+            }
+        }
+    }
 }
 
 public extension DatabaseManager
@@ -129,10 +168,7 @@ public extension DatabaseManager
     var viewContext: NSManagedObjectContext {
         return self.persistentContainer.viewContext
     }
-}
+    
-
-public extension DatabaseManager
-{
     func activeAccount(in context: NSManagedObjectContext = DatabaseManager.shared.viewContext) -> Account?
     {
         let predicate = NSPredicate(format: "%K == YES", #keyPath(Account.isActiveAccount))
@@ -193,7 +229,7 @@ private extension DatabaseManager
             else
             {
                 storeApp = StoreApp.makeAltStoreApp(in: context)
-                storeApp.version = localApp.version
+                storeApp.latestVersion?.version = localApp.version
                 storeApp.source = altStoreSource
             }
                         
@@ -380,4 +416,14 @@ private extension DatabaseManager
             }
         }
     }
+    
+    func receivedWillAccessDatabaseNotification()
+    {
+        defer { self.ignoreWillAccessDatabaseNotification = false }
+        
+        // Ignore notifications sent by the current process.
+        guard !self.ignoreWillAccessDatabaseNotification else { return }
+        
+        exit(104)
+    }
 }

AltStoreCore/Model/InstalledApp.swift

@@ -53,6 +53,8 @@ public class InstalledApp: NSManagedObject, InstalledAppProtocol
     @NSManaged public var team: Team?
     @NSManaged public var appExtensions: Set<InstalledExtension>
     
+    @NSManaged public private(set) var loggedErrors: NSSet /* Set<LoggedError> */ // Use NSSet to avoid eagerly fetching values.
+    
     public var isSideloaded: Bool {
         return self.storeApp == nil
     }
@@ -77,6 +79,8 @@ public class InstalledApp: NSManagedObject, InstalledAppProtocol
         
         self.bundleIdentifier = originalBundleIdentifier
         
+        print("InstalledApp `self.bundleIdentifier`: \(self.bundleIdentifier)")
+        
         self.refreshedDate = Date()
         self.installedDate = Date()
         
@@ -144,7 +148,7 @@ public extension InstalledApp
     {
         let fetchRequest = InstalledApp.fetchRequest() as NSFetchRequest<InstalledApp>
         fetchRequest.predicate = NSPredicate(format: "%K == YES AND %K != nil AND %K != %K",
-                                             #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.storeApp), #keyPath(InstalledApp.version), #keyPath(InstalledApp.storeApp.version))
+                                             #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.storeApp), #keyPath(InstalledApp.version), #keyPath(InstalledApp.storeApp.latestVersion.version))
         return fetchRequest
     }
     
@@ -152,13 +156,14 @@ public extension InstalledApp
     {
         let fetchRequest = InstalledApp.fetchRequest() as NSFetchRequest<InstalledApp>
         fetchRequest.predicate = NSPredicate(format: "%K == YES", #keyPath(InstalledApp.isActive))
+        print("Active Apps Fetch Request: \(String(describing: fetchRequest.predicate))")
         return fetchRequest
     }
     
     class func fetchAltStore(in context: NSManagedObjectContext) -> InstalledApp?
     {
         let predicate = NSPredicate(format: "%K == %@", #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
-        
+        print("Fetch 'AltStore' Predicate: \(String(describing: predicate))")
         let altStore = InstalledApp.first(satisfying: predicate, in: context)
         return altStore
     }
@@ -172,16 +177,17 @@ public extension InstalledApp
     class func fetchAppsForRefreshingAll(in context: NSManagedObjectContext) -> [InstalledApp]
     {
         var predicate = NSPredicate(format: "%K == YES AND %K != %@", #keyPath(InstalledApp.isActive), #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
+        print("Fetch Apps for Refreshing All 'AltStore' predicate: \(String(describing: predicate))")
         
-        if let patreonAccount = DatabaseManager.shared.patreonAccount(in: context), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
+//        if let patreonAccount = DatabaseManager.shared.patreonAccount(in: context), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
-        {
+//        {
-            // No additional predicate
+//            // No additional predicate
-        }
+//        }
-        else
+//        else
-        {
+//        {
-            predicate = NSCompoundPredicate(andPredicateWithSubpredicates: [predicate,
+//            predicate = NSCompoundPredicate(andPredicateWithSubpredicates: [predicate,
-                                                                            NSPredicate(format: "%K == nil OR %K == NO", #keyPath(InstalledApp.storeApp), #keyPath(InstalledApp.storeApp.isBeta))])
+//                                                                            NSPredicate(format: "%K == nil OR %K == NO", #keyPath(InstalledApp.storeApp), #keyPath(InstalledApp.storeApp.isBeta))])
-        }
+//        }
         
         var installedApps = InstalledApp.all(satisfying: predicate,
                                              sortedBy: [NSSortDescriptor(keyPath: \InstalledApp.expirationDate, ascending: true)],
@@ -205,16 +211,17 @@ public extension InstalledApp
                                     #keyPath(InstalledApp.isActive),
                                     #keyPath(InstalledApp.refreshedDate), date as NSDate,
                                     #keyPath(InstalledApp.bundleIdentifier), StoreApp.altstoreAppID)
+        print("Active Apps For Background Refresh 'AltStore' predicate: \(String(describing: predicate))")
         
-        if let patreonAccount = DatabaseManager.shared.patreonAccount(in: context), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
+//        if let patreonAccount = DatabaseManager.shared.patreonAccount(in: context), patreonAccount.isPatron, PatreonAPI.shared.isAuthenticated
-        {
+//        {
-            // No additional predicate
+//            // No additional predicate
-        }
+//        }
-        else
+//        else
-        {
+//        {
-            predicate = NSCompoundPredicate(andPredicateWithSubpredicates: [predicate,
+//            predicate = NSCompoundPredicate(andPredicateWithSubpredicates: [predicate,
-                                                                            NSPredicate(format: "%K == nil OR %K == NO", #keyPath(InstalledApp.storeApp), #keyPath(InstalledApp.storeApp.isBeta))])
+//                                                                            NSPredicate(format: "%K == nil OR %K == NO", #keyPath(InstalledApp.storeApp), #keyPath(InstalledApp.storeApp.isBeta))])
-        }
+//        }
         
         var installedApps = InstalledApp.all(satisfying: predicate,
                                              sortedBy: [NSSortDescriptor(keyPath: \InstalledApp.expirationDate, ascending: true)],
@@ -251,14 +258,15 @@ public extension InstalledApp
         let appsDirectoryURL = baseDirectory.appendingPathComponent("Apps")
         
         do { try FileManager.default.createDirectory(at: appsDirectoryURL, withIntermediateDirectories: true, attributes: nil) }
-        catch { print(error) }
+        catch { print("Creating App Directory Error: \(error)") }
-        
+        print("`appsDirectoryURL` is set to: \(appsDirectoryURL.absoluteString)")
         return appsDirectoryURL
     }
     
     class var legacyAppsDirectoryURL: URL {
         let baseDirectory = FileManager.default.applicationSupportDirectory
         let appsDirectoryURL = baseDirectory.appendingPathComponent("Apps")
+        print("legacy `appsDirectoryURL` is set to: \(appsDirectoryURL.absoluteString)")
         return appsDirectoryURL
     }
     
@@ -271,6 +279,7 @@ public extension InstalledApp
     class func refreshedIPAURL(for app: AppProtocol) -> URL
     {
         let ipaURL = self.directoryURL(for: app).appendingPathComponent("Refreshed.ipa")
+        print("`ipaURL`: \(ipaURL.absoluteString)")
         return ipaURL
     }
     

AltStoreCore/Model/LoggedError.swift

@@ -0,0 +1,126 @@
+//
+//  LoggedError.swift
+//  AltStoreCore
+//
+//  Created by Riley Testut on 9/6/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import CoreData
+
+extension LoggedError
+{
+    public enum Operation: String
+    {
+        case install
+        case update
+        case refresh
+        case activate
+        case deactivate
+        case backup
+        case restore
+    }
+}
+
+@objc(LoggedError)
+public class LoggedError: NSManagedObject, Fetchable
+{
+    /* Properties */
+    @NSManaged public private(set) var date: Date
+    
+    @nonobjc public var operation: Operation? {
+        guard let rawOperation = self._operation else { return nil }
+        
+        let operation = Operation(rawValue: rawOperation)
+        return operation
+    }
+    @NSManaged @objc(operation) private var _operation: String?
+    
+    @NSManaged public private(set) var domain: String
+    @NSManaged public private(set) var code: Int32
+    @NSManaged public private(set) var userInfo: [String: Any]
+    
+    @NSManaged public private(set) var appName: String
+    @NSManaged public private(set) var appBundleID: String
+    
+    /* Relationships */
+    @NSManaged public private(set) var storeApp: StoreApp?
+    @NSManaged public private(set) var installedApp: InstalledApp?
+    
+    private static let dateFormatter: DateFormatter = {
+        let dateFormatter = DateFormatter()
+        dateFormatter.dateStyle = .long
+        dateFormatter.timeStyle = .none
+        return dateFormatter
+    }()
+    
+    private override init(entity: NSEntityDescription, insertInto context: NSManagedObjectContext?)
+    {
+        super.init(entity: entity, insertInto: context)
+    }
+    
+    public init(error: Error, app: AppProtocol, date: Date = Date(), operation: Operation? = nil, context: NSManagedObjectContext)
+    {
+        super.init(entity: LoggedError.entity(), insertInto: context)
+        
+        self.date = date
+        self._operation = operation?.rawValue
+        
+        let nsError = error as NSError
+        self.domain = nsError.domain
+        self.code = Int32(nsError.code)
+        self.userInfo = nsError.userInfo
+        
+        self.appName = app.name
+        self.appBundleID = app.bundleIdentifier
+        
+        switch app
+        {
+        case let storeApp as StoreApp: self.storeApp = storeApp
+        case let installedApp as InstalledApp: self.installedApp = installedApp
+        default: break
+        }
+    }
+}
+
+public extension LoggedError
+{
+    var app: AppProtocol {
+        // `as AppProtocol` needed to fix "cannot convert AnyApp to StoreApp" compiler error with Xcode 14.
+        let app = self.installedApp ?? self.storeApp ?? AnyApp(name: self.appName, bundleIdentifier: self.appBundleID, url: nil) as AppProtocol
+        return app
+    }
+    
+    var error: Error {
+        let nsError = NSError(domain: self.domain, code: Int(self.code), userInfo: self.userInfo)
+        return nsError
+    }
+    
+    @objc
+    var localizedDateString: String {
+        let localizedDateString = LoggedError.dateFormatter.string(from: self.date)
+        return localizedDateString
+    }
+    
+    var localizedFailure: String? {
+        guard let operation = self.operation else { return nil }
+        switch operation
+        {
+        case .install: return String(format: NSLocalizedString("Install %@ Failed", comment: ""), self.appName)
+        case .update: return String(format: NSLocalizedString("Update %@ Failed", comment: ""), self.appName)
+        case .refresh: return String(format: NSLocalizedString("Refresh %@ Failed", comment: ""), self.appName)
+        case .activate: return String(format: NSLocalizedString("Activate %@ Failed", comment: ""), self.appName)
+        case .deactivate: return String(format: NSLocalizedString("Deactivate %@ Failed", comment: ""), self.appName)
+        case .backup: return String(format: NSLocalizedString("Backup %@ Failed", comment: ""), self.appName)
+        case .restore: return String(format: NSLocalizedString("Restore %@ Failed", comment: ""), self.appName)
+        }
+    }
+}
+
+public extension LoggedError
+{
+    @nonobjc class func fetchRequest() -> NSFetchRequest<LoggedError>
+    {
+        return NSFetchRequest<LoggedError>(entityName: "LoggedError")
+    }
+}

AltStoreCore/Model/MergePolicy.swift

@@ -31,6 +31,24 @@ open class MergePolicy: RSTRelationshipPreservingMergePolicy
                         {
                             permission.managedObjectContext?.delete(permission)
                         }
+                        
+                        // Delete previous versions (different than below).
+                        for case let appVersion as AppVersion in previousApp._versions where appVersion.app == nil
+                        {
+                            appVersion.managedObjectContext?.delete(appVersion)
+                        }
+                    }
+                    
+                case is AppVersion where conflict.conflictingObjects.count == 2:
+                    // Occurs first time fetching sources after migrating from pre-AppVersion database model.
+                    let conflictingAppVersions = conflict.conflictingObjects.lazy.compactMap { $0 as? AppVersion }
+                    
+                    // Primary AppVersion == AppVersion whose latestVersionApp.latestVersion points back to itself.
+                    if let primaryAppVersion = conflictingAppVersions.first(where: { $0.latestVersionApp?.latestVersion == $0 }),
+                       let secondaryAppVersion = conflictingAppVersions.first(where: { $0 != primaryAppVersion })
+                    {
+                        secondaryAppVersion.managedObjectContext?.delete(secondaryAppVersion)
+                        print("[ALTLog] Resolving AppVersion context-level conflict. Most likely due to migrating from pre-AppVersion model version.", primaryAppVersion)
                     }
                     
                 default:
@@ -55,6 +73,16 @@ open class MergePolicy: RSTRelationshipPreservingMergePolicy
                     permission.managedObjectContext?.delete(permission)
                 }
                 
+                if let contextApp = conflict.conflictingObjects.first as? StoreApp
+                {
+                    let contextVersions = Set(contextApp._versions.lazy.compactMap { $0 as? AppVersion }.map { $0.version })
+                    for case let appVersion as AppVersion in databaseObject._versions where !contextVersions.contains(appVersion.version)
+                    {
+                        print("[ALTLog] Deleting cached app version: \(appVersion.appBundleID + "_" + appVersion.version), not in:", contextApp.versions.map { $0.appBundleID + "_" + $0.version })
+                        appVersion.managedObjectContext?.delete(appVersion)
+                    }
+                }
+                
             case let databaseObject as Source:
                 guard let conflictedObject = conflict.conflictingObjects.first as? Source else { break }
 

AltStoreCore/Model/Migrations/Policies/StoreApp10ToStoreApp11Policy.swift

@@ -0,0 +1,111 @@
+//
+//  StoreApp10ToStoreApp11Policy.swift
+//  AltStoreCore
+//
+//  Created by Riley Testut on 9/13/22.
+//  Copyright © 2022 Riley Testut. All rights reserved.
+//
+
+import CoreData
+
+// Can't use NSManagedObject subclasses, so add convenience accessors for KVC.
+fileprivate extension NSManagedObject
+{
+    var storeAppBundleID: String? {
+        let bundleID = self.value(forKey: #keyPath(StoreApp.bundleIdentifier)) as? String
+        return bundleID
+    }
+    
+    var storeAppSourceID: String? {
+        let sourceID = self.value(forKey: #keyPath(StoreApp.sourceIdentifier)) as? String
+        return sourceID
+    }
+    
+    var storeAppVersion: String? {
+        let version = self.value(forKey: #keyPath(StoreApp._version)) as? String
+        return version
+    }
+    
+    var storeAppVersionDate: Date? {
+        let versionDate = self.value(forKey: #keyPath(StoreApp._versionDate)) as? Date
+        return versionDate
+    }
+    
+    var storeAppVersionDescription: String? {
+        let versionDescription = self.value(forKey: #keyPath(StoreApp._versionDescription)) as? String
+        return versionDescription
+    }
+    
+    var storeAppSize: NSNumber? {
+        let size = self.value(forKey: #keyPath(StoreApp._size)) as? NSNumber
+        return size
+    }
+    
+    var storeAppDownloadURL: URL? {
+        let downloadURL = self.value(forKey: #keyPath(StoreApp._downloadURL)) as? URL
+        return downloadURL
+    }
+    
+    func setStoreAppLatestVersion(_ appVersion: NSManagedObject)
+    {
+        self.setValue(appVersion, forKey: #keyPath(StoreApp.latestVersion))
+        
+        let versions = NSOrderedSet(array: [appVersion])
+        self.setValue(versions, forKey: #keyPath(StoreApp._versions))
+    }
+    
+    class func makeAppVersion(version: String,
+                              date: Date,
+                              localizedDescription: String?,
+                              downloadURL: URL,
+                              size: Int64,
+                              appBundleID: String,
+                              sourceID: String,
+                              in context: NSManagedObjectContext) -> NSManagedObject
+    {
+        let appVersion = NSEntityDescription.insertNewObject(forEntityName: AppVersion.entity().name!, into: context)
+        appVersion.setValue(version, forKey: #keyPath(AppVersion.version))
+        appVersion.setValue(date, forKey: #keyPath(AppVersion.date))
+        appVersion.setValue(localizedDescription, forKey: #keyPath(AppVersion.localizedDescription))
+        appVersion.setValue(downloadURL, forKey: #keyPath(AppVersion.downloadURL))
+        appVersion.setValue(size, forKey: #keyPath(AppVersion.size))
+        appVersion.setValue(appBundleID, forKey: #keyPath(AppVersion.appBundleID))
+        appVersion.setValue(sourceID, forKey: #keyPath(AppVersion.sourceID))
+        return appVersion
+    }
+}
+
+@objc(StoreApp10ToStoreApp11Policy)
+class StoreApp10ToStoreApp11Policy: NSEntityMigrationPolicy
+{
+    override func createDestinationInstances(forSource sInstance: NSManagedObject, in mapping: NSEntityMapping, manager: NSMigrationManager) throws
+    {
+        try super.createDestinationInstances(forSource: sInstance, in: mapping, manager: manager)
+        
+        guard let appBundleID = sInstance.storeAppBundleID,
+              let sourceID = sInstance.storeAppSourceID,
+              let version = sInstance.storeAppVersion,
+              let versionDate = sInstance.storeAppVersionDate,
+              // let versionDescription = sInstance.storeAppVersionDescription, // Optional
+              let downloadURL = sInstance.storeAppDownloadURL,
+              let size = sInstance.storeAppSize as? Int64
+        else { return }
+        
+        guard
+            let destinationStoreApp = manager.destinationInstances(forEntityMappingName: mapping.name, sourceInstances: [sInstance]).first,
+            let context = destinationStoreApp.managedObjectContext
+        else { fatalError("A destination StoreApp and its managedObjectContext must exist.") }
+        
+        let appVersion = NSManagedObject.makeAppVersion(
+            version: version,
+            date: versionDate,
+            localizedDescription: sInstance.storeAppVersionDescription,
+            downloadURL: downloadURL,
+            size: Int64(size),
+            appBundleID: appBundleID,
+            sourceID: sourceID,
+            in: context)
+        
+        destinationStoreApp.setStoreAppLatestVersion(appVersion)
+    }
+}

AltStoreCore/Model/PatreonAccount.swift

@@ -52,15 +52,16 @@ public class PatreonAccount: NSManagedObject, Fetchable
         self.name = response.data.attributes.full_name
         self.firstName = response.data.attributes.first_name
         
-        if let patronResponse = response.included?.first
+//        if let patronResponse = response.included?.first
-        {
+//        {
-            let patron = Patron(response: patronResponse)
+//            let patron = Patron(response: patronResponse)
-            self.isPatron = (patron.status == .active)
+//            self.isPatron = (patron.status == .active)
-        }
+//        }
-        else
+//        else
-        {
+//        {
-            self.isPatron = false
+//            self.isPatron = false
-        }
+//        }
+        self.isPatron = true
     }
 }
 

AltStoreCore/Model/Source.swift

@@ -11,9 +11,9 @@ import CoreData
 public extension Source
 {
     #if ALPHA
-    static let altStoreIdentifier = "com.SideStore.SideStore"
+    static let altStoreIdentifier = Bundle.Info.appbundleIdentifier
     #else
-    static let altStoreIdentifier = "com.SideStore.SideStore"
+    static let altStoreIdentifier = Bundle.Info.appbundleIdentifier
     #endif
     
     #if STAGING

AltStoreCore/Model/StoreApp.swift

@@ -15,11 +15,11 @@ import AltSign
 public extension StoreApp
 {
     #if ALPHA
-    static let altstoreAppID = "com.SideStore.SideStore"
+    static let altstoreAppID = Bundle.Info.appbundleIdentifier
     #elseif BETA
-    static let altstoreAppID = "com.SideStore.SideStore"
+    static let altstoreAppID = Bundle.Info.appbundleIdentifier
     #else
-    static let altstoreAppID = "com.SideStore.SideStore"
+    static let altstoreAppID = Bundle.Info.appbundleIdentifier
     #endif
     
     static let dolphinAppID = "me.oatmealdome.dolphinios-njb"
@@ -103,22 +103,41 @@ public class StoreApp: NSManagedObject, Decodable, Fetchable
     
     @NSManaged public private(set) var developerName: String
     @NSManaged public private(set) var localizedDescription: String
-    @NSManaged public private(set) var size: Int32
+    @NSManaged @objc(size) internal var _size: Int32
     
     @NSManaged public private(set) var iconURL: URL
     @NSManaged public private(set) var screenshotURLs: [URL]
     
-    @NSManaged public var version: String
+    @NSManaged @objc(version) internal var _version: String
-    @NSManaged public private(set) var versionDate: Date
+    @NSManaged @objc(versionDate) internal var _versionDate: Date
-    @NSManaged public private(set) var versionDescription: String?
+    @NSManaged @objc(versionDescription) internal var _versionDescription: String?
     
-    @NSManaged public private(set) var downloadURL: URL
+    @NSManaged @objc(downloadURL) internal var _downloadURL: URL
     @NSManaged public private(set) var platformURLs: PlatformURLs?
 
     @NSManaged public private(set) var tintColor: UIColor?
     @NSManaged public private(set) var isBeta: Bool
     
-    @NSManaged public var sourceIdentifier: String?
+    @objc public internal(set) var sourceIdentifier: String? {
+        get {
+            self.willAccessValue(forKey: #keyPath(sourceIdentifier))
+            defer { self.didAccessValue(forKey: #keyPath(sourceIdentifier)) }
+            
+            let sourceIdentifier = self.primitiveSourceIdentifier
+            return sourceIdentifier
+        }
+        set {
+            self.willChangeValue(forKey: #keyPath(sourceIdentifier))
+            self.primitiveSourceIdentifier = newValue
+            self.didChangeValue(forKey: #keyPath(sourceIdentifier))
+            
+            for version in self.versions
+            {
+                version.sourceID = newValue
+            }
+        }
+    }
+    @NSManaged private var primitiveSourceIdentifier: String?
     
     @NSManaged public var sortIndex: Int32
     
@@ -129,6 +148,11 @@ public class StoreApp: NSManagedObject, Decodable, Fetchable
     @NSManaged @objc(source) public var _source: Source?
     @NSManaged @objc(permissions) public var _permissions: NSOrderedSet
     
+    @NSManaged public private(set) var latestVersion: AppVersion?
+    @NSManaged @objc(versions) public private(set) var _versions: NSOrderedSet
+    
+    @NSManaged public private(set) var loggedErrors: NSSet /* Set<LoggedError> */ // Use NSSet to avoid eagerly fetching values.
+    
     @nonobjc public var source: Source? {
         set {
             self._source = newValue
@@ -143,6 +167,35 @@ public class StoreApp: NSManagedObject, Decodable, Fetchable
         return self._permissions.array as! [AppPermission]
     }
     
+    @nonobjc public var versions: [AppVersion] {
+        return self._versions.array as! [AppVersion]
+    }
+    
+    @nonobjc public var size: Int64? {
+        guard let version = self.latestVersion else { return nil }
+        return version.size
+    }
+    
+    @nonobjc public var version: String? {
+        guard let version = self.latestVersion else { return nil }
+        return version.version
+    }
+    
+    @nonobjc public var versionDescription: String? {
+        guard let version = self.latestVersion else { return nil }
+        return version.localizedDescription
+    }
+    
+    @nonobjc public var versionDate: Date? {
+        guard let version = self.latestVersion else { return nil }
+        return version.date
+    }
+    
+    @nonobjc public var downloadURL: URL? {
+        guard let version = self.latestVersion else { return nil }
+        return version.downloadURL
+    }
+    
     private override init(entity: NSEntityDescription, insertInto context: NSManagedObjectContext?)
     {
         super.init(entity: entity, insertInto: context)
@@ -166,6 +219,7 @@ public class StoreApp: NSManagedObject, Decodable, Fetchable
         case permissions
         case size
         case isBeta = "beta"
+        case versions
     }
     
     public required init(from decoder: Decoder) throws
@@ -185,10 +239,6 @@ public class StoreApp: NSManagedObject, Decodable, Fetchable
             
             self.subtitle = try container.decodeIfPresent(String.self, forKey: .subtitle)
             
-            self.version = try container.decode(String.self, forKey: .version)
-            self.versionDate = try container.decode(Date.self, forKey: .versionDate)
-            self.versionDescription = try container.decodeIfPresent(String.self, forKey: .versionDescription)
-            
             self.iconURL = try container.decode(URL.self, forKey: .iconURL)
             self.screenshotURLs = try container.decodeIfPresent([URL].self, forKey: .screenshotURLs) ?? []
             
@@ -198,14 +248,14 @@ public class StoreApp: NSManagedObject, Decodable, Fetchable
                 self.platformURLs = platformURLs
                 // Backwards compatibility, use the fiirst (iOS will be first since sorted that way)
                 if let first = platformURLs.sorted().first {
-                    self.downloadURL = first.downloadURL
+                    self._downloadURL = first.downloadURL
                 } else {
                     throw DecodingError.dataCorruptedError(forKey: .platformURLs, in: container, debugDescription: "platformURLs has no entries")
 
                 }
                     
             } else if let downloadURL = downloadURL {
-                self.downloadURL = downloadURL
+                self._downloadURL = downloadURL
             } else {
                 throw DecodingError.dataCorruptedError(forKey: .downloadURL, in: container, debugDescription: "E downloadURL:String or downloadURLs:[[Platform:URL]] key required.")
             }
@@ -219,11 +269,40 @@ public class StoreApp: NSManagedObject, Decodable, Fetchable
                 self.tintColor = tintColor
             }
             
-            self.size = try container.decode(Int32.self, forKey: .size)
             self.isBeta = try container.decodeIfPresent(Bool.self, forKey: .isBeta) ?? false
             
             let permissions = try container.decodeIfPresent([AppPermission].self, forKey: .permissions) ?? []
             self._permissions = NSOrderedSet(array: permissions)
+            
+            if let versions = try container.decodeIfPresent([AppVersion].self, forKey: .versions)
+            {
+                //TODO: Throw error if there isn't at least one version.
+                
+                for version in versions
+                {
+                    version.appBundleID = self.bundleIdentifier
+                }
+                
+                self.setVersions(versions)
+            }
+            else
+            {
+                let version = try container.decode(String.self, forKey: .version)
+                let versionDate = try container.decode(Date.self, forKey: .versionDate)
+                let versionDescription = try container.decodeIfPresent(String.self, forKey: .versionDescription)
+                
+                let downloadURL = try container.decode(URL.self, forKey: .downloadURL)
+                let size = try container.decode(Int32.self, forKey: .size)
+                
+                let appVersion = AppVersion.makeAppVersion(version: version,
+                                                           date: versionDate,
+                                                           localizedDescription: versionDescription,
+                                                           downloadURL: downloadURL,
+                                                           size: Int64(size),
+                                                           appBundleID: self.bundleIdentifier,
+                                                           in: context)
+                self.setVersions([appVersion])
+            }
         }
         catch
         {
@@ -237,6 +316,24 @@ public class StoreApp: NSManagedObject, Decodable, Fetchable
     }
 }
 
+private extension StoreApp
+{
+    func setVersions(_ versions: [AppVersion])
+    {
+        guard let latestVersion = versions.first else { preconditionFailure("StoreApp must have at least one AppVersion.") }
+        
+        self.latestVersion = latestVersion
+        self._versions = NSOrderedSet(array: versions)
+        
+        // Preserve backwards compatibility by assigning legacy property values.
+        self._version = latestVersion.version
+        self._versionDate = latestVersion.date
+        self._versionDescription = latestVersion.localizedDescription
+        self._downloadURL = latestVersion.downloadURL
+        self._size = Int32(latestVersion.size)
+    }
+}
+
 public extension StoreApp
 {
     @nonobjc class func fetchRequest() -> NSFetchRequest<StoreApp>
@@ -253,9 +350,18 @@ public extension StoreApp
         app.localizedDescription = "SideStore is an alternative App Store."
         app.iconURL = URL(string: "https://user-images.githubusercontent.com/705880/63392210-540c5980-c37b-11e9-968c-8742fc68ab2e.png")!
         app.screenshotURLs = []
-        app.version = "1.0"
+        app.sourceIdentifier = Source.altStoreIdentifier
-        app.versionDate = Date()
+        
-        app.downloadURL = URL(string: "http://rileytestut.com")!
+        let appVersion = AppVersion.makeAppVersion(version: "0.3.0",
+                                                   date: Date(),
+                                                   downloadURL: URL(string: "http://rileytestut.com")!,
+                                                   size: 0,
+                                                   appBundleID: app.bundleIdentifier,
+                                                   sourceID: Source.altStoreIdentifier,
+                                                   in: context)
+        app.setVersions([appVersion])
+        
+        print("makeAltStoreApp StoreApp: \(String(describing: app))")
         
         #if BETA
         app.isBeta = true

AltStoreCore/Patreon/PatreonAPI.swift

@@ -271,7 +271,7 @@ public extension PatreonAPI
                 if let context = account.managedObjectContext, !account.isPatron
                 {
                     // Deactivate all beta apps now that we're no longer a patron.
-                    self.deactivateBetaApps(in: context)
+                    //self.deactivateBetaApps(in: context)
                 }
                 
                 try account.managedObjectContext?.save()

AltStoreCore/Protocols/AppProtocol.swift

@@ -13,16 +13,16 @@ public protocol AppProtocol
 {
     var name: String { get }
     var bundleIdentifier: String { get }
-    var url: URL { get }
+    var url: URL? { get }
 }
 
 public struct AnyApp: AppProtocol
 {
     public var name: String
     public var bundleIdentifier: String
-    public var url: URL
+    public var url: URL?
     
-    public init(name: String, bundleIdentifier: String, url: URL)
+    public init(name: String, bundleIdentifier: String, url: URL?)
     {
         self.name = name
         self.bundleIdentifier = bundleIdentifier
@@ -32,21 +32,21 @@ public struct AnyApp: AppProtocol
 
 extension ALTApplication: AppProtocol
 {
-    public var url: URL {
+    public var url: URL? {
         return self.fileURL
     }
 }
 
 extension StoreApp: AppProtocol
 {
-    public var url: URL {
+    public var url: URL? {
         return self.downloadURL
     }
 }
 
 extension InstalledApp: AppProtocol
 {
-    public var url: URL {
+    public var url: URL? {
         return self.fileURL
     }
 }

AltStoreCore/Resources/Colors.xcassets/Primary.colorset/Contents.json

@@ -5,9 +5,9 @@
         "color-space" : "srgb",
         "components" : {
           "alpha" : "1.000",
-          "blue" : "255",
+          "blue" : "250",
-          "green" : "67",
+          "green" : "5",
-          "red" : "128"
+          "red" : "164"
         }
       },
       "idiom" : "universal"

AltStoreCore/Types/ALTAppPermission.h

@@ -10,5 +10,19 @@
 
 typedef NSString *ALTAppPermissionType NS_TYPED_EXTENSIBLE_ENUM;
 extern ALTAppPermissionType const ALTAppPermissionTypePhotos;
+extern ALTAppPermissionType const ALTAppPermissionTypeCamera;
+extern ALTAppPermissionType const ALTAppPermissionTypeLocation;
+extern ALTAppPermissionType const ALTAppPermissionTypeContacts;
+extern ALTAppPermissionType const ALTAppPermissionTypeReminders;
+extern ALTAppPermissionType const ALTAppPermissionTypeAppleMusic;
+extern ALTAppPermissionType const ALTAppPermissionTypeMicrophone;
+extern ALTAppPermissionType const ALTAppPermissionTypeSpeechRecognition;
 extern ALTAppPermissionType const ALTAppPermissionTypeBackgroundAudio;
 extern ALTAppPermissionType const ALTAppPermissionTypeBackgroundFetch;
+extern ALTAppPermissionType const ALTAppPermissionTypeBluetooth;
+extern ALTAppPermissionType const ALTAppPermissionTypeNetwork;
+extern ALTAppPermissionType const ALTAppPermissionTypeCalendars;
+extern ALTAppPermissionType const ALTAppPermissionTypeTouchID;
+extern ALTAppPermissionType const ALTAppPermissionTypeFaceID;
+extern ALTAppPermissionType const ALTAppPermissionTypeSiri;
+extern ALTAppPermissionType const ALTAppPermissionTypeMotion;